E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0820(Antioxidative peptide)
DFBP ID DFBPANOX0820
Peptide sequence ALI
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Ala-Leu-Ile
Single-letter amino acid ALI
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 315.40 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 3.3667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine whey protein
Precursor protein β-Lactoglobulin
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1
Source.2: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.3: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.4: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.5: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.6: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.7: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.8: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.9: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.10: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.11: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.12: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.13: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7
Source.14: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.15: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.16: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.17: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.18: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.19: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.20: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.21: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.22: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.23: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.24: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.25: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.26: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.27: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.28: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.29: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.30: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.31: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.32: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13
Source.33: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.34: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.35: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.36: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.37: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.38: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.39: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.40: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.41: DFBPPR1154 ---- Plant proteins ---- MADS-box transcription factor 22
Source.42: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.43: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.44: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17
Source.45: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.46: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18
Source.47: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.48: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.49: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.50: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50
Source.51: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.52: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.53: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.54: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.55: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.56: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.57: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.58: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.59: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.60: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.61: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.62: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.63: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.64: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.65: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.66: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.67: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.68: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.69: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.70: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.71: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.72: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.73: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.74: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.75: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.76: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.77: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.78: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.79: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.80: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.81: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.82: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.83: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.84: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.85: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.86: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal
Source.87: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.88: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.89: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.90: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.91: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.92: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.93: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.94: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.95: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5
Source.96: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.97: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.98: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.99: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.100: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.101: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.102: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.103: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.104: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.105: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.106: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.107: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.108: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.109: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.110: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.111: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.112: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.113: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.114: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.115: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.116: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.117: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.118: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.119: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.120: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.121: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.122: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.123: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.124: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.125: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.126: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.127: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.128: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.129: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.130: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.131: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.132: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.133: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.134: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.135: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.136: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.137: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.138: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.139: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.140: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.141: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.142: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.143: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.144: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.145: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.146: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.147: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.148: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.149: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.150: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.151: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.152: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.153: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.154: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.155: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.156: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.157: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.158: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.159: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.160: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.161: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.162: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.163: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.164: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.165: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.166: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.167: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.168: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.169: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.170: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.171: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2
Source.172: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.173: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.174: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.175: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.176: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.177: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.178: DFBPPR2223 ---- Plant proteins ---- Urease
Source.179: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.180: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.181: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.182: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.183: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.184: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.185: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.186: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.187: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.188: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.189: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.190: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.191: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.192: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.193: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.194: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.195: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.196: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.197: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.198: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.199: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.200: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.201: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.202: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.203: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.204: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.205: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.206: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.207: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.208: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.209: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.210: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.211: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56
Source.212: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.213: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.214: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5
Source.215: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.216: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.217: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.218: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.219: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.220: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.221: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.222: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.223: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.224: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.225: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.226: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.227: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial
Source.228: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.229: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.230: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.231: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.232: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.233: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.234: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.235: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.236: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.237: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.238: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.239: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.240: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.241: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.242: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1
Source.243: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.244: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.245: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.246: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2
Source.247: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.248: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.249: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.250: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.251: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.252: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.253: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.254: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.255: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.256: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.257: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3
Source.258: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.259: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.260: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1
Source.261: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.262: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.263: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.264: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.265: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.266: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.267: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2
Source.268: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.269: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.270: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.271: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.272: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.273: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.274: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.275: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.276: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.277: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.278: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.279: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.280: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.281: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.282: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.283: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.284: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.285: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.286: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.287: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.288: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.289: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.290: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.291: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.292: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.293: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.294: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.295: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.296: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.297: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.298: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.299: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.300: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.301: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.302: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.303: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.304: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.305: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.306: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.307: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.308: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.309: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.310: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.311: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.312: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.313: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.314: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.315: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.316: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.317: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.318: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.319: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.320: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.321: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.322: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.323: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.324: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.325: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.326: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.327: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.328: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.329: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.330: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.331: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.332: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.333: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.334: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.335: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.336: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.337: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.338: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.339: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.340: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.341: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.342: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.343: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.344: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.345: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.346: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.347: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.348: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.349: DFBPPR3582 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7c
Source.350: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.351: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.352: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.353: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.354: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b
Source.355: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.356: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.357: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.358: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.359: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e
Source.360: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.361: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.362: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10
Source.363: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.364: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.365: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.366: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.367: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d
Source.368: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.369: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.370: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.371: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.372: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.373: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.374: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.375: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.376: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.377: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.378: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.379: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.380: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.381: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.382: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.383: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.384: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.385: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.386: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.387: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.388: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.389: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.390: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.391: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.392: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.393: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.394: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.395: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.396: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.397: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.398: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.399: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.400: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.401: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.402: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.403: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.404: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.405: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.406: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.407: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.408: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.409: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.410: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.411: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.412: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.413: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.414: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.415: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.416: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.417: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.418: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.419: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.420: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.421: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.422: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.423: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.424: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.425: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.426: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.427: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.428: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.429: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.430: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.431: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.432: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.433: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.434: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.435: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic
Source.436: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.437: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.438: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.439: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.440: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.441: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.442: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.443: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.444: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.445: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.446: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.447: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.448: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.449: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.450: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.451: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.452: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.453: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.454: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.455: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.456: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.457: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.458: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.459: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16
Source.460: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.461: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15
Source.462: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.463: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12
Source.464: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.465: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.466: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.467: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.468: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.469: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.470: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.471: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.472: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.473: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.474: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.475: DFBPPR4658 ---- Plant proteins ---- 60S ribosomal protein L9
Source.476: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.477: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.478: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.479: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800
Source.480: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.481: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.482: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.483: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.484: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300
Source.485: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.486: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.487: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.488: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.489: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.490: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A
Source.491: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.492: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.493: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.494: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.495: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.496: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.497: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.498: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.499: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.500: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.501: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.502: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.503: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.504: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.505: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.506: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.507: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.508: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.509: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.510: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.511: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.512: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.513: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.514: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.515: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.516: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.517: DFBPPR5150 ---- Plant proteins ---- Profilin-2
Source.518: DFBPPR5154 ---- Plant proteins ---- Profilin-1
Source.519: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2
Source.520: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.521: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1
Source.522: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.523: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.524: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.525: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.526: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.527: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.528: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.529: DFBPPR5309 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.530: DFBPPR5310 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.531: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.532: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.533: DFBPPR5314 ---- Plant proteins ---- Hydrophobic seed protein
Source.534: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.535: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.536: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.537: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3
Source.538: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase
Source.539: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.540: DFBPPR5355 ---- Plant proteins ---- Early nodulin-93
Source.541: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.542: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.543: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.544: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.545: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.546: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.547: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.548: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.549: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.550: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.551: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.552: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.553: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.554: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.555: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.556: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.557: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.558: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.559: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.560: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.561: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.562: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.563: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.564: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.565: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.566: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.567: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.568: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.569: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.570: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.571: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.572: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.573: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.574: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.575: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.576: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.577: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1
Source.578: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.579: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.580: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.581: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.582: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.583: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.584: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.585: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.586: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.587: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.588: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.589: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.590: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.591: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.592: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.593: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.594: DFBPPR5953 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.595: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.596: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.597: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.598: DFBPPR6025 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.599: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.600: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1
Source.601: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.602: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.603: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.604: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid
Source.605: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.606: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34
Source.607: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.608: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.609: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.610: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.611: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.612: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.613: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.614: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.615: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.616: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.617: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.618: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.619: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.620: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.621: DFBPPR6372 ---- Plant proteins ---- Early nodulin-12A
Source.622: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.623: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.624: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.625: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.626: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.627: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.628: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1
Source.629: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic
Source.630: DFBPPR6445 ---- Plant proteins ---- Early nodulin-12B
Source.631: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.632: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.633: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.634: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.635: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.636: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.637: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.638: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.639: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.640: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.641: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.642: DFBPPR6527 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.643: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.644: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.645: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.646: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.647: DFBPPR6563 ---- Plant proteins ---- 60S ribosomal protein L9
Source.648: DFBPPR6574 ---- Plant proteins ---- Probable 60S ribosomal protein L14
Source.649: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.650: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.651: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.652: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.653: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.654: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.655: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.656: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.657: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.658: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.659: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.660: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.661: DFBPPR6721 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.662: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.663: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.664: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.665: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.666: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.667: DFBPPR6808 ---- Plant proteins ---- Profilin-2
Source.668: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.669: DFBPPR6810 ---- Plant proteins ---- Profilin-1
Source.670: DFBPPR6813 ---- Plant proteins ---- Profilin-3
Source.671: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.672: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.673: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.674: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.675: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.676: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.677: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.678: DFBPPR6928 ---- Plant proteins ---- Avenin-like a5
Source.679: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.680: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.681: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.682: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4
Source.683: DFBPPR7001 ---- Plant proteins ---- Uncharacterized protein ycf70
Source.684: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.685: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.686: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.687: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.688: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.689: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.690: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.691: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.692: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.693: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.694: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.695: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.696: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.697: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.698: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.699: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.700: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.701: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.702: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.703: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.704: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.705: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.706: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.707: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.708: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6
Source.709: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2
Source.710: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.711: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.712: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2
Source.713: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.714: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.715: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.716: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.717: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.718: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II
Source.719: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.720: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.721: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.722: DFBPPR7609 ---- Milk proteins ---- Lysozyme C
Source.723: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.724: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.725: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.726: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.727: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.728: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.729: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.730: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.731: DFBPPR7691 ---- Milk proteins ---- Albumin
Source.732: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.733: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.734: DFBPPR7710 ---- Milk proteins ---- Beta-lactoglobulin, Beta-LG
Source.735: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.736: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.737: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.738: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.739: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.740: DFBPPR8408 ---- Plant proteins ---- Profilin
Source.741: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.742: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.743: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.744: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.745: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.746: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.747: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.748: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.749: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.750: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.751: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.752: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.753: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.754: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.755: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.756: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.757: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.758: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.759: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.760: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.761: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.762: DFBPPR16037 ---- Animal proteins ---- Caveolin-1
Source.763: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.764: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.765: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.766: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.767: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.768: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.769: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.770: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.771: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.772: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.773: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.774: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.775: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.776: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.777: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2
Source.778: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.779: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.780: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.781: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.782: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.783: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.784: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.785: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.786: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.787: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.788: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.789: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.790: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.791: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.792: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.793: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.794: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.795: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.796: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.797: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.798: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.799: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.800: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.801: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.802: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.803: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.804: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.805: DFBPPR16444 ---- Animal proteins ---- Interleukin-33
Source.806: DFBPPR16460 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-T2
Source.807: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.808: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.809: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.810: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.811: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.812: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.813: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.814: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.815: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.816: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.817: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.818: DFBPPR16667 ---- Animal proteins ---- 60S ribosomal protein L12
Source.819: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.820: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.821: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.822: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.823: DFBPPR16744 ---- Animal proteins ---- Apoptotic protease-activating factor 1
Source.824: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.825: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.826: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.827: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.828: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.829: DFBPPR16853 ---- Animal proteins ---- Protein S100-B
Source.830: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.831: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.832: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.833: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.834: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.835: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.836: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.837: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.838: DFBPPR16927 ---- Animal proteins ---- Caveolin-1
Source.839: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.840: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.841: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.842: DFBPPR16956 ---- Animal proteins ---- Interleukin-6
Source.843: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.844: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.845: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.846: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.847: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.848: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.849: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.850: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.851: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.852: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.853: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.854: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.855: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.856: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.857: DFBPPR17082 ---- Animal proteins ---- Calbindin
Source.858: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.859: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.860: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.861: DFBPPR17115 ---- Animal proteins ---- CD44 antigen
Source.862: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.863: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.864: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog
Source.865: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.866: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.867: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.868: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.869: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.870: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.871: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.872: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.873: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.874: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.875: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.876: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.877: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.878: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.879: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.880: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.881: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.882: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.883: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.884: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.885: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.886: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.887: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.888: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.889: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.890: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.891: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.892: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.893: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.894: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.895: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.896: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.897: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1
Source.898: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.899: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.900: DFBPPR17428 ---- Animal proteins ---- DNA damage-inducible transcript 3 protein
Source.901: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.902: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.903: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.904: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.905: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.906: DFBPPR17532 ---- Animal proteins ---- Cytochrome b5
Source.907: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.908: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.909: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.910: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.911: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.912: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.913: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.914: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.915: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.916: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.917: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.918: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.919: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.920: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.921: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.922: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.923: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.924: DFBPPR17816 ---- Animal proteins ---- Lumican
Source.925: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.926: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.927: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.928: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.929: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.930: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.931: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.932: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.933: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.934: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.935: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.936: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.937: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.938: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.939: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.940: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.941: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.942: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1
Source.943: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.944: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.945: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.946: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.947: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.948: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.949: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.950: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.951: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.952: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.953: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.954: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.955: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.956: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.957: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.958: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.959: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.960: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.961: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.962: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.963: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.964: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.965: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.966: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2
Source.967: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.968: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.969: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.970: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.971: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.972: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B
Source.973: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.974: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.975: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.976: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.977: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.978: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.979: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.980: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.981: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.982: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.983: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.984: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.985: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.986: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.987: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.988: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.989: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.990: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.991: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.992: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.993: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.994: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.995: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.996: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.997: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.998: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.999: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.1000: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.1001: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1002: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.1003: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3
Source.1004: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1005: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1006: DFBPPR18591 ---- Animal proteins ---- ATP synthase membrane subunit DAPIT, mitochondrial
Source.1007: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1008: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase
Source.1009: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.1010: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.1011: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.1012: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.1013: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.1014: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.1015: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1016: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1017: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.1018: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.1019: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.1020: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.1021: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.1022: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.1023: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.1024: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1025: DFBPPR18839 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 12
Source.1026: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1027: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1028: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.1029: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.1030: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.1031: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.1032: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.1033: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.1034: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.1035: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.1036: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.1037: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.1038: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.1039: DFBPPR18895 ---- Animal proteins ---- Lysozyme C-1
Source.1040: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1041: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.1042: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.1043: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.1044: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.1045: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.1046: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.1047: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1048: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.1049: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1050: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.1051: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.1052: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1
Source.1053: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.1054: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1055: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.1056: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.1057: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.1058: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.1059: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.1060: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1061: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.1062: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.1063: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.1064: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.1065: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.1066: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.1067: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.1068: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.1069: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.1070: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1071: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.1072: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.1073: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.1074: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.1075: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.1076: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.1077: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.1078: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.1079: DFBPPR19300 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-T2
Source.1080: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.1081: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.1082: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.1083: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.1084: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20
Source.1085: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.1086: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.1087: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.1088: DFBPPR19425 ---- Animal proteins ---- Microfibrillar-associated protein 5
Source.1089: DFBPPR19456 ---- Animal proteins ---- Ly-6/neurotoxin-like protein 1
Source.1090: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1091: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.1092: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.1093: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1094: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.1095: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1096: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.1097: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.1098: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1
Source.1099: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1100: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.1101: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4
Source.1102: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.1103: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1104: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1105: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1106: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.1107: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.1108: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.1109: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1110: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1111: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.1112: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.1113: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.1114: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.1115: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.1116: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.1117: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.1118: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.1119: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4
Source.1120: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.1121: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.1122: DFBPPR19717 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.1123: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.1124: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1
Source.1125: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.1126: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.1127: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.1128: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.1129: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.1130: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.1131: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.1132: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2
Source.1133: DFBPPR19806 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.1134: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.1135: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.1136: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1137: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.1138: DFBPPR19846 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8B
Source.1139: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.1140: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.1141: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.1142: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.1143: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.1144: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1145: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.1146: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1
Source.1147: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.1148: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.1149: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.1150: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.1151: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.1152: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.1153: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.1154: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.1155: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.1156: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.1157: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.1158: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.1159: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2
Source.1160: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.1161: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.1162: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.1163: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.1164: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.1165: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.1166: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.1167: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.1168: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.1169: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1170: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.1171: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.1172: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1173: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.1174: DFBPPR20242 ---- Animal proteins ---- Coactosin-like protein
Source.1175: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30
Source.1176: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.1177: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1178: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1179: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.1180: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.1181: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.1182: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.1183: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.1184: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1
Source.1185: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.1186: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.1187: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.1188: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1189: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A
Source.1190: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.1191: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.1192: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.1193: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.1194: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1195: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.1196: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.1197: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.1198: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.1199: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.1200: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.1201: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.1202: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.1203: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.1204: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.1205: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.1206: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.1207: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.1208: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.1209: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.1210: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.1211: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.1212: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.1213: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.1214: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.1215: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1216: DFBPPR20728 ---- Animal proteins ---- Serine protease 45
Source.1217: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.1218: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.1219: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.1220: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.1221: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.1222: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.1223: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.1224: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.1225: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.1226: DFBPPR20866 ---- Animal proteins ---- PRKR-interacting protein 1
Source.1227: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2
Source.1228: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.1229: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.1230: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1231: DFBPPR20919 ---- Animal proteins ---- Protein cornichon homolog 4
Source.1232: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.1233: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.1234: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4
Source.1235: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.1236: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.1237: DFBPPR20950 ---- Animal proteins ---- WAP four-disulfide core domain protein 18
Source.1238: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.1239: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.1240: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.1241: DFBPPR20990 ---- Animal proteins ---- 60S ribosomal protein L12
Source.1242: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.1243: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.1244: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1245: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.1246: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.1247: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.1248: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.1249: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein
Source.1250: DFBPPR21123 ---- Animal proteins ---- 39S ribosomal protein L14, mitochondrial
Source.1251: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.1252: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.1253: DFBPPR21152 ---- Animal proteins ---- Protein S100-A2
Source.1254: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.1255: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.1256: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.1257: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.1258: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.1259: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.1260: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.1261: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.1262: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.1263: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.1264: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.1265: DFBPPR21318 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.1266: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1267: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.1268: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397
Source.1269: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.1270: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.1271: DFBPPR21363 ---- Animal proteins ---- Pleckstrin homology-like domain family A member 2
Source.1272: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.1273: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.1274: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.1275: DFBPPR21424 ---- Animal proteins ---- Chromosome transmission fidelity protein 8 homolog
Source.1276: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A
Source.1277: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.1278: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.1279: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.1280: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.1281: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.1282: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.1283: DFBPPR21538 ---- Animal proteins ---- Small cell adhesion glycoprotein
Source.1284: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.1285: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.1286: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.1287: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1288: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.1289: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1290: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.1291: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.1292: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6
Source.1293: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1294: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.1295: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.1296: DFBPPR21684 ---- Animal proteins ---- Stannin
Source.1297: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.1298: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.1299: DFBPPR21698 ---- Animal proteins ---- Alpha-hemoglobin-stabilizing protein
Source.1300: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.1301: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.1302: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.1303: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1304: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.1305: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.1306: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.1307: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.1308: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1309: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.1310: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.1311: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17
Source.1312: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.1313: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.1314: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.1315: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3
Source.1316: DFBPPR21918 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 21
Source.1317: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1318: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1319: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.1320: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.1321: DFBPPR21957 ---- Animal proteins ---- LIM domain transcription factor LMO4
Source.1322: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.1323: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.1324: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.1325: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.1326: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12
Source.1327: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.1328: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1329: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1
Source.1330: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.1331: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.1332: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.1333: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.1334: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.1335: DFBPPR22130 ---- Animal proteins ---- 60S ribosomal protein L9
Source.1336: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.1337: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.1338: DFBPPR22170 ---- Animal proteins ---- Transmembrane protein 106C
Source.1339: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.1340: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1341: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.1342: DFBPPR22200 ---- Animal proteins ---- Profilin-4
Source.1343: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.1344: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.1345: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog
Source.1346: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.1347: DFBPPR22297 ---- Animal proteins ---- Histatherin
Source.1348: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein
Source.1349: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9
Source.1350: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218
Source.1351: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3
Source.1352: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1
Source.1353: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.1354: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.1355: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1356: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.1357: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.1358: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.1359: DFBPPR22471 ---- Animal proteins ---- Protein shisa-like-2B
Source.1360: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.1361: DFBPPR22482 ---- Animal proteins ---- Adropin
Source.1362: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3
Source.1363: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.1364: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29
Source.1365: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C
Source.1366: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.1367: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.1368: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.1369: DFBPPR22574 ---- Animal proteins ---- Uncharacterized protein C1orf54 homolog
Source.1370: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.1371: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.1372: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.1373: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.1374: DFBPPR22675 ---- Animal proteins ---- UPF0711 protein C18orf21 homolog
Source.1375: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.1376: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.1377: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1
Source.1378: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.1379: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1380: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.1381: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1382: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.1383: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.1384: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.1385: DFBPPR8593 ---- Animal proteins ---- Caveolin-1
Source.1386: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.1387: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1388: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.1389: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.1390: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.1391: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1392: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.1393: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1394: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.1395: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.1396: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.1397: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1398: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1399: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1400: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.1401: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.1402: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1403: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.1404: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.1405: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1406: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.1407: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1408: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1409: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.1410: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.1411: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1412: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.1413: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.1414: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.1415: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1416: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.1417: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.1418: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.1419: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.1420: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.1421: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.1422: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.1423: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.1424: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.1425: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1426: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1427: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1428: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.1429: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1430: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1431: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1432: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.1433: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.1434: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.1435: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B
Source.1436: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.1437: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.1438: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.1439: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1440: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.1441: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1442: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1
Source.1443: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1444: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.1445: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1446: DFBPPR9154 ---- Animal proteins ---- Interleukin-6
Source.1447: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1448: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.1449: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.1450: DFBPPR9223 ---- Animal proteins ---- Protransforming growth factor alpha
Source.1451: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.1452: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.1453: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.1454: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.1455: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.1456: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.1457: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.1458: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.1459: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.1460: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.1461: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.1462: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.1463: DFBPPR9356 ---- Animal proteins ---- Odorant-binding protein
Source.1464: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.1465: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.1466: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.1467: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.1468: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.1469: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.1470: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.1471: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.1472: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.1473: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.1474: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.1475: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1476: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.1477: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.1478: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.1479: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.1480: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1481: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.1482: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.1483: DFBPPR9659 ---- Animal proteins ---- Placenta-expressed transcript 1 protein
Source.1484: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1485: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.1486: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1487: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.1488: DFBPPR9741 ---- Animal proteins ---- Syndecan-4
Source.1489: DFBPPR9753 ---- Animal proteins ---- Syntaxin-binding protein 2
Source.1490: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.1491: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.1492: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.1493: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.1494: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.1495: DFBPPR9837 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.1496: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.1497: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.1498: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.1499: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.1500: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.1501: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40
Source.1502: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.1503: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.1504: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.1505: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.1506: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.1507: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1508: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1509: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.1510: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.1511: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.1512: DFBPPR10113 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.1513: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.1514: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.1515: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1516: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1517: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.1518: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.1519: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1520: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.1521: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.1522: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.1523: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1524: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.1525: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.1526: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.1527: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.1528: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.1529: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.1530: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.1531: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.1532: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.1533: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.1534: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1535: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1536: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1537: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.1538: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.1539: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1540: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.1541: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.1542: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.1543: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.1544: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.1545: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.1546: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.1547: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.1548: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1549: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.1550: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.1551: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.1552: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.1553: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.1554: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1555: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1556: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1557: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1558: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.1559: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.1560: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.1561: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.1562: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.1563: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.1564: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.1565: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.1566: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.1567: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.1568: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.1569: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.1570: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.1571: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.1572: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.1573: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.1574: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2
Source.1575: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.1576: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.1577: DFBPPR10548 ---- Animal proteins ---- Syndecan-4
Source.1578: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1579: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1580: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.1581: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.1582: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1583: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.1584: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1585: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1586: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.1587: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.1588: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.1589: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1590: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.1591: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1592: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1593: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.1594: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.1595: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1596: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.1597: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.1598: DFBPPR10740 ---- Animal proteins ---- Cryptic protein
Source.1599: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.1600: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.1601: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.1602: DFBPPR10779 ---- Animal proteins ---- Natriuretic peptides A
Source.1603: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.1604: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.1605: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.1606: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.1607: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.1608: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.1609: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1610: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.1611: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.1612: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.1613: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.1614: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1615: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1616: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.1617: DFBPPR10920 ---- Animal proteins ---- Troponin T, fast skeletal muscle isoforms
Source.1618: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.1619: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.1620: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.1621: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.1622: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1623: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.1624: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.1625: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.1626: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.1627: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.1628: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1629: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.1630: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1631: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.1632: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.1633: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.1634: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.1635: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA
Source.1636: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.1637: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1638: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.1639: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.1640: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.1641: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1642: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.1643: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.1644: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.1645: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.1646: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein
Source.1647: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1648: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1649: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.1650: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.1651: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.1652: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.1653: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.1654: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.1655: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.1656: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.1657: DFBPPR11373 ---- Animal proteins ---- Decorin
Source.1658: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.1659: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.1660: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1661: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4
Source.1662: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.1663: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.1664: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.1665: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.1666: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.1667: DFBPPR11444 ---- Animal proteins ---- Troponin T, cardiac muscle isoforms
Source.1668: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.1669: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.1670: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.1671: DFBPPR11525 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1672: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.1673: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1674: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1675: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.1676: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.1677: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.1678: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.1679: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.1680: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.1681: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.1682: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.1683: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1684: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A
Source.1685: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1686: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1687: DFBPPR11651 ---- Animal proteins ---- Vitelline membrane outer layer protein 1
Source.1688: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1689: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog
Source.1690: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1
Source.1691: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.1692: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.1693: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.1694: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.1695: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.1696: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.1697: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.1698: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.1699: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.1700: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.1701: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.1702: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.1703: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.1704: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.1705: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.1706: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.1707: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.1708: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.1709: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.1710: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.1711: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.1712: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.1713: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.1714: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.1715: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1716: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1717: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.1718: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.1719: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.1720: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.1721: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.1722: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.1723: DFBPPR12045 ---- Animal proteins ---- Zinc finger protein 706
Source.1724: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.1725: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.1726: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.1727: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.1728: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.1729: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.1730: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.1731: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.1732: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.1733: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.1734: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1
Source.1735: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.1736: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1737: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.1738: DFBPPR12142 ---- Animal proteins ---- FGFR1 oncogene partner 2 homolog
Source.1739: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.1740: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.1741: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.1742: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.1743: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.1744: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1
Source.1745: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.1746: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.1747: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.1748: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.1749: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.1750: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.1751: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1752: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.1753: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1754: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1755: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.1756: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.1757: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1758: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1759: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1760: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.1761: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1762: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.1763: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.1764: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.1765: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.1766: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1767: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.1768: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1769: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.1770: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.1771: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.1772: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1773: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.1774: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1775: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.1776: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.1777: DFBPPR12397 ---- Animal proteins ---- Caveolin-1
Source.1778: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.1779: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.1780: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.1781: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.1782: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1783: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.1784: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.1785: DFBPPR12436 ---- Animal proteins ---- Cytochrome b5
Source.1786: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.1787: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1788: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.1789: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.1790: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.1791: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.1792: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.1793: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.1794: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.1795: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.1796: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.1797: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.1798: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.1799: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.1800: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.1801: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.1802: DFBPPR12538 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.1803: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1804: DFBPPR12542 ---- Animal proteins ---- Decorin
Source.1805: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1806: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.1807: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1808: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.1809: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.1810: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.1811: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.1812: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.1813: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.1814: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.1815: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.1816: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.1817: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.1818: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.1819: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.1820: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.1821: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.1822: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.1823: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.1824: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.1825: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.1826: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.1827: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2
Source.1828: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1829: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.1830: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.1831: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.1832: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.1833: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.1834: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.1835: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.1836: DFBPPR12878 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.1837: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.1838: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.1839: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1840: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.1841: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1842: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.1843: DFBPPR12970 ---- Animal proteins ---- Protein S100-B
Source.1844: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.1845: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1846: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1847: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1848: DFBPPR13001 ---- Animal proteins ---- Annexin A6
Source.1849: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1850: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1851: DFBPPR13104 ---- Animal proteins ---- Ig kappa chain V region 2717
Source.1852: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1853: DFBPPR13166 ---- Animal proteins ---- CD44 antigen
Source.1854: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.1855: DFBPPR13173 ---- Animal proteins ---- Caveolin-1
Source.1856: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1857: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.1858: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.1859: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.1860: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.1861: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.1862: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.1863: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.1864: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.1865: DFBPPR13240 ---- Animal proteins ---- Decorin
Source.1866: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.1867: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.1868: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1869: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1870: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1871: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.1872: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.1873: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.1874: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.1875: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.1876: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1877: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.1878: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.1879: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1880: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1881: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1882: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.1883: DFBPPR13452 ---- Animal proteins ---- Interleukin-6
Source.1884: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.1885: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.1886: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.1887: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1888: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.1889: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1890: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.1891: DFBPPR13577 ---- Animal proteins ---- Interleukin-6
Source.1892: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.1893: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1894: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.1895: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.1896: DFBPPR13625 ---- Animal proteins ---- Lysozyme C-1
Source.1897: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.1898: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1899: DFBPPR13689 ---- Animal proteins ---- Caveolin-1
Source.1900: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.1901: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1902: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.1903: DFBPPR13719 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.1904: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1905: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.1906: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.1907: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.1908: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1909: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.1910: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.1911: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.1912: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.1913: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1914: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1915: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1916: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1917: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.1918: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.1919: DFBPPR13928 ---- Animal proteins ---- Keratin, type II microfibrillar
Source.1920: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1921: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1922: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.1923: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.1924: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.1925: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1926: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1927: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.1928: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.1929: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.1930: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1
Source.1931: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.1932: DFBPPR14125 ---- Marine protein ---- Partner of Y14 and mago B
Source.1933: DFBPPR14128 ---- Marine protein ---- F-box/LRR-repeat protein 15
Source.1934: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.1935: DFBPPR14183 ---- Marine protein ---- Pleckstrin homology-like domain family A member 2
Source.1936: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1937: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.1938: DFBPPR14282 ---- Marine protein ---- Cytochrome c oxidase subunit 8A, mitochondrial
Source.1939: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.1940: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1941: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.1942: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1943: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.1944: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.1945: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.1946: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.1947: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.1948: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1949: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.1950: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.1951: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1952: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.1953: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain
Source.1954: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.1955: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.1956: DFBPPR14411 ---- Marine protein ---- 50S ribosomal protein L22, chloroplastic
Source.1957: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.1958: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator
Source.1959: DFBPPR14441 ---- Marine protein ---- 30S ribosomal protein S8, chloroplastic
Source.1960: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY
Source.1961: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.1962: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.1963: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.1964: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.1965: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.1966: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.1967: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.1968: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.1969: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.1970: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.1971: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.1972: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.1973: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.1974: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.1975: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.1976: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.1977: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.1978: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha
Source.1979: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.1980: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.1981: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.1982: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.1983: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.1984: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.1985: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.1986: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.1987: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.1988: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.1989: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.1990: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.1991: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.1992: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.1993: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.1994: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.1995: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.1996: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.1997: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.1998: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.1999: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.2000: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.2001: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.2002: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.2003: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.2004: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.2005: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.2006: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.2007: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.2008: DFBPPR15026 ---- Microorganism protein ---- ATP synthase subunit 9, mitochondrial
Source.2009: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.2010: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.2011: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.2012: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.2013: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1
Source.2014: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.2015: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.2016: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.2017: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.2018: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2
Source.2019: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.2020: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.2021: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.2022: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.2023: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.2024: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.2025: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.2026: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.2027: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase
Source.2028: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.2029: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.2030: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.2031: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.2032: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35
Source.2033: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.2034: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.2035: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.2036: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4
Source.2037: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2
Source.2038: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38
Source.2039: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.2040: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.2041: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.2042: DFBPPR15307 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 21
Source.2043: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.2044: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.2045: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.2046: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.2047: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.2048: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.2049: DFBPPR15349 ---- Microorganism protein ---- Mitochondrial fission 1 protein
Source.2050: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.2051: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.2052: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3
Source.2053: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.2054: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.2055: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.2056: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.2057: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22
Source.2058: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.2059: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4
Source.2060: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.2061: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.2062: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9
Source.2063: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2064: DFBPPR15489 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB5
Source.2065: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.2066: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.2067: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.2068: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.2069: DFBPPR15525 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit KXD1
Source.2070: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3
Source.2071: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.2072: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.2073: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.2074: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.2075: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.2076: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.2077: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.2078: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.2079: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.2080: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5
Source.2081: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial
Source.2082: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.2083: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6
Source.2084: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.2085: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.2086: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.2087: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.2088: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.2089: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.2090: DFBPPR15758 ---- Microorganism protein ---- Required for respiratory growth protein 8, mitochondrial
Source.2091: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.2092: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.2093: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.2094: DFBPPR15793 ---- Microorganism protein ---- Uncharacterized protein KLLA0D02464g
Source.2095: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.2096: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.2097: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.2098: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.2099: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR
Source.2100: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.2101: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.2102: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.2103: DFBPPR15865 ---- Microorganism protein ---- Hydrophobin-1
Source.2104: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.2105: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.2106: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.2107: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.2108: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.2109: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.2110: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.2111: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2112: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.2113: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic
Source.2114: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2115: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2116: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2117: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2118: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.2119: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.2120: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2121: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.2122: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1
Source.2123: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z
Source.2124: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.2125: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.2126: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.2127: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.2128: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.2129: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.2130: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2131: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2132: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.2133: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.2134: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.2135: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.2136: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2137: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2138: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2139: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.2140: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2141: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.2142: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.2143: DFBPPR8141 ---- Plant protein ---- Photosystem I reaction center subunit IX
Source.2144: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.2145: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2146: DFBPPR8180 ---- Plant protein ---- 45 kDa cell wall protein
Source.2147: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.2148: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2149: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.2150: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2151: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2152: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2153: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2154: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2155: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.2156: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.2157: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.2158: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2159: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.2160: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.2161: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.2162: DFBPPR8324 ---- Plant protein ---- Photosystem II reaction center protein Z
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe3+/mol peptide) was measured as a positive control. The peptide ALI showed low antioxidant activity with a relative antioxidant activity of 0.17 ± 0.08 mmol Fe3+/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63.
Other literature(s) N.D
PubDate 2015
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214