E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0836(Antioxidative peptide)
DFBP ID DFBPANOX0836
Peptide sequence AGT
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Ala-Gly-Thr
Single-letter amino acid AGT
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 247.25 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 0.2333 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine whey protein
Precursor protein β-Lactoglobulin
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.4: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.5: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.6: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.7: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.8: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.9: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.10: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.11: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.12: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.13: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.14: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.15: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.16: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.17: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.18: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.19: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1
Source.20: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.21: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.22: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.23: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.24: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.25: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.26: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.27: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.28: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.29: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.30: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.31: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.32: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1
Source.33: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.34: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.35: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.36: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.37: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.38: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.39: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.40: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.41: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.42: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.43: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.44: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.45: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.46: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.47: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.48: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.49: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.50: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.51: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.52: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.53: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.54: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.55: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.56: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.57: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.58: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.59: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.60: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.61: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.62: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.63: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.64: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.65: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.66: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.67: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.68: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.69: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.70: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.71: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.72: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.73: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.74: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.75: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.76: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.77: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.78: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.79: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.80: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.81: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.82: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.83: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.84: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1
Source.85: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.86: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.87: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.88: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.89: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.90: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.91: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.92: DFBPPR1510 ---- Plant proteins ---- Ubiquitin-40S ribosomal protein S27a-2
Source.93: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.94: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.95: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal
Source.96: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.97: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.98: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.99: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.100: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.101: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.102: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.103: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.104: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.105: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.106: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.107: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.108: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.109: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.110: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.111: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.112: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.113: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.114: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.115: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.116: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.117: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.118: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.119: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.120: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.121: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.122: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.123: DFBPPR1715 ---- Plant proteins ---- Ubiquitin-40S ribosomal protein S27a-1
Source.124: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.125: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.126: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.127: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.128: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.129: DFBPPR1751 ---- Plant proteins ---- Heat stress transcription factor A-4b
Source.130: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.131: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.132: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.133: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.134: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.135: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.136: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.137: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.138: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.139: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.140: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.141: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.142: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.143: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.144: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.145: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.146: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.147: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.148: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.149: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.150: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.151: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.152: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.153: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.154: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.155: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.156: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.157: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.158: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.159: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.160: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.161: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.162: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.163: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.164: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.165: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.166: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.167: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.168: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.169: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.170: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.171: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.172: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.173: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.174: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.175: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.176: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.177: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.178: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.179: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.180: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.181: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.182: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.183: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.184: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.185: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.186: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.187: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.188: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.189: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.190: DFBPPR2223 ---- Plant proteins ---- Urease
Source.191: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.192: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.193: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.194: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.195: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.196: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa
Source.197: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.198: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.199: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.200: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.201: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.202: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.203: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.204: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.205: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.206: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.207: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.208: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.209: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.210: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.211: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.212: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.213: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.214: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.215: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.216: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.217: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.218: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.219: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.220: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.221: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.222: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.223: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.224: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.225: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.226: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.227: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.228: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.229: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.230: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.231: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.232: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.233: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.234: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.235: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.236: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.237: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.238: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.239: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.240: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.241: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.242: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.243: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.244: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500
Source.245: DFBPPR2745 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor EL2
Source.246: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.247: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.248: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.249: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.250: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c
Source.251: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.252: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.253: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.254: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.255: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.256: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.257: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.258: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.259: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.260: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.261: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.262: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.263: DFBPPR2939 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 5
Source.264: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.265: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.266: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.267: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.268: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.269: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.270: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.271: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.272: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.273: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.274: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.275: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.276: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.277: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.278: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic
Source.279: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.280: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.281: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.282: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.283: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.284: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.285: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.286: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.287: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.288: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.289: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.290: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.291: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.292: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.293: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.294: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.295: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.296: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.297: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.298: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.299: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.300: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.301: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.302: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.303: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.304: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.305: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.306: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.307: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.308: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.309: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.310: DFBPPR3298 ---- Plant proteins ---- Hydrophobic protein LTI6B
Source.311: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.312: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.313: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.314: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.315: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.316: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.317: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.318: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.319: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.320: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.321: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.322: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.323: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.324: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.325: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.326: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.327: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.328: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.329: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.330: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.331: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.332: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.333: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.334: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.335: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.336: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.337: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.338: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.339: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.340: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.341: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.342: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.343: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.344: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2
Source.345: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.346: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.347: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.348: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.349: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.350: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.351: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.352: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.353: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.354: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.355: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.356: DFBPPR3708 ---- Plant proteins ---- Late embryogenesis abundant protein 19
Source.357: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.358: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.359: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.360: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.361: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.362: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.363: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.364: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.365: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8
Source.366: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.367: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.368: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.369: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.370: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.371: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.372: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.373: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.374: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.375: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.376: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.377: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.378: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.379: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.380: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.381: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.382: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.383: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.384: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.385: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.386: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.387: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.388: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.389: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.390: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4
Source.391: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.392: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.393: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.394: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.395: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.396: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.397: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.398: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.399: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.400: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.401: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.402: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.403: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.404: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.405: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.406: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.407: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.408: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.409: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.410: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.411: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.412: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.413: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.414: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.415: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.416: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.417: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.418: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.419: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.420: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.421: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.422: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.423: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.424: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.425: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.426: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.427: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.428: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.429: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.430: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.431: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.432: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.433: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.434: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.435: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.436: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.437: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.438: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.439: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.440: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.441: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.442: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.443: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.444: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.445: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.446: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.447: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.448: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.449: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.450: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.451: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.452: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.453: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.454: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4
Source.455: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.456: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.457: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.458: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.459: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.460: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.461: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800
Source.462: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.463: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.464: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.465: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.466: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.467: DFBPPR4809 ---- Plant proteins ---- B3 domain-containing protein Os03g0164300
Source.468: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.469: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.470: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.471: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.472: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1
Source.473: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.474: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.475: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.476: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.477: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.478: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.479: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.480: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.481: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.482: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.483: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.484: DFBPPR4943 ---- Plant proteins ---- Transcription repressor OFP8
Source.485: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.486: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.487: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.488: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.489: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.490: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.491: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.492: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.493: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.494: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.495: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.496: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.497: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.498: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.499: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.500: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.501: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.502: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.503: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.504: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.505: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.506: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.507: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.508: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B
Source.509: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.510: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A
Source.511: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.512: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.513: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.514: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic
Source.515: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.516: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.517: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.518: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.519: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.520: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.521: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.522: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.523: DFBPPR5272 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.524: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.525: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.526: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.527: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.528: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.529: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.530: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.531: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.532: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11
Source.533: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.534: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.535: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.536: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.537: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.538: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.539: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.540: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.541: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.542: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.543: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.544: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.545: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.546: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.547: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.548: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.549: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.550: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.551: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.552: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.553: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.554: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.555: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.556: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.557: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II
Source.558: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.559: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.560: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.561: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.562: DFBPPR5569 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn] 2
Source.563: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.564: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.565: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.566: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.567: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.568: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.569: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.570: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.571: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.572: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.573: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.574: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.575: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.576: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.577: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.578: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.579: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.580: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.581: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.582: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.583: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.584: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.585: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.586: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.587: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.588: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.589: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.590: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.591: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.592: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.593: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.594: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.595: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.596: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.597: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.598: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.599: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.600: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.601: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.602: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A
Source.603: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.604: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.605: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.606: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.607: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.608: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.609: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.610: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.611: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.612: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.613: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.614: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.615: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.616: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.617: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.618: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.619: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.620: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.621: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.622: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.623: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.624: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.625: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.626: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.627: DFBPPR6074 ---- Plant proteins ---- Trypsin inhibitor
Source.628: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.629: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.630: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.631: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.632: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.633: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11
Source.634: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.635: DFBPPR6159 ---- Plant proteins ---- MFS14 protein
Source.636: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.637: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.638: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.639: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.640: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.641: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.642: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.643: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.644: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.645: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.646: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.647: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.648: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.649: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.650: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.651: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.652: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.653: DFBPPR6352 ---- Plant proteins ---- Protein TIC 22, chloroplastic
Source.654: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.655: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.656: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.657: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.658: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.659: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.660: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.661: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.662: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.663: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.664: DFBPPR6458 ---- Plant proteins ---- Convicilin
Source.665: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.666: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.667: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.668: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.669: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.670: DFBPPR6494 ---- Plant proteins ---- 50S ribosomal protein L1, chloroplastic
Source.671: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.672: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.673: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49
Source.674: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176
Source.675: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.676: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.677: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.678: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.679: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.680: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.681: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.682: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.683: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.684: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.685: DFBPPR6690 ---- Plant proteins ---- Histone H2A.2.2
Source.686: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.687: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.688: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.689: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.690: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.691: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.692: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.693: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.694: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.695: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.696: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.697: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.698: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.699: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.700: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.701: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.702: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.703: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.704: DFBPPR6829 ---- Plant proteins ---- Cold-shock protein CS120
Source.705: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.706: DFBPPR6848 ---- Plant proteins ---- Cold shock protein CS66
Source.707: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.708: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.709: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial
Source.710: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.711: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.712: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.713: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2
Source.714: DFBPPR7004 ---- Plant proteins ---- Uncharacterized 16 kDa protein in middle repetitive insertion sequence WIS1
Source.715: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.716: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.717: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.718: DFBPPR7060 ---- Plant proteins ---- Ubiquitin-40S ribosomal protein S27a
Source.719: DFBPPR7061 ---- Plant proteins ---- Ubiquitin-40S ribosomal protein S27a
Source.720: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.721: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1
Source.722: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.723: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.724: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.725: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.726: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.727: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.728: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.729: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.730: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.731: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.732: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.733: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.734: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.735: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.736: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.737: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.738: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.739: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.740: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.741: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4
Source.742: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic
Source.743: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.744: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1
Source.745: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2
Source.746: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C
Source.747: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B
Source.748: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.749: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1
Source.750: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.751: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6
Source.752: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.753: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.754: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.755: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2
Source.756: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.757: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.758: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.759: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.760: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.761: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.762: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.763: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.764: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.765: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.766: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.767: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.768: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.769: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.770: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.771: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.772: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.773: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12
Source.774: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.775: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.776: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.777: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.778: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.779: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.780: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.781: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.782: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.783: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.784: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.785: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.786: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.787: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.788: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101
Source.789: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101
Source.790: DFBPPR8412 ---- Plant proteins ---- Oleosin Ara h 10.0102
Source.791: DFBPPR8425 ---- Plant proteins ---- Oleosin L
Source.792: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.793: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.794: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.795: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.796: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.797: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.798: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.799: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.800: DFBPPR15938 ---- Animal proteins ---- Apolipoprotein A-II
Source.801: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.802: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.803: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.804: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.805: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.806: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.807: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.808: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.809: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.810: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.811: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.812: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.813: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.814: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.815: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.816: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.817: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.818: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.819: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.820: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.821: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.822: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.823: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.824: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.825: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta
Source.826: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.827: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.828: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.829: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.830: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.831: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.832: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.833: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.834: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.835: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.836: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.837: DFBPPR16287 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.838: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.839: DFBPPR16292 ---- Animal proteins ---- Protein unc-119 homolog A
Source.840: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.841: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.842: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.843: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.844: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.845: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.846: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.847: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.848: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.849: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.850: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.851: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.852: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.853: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.854: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.855: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.856: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.857: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.858: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.859: DFBPPR16499 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.860: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.861: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.862: DFBPPR16524 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.863: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.864: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.865: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.866: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.867: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.868: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.869: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.870: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.871: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.872: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.873: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.874: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1
Source.875: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2
Source.876: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.877: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.878: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B
Source.879: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.880: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.881: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.882: DFBPPR16651 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.883: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.884: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.885: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.886: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.887: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.888: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor
Source.889: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.890: DFBPPR16715 ---- Animal proteins ---- Submaxillary mucin
Source.891: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.892: DFBPPR16734 ---- Animal proteins ---- 40S ribosomal protein S11
Source.893: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.894: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.895: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.896: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.897: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.898: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.899: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.900: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.901: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.902: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.903: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.904: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.905: DFBPPR16879 ---- Animal proteins ---- Inhibin beta A chain
Source.906: DFBPPR16886 ---- Animal proteins ---- Platelet factor 4
Source.907: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.908: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.909: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.910: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.911: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.912: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A
Source.913: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.914: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.915: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.916: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.917: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.918: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.919: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.920: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.921: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.922: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.923: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.924: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.925: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.926: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.927: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.928: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.929: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.930: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.931: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.932: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.933: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.934: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.935: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.936: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.937: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.938: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.939: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.940: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.941: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.942: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.943: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.944: DFBPPR17132 ---- Animal proteins ---- Apolipoprotein A-II
Source.945: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.946: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.947: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.948: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.949: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.950: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.951: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.952: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.953: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.954: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.955: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.956: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.957: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.958: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.959: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.960: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.961: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.962: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.963: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.964: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.965: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.966: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.967: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.968: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.969: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.970: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.971: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.972: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.973: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.974: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.975: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.976: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.977: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.978: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.979: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.980: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.981: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.982: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.983: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.984: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.985: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.986: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.987: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.988: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.989: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.990: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.991: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.992: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.993: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.994: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.995: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.996: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.997: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.998: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial
Source.999: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.1000: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1001: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.1002: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.1003: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.1004: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1005: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.1006: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.1007: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1008: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.1009: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.1010: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.1011: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1012: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1013: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.1014: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.1015: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1016: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.1017: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase
Source.1018: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1019: DFBPPR17875 ---- Animal proteins ---- Brain acid soluble protein 1
Source.1020: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.1021: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.1022: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1023: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.1024: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1025: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.1026: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.1027: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.1028: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1029: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.1030: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.1031: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.1032: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.1033: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.1034: DFBPPR17981 ---- Animal proteins ---- Retinol-binding protein 4
Source.1035: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1036: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1037: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.1038: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1039: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.1040: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.1041: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.1042: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.1043: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1044: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.1045: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1046: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1047: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1048: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.1049: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.1050: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.1051: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.1052: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.1053: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.1054: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B
Source.1055: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.1056: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.1057: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.1058: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.1059: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.1060: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B
Source.1061: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1062: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.1063: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1064: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.1065: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.1066: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A
Source.1067: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.1068: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1069: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.1070: DFBPPR18373 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1
Source.1071: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1072: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1073: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.1074: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.1075: DFBPPR18433 ---- Animal proteins ---- Basigin
Source.1076: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.1077: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.1078: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.1079: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1080: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.1081: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.1082: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.1083: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.1084: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.1085: DFBPPR18568 ---- Animal proteins ---- Cdc42 effector protein 2
Source.1086: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S
Source.1087: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.1088: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.1089: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.1090: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.1091: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.1092: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.1093: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.1094: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.1095: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.1096: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.1097: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.1098: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A
Source.1099: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.1100: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1101: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1102: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1103: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1104: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.1105: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.1106: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1107: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.1108: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor
Source.1109: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1110: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.1111: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.1112: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1113: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.1114: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.1115: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1116: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.1117: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1118: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.1119: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1120: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.1121: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1122: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.1123: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.1124: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1125: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.1126: DFBPPR19004 ---- Animal proteins ---- Histone H1.3
Source.1127: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.1128: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1
Source.1129: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.1130: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.1131: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.1132: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.1133: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.1134: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.1135: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.1136: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.1137: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.1138: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.1139: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.1140: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1141: DFBPPR19191 ---- Animal proteins ---- Protein unc-119 homolog A
Source.1142: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.1143: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1144: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.1145: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.1146: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.1147: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.1148: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.1149: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1150: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.1151: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.1152: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.1153: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.1154: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.1155: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.1156: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.1157: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.1158: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.1159: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.1160: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.1161: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.1162: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6
Source.1163: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.1164: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.1165: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.1166: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.1167: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1168: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.1169: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1170: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1171: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1172: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.1173: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.1174: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.1175: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.1176: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.1177: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1178: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4
Source.1179: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.1180: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1181: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.1182: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.1183: DFBPPR19594 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.1184: DFBPPR19595 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.1185: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.1186: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.1187: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1188: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.1189: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1190: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3
Source.1191: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1192: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.1193: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.1194: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1195: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.1196: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.1197: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4
Source.1198: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.1199: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1200: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1201: DFBPPR19812 ---- Animal proteins ---- Probable inactive serine protease 37
Source.1202: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.1203: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.1204: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.1205: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.1206: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.1207: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.1208: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1209: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.1210: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1211: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.1212: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.1213: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.1214: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.1215: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.1216: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.1217: DFBPPR20023 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.1218: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1219: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1220: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.1221: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.1222: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.1223: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.1224: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.1225: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.1226: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1227: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.1228: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.1229: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.1230: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1231: DFBPPR20213 ---- Animal proteins ---- Coiled-coil domain-containing protein 115
Source.1232: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.1233: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.1234: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1
Source.1235: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1236: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.1237: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3
Source.1238: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3
Source.1239: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.1240: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.1241: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.1242: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.1243: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.1244: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.1245: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.1246: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.1247: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.1248: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.1249: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.1250: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1251: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.1252: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.1253: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.1254: DFBPPR20446 ---- Animal proteins ---- 39S ribosomal protein L33, mitochondrial
Source.1255: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.1256: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial
Source.1257: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1258: DFBPPR20474 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.1259: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.1260: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.1261: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.1262: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein
Source.1263: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.1264: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1265: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.1266: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.1267: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.1268: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1269: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.1270: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.1271: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.1272: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.1273: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.1274: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.1275: DFBPPR20645 ---- Animal proteins ---- Eukaryotic translation initiation factor 1
Source.1276: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.1277: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.1278: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.1279: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.1280: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.1281: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial
Source.1282: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.1283: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1284: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.1285: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.1286: DFBPPR20725 ---- Animal proteins ---- RBPJ-interacting and tubulin-associated protein 1
Source.1287: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.1288: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1289: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.1290: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.1291: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.1292: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.1293: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1294: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.1295: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1296: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.1297: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase
Source.1298: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.1299: DFBPPR20874 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC2
Source.1300: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta
Source.1301: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3
Source.1302: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.1303: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.1304: DFBPPR20922 ---- Animal proteins ---- Calcipressin-2
Source.1305: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.1306: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor
Source.1307: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial
Source.1308: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1309: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.1310: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.1311: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.1312: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.1313: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.1314: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.1315: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1316: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.1317: DFBPPR21081 ---- Animal proteins ---- Uteroglobin
Source.1318: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.1319: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3
Source.1320: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1
Source.1321: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.1322: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.1323: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.1324: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.1325: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.1326: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.1327: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.1328: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3
Source.1329: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6
Source.1330: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.1331: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.1332: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.1333: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog
Source.1334: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.1335: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2
Source.1336: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.1337: DFBPPR21318 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.1338: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.1339: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.1340: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.1341: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.1342: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.1343: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.1344: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.1345: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.1346: DFBPPR21430 ---- Animal proteins ---- Calmodulin regulator protein PCP4
Source.1347: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.1348: DFBPPR21448 ---- Animal proteins ---- Protein N-lysine methyltransferase METTL21A
Source.1349: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.1350: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.1351: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.1352: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1
Source.1353: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.1354: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.1355: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.1356: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.1357: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.1358: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.1359: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.1360: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.1361: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4
Source.1362: DFBPPR21675 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2B
Source.1363: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.1364: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.1365: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.1366: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.1367: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.1368: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1369: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.1370: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.1371: DFBPPR21743 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2A
Source.1372: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1373: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.1374: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.1375: DFBPPR21780 ---- Animal proteins ---- 40S ribosomal protein S11
Source.1376: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.1377: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.1378: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1379: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.1380: DFBPPR21828 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 11
Source.1381: DFBPPR21854 ---- Animal proteins ---- Suppressor of IKBKE 1
Source.1382: DFBPPR21864 ---- Animal proteins ---- Arpin
Source.1383: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.1384: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.1385: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2
Source.1386: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.1387: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.1388: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.1389: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4
Source.1390: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1391: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.1392: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.1393: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.1394: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5
Source.1395: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.1396: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1397: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.1398: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.1399: DFBPPR22025 ---- Animal proteins ---- Putative deoxyribonuclease TATDN3
Source.1400: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.1401: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.1402: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.1403: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1404: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.1405: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.1406: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.1407: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.1408: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.1409: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.1410: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2
Source.1411: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.1412: DFBPPR22166 ---- Animal proteins ---- Nucleosome assembly protein 1-like 5
Source.1413: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3
Source.1414: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.1415: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1416: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.1417: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.1418: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.1419: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.1420: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.1421: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.1422: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218
Source.1423: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.1424: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.1425: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1426: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.1427: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.1428: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.1429: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.1430: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.1431: DFBPPR22429 ---- Animal proteins ---- Coiled-coil domain-containing protein 107
Source.1432: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.1433: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.1434: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.1435: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A
Source.1436: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.1437: DFBPPR22518 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 4-like 2
Source.1438: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.1439: DFBPPR22567 ---- Animal proteins ---- Ubiquitin-like protein FUBI
Source.1440: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A
Source.1441: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.1442: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.1443: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.1444: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.1445: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.1446: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.1447: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.1448: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog
Source.1449: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.1450: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.1451: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.1452: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.1453: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1454: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.1455: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1456: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.1457: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.1458: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.1459: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.1460: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.1461: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.1462: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1463: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.1464: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.1465: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1466: DFBPPR8628 ---- Animal proteins ---- Inhibin beta A chain
Source.1467: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.1468: DFBPPR8655 ---- Animal proteins ---- Azurocidin
Source.1469: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.1470: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.1471: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.1472: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.1473: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.1474: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.1475: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.1476: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.1477: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.1478: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1479: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1480: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.1481: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1482: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.1483: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1484: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.1485: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1486: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.1487: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1488: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.1489: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.1490: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.1491: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.1492: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1493: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1494: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.1495: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.1496: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1497: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.1498: DFBPPR8991 ---- Animal proteins ---- Cholecystokinin
Source.1499: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.1500: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1501: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1502: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1503: DFBPPR9017 ---- Animal proteins ---- Mannose-binding protein C
Source.1504: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1505: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.1506: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B
Source.1507: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.1508: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.1509: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1510: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.1511: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1512: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.1513: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1514: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.1515: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.1516: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.1517: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.1518: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.1519: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.1520: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.1521: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.1522: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.1523: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.1524: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.1525: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.1526: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.1527: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.1528: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1529: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.1530: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1531: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.1532: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.1533: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.1534: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.1535: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.1536: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1537: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1538: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1539: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.1540: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.1541: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.1542: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.1543: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.1544: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.1545: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.1546: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1547: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1548: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.1549: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1550: DFBPPR9556 ---- Animal proteins ---- N(4)-(Beta-N-acetylglucosaminyl)-L-asparaginase
Source.1551: DFBPPR9561 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1552: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.1553: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1554: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.1555: DFBPPR9584 ---- Animal proteins ---- FXYD domain-containing ion transport regulator 3
Source.1556: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1557: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform
Source.1558: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1559: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1560: DFBPPR9675 ---- Animal proteins ---- Cystatin-A5
Source.1561: DFBPPR9686 ---- Animal proteins ---- Fatty acid-binding protein, heart
Source.1562: DFBPPR9732 ---- Animal proteins ---- Leukocyte cysteine proteinase inhibitor 1
Source.1563: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.1564: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.1565: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.1566: DFBPPR9815 ---- Animal proteins ---- Eukaryotic translation initiation factor 1b
Source.1567: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.1568: DFBPPR9837 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.1569: DFBPPR9854 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1570: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.1571: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.1572: DFBPPR9871 ---- Animal proteins ---- DNA-binding protein inhibitor ID-4
Source.1573: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1574: DFBPPR9887 ---- Animal proteins ---- Cystatin-A8
Source.1575: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.1576: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1577: DFBPPR9945 ---- Animal proteins ---- Ubiquitin-like protein FUBI
Source.1578: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.1579: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1580: DFBPPR9968 ---- Animal proteins ---- Beta-2-microglobulin
Source.1581: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.1582: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.1583: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1584: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.1585: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.1586: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1587: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1588: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.1589: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.1590: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1591: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.1592: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.1593: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.1594: DFBPPR10113 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.1595: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.1596: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.1597: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1598: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.1599: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.1600: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.1601: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.1602: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.1603: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.1604: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1605: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.1606: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.1607: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.1608: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1609: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.1610: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.1611: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.1612: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.1613: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.1614: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain
Source.1615: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1616: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.1617: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.1618: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1619: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.1620: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.1621: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.1622: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.1623: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.1624: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1625: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.1626: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.1627: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.1628: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1629: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1630: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1631: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.1632: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.1633: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1634: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1635: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1636: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1637: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.1638: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.1639: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1640: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.1641: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1642: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1643: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.1644: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.1645: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.1646: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.1647: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.1648: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.1649: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.1650: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.1651: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros
Source.1652: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.1653: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.1654: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.1655: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.1656: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.1657: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.1658: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.1659: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.1660: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.1661: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.1662: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.1663: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.1664: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1665: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1666: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.1667: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1668: DFBPPR10643 ---- Animal proteins ---- Sclerostin domain-containing protein 1
Source.1669: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.1670: DFBPPR10685 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1
Source.1671: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.1672: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.1673: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.1674: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.1675: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1676: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.1677: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1678: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.1679: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.1680: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.1681: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.1682: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.1683: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.1684: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.1685: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.1686: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1687: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1688: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.1689: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.1690: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.1691: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1692: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.1693: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.1694: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1695: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.1696: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1697: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.1698: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.1699: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.1700: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.1701: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1702: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1703: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1704: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.1705: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.1706: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1707: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1
Source.1708: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.1709: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.1710: DFBPPR11048 ---- Animal proteins ---- Calcitonin
Source.1711: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.1712: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.1713: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.1714: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.1715: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.1716: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.1717: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.1718: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.1719: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.1720: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.1721: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1722: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.1723: DFBPPR11146 ---- Animal proteins ---- Formin
Source.1724: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.1725: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.1726: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3
Source.1727: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.1728: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.1729: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1730: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.1731: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1732: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.1733: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.1734: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.1735: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.1736: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1737: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B
Source.1738: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.1739: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1740: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1741: DFBPPR11305 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.1742: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.1743: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.1744: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.1745: DFBPPR11355 ---- Animal proteins ---- Collectin-10
Source.1746: DFBPPR11371 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.1747: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.1748: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.1749: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.1750: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.1751: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.1752: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.1753: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.1754: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.1755: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.1756: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.1757: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.1758: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.1759: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.1760: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.1761: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1762: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32
Source.1763: DFBPPR11570 ---- Animal proteins ---- Ribonuclease CL2
Source.1764: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.1765: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1766: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.1767: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.1768: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1769: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.1770: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.1771: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.1772: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.1773: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1774: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.1775: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.1776: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.1777: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.1778: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.1779: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.1780: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1781: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.1782: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.1783: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.1784: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1785: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.1786: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.1787: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.1788: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3
Source.1789: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.1790: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.1791: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.1792: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.1793: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.1794: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1795: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.1796: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.1797: DFBPPR11973 ---- Animal proteins ---- Avidin-related protein 3
Source.1798: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.1799: DFBPPR11996 ---- Animal proteins ---- Homeobox protein Hox-A6
Source.1800: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.1801: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.1802: DFBPPR12043 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 5
Source.1803: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.1804: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.1805: DFBPPR12091 ---- Animal proteins ---- Neurofibromin
Source.1806: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.1807: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.1808: DFBPPR12115 ---- Animal proteins ---- Active regulator of SIRT1
Source.1809: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.1810: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.1811: DFBPPR12168 ---- Animal proteins ---- Osteoclast-stimulating factor 1
Source.1812: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.1813: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.1814: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.1815: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.1816: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1817: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.1818: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1819: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1820: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1821: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1822: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1823: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1824: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1825: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1826: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1827: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1828: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.1829: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.1830: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.1831: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.1832: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.1833: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.1834: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.1835: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1836: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.1837: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.1838: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.1839: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.1840: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1841: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1842: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.1843: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1844: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.1845: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.1846: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.1847: DFBPPR12419 ---- Animal proteins ---- Phospholipase A2
Source.1848: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.1849: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.1850: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.1851: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.1852: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.1853: DFBPPR12471 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.1854: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.1855: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.1856: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1857: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.1858: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1859: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.1860: DFBPPR12538 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.1861: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1862: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.1863: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1864: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.1865: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1866: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1867: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.1868: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.1869: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.1870: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.1871: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.1872: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.1873: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.1874: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.1875: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.1876: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1877: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.1878: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.1879: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.1880: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.1881: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.1882: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.1883: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.1884: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.1885: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.1886: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.1887: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.1888: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.1889: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.1890: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4
Source.1891: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.1892: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.1893: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1894: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1895: DFBPPR12876 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.1896: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.1897: DFBPPR12940 ---- Animal proteins ---- Interleukin-4
Source.1898: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.1899: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.1900: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1901: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1902: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.1903: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.1904: DFBPPR13001 ---- Animal proteins ---- Annexin A6
Source.1905: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.1906: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1907: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.1908: DFBPPR13034 ---- Animal proteins ---- Sarcospan
Source.1909: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1910: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.1911: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.1912: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1913: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.1914: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.1915: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.1916: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain
Source.1917: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1918: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1919: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.1920: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1921: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1922: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.1923: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1924: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1925: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1926: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.1927: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.1928: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2
Source.1929: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.1930: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.1931: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.1932: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.1933: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1934: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.1935: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A
Source.1936: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1937: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1938: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.1939: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1940: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1941: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.1942: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.1943: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1944: DFBPPR13552 ---- Animal proteins ---- Inhibin beta A chain
Source.1945: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.1946: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1947: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.1948: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1949: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1950: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1951: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1952: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.1953: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.1954: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1955: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.1956: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1957: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.1958: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.1959: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1960: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1961: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.1962: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1963: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.1964: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1965: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1966: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.1967: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.1968: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.1969: DFBPPR13911 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2C
Source.1970: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1971: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1972: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1973: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.1974: DFBPPR13991 ---- Animal proteins ---- Osteocalcin
Source.1975: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog
Source.1976: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1977: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1978: DFBPPR14061 ---- Animal proteins ---- Neurotrophin-7
Source.1979: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.1980: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.1981: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.1982: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA
Source.1983: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.1984: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.1985: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.1986: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.1987: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.1988: DFBPPR14222 ---- Marine protein ---- Neuropeptide-like protein C4orf48 homolog
Source.1989: DFBPPR14239 ---- Marine protein ---- Gonadotropin subunit beta-1
Source.1990: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.1991: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.1992: DFBPPR14306 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1993: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.1994: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.1995: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.1996: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1997: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1998: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.1999: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.2000: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.2001: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic
Source.2002: DFBPPR14438 ---- Marine protein ---- 50S ribosomal protein L1, chloroplastic
Source.2003: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.2004: DFBPPR14449 ---- Marine protein ---- Photosystem II reaction center protein J
Source.2005: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.2006: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.2007: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.2008: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.2009: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.2010: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.2011: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.2012: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.2013: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.2014: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.2015: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.2016: DFBPPR14670 ---- Marine protein ---- Fatty acid-binding protein, heart
Source.2017: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.2018: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64
Source.2019: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.2020: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.2021: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.2022: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.2023: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.2024: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2025: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.2026: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.2027: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.2028: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.2029: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.2030: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2031: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.2032: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.2033: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.2034: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.2035: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.2036: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.2037: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.2038: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.2039: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2040: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.2041: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.2042: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2043: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.2044: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.2045: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.2046: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.2047: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.2048: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.2049: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.2050: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.2051: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.2052: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2053: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.2054: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.2055: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2
Source.2056: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.2057: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.2058: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.2059: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.2060: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.2061: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.2062: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.2063: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.2064: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.2065: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.2066: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.2067: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.2068: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.2069: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.2070: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.2071: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.2072: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.2073: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3
Source.2074: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.2075: DFBPPR15476 ---- Microorganism protein ---- Mitochondrial inner membrane i-AAA protease complex subunit MGR1
Source.2076: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2077: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.2078: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.2079: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.2080: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.2081: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.2082: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.2083: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.2084: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.2085: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.2086: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.2087: DFBPPR15651 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 34, mitochondrial
Source.2088: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.2089: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.2090: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.2091: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.2092: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.2093: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.2094: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.2095: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.2096: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.2097: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.2098: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.2099: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.2100: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.2101: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.2102: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.2103: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.2104: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.2105: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.2106: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.2107: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.2108: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.2109: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2110: DFBPPR0010 ---- Plant protein ---- Ubiquitin-40S ribosomal protein S27a
Source.2111: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.2112: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.2113: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2114: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.2115: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.2116: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2117: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.2118: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2119: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2120: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2121: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.2122: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2123: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.2124: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.2125: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.2126: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.2127: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.2128: DFBPPR7939 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase FKBP12
Source.2129: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.2130: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2131: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.2132: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2133: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.2134: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.2135: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1
Source.2136: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.2137: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.2138: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.2139: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2140: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2141: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2142: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2143: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.2144: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.2145: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.2146: DFBPPR8151 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.2147: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.2148: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.2149: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2150: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2151: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.2152: DFBPPR8277 ---- Plant protein ---- Profilin
Source.2153: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase
Source.2154: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2155: DFBPPR8328 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic
Source.2156: DFBPPR8339 ---- Plant protein ---- Cysteine proteinase inhibitor B
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe3+/mol peptide) was measured as a positive control. The peptide AGT showed moderate antioxidant activity with a relative antioxidant activity of 1.09 ± 0.24 mmol Fe3+/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63.
Other literature(s) N.D
PubDate 2015
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214