Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0844(Antioxidative peptide)

DFBP ID	DFBPANOX0844
Peptide sequence	AAS
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ala-Ala-Ser

Single-letter amino acid

AAS

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	247.24 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

0.9333^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.3: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1 Source.4: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.5: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.6: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.7: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5 Source.8: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3 Source.9: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.10: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.11: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.12: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71 Source.13: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.14: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.15: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.16: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.17: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.18: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.19: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.20: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.21: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.22: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.23: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.24: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.25: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.26: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.27: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.28: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.29: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.30: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.31: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic Source.32: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.33: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.34: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2 Source.35: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.36: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12 Source.37: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.38: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.39: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.40: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6 Source.41: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.42: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.43: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.44: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase Source.45: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.46: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.47: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.48: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.49: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.50: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.51: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.52: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.53: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5 Source.54: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.55: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.56: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.57: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.58: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.59: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.60: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.61: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.62: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.63: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.64: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.65: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase Source.66: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.67: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.68: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.69: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4 Source.70: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.71: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.72: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.73: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.74: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.75: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.76: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.77: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8 Source.78: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.79: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62 Source.80: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3 Source.81: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.82: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.83: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1 Source.84: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79 Source.85: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.86: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.87: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.88: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24 Source.89: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE Source.90: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5 Source.91: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.92: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.93: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1 Source.94: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.95: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB Source.96: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.97: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3 Source.98: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.99: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.100: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.101: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.102: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.103: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6 Source.104: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.105: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.106: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.107: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog Source.108: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.109: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.110: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.111: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.112: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.113: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.114: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.115: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.116: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23 Source.117: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.118: DFBPPR1176 ---- Plant proteins ---- Chitinase 12 Source.119: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.120: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic Source.121: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.122: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3 Source.123: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.124: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.125: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.126: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.127: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic Source.128: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19 Source.129: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.130: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.131: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.132: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.133: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.134: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.135: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.136: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.137: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic Source.138: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.139: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.140: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic Source.141: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.142: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.143: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic Source.144: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.145: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.146: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.147: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.148: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.149: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.150: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.151: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.152: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.153: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.154: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.155: DFBPPR1297 ---- Plant proteins ---- Peroxygenase Source.156: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b Source.157: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22 Source.158: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.159: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.160: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.161: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7 Source.162: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.163: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.164: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.165: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1 Source.166: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.167: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.168: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.169: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.170: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.171: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1 Source.172: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.173: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.174: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.175: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.176: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.177: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.178: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.179: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.180: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.181: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.182: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.183: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.184: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.185: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.186: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2 Source.187: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.188: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.189: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.190: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.191: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3 Source.192: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.193: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.194: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.195: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.196: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.197: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.198: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.199: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.200: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.201: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.202: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic Source.203: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.204: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.205: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.206: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.207: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.208: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.209: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.210: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.211: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.212: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1 Source.213: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.214: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.215: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.216: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.217: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.218: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.219: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.220: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.221: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.222: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.223: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.224: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.225: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.226: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.227: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.228: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.229: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.230: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.231: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.232: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.233: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.234: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.235: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.236: DFBPPR1545 ---- Plant proteins ---- Protein NEGATIVE REGULATOR OF RESISTANCE Source.237: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.238: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5 Source.239: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.240: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.241: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.242: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.243: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51 Source.244: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A Source.245: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.246: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17 Source.247: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.248: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.249: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.250: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.251: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.252: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.253: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.254: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.255: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.256: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.257: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.258: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic Source.259: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.260: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.261: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.262: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.263: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.264: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.265: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.266: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.267: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.268: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a Source.269: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.270: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.271: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.272: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.273: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.274: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.275: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.276: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.277: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2 Source.278: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.279: DFBPPR1641 ---- Plant proteins ---- Enolase Source.280: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic Source.281: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.282: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.283: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.284: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.285: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4 Source.286: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.287: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.288: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.289: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.290: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.291: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.292: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.293: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.294: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.295: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.296: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.297: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1 Source.298: DFBPPR1706 ---- Plant proteins ---- Phytosulfokines 4 Source.299: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.300: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.301: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.302: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.303: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.304: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.305: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.306: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.307: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.308: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic Source.309: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.310: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.311: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.312: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1 Source.313: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.314: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094 Source.315: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57 Source.316: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.317: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.318: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.319: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.320: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.321: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.322: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.323: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.324: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.325: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.326: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.327: DFBPPR1796 ---- Plant proteins ---- Fibrillin protein 5 homolog Source.328: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.329: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.330: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4 Source.331: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.332: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.333: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1 Source.334: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.335: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.336: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2 Source.337: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.338: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.339: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.340: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.341: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.342: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.343: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.344: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.345: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.346: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.347: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.348: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.349: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.350: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.351: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.352: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.353: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.354: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.355: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.356: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.357: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2 Source.358: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8 Source.359: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.360: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.361: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.362: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.363: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.364: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.365: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.366: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.367: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.368: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.369: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.370: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.371: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.372: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.373: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.374: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.375: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.376: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.377: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10 Source.378: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.379: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.380: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.381: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.382: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA Source.383: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.384: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.385: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1 Source.386: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17 Source.387: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.388: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.389: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.390: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.391: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.392: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.393: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.394: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.395: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.396: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.397: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.398: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.399: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.400: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.401: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.402: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.403: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.404: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.405: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.406: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.407: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.408: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.409: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.410: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.411: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.412: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.413: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.414: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.415: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.416: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.417: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5 Source.418: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.419: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.420: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.421: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.422: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.423: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.424: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.425: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.426: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.427: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.428: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1 Source.429: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.430: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.431: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.432: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.433: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.434: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.435: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.436: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.437: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.438: DFBPPR2096 ---- Plant proteins ---- Peroxiredoxin-2E-1, chloroplastic Source.439: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.440: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.441: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12 Source.442: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.443: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.444: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.445: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.446: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2 Source.447: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5 Source.448: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.449: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.450: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.451: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.452: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.453: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.454: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.455: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.456: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.457: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.458: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.459: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.460: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.461: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.462: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.463: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.464: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.465: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2 Source.466: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.467: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.468: DFBPPR2184 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.469: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.470: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.471: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.472: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.473: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.474: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.475: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.476: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.477: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16 Source.478: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial Source.479: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.480: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.481: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.482: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.483: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.484: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.485: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.486: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic Source.487: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.488: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.489: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.490: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha Source.491: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.492: DFBPPR2241 ---- Plant proteins ---- Nitrogen regulatory protein P-II homolog Source.493: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.494: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.495: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.496: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.497: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.498: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.499: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.500: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2 Source.501: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog Source.502: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.503: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.504: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.505: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.506: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic Source.507: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.508: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.509: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.510: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.511: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.512: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.513: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.514: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.515: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.516: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.517: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.518: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.519: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic Source.520: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.521: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.522: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic Source.523: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.524: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.525: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.526: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.527: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.528: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b Source.529: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1 Source.530: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400 Source.531: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.532: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial Source.533: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.534: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.535: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.536: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.537: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.538: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6 Source.539: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.540: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.541: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.542: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.543: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.544: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic Source.545: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.546: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1 Source.547: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.548: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.549: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.550: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.551: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.552: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.553: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.554: DFBPPR2387 ---- Plant proteins ---- Chitinase 8 Source.555: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase Source.556: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1 Source.557: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.558: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.559: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.560: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089 Source.561: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.562: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3 Source.563: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.564: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.565: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.566: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.567: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.568: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.569: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.570: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.571: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.572: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic Source.573: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.574: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.575: DFBPPR2438 ---- Plant proteins ---- Arabinogalactan protein 1 Source.576: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.577: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.578: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.579: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.580: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial Source.581: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.582: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.583: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.584: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.585: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.586: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.587: DFBPPR2485 ---- Plant proteins ---- SKP1-like protein 1 Source.588: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.589: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.590: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.591: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20 Source.592: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.593: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.594: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4 Source.595: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b Source.596: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.597: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.598: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.599: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.600: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.601: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.602: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.603: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.604: DFBPPR2526 ---- Plant proteins ---- Chitinase 10 Source.605: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.606: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.607: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.608: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.609: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.610: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.611: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.612: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein Source.613: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.614: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1 Source.615: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.616: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic Source.617: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.618: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a Source.619: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.620: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.621: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase Source.622: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.623: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4 Source.624: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.625: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.626: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.627: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.628: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.629: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.630: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.631: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1 Source.632: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.633: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a Source.634: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.635: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.636: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.637: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.638: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.639: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.640: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2 Source.641: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E Source.642: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.643: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.644: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12 Source.645: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.646: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.647: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a Source.648: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.649: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.650: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.651: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2 Source.652: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.653: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic Source.654: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8 Source.655: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4 Source.656: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.657: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.658: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.659: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.660: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.661: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.662: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.663: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.664: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.665: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.666: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2 Source.667: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.668: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.669: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic Source.670: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27 Source.671: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.672: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b Source.673: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.674: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal Source.675: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.676: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4 Source.677: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.678: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.679: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.680: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.681: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.682: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.683: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.684: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.685: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.686: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.687: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.688: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.689: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.690: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.691: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.692: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.693: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2 Source.694: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.695: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.696: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.697: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.698: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic Source.699: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.700: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.701: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.702: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1 Source.703: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.704: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.705: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.706: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic Source.707: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B Source.708: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.709: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.710: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.711: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX Source.712: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.713: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.714: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.715: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2 Source.716: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.717: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.718: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.719: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.720: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.721: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c Source.722: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.723: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.724: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7 Source.725: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1 Source.726: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.727: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.728: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.729: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.730: DFBPPR2939 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 5 Source.731: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.732: DFBPPR2948 ---- Plant proteins ---- Expansin-A25 Source.733: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic Source.734: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23 Source.735: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.736: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.737: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.738: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.739: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.740: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.741: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.742: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic Source.743: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.744: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.745: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.746: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.747: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.748: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.749: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.750: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.751: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase Source.752: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.753: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.754: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit Source.755: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c Source.756: DFBPPR3021 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 1 Source.757: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.758: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.759: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.760: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1 Source.761: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.762: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.763: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36 Source.764: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3 Source.765: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8 Source.766: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.767: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.768: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial Source.769: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.770: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3 Source.771: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.772: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.773: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.774: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.775: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.776: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.777: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.778: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.779: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.780: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.781: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.782: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.783: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.784: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20 Source.785: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.786: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6 Source.787: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.788: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.789: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.790: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.791: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.792: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.793: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.794: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13 Source.795: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.796: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.797: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.798: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.799: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3 Source.800: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.801: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.802: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.803: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.804: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.805: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.806: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4 Source.807: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15 Source.808: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.809: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.810: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.811: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.812: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27 Source.813: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.814: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.815: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.816: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.817: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.818: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.819: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.820: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.821: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.822: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.823: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.824: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.825: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial Source.826: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1 Source.827: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain Source.828: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7 Source.829: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.830: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.831: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.832: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.833: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.834: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2 Source.835: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.836: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.837: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.838: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.839: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.840: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.841: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.842: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.843: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic Source.844: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.845: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.846: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.847: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.848: DFBPPR3276 ---- Plant proteins ---- MADS-box transcription factor 27 Source.849: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.850: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.851: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b Source.852: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.853: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b Source.854: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.855: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic Source.856: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9 Source.857: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.858: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.859: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1 Source.860: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13 Source.861: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8 Source.862: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.863: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8 Source.864: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.865: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7 Source.866: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9 Source.867: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30 Source.868: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.869: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5 Source.870: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.871: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit Source.872: DFBPPR3337 ---- Plant proteins ---- Probable acylpyruvase FAHD1, mitochondrial Source.873: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.874: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.875: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.876: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.877: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.878: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2 Source.879: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.880: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.881: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic Source.882: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.883: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.884: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.885: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.886: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.887: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19 Source.888: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.889: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.890: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.891: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.892: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.893: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1 Source.894: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.895: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.896: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.897: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.898: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.899: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12 Source.900: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.901: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1 Source.902: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2 Source.903: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1 Source.904: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15 Source.905: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5 Source.906: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.907: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.908: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11 Source.909: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.910: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.911: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1 Source.912: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.913: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.914: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.915: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.916: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.917: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.918: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3 Source.919: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.920: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.921: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.922: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.923: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.924: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.925: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.926: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17 Source.927: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.928: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A Source.929: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.930: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.931: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.932: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3 Source.933: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.934: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1 Source.935: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.936: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.937: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19 Source.938: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.939: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.940: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.941: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.942: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4 Source.943: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1 Source.944: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.945: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog Source.946: DFBPPR3506 ---- Plant proteins ---- Growth-regulating factor 12 Source.947: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.948: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.949: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.950: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.951: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.952: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.953: DFBPPR3525 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic Source.954: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10 Source.955: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.956: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.957: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.958: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic Source.959: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.960: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.961: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.962: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.963: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.964: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.965: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5 Source.966: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.967: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.968: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.969: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein Source.970: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.971: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2 Source.972: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.973: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.974: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.975: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.976: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1 Source.977: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.978: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e Source.979: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.980: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7 Source.981: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3 Source.982: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.983: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.984: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6 Source.985: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.986: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.987: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.988: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.989: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.990: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.991: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2 Source.992: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4 Source.993: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1 Source.994: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.995: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.996: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.997: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2 Source.998: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.999: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1000: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3 Source.1001: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.1002: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3 Source.1003: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.1004: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25 Source.1005: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.1006: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.1007: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.1008: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.1009: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.1010: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.1011: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.1012: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6 Source.1013: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.1014: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1015: DFBPPR3701 ---- Plant proteins ---- Non-specific lipid-transfer protein C4 Source.1016: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.1017: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase Source.1018: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.1019: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.1020: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.1021: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.1022: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.1023: DFBPPR3753 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1024: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.1025: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12 Source.1026: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.1027: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.1028: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51 Source.1029: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4 Source.1030: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38 Source.1031: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.1032: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial Source.1033: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.1034: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55 Source.1035: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial Source.1036: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.1037: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1 Source.1038: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase Source.1039: DFBPPR3795 ---- Plant proteins ---- NRR repressor homolog 1 Source.1040: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42 Source.1041: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E Source.1042: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.1043: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.1044: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.1045: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic Source.1046: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2 Source.1047: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.1048: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.1049: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.1050: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.1051: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.1052: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12 Source.1053: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial Source.1054: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.1055: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.1056: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic Source.1057: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.1058: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.1059: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.1060: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.1061: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.1062: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.1063: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.1064: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.1065: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.1066: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31 Source.1067: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.1068: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.1069: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.1070: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.1071: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.1072: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.1073: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9 Source.1074: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.1075: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.1076: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4 Source.1077: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.1078: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.1079: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.1080: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.1081: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2 Source.1082: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.1083: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.1084: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.1085: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.1086: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.1087: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10 Source.1088: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.1089: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.1090: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.1091: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.1092: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1 Source.1093: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.1094: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.1095: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.1096: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.1097: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.1098: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.1099: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic Source.1100: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.1101: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.1102: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.1103: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2 Source.1104: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.1105: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2 Source.1106: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.1107: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.1108: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.1109: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.1110: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.1111: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9 Source.1112: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2 Source.1113: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.1114: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.1115: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7 Source.1116: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.1117: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.1118: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.1119: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.1120: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1 Source.1121: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.1122: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.1123: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1 Source.1124: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.1125: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.1126: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.1127: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.1128: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.1129: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.1130: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta Source.1131: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.1132: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C Source.1133: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.1134: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB Source.1135: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A Source.1136: DFBPPR4060 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.1137: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.1138: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.1139: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.1140: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.1141: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.1142: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5 Source.1143: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.1144: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.1145: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.1146: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.1147: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.1148: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.1149: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.1150: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.1151: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.1152: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10 Source.1153: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D Source.1154: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.1155: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.1156: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.1157: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.1158: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4 Source.1159: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.1160: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.1161: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.1162: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.1163: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.1164: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.1165: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.1166: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.1167: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1 Source.1168: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2 Source.1169: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2 Source.1170: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75 Source.1171: DFBPPR4128 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 2 Source.1172: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.1173: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.1174: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.1175: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.1176: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.1177: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.1178: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.1179: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.1180: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6 Source.1181: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.1182: DFBPPR4166 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.1183: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.1184: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.1185: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3 Source.1186: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.1187: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.1188: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic Source.1189: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.1190: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.1191: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial Source.1192: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.1193: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.1194: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1 Source.1195: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.1196: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.1197: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.1198: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.1199: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P Source.1200: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.1201: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.1202: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.1203: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.1204: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.1205: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.1206: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.1207: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.1208: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.1209: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.1210: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.1211: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.1212: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.1213: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.1214: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.1215: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2 Source.1216: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1 Source.1217: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5 Source.1218: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6 Source.1219: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.1220: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.1221: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1 Source.1222: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.1223: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400 Source.1224: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1 Source.1225: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.1226: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.1227: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4 Source.1228: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.1229: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.1230: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.1231: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.1232: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.1233: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.1234: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.1235: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like Source.1236: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.1237: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17 Source.1238: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1 Source.1239: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6 Source.1240: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.1241: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.1242: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.1243: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.1244: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.1245: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.1246: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like Source.1247: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.1248: DFBPPR4329 ---- Plant proteins ---- Metallothionein-like protein 2B Source.1249: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5 Source.1250: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.1251: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5 Source.1252: DFBPPR4339 ---- Plant proteins ---- Protein LHCP TRANSLOCATION DEFECT Source.1253: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.1254: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J Source.1255: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1 Source.1256: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E Source.1257: DFBPPR4345 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 11 Source.1258: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G Source.1259: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.1260: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3 Source.1261: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.1262: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.1263: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.1264: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.1265: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.1266: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.1267: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.1268: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.1269: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6 Source.1270: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1 Source.1271: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.1272: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.1273: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.1274: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2 Source.1275: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.1276: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14 Source.1277: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4 Source.1278: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.1279: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1280: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.1281: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog Source.1282: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.1283: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.1284: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1 Source.1285: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.1286: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.1287: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.1288: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9 Source.1289: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.1290: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.1291: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.1292: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.1293: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.1294: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.1295: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.1296: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.1297: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.1298: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.1299: DFBPPR4451 ---- Plant proteins ---- Mini zinc finger protein 2 Source.1300: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3 Source.1301: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.1302: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.1303: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18 Source.1304: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.1305: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4 Source.1306: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.1307: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.1308: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.1309: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.1310: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.1311: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.1312: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.1313: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.1314: DFBPPR4483 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 11 Source.1315: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1 Source.1316: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.1317: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.1318: DFBPPR4502 ---- Plant proteins ---- Actin-depolymerizing factor 7 Source.1319: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.1320: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.1321: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.1322: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.1323: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.1324: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.1325: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6 Source.1326: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.1327: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.1328: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.1329: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.1330: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7 Source.1331: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.1332: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.1333: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31 Source.1334: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.1335: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase Source.1336: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F Source.1337: DFBPPR4562 ---- Plant proteins ---- Mini zinc finger protein 2 Source.1338: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1 Source.1339: DFBPPR4564 ---- Plant proteins ---- Mini zinc finger protein 1 Source.1340: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1 Source.1341: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1 Source.1342: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.1343: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.1344: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12 Source.1345: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.1346: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.1347: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.1348: DFBPPR4593 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 15 Source.1349: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.1350: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.1351: DFBPPR4604 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 17 Source.1352: DFBPPR4606 ---- Plant proteins ---- ACT domain-containing protein DS12, chloroplastic Source.1353: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic Source.1354: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4 Source.1355: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.1356: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.1357: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19 Source.1358: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.1359: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3 Source.1360: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.1361: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1 Source.1362: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4 Source.1363: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.1364: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.1365: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2 Source.1366: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.1367: DFBPPR4663 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 6 Source.1368: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.1369: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4 Source.1370: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.1371: DFBPPR4669 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 8 Source.1372: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.1373: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.1374: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.1375: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.1376: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17 Source.1377: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.1378: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.1379: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.1380: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2 Source.1381: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.1382: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2 Source.1383: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5 Source.1384: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.1385: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.1386: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51 Source.1387: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.1388: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800 Source.1389: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.1390: DFBPPR4728 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 12 Source.1391: DFBPPR4730 ---- Plant proteins ---- 40S ribosomal protein S13-2 Source.1392: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5 Source.1393: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.1394: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400 Source.1395: DFBPPR4738 ---- Plant proteins ---- Putative yippee-like protein Os10g0369500 Source.1396: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.1397: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3 Source.1398: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic Source.1399: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.1400: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.1401: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400 Source.1402: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.1403: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.1404: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21 Source.1405: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35 Source.1406: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.1407: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic Source.1408: DFBPPR4768 ---- Plant proteins ---- Protein SPIRAL1-like 2 Source.1409: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.1410: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.1411: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.1412: DFBPPR4783 ---- Plant proteins ---- Putative ripening-related protein 7 Source.1413: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.1414: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.1415: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.1416: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.1417: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.1418: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.1419: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.1420: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.1421: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1 Source.1422: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.1423: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000 Source.1424: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.1425: DFBPPR4838 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 4 Source.1426: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400 Source.1427: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48 Source.1428: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800 Source.1429: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.1430: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.1431: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.1432: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900 Source.1433: DFBPPR4872 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0158600 Source.1434: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1 Source.1435: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.1436: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.1437: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940 Source.1438: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.1439: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4 Source.1440: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.1441: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.1442: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.1443: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.1444: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.1445: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.1446: DFBPPR4896 ---- Plant proteins ---- Thioredoxin H1 Source.1447: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.1448: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.1449: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2 Source.1450: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic Source.1451: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.1452: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.1453: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.1454: DFBPPR4915 ---- Plant proteins ---- Chitinase 2 Source.1455: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.1456: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.1457: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.1458: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.1459: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.1460: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.1461: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.1462: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial Source.1463: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1464: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.1465: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.1466: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G Source.1467: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d Source.1468: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.1469: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.1470: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.1471: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.1472: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase Source.1473: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.1474: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.1475: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.1476: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.1477: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.1478: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.1479: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1480: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase Source.1481: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.1482: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.1483: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.1484: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.1485: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic Source.1486: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.1487: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.1488: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2 Source.1489: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.1490: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.1491: DFBPPR5111 ---- Plant proteins ---- Lectin Source.1492: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.1493: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1494: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.1495: DFBPPR5121 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1496: DFBPPR5124 ---- Plant proteins ---- Nodulin-26 Source.1497: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.1498: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A Source.1499: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6 Source.1500: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.1501: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1502: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.1503: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase Source.1504: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1505: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1506: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.1507: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.1508: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1509: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.1510: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.1511: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein Source.1512: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1513: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic Source.1514: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1515: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.1516: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.1517: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.1518: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.1519: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1 Source.1520: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1 Source.1521: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1 Source.1522: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2 Source.1523: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6 Source.1524: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1 Source.1525: DFBPPR5337 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial Source.1526: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase Source.1527: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1528: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1 Source.1529: DFBPPR5354 ---- Plant proteins ---- Protein P21 Source.1530: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A Source.1531: DFBPPR5363 ---- Plant proteins ---- Auxin-induced protein 10A5 Source.1532: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.1533: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.1534: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1535: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.1536: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.1537: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1538: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.1539: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1540: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.1541: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.1542: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.1543: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein Source.1544: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.1545: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.1546: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.1547: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.1548: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.1549: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A Source.1550: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.1551: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase Source.1552: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1 Source.1553: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.1554: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.1555: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.1556: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2 Source.1557: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial Source.1558: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.1559: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.1560: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.1561: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.1562: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic Source.1563: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.1564: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.1565: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.1566: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.1567: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.1568: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.1569: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.1570: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.1571: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.1572: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66 Source.1573: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor Source.1574: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1575: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.1576: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.1577: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.1578: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.1579: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1 Source.1580: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.1581: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase Source.1582: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase Source.1583: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.1584: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.1585: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic Source.1586: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B Source.1587: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.1588: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A Source.1589: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.1590: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.1591: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.1592: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic Source.1593: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7 Source.1594: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.1595: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1596: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.1597: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.1598: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.1599: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1600: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1601: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.1602: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.1603: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.1604: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.1605: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3 Source.1606: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1607: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.1608: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase Source.1609: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.1610: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.1611: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9 Source.1612: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A Source.1613: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1614: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6 Source.1615: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1616: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.1617: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.1618: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.1619: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.1620: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.1621: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.1622: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.1623: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.1624: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.1625: DFBPPR5661 ---- Plant proteins ---- Albumin b-32 Source.1626: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial Source.1627: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.1628: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein Source.1629: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial Source.1630: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.1631: DFBPPR5683 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.1632: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.1633: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.1634: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.1635: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1636: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.1637: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.1638: DFBPPR5706 ---- Plant proteins ---- Glutelin-2 Source.1639: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.1640: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2 Source.1641: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3 Source.1642: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3 Source.1643: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.1644: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1 Source.1645: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1 Source.1646: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.1647: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.1648: DFBPPR5755 ---- Plant proteins ---- Protein Iojap, chloroplastic Source.1649: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.1650: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1651: DFBPPR5777 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1652: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1653: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.1654: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.1655: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1656: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase Source.1657: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1658: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.1659: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1660: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.1661: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog Source.1662: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.1663: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha Source.1664: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.1665: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.1666: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.1667: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.1668: DFBPPR5850 ---- Plant proteins ---- ATP synthase subunit epsilon, mitochondrial Source.1669: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4 Source.1670: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.1671: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P Source.1672: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.1673: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1674: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16 Source.1675: DFBPPR5872 ---- Plant proteins ---- 50S ribosomal protein L29, chloroplastic Source.1676: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.1677: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1 Source.1678: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1 Source.1679: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.1680: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.1681: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.1682: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.1683: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.1684: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1 Source.1685: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein Source.1686: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1687: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.1688: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.1689: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic Source.1690: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.1691: DFBPPR5941 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.1692: DFBPPR5942 ---- Plant proteins ---- GTP-binding protein YPTM2 Source.1693: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.1694: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.1695: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B Source.1696: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.1697: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2 Source.1698: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.1699: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.1700: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.1701: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor Source.1702: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.1703: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.1704: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1 Source.1705: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1 Source.1706: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.1707: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1 Source.1708: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9 Source.1709: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.1710: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.1711: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.1712: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2 Source.1713: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.1714: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.1715: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1 Source.1716: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1 Source.1717: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2 Source.1718: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3 Source.1719: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.1720: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1721: DFBPPR6073 ---- Plant proteins ---- Protein IAL1 Source.1722: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.1723: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1 Source.1724: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7 Source.1725: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1 Source.1726: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10 Source.1727: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1 Source.1728: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20 Source.1729: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2 Source.1730: DFBPPR6101 ---- Plant proteins ---- Zein-alpha M6 Source.1731: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3 Source.1732: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.1733: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1 Source.1734: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1735: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.1736: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.1737: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13 Source.1738: DFBPPR6133 ---- Plant proteins ---- 40S ribosomal protein S13 Source.1739: DFBPPR6147 ---- Plant proteins ---- 60S ribosomal protein L19 Source.1740: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.1741: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein Source.1742: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1743: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.1744: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1745: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.1746: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic Source.1747: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.1748: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1749: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.1750: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1751: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.1752: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.1753: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.1754: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1755: DFBPPR6262 ---- Plant proteins ---- Nodule lectin Source.1756: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic Source.1757: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.1758: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.1759: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.1760: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.1761: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic Source.1762: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.1763: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F Source.1764: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.1765: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.1766: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.1767: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1 Source.1768: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.1769: DFBPPR6351 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1770: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1771: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1772: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1773: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D Source.1774: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2 Source.1775: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.1776: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.1777: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1778: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic Source.1779: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B Source.1780: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A Source.1781: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.1782: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.1783: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.1784: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic Source.1785: DFBPPR6481 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic Source.1786: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.1787: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E Source.1788: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.1789: DFBPPR6511 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1790: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.1791: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1792: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.1793: DFBPPR6573 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial Source.1794: DFBPPR6575 ---- Plant proteins ---- Metallothionein-like protein 1 Source.1795: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1796: DFBPPR6618 ---- Plant proteins ---- 50S ribosomal protein L36, chloroplastic Source.1797: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28 Source.1798: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.1799: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.1800: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.1801: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.1802: DFBPPR6642 ---- Plant proteins ---- Peroxidase Source.1803: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.1804: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase Source.1805: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.1806: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic Source.1807: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A Source.1808: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.1809: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1810: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.1811: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19 Source.1812: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.1813: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5 Source.1814: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.1815: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.1816: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3 Source.1817: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1818: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B Source.1819: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa Source.1820: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.1821: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D Source.1822: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.1823: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.1824: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.1825: DFBPPR6771 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1826: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.1827: DFBPPR6783 ---- Plant proteins ---- Thioredoxin H-type Source.1828: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1829: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.1830: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta Source.1831: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.1832: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1833: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1834: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1835: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1836: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.1837: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1838: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.1839: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1840: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.1841: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10 Source.1842: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic Source.1843: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1844: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1845: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1846: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.1847: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12 Source.1848: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212 Source.1849: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit Source.1850: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.1851: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.1852: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1 Source.1853: DFBPPR6924 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC256 Source.1854: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.1855: DFBPPR6948 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.1856: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.1857: DFBPPR6955 ---- Plant proteins ---- Protein WIR1A Source.1858: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1859: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.1860: DFBPPR6998 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX1/CMX3 Source.1861: DFBPPR7000 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX2 Source.1862: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.1863: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.1864: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.1865: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.1866: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.1867: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.1868: DFBPPR7030 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1869: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.1870: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.1871: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1872: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.1873: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII Source.1874: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.1875: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.1876: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.1877: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1878: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1879: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.1880: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.1881: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.1882: DFBPPR7098 ---- Plant proteins ---- Acyl carrier protein 2, chloroplastic Source.1883: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.1884: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1 Source.1885: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.1886: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.1887: DFBPPR7132 ---- Plant proteins ---- Beta-galactosidase Source.1888: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.1889: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A Source.1890: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.1891: DFBPPR7152 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic Source.1892: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3 Source.1893: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.1894: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.1895: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic Source.1896: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1897: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1898: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.1899: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.1900: DFBPPR7200 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.1 Source.1901: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain Source.1902: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic Source.1903: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1904: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1905: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1906: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.1907: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic Source.1908: DFBPPR7278 ---- Plant proteins ---- Protein BLT4 Source.1909: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1 Source.1910: DFBPPR7307 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.1911: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1912: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A Source.1913: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein Source.1914: DFBPPR7354 ---- Plant proteins ---- Cold-regulated protein 1 Source.1915: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.1916: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.1917: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.1918: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.1919: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.1920: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.1921: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase Source.1922: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.1923: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1924: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.1925: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase Source.1926: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.1927: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1928: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3 Source.1929: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4 Source.1930: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.1931: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1932: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase Source.1933: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1934: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.1935: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.1936: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1937: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1938: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1939: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.1940: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic Source.1941: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.1942: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.1943: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.1944: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.1945: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.1946: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.1947: DFBPPR7594 ---- Milk proteins ---- Lactadherin Source.1948: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.1949: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1950: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.1951: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.1952: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.1953: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4 Source.1954: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein Source.1955: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1956: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.1957: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.1958: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1959: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1960: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.1961: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor Source.1962: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6 Source.1963: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.1964: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.1965: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.1966: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.1967: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1 Source.1968: DFBPPR7676 ---- Milk proteins ---- Kappa-casein Source.1969: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.1970: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.1971: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.1972: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.1973: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.1974: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.1975: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1976: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.1977: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.1978: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.1979: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1980: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.1981: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.1982: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.1983: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.1984: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1985: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1986: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.1987: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin Source.1988: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin Source.1989: DFBPPR8415 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor B-II Source.1990: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5 Source.1991: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.1992: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.1993: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1994: DFBPPR8478 ---- Plant proteins ---- 50S ribosomal protein L12-1, chloroplastic Source.1995: DFBPPR8479 ---- Plant proteins ---- 50S ribosomal protein L12-2, chloroplastic Source.1996: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.1997: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.1998: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.1999: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.2000: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.2001: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.2002: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.2003: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor Source.2004: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3 Source.2005: DFBPPR8523 ---- Milk proteins ---- Perilipin-2 Source.2006: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A Source.2007: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.2008: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1 Source.2009: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2010: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.2011: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.2012: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.2013: DFBPPR15969 ---- Animal proteins ---- Natriuretic peptides A Source.2014: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.2015: DFBPPR15982 ---- Animal proteins ---- Triadin Source.2016: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.2017: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein Source.2018: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.2019: DFBPPR16024 ---- Animal proteins ---- Podocalyxin Source.2020: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.2021: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2022: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.2023: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.2024: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.2025: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.2026: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.2027: DFBPPR16067 ---- Animal proteins ---- CD40 ligand Source.2028: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.2029: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.2030: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.2031: DFBPPR16093 ---- Animal proteins ---- Menin Source.2032: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2033: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.2034: DFBPPR16116 ---- Animal proteins ---- Kit ligand Source.2035: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.2036: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.2037: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2038: DFBPPR16142 ---- Animal proteins ---- Procathepsin L Source.2039: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.2040: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2041: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.2042: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.2043: DFBPPR16170 ---- Animal proteins ---- Inversin Source.2044: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.2045: DFBPPR16179 ---- Animal proteins ---- C-C motif chemokine 8 Source.2046: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.2047: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.2048: DFBPPR16191 ---- Animal proteins ---- Somatotropin Source.2049: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.2050: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.2051: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.2052: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.2053: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2054: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.2055: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.2056: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.2057: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.2058: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2059: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.2060: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.2061: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.2062: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2063: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.2064: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.2065: DFBPPR16279 ---- Animal proteins ---- Galactokinase Source.2066: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.2067: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2 Source.2068: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor Source.2069: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2070: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.2071: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.2072: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.2073: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.2074: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.2075: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.2076: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.2077: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.2078: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.2079: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.2080: DFBPPR16512 ---- Animal proteins ---- Cytochrome c oxidase copper chaperone Source.2081: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.2082: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.2083: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.2084: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.2085: DFBPPR16553 ---- Animal proteins ---- Tapasin Source.2086: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein Source.2087: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.2088: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1 Source.2089: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2 Source.2090: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.2091: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S Source.2092: DFBPPR16594 ---- Animal proteins ---- Macoilin Source.2093: DFBPPR16621 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.2094: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.2095: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H Source.2096: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2097: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4 Source.2098: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.2099: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22 Source.2100: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.2101: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.2102: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.2103: DFBPPR16714 ---- Animal proteins ---- Protein fosB Source.2104: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.2105: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.2106: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2107: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.2108: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.2109: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.2110: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2111: DFBPPR16804 ---- Animal proteins ---- Pancreatic trypsin inhibitor Source.2112: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2113: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic Source.2114: DFBPPR16816 ---- Animal proteins ---- Decorin Source.2115: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.2116: DFBPPR16838 ---- Animal proteins ---- Leptin Source.2117: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.2118: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial Source.2119: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin Source.2120: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2121: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.2122: DFBPPR16893 ---- Animal proteins ---- Annexin A4 Source.2123: DFBPPR16894 ---- Animal proteins ---- Procathepsin L Source.2124: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.2125: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.2126: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.2127: DFBPPR16918 ---- Animal proteins ---- Spastin Source.2128: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.2129: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2130: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.2131: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Source.2132: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2133: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.2134: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.2135: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.2136: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.2137: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2 Source.2138: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.2139: DFBPPR17031 ---- Animal proteins ---- Aurora kinase A Source.2140: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.2141: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.2142: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.2143: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5 Source.2144: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.2145: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.2146: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.2147: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.2148: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.2149: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.2150: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.2151: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.2152: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.2153: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.2154: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.2155: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.2156: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.2157: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.2158: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.2159: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.2160: DFBPPR17192 ---- Animal proteins ---- Kit ligand Source.2161: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.2162: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.2163: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.2164: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.2165: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2166: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.2167: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase Source.2168: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR Source.2169: DFBPPR17278 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.2170: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.2171: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.2172: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7 Source.2173: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.2174: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Source.2175: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.2176: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha Source.2177: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.2178: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.2179: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.2180: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein Source.2181: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.2182: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.2183: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.2184: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.2185: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.2186: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.2187: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.2188: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.2189: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2 Source.2190: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.2191: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.2192: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD Source.2193: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.2194: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.2195: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.2196: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2197: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2198: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1 Source.2199: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.2200: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.2201: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2202: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2203: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2204: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.2205: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.2206: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.2207: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.2208: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.2209: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.2210: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.2211: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase Source.2212: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.2213: DFBPPR17529 ---- Animal proteins ---- C-type lectin domain family 7 member A Source.2214: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.2215: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E Source.2216: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.2217: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.2218: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.2219: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B Source.2220: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.2221: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.2222: DFBPPR17577 ---- Animal proteins ---- Interleukin-1 alpha Source.2223: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1 Source.2224: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.2225: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.2226: DFBPPR17592 ---- Animal proteins ---- Claudin-3 Source.2227: DFBPPR17593 ---- Animal proteins ---- Claudin-3 Source.2228: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.2229: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7 Source.2230: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.2231: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.2232: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2233: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.2234: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.2235: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.2236: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.2237: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.2238: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.2239: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.2240: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.2241: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.2242: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1 Source.2243: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.2244: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.2245: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein Source.2246: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.2247: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.2248: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C Source.2249: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.2250: DFBPPR17810 ---- Animal proteins ---- Histone H1.2 Source.2251: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.2252: DFBPPR17823 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 1 Source.2253: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.2254: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.2255: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3 Source.2256: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B Source.2257: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.2258: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.2259: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.2260: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.2261: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.2262: DFBPPR17875 ---- Animal proteins ---- Brain acid soluble protein 1 Source.2263: DFBPPR17879 ---- Animal proteins ---- Menin Source.2264: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.2265: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase Source.2266: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.2267: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.2268: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.2269: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.2270: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.2271: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.2272: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.2273: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.2274: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.2275: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2276: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.2277: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.2278: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.2279: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.2280: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.2281: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.2282: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.2283: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.2284: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.2285: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.2286: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.2287: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.2288: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.2289: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.2290: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2291: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.2292: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.2293: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.2294: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.2295: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.2296: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.2297: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.2298: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.2299: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.2300: DFBPPR18017 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19 Source.2301: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.2302: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.2303: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3 Source.2304: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.2305: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S Source.2306: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial Source.2307: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A Source.2308: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.2309: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.2310: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.2311: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2312: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.2313: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2314: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta Source.2315: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.2316: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.2317: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase Source.2318: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.2319: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.2320: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.2321: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.2322: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4 Source.2323: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23 Source.2324: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.2325: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.2326: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.2327: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1 Source.2328: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1 Source.2329: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.2330: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.2331: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.2332: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.2333: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B Source.2334: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.2335: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.2336: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.2337: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.2338: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.2339: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.2340: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2 Source.2341: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.2342: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.2343: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.2344: DFBPPR18257 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2345: DFBPPR18262 ---- Animal proteins ---- Claudin-1 Source.2346: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2347: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.2348: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.2349: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.2350: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.2351: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.2352: DFBPPR18312 ---- Animal proteins ---- Interleukin-10 Source.2353: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B Source.2354: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.2355: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial Source.2356: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.2357: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.2358: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.2359: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha Source.2360: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2 Source.2361: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.2362: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.2363: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.2364: DFBPPR18373 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1 Source.2365: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.2366: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.2367: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.2368: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.2369: DFBPPR18394 ---- Animal proteins ---- Histone H1.1 Source.2370: DFBPPR18396 ---- Animal proteins ---- Corticoliberin Source.2371: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.2372: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.2373: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1 Source.2374: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.2375: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.2376: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.2377: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12 Source.2378: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.2379: DFBPPR18441 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.2380: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2381: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.2382: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1 Source.2383: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.2384: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.2385: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial Source.2386: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.2387: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.2388: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3 Source.2389: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2390: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.2391: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb Source.2392: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.2393: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit Source.2394: DFBPPR18516 ---- Animal proteins ---- Galactokinase Source.2395: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.2396: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.2397: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.2398: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.2399: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.2400: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.2401: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.2402: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.2403: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.2404: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1 Source.2405: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal Source.2406: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S Source.2407: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.2408: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6 Source.2409: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.2410: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.2411: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.2412: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26 Source.2413: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.2414: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.2415: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.2416: DFBPPR18623 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial Source.2417: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2 Source.2418: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2419: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.2420: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.2421: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.2422: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.2423: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Source.2424: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2 Source.2425: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2426: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.2427: DFBPPR18753 ---- Animal proteins ---- Endosome-associated-trafficking regulator 1 Source.2428: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.2429: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.2430: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.2431: DFBPPR18778 ---- Animal proteins ---- Erlin-2 Source.2432: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A Source.2433: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.2434: DFBPPR18785 ---- Animal proteins ---- Protein lin-7 homolog C Source.2435: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A Source.2436: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.2437: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.2438: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.2439: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.2440: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.2441: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.2442: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.2443: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.2444: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.2445: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2446: DFBPPR18889 ---- Animal proteins ---- Achaete-scute homolog 2 Source.2447: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.2448: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.2449: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.2450: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.2451: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1 Source.2452: DFBPPR18911 ---- Animal proteins ---- Mesencephalic astrocyte-derived neurotrophic factor Source.2453: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.2454: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.2455: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.2456: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.2457: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.2458: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial Source.2459: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.2460: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1 Source.2461: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1 Source.2462: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.2463: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.2464: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog Source.2465: DFBPPR18995 ---- Animal proteins ---- Tektin-3 Source.2466: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.2467: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa Source.2468: DFBPPR19003 ---- Animal proteins ---- Protein lin-7 homolog A Source.2469: DFBPPR19004 ---- Animal proteins ---- Histone H1.3 Source.2470: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.2471: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.2472: DFBPPR19034 ---- Animal proteins ---- Sialomucin core protein 24 Source.2473: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase Source.2474: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.2475: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.2476: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5 Source.2477: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.2478: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.2479: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.2480: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.2481: DFBPPR19076 ---- Animal proteins ---- Protein MGARP Source.2482: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.2483: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2 Source.2484: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A Source.2485: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.2486: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.2487: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1 Source.2488: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit Source.2489: DFBPPR19131 ---- Animal proteins ---- Nectin-4 Source.2490: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2491: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.2492: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.2493: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator Source.2494: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.2495: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2496: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.2497: DFBPPR19185 ---- Animal proteins ---- Partner of Y14 and mago Source.2498: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4 Source.2499: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.2500: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.2501: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.2502: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.2503: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.2504: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.2505: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein Source.2506: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog Source.2507: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.2508: DFBPPR19253 ---- Animal proteins ---- Limbin Source.2509: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.2510: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2 Source.2511: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.2512: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2 Source.2513: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.2514: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.2515: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide Source.2516: DFBPPR19291 ---- Animal proteins ---- Multicilin Source.2517: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.2518: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.2519: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.2520: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1 Source.2521: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.2522: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.2523: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.2524: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85 Source.2525: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.2526: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.2527: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.2528: DFBPPR19346 ---- Animal proteins ---- Cylicin-1 Source.2529: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.2530: DFBPPR19359 ---- Animal proteins ---- Spartin Source.2531: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.2532: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.2533: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.2534: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.2535: DFBPPR19384 ---- Animal proteins ---- Complement component C9 Source.2536: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.2537: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.2538: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6 Source.2539: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.2540: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.2541: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.2542: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.2543: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase Source.2544: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22 Source.2545: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.2546: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.2547: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.2548: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2 Source.2549: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B Source.2550: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4 Source.2551: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial Source.2552: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.2553: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.2554: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.2555: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.2556: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5 Source.2557: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase Source.2558: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1 Source.2559: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4 Source.2560: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.2561: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG Source.2562: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.2563: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.2564: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase Source.2565: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.2566: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.2567: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.2568: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4 Source.2569: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.2570: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.2571: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4 Source.2572: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.2573: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.2574: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.2575: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.2576: DFBPPR19590 ---- Animal proteins ---- Norrin Source.2577: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.2578: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.2579: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.2580: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.2581: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.2582: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.2583: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein Source.2584: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.2585: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.2586: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.2587: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3 Source.2588: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1 Source.2589: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.2590: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.2591: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2 Source.2592: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.2593: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1 Source.2594: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3 Source.2595: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog Source.2596: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.2597: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.2598: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.2599: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.2600: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2 Source.2601: DFBPPR19756 ---- Animal proteins ---- Ras-related protein Rab-1B Source.2602: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.2603: DFBPPR19758 ---- Animal proteins ---- MICOS complex subunit MIC25 Source.2604: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor Source.2605: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.2606: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit Source.2607: DFBPPR19783 ---- Animal proteins ---- Syndecan-1 Source.2608: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.2609: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1 Source.2610: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2 Source.2611: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.2612: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3 Source.2613: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3 Source.2614: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.2615: DFBPPR19810 ---- Animal proteins ---- Seipin Source.2616: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.2617: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.2618: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.2619: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.2620: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.2621: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.2622: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.2623: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.2624: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial Source.2625: DFBPPR19844 ---- Animal proteins ---- Prosalusin Source.2626: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.2627: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.2628: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.2629: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A Source.2630: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase Source.2631: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1 Source.2632: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.2633: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2634: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1 Source.2635: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial Source.2636: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic Source.2637: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30 Source.2638: DFBPPR19914 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2 Source.2639: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3 Source.2640: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.2641: DFBPPR19927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] flavoprotein 3, mitochondrial Source.2642: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1 Source.2643: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial Source.2644: DFBPPR19944 ---- Animal proteins ---- Histone H1.0 Source.2645: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.2646: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.2647: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.2648: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.2649: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein Source.2650: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.2651: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.2652: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.2653: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C Source.2654: DFBPPR20006 ---- Animal proteins ---- Protein Abitram Source.2655: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.2656: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.2657: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.2658: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1 Source.2659: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.2660: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.2661: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.2662: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial Source.2663: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.2664: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.2665: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.2666: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.2667: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2 Source.2668: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.2669: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.2670: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2671: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.2672: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.2673: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2 Source.2674: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial Source.2675: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.2676: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.2677: DFBPPR20163 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6f Source.2678: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.2679: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.2680: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.2681: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein Source.2682: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40 Source.2683: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.2684: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein Source.2685: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3 Source.2686: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.2687: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4 Source.2688: DFBPPR20210 ---- Animal proteins ---- Exonuclease V Source.2689: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.2690: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.2691: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.2692: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.2693: DFBPPR20247 ---- Animal proteins ---- Claudin-15 Source.2694: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14 Source.2695: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.2696: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.2697: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1 Source.2698: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.2699: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.2700: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.2701: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3 Source.2702: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.2703: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.2704: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2705: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14 Source.2706: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2707: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2 Source.2708: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.2709: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C Source.2710: DFBPPR20374 ---- Animal proteins ---- 5'-deoxynucleotidase HDDC2 Source.2711: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.2712: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.2713: DFBPPR20396 ---- Animal proteins ---- Claudin-5 Source.2714: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.2715: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A Source.2716: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61 Source.2717: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.2718: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.2719: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2 Source.2720: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF Source.2721: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.2722: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.2723: DFBPPR20478 ---- Animal proteins ---- Macoilin Source.2724: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.2725: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.2726: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1 Source.2727: DFBPPR20506 ---- Animal proteins ---- Akirin-2 Source.2728: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.2729: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.2730: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2 Source.2731: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6 Source.2732: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36 Source.2733: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6 Source.2734: DFBPPR20536 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.2735: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16 Source.2736: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.2737: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1 Source.2738: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.2739: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.2740: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.2741: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2742: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.2743: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.2744: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201 Source.2745: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog Source.2746: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.2747: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.2748: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.2749: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.2750: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.2751: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.2752: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.2753: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.2754: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13 Source.2755: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.2756: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.2757: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.2758: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.2759: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial Source.2760: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91 Source.2761: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa Source.2762: DFBPPR20679 ---- Animal proteins ---- Ragulator complex protein LAMTOR4 Source.2763: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.2764: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.2765: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.2766: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.2767: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.2768: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.2769: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.2770: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.2771: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3 Source.2772: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1 Source.2773: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.2774: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.2775: DFBPPR20728 ---- Animal proteins ---- Serine protease 45 Source.2776: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11 Source.2777: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial Source.2778: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6 Source.2779: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.2780: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1 Source.2781: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B Source.2782: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45 Source.2783: DFBPPR20766 ---- Animal proteins ---- Torsin-2A Source.2784: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.2785: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.2786: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1 Source.2787: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.2788: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2789: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.2790: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.2791: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148 Source.2792: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.2793: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.2794: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2 Source.2795: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.2796: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.2797: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.2798: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.2799: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.2800: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1 Source.2801: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta Source.2802: DFBPPR20866 ---- Animal proteins ---- PRKR-interacting protein 1 Source.2803: DFBPPR20871 ---- Animal proteins ---- Iron-sulfur cluster assembly 2 homolog, mitochondrial Source.2804: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.2805: DFBPPR20894 ---- Animal proteins ---- THAP domain-containing protein 11 Source.2806: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2807: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.2808: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.2809: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.2810: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A Source.2811: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1 Source.2812: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.2813: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.2814: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.2815: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.2816: DFBPPR20973 ---- Animal proteins ---- Growth-regulated protein homolog gamma Source.2817: DFBPPR20978 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 B Source.2818: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.2819: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.2820: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.2821: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial Source.2822: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2 Source.2823: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.2824: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.2825: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.2826: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26 Source.2827: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.2828: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5 Source.2829: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein Source.2830: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1 Source.2831: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.2832: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.2833: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.2834: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.2835: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.2836: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.2837: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.2838: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22 Source.2839: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.2840: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.2841: DFBPPR21087 ---- Animal proteins ---- Claudin-11 Source.2842: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.2843: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.2844: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.2845: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.2846: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.2847: DFBPPR21137 ---- Animal proteins ---- Thioredoxin domain-containing protein 12 Source.2848: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2 Source.2849: DFBPPR21149 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 4 Source.2850: DFBPPR21160 ---- Animal proteins ---- Prefoldin subunit 3 Source.2851: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.2852: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A Source.2853: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.2854: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52 Source.2855: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase Source.2856: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.2857: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173 Source.2858: DFBPPR21187 ---- Animal proteins ---- Plasmolipin Source.2859: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22 Source.2860: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.2861: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16 Source.2862: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.2863: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.2864: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome Source.2865: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6 Source.2866: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1 Source.2867: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.2868: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.2869: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.2870: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4 Source.2871: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3 Source.2872: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.2873: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.2874: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.2875: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.2876: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog Source.2877: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4 Source.2878: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen Source.2879: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.2880: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial Source.2881: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.2882: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.2883: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner Source.2884: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124 Source.2885: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.2886: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692 Source.2887: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.2888: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3 Source.2889: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.2890: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2 Source.2891: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.2892: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.2893: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.2894: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.2895: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.2896: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37 Source.2897: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.2898: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.2899: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like Source.2900: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.2901: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.2902: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2 Source.2903: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8 Source.2904: DFBPPR21450 ---- Animal proteins ---- Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1 Source.2905: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.2906: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.2907: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.2908: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8 Source.2909: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35 Source.2910: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.2911: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3 Source.2912: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.2913: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.2914: DFBPPR21494 ---- Animal proteins ---- Spleen trypsin inhibitor I Source.2915: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.2916: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.2917: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.2918: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.2919: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4 Source.2920: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.2921: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.2922: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.2923: DFBPPR21546 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 29 Source.2924: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.2925: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.2926: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.2927: DFBPPR21579 ---- Animal proteins ---- Protein phosphatase inhibitor 2 Source.2928: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2 Source.2929: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2930: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10 Source.2931: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.2932: DFBPPR21600 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit H Source.2933: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.2934: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.2935: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1 Source.2936: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4 Source.2937: DFBPPR21640 ---- Animal proteins ---- 60S ribosomal protein L35 Source.2938: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.2939: DFBPPR21652 ---- Animal proteins ---- Protein Flattop Source.2940: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.2941: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8 Source.2942: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2 Source.2943: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A Source.2944: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.2945: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2 Source.2946: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.2947: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.2948: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.2949: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6 Source.2950: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.2951: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.2952: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial Source.2953: DFBPPR21793 ---- Animal proteins ---- Dynein light chain Tctex-type protein 2B Source.2954: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B Source.2955: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.2956: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein Source.2957: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2958: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.2959: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.2960: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.2961: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24 Source.2962: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2 Source.2963: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526 Source.2964: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A Source.2965: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.2966: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.2967: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3 Source.2968: DFBPPR21864 ---- Animal proteins ---- Arpin Source.2969: DFBPPR21867 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5 Source.2970: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin Source.2971: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19 Source.2972: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial Source.2973: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2 Source.2974: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.2975: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.2976: DFBPPR21918 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 21 Source.2977: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2 Source.2978: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14 Source.2979: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2 Source.2980: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.2981: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.2982: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.2983: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.2984: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.2985: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog Source.2986: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28 Source.2987: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.2988: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2989: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.2990: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial Source.2991: DFBPPR22022 ---- Animal proteins ---- SRA stem-loop-interacting RNA-binding protein, mitochondrial Source.2992: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.2993: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.2994: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A Source.2995: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial Source.2996: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.2997: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.2998: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1 Source.2999: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.3000: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.3001: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.3002: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a Source.3003: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.3004: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.3005: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.3006: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.3007: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1 Source.3008: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.3009: DFBPPR22161 ---- Animal proteins ---- 39S ribosomal protein L53, mitochondrial Source.3010: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.3011: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106 Source.3012: DFBPPR22174 ---- Animal proteins ---- Ribonuclease kappa Source.3013: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.3014: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.3015: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.3016: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.3017: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.3018: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9 Source.3019: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2 Source.3020: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.3021: DFBPPR22243 ---- Animal proteins ---- COMM domain-containing protein 4 Source.3022: DFBPPR22268 ---- Animal proteins ---- Keratin-associated protein 10-8 Source.3023: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1 Source.3024: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.3025: DFBPPR22283 ---- Animal proteins ---- F-box only protein 8 Source.3026: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.3027: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.3028: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein Source.3029: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2 Source.3030: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.3031: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1 Source.3032: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.3033: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.3034: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80 Source.3035: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.3036: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like Source.3037: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.3038: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4 Source.3039: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.3040: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.3041: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3 Source.3042: DFBPPR22414 ---- Animal proteins ---- Protein C10 Source.3043: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.3044: DFBPPR22425 ---- Animal proteins ---- Protein THEM6 Source.3045: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B Source.3046: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.3047: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.3048: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11 Source.3049: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.3050: DFBPPR22471 ---- Animal proteins ---- Protein shisa-like-2B Source.3051: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.3052: DFBPPR22491 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1B Source.3053: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C Source.3054: DFBPPR22498 ---- Animal proteins ---- Protein NATD1 Source.3055: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.3056: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2 Source.3057: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.3058: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126 Source.3059: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.3060: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1 Source.3061: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1 Source.3062: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5 Source.3063: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.3064: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1 Source.3065: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A Source.3066: DFBPPR22585 ---- Animal proteins ---- UPF0449 protein C19orf25 homolog Source.3067: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog Source.3068: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171 Source.3069: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog Source.3070: DFBPPR22598 ---- Animal proteins ---- UPF0488 protein C8orf33 homolog Source.3071: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.3072: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.3073: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.3074: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.3075: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1 Source.3076: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61 Source.3077: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30 Source.3078: DFBPPR22640 ---- Animal proteins ---- Placenta-specific gene 8 protein Source.3079: DFBPPR22660 ---- Animal proteins ---- Leydig cell tumor 10 kDa protein homolog Source.3080: DFBPPR22682 ---- Animal proteins ---- Protein FAM216A Source.3081: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.3082: DFBPPR22700 ---- Animal proteins ---- Protein FAM89A Source.3083: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog Source.3084: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.3085: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1 Source.3086: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.3087: DFBPPR22722 ---- Animal proteins ---- Uncharacterized protein C11orf91 homolog Source.3088: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog Source.3089: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein Source.3090: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog Source.3091: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.3092: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.3093: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.3094: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial Source.3095: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.3096: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.3097: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.3098: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.3099: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.3100: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.3101: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.3102: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.3103: DFBPPR8595 ---- Animal proteins ---- Annexin A4 Source.3104: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.3105: DFBPPR8598 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5 Source.3106: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2 Source.3107: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.3108: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.3109: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.3110: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.3111: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.3112: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.3113: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.3114: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.3115: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.3116: DFBPPR8655 ---- Animal proteins ---- Azurocidin Source.3117: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A Source.3118: DFBPPR8670 ---- Animal proteins ---- Aurora kinase A Source.3119: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.3120: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.3121: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.3122: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.3123: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.3124: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.3125: DFBPPR8694 ---- Animal proteins ---- Spastin Source.3126: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.3127: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein Source.3128: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.3129: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.3130: DFBPPR8733 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial Source.3131: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.3132: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.3133: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.3134: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.3135: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.3136: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.3137: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.3138: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.3139: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.3140: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.3141: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.3142: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.3143: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1 Source.3144: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.3145: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.3146: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.3147: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.3148: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.3149: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.3150: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.3151: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.3152: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.3153: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.3154: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.3155: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.3156: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.3157: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.3158: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3159: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.3160: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.3161: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.3162: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.3163: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.3164: DFBPPR8939 ---- Animal proteins ---- Kit ligand Source.3165: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.3166: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.3167: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.3168: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.3169: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3 Source.3170: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.3171: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.3172: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.3173: DFBPPR9012 ---- Animal proteins ---- Orexin Source.3174: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.3175: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.3176: DFBPPR9036 ---- Animal proteins ---- Antimicrobial peptide NK-lysin Source.3177: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.3178: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.3179: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.3180: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.3181: DFBPPR9092 ---- Animal proteins ---- Galanin peptides Source.3182: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.3183: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.3184: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.3185: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3186: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.3187: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.3188: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.3189: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.3190: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.3191: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial Source.3192: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.3193: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.3194: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.3195: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.3196: DFBPPR9223 ---- Animal proteins ---- Protransforming growth factor alpha Source.3197: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.3198: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.3199: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.3200: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.3201: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase Source.3202: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.3203: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.3204: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.3205: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.3206: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.3207: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.3208: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.3209: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.3210: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.3211: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B Source.3212: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.3213: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.3214: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.3215: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.3216: DFBPPR9366 ---- Animal proteins ---- Decorin Source.3217: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.3218: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.3219: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta Source.3220: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3221: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.3222: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.3223: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor Source.3224: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.3225: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.3226: DFBPPR9484 ---- Animal proteins ---- Macoilin Source.3227: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.3228: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.3229: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.3230: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.3231: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor Source.3232: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial Source.3233: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.3234: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.3235: DFBPPR9547 ---- Animal proteins ---- Ras-related protein Rab-1B Source.3236: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.3237: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.3238: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.3239: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.3240: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor Source.3241: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.3242: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.3243: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.3244: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.3245: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.3246: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.3247: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.3248: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.3249: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.3250: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.3251: DFBPPR9656 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.3252: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.3253: DFBPPR9662 ---- Animal proteins ---- 60S ribosomal protein L35 Source.3254: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.3255: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.3256: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.3257: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.3258: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39 Source.3259: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.3260: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.3261: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2 Source.3262: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.3263: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region Source.3264: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.3265: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.3266: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.3267: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.3268: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1 Source.3269: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15 Source.3270: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.3271: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.3272: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1 Source.3273: DFBPPR9827 ---- Animal proteins ---- Guanylate cyclase activator 2B Source.3274: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.3275: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.3276: DFBPPR9841 ---- Animal proteins ---- Interleukin-10 Source.3277: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.3278: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.3279: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.3280: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.3281: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.3282: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.3283: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19 Source.3284: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.3285: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3286: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.3287: DFBPPR9940 ---- Animal proteins ---- Neuronatin Source.3288: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.3289: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.3290: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.3291: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.3292: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.3293: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.3294: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.3295: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin Source.3296: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.3297: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.3298: DFBPPR9989 ---- Animal proteins ---- VIP peptides Source.3299: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.3300: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.3301: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.3302: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.3303: DFBPPR10004 ---- Animal proteins ---- Spastin Source.3304: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.3305: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.3306: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.3307: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.3308: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.3309: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.3310: DFBPPR10054 ---- Animal proteins ---- Kit ligand Source.3311: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.3312: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.3313: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.3314: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.3315: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.3316: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3317: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.3318: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1 Source.3319: DFBPPR10139 ---- Animal proteins ---- Cytochrome b Source.3320: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.3321: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.3322: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.3323: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor Source.3324: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.3325: DFBPPR10157 ---- Animal proteins ---- CD40 ligand Source.3326: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.3327: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.3328: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.3329: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3 Source.3330: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.3331: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.3332: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1 Source.3333: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.3334: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.3335: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.3336: DFBPPR10205 ---- Animal proteins ---- Noelin Source.3337: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A Source.3338: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.3339: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2 Source.3340: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.3341: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein Source.3342: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.3343: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.3344: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.3345: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.3346: DFBPPR10270 ---- Animal proteins ---- Agrin Source.3347: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.3348: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.3349: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.3350: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.3351: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.3352: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.3353: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.3354: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.3355: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.3356: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.3357: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.3358: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.3359: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor Source.3360: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3 Source.3361: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.3362: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.3363: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3364: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog Source.3365: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2 Source.3366: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.3367: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.3368: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.3369: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.3370: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha Source.3371: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24 Source.3372: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.3373: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.3374: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.3375: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.3376: DFBPPR10405 ---- Animal proteins ---- Ras-related protein Rab-8A Source.3377: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.3378: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.3379: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.3380: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.3381: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10 Source.3382: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.3383: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.3384: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.3385: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.3386: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.3387: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.3388: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.3389: DFBPPR10459 ---- Animal proteins ---- Reelin Source.3390: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.3391: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3392: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.3393: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.3394: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.3395: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.3396: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.3397: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.3398: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.3399: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.3400: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.3401: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.3402: DFBPPR10537 ---- Animal proteins ---- Neuromodulin Source.3403: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.3404: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1 Source.3405: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.3406: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.3407: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.3408: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.3409: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.3410: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.3411: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.3412: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B Source.3413: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.3414: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.3415: DFBPPR10605 ---- Animal proteins ---- Elastin Source.3416: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.3417: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.3418: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.3419: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.3420: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.3421: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D Source.3422: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.3423: DFBPPR10634 ---- Animal proteins ---- Procathepsin L Source.3424: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.3425: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.3426: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3 Source.3427: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.3428: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.3429: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.3430: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.3431: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.3432: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.3433: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.3434: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.3435: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.3436: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.3437: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.3438: DFBPPR10685 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1 Source.3439: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.3440: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.3441: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.3442: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.3443: DFBPPR10703 ---- Animal proteins ---- Tensin Source.3444: DFBPPR10709 ---- Animal proteins ---- Docking protein 3 Source.3445: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1 Source.3446: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog Source.3447: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.3448: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.3449: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.3450: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.3451: DFBPPR10755 ---- Animal proteins ---- Draxin Source.3452: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.3453: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.3454: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.3455: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3456: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3457: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3458: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.3459: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b Source.3460: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase Source.3461: DFBPPR10796 ---- Animal proteins ---- Protrudin Source.3462: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1 Source.3463: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.3464: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.3465: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.3466: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain Source.3467: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.3468: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1 Source.3469: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2 Source.3470: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.3471: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.3472: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2 Source.3473: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.3474: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3 Source.3475: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.3476: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.3477: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1 Source.3478: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.3479: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.3480: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.3481: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12 Source.3482: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.3483: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.3484: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.3485: DFBPPR10932 ---- Animal proteins ---- Histone H1.11L Source.3486: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.3487: DFBPPR10934 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.3488: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos Source.3489: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.3490: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.3491: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.3492: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.3493: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type Source.3494: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.3495: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.3496: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein Source.3497: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.3498: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C Source.3499: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.3500: DFBPPR10987 ---- Animal proteins ---- Charged multivesicular body protein 6 Source.3501: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.3502: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.3503: DFBPPR11016 ---- Animal proteins ---- Protein lin-7 homolog C Source.3504: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.3505: DFBPPR11035 ---- Animal proteins ---- Protein Dr1 Source.3506: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.3507: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.3508: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.3509: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.3510: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.3511: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.3512: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.3513: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.3514: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.3515: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.3516: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.3517: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.3518: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.3519: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin Source.3520: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.3521: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.3522: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.3523: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.3524: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.3525: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.3526: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.3527: DFBPPR11133 ---- Animal proteins ---- Transcription factor MafG Source.3528: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.3529: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7 Source.3530: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.3531: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog Source.3532: DFBPPR11156 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase Source.3533: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.3534: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.3535: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.3536: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.3537: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.3538: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.3539: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.3540: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF Source.3541: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.3542: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.3543: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.3544: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.3545: DFBPPR11241 ---- Animal proteins ---- Lymphocyte antigen 6E Source.3546: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.3547: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.3548: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.3549: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.3550: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.3551: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.3552: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.3553: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.3554: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.3555: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.3556: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.3557: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.3558: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.3559: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.3560: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta Source.3561: DFBPPR11302 ---- Animal proteins ---- Histone H1.11R Source.3562: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1 Source.3563: DFBPPR11312 ---- Animal proteins ---- Transcription factor MafK Source.3564: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3 Source.3565: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3 Source.3566: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.3567: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42 Source.3568: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.3569: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1 Source.3570: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2 Source.3571: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.3572: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.3573: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.3574: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1 Source.3575: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.3576: DFBPPR11354 ---- Animal proteins ---- Centromere protein O Source.3577: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.3578: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.3579: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.3580: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX Source.3581: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.3582: DFBPPR11376 ---- Animal proteins ---- Lamin-A Source.3583: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.3584: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.3585: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.3586: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.3587: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4 Source.3588: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.3589: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.3590: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.3591: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.3592: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.3593: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.3594: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1 Source.3595: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6 Source.3596: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3597: DFBPPR11448 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase 2 Source.3598: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7 Source.3599: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2 Source.3600: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.3601: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2 Source.3602: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46 Source.3603: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.3604: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.3605: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.3606: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.3607: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2 Source.3608: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog Source.3609: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11 Source.3610: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.3611: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.3612: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.3613: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.3614: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.3615: DFBPPR11552 ---- Animal proteins ---- RecQ-mediated genome instability protein 2 Source.3616: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein Source.3617: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32 Source.3618: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.3619: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.3620: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.3621: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.3622: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.3623: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.3624: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.3625: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.3626: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.3627: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3628: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon Source.3629: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.3630: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.3631: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.3632: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein Source.3633: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1 Source.3634: DFBPPR11692 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14B Source.3635: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit Source.3636: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.3637: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.3638: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.3639: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.3640: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.3641: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.3642: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.3643: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1 Source.3644: DFBPPR11738 ---- Animal proteins ---- Ensconsin Source.3645: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61 Source.3646: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1 Source.3647: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2 Source.3648: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38 Source.3649: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15 Source.3650: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.3651: DFBPPR11765 ---- Animal proteins ---- Peptide YY-like Source.3652: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1 Source.3653: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B Source.3654: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.3655: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.3656: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.3657: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.3658: DFBPPR11784 ---- Animal proteins ---- Homeobox protein Hox-B8 Source.3659: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.3660: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1 Source.3661: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22 Source.3662: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.3663: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.3664: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.3665: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.3666: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.3667: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.3668: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.3669: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.3670: DFBPPR11851 ---- Animal proteins ---- Borealin Source.3671: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.3672: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.3673: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2 Source.3674: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1 Source.3675: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein Source.3676: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61 Source.3677: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.3678: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.3679: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A Source.3680: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.3681: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like Source.3682: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.3683: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna Source.3684: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.3685: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.3686: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.3687: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.3688: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.3689: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD Source.3690: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.3691: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.3692: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.3693: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.3694: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.3695: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein Source.3696: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.3697: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.3698: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.3699: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4 Source.3700: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.3701: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.3702: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.3703: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.3704: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.3705: DFBPPR12023 ---- Animal proteins ---- 60S ribosomal protein L35 Source.3706: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.3707: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208 Source.3708: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.3709: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.3710: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2 Source.3711: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.3712: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.3713: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.3714: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.3715: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC Source.3716: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.3717: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.3718: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.3719: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5 Source.3720: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.3721: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.3722: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4 Source.3723: DFBPPR12097 ---- Animal proteins ---- Photoreceptor outer segment membrane glycoprotein 2 Source.3724: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.3725: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21 Source.3726: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.3727: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.3728: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.3729: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3 Source.3730: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.3731: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.3732: DFBPPR12158 ---- Animal proteins ---- Protein CDV3 homolog Source.3733: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.3734: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.3735: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.3736: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Source.3737: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog Source.3738: DFBPPR12203 ---- Animal proteins ---- Small acidic protein Source.3739: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180 Source.3740: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.3741: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.3742: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174 Source.3743: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.3744: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.3745: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.3746: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.3747: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.3748: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A Source.3749: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.3750: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.3751: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3752: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.3753: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.3754: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.3755: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.3756: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.3757: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.3758: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.3759: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3760: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.3761: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.3762: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.3763: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.3764: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3765: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.3766: DFBPPR12318 ---- Animal proteins ---- Endothelin-1 Source.3767: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.3768: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.3769: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.3770: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.3771: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.3772: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.3773: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.3774: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.3775: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.3776: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.3777: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.3778: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.3779: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.3780: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase Source.3781: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.3782: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.3783: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.3784: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.3785: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.3786: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.3787: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4 Source.3788: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.3789: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha Source.3790: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.3791: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.3792: DFBPPR12419 ---- Animal proteins ---- Phospholipase A2 Source.3793: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.3794: DFBPPR12424 ---- Animal proteins ---- Protein phosphatase inhibitor 2 Source.3795: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.3796: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.3797: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.3798: DFBPPR12441 ---- Animal proteins ---- Triadin Source.3799: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.3800: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.3801: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.3802: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.3803: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.3804: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.3805: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.3806: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A Source.3807: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.3808: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.3809: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.3810: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.3811: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.3812: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.3813: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.3814: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.3815: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.3816: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.3817: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.3818: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.3819: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.3820: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.3821: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.3822: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.3823: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.3824: DFBPPR12636 ---- Animal proteins ---- Complement component C9 Source.3825: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.3826: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.3827: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.3828: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3829: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3830: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.3831: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.3832: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.3833: DFBPPR12738 ---- Animal proteins ---- Histone H1.4 Source.3834: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.3835: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.3836: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Source.3837: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial Source.3838: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.3839: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.3840: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6 Source.3841: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.3842: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.3843: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.3844: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.3845: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.3846: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.3847: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.3848: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.3849: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.3850: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta Source.3851: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.3852: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn] Source.3853: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D Source.3854: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.3855: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.3856: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.3857: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.3858: DFBPPR12930 ---- Animal proteins ---- Kappa-casein Source.3859: DFBPPR12935 ---- Animal proteins ---- Histone H1.3 Source.3860: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.3861: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.3862: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3863: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.3864: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.3865: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.3866: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.3867: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.3868: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.3869: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.3870: DFBPPR13024 ---- Animal proteins ---- Erythropoietin Source.3871: DFBPPR13029 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5 Source.3872: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.3873: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.3874: DFBPPR13058 ---- Animal proteins ---- Anion exchange transporter Source.3875: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.3876: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207 Source.3877: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3878: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.3879: DFBPPR13094 ---- Animal proteins ---- Atherin Source.3880: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.3881: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3882: DFBPPR13120 ---- Animal proteins ---- Ig lambda chain C region Source.3883: DFBPPR13125 ---- Animal proteins ---- Ig kappa chain V region 3547 Source.3884: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.3885: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3886: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.3887: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.3888: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.3889: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.3890: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.3891: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3892: DFBPPR13219 ---- Animal proteins ---- Kit ligand Source.3893: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.3894: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.3895: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3896: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2 Source.3897: DFBPPR13240 ---- Animal proteins ---- Decorin Source.3898: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3899: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.3900: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.3901: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.3902: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1 Source.3903: DFBPPR13306 ---- Animal proteins ---- Tropomyosin alpha-4 chain Source.3904: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.3905: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.3906: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.3907: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.3908: DFBPPR13344 ---- Animal proteins ---- Interferon omega-2 Source.3909: DFBPPR13358 ---- Animal proteins ---- Erythropoietin Source.3910: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.3911: DFBPPR13403 ---- Animal proteins ---- Antimicrobial peptide NK-lysin Source.3912: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22 Source.3913: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3914: DFBPPR13412 ---- Animal proteins ---- Dander allergen Equ c 2.0101 Source.3915: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3916: DFBPPR13424 ---- Animal proteins ---- Leptin Source.3917: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.3918: DFBPPR13443 ---- Animal proteins ---- Kit ligand Source.3919: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.3920: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.3921: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.3922: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.3923: DFBPPR13505 ---- Animal proteins ---- Spectrin beta chain, non-erythrocytic 1 Source.3924: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.3925: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3926: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein Source.3927: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3928: DFBPPR13597 ---- Animal proteins ---- Leptin Source.3929: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.3930: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.3931: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.3932: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.3933: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.3934: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.3935: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.3936: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.3937: DFBPPR13646 ---- Animal proteins ---- Procathepsin L Source.3938: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha Source.3939: DFBPPR13654 ---- Animal proteins ---- Corticoliberin Source.3940: DFBPPR13657 ---- Animal proteins ---- Platelet factor 4 Source.3941: DFBPPR13663 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial Source.3942: DFBPPR13664 ---- Animal proteins ---- Interleukin-10 Source.3943: DFBPPR13665 ---- Animal proteins ---- Kit ligand Source.3944: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.3945: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.3946: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.3947: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen Source.3948: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.3949: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1 Source.3950: DFBPPR13702 ---- Animal proteins ---- Protransforming growth factor alpha Source.3951: DFBPPR13727 ---- Animal proteins ---- Prolactin-releasing peptide Source.3952: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.3953: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.3954: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21 Source.3955: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3956: DFBPPR13778 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.3957: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.3958: DFBPPR13791 ---- Animal proteins ---- Cholinesterase Source.3959: DFBPPR13793 ---- Animal proteins ---- Decorin Source.3960: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.3961: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.3962: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.3963: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.3964: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.3965: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3 Source.3966: DFBPPR13930 ---- Animal proteins ---- Homeobox protein Hox-A7 Source.3967: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.3968: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3969: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.3970: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.3971: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.3972: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3973: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3974: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.3975: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.3976: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.3977: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3978: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial Source.3979: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos Source.3980: DFBPPR14081 ---- Marine protein ---- Beta-enolase Source.3981: DFBPPR14102 ---- Marine protein ---- Anamorsin-B Source.3982: DFBPPR14104 ---- Marine protein ---- Anamorsin-A Source.3983: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.3984: DFBPPR14112 ---- Marine protein ---- Proteasome subunit beta type-6-A like protein Source.3985: DFBPPR14114 ---- Marine protein ---- Proteasome subunit beta type-6-B like protein Source.3986: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.3987: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.3988: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2 Source.3989: DFBPPR14187 ---- Marine protein ---- Secreted phosphoprotein 24 Source.3990: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2 Source.3991: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.3992: DFBPPR14238 ---- Marine protein ---- Insulin Source.3993: DFBPPR14253 ---- Marine protein ---- Vasotocin-neurophysin VT 1 Source.3994: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.3995: DFBPPR14287 ---- Marine protein ---- C-phycocyanin alpha chain Source.3996: DFBPPR14294 ---- Marine protein ---- ATP synthase subunit c, chloroplastic Source.3997: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.3998: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.3999: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.4000: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.4001: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.4002: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein Source.4003: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.4004: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3 Source.4005: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.4006: DFBPPR14355 ---- Marine protein ---- ATP synthase subunit c, chloroplastic Source.4007: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.4008: DFBPPR14383 ---- Marine protein ---- C-phycocyanin alpha chain Source.4009: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.4010: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.4011: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.4012: DFBPPR14429 ---- Marine protein ---- Photosystem II protein Y Source.4013: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic Source.4014: DFBPPR14470 ---- Marine protein ---- Photosystem I reaction center subunit PsaK Source.4015: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.4016: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.4017: DFBPPR14522 ---- Marine protein ---- Uncharacterized protein ycf20 Source.4018: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.4019: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.4020: DFBPPR14604 ---- Marine protein ---- Anamorsin Source.4021: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.4022: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing] Source.4023: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase Source.4024: DFBPPR14625 ---- Marine protein ---- Somatostatin-2 Source.4025: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18 Source.4026: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A Source.4027: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.4028: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.4029: DFBPPR14686 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial Source.4030: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.4031: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog Source.4032: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24 Source.4033: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.4034: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3 Source.4035: DFBPPR14783 ---- Marine protein ---- Enolase Source.4036: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4037: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1 Source.4038: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit Source.4039: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2 Source.4040: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4041: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.4042: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.4043: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit Source.4044: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.4045: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.4046: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.4047: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.4048: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.4049: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.4050: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.4051: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1 Source.4052: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.4053: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.4054: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.4055: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.4056: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB Source.4057: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.4058: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.4059: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit Source.4060: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.4061: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.4062: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.4063: DFBPPR14998 ---- Microorganism protein ---- Galactokinase Source.4064: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.4065: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.4066: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8 Source.4067: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.4068: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase Source.4069: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.4070: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.4071: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.4072: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.4073: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.4074: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.4075: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1 Source.4076: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13 Source.4077: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.4078: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.4079: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.4080: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6 Source.4081: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.4082: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.4083: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.4084: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.4085: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.4086: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.4087: DFBPPR15157 ---- Microorganism protein ---- DASH complex subunit DAD2 Source.4088: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1 Source.4089: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.4090: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.4091: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.4092: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.4093: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.4094: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.4095: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.4096: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.4097: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.4098: DFBPPR15243 ---- Microorganism protein ---- Coupling of ubiquitin conjugation to ER degradation protein 1 Source.4099: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.4100: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2 Source.4101: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.4102: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.4103: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.4104: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.4105: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.4106: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.4107: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.4108: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.4109: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.4110: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.4111: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.4112: DFBPPR15403 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM13 Source.4113: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.4114: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59 Source.4115: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.4116: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3 Source.4117: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22 Source.4118: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial Source.4119: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.4120: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1 Source.4121: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.4122: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1 Source.4123: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5 Source.4124: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.4125: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14 Source.4126: DFBPPR15518 ---- Microorganism protein ---- Chromatin modification-related protein EAF6 Source.4127: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101 Source.4128: DFBPPR15522 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 3 Source.4129: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.4130: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.4131: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.4132: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26 Source.4133: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein Source.4134: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.4135: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.4136: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9 Source.4137: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.4138: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.4139: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.4140: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5 Source.4141: DFBPPR15618 ---- Microorganism protein ---- Ribosome assembly protein 3 Source.4142: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.4143: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18 Source.4144: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.4145: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1 Source.4146: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.4147: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.4148: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3 Source.4149: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.4150: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.4151: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial Source.4152: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45 Source.4153: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.4154: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial Source.4155: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.4156: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.4157: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.4158: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21 Source.4159: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8 Source.4160: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86 Source.4161: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.4162: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.4163: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.4164: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase Source.4165: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.4166: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase Source.4167: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase Source.4168: DFBPPR15819 ---- Microorganism protein ---- Phosphocarrier protein HPr Source.4169: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase Source.4170: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR Source.4171: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.4172: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.4173: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.4174: DFBPPR15865 ---- Microorganism protein ---- Hydrophobin-1 Source.4175: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase Source.4176: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.4177: DFBPPR15886 ---- Microorganism protein ---- Capsid protein Source.4178: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.4179: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.4180: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.4181: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.4182: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.4183: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.4184: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.4185: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.4186: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic Source.4187: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.4188: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.4189: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.4190: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.4191: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic Source.4192: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.4193: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.4194: DFBPPR7798 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.4195: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.4196: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4197: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4198: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.4199: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.4200: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.4201: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.4202: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.4203: DFBPPR7847 ---- Plant protein ---- Non-specific lipid-transfer protein 1 Source.4204: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.4205: DFBPPR7883 ---- Plant protein ---- Non-specific lipid-transfer protein 2 Source.4206: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1 Source.4207: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1 Source.4208: DFBPPR7898 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic Source.4209: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1 Source.4210: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2 Source.4211: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1 Source.4212: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1 Source.4213: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.4214: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.4215: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.4216: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1 Source.4217: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.4218: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.4219: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4220: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.4221: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.4222: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.4223: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.4224: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.4225: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.4226: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.4227: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.4228: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4229: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.4230: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4231: DFBPPR8077 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.4232: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin Source.4233: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.4234: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.4235: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.4236: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.4237: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.4238: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5 Source.4239: DFBPPR8153 ---- Plant protein ---- Thaumatin-like protein Source.4240: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.4241: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.4242: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.4243: DFBPPR8244 ---- Plant protein ---- ATP synthase subunit c, chloroplastic Source.4244: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4245: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4246: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.4247: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.4248: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.4249: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.4250: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic Source.4251: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.4252: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.4253: DFBPPR8325 ---- Plant protein ---- 11 kDa late embryogenesis abundant protein Source.4254: DFBPPR8327 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic Source.4255: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein Source.4256: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.4257: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21 Source.4258: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide AAS showed low antioxidant activity with a relative antioxidant activity of 0.23 ± 0.08 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015