Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0814(Antioxidative peptide)

DFBP ID	DFBPANOX0814
Peptide sequence	ALT
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ala-Leu-Thr

Single-letter amino acid

ALT

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	303.35 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.6333^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.3: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic Source.4: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.5: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.6: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.7: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.8: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.9: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.10: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.11: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.12: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2 Source.13: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.14: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.15: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.16: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.17: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.18: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.19: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8 Source.20: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10 Source.21: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.22: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.23: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.24: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.25: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.26: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.27: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.28: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.29: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.30: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.31: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.32: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.33: DFBPPR1041 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 1 Source.34: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8 Source.35: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1 Source.36: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.37: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.38: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.39: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.40: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.41: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.42: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.43: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4 Source.44: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.45: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic Source.46: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.47: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic Source.48: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.49: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.50: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.51: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.52: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.53: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3 Source.54: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.55: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.56: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.57: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.58: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.59: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.60: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.61: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.62: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.63: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.64: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.65: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.66: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.67: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.68: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.69: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.70: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.71: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.72: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.73: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.74: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3 Source.75: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.76: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.77: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.78: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.79: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.80: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.81: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.82: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.83: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.84: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2 Source.85: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.86: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.87: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.88: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.89: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.90: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.91: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.92: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.93: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.94: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.95: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.96: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.97: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.98: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.99: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.100: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.101: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.102: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.103: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.104: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial Source.105: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.106: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.107: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.108: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1 Source.109: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B Source.110: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.111: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.112: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.113: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.114: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.115: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.116: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic Source.117: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.118: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.119: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.120: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.121: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.122: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.123: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.124: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.125: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.126: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3 Source.127: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.128: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.129: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.130: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.131: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.132: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.133: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.134: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.135: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.136: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.137: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8 Source.138: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.139: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.140: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.141: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8 Source.142: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.143: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.144: DFBPPR1932 ---- Plant proteins ---- Inactive casein kinase II subunit alpha-2 Source.145: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.146: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.147: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.148: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.149: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B Source.150: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.151: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.152: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.153: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.154: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.155: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2 Source.156: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.157: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.158: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.159: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.160: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.161: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.162: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic Source.163: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.164: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.165: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.166: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.167: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.168: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.169: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.170: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.171: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.172: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.173: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.174: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.175: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.176: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.177: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12 Source.178: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.179: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.180: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2 Source.181: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.182: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.183: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A Source.184: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.185: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.186: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.187: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.188: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.189: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.190: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.191: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.192: DFBPPR2184 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.193: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.194: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.195: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.196: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.197: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16 Source.198: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.199: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.200: DFBPPR2223 ---- Plant proteins ---- Urease Source.201: DFBPPR2230 ---- Plant proteins ---- Proteasome subunit alpha type-2 Source.202: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.203: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76 Source.204: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.205: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.206: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.207: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6 Source.208: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.209: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.210: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.211: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.212: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.213: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.214: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.215: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.216: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.217: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.218: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.219: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.220: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.221: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.222: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.223: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.224: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.225: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.226: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.227: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.228: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.229: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.230: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.231: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.232: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.233: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.234: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.235: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.236: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.237: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2 Source.238: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.239: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.240: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.241: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic Source.242: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.243: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.244: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.245: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.246: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.247: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.248: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.249: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic Source.250: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.251: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.252: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a Source.253: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.254: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.255: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.256: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.257: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.258: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.259: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.260: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6 Source.261: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.262: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.263: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.264: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.265: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.266: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.267: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.268: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A Source.269: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.270: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.271: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.272: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.273: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.274: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.275: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.276: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.277: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.278: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.279: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.280: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.281: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2 Source.282: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.283: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.284: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.285: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.286: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.287: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.288: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.289: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.290: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.291: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.292: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.293: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic Source.294: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.295: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.296: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.297: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.298: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.299: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.300: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.301: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.302: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.303: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.304: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.305: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.306: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.307: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.308: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.309: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.310: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.311: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.312: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.313: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.314: DFBPPR3143 ---- Plant proteins ---- Protein OS-9 homolog Source.315: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.316: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2 Source.317: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15 Source.318: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.319: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.320: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.321: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.322: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.323: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.324: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.325: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic Source.326: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.327: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.328: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.329: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.330: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.331: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.332: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b Source.333: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9 Source.334: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1 Source.335: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.336: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.337: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.338: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.339: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19 Source.340: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.341: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.342: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.343: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.344: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3 Source.345: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1 Source.346: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15 Source.347: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2 Source.348: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.349: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.350: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.351: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.352: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.353: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.354: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8 Source.355: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.356: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9 Source.357: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.358: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4 Source.359: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6 Source.360: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.361: DFBPPR3506 ---- Plant proteins ---- Growth-regulating factor 12 Source.362: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1 Source.363: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.364: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.365: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.366: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.367: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.368: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.369: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.370: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.371: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic Source.372: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.373: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.374: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.375: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.376: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.377: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.378: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.379: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.380: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.381: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.382: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7 Source.383: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23 Source.384: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.385: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.386: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.387: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.388: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.389: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.390: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1 Source.391: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.392: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6 Source.393: DFBPPR3764 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6 Source.394: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1 Source.395: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3 Source.396: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2 Source.397: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2 Source.398: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5 Source.399: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2 Source.400: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77 Source.401: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1 Source.402: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42 Source.403: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.404: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.405: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.406: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39 Source.407: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54 Source.408: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78 Source.409: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1 Source.410: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10 Source.411: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.412: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.413: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.414: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.415: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.416: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.417: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.418: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.419: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.420: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.421: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.422: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.423: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.424: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.425: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.426: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.427: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.428: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.429: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.430: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27 Source.431: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.432: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.433: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.434: DFBPPR4068 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 6 Source.435: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4 Source.436: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.437: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.438: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.439: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.440: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.441: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.442: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.443: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.444: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.445: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43 Source.446: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.447: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4 Source.448: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.449: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74 Source.450: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.451: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2 Source.452: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.453: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.454: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.455: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.456: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.457: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.458: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.459: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.460: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.461: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.462: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.463: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.464: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.465: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.466: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.467: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.468: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1 Source.469: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.470: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.471: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1 Source.472: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.473: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.474: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.475: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.476: DFBPPR4320 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.477: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.478: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11 Source.479: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3 Source.480: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2 Source.481: DFBPPR4398 ---- Plant proteins ---- 40S ribosomal protein S16 Source.482: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8 Source.483: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.484: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.485: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.486: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.487: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.488: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.489: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.490: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.491: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.492: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.493: DFBPPR4496 ---- Plant proteins ---- Transcription elongation factor 1 homolog Source.494: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2 Source.495: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.496: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.497: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.498: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.499: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.500: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.501: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9 Source.502: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.503: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.504: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11 Source.505: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.506: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1 Source.507: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9 Source.508: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.509: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.510: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.511: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400 Source.512: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.513: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.514: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.515: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.516: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.517: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.518: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.519: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic Source.520: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d Source.521: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.522: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.523: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.524: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.525: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.526: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.527: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.528: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.529: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.530: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.531: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase Source.532: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.533: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.534: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.535: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.536: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic Source.537: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.538: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.539: DFBPPR5121 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.540: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.541: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.542: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.543: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase Source.544: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.545: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.546: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.547: DFBPPR5196 ---- Plant proteins ---- Arginase Source.548: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.549: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.550: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.551: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.552: DFBPPR5347 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.553: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.554: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.555: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.556: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.557: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.558: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.559: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.560: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.561: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.562: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.563: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.564: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.565: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1 Source.566: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.567: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha Source.568: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.569: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.570: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.571: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II Source.572: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.573: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.574: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.575: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.576: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.577: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.578: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.579: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.580: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.581: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.582: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.583: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.584: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.585: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.586: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.587: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.588: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.589: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.590: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.591: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.592: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.593: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.594: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.595: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.596: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17 Source.597: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.598: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.599: DFBPPR5777 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.600: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.601: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.602: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a Source.603: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.604: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic Source.605: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2 Source.606: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.607: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.608: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4 Source.609: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16 Source.610: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.611: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.612: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.613: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.614: DFBPPR5954 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.615: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2 Source.616: DFBPPR5967 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6 Source.617: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.618: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1 Source.619: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.620: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2 Source.621: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.622: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2 Source.623: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.624: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4 Source.625: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1 Source.626: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1 Source.627: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.628: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.629: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2 Source.630: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1 Source.631: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1 Source.632: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30 Source.633: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99 Source.634: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1 Source.635: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20 Source.636: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11 Source.637: DFBPPR6101 ---- Plant proteins ---- Zein-alpha M6 Source.638: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.639: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4 Source.640: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.641: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.642: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49 Source.643: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.644: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.645: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA Source.646: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34 Source.647: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.648: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.649: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.650: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.651: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.652: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.653: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.654: DFBPPR6262 ---- Plant proteins ---- Nodule lectin Source.655: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.656: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.657: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.658: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.659: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.660: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.661: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5 Source.662: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.663: DFBPPR6351 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.664: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.665: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.666: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.667: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial Source.668: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.669: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.670: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.671: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.672: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.673: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.674: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.675: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin Source.676: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28 Source.677: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.678: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.679: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic Source.680: DFBPPR6656 ---- Plant proteins ---- Catalase Source.681: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2 Source.682: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.683: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.684: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5 Source.685: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10 Source.686: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.687: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.688: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.689: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.690: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.691: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.692: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.693: DFBPPR6771 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.694: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.695: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.696: DFBPPR6792 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6 Source.697: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.698: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10 Source.699: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.700: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.701: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1 Source.702: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.703: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.704: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12 Source.705: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212 Source.706: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.707: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5 Source.708: DFBPPR6958 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.709: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4 Source.710: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11 Source.711: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2 Source.712: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3 Source.713: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.714: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.715: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.716: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.717: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.718: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.719: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.720: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.721: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.722: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.723: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.724: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.725: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.726: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.727: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.728: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.729: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.730: DFBPPR7152 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.731: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2 Source.732: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic Source.733: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.734: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.735: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.736: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.737: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.738: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.739: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.740: DFBPPR7256 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6 Source.741: DFBPPR7327 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.742: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor Source.743: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4 Source.744: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.745: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.746: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.747: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.748: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a Source.749: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.750: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.751: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.752: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.753: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.754: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II Source.755: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.756: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.757: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.758: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.759: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2 Source.760: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.761: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.762: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.763: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.764: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.765: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.766: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein Source.767: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.768: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.769: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.770: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.771: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.772: DFBPPR7663 ---- Milk proteins ---- Kappa-casein Source.773: DFBPPR7673 ---- Milk proteins ---- Kappa-casein Source.774: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.775: DFBPPR7695 ---- Milk proteins ---- Kappa-casein Source.776: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein Source.777: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.778: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.779: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.780: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.781: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1 Source.782: DFBPPR8425 ---- Plant proteins ---- Oleosin L Source.783: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.784: DFBPPR8429 ---- Plant proteins ---- Oleosin H2 Source.785: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.786: DFBPPR8458 ---- Plant proteins ---- Catalase Source.787: DFBPPR8478 ---- Plant proteins ---- 50S ribosomal protein L12-1, chloroplastic Source.788: DFBPPR8479 ---- Plant proteins ---- 50S ribosomal protein L12-2, chloroplastic Source.789: DFBPPR8492 ---- Milk proteins ---- Kappa-casein Source.790: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.791: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.792: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.793: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.794: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein Source.795: DFBPPR8523 ---- Milk proteins ---- Perilipin-2 Source.796: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.797: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.798: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.799: DFBPPR15967 ---- Animal proteins ---- Interleukin-4 Source.800: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.801: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.802: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.803: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.804: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.805: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.806: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.807: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.808: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.809: DFBPPR16024 ---- Animal proteins ---- Podocalyxin Source.810: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.811: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.812: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.813: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.814: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.815: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog Source.816: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.817: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.818: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.819: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.820: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.821: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.822: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.823: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.824: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.825: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.826: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.827: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.828: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.829: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.830: DFBPPR16194 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.831: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.832: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.833: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.834: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.835: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type Source.836: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.837: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein Source.838: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.839: DFBPPR16244 ---- Animal proteins ---- Interleukin-2 Source.840: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha Source.841: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.842: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.843: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha Source.844: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.845: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41 Source.846: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.847: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.848: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.849: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.850: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.851: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.852: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.853: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.854: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.855: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.856: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.857: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.858: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.859: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.860: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator Source.861: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.862: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.863: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.864: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.865: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83 Source.866: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.867: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.868: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan Source.869: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.870: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.871: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.872: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B Source.873: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.874: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.875: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.876: DFBPPR16638 ---- Animal proteins ---- Synapsin-1 Source.877: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.878: DFBPPR16674 ---- Animal proteins ---- Double-headed protease inhibitor, submandibular gland Source.879: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.880: DFBPPR16716 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.881: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1 Source.882: DFBPPR16746 ---- Animal proteins ---- Tektin-1 Source.883: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.884: DFBPPR16753 ---- Animal proteins ---- Nicolin-1 Source.885: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.886: DFBPPR16772 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.887: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.888: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.889: DFBPPR16797 ---- Animal proteins ---- Albumin Source.890: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.891: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.892: DFBPPR16829 ---- Animal proteins ---- Fibroblast growth factor 1 Source.893: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.894: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein Source.895: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.896: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.897: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.898: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.899: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.900: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.901: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.902: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.903: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.904: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.905: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.906: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A Source.907: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.908: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin Source.909: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.910: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.911: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1 Source.912: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5 Source.913: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.914: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.915: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.916: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.917: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.918: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.919: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.920: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.921: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.922: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.923: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.924: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.925: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog Source.926: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.927: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.928: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.929: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.930: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.931: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2 Source.932: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.933: DFBPPR17132 ---- Animal proteins ---- Apolipoprotein A-II Source.934: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.935: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.936: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.937: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.938: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.939: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1 Source.940: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.941: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.942: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1 Source.943: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.944: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.945: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR Source.946: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.947: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2 Source.948: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B Source.949: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.950: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.951: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.952: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.953: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.954: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.955: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.956: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.957: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.958: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.959: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2 Source.960: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.961: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.962: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.963: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.964: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6 Source.965: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.966: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.967: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4 Source.968: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1 Source.969: DFBPPR17401 ---- Animal proteins ---- Moesin Source.970: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.971: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.972: DFBPPR17423 ---- Animal proteins ---- Furin Source.973: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.974: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.975: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.976: DFBPPR17468 ---- Animal proteins ---- Hemoglobin subunit alpha Source.977: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.978: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.979: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.980: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.981: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase Source.982: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.983: DFBPPR17529 ---- Animal proteins ---- C-type lectin domain family 7 member A Source.984: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.985: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.986: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.987: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.988: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.989: DFBPPR17594 ---- Animal proteins ---- E-selectin Source.990: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.991: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.992: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.993: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16 Source.994: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase Source.995: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.996: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.997: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.998: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.999: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1000: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.1001: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.1002: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1003: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1004: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1 Source.1005: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.1006: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b Source.1007: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.1008: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.1009: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B Source.1010: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.1011: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.1012: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor Source.1013: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1014: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.1015: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1016: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase Source.1017: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9 Source.1018: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.1019: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.1020: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.1021: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.1022: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38 Source.1023: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1024: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.1025: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.1026: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1027: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1028: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.1029: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.1030: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1031: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.1032: DFBPPR18011 ---- Animal proteins ---- Afamin Source.1033: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1034: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1035: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.1036: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1037: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3 Source.1038: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.1039: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1040: DFBPPR18146 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 9 Source.1041: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.1042: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.1043: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.1044: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1045: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.1046: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.1047: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1048: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1049: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.1050: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1051: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.1052: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.1053: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.1054: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.1055: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.1056: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.1057: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.1058: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1 Source.1059: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial Source.1060: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.1061: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.1062: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.1063: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog Source.1064: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1065: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1066: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.1067: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase Source.1068: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1069: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.1070: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.1071: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.1072: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos Source.1073: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.1074: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1075: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1076: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16 Source.1077: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.1078: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.1079: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.1080: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.1081: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.1082: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.1083: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.1084: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.1085: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.1086: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.1087: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.1088: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.1089: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.1090: DFBPPR18568 ---- Animal proteins ---- Cdc42 effector protein 2 Source.1091: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1092: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1093: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.1094: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase Source.1095: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.1096: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.1097: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1098: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha Source.1099: DFBPPR18622 ---- Animal proteins ---- CYFIP-related Rac1 interactor B Source.1100: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.1101: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.1102: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase Source.1103: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.1104: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1105: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3 Source.1106: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1107: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4 Source.1108: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2 Source.1109: DFBPPR18727 ---- Animal proteins ---- Interleukin-2 Source.1110: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.1111: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.1112: DFBPPR18746 ---- Animal proteins ---- Anamorsin Source.1113: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A Source.1114: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1115: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.1116: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1117: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU Source.1118: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.1119: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.1120: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.1121: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type Source.1122: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.1123: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma Source.1124: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1125: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3 Source.1126: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.1127: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.1128: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.1129: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1130: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1131: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1 Source.1132: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1133: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.1134: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.1135: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.1136: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.1137: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.1138: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.1139: DFBPPR18904 ---- Animal proteins ---- Protein KASH5 Source.1140: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.1141: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.1142: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.1143: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1144: DFBPPR18931 ---- Animal proteins ---- Ficolin-2 Source.1145: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.1146: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.1147: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.1148: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1149: DFBPPR18958 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein Source.1150: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.1151: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb Source.1152: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.1153: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.1154: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1 Source.1155: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.1156: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.1157: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.1158: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.1159: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic Source.1160: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.1161: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.1162: DFBPPR19078 ---- Animal proteins ---- Cystatin-B Source.1163: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1 Source.1164: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.1165: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1166: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.1167: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.1168: DFBPPR19124 ---- Animal proteins ---- Neuroguidin Source.1169: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein Source.1170: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.1171: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1172: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin Source.1173: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1174: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4 Source.1175: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.1176: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.1177: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4 Source.1178: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.1179: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1180: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.1181: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1182: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.1183: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.1184: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.1185: DFBPPR19291 ---- Animal proteins ---- Multicilin Source.1186: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.1187: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.1188: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.1189: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.1190: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.1191: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1192: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.1193: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1194: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.1195: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.1196: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1197: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial Source.1198: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2 Source.1199: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1200: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.1201: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.1202: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1203: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1204: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1205: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.1206: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.1207: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1 Source.1208: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1209: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.1210: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K Source.1211: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1212: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.1213: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.1214: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1215: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1216: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1217: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog Source.1218: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein Source.1219: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.1220: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.1221: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1222: DFBPPR19664 ---- Animal proteins ---- Protein OS-9 Source.1223: DFBPPR19668 ---- Animal proteins ---- Calicin Source.1224: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1225: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1 Source.1226: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.1227: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1228: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7 Source.1229: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1 Source.1230: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.1231: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1232: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.1233: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase Source.1234: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.1235: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1 Source.1236: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.1237: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1238: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog Source.1239: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein Source.1240: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein Source.1241: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.1242: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.1243: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.1244: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.1245: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1246: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.1247: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1248: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.1249: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.1250: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.1251: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.1252: DFBPPR19929 ---- Animal proteins ---- Ermin Source.1253: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.1254: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.1255: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial Source.1256: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.1257: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1258: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.1259: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2 Source.1260: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12 Source.1261: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.1262: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7 Source.1263: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.1264: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1265: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.1266: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.1267: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.1268: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.1269: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.1270: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.1271: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.1272: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2 Source.1273: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1 Source.1274: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.1275: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4 Source.1276: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.1277: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.1278: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23 Source.1279: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.1280: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.1281: DFBPPR20164 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 2 Source.1282: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.1283: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.1284: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1285: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1286: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.1287: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase Source.1288: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1289: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53 Source.1290: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase Source.1291: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN Source.1292: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.1293: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.1294: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV Source.1295: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2 Source.1296: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.1297: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1298: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.1299: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.1300: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.1301: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.1302: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.1303: DFBPPR20396 ---- Animal proteins ---- Claudin-5 Source.1304: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1305: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial Source.1306: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.1307: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.1308: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.1309: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4 Source.1310: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.1311: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.1312: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.1313: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.1314: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.1315: DFBPPR20510 ---- Animal proteins ---- Josephin-1 Source.1316: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.1317: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.1318: DFBPPR20538 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.1319: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.1320: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.1321: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.1322: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein Source.1323: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.1324: DFBPPR20585 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 3 Source.1325: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.1326: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A Source.1327: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1328: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.1329: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.1330: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.1331: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.1332: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.1333: DFBPPR20659 ---- Animal proteins ---- Cystinosin Source.1334: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1335: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1336: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.1337: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.1338: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.1339: DFBPPR20679 ---- Animal proteins ---- Ragulator complex protein LAMTOR4 Source.1340: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.1341: DFBPPR20683 ---- Animal proteins ---- Kinetochore protein Spc25 Source.1342: DFBPPR20692 ---- Animal proteins ---- ELMO domain-containing protein 3 Source.1343: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.1344: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.1345: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like Source.1346: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.1347: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.1348: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.1349: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6 Source.1350: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog Source.1351: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5 Source.1352: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1 Source.1353: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B Source.1354: DFBPPR20769 ---- Animal proteins ---- Coiled-coil domain-containing protein 69 Source.1355: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.1356: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17 Source.1357: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Source.1358: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.1359: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.1360: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.1361: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog Source.1362: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.1363: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.1364: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135 Source.1365: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C Source.1366: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.1367: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator Source.1368: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2 Source.1369: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1370: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.1371: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial Source.1372: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.1373: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17 Source.1374: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.1375: DFBPPR20982 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.1376: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1377: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2 Source.1378: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial Source.1379: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.1380: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.1381: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.1382: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2 Source.1383: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor Source.1384: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.1385: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.1386: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.1387: DFBPPR21040 ---- Animal proteins ---- Neuritin Source.1388: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.1389: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.1390: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D Source.1391: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial Source.1392: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.1393: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.1394: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.1395: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.1396: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.1397: DFBPPR21128 ---- Animal proteins ---- Stefin-C Source.1398: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.1399: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.1400: DFBPPR21155 ---- Animal proteins ---- Cyclin-H Source.1401: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.1402: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.1403: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H Source.1404: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.1405: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A Source.1406: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1 Source.1407: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3 Source.1408: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.1409: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial Source.1410: DFBPPR21254 ---- Animal proteins ---- Zinc finger protein 567 Source.1411: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.1412: DFBPPR21274 ---- Animal proteins ---- 39S ribosomal protein L48, mitochondrial Source.1413: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.1414: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.1415: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58 Source.1416: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.1417: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.1418: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2 Source.1419: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial Source.1420: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1421: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.1422: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.1423: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4 Source.1424: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1425: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.1426: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.1427: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.1428: DFBPPR21381 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A-related protein, mitochondrial Source.1429: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.1430: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4 Source.1431: DFBPPR21394 ---- Animal proteins ---- Elongin-C Source.1432: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1433: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B Source.1434: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.1435: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.1436: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.1437: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.1438: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1 Source.1439: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1440: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40 Source.1441: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A Source.1442: DFBPPR21542 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6c Source.1443: DFBPPR21548 ---- Animal proteins ---- Cornifelin Source.1444: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39 Source.1445: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3 Source.1446: DFBPPR21579 ---- Animal proteins ---- Protein phosphatase inhibitor 2 Source.1447: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1448: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10 Source.1449: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.1450: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.1451: DFBPPR21604 ---- Animal proteins ---- Zinc finger protein 345 Source.1452: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.1453: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.1454: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1 Source.1455: DFBPPR21630 ---- Animal proteins ---- Maspardin Source.1456: DFBPPR21669 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 3 Source.1457: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog Source.1458: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11 Source.1459: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.1460: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2 Source.1461: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.1462: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.1463: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1464: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.1465: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1466: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.1467: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.1468: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.1469: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526 Source.1470: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier Source.1471: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.1472: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B Source.1473: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2 Source.1474: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17 Source.1475: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1 Source.1476: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2 Source.1477: DFBPPR21864 ---- Animal proteins ---- Arpin Source.1478: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.1479: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.1480: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9 Source.1481: DFBPPR21902 ---- Animal proteins ---- Centromere protein N Source.1482: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.1483: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12 Source.1484: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14 Source.1485: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.1486: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28 Source.1487: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1488: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7 Source.1489: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.1490: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.1491: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.1492: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.1493: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A Source.1494: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.1495: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1 Source.1496: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.1497: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.1498: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1 Source.1499: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.1500: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.1501: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.1502: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.1503: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106 Source.1504: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.1505: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial Source.1506: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8 Source.1507: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2 Source.1508: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1509: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.1510: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.1511: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.1512: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1513: DFBPPR22254 ---- Animal proteins ---- BLOC-1-related complex subunit 7 Source.1514: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.1515: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B Source.1516: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9 Source.1517: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1 Source.1518: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.1519: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3 Source.1520: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2 Source.1521: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.1522: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.1523: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23 Source.1524: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4 Source.1525: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.1526: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.1527: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.1528: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.1529: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149 Source.1530: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2 Source.1531: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13 Source.1532: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.1533: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144 Source.1534: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3 Source.1535: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.1536: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog Source.1537: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.1538: DFBPPR22532 ---- Animal proteins ---- Cilia- and flagella-associated protein 299 Source.1539: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A Source.1540: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A Source.1541: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2 Source.1542: DFBPPR22599 ---- Animal proteins ---- Tetratricopeptide repeat protein 9C Source.1543: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.1544: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61 Source.1545: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270 Source.1546: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.1547: DFBPPR22655 ---- Animal proteins ---- Coiled-coil domain-containing protein 190 Source.1548: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C Source.1549: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.1550: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.1551: DFBPPR22693 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1 Source.1552: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D Source.1553: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.1554: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog Source.1555: DFBPPR22734 ---- Animal proteins ---- Uncharacterized protein C1orf226 homolog Source.1556: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog Source.1557: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.1558: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1559: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1560: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.1561: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.1562: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1563: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.1564: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.1565: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.1566: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.1567: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.1568: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.1569: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.1570: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.1571: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.1572: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.1573: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.1574: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog Source.1575: DFBPPR8659 ---- Animal proteins ---- Fibroblast growth factor 1 Source.1576: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1577: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.1578: DFBPPR8668 ---- Animal proteins ---- Annexin A1 Source.1579: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.1580: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.1581: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.1582: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1583: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.1584: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1585: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C Source.1586: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1587: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1588: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1589: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.1590: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha Source.1591: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1592: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.1593: DFBPPR8733 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial Source.1594: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.1595: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.1596: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.1597: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.1598: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.1599: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1600: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.1601: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.1602: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1603: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1604: DFBPPR8831 ---- Animal proteins ---- Interferon regulatory factor 1 Source.1605: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5 Source.1606: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.1607: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.1608: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.1609: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.1610: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.1611: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.1612: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.1613: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1614: DFBPPR8968 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin Source.1615: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1616: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1617: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.1618: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1619: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.1620: DFBPPR9033 ---- Animal proteins ---- Interleukin-2 Source.1621: DFBPPR9044 ---- Animal proteins ---- Albumin Source.1622: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.1623: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.1624: DFBPPR9063 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1625: DFBPPR9065 ---- Animal proteins ---- GTPase NRas Source.1626: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.1627: DFBPPR9069 ---- Animal proteins ---- E-selectin Source.1628: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1629: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.1630: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.1631: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1632: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1633: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6 Source.1634: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.1635: DFBPPR9128 ---- Animal proteins ---- Interleukin-13 Source.1636: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1637: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1638: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1639: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3 Source.1640: DFBPPR9174 ---- Animal proteins ---- Ficolin-1 Source.1641: DFBPPR9179 ---- Animal proteins ---- Hemoglobin subunit alpha Source.1642: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1643: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1644: DFBPPR9226 ---- Animal proteins ---- Protein GPR15L Source.1645: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.1646: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.1647: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1648: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1 Source.1649: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2 Source.1650: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.1651: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.1652: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1653: DFBPPR9324 ---- Animal proteins ---- Carbohydrate-binding protein AQN-3 Source.1654: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.1655: DFBPPR9345 ---- Animal proteins ---- Relaxin-3 Source.1656: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.1657: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.1658: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.1659: DFBPPR9363 ---- Animal proteins ---- Moesin Source.1660: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1661: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.1662: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.1663: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34 Source.1664: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.1665: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type Source.1666: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1667: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.1668: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.1669: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.1670: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2 Source.1671: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein Source.1672: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1673: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase Source.1674: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.1675: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1676: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform Source.1677: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.1678: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1679: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1680: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.1681: DFBPPR9664 ---- Animal proteins ---- Perilipin-2 Source.1682: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2 Source.1683: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor Source.1684: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1685: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.1686: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.1687: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.1688: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain Source.1689: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1690: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain Source.1691: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain Source.1692: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.1693: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide Source.1694: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.1695: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8 Source.1696: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8 Source.1697: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.1698: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.1699: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1700: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.1701: DFBPPR9850 ---- Animal proteins ---- Retinol-binding protein 2 Source.1702: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17 Source.1703: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.1704: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1705: DFBPPR9945 ---- Animal proteins ---- Ubiquitin-like protein FUBI Source.1706: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1707: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.1708: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.1709: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.1710: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1711: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.1712: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1713: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.1714: DFBPPR10054 ---- Animal proteins ---- Kit ligand Source.1715: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein Source.1716: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1717: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog Source.1718: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.1719: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.1720: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1721: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor Source.1722: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.1723: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7 Source.1724: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.1725: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.1726: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.1727: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1728: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.1729: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.1730: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.1731: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT Source.1732: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.1733: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.1734: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.1735: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.1736: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.1737: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1738: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4 Source.1739: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.1740: DFBPPR10222 ---- Animal proteins ---- Podocalyxin Source.1741: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.1742: DFBPPR10226 ---- Animal proteins ---- GTPase HRas Source.1743: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2 Source.1744: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.1745: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.1746: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain Source.1747: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein Source.1748: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.1749: DFBPPR10264 ---- Animal proteins ---- Fibroblast growth factor 1 Source.1750: DFBPPR10270 ---- Animal proteins ---- Agrin Source.1751: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.1752: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.1753: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1754: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1755: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.1756: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.1757: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.1758: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1759: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein Source.1760: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.1761: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.1762: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.1763: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A Source.1764: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.1765: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.1766: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.1767: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.1768: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.1769: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.1770: DFBPPR10400 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.1771: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1772: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.1773: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.1774: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1775: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.1776: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.1777: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.1778: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.1779: DFBPPR10452 ---- Animal proteins ---- Desmin Source.1780: DFBPPR10453 ---- Animal proteins ---- Neurotrophin-3 Source.1781: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.1782: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.1783: DFBPPR10459 ---- Animal proteins ---- Reelin Source.1784: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.1785: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.1786: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1787: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1788: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.1789: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.1790: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.1791: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.1792: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros Source.1793: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1794: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1795: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.1796: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog Source.1797: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.1798: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3 Source.1799: DFBPPR10549 ---- Animal proteins ---- Interferon type B Source.1800: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.1801: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1802: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.1803: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.1804: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.1805: DFBPPR10570 ---- Animal proteins ---- Protein atonal homolog 7 Source.1806: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.1807: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.1808: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.1809: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.1810: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.1811: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D Source.1812: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.1813: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.1814: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.1815: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.1816: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.1817: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.1818: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1819: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi Source.1820: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.1821: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a Source.1822: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1823: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1824: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.1825: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.1826: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.1827: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1828: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9 Source.1829: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.1830: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.1831: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.1832: DFBPPR10780 ---- Animal proteins ---- Caspase-2 Source.1833: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C Source.1834: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.1835: DFBPPR10787 ---- Animal proteins ---- Angiogenin Source.1836: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.1837: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.1838: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1839: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.1840: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.1841: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1842: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.1843: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.1844: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1 Source.1845: DFBPPR10837 ---- Animal proteins ---- GTPase NRas Source.1846: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2 Source.1847: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.1848: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.1849: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.1850: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.1851: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.1852: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.1853: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.1854: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.1855: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.1856: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha Source.1857: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.1858: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.1859: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.1860: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.1861: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3 Source.1862: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.1863: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.1864: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.1865: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor Source.1866: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.1867: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.1868: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1869: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.1870: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.1871: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1872: DFBPPR11007 ---- Animal proteins ---- Anamorsin Source.1873: DFBPPR11011 ---- Animal proteins ---- Epigen Source.1874: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.1875: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.1876: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein Source.1877: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog Source.1878: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.1879: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.1880: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.1881: DFBPPR11051 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.1882: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a Source.1883: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.1884: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.1885: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.1886: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.1887: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.1888: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1 Source.1889: DFBPPR11118 ---- Animal proteins ---- Filensin Source.1890: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.1891: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b Source.1892: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.1893: DFBPPR11146 ---- Animal proteins ---- Formin Source.1894: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.1895: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.1896: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.1897: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.1898: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1899: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1900: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.1901: DFBPPR11211 ---- Animal proteins ---- Acylphosphatase-2 Source.1902: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.1903: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.1904: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4 Source.1905: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.1906: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.1907: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.1908: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.1909: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.1910: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.1911: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1912: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.1913: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2 Source.1914: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1 Source.1915: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6 Source.1916: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.1917: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.1918: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7 Source.1919: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.1920: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1921: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a Source.1922: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2 Source.1923: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.1924: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.1925: DFBPPR11478 ---- Animal proteins ---- Gastrin-releasing peptide Source.1926: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.1927: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.1928: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.1929: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.1930: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1931: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.1932: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.1933: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1934: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.1935: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.1936: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4 Source.1937: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein Source.1938: DFBPPR11583 ---- Animal proteins ---- Translin Source.1939: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.1940: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.1941: DFBPPR11616 ---- Animal proteins ---- Iron-sulfur cluster assembly 1 homolog, mitochondrial Source.1942: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.1943: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.1944: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.1945: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1946: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.1947: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1948: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1949: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.1950: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.1951: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.1952: DFBPPR11736 ---- Animal proteins ---- Ig lambda chain V-1 region Source.1953: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.1954: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.1955: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2 Source.1956: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3 Source.1957: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.1958: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.1959: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2 Source.1960: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4 Source.1961: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.1962: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A Source.1963: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.1964: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5 Source.1965: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.1966: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.1967: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1968: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.1969: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.1970: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.1971: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.1972: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.1973: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.1974: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog Source.1975: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1976: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.1977: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.1978: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.1979: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.1980: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.1981: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal Source.1982: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.1983: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog Source.1984: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.1985: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4 Source.1986: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.1987: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121 Source.1988: DFBPPR12089 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein Source.1989: DFBPPR12091 ---- Animal proteins ---- Neurofibromin Source.1990: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.1991: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.1992: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.1993: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1 Source.1994: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.1995: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19 Source.1996: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93 Source.1997: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1998: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A Source.1999: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2000: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.2001: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.2002: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.2003: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.2004: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.2005: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10 Source.2006: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A Source.2007: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2008: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1 Source.2009: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2010: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2011: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2012: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2013: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.2014: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2015: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.2016: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.2017: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2018: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.2019: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.2020: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2021: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.2022: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.2023: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.2024: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.2025: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2026: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.2027: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.2028: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.2029: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.2030: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.2031: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.2032: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.2033: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.2034: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.2035: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2036: DFBPPR12431 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2 Source.2037: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.2038: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.2039: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.2040: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.2041: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2042: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2043: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.2044: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.2045: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta Source.2046: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.2047: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.2048: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.2049: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14 Source.2050: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3 Source.2051: DFBPPR12508 ---- Animal proteins ---- Interleukin-2 Source.2052: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.2053: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.2054: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2055: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2056: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2057: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.2058: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.2059: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.2060: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2061: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide Source.2062: DFBPPR12636 ---- Animal proteins ---- Complement component C9 Source.2063: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2064: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.2065: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.2066: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.2067: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein Source.2068: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.2069: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2070: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.2071: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2072: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.2073: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2074: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.2075: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.2076: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.2077: DFBPPR12789 ---- Animal proteins ---- CD59 glycoprotein Source.2078: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.2079: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2 Source.2080: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2081: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase Source.2082: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.2083: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2084: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2085: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.2086: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.2087: DFBPPR12857 ---- Animal proteins ---- Arginase-1 Source.2088: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.2089: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.2090: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2091: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.2092: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn] Source.2093: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A Source.2094: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2 Source.2095: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B Source.2096: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.2097: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.2098: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2099: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.2100: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.2101: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.2102: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.2103: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2104: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2105: DFBPPR13014 ---- Animal proteins ---- Ciliary neurotrophic factor Source.2106: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein Source.2107: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2108: DFBPPR13051 ---- Animal proteins ---- Permeability factor 2 Source.2109: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.2110: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D Source.2111: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1 Source.2112: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2113: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.2114: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form Source.2115: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2116: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2117: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2118: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.2119: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.2120: DFBPPR13199 ---- Animal proteins ---- Hemoglobin subunit alpha Source.2121: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2122: DFBPPR13220 ---- Animal proteins ---- Latherin Source.2123: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2124: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.2125: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2 Source.2126: DFBPPR13242 ---- Animal proteins ---- E-selectin Source.2127: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2128: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.2129: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.2130: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein Source.2131: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2132: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2133: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2134: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2135: DFBPPR13370 ---- Animal proteins ---- Interleukin-2 Source.2136: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2137: DFBPPR13397 ---- Animal proteins ---- Hemoglobin subunit theta-1 Source.2138: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2139: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog Source.2140: DFBPPR13418 ---- Animal proteins ---- 40S ribosomal protein S4 Source.2141: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2142: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase Source.2143: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.2144: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.2145: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2146: DFBPPR13464 ---- Animal proteins ---- Interferon tau Source.2147: DFBPPR13468 ---- Animal proteins ---- Hemoglobin subunit alpha-1 Source.2148: DFBPPR13476 ---- Animal proteins ---- Hemoglobin subunit alpha-2 Source.2149: DFBPPR13486 ---- Animal proteins ---- Beta-defensin 1 Source.2150: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a Source.2151: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1 Source.2152: DFBPPR13512 ---- Animal proteins ---- Interleukin-2 Source.2153: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2154: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2155: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.2156: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.2157: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2158: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.2159: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.2160: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.2161: DFBPPR13586 ---- Animal proteins ---- Fibroblast growth factor 1 Source.2162: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.2163: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.2164: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2 Source.2165: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2166: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6 Source.2167: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.2168: DFBPPR13661 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2 Source.2169: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2170: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3 Source.2171: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.2172: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1 Source.2173: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase Source.2174: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10 Source.2175: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.2176: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2177: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5 Source.2178: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9 Source.2179: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8 Source.2180: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7 Source.2181: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4 Source.2182: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21 Source.2183: DFBPPR13763 ---- Animal proteins ---- Interleukin-2 Source.2184: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2185: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.2186: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.2187: DFBPPR13832 ---- Animal proteins ---- Cystatin-B Source.2188: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.2189: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1 Source.2190: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2191: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor Source.2192: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2193: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.2194: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2195: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2196: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.2197: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2198: DFBPPR13941 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.2199: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2200: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4 Source.2201: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2202: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2203: DFBPPR14002 ---- Animal proteins ---- Cytochrome b Source.2204: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.2205: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase Source.2206: DFBPPR14010 ---- Animal proteins ---- GTPase KRas Source.2207: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.2208: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b Source.2209: DFBPPR14020 ---- Animal proteins ---- Parvalbumin alpha Source.2210: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.2211: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2212: DFBPPR14037 ---- Animal proteins ---- Parvalbumin beta Source.2213: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2214: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form Source.2215: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form Source.2216: DFBPPR14061 ---- Animal proteins ---- Neurotrophin-7 Source.2217: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2218: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.2219: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.2220: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.2221: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A Source.2222: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.2223: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.2224: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.2225: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.2226: DFBPPR14141 ---- Marine protein ---- Ependymin-2 Source.2227: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I Source.2228: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a Source.2229: DFBPPR14147 ---- Marine protein ---- Parvalbumin beta 2 Source.2230: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.2231: DFBPPR14158 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 3 Source.2232: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.2233: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2 Source.2234: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor Source.2235: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2 Source.2236: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.2237: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.2238: DFBPPR14221 ---- Marine protein ---- LYR motif-containing protein 2 Source.2239: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin Source.2240: DFBPPR14245 ---- Marine protein ---- Pro-MCH 1 Source.2241: DFBPPR14247 ---- Marine protein ---- Pro-MCH 2 Source.2242: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a Source.2243: DFBPPR14294 ---- Marine protein ---- ATP synthase subunit c, chloroplastic Source.2244: DFBPPR14298 ---- Marine protein ---- Acetolactate synthase small subunit Source.2245: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2246: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region Source.2247: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.2248: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2249: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.2250: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.2251: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.2252: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2253: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.2254: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.2255: DFBPPR14395 ---- Marine protein ---- 30S ribosomal protein S13-2, chloroplastic Source.2256: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha Source.2257: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.2258: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA Source.2259: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43 Source.2260: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.2261: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23 Source.2262: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35 Source.2263: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B Source.2264: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2265: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta Source.2266: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.2267: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.2268: DFBPPR14591 ---- Marine protein ---- Vimentin Source.2269: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.2270: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.2271: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2 Source.2272: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a Source.2273: DFBPPR14618 ---- Marine protein ---- Ependymin-1 Source.2274: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.2275: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase Source.2276: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.2277: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1 Source.2278: DFBPPR14645 ---- Marine protein ---- Ependymin-2 Source.2279: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.2280: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.2281: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.2282: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.2283: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.2284: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.2285: DFBPPR14684 ---- Marine protein ---- Pro-MCH 2 Source.2286: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1 Source.2287: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2 Source.2288: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.2289: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4 Source.2290: DFBPPR14745 ---- Marine protein ---- Parvalbumin beta 2 Source.2291: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1 Source.2292: DFBPPR14750 ---- Marine protein ---- Parvalbumin beta Source.2293: DFBPPR14755 ---- Marine protein ---- Techylectin-5A Source.2294: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.2295: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit Source.2296: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit Source.2297: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.2298: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.2299: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2300: DFBPPR14861 ---- Marine protein ---- Cytochrome b Source.2301: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.2302: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.2303: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.2304: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.2305: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.2306: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2307: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.2308: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.2309: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase Source.2310: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.2311: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.2312: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase Source.2313: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.2314: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.2315: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2316: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2317: DFBPPR14998 ---- Microorganism protein ---- Galactokinase Source.2318: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8 Source.2319: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.2320: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.2321: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.2322: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.2323: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9 Source.2324: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1 Source.2325: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.2326: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.2327: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.2328: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2329: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial Source.2330: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.2331: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.2332: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.2333: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.2334: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.2335: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.2336: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.2337: DFBPPR15157 ---- Microorganism protein ---- DASH complex subunit DAD2 Source.2338: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1 Source.2339: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.2340: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.2341: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.2342: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I Source.2343: DFBPPR15203 ---- Microorganism protein ---- Ubiquitin-like protein ATG12 Source.2344: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.2345: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.2346: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19 Source.2347: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.2348: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4 Source.2349: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.2350: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.2351: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.2352: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.2353: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.2354: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2 Source.2355: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3 Source.2356: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1 Source.2357: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2358: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.2359: DFBPPR15403 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM13 Source.2360: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.2361: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0 Source.2362: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter Source.2363: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.2364: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.2365: DFBPPR15484 ---- Microorganism protein ---- Protein TOS6 Source.2366: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1 Source.2367: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.2368: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta Source.2369: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.2370: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase Source.2371: DFBPPR15549 ---- Microorganism protein ---- Probable kinetochore protein SPC25 Source.2372: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2373: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14 Source.2374: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.2375: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.2376: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.2377: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.2378: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.2379: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.2380: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2 Source.2381: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25 Source.2382: DFBPPR15665 ---- Microorganism protein ---- Ribosome biogenesis protein ALB1 Source.2383: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.2384: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.2385: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1 Source.2386: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2 Source.2387: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.2388: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3 Source.2389: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.2390: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2 Source.2391: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.2392: DFBPPR15725 ---- Microorganism protein ---- Protein DML1 Source.2393: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.2394: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial Source.2395: DFBPPR15737 ---- Microorganism protein ---- Required for respiratory growth protein 9, mitochondrial Source.2396: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14 Source.2397: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g Source.2398: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog Source.2399: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11 Source.2400: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.2401: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1 Source.2402: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2 Source.2403: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.2404: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.2405: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase Source.2406: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.2407: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.2408: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase Source.2409: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD Source.2410: DFBPPR15831 ---- Microorganism protein ---- Probable transcriptional regulator flp Source.2411: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.2412: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase Source.2413: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2414: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.2415: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.2416: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.2417: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2418: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.2419: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.2420: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.2421: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.2422: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.2423: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.2424: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2425: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.2426: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.2427: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.2428: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.2429: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.2430: DFBPPR7798 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.2431: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.2432: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2433: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.2434: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a Source.2435: DFBPPR7854 ---- Plant protein ---- Cytochrome b6-f complex subunit 6 Source.2436: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.2437: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1 Source.2438: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.2439: DFBPPR7920 ---- Plant protein ---- Photosystem I assembly protein Ycf3 Source.2440: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.2441: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.2442: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a Source.2443: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP Source.2444: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.2445: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1 Source.2446: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92 Source.2447: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87 Source.2448: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1 Source.2449: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2450: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.2451: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2452: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.2453: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2454: DFBPPR8077 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.2455: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.2456: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2457: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2458: DFBPPR8163 ---- Plant protein ---- Photosystem I assembly protein Ycf3 Source.2459: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2460: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.2461: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.2462: DFBPPR8235 ---- Plant protein ---- Catalase Source.2463: DFBPPR8244 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.2464: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.2465: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2466: DFBPPR8286 ---- Plant protein ---- Oleosin Source.2467: DFBPPR8294 ---- Plant protein ---- Cytochrome b6-f complex subunit 6 Source.2468: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.2469: DFBPPR8326 ---- Plant protein ---- Photosystem I reaction center subunit IX Source.2470: DFBPPR8349 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide ALT showed no antioxidant activity with a relative antioxidant activity of 0.00 ± 0.00 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015