E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0842(Antioxidative peptide)
DFBP ID DFBPANOX0842
Peptide sequence AMA
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Ala-Met-Ala
Single-letter amino acid AMA
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 291.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 1.8333 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine whey protein
Precursor protein β-Lactoglobulin
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.2: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin
Source.3: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.4: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.5: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A
Source.6: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.7: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.8: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.9: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.10: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.11: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.12: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.13: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.14: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2
Source.15: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.16: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.17: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.18: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.19: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.20: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase
Source.21: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.22: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.23: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.24: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.25: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.26: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.27: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.28: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.29: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.30: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.31: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.32: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.33: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.34: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.35: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.36: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.37: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.38: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.39: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.40: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.41: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.42: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.43: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.44: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.45: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.46: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.47: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.48: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.49: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.50: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.51: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.52: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.53: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.54: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA
Source.55: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.56: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.57: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.58: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.59: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.60: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.61: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.62: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.63: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.64: DFBPPR1283 ---- Plant proteins ---- Arsenate reductase 2.1
Source.65: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.66: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.67: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.68: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.69: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.70: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.71: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.72: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.73: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.74: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.75: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.76: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.77: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.78: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.79: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.80: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.81: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.82: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.83: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.84: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.85: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.86: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.87: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.88: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.89: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.90: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.91: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.92: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.93: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.94: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.95: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.96: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.97: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.98: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.99: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.100: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.101: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.102: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.103: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.104: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.105: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.106: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.107: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.108: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.109: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.110: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.111: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.112: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.113: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.114: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.115: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.116: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.117: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.118: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.119: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.120: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.121: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.122: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.123: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.124: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.125: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.126: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.127: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.128: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.129: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.130: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.131: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.132: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.133: DFBPPR1706 ---- Plant proteins ---- Phytosulfokines 4
Source.134: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.135: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.136: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a
Source.137: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.138: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.139: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.140: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.141: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.142: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.143: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.144: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.145: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.146: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.147: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.148: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.149: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.150: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.151: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.152: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.153: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.154: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.155: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.156: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.157: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.158: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.159: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.160: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.161: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.162: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.163: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.164: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.165: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.166: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.167: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.168: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1
Source.169: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.170: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.171: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.172: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.173: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.174: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.175: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.176: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.177: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.178: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.179: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.180: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.181: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.182: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.183: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.184: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.185: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.186: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.187: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.188: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.189: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.190: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.191: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.192: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.193: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.194: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.195: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.196: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.197: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.198: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.199: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.200: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.201: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.202: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.203: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.204: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.205: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.206: DFBPPR2176 ---- Plant proteins ---- Expansin-B11
Source.207: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.208: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.209: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.210: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.211: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein
Source.212: DFBPPR2206 ---- Plant proteins ---- Leucine-rich repeat protein 1
Source.213: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.214: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.215: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.216: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.217: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.218: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3
Source.219: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic
Source.220: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.221: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.222: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.223: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.224: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.225: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.226: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.227: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.228: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.229: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.230: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.231: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.232: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.233: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.234: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.235: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.236: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.237: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.238: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.239: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.240: DFBPPR2438 ---- Plant proteins ---- Arabinogalactan protein 1
Source.241: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.242: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.243: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.244: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.245: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.246: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.247: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.248: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.249: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.250: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5
Source.251: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.252: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.253: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.254: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.255: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.256: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.257: DFBPPR2614 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.258: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4
Source.259: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.260: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3
Source.261: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1
Source.262: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.263: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.264: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.265: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.266: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.267: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.268: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.269: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.270: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.271: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.272: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.273: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.274: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.275: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.276: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.277: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS
Source.278: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.279: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.280: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.281: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.282: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.283: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.284: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.285: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.286: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.287: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.288: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.289: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.290: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1
Source.291: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.292: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.293: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.294: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.295: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.296: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.297: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2
Source.298: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.299: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.300: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.301: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23
Source.302: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.303: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.304: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.305: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.306: DFBPPR3022 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 2
Source.307: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.308: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein
Source.309: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.310: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.311: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.312: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.313: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.314: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.315: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.316: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.317: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.318: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.319: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.320: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7
Source.321: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.322: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.323: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.324: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.325: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.326: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.327: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.328: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.329: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.330: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.331: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.332: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.333: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.334: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.335: DFBPPR3205 ---- Plant proteins ---- Monothiol glutaredoxin-S3
Source.336: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.337: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.338: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.339: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.340: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.341: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.342: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.343: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.344: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.345: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.346: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.347: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.348: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.349: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.350: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.351: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.352: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.353: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.354: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.355: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.356: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.357: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.358: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.359: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.360: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.361: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.362: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.363: DFBPPR3418 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 3
Source.364: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.365: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.366: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3
Source.367: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.368: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.369: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.370: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.371: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.372: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.373: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.374: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.375: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.376: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.377: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.378: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.379: DFBPPR3521 ---- Plant proteins ---- Photosystem II reaction center W protein, chloroplastic
Source.380: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.381: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10
Source.382: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.383: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.384: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.385: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.386: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.387: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.388: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.389: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.390: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.391: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.392: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.393: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.394: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.395: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.396: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.397: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.398: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.399: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.400: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.401: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.402: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.403: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.404: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.405: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1
Source.406: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.407: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.408: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.409: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.410: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.411: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.412: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.413: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.414: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.415: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.416: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.417: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.418: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.419: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.420: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.421: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.422: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.423: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.424: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.425: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.426: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.427: DFBPPR3882 ---- Plant proteins ---- Squamosa promoter-binding-like protein 7
Source.428: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.429: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.430: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.431: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.432: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.433: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.434: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.435: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.436: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.437: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.438: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.439: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.440: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19
Source.441: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.442: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.443: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.444: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.445: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.446: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.447: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.448: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.449: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.450: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.451: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.452: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a
Source.453: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.454: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.455: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.456: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.457: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.458: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.459: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1
Source.460: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.461: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.462: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.463: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.464: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.465: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.466: DFBPPR4140 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3, chloroplastic
Source.467: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.468: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.469: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.470: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.471: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.472: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.473: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.474: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.475: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.476: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.477: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.478: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.479: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.480: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.481: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.482: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.483: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.484: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.485: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.486: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.487: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.488: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.489: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.490: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.491: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.492: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.493: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.494: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.495: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.496: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.497: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.498: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.499: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.500: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.501: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.502: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.503: DFBPPR4455 ---- Plant proteins ---- CASP-like protein 5A2
Source.504: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.505: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.506: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.507: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.508: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.509: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.510: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.511: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.512: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.513: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.514: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.515: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.516: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.517: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.518: DFBPPR4620 ---- Plant proteins ---- Protein LOL1
Source.519: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.520: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.521: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.522: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.523: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.524: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.525: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.526: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.527: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100
Source.528: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.529: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.530: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58
Source.531: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.532: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.533: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.534: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.535: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.536: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.537: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.538: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.539: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.540: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.541: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.542: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.543: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.544: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.545: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.546: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.547: DFBPPR5178 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.548: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.549: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.550: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.551: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein
Source.552: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.553: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.554: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.555: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.556: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.557: DFBPPR5317 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.558: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.559: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.560: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.561: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.562: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.563: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.564: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.565: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.566: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.567: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.568: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic
Source.569: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.570: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.571: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.572: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.573: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic
Source.574: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.575: DFBPPR5520 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.576: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.577: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.578: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.579: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.580: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.581: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.582: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.583: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.584: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.585: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.586: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.587: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.588: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.589: DFBPPR5681 ---- Plant proteins ---- Single myb histone 4
Source.590: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.591: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.592: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.593: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.594: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.595: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.596: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.597: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3
Source.598: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.599: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.600: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.601: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.602: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.603: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.604: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.605: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.606: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.607: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.608: DFBPPR5872 ---- Plant proteins ---- 50S ribosomal protein L29, chloroplastic
Source.609: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.610: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.611: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B
Source.612: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic
Source.613: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.614: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.615: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.616: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.617: DFBPPR5942 ---- Plant proteins ---- GTP-binding protein YPTM2
Source.618: DFBPPR5955 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-2, chloroplastic
Source.619: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.620: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.621: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.622: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.623: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.624: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.625: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.626: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.627: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.628: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.629: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.630: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.631: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.632: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.633: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.634: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.635: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5
Source.636: DFBPPR6192 ---- Plant proteins ---- Unknown protein from spot 688 of 2D-PAGE of etiolated coleoptile
Source.637: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.638: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.639: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.640: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.641: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.642: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.643: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.644: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.645: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.646: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.647: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.648: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.649: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.650: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.651: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.652: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.653: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.654: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.655: DFBPPR6384 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.656: DFBPPR6421 ---- Plant proteins ---- 50S ribosomal protein L24, chloroplastic
Source.657: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.658: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.659: DFBPPR6578 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.660: DFBPPR6579 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.661: DFBPPR6580 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.662: DFBPPR6612 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.663: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.664: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.665: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.666: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.667: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.668: DFBPPR6708 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.669: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.670: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.671: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.672: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.673: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.674: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.675: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.676: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.677: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.678: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.679: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.680: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.681: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.682: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin
Source.683: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B
Source.684: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin
Source.685: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin
Source.686: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.687: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.688: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.689: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.690: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.691: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2
Source.692: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.693: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.694: DFBPPR7134 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.695: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.696: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.697: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein
Source.698: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.699: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.700: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.701: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.702: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.703: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.704: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.705: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1
Source.706: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1
Source.707: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.708: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.709: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.710: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.711: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.712: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.713: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.714: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.715: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1
Source.716: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.717: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.718: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.719: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.720: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.721: DFBPPR7725 ---- Plant proteins ---- Avenin-3
Source.722: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.723: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.724: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.725: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.726: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C
Source.727: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.728: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.729: DFBPPR8461 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.730: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.731: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.732: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2
Source.733: DFBPPR15937 ---- Animal proteins ---- Appetite-regulating hormone
Source.734: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.735: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.736: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.737: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.738: DFBPPR16037 ---- Animal proteins ---- Caveolin-1
Source.739: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.740: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.741: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.742: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.743: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.744: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.745: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.746: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.747: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.748: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.749: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.750: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.751: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.752: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.753: DFBPPR16234 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma
Source.754: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.755: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.756: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.757: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.758: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.759: DFBPPR16328 ---- Animal proteins ---- Fibroblast growth factor 8
Source.760: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.761: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.762: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.763: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.764: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1
Source.765: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2
Source.766: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.767: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.768: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.769: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.770: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.771: DFBPPR16655 ---- Animal proteins ---- Somatostatin
Source.772: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.773: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.774: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.775: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.776: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.777: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.778: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.779: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.780: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.781: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.782: DFBPPR16905 ---- Animal proteins ---- Fatty acid-binding protein 5
Source.783: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.784: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.785: DFBPPR16927 ---- Animal proteins ---- Caveolin-1
Source.786: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.787: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.788: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.789: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.790: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.791: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.792: DFBPPR17046 ---- Animal proteins ---- Appetite-regulating hormone
Source.793: DFBPPR17047 ---- Animal proteins ---- Neuromodulin
Source.794: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.795: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.796: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.797: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.798: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog
Source.799: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.800: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.801: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.802: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.803: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.804: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.805: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.806: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.807: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.808: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.809: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.810: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.811: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.812: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.813: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3
Source.814: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.815: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)]
Source.816: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.817: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.818: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.819: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.820: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.821: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.822: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.823: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.824: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.825: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.826: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.827: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.828: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.829: DFBPPR17795 ---- Animal proteins ---- Acyl-coenzyme A thioesterase THEM4
Source.830: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.831: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.832: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.833: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.834: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.835: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.836: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.837: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.838: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.839: DFBPPR17981 ---- Animal proteins ---- Retinol-binding protein 4
Source.840: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.841: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.842: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.843: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.844: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.845: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.846: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.847: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.848: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.849: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.850: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.851: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.852: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.853: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial
Source.854: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.855: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.856: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.857: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.858: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1
Source.859: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.860: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.861: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.862: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.863: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.864: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.865: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.866: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.867: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3
Source.868: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.869: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.870: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma
Source.871: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.872: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.873: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.874: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.875: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1
Source.876: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.877: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.878: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.879: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.880: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.881: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.882: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.883: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.884: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase
Source.885: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.886: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.887: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.888: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.889: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.890: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.891: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.892: DFBPPR18936 ---- Animal proteins ---- S-methyl-5'-thioadenosine phosphorylase
Source.893: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.894: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.895: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.896: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.897: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.898: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.899: DFBPPR19082 ---- Animal proteins ---- Protein SCO2 homolog, mitochondrial
Source.900: DFBPPR19118 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1
Source.901: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.902: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein
Source.903: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.904: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha
Source.905: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.906: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.907: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.908: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220
Source.909: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.910: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.911: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.912: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.913: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.914: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.915: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.916: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.917: DFBPPR19463 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.918: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.919: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.920: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.921: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.922: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.923: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.924: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C
Source.925: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.926: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.927: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.928: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.929: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1
Source.930: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.931: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.932: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.933: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.934: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2
Source.935: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.936: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.937: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.938: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.939: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6
Source.940: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial
Source.941: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.942: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.943: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.944: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.945: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.946: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.947: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.948: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.949: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.950: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.951: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.952: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.953: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.954: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.955: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.956: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.957: DFBPPR20292 ---- Animal proteins ---- Caltrin
Source.958: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.959: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.960: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.961: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.962: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.963: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.964: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.965: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.966: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.967: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.968: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.969: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.970: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.971: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.972: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.973: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.974: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.975: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.976: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.977: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.978: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.979: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.980: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.981: DFBPPR20866 ---- Animal proteins ---- PRKR-interacting protein 1
Source.982: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.983: DFBPPR20894 ---- Animal proteins ---- THAP domain-containing protein 11
Source.984: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.985: DFBPPR20913 ---- Animal proteins ---- Somatostatin
Source.986: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.987: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.988: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4
Source.989: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.990: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.991: DFBPPR20996 ---- Animal proteins ---- Tripartite motif-containing protein 44
Source.992: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.993: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.994: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.995: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1
Source.996: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.997: DFBPPR21048 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma
Source.998: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.999: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma
Source.1000: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.1001: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1
Source.1002: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.1003: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.1004: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.1005: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.1006: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.1007: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.1008: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.1009: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2
Source.1010: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.1011: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.1012: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.1013: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.1014: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.1015: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.1016: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.1017: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.1018: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.1019: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.1020: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1021: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2
Source.1022: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1023: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.1024: DFBPPR21703 ---- Animal proteins ---- RRP15-like protein
Source.1025: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.1026: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.1027: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.1028: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.1029: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.1030: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC
Source.1031: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.1032: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.1033: DFBPPR21904 ---- Animal proteins ---- Protein TBATA
Source.1034: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2
Source.1035: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1
Source.1036: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.1037: DFBPPR22022 ---- Animal proteins ---- SRA stem-loop-interacting RNA-binding protein, mitochondrial
Source.1038: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.1039: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1040: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.1041: DFBPPR22100 ---- Animal proteins ---- Centromere protein M
Source.1042: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.1043: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2
Source.1044: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.1045: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.1046: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.1047: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.1048: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.1049: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.1050: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.1051: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.1052: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248
Source.1053: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.1054: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.1055: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1
Source.1056: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.1057: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.1058: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.1059: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1060: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.1061: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1062: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.1063: DFBPPR8593 ---- Animal proteins ---- Caveolin-1
Source.1064: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.1065: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1066: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1067: DFBPPR8625 ---- Animal proteins ---- Appetite-regulating hormone
Source.1068: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.1069: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1070: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1071: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1072: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.1073: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1074: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1075: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.1076: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.1077: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.1078: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.1079: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1080: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.1081: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.1082: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4
Source.1083: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.1084: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.1085: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.1086: DFBPPR9108 ---- Animal proteins ---- Somatostatin
Source.1087: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1
Source.1088: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1089: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1090: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.1091: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4
Source.1092: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1093: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.1094: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1095: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.1096: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.1097: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.1098: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.1099: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1100: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1101: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.1102: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1103: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.1104: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.1105: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.1106: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.1107: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.1108: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1109: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.1110: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1111: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.1112: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.1113: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.1114: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.1115: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.1116: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.1117: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.1118: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.1119: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.1120: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.1121: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.1122: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1123: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4
Source.1124: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.1125: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.1126: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1127: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.1128: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.1129: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.1130: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1131: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.1132: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.1133: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.1134: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.1135: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8
Source.1136: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.1137: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1138: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.1139: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.1140: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1141: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.1142: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1143: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.1144: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1145: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.1146: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.1147: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1148: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1149: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.1150: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.1151: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1152: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.1153: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.1154: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.1155: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.1156: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.1157: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.1158: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1159: DFBPPR10585 ---- Animal proteins ---- Cystatin
Source.1160: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1161: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.1162: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.1163: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.1164: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.1165: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.1166: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1167: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.1168: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.1169: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.1170: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.1171: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b
Source.1172: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C
Source.1173: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1174: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.1175: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1176: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.1177: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1178: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.1179: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.1180: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.1181: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.1182: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.1183: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.1184: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.1185: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.1186: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.1187: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.1188: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.1189: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.1190: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.1191: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.1192: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.1193: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.1194: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.1195: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1196: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.1197: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.1198: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.1199: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.1200: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.1201: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1202: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1203: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.1204: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1205: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.1206: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.1207: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.1208: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.1209: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a
Source.1210: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.1211: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC
Source.1212: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.1213: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.1214: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.1215: DFBPPR11581 ---- Animal proteins ---- PRKR-interacting protein 1 homolog
Source.1216: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.1217: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.1218: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.1219: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.1220: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.1221: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.1222: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.1223: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.1224: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.1225: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.1226: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.1227: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.1228: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.1229: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.1230: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.1231: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.1232: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1
Source.1233: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.1234: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.1235: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.1236: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.1237: DFBPPR12091 ---- Animal proteins ---- Neurofibromin
Source.1238: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.1239: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.1240: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.1241: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.1242: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.1243: DFBPPR12236 ---- Animal proteins ---- Protein FAM133
Source.1244: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.1245: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1246: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1247: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1248: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1249: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1250: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1251: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.1252: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.1253: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.1254: DFBPPR12397 ---- Animal proteins ---- Caveolin-1
Source.1255: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.1256: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.1257: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.1258: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.1259: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1260: DFBPPR12510 ---- Animal proteins ---- Phospholemman
Source.1261: DFBPPR12519 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1
Source.1262: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1263: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1264: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1265: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.1266: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.1267: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1268: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.1269: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.1270: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1271: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.1272: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.1273: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1274: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.1275: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4
Source.1276: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.1277: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.1278: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.1279: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1280: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.1281: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1282: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1283: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.1284: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1285: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.1286: DFBPPR13173 ---- Animal proteins ---- Caveolin-1
Source.1287: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1288: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.1289: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.1290: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.1291: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.1292: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.1293: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.1294: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2
Source.1295: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.1296: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.1297: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1298: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4
Source.1299: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1300: DFBPPR13428 ---- Animal proteins ---- Appetite-regulating hormone
Source.1301: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.1302: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.1303: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1304: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1305: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1306: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.1307: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.1308: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.1309: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1310: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma
Source.1311: DFBPPR13689 ---- Animal proteins ---- Caveolin-1
Source.1312: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1313: DFBPPR13782 ---- Animal proteins ---- BMP and activin membrane-bound inhibitor homolog
Source.1314: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.1315: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1316: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1317: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.1318: DFBPPR13896 ---- Animal proteins ---- Somatostatin
Source.1319: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.1320: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.1321: DFBPPR13935 ---- Animal proteins ---- Major centromere autoantigen B
Source.1322: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.1323: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4
Source.1324: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1325: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1326: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1327: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1328: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.1329: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.1330: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.1331: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.1332: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.1333: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1334: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.1335: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.1336: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.1337: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.1338: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.1339: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.1340: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.1341: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.1342: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.1343: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.1344: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.1345: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.1346: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.1347: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.1348: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.1349: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.1350: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial
Source.1351: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.1352: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.1353: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.1354: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28
Source.1355: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.1356: DFBPPR15281 ---- Microorganism protein ---- Cytochrome c oxidase subunit 9, mitochondrial
Source.1357: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.1358: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.1359: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.1360: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.1361: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.1362: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.1363: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.1364: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.1365: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.1366: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.1367: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.1368: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4
Source.1369: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.1370: DFBPPR15522 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 3
Source.1371: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.1372: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.1373: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.1374: DFBPPR15634 ---- Microorganism protein ---- Hsp70 nucleotide exchange factor FES1
Source.1375: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.1376: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.1377: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.1378: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.1379: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.1380: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.1381: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.1382: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.1383: DFBPPR15847 ---- Microorganism protein ---- Histone H2B
Source.1384: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase
Source.1385: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.1386: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.1387: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.1388: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.1389: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.1390: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1391: DFBPPR7815 ---- Plant protein ---- Photosystem II reaction center protein H
Source.1392: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.1393: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.1394: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.1395: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.1396: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2
Source.1397: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1
Source.1398: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.1399: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2
Source.1400: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.1401: DFBPPR7926 ---- Plant protein ---- Kafirin PSK8
Source.1402: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.1403: DFBPPR8009 ---- Plant protein ---- CASP-like protein 5B1
Source.1404: DFBPPR8012 ---- Plant protein ---- CASP-like protein 5A1
Source.1405: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.1406: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.1407: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.1408: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.1409: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.1410: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.1411: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1412: DFBPPR8261 ---- Plant protein ---- Photosystem II reaction center protein H
Source.1413: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.1414: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII
Source.1415: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Source.1416: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe3+/mol peptide) was measured as a positive control. The peptide AMA showed low antioxidant activity with a relative antioxidant activity of 0.39 ± 0.02 mmol Fe3+/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63.
Other literature(s) N.D
PubDate 2015
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214