Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0845(Antioxidative peptide)

DFBP ID	DFBPANOX0845
Peptide sequence	ASD
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ala-Ser-Asp

Single-letter amino acid

ASD

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	291.25 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.13 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-0.8333^c

Hydrophilic residue ratio

33.33%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0164 ---- Plant proteins ---- Monellin chain A Source.3: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.4: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.5: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.6: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.7: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.8: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic Source.9: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5 Source.10: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.11: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.12: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.13: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.14: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.15: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.16: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.17: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.18: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12 Source.19: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.20: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.21: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.22: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.23: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.24: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.25: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.26: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.27: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.28: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.29: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.30: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.31: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.32: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.33: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.34: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.35: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.36: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.37: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12 Source.38: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.39: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.40: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.41: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.42: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.43: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.44: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.45: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.46: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.47: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.48: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.49: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.50: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.51: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13 Source.52: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.53: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.54: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.55: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.56: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.57: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.58: DFBPPR1176 ---- Plant proteins ---- Chitinase 12 Source.59: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.60: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.61: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.62: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.63: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.64: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.65: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.66: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.67: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.68: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.69: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.70: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.71: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.72: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.73: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.74: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.75: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.76: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2 Source.77: DFBPPR1292 ---- Plant proteins ---- Chitinase 3 Source.78: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.79: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1 Source.80: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.81: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.82: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.83: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.84: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.85: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.86: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1 Source.87: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.88: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.89: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.90: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.91: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.92: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.93: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.94: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic Source.95: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.96: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3 Source.97: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.98: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.99: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.100: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.101: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.102: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1 Source.103: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.104: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.105: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.106: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.107: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.108: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.109: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.110: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.111: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.112: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.113: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.114: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.115: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.116: DFBPPR1497 ---- Plant proteins ---- Chitinase 1 Source.117: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.118: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.119: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.120: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.121: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.122: DFBPPR1545 ---- Plant proteins ---- Protein NEGATIVE REGULATOR OF RESISTANCE Source.123: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.124: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.125: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17 Source.126: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.127: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.128: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.129: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.130: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.131: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.132: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.133: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.134: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.135: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.136: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial Source.137: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.138: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.139: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.140: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.141: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.142: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.143: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic Source.144: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.145: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.146: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.147: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.148: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.149: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.150: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.151: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1 Source.152: DFBPPR1798 ---- Plant proteins ---- UMP-CMP kinase 2 Source.153: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.154: DFBPPR1818 ---- Plant proteins ---- Chitinase 9 Source.155: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.156: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.157: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.158: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.159: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.160: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.161: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.162: DFBPPR1863 ---- Plant proteins ---- Chitinase 6 Source.163: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.164: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2 Source.165: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.166: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.167: DFBPPR1912 ---- Plant proteins ---- Expansin-B3 Source.168: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.169: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.170: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.171: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.172: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.173: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5 Source.174: DFBPPR1991 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic Source.175: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.176: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.177: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.178: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.179: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.180: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.181: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.182: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.183: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.184: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.185: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2 Source.186: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.187: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.188: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.189: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57 Source.190: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23 Source.191: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.192: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2 Source.193: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.194: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.195: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.196: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.197: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.198: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.199: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.200: DFBPPR2223 ---- Plant proteins ---- Urease Source.201: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.202: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.203: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.204: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3 Source.205: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3 Source.206: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.207: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS Source.208: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.209: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial Source.210: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.211: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.212: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.213: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial Source.214: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.215: DFBPPR2352 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-4 Source.216: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.217: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11 Source.218: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.219: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.220: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.221: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase Source.222: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.223: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.224: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.225: DFBPPR2408 ---- Plant proteins ---- Cytochrome f Source.226: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.227: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.228: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.229: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73 Source.230: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.231: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.232: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7 Source.233: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.234: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.235: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.236: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10 Source.237: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5 Source.238: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.239: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.240: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.241: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.242: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.243: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.244: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.245: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.246: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.247: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.248: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.249: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.250: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12 Source.251: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.252: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.253: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.254: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8 Source.255: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4 Source.256: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3 Source.257: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.258: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.259: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2 Source.260: DFBPPR2676 ---- Plant proteins ---- Expansin-A11 Source.261: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72 Source.262: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.263: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.264: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.265: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.266: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.267: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.268: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.269: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.270: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.271: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.272: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.273: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.274: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.275: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.276: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9 Source.277: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3 Source.278: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8 Source.279: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.280: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6 Source.281: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.282: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.283: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.284: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.285: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.286: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.287: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.288: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.289: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1 Source.290: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.291: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.292: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.293: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.294: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3 Source.295: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.296: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.297: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.298: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.299: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1 Source.300: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2 Source.301: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.302: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.303: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.304: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.305: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.306: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.307: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit Source.308: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.309: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.310: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.311: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.312: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.313: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.314: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.315: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.316: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.317: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.318: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.319: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.320: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.321: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.322: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.323: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.324: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.325: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.326: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.327: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.328: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1 Source.329: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59 Source.330: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.331: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.332: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.333: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.334: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.335: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.336: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.337: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP Source.338: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.339: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.340: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.341: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9 Source.342: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.343: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.344: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.345: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A Source.346: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.347: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.348: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.349: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.350: DFBPPR3397 ---- Plant proteins ---- Probable membrane-associated 30 kDa protein, chloroplastic Source.351: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3 Source.352: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.353: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.354: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.355: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44 Source.356: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.357: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A Source.358: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.359: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.360: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.361: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.362: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog Source.363: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.364: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.365: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.366: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.367: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.368: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.369: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45 Source.370: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.371: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.372: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.373: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.374: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.375: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.376: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.377: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.378: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.379: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3 Source.380: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24 Source.381: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.382: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.383: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.384: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.385: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.386: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.387: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.388: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.389: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.390: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.391: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.392: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.393: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.394: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.395: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4 Source.396: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1 Source.397: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.398: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28 Source.399: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.400: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.401: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.402: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.403: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.404: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.405: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.406: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77 Source.407: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.408: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.409: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.410: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.411: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial Source.412: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.413: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.414: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.415: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41 Source.416: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78 Source.417: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8 Source.418: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic Source.419: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.420: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.421: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.422: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62 Source.423: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.424: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.425: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.426: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.427: DFBPPR3923 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic Source.428: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.429: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.430: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.431: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.432: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.433: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA Source.434: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.435: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.436: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.437: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.438: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.439: DFBPPR4004 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.440: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27 Source.441: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.442: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.443: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.444: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta Source.445: DFBPPR4050 ---- Plant proteins ---- Cysteine proteinase inhibitor 8 Source.446: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB Source.447: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25 Source.448: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.449: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.450: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.451: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.452: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.453: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.454: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.455: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43 Source.456: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.457: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74 Source.458: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.459: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.460: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.461: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.462: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.463: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.464: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.465: DFBPPR4169 ---- Plant proteins ---- Succinate dehydrogenase subunit 6, mitochondrial Source.466: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.467: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.468: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.469: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.470: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.471: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.472: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.473: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.474: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16 Source.475: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6 Source.476: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.477: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.478: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.479: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.480: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.481: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic Source.482: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.483: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.484: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2 Source.485: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.486: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.487: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.488: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14 Source.489: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.490: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.491: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.492: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.493: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.494: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.495: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.496: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2 Source.497: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.498: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.499: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.500: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.501: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.502: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial Source.503: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.504: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.505: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.506: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.507: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.508: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.509: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1 Source.510: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9 Source.511: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23 Source.512: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic Source.513: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.514: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.515: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.516: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4 Source.517: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.518: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.519: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.520: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.521: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17 Source.522: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11 Source.523: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.524: DFBPPR4730 ---- Plant proteins ---- 40S ribosomal protein S13-2 Source.525: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.526: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.527: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.528: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.529: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1 Source.530: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2 Source.531: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.532: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2 Source.533: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13 Source.534: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13 Source.535: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.536: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.537: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900 Source.538: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.539: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.540: DFBPPR4821 ---- Plant proteins ---- Protein SPIRAL1-like 4 Source.541: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900 Source.542: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42 Source.543: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1 Source.544: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.545: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.546: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.547: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A Source.548: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.549: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.550: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.551: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.552: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.553: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.554: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.555: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.556: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.557: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.558: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.559: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.560: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.561: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.562: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.563: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog Source.564: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.565: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.566: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.567: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.568: DFBPPR5105 ---- Plant proteins ---- Probable bifunctional TENA-E protein Source.569: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.570: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.571: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.572: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1 Source.573: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.574: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.575: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.576: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.577: DFBPPR5319 ---- Plant proteins ---- Nodulin-22 Source.578: DFBPPR5352 ---- Plant proteins ---- Nodulin-27 Source.579: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog Source.580: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.581: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.582: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.583: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.584: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.585: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.586: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.587: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.588: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial Source.589: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.590: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.591: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.592: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.593: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.594: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.595: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.596: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.597: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.598: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10 Source.599: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.600: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.601: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.602: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.603: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.604: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.605: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.606: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.607: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.608: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.609: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.610: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase Source.611: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.612: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.613: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.614: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform Source.615: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.616: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.617: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.618: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic Source.619: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.620: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.621: DFBPPR5828 ---- Plant proteins ---- Cytochrome f Source.622: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.623: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.624: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.625: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.626: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.627: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B Source.628: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.629: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.630: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.631: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.632: DFBPPR5914 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase, variable chain Source.633: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4 Source.634: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.635: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.636: DFBPPR5942 ---- Plant proteins ---- GTP-binding protein YPTM2 Source.637: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.638: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.639: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.640: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.641: DFBPPR6133 ---- Plant proteins ---- 40S ribosomal protein S13 Source.642: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8 Source.643: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7 Source.644: DFBPPR6168 ---- Plant proteins ---- Late embryogenesis abundant protein, group 3 Source.645: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34 Source.646: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.647: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.648: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.649: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.650: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.651: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.652: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.653: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.654: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.655: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.656: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.657: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.658: DFBPPR6392 ---- Plant proteins ---- Cytochrome f Source.659: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.660: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.661: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.662: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.663: DFBPPR6520 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.664: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.665: DFBPPR6561 ---- Plant proteins ---- Blue copper protein Source.666: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit Source.667: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.668: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.669: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.670: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.671: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.672: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.673: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.674: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.675: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.676: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.677: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.678: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.679: DFBPPR6805 ---- Plant proteins ---- Cytochrome f Source.680: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.681: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.682: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.683: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.684: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.685: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.686: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.687: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.688: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.689: DFBPPR6931 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP Source.690: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.691: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.692: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.693: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2 Source.694: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.695: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.696: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801 Source.697: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase Source.698: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.699: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.700: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.701: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.702: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.703: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.704: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.705: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.706: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.707: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.708: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3 Source.709: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.710: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.711: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.712: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.713: DFBPPR7194 ---- Plant proteins ---- Cytochrome f Source.714: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3 Source.715: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.716: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1 Source.717: DFBPPR7242 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor Source.718: DFBPPR7310 ---- Plant proteins ---- ABA-inducible protein PHV A1 Source.719: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.720: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.721: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic Source.722: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.723: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.724: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.725: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.726: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.727: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.728: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1 Source.729: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.730: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.731: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.732: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.733: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.734: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.735: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.736: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.737: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.738: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.739: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1 Source.740: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.741: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.742: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.743: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.744: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.745: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.746: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.747: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.748: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.749: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.750: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2 Source.751: DFBPPR8407 ---- Plant proteins ---- Endochitinase 2 Source.752: DFBPPR8415 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor B-II Source.753: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.754: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.755: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.756: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.757: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.758: DFBPPR15935 ---- Animal proteins ---- Catalase Source.759: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.760: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.761: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.762: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.763: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.764: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.765: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.766: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.767: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.768: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.769: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.770: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.771: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.772: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.773: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.774: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.775: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.776: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.777: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.778: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101 Source.779: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.780: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.781: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.782: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.783: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.784: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.785: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.786: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.787: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein Source.788: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.789: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.790: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.791: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.792: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor Source.793: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.794: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.795: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.796: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.797: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.798: DFBPPR16500 ---- Animal proteins ---- C-C motif chemokine 5 Source.799: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.800: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.801: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.802: DFBPPR16546 ---- Animal proteins ---- Apolipoprotein C-III Source.803: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.804: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1 Source.805: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2 Source.806: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.807: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.808: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.809: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.810: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.811: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.812: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial Source.813: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.814: DFBPPR16825 ---- Animal proteins ---- Myelin basic protein Source.815: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.816: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.817: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.818: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.819: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.820: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.821: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.822: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.823: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.824: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.825: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.826: DFBPPR16960 ---- Animal proteins ---- Catalase Source.827: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5 Source.828: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.829: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.830: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.831: DFBPPR17037 ---- Animal proteins ---- Annexin A1 Source.832: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.833: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.834: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.835: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.836: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.837: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.838: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.839: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.840: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.841: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.842: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.843: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.844: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.845: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.846: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.847: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.848: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.849: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.850: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.851: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.852: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.853: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6 Source.854: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2 Source.855: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.856: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.857: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.858: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.859: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein Source.860: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.861: DFBPPR17443 ---- Animal proteins ---- Beclin-1 Source.862: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.863: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.864: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.865: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.866: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.867: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.868: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.869: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.870: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.871: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.872: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.873: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.874: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.875: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.876: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.877: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10 Source.878: DFBPPR17752 ---- Animal proteins ---- Follistatin Source.879: DFBPPR17756 ---- Animal proteins ---- Ras-related protein Rab-3B Source.880: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.881: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.882: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.883: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.884: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.885: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.886: DFBPPR17874 ---- Animal proteins ---- Endonuclease 8-like 2 Source.887: DFBPPR17875 ---- Animal proteins ---- Brain acid soluble protein 1 Source.888: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.889: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.890: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.891: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2 Source.892: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.893: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.894: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.895: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.896: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.897: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17 Source.898: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.899: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.900: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.901: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.902: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.903: DFBPPR18067 ---- Animal proteins ---- Metallothionein-1A Source.904: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.905: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.906: DFBPPR18095 ---- Animal proteins ---- Metallothionein-2 Source.907: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.908: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.909: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2 Source.910: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.911: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.912: DFBPPR18262 ---- Animal proteins ---- Claudin-1 Source.913: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.914: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.915: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.916: DFBPPR18326 ---- Animal proteins ---- Metallothionein-1 Source.917: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.918: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2 Source.919: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.920: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.921: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.922: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.923: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.924: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1 Source.925: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.926: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.927: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.928: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.929: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.930: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.931: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.932: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.933: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.934: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.935: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.936: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal Source.937: DFBPPR18573 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.938: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.939: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.940: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.941: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.942: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.943: DFBPPR18615 ---- Animal proteins ---- Metallothionein-II, hippocampal Source.944: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.945: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.946: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5 Source.947: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.948: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.949: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A Source.950: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1 Source.951: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.952: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A Source.953: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.954: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.955: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha Source.956: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.957: DFBPPR18815 ---- Animal proteins ---- Pantetheinase Source.958: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.959: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.960: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F Source.961: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.962: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.963: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein Source.964: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.965: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.966: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.967: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.968: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.969: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1 Source.970: DFBPPR19011 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF138 Source.971: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.972: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.973: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.974: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.975: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.976: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.977: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1 Source.978: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.979: DFBPPR19116 ---- Animal proteins ---- Metallothionein-I, hippocampal Source.980: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2 Source.981: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.982: DFBPPR19185 ---- Animal proteins ---- Partner of Y14 and mago Source.983: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.984: DFBPPR19188 ---- Animal proteins ---- Centromere protein S Source.985: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.986: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.987: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.988: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.989: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.990: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2 Source.991: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.992: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220 Source.993: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.994: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.995: DFBPPR19346 ---- Animal proteins ---- Cylicin-1 Source.996: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.997: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.998: DFBPPR19359 ---- Animal proteins ---- Spartin Source.999: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.1000: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog Source.1001: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.1002: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.1003: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.1004: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.1005: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.1006: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1007: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1008: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.1009: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.1010: DFBPPR19489 ---- Animal proteins ---- Keratocan Source.1011: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L Source.1012: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2 Source.1013: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4 Source.1014: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.1015: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.1016: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.1017: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin Source.1018: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C Source.1019: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1020: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.1021: DFBPPR19664 ---- Animal proteins ---- Protein OS-9 Source.1022: DFBPPR19686 ---- Animal proteins ---- Spindle and kinetochore-associated protein 1 Source.1023: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1 Source.1024: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4 Source.1025: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1026: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1027: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5 Source.1028: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.1029: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4 Source.1030: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.1031: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.1032: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1 Source.1033: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.1034: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.1035: DFBPPR19810 ---- Animal proteins ---- Seipin Source.1036: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Source.1037: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.1038: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B Source.1039: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.1040: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.1041: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.1042: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1043: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1 Source.1044: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase Source.1045: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.1046: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1047: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.1048: DFBPPR19929 ---- Animal proteins ---- Ermin Source.1049: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78 Source.1050: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.1051: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.1052: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.1053: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.1054: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12 Source.1055: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.1056: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.1057: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.1058: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical] Source.1059: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.1060: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.1061: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.1062: DFBPPR20123 ---- Animal proteins ---- Securin Source.1063: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C Source.1064: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a Source.1065: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.1066: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2 Source.1067: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.1068: DFBPPR20189 ---- Animal proteins ---- Protein disulfide isomerase CRELD2 Source.1069: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3 Source.1070: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1071: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein Source.1072: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1073: DFBPPR20247 ---- Animal proteins ---- Claudin-15 Source.1074: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2 Source.1075: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog Source.1076: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.1077: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.1078: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.1079: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1080: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.1081: DFBPPR20342 ---- Animal proteins ---- Nucleosome assembly protein 1-like 4 Source.1082: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.1083: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2 Source.1084: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.1085: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56 Source.1086: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1087: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.1088: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61 Source.1089: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.1090: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.1091: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.1092: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.1093: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2 Source.1094: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.1095: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2 Source.1096: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D Source.1097: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.1098: DFBPPR20635 ---- Animal proteins ---- Transcription elongation factor A protein 1 Source.1099: DFBPPR20644 ---- Animal proteins ---- Dynein regulatory complex protein 9 Source.1100: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein Source.1101: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.1102: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.1103: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog Source.1104: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3 Source.1105: DFBPPR20721 ---- Animal proteins ---- Myomesin-1 Source.1106: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial Source.1107: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain Source.1108: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.1109: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1 Source.1110: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.1111: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.1112: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.1113: DFBPPR20880 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14 Source.1114: DFBPPR20898 ---- Animal proteins ---- Transaldolase Source.1115: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a Source.1116: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.1117: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial Source.1118: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A Source.1119: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.1120: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1121: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A Source.1122: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.1123: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.1124: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog Source.1125: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.1126: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.1127: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.1128: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.1129: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7 Source.1130: DFBPPR21139 ---- Animal proteins ---- Transcription elongation factor A protein 3 Source.1131: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.1132: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.1133: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29 Source.1134: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.1135: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2 Source.1136: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.1137: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.1138: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog Source.1139: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11 Source.1140: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.1141: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial Source.1142: DFBPPR21302 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC9 Source.1143: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2 Source.1144: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4 Source.1145: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1 Source.1146: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.1147: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog Source.1148: DFBPPR21381 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A-related protein, mitochondrial Source.1149: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4 Source.1150: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3 Source.1151: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.1152: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1 Source.1153: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1154: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.1155: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A Source.1156: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330 Source.1157: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1158: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8 Source.1159: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1 Source.1160: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.1161: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.1162: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.1163: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.1164: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.1165: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2 Source.1166: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.1167: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1 Source.1168: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.1169: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.1170: DFBPPR21649 ---- Animal proteins ---- NTF2-related export protein 1 Source.1171: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.1172: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2 Source.1173: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2 Source.1174: DFBPPR21703 ---- Animal proteins ---- RRP15-like protein Source.1175: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog Source.1176: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.1177: DFBPPR21738 ---- Animal proteins ---- Bcl-2-related protein A1 Source.1178: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.1179: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS Source.1180: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1181: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1182: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6 Source.1183: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2 Source.1184: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.1185: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.1186: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24 Source.1187: DFBPPR21843 ---- Animal proteins ---- Tektin-1 Source.1188: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1 Source.1189: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.1190: DFBPPR21854 ---- Animal proteins ---- Suppressor of IKBKE 1 Source.1191: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2 Source.1192: DFBPPR21871 ---- Animal proteins ---- Serpin B10 Source.1193: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39 Source.1194: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2 Source.1195: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.1196: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.1197: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4 Source.1198: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.1199: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.1200: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.1201: DFBPPR22071 ---- Animal proteins ---- Neuromedin-S Source.1202: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.1203: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.1204: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106 Source.1205: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein Source.1206: DFBPPR22204 ---- Animal proteins ---- Ubiquitin-like protein 3 Source.1207: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1208: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.1209: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.1210: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2 Source.1211: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8 Source.1212: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22 Source.1213: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1214: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1 Source.1215: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.1216: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.1217: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.1218: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2 Source.1219: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein Source.1220: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218 Source.1221: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.1222: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.1223: DFBPPR22367 ---- Animal proteins ---- 60S ribosomal protein L22-like 1 Source.1224: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.1225: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.1226: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.1227: DFBPPR22391 ---- Animal proteins ---- Transmembrane protein 88B Source.1228: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1 Source.1229: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.1230: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein Source.1231: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37 Source.1232: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1 Source.1233: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein Source.1234: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein Source.1235: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.1236: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71 Source.1237: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B Source.1238: DFBPPR22632 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 1 Source.1239: DFBPPR22635 ---- Animal proteins ---- Translation machinery-associated protein 16 Source.1240: DFBPPR22640 ---- Animal proteins ---- Placenta-specific gene 8 protein Source.1241: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D Source.1242: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.1243: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein Source.1244: DFBPPR22691 ---- Animal proteins ---- Protein FAM216B Source.1245: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83 Source.1246: DFBPPR22704 ---- Animal proteins ---- Uncharacterized protein C17orf64 homolog Source.1247: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog Source.1248: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog Source.1249: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.1250: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.1251: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.1252: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1253: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.1254: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.1255: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1256: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.1257: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.1258: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.1259: DFBPPR8647 ---- Animal proteins ---- Beclin-1 Source.1260: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1261: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1 Source.1262: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.1263: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.1264: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1265: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.1266: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A Source.1267: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1268: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1269: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.1270: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.1271: DFBPPR8810 ---- Animal proteins ---- Follistatin Source.1272: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1273: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1274: DFBPPR8825 ---- Animal proteins ---- Optineurin Source.1275: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1276: DFBPPR8904 ---- Animal proteins ---- Osteopontin Source.1277: DFBPPR8906 ---- Animal proteins ---- Sialidase-1 Source.1278: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.1279: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.1280: DFBPPR8939 ---- Animal proteins ---- Kit ligand Source.1281: DFBPPR8968 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin Source.1282: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1283: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1284: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.1285: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1286: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1287: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1288: DFBPPR9037 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.1289: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.1290: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.1291: DFBPPR9058 ---- Animal proteins ---- Metallothionein-2A Source.1292: DFBPPR9061 ---- Animal proteins ---- Caspase-1 Source.1293: DFBPPR9064 ---- Animal proteins ---- Metallothionein-1A Source.1294: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.1295: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.1296: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1297: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1298: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase Source.1299: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.1300: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.1301: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2 Source.1302: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.1303: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.1304: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.1305: DFBPPR9221 ---- Animal proteins ---- Catalase Source.1306: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1307: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.1308: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.1309: DFBPPR9265 ---- Animal proteins ---- Pantetheinase Source.1310: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.1311: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.1312: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.1313: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.1314: DFBPPR9388 ---- Animal proteins ---- Metallothionein-2B Source.1315: DFBPPR9389 ---- Animal proteins ---- Metallothionein-1E Source.1316: DFBPPR9390 ---- Animal proteins ---- Metallothionein-1F Source.1317: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor Source.1318: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1319: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1320: DFBPPR9445 ---- Animal proteins ---- Securin Source.1321: DFBPPR9453 ---- Animal proteins ---- Metallothionein-1C Source.1322: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.1323: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase Source.1324: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.1325: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.1326: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.1327: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.1328: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.1329: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.1330: DFBPPR9626 ---- Animal proteins ---- Adenylyl cyclase-associated protein 1 Source.1331: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.1332: DFBPPR9677 ---- Animal proteins ---- Metallothionein-1D Source.1333: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2 Source.1334: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.1335: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.1336: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2 Source.1337: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region Source.1338: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.1339: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A Source.1340: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8 Source.1341: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.1342: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.1343: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.1344: DFBPPR9936 ---- Animal proteins ---- Serum amyloid A-4 protein Source.1345: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.1346: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1347: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1348: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor Source.1349: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.1350: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.1351: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.1352: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.1353: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.1354: DFBPPR10045 ---- Animal proteins ---- Albumin Source.1355: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.1356: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.1357: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.1358: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1359: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.1360: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1 Source.1361: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.1362: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.1363: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.1364: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.1365: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.1366: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.1367: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.1368: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.1369: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog Source.1370: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.1371: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.1372: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.1373: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.1374: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.1375: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.1376: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.1377: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.1378: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.1379: DFBPPR10217 ---- Animal proteins ---- Follistatin Source.1380: DFBPPR10228 ---- Animal proteins ---- Presenilin-2 Source.1381: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.1382: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.1383: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.1384: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.1385: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.1386: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.1387: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1 Source.1388: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.1389: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.1390: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1391: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.1392: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.1393: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1394: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.1395: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.1396: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog Source.1397: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.1398: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.1399: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.1400: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1401: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.1402: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.1403: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.1404: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1405: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.1406: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.1407: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.1408: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.1409: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10 Source.1410: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.1411: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.1412: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.1413: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.1414: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1415: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.1416: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.1417: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.1418: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1419: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.1420: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.1421: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.1422: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.1423: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.1424: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.1425: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.1426: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.1427: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin Source.1428: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.1429: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.1430: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.1431: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.1432: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.1433: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.1434: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein Source.1435: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.1436: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.1437: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.1438: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.1439: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.1440: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.1441: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.1442: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.1443: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.1444: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.1445: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.1446: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.1447: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.1448: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.1449: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.1450: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.1451: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.1452: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1 Source.1453: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.1454: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.1455: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1456: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.1457: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.1458: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.1459: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.1460: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.1461: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1 Source.1462: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.1463: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.1464: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.1465: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.1466: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.1467: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.1468: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.1469: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type Source.1470: DFBPPR10964 ---- Animal proteins ---- Protein artemis Source.1471: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type Source.1472: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.1473: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.1474: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.1475: DFBPPR11007 ---- Animal proteins ---- Anamorsin Source.1476: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.1477: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F Source.1478: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor Source.1479: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.1480: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.1481: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.1482: DFBPPR11060 ---- Animal proteins ---- Netrin-3 Source.1483: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.1484: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.1485: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1 Source.1486: DFBPPR11118 ---- Animal proteins ---- Filensin Source.1487: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.1488: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.1489: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.1490: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.1491: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.1492: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.1493: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.1494: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.1495: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2 Source.1496: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1 Source.1497: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.1498: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.1499: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.1500: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1 Source.1501: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.1502: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.1503: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B Source.1504: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.1505: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.1506: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.1507: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42 Source.1508: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.1509: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1510: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1511: DFBPPR11387 ---- Animal proteins ---- Amphiphysin Source.1512: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1513: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.1514: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.1515: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.1516: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2 Source.1517: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.1518: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.1519: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.1520: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.1521: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.1522: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2 Source.1523: DFBPPR11692 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14B Source.1524: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.1525: DFBPPR11713 ---- Animal proteins ---- Charged multivesicular body protein 2b Source.1526: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.1527: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor Source.1528: DFBPPR11733 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14A Source.1529: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.1530: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2 Source.1531: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15 Source.1532: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.1533: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1 Source.1534: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.1535: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.1536: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.1537: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.1538: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.1539: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.1540: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.1541: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36 Source.1542: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13 Source.1543: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog Source.1544: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.1545: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A Source.1546: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.1547: DFBPPR11847 ---- Animal proteins ---- Borealin-2 Source.1548: DFBPPR11851 ---- Animal proteins ---- Borealin Source.1549: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1550: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61 Source.1551: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna Source.1552: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.1553: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.1554: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.1555: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog Source.1556: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.1557: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.1558: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2 Source.1559: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.1560: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.1561: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1 Source.1562: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.1563: DFBPPR12106 ---- Animal proteins ---- Ig lambda chain C region Source.1564: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.1565: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.1566: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog Source.1567: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.1568: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.1569: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.1570: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Source.1571: DFBPPR12236 ---- Animal proteins ---- Protein FAM133 Source.1572: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.1573: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.1574: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.1575: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2 Source.1576: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.1577: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1578: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.1579: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.1580: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.1581: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.1582: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.1583: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.1584: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1585: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.1586: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.1587: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.1588: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.1589: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1590: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.1591: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.1592: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.1593: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.1594: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.1595: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1596: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.1597: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.1598: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.1599: DFBPPR12586 ---- Animal proteins ---- Metallothionein-2A Source.1600: DFBPPR12587 ---- Animal proteins ---- Metallothionein-2A Source.1601: DFBPPR12608 ---- Animal proteins ---- Metallothionein-1A Source.1602: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.1603: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.1604: DFBPPR12640 ---- Animal proteins ---- Metallothionein-2B Source.1605: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.1606: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase Source.1607: DFBPPR12710 ---- Animal proteins ---- Endoplasmin Source.1608: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.1609: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.1610: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1 Source.1611: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1 Source.1612: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.1613: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial Source.1614: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.1615: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.1616: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.1617: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.1618: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.1619: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.1620: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.1621: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.1622: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.1623: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.1624: DFBPPR13050 ---- Animal proteins ---- Odorant-binding protein 3 Source.1625: DFBPPR13073 ---- Animal proteins ---- Odorant-binding protein 2 Source.1626: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1627: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207 Source.1628: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.1629: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.1630: DFBPPR13125 ---- Animal proteins ---- Ig kappa chain V region 3547 Source.1631: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.1632: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5 Source.1633: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.1634: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.1635: DFBPPR13201 ---- Animal proteins ---- Major allergen Equ c 1 Source.1636: DFBPPR13203 ---- Animal proteins ---- Follistatin Source.1637: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.1638: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2 Source.1639: DFBPPR13243 ---- Animal proteins ---- Metallothionein-1A Source.1640: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1641: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.1642: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1643: DFBPPR13290 ---- Animal proteins ---- Myelin basic protein Source.1644: DFBPPR13321 ---- Animal proteins ---- Metallothionein-1B Source.1645: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.1646: DFBPPR13380 ---- Animal proteins ---- Alpha-1-antiproteinase 4 Source.1647: DFBPPR13397 ---- Animal proteins ---- Hemoglobin subunit theta-1 Source.1648: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.1649: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.1650: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.1651: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.1652: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1653: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.1654: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1655: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.1656: DFBPPR13670 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin Source.1657: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.1658: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1659: DFBPPR13700 ---- Animal proteins ---- Metallothionein-1A Source.1660: DFBPPR13725 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.1661: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1662: DFBPPR13758 ---- Animal proteins ---- Metallothionein-2 Source.1663: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.1664: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.1665: DFBPPR13807 ---- Animal proteins ---- Metallothionein-1C Source.1666: DFBPPR13813 ---- Animal proteins ---- Metallothionein-1B Source.1667: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.1668: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.1669: DFBPPR13876 ---- Animal proteins ---- Follistatin Source.1670: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.1671: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1672: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.1673: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.1674: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.1675: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.1676: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.1677: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.1678: DFBPPR14014 ---- Animal proteins ---- Somatotropin Source.1679: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1 Source.1680: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1 Source.1681: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.1682: DFBPPR14117 ---- Marine protein ---- Ferritin, middle subunit Source.1683: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.1684: DFBPPR14151 ---- Marine protein ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial Source.1685: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.1686: DFBPPR14189 ---- Marine protein ---- Protein Flattop Source.1687: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a Source.1688: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.1689: DFBPPR14334 ---- Marine protein ---- Ferredoxin-thioredoxin reductase, catalytic chain Source.1690: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.1691: DFBPPR14409 ---- Marine protein ---- 30S ribosomal protein S5, chloroplastic Source.1692: DFBPPR14484 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic Source.1693: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46 Source.1694: DFBPPR14505 ---- Marine protein ---- 50S ribosomal protein L32, chloroplastic Source.1695: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.1696: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.1697: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a Source.1698: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b Source.1699: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.1700: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.1701: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.1702: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.1703: DFBPPR14880 ---- Microorganism protein ---- Spindle assembly checkpoint kinase Source.1704: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.1705: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.1706: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.1707: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase Source.1708: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.1709: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.1710: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4 Source.1711: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.1712: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.1713: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.1714: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5 Source.1715: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.1716: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1717: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32 Source.1718: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.1719: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.1720: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1 Source.1721: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.1722: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.1723: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1 Source.1724: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.1725: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.1726: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.1727: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8 Source.1728: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.1729: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.1730: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.1731: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.1732: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.1733: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.1734: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.1735: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.1736: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9 Source.1737: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.1738: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.1739: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.1740: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.1741: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.1742: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.1743: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6 Source.1744: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.1745: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic Source.1746: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.1747: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.1748: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.1749: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1 Source.1750: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.1751: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3 Source.1752: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.1753: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.1754: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2 Source.1755: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.1756: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20 Source.1757: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase Source.1758: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta Source.1759: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.1760: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.1761: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.1762: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.1763: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1764: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5 Source.1765: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.1766: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34 Source.1767: DFBPPR15420 ---- Microorganism protein ---- EKC/KEOPS complex subunit GON7 Source.1768: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24 Source.1769: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.1770: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2 Source.1771: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24 Source.1772: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.1773: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.1774: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1 Source.1775: DFBPPR15513 ---- Microorganism protein ---- Killer toxin subunit gamma Source.1776: DFBPPR15541 ---- Microorganism protein ---- F-actin-capping protein subunit alpha Source.1777: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.1778: DFBPPR15562 ---- Microorganism protein ---- Mitotic spindle-associated protein SHE1 Source.1779: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1 Source.1780: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3 Source.1781: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9 Source.1782: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.1783: DFBPPR15618 ---- Microorganism protein ---- Ribosome assembly protein 3 Source.1784: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.1785: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1 Source.1786: DFBPPR15642 ---- Microorganism protein ---- Spindle pole component 29 Source.1787: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3 Source.1788: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.1789: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.1790: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1 Source.1791: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.1792: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.1793: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.1794: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.1795: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.1796: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14 Source.1797: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.1798: DFBPPR15743 ---- Microorganism protein ---- Damage-regulated import facilitator 1 Source.1799: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21 Source.1800: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8 Source.1801: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.1802: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.1803: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.1804: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.1805: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.1806: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase Source.1807: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1 Source.1808: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.1809: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.1810: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.1811: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.1812: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.1813: DFBPPR7810 ---- Plant protein ---- Cytochrome f Source.1814: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP Source.1815: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.1816: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1 Source.1817: DFBPPR7967 ---- Plant protein ---- Plastocyanin Source.1818: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92 Source.1819: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87 Source.1820: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1 Source.1821: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.1822: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.1823: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.1824: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.1825: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme Source.1826: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.1827: DFBPPR8092 ---- Plant protein ---- Alpha-amylase inhibitor 2 Source.1828: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.1829: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.1830: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1 Source.1831: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.1832: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.1833: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.1834: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.1835: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.1836: DFBPPR8259 ---- Plant protein ---- Cytochrome f Source.1837: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide ASD showed low antioxidant activity with a relative antioxidant activity of 0.30 ± 0.03 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015