E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0835(Antioxidative peptide)
DFBP ID DFBPANOX0835
Peptide sequence VAG
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Val-Ala-Gly
Single-letter amino acid VAG
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 245.28 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 1.8667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine whey protein
Precursor protein β-Lactoglobulin
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.3: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.4: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.6: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.7: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.8: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.9: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.10: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.11: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.12: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.13: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.14: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.15: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.16: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.17: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.18: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.19: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.20: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.21: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.22: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.23: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.24: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.25: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.26: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.27: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.28: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.29: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.30: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.31: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.32: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.33: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.34: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.35: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.36: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.37: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.38: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.39: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.40: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.41: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.42: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.43: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.44: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.45: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.46: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.47: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.48: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.49: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.50: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.51: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.52: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.53: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.54: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.55: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.56: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.57: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.58: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.59: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.60: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.61: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.62: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.63: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.64: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.65: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.66: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.67: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.68: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.69: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.70: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.71: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.72: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.73: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.74: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.75: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.76: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.77: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.78: DFBPPR1150 ---- Plant proteins ---- Abscisic stress-ripening protein 5
Source.79: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.80: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.81: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.82: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.83: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.84: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.85: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.86: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.87: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.88: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.89: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.90: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.91: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.92: DFBPPR1253 ---- Plant proteins ---- Phospholipase A2 homolog 3
Source.93: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.94: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.95: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.96: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.97: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.98: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.99: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.100: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.101: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.102: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.103: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.104: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.105: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.106: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.107: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.108: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.109: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic
Source.110: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.111: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.112: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.113: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.114: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.115: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.116: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.117: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.118: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.119: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.120: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.121: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.122: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.123: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.124: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.125: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.126: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.127: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.128: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.129: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.130: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.131: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.132: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.133: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.134: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.135: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.136: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.137: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1
Source.138: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.139: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.140: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.141: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.142: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.143: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.144: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.145: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.146: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.147: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.148: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.149: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.150: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.151: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1
Source.152: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.153: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.154: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.155: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.156: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.157: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.158: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.159: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.160: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.161: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.162: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.163: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.164: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.165: DFBPPR1580 ---- Plant proteins ---- Expansin-A4
Source.166: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.167: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.168: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.169: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.170: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.171: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.172: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.173: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.174: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.175: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.176: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.177: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.178: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.179: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.180: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.181: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.182: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.183: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.184: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.185: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.186: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.187: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.188: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.189: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.190: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.191: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.192: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.193: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.194: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.195: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1
Source.196: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.197: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.198: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.199: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.200: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.201: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.202: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.203: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.204: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.205: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.206: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.207: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1
Source.208: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.209: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.210: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.211: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.212: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.213: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.214: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.215: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.216: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.217: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.218: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.219: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.220: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.221: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.222: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.223: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.224: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.225: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.226: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.227: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.228: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.229: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.230: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.231: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.232: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.233: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.234: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.235: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.236: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.237: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.238: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.239: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.240: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.241: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.242: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.243: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.244: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.245: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.246: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.247: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.248: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4
Source.249: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.250: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.251: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.252: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.253: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.254: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.255: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.256: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.257: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.258: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.259: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.260: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.261: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.262: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.263: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.264: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.265: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.266: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.267: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.268: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.269: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.270: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein
Source.271: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.272: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.273: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.274: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.275: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.276: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.277: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.278: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.279: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.280: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.281: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.282: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.283: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.284: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.285: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.286: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.287: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.288: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.289: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.290: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.291: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.292: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.293: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.294: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.295: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.296: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.297: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.298: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.299: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.300: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.301: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.302: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.303: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.304: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.305: DFBPPR2245 ---- Plant proteins ---- Expansin-A26
Source.306: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.307: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.308: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.309: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.310: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.311: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.312: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.313: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa
Source.314: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.315: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1
Source.316: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.317: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.318: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.319: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.320: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.321: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.322: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.323: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.324: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.325: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.326: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.327: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.328: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.329: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2
Source.330: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.331: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.332: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.333: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.334: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.335: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.336: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.337: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.338: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1
Source.339: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.340: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.341: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.342: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.343: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3
Source.344: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.345: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.346: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.347: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.348: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.349: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.350: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.351: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.352: DFBPPR2491 ---- Plant proteins ---- Expansin-A10
Source.353: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.354: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.355: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.356: DFBPPR2500 ---- Plant proteins ---- Arabinogalactan peptide 2
Source.357: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.358: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.359: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.360: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.361: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.362: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.363: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.364: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.365: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.366: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.367: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.368: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.369: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.370: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.371: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.372: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.373: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.374: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.375: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.376: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.377: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.378: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1
Source.379: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.380: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.381: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.382: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.383: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.384: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.385: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.386: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.387: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.388: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.389: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.390: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.391: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2
Source.392: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.393: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.394: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.395: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.396: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.397: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.398: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.399: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.400: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.401: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.402: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.403: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.404: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.405: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.406: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.407: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.408: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.409: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.410: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.411: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.412: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.413: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.414: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.415: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.416: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.417: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c
Source.418: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.419: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.420: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.421: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.422: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.423: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.424: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.425: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.426: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.427: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.428: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.429: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.430: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.431: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.432: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.433: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.434: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B
Source.435: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.436: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.437: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.438: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.439: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.440: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.441: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.442: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.443: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.444: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.445: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1
Source.446: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.447: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.448: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.449: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.450: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.451: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.452: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.453: DFBPPR2952 ---- Plant proteins ---- Expansin-A17
Source.454: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.455: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.456: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.457: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.458: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.459: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.460: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.461: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.462: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.463: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.464: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.465: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.466: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.467: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.468: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.469: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.470: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.471: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.472: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein
Source.473: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.474: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.475: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.476: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.477: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.478: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.479: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.480: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.481: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.482: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.483: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.484: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.485: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.486: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.487: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.488: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7
Source.489: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.490: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.491: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.492: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.493: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8
Source.494: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.495: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.496: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13
Source.497: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.498: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.499: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.500: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.501: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.502: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.503: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.504: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.505: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.506: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.507: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.508: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.509: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.510: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.511: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.512: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.513: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial
Source.514: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.515: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.516: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.517: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.518: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.519: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.520: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.521: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.522: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.523: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.524: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.525: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.526: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.527: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.528: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.529: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.530: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.531: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.532: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.533: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.534: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.535: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.536: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.537: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.538: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.539: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.540: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.541: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.542: DFBPPR3337 ---- Plant proteins ---- Probable acylpyruvase FAHD1, mitochondrial
Source.543: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.544: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.545: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2
Source.546: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.547: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.548: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.549: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.550: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.551: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.552: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.553: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.554: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.555: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.556: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.557: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.558: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.559: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.560: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.561: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.562: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.563: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.564: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.565: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.566: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3
Source.567: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.568: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.569: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.570: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.571: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.572: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.573: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.574: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31
Source.575: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.576: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.577: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.578: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.579: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.580: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.581: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.582: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.583: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.584: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.585: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.586: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.587: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.588: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.589: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.590: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.591: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.592: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.593: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.594: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.595: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.596: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5
Source.597: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.598: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.599: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.600: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10
Source.601: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.602: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e
Source.603: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.604: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.605: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.606: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.607: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.608: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.609: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.610: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.611: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.612: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1
Source.613: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.614: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.615: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.616: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.617: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.618: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.619: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.620: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.621: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.622: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.623: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.624: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.625: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.626: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.627: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.628: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.629: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.630: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.631: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.632: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.633: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.634: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.635: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.636: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.637: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8
Source.638: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.639: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.640: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.641: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.642: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.643: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.644: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.645: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.646: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.647: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.648: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.649: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.650: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.651: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.652: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.653: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.654: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.655: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.656: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.657: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.658: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.659: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.660: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.661: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.662: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.663: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.664: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.665: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.666: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.667: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7
Source.668: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.669: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.670: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.671: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.672: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.673: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7
Source.674: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.675: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.676: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.677: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.678: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.679: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f
Source.680: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.681: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.682: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.683: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.684: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.685: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.686: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.687: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.688: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A
Source.689: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.690: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.691: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.692: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.693: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29
Source.694: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.695: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.696: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.697: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.698: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.699: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.700: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.701: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.702: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.703: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.704: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.705: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.706: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.707: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.708: DFBPPR4169 ---- Plant proteins ---- Succinate dehydrogenase subunit 6, mitochondrial
Source.709: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.710: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.711: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.712: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.713: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.714: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.715: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.716: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1
Source.717: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.718: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.719: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.720: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.721: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.722: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.723: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.724: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.725: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.726: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.727: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.728: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.729: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.730: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.731: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.732: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.733: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.734: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3
Source.735: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7
Source.736: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.737: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.738: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.739: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.740: DFBPPR4345 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 11
Source.741: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.742: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.743: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.744: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.745: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.746: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.747: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.748: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.749: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.750: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.751: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.752: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.753: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.754: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.755: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.756: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.757: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.758: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.759: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.760: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.761: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.762: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.763: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.764: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.765: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.766: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.767: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.768: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.769: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.770: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.771: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.772: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.773: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.774: DFBPPR4497 ---- Plant proteins ---- Cytochrome c oxidase subunit 5C
Source.775: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.776: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.777: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.778: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.779: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.780: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.781: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.782: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.783: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.784: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.785: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.786: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5
Source.787: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.788: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.789: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.790: DFBPPR4605 ---- Plant proteins ---- Protein LOL4
Source.791: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19
Source.792: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.793: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.794: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.795: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.796: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.797: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.798: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4
Source.799: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.800: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.801: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.802: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.803: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.804: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.805: DFBPPR4721 ---- Plant proteins ---- Protein YY1
Source.806: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.807: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.808: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.809: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.810: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300
Source.811: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.812: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.813: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.814: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.815: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090
Source.816: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.817: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58
Source.818: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.819: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.820: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.821: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.822: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.823: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.824: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.825: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.826: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.827: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.828: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.829: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.830: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.831: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.832: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.833: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.834: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.835: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.836: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.837: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.838: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.839: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.840: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.841: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.842: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.843: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.844: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.845: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.846: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.847: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.848: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.849: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.850: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.851: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.852: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.853: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.854: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22
Source.855: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B
Source.856: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.857: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A
Source.858: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.859: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.860: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.861: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.862: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.863: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.864: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.865: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.866: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.867: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.868: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.869: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.870: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.871: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.872: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.873: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.874: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.875: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.876: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.877: DFBPPR5385 ---- Plant proteins ---- Profilin-5
Source.878: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.879: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.880: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.881: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.882: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.883: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.884: DFBPPR5410 ---- Plant proteins ---- Profilin-4
Source.885: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.886: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.887: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.888: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.889: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.890: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.891: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.892: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.893: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.894: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.895: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.896: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.897: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.898: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.899: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.900: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.901: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.902: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.903: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.904: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.905: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.906: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.907: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.908: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.909: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.910: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.911: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.912: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1
Source.913: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.914: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.915: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.916: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.917: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.918: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.919: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.920: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.921: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.922: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.923: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.924: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.925: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.926: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.927: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.928: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.929: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.930: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.931: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.932: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.933: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.934: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.935: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.936: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.937: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.938: DFBPPR5706 ---- Plant proteins ---- Glutelin-2
Source.939: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.940: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.941: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.942: DFBPPR5736 ---- Plant proteins ---- Histone H1
Source.943: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.944: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.945: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.946: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.947: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.948: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.949: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.950: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.951: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.952: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.953: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.954: DFBPPR5827 ---- Plant proteins ---- 60S acidic ribosomal protein P2B
Source.955: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.956: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.957: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.958: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.959: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.960: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.961: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.962: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.963: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.964: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.965: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.966: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.967: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.968: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.969: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.970: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.971: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.972: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.973: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.974: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.975: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.976: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.977: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.978: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.979: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.980: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.981: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.982: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.983: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.984: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.985: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.986: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.987: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A
Source.988: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.989: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.990: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.991: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.992: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.993: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.994: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.995: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.996: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.997: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.998: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.999: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.1000: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.1001: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.1002: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1003: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.1004: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1005: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1006: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.1007: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic
Source.1008: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1009: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1010: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.1011: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.1012: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.1013: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.1014: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.1015: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.1016: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.1017: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.1018: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1019: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1020: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.1021: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.1022: DFBPPR6529 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.1023: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27
Source.1024: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1025: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1026: DFBPPR6639 ---- Plant proteins ---- Puroindoline-A
Source.1027: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.1028: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8
Source.1029: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.1030: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.1031: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5
Source.1032: DFBPPR6690 ---- Plant proteins ---- Histone H2A.2.2
Source.1033: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.1034: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1035: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1
Source.1036: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.1037: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.1038: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.1039: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1040: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.1041: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1042: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1043: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1044: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1045: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1046: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.1047: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1048: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1049: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1050: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.1051: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1052: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212
Source.1053: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial
Source.1054: DFBPPR6933 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.1055: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin
Source.1056: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1057: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.1058: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.1059: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1060: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.1061: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1062: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1063: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1064: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1065: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.1066: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.1067: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.1068: DFBPPR7056 ---- Plant proteins ---- Cysteine proteinase inhibitor
Source.1069: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1070: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1071: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.1072: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1
Source.1073: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1074: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1075: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1076: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1077: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.1078: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.1079: DFBPPR7146 ---- Plant proteins ---- Non-specific lipid-transfer protein Cw18
Source.1080: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.1081: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.1082: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.1083: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1084: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1085: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic
Source.1086: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1087: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.1088: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.1089: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1090: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.1091: DFBPPR7236 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.1092: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3
Source.1093: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4
Source.1094: DFBPPR7293 ---- Plant proteins ---- Cytochrome c oxidase subunit 5C
Source.1095: DFBPPR7310 ---- Plant proteins ---- ABA-inducible protein PHV A1
Source.1096: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1
Source.1097: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2
Source.1098: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2
Source.1099: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.1100: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.1101: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1102: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.1103: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.1104: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.1105: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.1106: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.1107: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.1108: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.1109: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase
Source.1110: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1111: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.1112: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1113: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2
Source.1114: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1115: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1116: DFBPPR7523 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.1117: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1118: DFBPPR7525 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.1119: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.1120: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.1121: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.1122: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.1123: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.1124: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1125: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.1126: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1127: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.1128: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.1129: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.1130: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1131: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1
Source.1132: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2
Source.1133: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.1134: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.1135: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.1136: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1137: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.1138: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.1139: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.1140: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1141: DFBPPR8383 ---- Plant proteins ---- Defensin 1
Source.1142: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.1143: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.1144: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101
Source.1145: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102
Source.1146: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101
Source.1147: DFBPPR8412 ---- Plant proteins ---- Oleosin Ara h 10.0102
Source.1148: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.1149: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.1150: DFBPPR8425 ---- Plant proteins ---- Oleosin L
Source.1151: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.1152: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.1153: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1154: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1155: DFBPPR8475 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.1156: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7
Source.1157: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.1158: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.1159: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.1160: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.1161: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1162: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1163: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1164: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1165: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.1166: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.1167: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.1168: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor
Source.1169: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1170: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1171: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.1172: DFBPPR16006 ---- Animal proteins ---- Leptin
Source.1173: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1174: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1175: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1176: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.1177: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.1178: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.1179: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1180: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1181: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1182: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1183: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1184: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.1185: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.1186: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.1187: DFBPPR16073 ---- Animal proteins ---- Endothelin-1
Source.1188: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.1189: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.1190: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.1191: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.1192: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.1193: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1194: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.1195: DFBPPR16110 ---- Animal proteins ---- Pro-glucagon
Source.1196: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.1197: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.1198: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1199: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.1200: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.1201: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.1202: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.1203: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1204: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1205: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.1206: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.1207: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1208: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.1209: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1210: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1211: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1212: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1213: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.1214: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.1215: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.1216: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1217: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1218: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1219: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.1220: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1221: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.1222: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1223: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.1224: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta
Source.1225: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.1226: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.1227: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1228: DFBPPR16285 ---- Animal proteins ---- Chymase
Source.1229: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.1230: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.1231: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.1232: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.1233: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1234: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.1235: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.1236: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.1237: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.1238: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.1239: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1240: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1241: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1242: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.1243: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1244: DFBPPR16487 ---- Animal proteins ---- Claudin-2
Source.1245: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1246: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1247: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.1248: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.1249: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1250: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.1251: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1252: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1253: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1254: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1
Source.1255: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2
Source.1256: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan
Source.1257: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3
Source.1258: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1259: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.1260: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.1261: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.1262: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.1263: DFBPPR16635 ---- Animal proteins ---- Corticoliberin
Source.1264: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.1265: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27
Source.1266: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1267: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.1268: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.1269: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.1270: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.1271: DFBPPR16715 ---- Animal proteins ---- Submaxillary mucin
Source.1272: DFBPPR16721 ---- Animal proteins ---- Testin
Source.1273: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1274: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.1275: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1276: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1277: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.1278: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.1279: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.1280: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1281: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta
Source.1282: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1283: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.1284: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1285: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.1286: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.1287: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.1288: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.1289: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1290: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.1291: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.1292: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1293: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.1294: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.1295: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1296: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1297: DFBPPR16928 ---- Animal proteins ---- Endothelin-1
Source.1298: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1299: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.1300: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.1301: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1302: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.1303: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1304: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.1305: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.1306: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.1307: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.1308: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.1309: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.1310: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.1311: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1312: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1313: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.1314: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.1315: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1316: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1317: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1318: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1319: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.1320: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.1321: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.1322: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.1323: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.1324: DFBPPR17133 ---- Animal proteins ---- Pro-glucagon
Source.1325: DFBPPR17134 ---- Animal proteins ---- Pro-glucagon
Source.1326: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.1327: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1328: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.1329: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1330: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.1331: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.1332: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1333: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1334: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.1335: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.1336: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B
Source.1337: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.1338: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.1339: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.1340: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1341: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.1342: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.1343: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1344: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1345: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1346: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.1347: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.1348: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.1349: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.1350: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.1351: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.1352: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1353: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.1354: DFBPPR17423 ---- Animal proteins ---- Furin
Source.1355: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.1356: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1357: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1358: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.1359: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1360: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.1361: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1362: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1363: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.1364: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.1365: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.1366: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.1367: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.1368: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.1369: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.1370: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.1371: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1372: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.1373: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1374: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.1375: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1376: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.1377: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.1378: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1379: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1380: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3
Source.1381: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.1382: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1383: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1384: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.1385: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.1386: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.1387: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.1388: DFBPPR17586 ---- Animal proteins ---- Dermatopontin
Source.1389: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.1390: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.1391: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.1392: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.1393: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.1394: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.1395: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7
Source.1396: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.1397: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.1398: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.1399: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.1400: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.1401: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3
Source.1402: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.1403: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.1404: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.1405: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.1406: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1407: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.1408: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.1409: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1410: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1411: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1
Source.1412: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.1413: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1414: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.1415: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.1416: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.1417: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor
Source.1418: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.1419: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.1420: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.1421: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.1422: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.1423: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.1424: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial
Source.1425: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.1426: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.1427: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.1428: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.1429: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1430: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.1431: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9
Source.1432: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.1433: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.1434: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.1435: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1
Source.1436: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A
Source.1437: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.1438: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.1439: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.1440: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.1441: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1442: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1443: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta
Source.1444: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.1445: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1446: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.1447: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1448: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.1449: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.1450: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1451: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1452: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.1453: DFBPPR18071 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte
Source.1454: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.1455: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1456: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1457: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1458: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.1459: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1460: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.1461: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.1462: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.1463: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.1464: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.1465: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.1466: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.1467: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.1468: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.1469: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.1470: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.1471: DFBPPR18268 ---- Animal proteins ---- Myoglobin
Source.1472: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.1473: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.1474: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.1475: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.1476: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.1477: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.1478: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A
Source.1479: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.1480: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1481: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.1482: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.1483: DFBPPR18336 ---- Animal proteins ---- Small nuclear ribonucleoprotein Sm D1
Source.1484: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.1485: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.1486: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.1487: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.1488: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.1489: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.1490: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.1491: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1492: DFBPPR18448 ---- Animal proteins ---- Septin-1
Source.1493: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.1494: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1495: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.1496: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.1497: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.1498: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.1499: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.1500: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3
Source.1501: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.1502: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.1503: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.1504: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1505: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.1506: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.1507: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.1508: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.1509: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.1510: DFBPPR18573 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain
Source.1511: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1512: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.1513: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1514: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.1515: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1516: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1517: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.1518: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.1519: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.1520: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.1521: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1522: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.1523: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.1524: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.1525: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.1526: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.1527: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial
Source.1528: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1529: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.1530: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.1531: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.1532: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1533: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.1534: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.1535: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU
Source.1536: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.1537: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A
Source.1538: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.1539: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.1540: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.1541: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.1542: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1543: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.1544: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.1545: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1546: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.1547: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.1548: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.1549: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.1550: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1551: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.1552: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.1553: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.1554: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1555: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.1556: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.1557: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1558: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.1559: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.1560: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial
Source.1561: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.1562: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1563: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.1564: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein
Source.1565: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.1566: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.1567: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.1568: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.1569: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.1570: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.1571: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.1572: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1573: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.1574: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.1575: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.1576: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.1577: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.1578: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.1579: DFBPPR19078 ---- Animal proteins ---- Cystatin-B
Source.1580: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.1581: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.1582: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1583: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.1584: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.1585: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1586: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.1587: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma
Source.1588: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.1589: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.1590: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein
Source.1591: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.1592: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.1593: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.1594: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.1595: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.1596: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.1597: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha
Source.1598: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.1599: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1600: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.1601: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1602: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6
Source.1603: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.1604: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.1605: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.1606: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial
Source.1607: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.1608: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1609: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.1610: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.1611: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.1612: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.1613: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.1614: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.1615: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19
Source.1616: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.1617: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.1618: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.1619: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1620: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.1621: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1622: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1623: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1624: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.1625: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.1626: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1627: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1628: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.1629: DFBPPR19530 ---- Animal proteins ---- Tuftelin
Source.1630: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.1631: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.1632: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.1633: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.1634: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.1635: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.1636: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1637: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.1638: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.1639: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.1640: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.1641: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.1642: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B
Source.1643: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.1644: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.1645: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.1646: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.1647: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.1648: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.1649: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.1650: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1651: DFBPPR19745 ---- Animal proteins ---- Collectin-46
Source.1652: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.1653: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor
Source.1654: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1655: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.1656: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2
Source.1657: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.1658: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.1659: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.1660: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4
Source.1661: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.1662: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.1663: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.1664: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1665: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.1666: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1667: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.1668: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.1669: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.1670: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1671: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.1672: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.1673: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1674: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.1675: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.1676: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.1677: DFBPPR19937 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.1678: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1679: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.1680: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.1681: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.1682: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.1683: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.1684: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.1685: DFBPPR19979 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.1686: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1687: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16
Source.1688: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.1689: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR
Source.1690: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.1691: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1692: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.1693: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.1694: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.1695: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.1696: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.1697: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.1698: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.1699: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.1700: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.1701: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.1702: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.1703: DFBPPR20184 ---- Animal proteins ---- Centromere protein H
Source.1704: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1705: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.1706: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.1707: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.1708: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.1709: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.1710: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.1711: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.1712: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.1713: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6
Source.1714: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1715: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.1716: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.1717: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan
Source.1718: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.1719: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.1720: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.1721: DFBPPR20328 ---- Animal proteins ---- 40S ribosomal protein S23
Source.1722: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.1723: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.1724: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog
Source.1725: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.1726: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.1727: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.1728: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.1729: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1730: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.1731: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.1732: DFBPPR20438 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.1733: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1734: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.1735: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.1736: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1737: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.1738: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.1739: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.1740: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.1741: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.1742: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.1743: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.1744: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.1745: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.1746: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.1747: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1748: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.1749: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.1750: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A
Source.1751: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.1752: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.1753: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1754: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.1755: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.1756: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.1757: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.1758: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.1759: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.1760: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.1761: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.1762: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.1763: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.1764: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.1765: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.1766: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.1767: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.1768: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1769: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.1770: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.1771: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.1772: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.1773: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.1774: DFBPPR20923 ---- Animal proteins ---- Cystatin-A
Source.1775: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.1776: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.1777: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.1778: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.1779: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.1780: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.1781: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.1782: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial
Source.1783: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.1784: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27
Source.1785: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.1786: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.1787: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28
Source.1788: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.1789: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.1790: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.1791: DFBPPR21089 ---- Animal proteins ---- 39S ribosomal protein L11, mitochondrial
Source.1792: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.1793: DFBPPR21128 ---- Animal proteins ---- Stefin-C
Source.1794: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B
Source.1795: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.1796: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.1797: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.1798: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.1799: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.1800: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.1801: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3
Source.1802: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta
Source.1803: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.1804: DFBPPR21272 ---- Animal proteins ---- Testin
Source.1805: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.1806: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.1807: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.1808: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.1809: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.1810: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.1811: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.1812: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.1813: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.1814: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.1815: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.1816: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.1817: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.1818: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.1819: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.1820: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.1821: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.1822: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.1823: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.1824: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.1825: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.1826: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.1827: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.1828: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.1829: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.1830: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.1831: DFBPPR21513 ---- Animal proteins ---- Profilin-3
Source.1832: DFBPPR21531 ---- Animal proteins ---- 60S ribosomal protein L13
Source.1833: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.1834: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.1835: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.1836: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta
Source.1837: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.1838: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1839: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.1840: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.1841: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.1842: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.1843: DFBPPR21719 ---- Animal proteins ---- Protein reprimo
Source.1844: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.1845: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.1846: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.1847: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.1848: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6
Source.1849: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.1850: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.1851: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1852: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog
Source.1853: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier
Source.1854: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.1855: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.1856: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A
Source.1857: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.1858: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.1859: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.1860: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.1861: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.1862: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.1863: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.1864: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.1865: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.1866: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.1867: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.1868: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.1869: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81
Source.1870: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.1871: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.1872: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.1873: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.1874: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.1875: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.1876: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.1877: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.1878: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.1879: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.1880: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.1881: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.1882: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.1883: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.1884: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.1885: DFBPPR22190 ---- Animal proteins ---- Protein NKG7
Source.1886: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.1887: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1888: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.1889: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.1890: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.1891: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.1892: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.1893: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.1894: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31
Source.1895: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.1896: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.1897: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.1898: DFBPPR22336 ---- Animal proteins ---- 60S ribosomal protein L37a
Source.1899: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.1900: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.1901: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.1902: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.1903: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.1904: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.1905: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein
Source.1906: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.1907: DFBPPR22410 ---- Animal proteins ---- Small acidic protein
Source.1908: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.1909: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.1910: DFBPPR22436 ---- Animal proteins ---- Transmembrane protein 263
Source.1911: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.1912: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.1913: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1
Source.1914: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.1915: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1
Source.1916: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234
Source.1917: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141
Source.1918: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.1919: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.1920: DFBPPR22567 ---- Animal proteins ---- Ubiquitin-like protein FUBI
Source.1921: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A
Source.1922: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125
Source.1923: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.1924: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36
Source.1925: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.1926: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog
Source.1927: DFBPPR22730 ---- Animal proteins ---- UPF0545 protein C22orf39 homolog
Source.1928: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1929: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1930: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.1931: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1932: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.1933: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.1934: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.1935: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1936: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.1937: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1938: DFBPPR8564 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.1939: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.1940: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.1941: DFBPPR8589 ---- Animal proteins ---- Pro-glucagon
Source.1942: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.1943: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.1944: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1945: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.1946: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.1947: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1948: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.1949: DFBPPR8655 ---- Animal proteins ---- Azurocidin
Source.1950: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.1951: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1952: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.1953: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1954: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.1955: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.1956: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor
Source.1957: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1958: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.1959: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.1960: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.1961: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.1962: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.1963: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1964: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.1965: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1966: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.1967: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1968: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1969: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1970: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1971: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.1972: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.1973: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.1974: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1975: DFBPPR8803 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte
Source.1976: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.1977: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.1978: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.1979: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1980: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.1981: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.1982: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.1983: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1984: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.1985: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1986: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.1987: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta
Source.1988: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.1989: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.1990: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta
Source.1991: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1992: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1993: DFBPPR9009 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.1994: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1995: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.1996: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.1997: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.1998: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.1999: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.2000: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2001: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2002: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.2003: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.2004: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2005: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.2006: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2007: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.2008: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.2009: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1
Source.2010: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.2011: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6
Source.2012: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2013: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.2014: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2015: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.2016: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2017: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.2018: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2019: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2020: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.2021: DFBPPR9210 ---- Animal proteins ---- 40S ribosomal protein S23
Source.2022: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.2023: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.2024: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2025: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.2026: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C
Source.2027: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.2028: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.2029: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.2030: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.2031: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.2032: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.2033: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.2034: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.2035: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.2036: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.2037: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27
Source.2038: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.2039: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.2040: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2041: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2042: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.2043: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.2044: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.2045: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2046: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.2047: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.2048: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2049: DFBPPR9455 ---- Animal proteins ---- Cystatin-B
Source.2050: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.2051: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2052: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.2053: DFBPPR9497 ---- Animal proteins ---- Myoglobin
Source.2054: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.2055: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.2056: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta
Source.2057: DFBPPR9561 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2058: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.2059: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.2060: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.2061: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2062: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.2063: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.2064: DFBPPR9597 ---- Animal proteins ---- Insulin-like 3
Source.2065: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.2066: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.2067: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2068: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2069: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2070: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2071: DFBPPR9675 ---- Animal proteins ---- Cystatin-A5
Source.2072: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2073: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.2074: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta
Source.2075: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.2076: DFBPPR9728 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.2077: DFBPPR9732 ---- Animal proteins ---- Leukocyte cysteine proteinase inhibitor 1
Source.2078: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.2079: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2080: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.2081: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.2082: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.2083: DFBPPR9780 ---- Animal proteins ---- Small ubiquitin-related modifier 4
Source.2084: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.2085: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.2086: DFBPPR9814 ---- Animal proteins ---- Testin
Source.2087: DFBPPR9822 ---- Animal proteins ---- Selenoprotein W
Source.2088: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.2089: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.2090: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A
Source.2091: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2092: DFBPPR9887 ---- Animal proteins ---- Cystatin-A8
Source.2093: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1
Source.2094: DFBPPR9893 ---- Animal proteins ---- MICOS complex subunit MIC13
Source.2095: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31
Source.2096: DFBPPR9929 ---- Animal proteins ---- Tuftelin
Source.2097: DFBPPR9945 ---- Animal proteins ---- Ubiquitin-like protein FUBI
Source.2098: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.2099: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.2100: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.2101: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.2102: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2103: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2104: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.2105: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.2106: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.2107: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.2108: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6
Source.2109: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.2110: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2111: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.2112: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.2113: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.2114: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.2115: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2116: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.2117: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.2118: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.2119: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.2120: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.2121: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.2122: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.2123: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.2124: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.2125: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2126: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.2127: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.2128: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.2129: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.2130: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.2131: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.2132: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.2133: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1
Source.2134: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.2135: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.2136: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.2137: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.2138: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.2139: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.2140: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.2141: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.2142: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2143: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.2144: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.2145: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.2146: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.2147: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2148: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.2149: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.2150: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.2151: DFBPPR10339 ---- Animal proteins ---- Osteocalcin
Source.2152: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.2153: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.2154: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.2155: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.2156: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.2157: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.2158: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.2159: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.2160: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2161: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2162: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.2163: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.2164: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2165: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.2166: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2167: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.2168: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.2169: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.2170: DFBPPR10455 ---- Animal proteins ---- Protein S100-A10
Source.2171: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.2172: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.2173: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.2174: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.2175: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.2176: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.2177: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.2178: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2179: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.2180: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.2181: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.2182: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2183: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.2184: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.2185: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.2186: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.2187: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.2188: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2189: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.2190: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.2191: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.2192: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.2193: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.2194: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.2195: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.2196: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.2197: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.2198: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.2199: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.2200: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.2201: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.2202: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.2203: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.2204: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.2205: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.2206: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.2207: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.2208: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.2209: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2210: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.2211: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2212: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.2213: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.2214: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.2215: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.2216: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.2217: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.2218: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2219: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.2220: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.2221: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.2222: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.2223: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2224: DFBPPR10830 ---- Animal proteins ---- Gallinacin-7
Source.2225: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.2226: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.2227: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.2228: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.2229: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.2230: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.2231: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.2232: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.2233: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2234: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.2235: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.2236: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.2237: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.2238: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.2239: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2240: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.2241: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.2242: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.2243: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.2244: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.2245: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.2246: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2247: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.2248: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2249: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.2250: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.2251: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.2252: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.2253: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.2254: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.2255: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.2256: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.2257: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.2258: DFBPPR11174 ---- Animal proteins ---- Gallinacin-6
Source.2259: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.2260: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2261: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.2262: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.2263: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.2264: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2265: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.2266: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.2267: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.2268: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.2269: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.2270: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.2271: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.2272: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.2273: DFBPPR11283 ---- Animal proteins ---- Centromere protein U
Source.2274: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.2275: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.2276: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.2277: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.2278: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.2279: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.2280: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.2281: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.2282: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.2283: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.2284: DFBPPR11351 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.2285: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.2286: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.2287: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.2288: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.2289: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.2290: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.2291: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.2292: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.2293: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2294: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.2295: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6
Source.2296: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.2297: DFBPPR11442 ---- Animal proteins ---- 60S ribosomal protein L37a
Source.2298: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.2299: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.2300: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.2301: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.2302: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.2303: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.2304: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2305: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.2306: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.2307: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.2308: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2309: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.2310: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.2311: DFBPPR11554 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.2312: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.2313: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.2314: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.2315: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13
Source.2316: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.2317: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.2318: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.2319: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2320: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.2321: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.2322: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.2323: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2324: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.2325: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.2326: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.2327: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.2328: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.2329: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.2330: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.2331: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.2332: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27
Source.2333: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2334: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.2335: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.2336: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.2337: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.2338: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.2339: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.2340: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8
Source.2341: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.2342: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.2343: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.2344: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.2345: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.2346: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.2347: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.2348: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.2349: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.2350: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.2351: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.2352: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.2353: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.2354: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.2355: DFBPPR12027 ---- Animal proteins ---- Centromere protein L
Source.2356: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.2357: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.2358: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.2359: DFBPPR12065 ---- Animal proteins ---- Testin
Source.2360: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.2361: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2
Source.2362: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.2363: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.2364: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.2365: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.2366: DFBPPR12197 ---- Animal proteins ---- Transmembrane protein 263
Source.2367: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1
Source.2368: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.2369: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2370: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor
Source.2371: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.2372: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.2373: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2374: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.2375: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2376: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.2377: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.2378: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2379: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.2380: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.2381: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2382: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.2383: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.2384: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.2385: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.2386: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.2387: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2388: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2389: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.2390: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2391: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.2392: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2393: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.2394: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.2395: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2396: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2397: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.2398: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.2399: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.2400: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.2401: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2402: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.2403: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.2404: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.2405: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.2406: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.2407: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2408: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.2409: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.2410: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2411: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.2412: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2413: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.2414: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.2415: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.2416: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.2417: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.2418: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.2419: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.2420: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2421: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.2422: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.2423: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.2424: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2425: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.2426: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.2427: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.2428: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.2429: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.2430: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.2431: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.2432: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2433: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.2434: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.2435: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.2436: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2437: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.2438: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.2439: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2440: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.2441: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.2442: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.2443: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.2444: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.2445: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.2446: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.2447: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.2448: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma
Source.2449: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.2450: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.2451: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2452: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2453: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.2454: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.2455: DFBPPR12857 ---- Animal proteins ---- Arginase-1
Source.2456: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.2457: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2458: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2459: DFBPPR12899 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.2460: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.2461: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2462: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.2463: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.2464: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.2465: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2466: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.2467: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.2468: DFBPPR12978 ---- Animal proteins ---- Endothelin-3
Source.2469: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.2470: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.2471: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.2472: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2473: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2474: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.2475: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.2476: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.2477: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.2478: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.2479: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2480: DFBPPR13092 ---- Animal proteins ---- Testin
Source.2481: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.2482: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.2483: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2484: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2485: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2486: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.2487: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2488: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2489: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.2490: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2491: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.2492: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.2493: DFBPPR13197 ---- Animal proteins ---- Caveolin-2
Source.2494: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.2495: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.2496: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.2497: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta
Source.2498: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2499: DFBPPR13261 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.2500: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2501: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2502: DFBPPR13270 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.2503: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2
Source.2504: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.2505: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.2506: DFBPPR13321 ---- Animal proteins ---- Metallothionein-1B
Source.2507: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.2508: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.2509: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2510: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.2511: DFBPPR13409 ---- Animal proteins ---- Testin
Source.2512: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.2513: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.2514: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.2515: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.2516: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.2517: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A
Source.2518: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.2519: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.2520: DFBPPR13511 ---- Animal proteins ---- Myoglobin
Source.2521: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.2522: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2523: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2524: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.2525: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.2526: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2527: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.2528: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.2529: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2530: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.2531: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2532: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.2533: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.2534: DFBPPR13602 ---- Animal proteins ---- Acrosin
Source.2535: DFBPPR13609 ---- Animal proteins ---- Lutropin subunit beta
Source.2536: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2537: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta
Source.2538: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.2539: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.2540: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.2541: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.2542: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.2543: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.2544: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.2545: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.2546: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2547: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2548: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.2549: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2550: DFBPPR13709 ---- Animal proteins ---- Pro-glucagon
Source.2551: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.2552: DFBPPR13713 ---- Animal proteins ---- Plasminogen
Source.2553: DFBPPR13725 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain
Source.2554: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.2555: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.2556: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.2557: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.2558: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2559: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.2560: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.2561: DFBPPR13812 ---- Animal proteins ---- Myoglobin
Source.2562: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.2563: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2564: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2565: DFBPPR13832 ---- Animal proteins ---- Cystatin-B
Source.2566: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.2567: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.2568: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2569: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.2570: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2571: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.2572: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.2573: DFBPPR13918 ---- Animal proteins ---- Testin
Source.2574: DFBPPR13919 ---- Animal proteins ---- Selenoprotein W
Source.2575: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.2576: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.2577: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2578: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.2579: DFBPPR14030 ---- Animal proteins ---- Prepro-urotensin II-gamma
Source.2580: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2581: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2582: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.2583: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.2584: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.2585: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.2586: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9
Source.2587: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146
Source.2588: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.2589: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.2590: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.2591: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12
Source.2592: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.2593: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A
Source.2594: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine
Source.2595: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.2596: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.2597: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial
Source.2598: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.2599: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.2600: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain
Source.2601: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.2602: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.2603: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.2604: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.2605: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.2606: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain
Source.2607: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.2608: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2609: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.2610: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.2611: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.2612: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.2613: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.2614: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.2615: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha
Source.2616: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.2617: DFBPPR14383 ---- Marine protein ---- C-phycocyanin alpha chain
Source.2618: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.2619: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.2620: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.2621: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.2622: DFBPPR14395 ---- Marine protein ---- 30S ribosomal protein S13-2, chloroplastic
Source.2623: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.2624: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.2625: DFBPPR14470 ---- Marine protein ---- Photosystem I reaction center subunit PsaK
Source.2626: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.2627: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.2628: DFBPPR14552 ---- Marine protein ---- Lysozyme C II
Source.2629: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.2630: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.2631: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.2632: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.2633: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.2634: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9
Source.2635: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.2636: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.2637: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.2638: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.2639: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.2640: DFBPPR14670 ---- Marine protein ---- Fatty acid-binding protein, heart
Source.2641: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.2642: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.2643: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.2644: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.2645: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.2646: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.2647: DFBPPR14762 ---- Marine protein ---- Coagulogen
Source.2648: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.2649: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.2650: DFBPPR14812 ---- Marine protein ---- Alpha-2-macroglobulin homolog
Source.2651: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2652: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.2653: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.2654: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.2655: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.2656: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.2657: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.2658: DFBPPR14936 ---- Microorganism protein ---- Inner kinetochore subunit MCM21
Source.2659: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.2660: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.2661: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.2662: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.2663: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.2664: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.2665: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.2666: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.2667: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.2668: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.2669: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.2670: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.2671: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.2672: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.2673: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.2674: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial
Source.2675: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.2676: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6
Source.2677: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.2678: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11
Source.2679: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.2680: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28
Source.2681: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.2682: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.2683: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.2684: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.2685: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.2686: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.2687: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.2688: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.2689: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.2690: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.2691: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.2692: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.2693: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial
Source.2694: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.2695: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.2696: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.2697: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3
Source.2698: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.2699: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.2700: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.2701: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24
Source.2702: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1
Source.2703: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.2704: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.2705: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2706: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.2707: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.2708: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.2709: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.2710: DFBPPR15510 ---- Microorganism protein ---- Autophagy-related protein 29
Source.2711: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.2712: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1
Source.2713: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.2714: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.2715: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.2716: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.2717: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.2718: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.2719: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.2720: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.2721: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.2722: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.2723: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.2724: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.2725: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.2726: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.2727: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.2728: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component
Source.2729: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.2730: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.2731: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.2732: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.2733: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.2734: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.2735: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.2736: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.2737: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.2738: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2739: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.2740: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2741: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.2742: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.2743: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.2744: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.2745: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.2746: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.2747: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.2748: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.2749: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.2750: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.2751: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2752: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2753: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2754: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.2755: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2756: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.2757: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.2758: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4
Source.2759: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.2760: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.2761: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.2762: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.2763: DFBPPR8008 ---- Plant protein ---- CASP-like protein 5A2
Source.2764: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.2765: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.2766: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2767: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.2768: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.2769: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2770: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.2771: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.2772: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2773: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2774: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.2775: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.2776: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2777: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.2778: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.2779: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2780: DFBPPR8176 ---- Plant protein ---- 53 kDa cell wall protein
Source.2781: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.2782: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.2783: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.2784: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.2785: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2786: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2787: DFBPPR8262 ---- Plant protein ---- ATP-dependent zinc metalloprotease FTSH, chloroplastic
Source.2788: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2789: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.2790: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase
Source.2791: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.2792: DFBPPR8322 ---- Plant protein ---- Photosystem II reaction center protein J
Source.2793: DFBPPR8339 ---- Plant protein ---- Cysteine proteinase inhibitor B
Source.2794: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe3+/mol peptide) was measured as a positive control. The peptide VAG showed moderate antioxidant activity with a relative antioxidant activity of 2.55 ± 0.17 mmol Fe3+/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63.
Other literature(s) N.D
PubDate 2015
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214