Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0835(Antioxidative peptide)

DFBP ID	DFBPANOX0835
Peptide sequence	VAG
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Val-Ala-Gly

Single-letter amino acid

VAG

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	245.28 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.8667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.3: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.4: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.6: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.7: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.8: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.9: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.10: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.11: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2 Source.12: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.13: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.14: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.15: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.16: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.17: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.18: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.19: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.20: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.21: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1 Source.22: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.23: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.24: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.25: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.26: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.27: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.28: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.29: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.30: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7 Source.31: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.32: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.33: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.34: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.35: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.36: DFBPPR0971 ---- Plant proteins ---- Protein STAR1 Source.37: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7 Source.38: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.39: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6 Source.40: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.41: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.42: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.43: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.44: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.45: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.46: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.47: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.48: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.49: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.50: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.51: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.52: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.53: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.54: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.55: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.56: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12 Source.57: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.58: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.59: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.60: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.61: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.62: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.63: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.64: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.65: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.66: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.67: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.68: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.69: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3 Source.70: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.71: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.72: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.73: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.74: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.75: DFBPPR1142 ---- Plant proteins ---- Calreticulin Source.76: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.77: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.78: DFBPPR1150 ---- Plant proteins ---- Abscisic stress-ripening protein 5 Source.79: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.80: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.81: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.82: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.83: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2 Source.84: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.85: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.86: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.87: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.88: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.89: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.90: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.91: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24 Source.92: DFBPPR1253 ---- Plant proteins ---- Phospholipase A2 homolog 3 Source.93: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.94: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.95: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.96: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.97: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a Source.98: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.99: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b Source.100: DFBPPR1300 ---- Plant proteins ---- Protein G1 Source.101: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1 Source.102: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.103: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.104: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.105: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.106: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.107: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.108: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.109: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.110: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.111: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.112: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.113: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.114: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.115: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.116: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.117: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.118: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.119: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.120: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2 Source.121: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.122: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.123: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.124: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.125: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.126: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.127: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.128: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.129: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.130: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.131: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.132: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.133: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14 Source.134: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.135: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.136: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.137: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1 Source.138: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.139: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.140: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.141: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.142: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.143: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.144: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.145: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.146: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.147: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.148: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.149: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.150: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.151: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1 Source.152: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.153: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.154: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.155: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2 Source.156: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.157: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.158: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.159: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.160: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.161: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51 Source.162: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.163: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.164: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.165: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.166: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.167: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.168: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.169: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.170: DFBPPR1609 ---- Plant proteins ---- Expansin-B1 Source.171: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.172: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.173: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.174: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.175: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.176: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.177: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.178: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.179: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.180: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein Source.181: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.182: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.183: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.184: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.185: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b Source.186: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.187: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.188: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.189: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.190: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.191: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.192: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.193: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.194: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.195: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1 Source.196: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.197: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.198: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.199: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.200: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.201: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.202: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.203: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.204: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.205: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.206: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.207: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1 Source.208: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.209: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.210: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22 Source.211: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1 Source.212: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.213: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.214: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.215: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.216: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.217: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.218: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.219: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.220: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.221: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.222: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.223: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.224: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.225: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.226: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.227: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.228: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.229: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.230: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.231: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.232: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.233: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.234: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.235: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.236: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.237: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.238: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.239: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.240: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.241: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.242: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.243: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8 Source.244: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.245: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.246: DFBPPR1912 ---- Plant proteins ---- Expansin-B3 Source.247: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.248: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4 Source.249: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.250: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.251: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.252: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.253: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.254: DFBPPR1962 ---- Plant proteins ---- Expansin-A2 Source.255: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.256: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.257: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.258: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.259: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.260: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.261: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.262: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.263: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.264: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.265: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.266: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.267: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.268: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.269: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.270: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.271: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.272: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.273: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.274: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.275: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.276: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.277: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.278: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.279: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.280: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.281: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.282: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.283: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.284: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.285: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.286: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.287: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.288: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.289: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.290: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.291: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.292: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.293: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.294: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.295: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.296: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.297: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.298: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.299: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.300: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.301: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.302: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.303: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6 Source.304: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.305: DFBPPR2245 ---- Plant proteins ---- Expansin-A26 Source.306: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.307: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.308: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.309: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.310: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.311: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.312: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.313: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.314: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.315: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.316: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.317: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.318: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B Source.319: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.320: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.321: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.322: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial Source.323: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.324: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.325: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.326: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.327: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.328: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.329: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.330: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.331: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.332: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.333: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.334: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.335: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.336: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13 Source.337: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.338: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1 Source.339: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.340: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.341: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.342: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.343: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.344: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.345: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.346: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial Source.347: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.348: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.349: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.350: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.351: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2 Source.352: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.353: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic Source.354: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20 Source.355: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.356: DFBPPR2500 ---- Plant proteins ---- Arabinogalactan peptide 2 Source.357: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.358: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic Source.359: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.360: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.361: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.362: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.363: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.364: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.365: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.366: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.367: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase Source.368: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.369: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.370: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.371: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.372: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6 Source.373: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.374: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.375: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.376: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.377: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.378: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.379: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.380: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.381: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.382: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.383: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.384: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.385: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25 Source.386: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.387: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.388: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.389: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.390: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.391: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2 Source.392: DFBPPR2673 ---- Plant proteins ---- Expansin-B13 Source.393: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.394: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.395: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.396: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.397: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27 Source.398: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1 Source.399: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.400: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.401: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.402: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72 Source.403: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.404: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.405: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9 Source.406: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.407: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.408: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.409: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.410: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.411: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.412: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.413: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.414: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.415: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.416: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33 Source.417: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.418: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.419: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.420: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.421: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.422: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.423: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.424: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.425: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.426: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4 Source.427: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.428: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.429: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.430: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.431: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.432: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.433: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.434: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B Source.435: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4 Source.436: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.437: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.438: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.439: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.440: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.441: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.442: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.443: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.444: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.445: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1 Source.446: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.447: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.448: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.449: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.450: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.451: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.452: DFBPPR2948 ---- Plant proteins ---- Expansin-A25 Source.453: DFBPPR2952 ---- Plant proteins ---- Expansin-A17 Source.454: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.455: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.456: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.457: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.458: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.459: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.460: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.461: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.462: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic Source.463: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.464: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.465: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.466: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.467: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.468: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.469: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.470: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.471: DFBPPR3027 ---- Plant proteins ---- Expansin-A31 Source.472: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein Source.473: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.474: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.475: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.476: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.477: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.478: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.479: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.480: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.481: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.482: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.483: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.484: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.485: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.486: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.487: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.488: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.489: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.490: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.491: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.492: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.493: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.494: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.495: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.496: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13 Source.497: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.498: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.499: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.500: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.501: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1 Source.502: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic Source.503: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.504: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.505: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.506: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.507: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1 Source.508: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.509: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.510: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.511: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.512: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.513: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial Source.514: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.515: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.516: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.517: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.518: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.519: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.520: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.521: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.522: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70 Source.523: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.524: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.525: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3 Source.526: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.527: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.528: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.529: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.530: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.531: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.532: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.533: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.534: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.535: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.536: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.537: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13 Source.538: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.539: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30 Source.540: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.541: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10 Source.542: DFBPPR3337 ---- Plant proteins ---- Probable acylpyruvase FAHD1, mitochondrial Source.543: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.544: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.545: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2 Source.546: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.547: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.548: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.549: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.550: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.551: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1 Source.552: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.553: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.554: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.555: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.556: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.557: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.558: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.559: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.560: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11 Source.561: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1 Source.562: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.563: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.564: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.565: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.566: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3 Source.567: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.568: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17 Source.569: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.570: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.571: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.572: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.573: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.574: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.575: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.576: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.577: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.578: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.579: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.580: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.581: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.582: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic Source.583: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.584: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.585: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.586: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.587: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.588: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.589: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.590: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.591: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.592: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.593: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.594: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.595: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.596: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5 Source.597: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.598: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.599: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.600: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10 Source.601: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.602: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e Source.603: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.604: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.605: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.606: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.607: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.608: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.609: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2 Source.610: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4 Source.611: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.612: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1 Source.613: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.614: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.615: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.616: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.617: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.618: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.619: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.620: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.621: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.622: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.623: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.624: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.625: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.626: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.627: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28 Source.628: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.629: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.630: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12 Source.631: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.632: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2 Source.633: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1 Source.634: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77 Source.635: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.636: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.637: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8 Source.638: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.639: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.640: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.641: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog Source.642: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.643: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14 Source.644: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.645: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.646: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.647: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.648: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.649: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.650: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.651: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.652: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.653: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11 Source.654: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.655: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4 Source.656: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.657: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.658: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.659: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.660: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.661: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.662: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.663: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.664: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.665: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.666: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.667: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7 Source.668: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2 Source.669: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.670: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.671: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.672: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.673: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7 Source.674: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.675: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.676: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2 Source.677: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.678: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.679: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.680: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.681: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.682: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6 Source.683: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.684: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.685: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.686: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.687: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.688: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A Source.689: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.690: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.691: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.692: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.693: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29 Source.694: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.695: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1 Source.696: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.697: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.698: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.699: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.700: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1 Source.701: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2 Source.702: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74 Source.703: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.704: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.705: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H Source.706: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.707: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.708: DFBPPR4169 ---- Plant proteins ---- Succinate dehydrogenase subunit 6, mitochondrial Source.709: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.710: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.711: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.712: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.713: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1 Source.714: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.715: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.716: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.717: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.718: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.719: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.720: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.721: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.722: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.723: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.724: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.725: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2 Source.726: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.727: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.728: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.729: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.730: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.731: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4 Source.732: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.733: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.734: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.735: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.736: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.737: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like Source.738: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.739: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2 Source.740: DFBPPR4345 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 11 Source.741: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.742: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.743: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.744: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.745: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.746: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.747: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.748: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.749: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.750: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.751: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.752: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.753: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.754: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.755: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.756: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.757: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.758: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.759: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.760: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.761: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.762: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.763: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.764: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3 Source.765: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.766: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.767: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2 Source.768: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.769: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.770: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.771: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.772: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.773: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.774: DFBPPR4497 ---- Plant proteins ---- Cytochrome c oxidase subunit 5C Source.775: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.776: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.777: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.778: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.779: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5 Source.780: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.781: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.782: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.783: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.784: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1 Source.785: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.786: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5 Source.787: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1 Source.788: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.789: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.790: DFBPPR4605 ---- Plant proteins ---- Protein LOL4 Source.791: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19 Source.792: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.793: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43 Source.794: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.795: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.796: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1 Source.797: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.798: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4 Source.799: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein Source.800: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.801: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C Source.802: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.803: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4 Source.804: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4 Source.805: DFBPPR4721 ---- Plant proteins ---- Protein YY1 Source.806: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.807: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14 Source.808: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.809: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10 Source.810: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300 Source.811: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.812: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.813: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.814: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.815: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090 Source.816: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820 Source.817: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58 Source.818: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.819: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.820: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.821: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.822: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.823: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.824: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.825: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic Source.826: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.827: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.828: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.829: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.830: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.831: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.832: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.833: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23 Source.834: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.835: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.836: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.837: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.838: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.839: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.840: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.841: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.842: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.843: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.844: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.845: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.846: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.847: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.848: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.849: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein Source.850: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.851: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.852: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.853: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.854: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22 Source.855: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B Source.856: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.857: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A Source.858: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.859: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.860: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.861: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.862: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.863: DFBPPR5197 ---- Plant proteins ---- Nodulin-21 Source.864: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.865: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.866: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.867: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9 Source.868: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.869: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.870: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.871: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.872: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.873: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.874: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.875: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.876: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.877: DFBPPR5385 ---- Plant proteins ---- Profilin-5 Source.878: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.879: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.880: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.881: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.882: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.883: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.884: DFBPPR5410 ---- Plant proteins ---- Profilin-4 Source.885: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.886: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.887: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.888: DFBPPR5432 ---- Plant proteins ---- Expansin-B1 Source.889: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.890: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.891: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.892: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.893: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.894: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.895: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein Source.896: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.897: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic Source.898: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.899: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.900: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.901: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.902: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.903: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.904: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.905: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.906: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.907: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.908: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.909: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10 Source.910: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.911: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.912: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1 Source.913: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.914: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.915: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.916: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.917: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.918: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.919: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.920: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.921: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.922: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.923: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.924: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.925: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.926: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.927: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.928: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.929: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.930: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.931: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.932: DFBPPR5670 ---- Plant proteins ---- Endochitinase B Source.933: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.934: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.935: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.936: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.937: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.938: DFBPPR5706 ---- Plant proteins ---- Glutelin-2 Source.939: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.940: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.941: DFBPPR5728 ---- Plant proteins ---- Calreticulin Source.942: DFBPPR5736 ---- Plant proteins ---- Histone H1 Source.943: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.944: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.945: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.946: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.947: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.948: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.949: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.950: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase Source.951: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.952: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.953: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.954: DFBPPR5827 ---- Plant proteins ---- 60S acidic ribosomal protein P2B Source.955: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.956: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.957: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.958: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.959: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.960: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.961: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.962: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.963: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4 Source.964: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.965: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1 Source.966: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1 Source.967: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.968: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.969: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.970: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.971: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.972: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1 Source.973: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.974: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9 Source.975: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.976: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.977: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.978: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1 Source.979: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2 Source.980: DFBPPR6052 ---- Plant proteins ---- Cystatin-1 Source.981: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.982: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.983: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.984: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3 Source.985: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1 Source.986: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3 Source.987: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A Source.988: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.989: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein Source.990: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.991: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.992: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.993: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.994: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.995: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.996: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.997: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.998: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.999: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.1000: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1 Source.1001: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.1002: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1003: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2 Source.1004: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.1005: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.1006: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.1007: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.1008: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1009: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1010: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1011: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.1012: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.1013: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.1014: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.1015: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.1016: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.1017: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.1018: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.1019: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.1020: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.1021: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic Source.1022: DFBPPR6529 ---- Plant proteins ---- Photosystem II reaction center protein J Source.1023: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27 Source.1024: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1025: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.1026: DFBPPR6639 ---- Plant proteins ---- Puroindoline-A Source.1027: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.1028: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8 Source.1029: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase Source.1030: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.1031: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5 Source.1032: DFBPPR6690 ---- Plant proteins ---- Histone H2A.2.2 Source.1033: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.1034: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.1035: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.1036: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein Source.1037: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase Source.1038: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.1039: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1 Source.1040: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.1041: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1042: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1043: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.1044: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1045: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1046: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2 Source.1047: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1048: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1049: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1050: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1051: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1052: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212 Source.1053: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial Source.1054: DFBPPR6933 ---- Plant proteins ---- Photosystem II reaction center protein J Source.1055: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin Source.1056: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.1057: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.1058: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.1059: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.1060: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.1061: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1062: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1063: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.1064: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.1065: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.1066: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II Source.1067: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein Source.1068: DFBPPR7056 ---- Plant proteins ---- Cysteine proteinase inhibitor Source.1069: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1070: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1071: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I Source.1072: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1 Source.1073: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1074: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.1075: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.1076: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.1077: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.1078: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.1079: DFBPPR7146 ---- Plant proteins ---- Non-specific lipid-transfer protein Cw18 Source.1080: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.1081: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.1082: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1 Source.1083: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1084: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1085: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic Source.1086: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1087: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.1088: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.1089: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1090: DFBPPR7222 ---- Plant proteins ---- Protein HVA22 Source.1091: DFBPPR7236 ---- Plant proteins ---- Photosystem II reaction center protein J Source.1092: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3 Source.1093: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4 Source.1094: DFBPPR7293 ---- Plant proteins ---- Cytochrome c oxidase subunit 5C Source.1095: DFBPPR7310 ---- Plant proteins ---- ABA-inducible protein PHV A1 Source.1096: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1 Source.1097: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2 Source.1098: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2 Source.1099: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.1100: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.1101: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.1102: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.1103: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.1104: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20 Source.1105: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.1106: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.1107: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.1108: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.1109: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.1110: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1111: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta Source.1112: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1113: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2 Source.1114: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.1115: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.1116: DFBPPR7523 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1117: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1118: DFBPPR7525 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1119: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.1120: DFBPPR7594 ---- Milk proteins ---- Lactadherin Source.1121: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin Source.1122: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.1123: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase Source.1124: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.1125: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.1126: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.1127: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.1128: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1129: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.1130: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.1131: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1 Source.1132: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.1133: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.1134: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.1135: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.1136: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1137: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1138: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.1139: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1140: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1141: DFBPPR8383 ---- Plant proteins ---- Defensin 1 Source.1142: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.1143: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1144: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101 Source.1145: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102 Source.1146: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101 Source.1147: DFBPPR8412 ---- Plant proteins ---- Oleosin Ara h 10.0102 Source.1148: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein Source.1149: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1150: DFBPPR8425 ---- Plant proteins ---- Oleosin L Source.1151: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.1152: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein Source.1153: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1154: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1155: DFBPPR8475 ---- Plant proteins ---- Photosystem II reaction center protein J Source.1156: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7 Source.1157: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.1158: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.1159: DFBPPR15935 ---- Animal proteins ---- Catalase Source.1160: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.1161: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1162: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1163: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1164: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1165: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.1166: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta Source.1167: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.1168: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor Source.1169: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1170: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1171: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.1172: DFBPPR16006 ---- Animal proteins ---- Leptin Source.1173: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1174: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.1175: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1176: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1177: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.1178: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.1179: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1180: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1181: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1182: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1183: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1184: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.1185: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln Source.1186: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX Source.1187: DFBPPR16073 ---- Animal proteins ---- Endothelin-1 Source.1188: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1189: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.1190: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.1191: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.1192: DFBPPR16096 ---- Animal proteins ---- Protein CLN8 Source.1193: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1194: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1195: DFBPPR16110 ---- Animal proteins ---- Pro-glucagon Source.1196: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1197: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.1198: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1199: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.1200: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.1201: DFBPPR16138 ---- Animal proteins ---- Claudin-3 Source.1202: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8 Source.1203: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1204: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1205: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.1206: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.1207: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.1208: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type Source.1209: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1210: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1211: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.1212: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.1213: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.1214: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.1215: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.1216: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.1217: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1218: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1219: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.1220: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1221: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.1222: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1223: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin Source.1224: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta Source.1225: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.1226: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.1227: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1228: DFBPPR16285 ---- Animal proteins ---- Chymase Source.1229: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.1230: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor Source.1231: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.1232: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2 Source.1233: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.1234: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1235: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1236: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.1237: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.1238: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1239: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1240: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1241: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1242: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2 Source.1243: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1244: DFBPPR16487 ---- Animal proteins ---- Claudin-2 Source.1245: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.1246: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.1247: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal Source.1248: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.1249: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.1250: DFBPPR16553 ---- Animal proteins ---- Tapasin Source.1251: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1252: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1253: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1254: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1 Source.1255: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2 Source.1256: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan Source.1257: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3 Source.1258: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1259: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.1260: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.1261: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.1262: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.1263: DFBPPR16635 ---- Animal proteins ---- Corticoliberin Source.1264: DFBPPR16638 ---- Animal proteins ---- Synapsin-1 Source.1265: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27 Source.1266: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1267: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.1268: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.1269: DFBPPR16693 ---- Animal proteins ---- Cingulin Source.1270: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.1271: DFBPPR16715 ---- Animal proteins ---- Submaxillary mucin Source.1272: DFBPPR16721 ---- Animal proteins ---- Testin Source.1273: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1274: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.1275: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.1276: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1277: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.1278: DFBPPR16796 ---- Animal proteins ---- Major prion protein Source.1279: DFBPPR16810 ---- Animal proteins ---- Cathepsin B Source.1280: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1281: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta Source.1282: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1283: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.1284: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1285: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1286: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.1287: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor Source.1288: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.1289: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1290: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.1291: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.1292: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.1293: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1 Source.1294: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.1295: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.1296: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1297: DFBPPR16928 ---- Animal proteins ---- Endothelin-1 Source.1298: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1299: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1300: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.1301: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1302: DFBPPR16960 ---- Animal proteins ---- Catalase Source.1303: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.1304: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1305: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8 Source.1306: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5 Source.1307: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.1308: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17 Source.1309: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.1310: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog Source.1311: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1312: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1313: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.1314: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.1315: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1316: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1317: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1318: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.1319: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.1320: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7 Source.1321: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2 Source.1322: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.1323: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1 Source.1324: DFBPPR17133 ---- Animal proteins ---- Pro-glucagon Source.1325: DFBPPR17134 ---- Animal proteins ---- Pro-glucagon Source.1326: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1327: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1328: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.1329: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1330: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.1331: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.1332: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1333: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1334: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1 Source.1335: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.1336: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B Source.1337: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.1338: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.1339: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.1340: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1341: DFBPPR17334 ---- Animal proteins ---- Prohibitin Source.1342: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.1343: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1344: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1345: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1346: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.1347: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6 Source.1348: DFBPPR17376 ---- Animal proteins ---- Flotillin-1 Source.1349: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.1350: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.1351: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.1352: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.1353: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.1354: DFBPPR17423 ---- Animal proteins ---- Furin Source.1355: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.1356: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1357: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.1358: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1359: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1360: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1361: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.1362: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1363: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.1364: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.1365: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.1366: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.1367: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1368: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.1369: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.1370: DFBPPR17504 ---- Animal proteins ---- Duodenase-1 Source.1371: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.1372: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.1373: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1374: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase Source.1375: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1376: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.1377: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E Source.1378: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.1379: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1380: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3 Source.1381: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.1382: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1383: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1384: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.1385: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.1386: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.1387: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1388: DFBPPR17586 ---- Animal proteins ---- Dermatopontin Source.1389: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2 Source.1390: DFBPPR17592 ---- Animal proteins ---- Claudin-3 Source.1391: DFBPPR17593 ---- Animal proteins ---- Claudin-3 Source.1392: DFBPPR17599 ---- Animal proteins ---- Tissue factor Source.1393: DFBPPR17600 ---- Animal proteins ---- Tissue factor Source.1394: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH) Source.1395: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7 Source.1396: DFBPPR17618 ---- Animal proteins ---- Synaptophysin Source.1397: DFBPPR17626 ---- Animal proteins ---- Elastin Source.1398: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.1399: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.1400: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.1401: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3 Source.1402: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.1403: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1404: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.1405: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.1406: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1407: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.1408: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.1409: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.1410: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.1411: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1 Source.1412: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3 Source.1413: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1414: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase Source.1415: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.1416: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.1417: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor Source.1418: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1419: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.1420: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1421: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.1422: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1423: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.1424: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial Source.1425: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.1426: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.1427: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.1428: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.1429: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.1430: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.1431: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9 Source.1432: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.1433: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.1434: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.1435: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1 Source.1436: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A Source.1437: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.1438: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.1439: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.1440: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.1441: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.1442: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1443: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta Source.1444: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.1445: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1446: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.1447: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1448: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial Source.1449: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2 Source.1450: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1451: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1452: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.1453: DFBPPR18071 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte Source.1454: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta Source.1455: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1456: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1457: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1458: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.1459: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.1460: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII Source.1461: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.1462: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25 Source.1463: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1464: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5 Source.1465: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.1466: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.1467: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.1468: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase Source.1469: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.1470: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.1471: DFBPPR18268 ---- Animal proteins ---- Myoglobin Source.1472: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.1473: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.1474: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.1475: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase Source.1476: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.1477: DFBPPR18307 ---- Animal proteins ---- Claudin-4 Source.1478: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.1479: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B Source.1480: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.1481: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.1482: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6 Source.1483: DFBPPR18336 ---- Animal proteins ---- Small nuclear ribonucleoprotein Sm D1 Source.1484: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.1485: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2 Source.1486: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Source.1487: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.1488: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.1489: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.1490: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10 Source.1491: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1492: DFBPPR18448 ---- Animal proteins ---- Septin-1 Source.1493: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2 Source.1494: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.1495: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.1496: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1 Source.1497: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.1498: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.1499: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.1500: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3 Source.1501: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1502: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein Source.1503: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.1504: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.1505: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.1506: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.1507: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.1508: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.1509: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.1510: DFBPPR18573 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.1511: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.1512: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.1513: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.1514: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.1515: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1516: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1517: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.1518: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type Source.1519: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.1520: DFBPPR18698 ---- Animal proteins ---- ATPase GET3 Source.1521: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4 Source.1522: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1 Source.1523: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1524: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3 Source.1525: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.1526: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1527: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial Source.1528: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1529: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.1530: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.1531: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.1532: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1533: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.1534: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A Source.1535: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU Source.1536: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C Source.1537: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A Source.1538: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.1539: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.1540: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.1541: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.1542: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1543: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.1544: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type Source.1545: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1546: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.1547: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.1548: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1549: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1550: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.1551: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.1552: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.1553: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.1554: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.1555: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.1556: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.1557: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.1558: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.1559: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein Source.1560: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial Source.1561: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.1562: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1563: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.1564: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein Source.1565: DFBPPR18986 ---- Animal proteins ---- Granzyme A Source.1566: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.1567: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1 Source.1568: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.1569: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa Source.1570: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.1571: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.1572: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1573: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.1574: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.1575: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1576: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.1577: DFBPPR19055 ---- Animal proteins ---- Complement factor D Source.1578: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.1579: DFBPPR19078 ---- Animal proteins ---- Cystatin-B Source.1580: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.1581: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.1582: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1583: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.1584: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.1585: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1586: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.1587: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma Source.1588: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.1589: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.1590: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein Source.1591: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A Source.1592: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.1593: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169 Source.1594: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.1595: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.1596: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.1597: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.1598: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.1599: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1600: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.1601: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.1602: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6 Source.1603: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.1604: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.1605: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.1606: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial Source.1607: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85 Source.1608: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1609: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.1610: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1611: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.1612: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3 Source.1613: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.1614: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.1615: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19 Source.1616: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.1617: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.1618: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.1619: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1620: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B Source.1621: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1622: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.1623: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1624: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.1625: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase Source.1626: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1627: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1628: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.1629: DFBPPR19530 ---- Animal proteins ---- Tuftelin Source.1630: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.1631: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.1632: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.1633: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.1634: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.1635: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.1636: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1637: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.1638: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.1639: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.1640: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4 Source.1641: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.1642: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B Source.1643: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.1644: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter Source.1645: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.1646: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.1647: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1648: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2 Source.1649: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.1650: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1651: DFBPPR19745 ---- Animal proteins ---- Collectin-46 Source.1652: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.1653: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor Source.1654: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.1655: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.1656: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Source.1657: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.1658: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.1659: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.1660: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4 Source.1661: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.1662: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1663: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase Source.1664: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.1665: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1666: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1667: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.1668: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.1669: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial Source.1670: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.1671: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1 Source.1672: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1673: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.1674: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial Source.1675: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1 Source.1676: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor Source.1677: DFBPPR19937 ---- Animal proteins ---- Prostamide/prostaglandin F synthase Source.1678: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.1679: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.1680: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.1681: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.1682: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.1683: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.1684: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1685: DFBPPR19979 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.1686: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.1687: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.1688: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.1689: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR Source.1690: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.1691: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1692: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.1693: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.1694: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.1695: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1696: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.1697: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.1698: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9 Source.1699: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase Source.1700: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.1701: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.1702: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1703: DFBPPR20184 ---- Animal proteins ---- Centromere protein H Source.1704: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1705: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.1706: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.1707: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.1708: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.1709: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein Source.1710: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1 Source.1711: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79 Source.1712: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1 Source.1713: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6 Source.1714: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.1715: DFBPPR20296 ---- Animal proteins ---- Claudin-18 Source.1716: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.1717: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.1718: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial Source.1719: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.1720: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.1721: DFBPPR20328 ---- Animal proteins ---- 40S ribosomal protein S23 Source.1722: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.1723: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.1724: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog Source.1725: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.1726: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.1727: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.1728: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial Source.1729: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.1730: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog Source.1731: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.1732: DFBPPR20438 ---- Animal proteins ---- Small ubiquitin-related modifier 3 Source.1733: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.1734: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.1735: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.1736: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus Source.1737: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.1738: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54 Source.1739: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.1740: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.1741: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1 Source.1742: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.1743: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.1744: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.1745: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.1746: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.1747: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.1748: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.1749: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi Source.1750: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A Source.1751: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1752: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.1753: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.1754: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5 Source.1755: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.1756: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.1757: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1758: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.1759: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.1760: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.1761: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1 Source.1762: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.1763: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45 Source.1764: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial Source.1765: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.1766: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.1767: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.1768: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.1769: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.1770: DFBPPR20824 ---- Animal proteins ---- CD151 antigen Source.1771: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.1772: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143 Source.1773: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1774: DFBPPR20923 ---- Animal proteins ---- Cystatin-A Source.1775: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.1776: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial Source.1777: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14 Source.1778: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A Source.1779: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17 Source.1780: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.1781: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1 Source.1782: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial Source.1783: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.1784: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27 Source.1785: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.1786: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.1787: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.1788: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D Source.1789: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter Source.1790: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.1791: DFBPPR21089 ---- Animal proteins ---- 39S ribosomal protein L11, mitochondrial Source.1792: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.1793: DFBPPR21128 ---- Animal proteins ---- Stefin-C Source.1794: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B Source.1795: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.1796: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6 Source.1797: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.1798: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.1799: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog Source.1800: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.1801: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3 Source.1802: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta Source.1803: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.1804: DFBPPR21272 ---- Animal proteins ---- Testin Source.1805: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4 Source.1806: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.1807: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.1808: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.1809: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H Source.1810: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115 Source.1811: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.1812: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9 Source.1813: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.1814: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.1815: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.1816: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.1817: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.1818: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.1819: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.1820: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.1821: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.1822: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.1823: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1 Source.1824: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2 Source.1825: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.1826: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1827: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.1828: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8 Source.1829: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.1830: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.1831: DFBPPR21513 ---- Animal proteins ---- Profilin-3 Source.1832: DFBPPR21531 ---- Animal proteins ---- 60S ribosomal protein L13 Source.1833: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39 Source.1834: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.1835: DFBPPR21620 ---- Animal proteins ---- Claudin-12 Source.1836: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.1837: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.1838: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.1839: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.1840: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.1841: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.1842: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B Source.1843: DFBPPR21719 ---- Animal proteins ---- Protein reprimo Source.1844: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.1845: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.1846: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein Source.1847: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.1848: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6 Source.1849: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.1850: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.1851: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1852: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog Source.1853: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier Source.1854: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A Source.1855: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.1856: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A Source.1857: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.1858: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.1859: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.1860: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2 Source.1861: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2 Source.1862: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6 Source.1863: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14 Source.1864: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.1865: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.1866: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10 Source.1867: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein Source.1868: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.1869: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81 Source.1870: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1 Source.1871: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.1872: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4 Source.1873: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.1874: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.1875: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6 Source.1876: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.1877: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.1878: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.1879: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein Source.1880: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.1881: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24 Source.1882: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.1883: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.1884: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2 Source.1885: DFBPPR22190 ---- Animal proteins ---- Protein NKG7 Source.1886: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.1887: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.1888: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.1889: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1890: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34 Source.1891: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog Source.1892: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40 Source.1893: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial Source.1894: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31 Source.1895: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70 Source.1896: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.1897: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.1898: DFBPPR22336 ---- Animal proteins ---- 60S ribosomal protein L37a Source.1899: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.1900: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.1901: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1 Source.1902: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.1903: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92 Source.1904: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.1905: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein Source.1906: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.1907: DFBPPR22410 ---- Animal proteins ---- Small acidic protein Source.1908: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.1909: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog Source.1910: DFBPPR22436 ---- Animal proteins ---- Transmembrane protein 263 Source.1911: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11 Source.1912: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9 Source.1913: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.1914: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.1915: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1 Source.1916: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234 Source.1917: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141 Source.1918: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3 Source.1919: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2 Source.1920: DFBPPR22567 ---- Animal proteins ---- Ubiquitin-like protein FUBI Source.1921: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A Source.1922: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.1923: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128 Source.1924: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36 Source.1925: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog Source.1926: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog Source.1927: DFBPPR22730 ---- Animal proteins ---- UPF0545 protein C22orf39 homolog Source.1928: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1929: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1930: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.1931: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.1932: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.1933: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.1934: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.1935: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.1936: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.1937: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1938: DFBPPR8564 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.1939: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.1940: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.1941: DFBPPR8589 ---- Animal proteins ---- Pro-glucagon Source.1942: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.1943: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.1944: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.1945: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.1946: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1 Source.1947: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.1948: DFBPPR8642 ---- Animal proteins ---- Major prion protein Source.1949: DFBPPR8655 ---- Animal proteins ---- Azurocidin Source.1950: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.1951: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1952: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.1953: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1954: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.1955: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.1956: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor Source.1957: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1958: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1959: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.1960: DFBPPR8707 ---- Animal proteins ---- Flotillin-1 Source.1961: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.1962: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.1963: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1964: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.1965: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1966: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.1967: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.1968: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.1969: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1970: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1971: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.1972: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1 Source.1973: DFBPPR8792 ---- Animal proteins ---- Plasminogen Source.1974: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.1975: DFBPPR8803 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte Source.1976: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1977: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.1978: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.1979: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.1980: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1981: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1982: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.1983: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.1984: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1985: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.1986: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.1987: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta Source.1988: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B Source.1989: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1990: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta Source.1991: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1992: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.1993: DFBPPR9009 ---- Animal proteins ---- Prostamide/prostaglandin F synthase Source.1994: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1995: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.1996: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.1997: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.1998: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.1999: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2000: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2001: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.2002: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.2003: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.2004: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2005: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.2006: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2007: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2008: DFBPPR9116 ---- Animal proteins ---- Cathepsin B Source.2009: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1 Source.2010: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.2011: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6 Source.2012: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2013: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.2014: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2015: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.2016: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2017: DFBPPR9174 ---- Animal proteins ---- Ficolin-1 Source.2018: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase Source.2019: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2020: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain Source.2021: DFBPPR9210 ---- Animal proteins ---- 40S ribosomal protein S23 Source.2022: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.2023: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII Source.2024: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2025: DFBPPR9221 ---- Animal proteins ---- Catalase Source.2026: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C Source.2027: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.2028: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.2029: DFBPPR9254 ---- Animal proteins ---- Complement factor D Source.2030: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.2031: DFBPPR9265 ---- Animal proteins ---- Pantetheinase Source.2032: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.2033: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.2034: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.2035: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.2036: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.2037: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27 Source.2038: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase Source.2039: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2040: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2041: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2042: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.2043: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.2044: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.2045: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2046: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.2047: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.2048: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2049: DFBPPR9455 ---- Animal proteins ---- Cystatin-B Source.2050: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase Source.2051: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.2052: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type Source.2053: DFBPPR9497 ---- Animal proteins ---- Myoglobin Source.2054: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain Source.2055: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.2056: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta Source.2057: DFBPPR9561 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2058: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.2059: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3 Source.2060: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial Source.2061: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.2062: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2 Source.2063: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2064: DFBPPR9597 ---- Animal proteins ---- Insulin-like 3 Source.2065: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.2066: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2067: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2068: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.2069: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2070: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2071: DFBPPR9675 ---- Animal proteins ---- Cystatin-A5 Source.2072: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2073: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.2074: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta Source.2075: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2076: DFBPPR9728 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.2077: DFBPPR9732 ---- Animal proteins ---- Leukocyte cysteine proteinase inhibitor 1 Source.2078: DFBPPR9751 ---- Animal proteins ---- Perilipin-3 Source.2079: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2080: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.2081: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.2082: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.2083: DFBPPR9780 ---- Animal proteins ---- Small ubiquitin-related modifier 4 Source.2084: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.2085: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H Source.2086: DFBPPR9814 ---- Animal proteins ---- Testin Source.2087: DFBPPR9822 ---- Animal proteins ---- Selenoprotein W Source.2088: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.2089: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.2090: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A Source.2091: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2092: DFBPPR9887 ---- Animal proteins ---- Cystatin-A8 Source.2093: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1 Source.2094: DFBPPR9893 ---- Animal proteins ---- MICOS complex subunit MIC13 Source.2095: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31 Source.2096: DFBPPR9929 ---- Animal proteins ---- Tuftelin Source.2097: DFBPPR9945 ---- Animal proteins ---- Ubiquitin-like protein FUBI Source.2098: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.2099: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin Source.2100: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.2101: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.2102: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.2103: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2104: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type Source.2105: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.2106: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.2107: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein Source.2108: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6 Source.2109: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.2110: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.2111: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.2112: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.2113: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.2114: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.2115: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2116: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1 Source.2117: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7 Source.2118: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.2119: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.2120: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.2121: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.2122: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.2123: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.2124: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.2125: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2126: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.2127: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20 Source.2128: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.2129: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85 Source.2130: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.2131: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2132: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.2133: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1 Source.2134: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.2135: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.2136: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A Source.2137: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.2138: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.2139: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.2140: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.2141: DFBPPR10268 ---- Animal proteins ---- CD166 antigen Source.2142: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2143: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.2144: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6 Source.2145: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.2146: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.2147: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2148: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1 Source.2149: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.2150: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.2151: DFBPPR10339 ---- Animal proteins ---- Osteocalcin Source.2152: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.2153: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.2154: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.2155: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.2156: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.2157: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.2158: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2159: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.2160: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2161: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2162: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.2163: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2164: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2165: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.2166: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2167: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.2168: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.2169: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.2170: DFBPPR10455 ---- Animal proteins ---- Protein S100-A10 Source.2171: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.2172: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.2173: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.2174: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.2175: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.2176: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2 Source.2177: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.2178: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.2179: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2180: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2 Source.2181: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type Source.2182: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2183: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2184: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.2185: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.2186: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.2187: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.2188: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2189: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.2190: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.2191: DFBPPR10605 ---- Animal proteins ---- Elastin Source.2192: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.2193: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX Source.2194: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.2195: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.2196: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.2197: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.2198: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.2199: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.2200: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.2201: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.2202: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3 Source.2203: DFBPPR10686 ---- Animal proteins ---- Collectin-11 Source.2204: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.2205: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.2206: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.2207: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.2208: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2209: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.2210: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.2211: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2212: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2213: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.2214: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.2215: DFBPPR10747 ---- Animal proteins ---- Cathepsin B Source.2216: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.2217: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.2218: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2219: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.2220: DFBPPR10796 ---- Animal proteins ---- Protrudin Source.2221: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.2222: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain Source.2223: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2224: DFBPPR10830 ---- Animal proteins ---- Gallinacin-7 Source.2225: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.2226: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.2227: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.2228: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain Source.2229: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2 Source.2230: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.2231: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.2232: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.2233: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2234: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.2235: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.2236: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1 Source.2237: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.2238: DFBPPR10970 ---- Animal proteins ---- Prohibitin Source.2239: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.2240: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.2241: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.2242: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.2243: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.2244: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase Source.2245: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2246: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2247: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.2248: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2249: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1 Source.2250: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.2251: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.2252: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.2253: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.2254: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.2255: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.2256: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.2257: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.2258: DFBPPR11174 ---- Animal proteins ---- Gallinacin-6 Source.2259: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.2260: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.2261: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.2262: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.2263: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.2264: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2265: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1 Source.2266: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.2267: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.2268: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1 Source.2269: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1 Source.2270: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.2271: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.2272: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.2273: DFBPPR11283 ---- Animal proteins ---- Centromere protein U Source.2274: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.2275: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.2276: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4 Source.2277: DFBPPR11294 ---- Animal proteins ---- Frizzled-8 Source.2278: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.2279: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.2280: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.2281: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.2282: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.2283: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.2284: DFBPPR11351 ---- Animal proteins ---- Small ubiquitin-related modifier 3 Source.2285: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.2286: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.2287: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.2288: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.2289: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.2290: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.2291: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.2292: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1 Source.2293: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.2294: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.2295: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6 Source.2296: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.2297: DFBPPR11442 ---- Animal proteins ---- 60S ribosomal protein L37a Source.2298: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform Source.2299: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.2300: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.2301: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase Source.2302: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.2303: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.2304: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2305: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.2306: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.2307: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.2308: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.2309: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J Source.2310: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.2311: DFBPPR11554 ---- Animal proteins ---- Troponin I, cardiac muscle Source.2312: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.2313: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.2314: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.2315: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13 Source.2316: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.2317: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.2318: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus Source.2319: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2320: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.2321: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.2322: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1 Source.2323: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2324: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2325: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.2326: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.2327: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi Source.2328: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.2329: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.2330: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.2331: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.2332: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27 Source.2333: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2334: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36 Source.2335: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.2336: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.2337: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.2338: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.2339: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.2340: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.2341: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.2342: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2343: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.2344: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20 Source.2345: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.2346: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.2347: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.2348: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.2349: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.2350: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.2351: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.2352: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.2353: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.2354: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein Source.2355: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.2356: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.2357: DFBPPR12041 ---- Animal proteins ---- Paladin Source.2358: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.2359: DFBPPR12065 ---- Animal proteins ---- Testin Source.2360: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.2361: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.2362: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like Source.2363: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.2364: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2365: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.2366: DFBPPR12197 ---- Animal proteins ---- Transmembrane protein 263 Source.2367: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1 Source.2368: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.2369: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2370: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor Source.2371: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.2372: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2373: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2374: DFBPPR12278 ---- Animal proteins ---- Major prion protein Source.2375: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2376: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.2377: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.2378: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2379: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.2380: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.2381: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2382: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.2383: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.2384: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.2385: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.2386: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E Source.2387: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2388: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.2389: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.2390: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2391: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.2392: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.2393: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.2394: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.2395: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2396: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2397: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.2398: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.2399: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.2400: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.2401: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2402: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.2403: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.2404: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.2405: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.2406: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.2407: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2408: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2 Source.2409: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.2410: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2411: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.2412: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2413: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.2414: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2415: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.2416: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.2417: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.2418: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2419: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.2420: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2421: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.2422: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type Source.2423: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.2424: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2425: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.2426: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.2427: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.2428: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.2429: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.2430: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain Source.2431: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.2432: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2433: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.2434: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.2435: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.2436: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2437: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.2438: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.2439: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2440: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.2441: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.2442: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2443: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln Source.2444: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2445: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.2446: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.2447: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.2448: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma Source.2449: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2450: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.2451: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2452: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2453: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.2454: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1 Source.2455: DFBPPR12857 ---- Animal proteins ---- Arginase-1 Source.2456: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.2457: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2458: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.2459: DFBPPR12899 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.2460: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2461: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.2462: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.2463: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.2464: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase Source.2465: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2466: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.2467: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2468: DFBPPR12978 ---- Animal proteins ---- Endothelin-3 Source.2469: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.2470: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.2471: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2472: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2473: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2474: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.2475: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein Source.2476: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.2477: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D Source.2478: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5 Source.2479: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2480: DFBPPR13092 ---- Animal proteins ---- Testin Source.2481: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.2482: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.2483: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2484: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.2485: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2486: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor Source.2487: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2488: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2489: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase Source.2490: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2491: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.2492: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2493: DFBPPR13197 ---- Animal proteins ---- Caveolin-2 Source.2494: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.2495: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2 Source.2496: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B Source.2497: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta Source.2498: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.2499: DFBPPR13261 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.2500: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2501: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2502: DFBPPR13270 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.2503: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2 Source.2504: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein Source.2505: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta Source.2506: DFBPPR13321 ---- Animal proteins ---- Metallothionein-1B Source.2507: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2508: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2509: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2510: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.2511: DFBPPR13409 ---- Animal proteins ---- Testin Source.2512: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor Source.2513: DFBPPR13433 ---- Animal proteins ---- Major prion protein Source.2514: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.2515: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.2516: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8 Source.2517: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A Source.2518: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.2519: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.2520: DFBPPR13511 ---- Animal proteins ---- Myoglobin Source.2521: DFBPPR13530 ---- Animal proteins ---- Major prion protein Source.2522: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2523: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.2524: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.2525: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.2526: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2527: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.2528: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1 Source.2529: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2530: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor Source.2531: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2532: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.2533: DFBPPR13601 ---- Animal proteins ---- Cathepsin B Source.2534: DFBPPR13602 ---- Animal proteins ---- Acrosin Source.2535: DFBPPR13609 ---- Animal proteins ---- Lutropin subunit beta Source.2536: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.2537: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta Source.2538: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.2539: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.2540: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.2541: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.2542: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8 Source.2543: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.2544: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.2545: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2 Source.2546: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2547: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2548: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.2549: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2550: DFBPPR13709 ---- Animal proteins ---- Pro-glucagon Source.2551: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX Source.2552: DFBPPR13713 ---- Animal proteins ---- Plasminogen Source.2553: DFBPPR13725 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.2554: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.2555: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2556: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.2557: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A Source.2558: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2559: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.2560: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.2561: DFBPPR13812 ---- Animal proteins ---- Myoglobin Source.2562: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2 Source.2563: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.2564: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.2565: DFBPPR13832 ---- Animal proteins ---- Cystatin-B Source.2566: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2567: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2568: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2569: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3 Source.2570: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2571: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.2572: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.2573: DFBPPR13918 ---- Animal proteins ---- Testin Source.2574: DFBPPR13919 ---- Animal proteins ---- Selenoprotein W Source.2575: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter Source.2576: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta Source.2577: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2578: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.2579: DFBPPR14030 ---- Animal proteins ---- Prepro-urotensin II-gamma Source.2580: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2581: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2582: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2583: DFBPPR14073 ---- Marine protein ---- Elastase-1 Source.2584: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III Source.2585: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1 Source.2586: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9 Source.2587: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146 Source.2588: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.2589: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.2590: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.2591: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.2592: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.2593: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A Source.2594: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine Source.2595: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.2596: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A Source.2597: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.2598: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain Source.2599: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.2600: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain Source.2601: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.2602: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein Source.2603: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.2604: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.2605: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA Source.2606: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain Source.2607: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.2608: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2609: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.2610: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.2611: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.2612: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.2613: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase Source.2614: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.2615: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha Source.2616: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.2617: DFBPPR14383 ---- Marine protein ---- C-phycocyanin alpha chain Source.2618: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.2619: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.2620: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.2621: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.2622: DFBPPR14395 ---- Marine protein ---- 30S ribosomal protein S13-2, chloroplastic Source.2623: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.2624: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III Source.2625: DFBPPR14470 ---- Marine protein ---- Photosystem I reaction center subunit PsaK Source.2626: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic Source.2627: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.2628: DFBPPR14552 ---- Marine protein ---- Lysozyme C II Source.2629: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.2630: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.2631: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.2632: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2633: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.2634: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9 Source.2635: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.2636: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.2637: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.2638: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.2639: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.2640: DFBPPR14670 ---- Marine protein ---- Fatty acid-binding protein, heart Source.2641: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.2642: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.2643: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.2644: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.2645: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A Source.2646: DFBPPR14758 ---- Marine protein ---- Techylectin-5B Source.2647: DFBPPR14762 ---- Marine protein ---- Coagulogen Source.2648: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.2649: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2650: DFBPPR14812 ---- Marine protein ---- Alpha-2-macroglobulin homolog Source.2651: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2652: DFBPPR14861 ---- Marine protein ---- Cytochrome b Source.2653: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2654: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.2655: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.2656: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2657: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.2658: DFBPPR14936 ---- Microorganism protein ---- Inner kinetochore subunit MCM21 Source.2659: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.2660: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.2661: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.2662: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.2663: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like Source.2664: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.2665: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2666: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.2667: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.2668: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.2669: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5 Source.2670: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.2671: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.2672: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.2673: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.2674: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.2675: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.2676: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6 Source.2677: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.2678: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11 Source.2679: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.2680: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.2681: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.2682: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.2683: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.2684: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.2685: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.2686: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.2687: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.2688: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.2689: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.2690: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4 Source.2691: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.2692: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.2693: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial Source.2694: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.2695: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.2696: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.2697: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3 Source.2698: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.2699: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.2700: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.2701: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24 Source.2702: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1 Source.2703: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.2704: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.2705: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.2706: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.2707: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.2708: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.2709: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.2710: DFBPPR15510 ---- Microorganism protein ---- Autophagy-related protein 29 Source.2711: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.2712: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1 Source.2713: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.2714: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1 Source.2715: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.2716: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.2717: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8 Source.2718: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4 Source.2719: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.2720: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2 Source.2721: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5 Source.2722: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6 Source.2723: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.2724: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.2725: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.2726: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.2727: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.2728: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component Source.2729: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.2730: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase Source.2731: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.2732: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain Source.2733: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.2734: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.2735: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.2736: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.2737: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2738: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2739: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.2740: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2741: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.2742: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.2743: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.2744: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.2745: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.2746: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein Source.2747: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.2748: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.2749: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.2750: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.2751: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.2752: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.2753: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.2754: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.2755: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2756: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2757: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1 Source.2758: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4 Source.2759: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.2760: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.2761: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.2762: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.2763: DFBPPR8008 ---- Plant protein ---- CASP-like protein 5A2 Source.2764: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.2765: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.2766: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2767: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.2768: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein Source.2769: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2770: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.2771: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.2772: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.2773: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.2774: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1 Source.2775: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.2776: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2777: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2778: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.2779: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.2780: DFBPPR8176 ---- Plant protein ---- 53 kDa cell wall protein Source.2781: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.2782: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein Source.2783: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.2784: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.2785: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.2786: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.2787: DFBPPR8262 ---- Plant protein ---- ATP-dependent zinc metalloprotease FTSH, chloroplastic Source.2788: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2789: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2790: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase Source.2791: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.2792: DFBPPR8322 ---- Plant protein ---- Photosystem II reaction center protein J Source.2793: DFBPPR8339 ---- Plant protein ---- Cysteine proteinase inhibitor B Source.2794: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide VAG showed moderate antioxidant activity with a relative antioxidant activity of 2.55 ± 0.17 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015