Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0851(Antioxidative peptide)

DFBP ID	DFBPANOX0851
Peptide sequence	LDA
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Leu-Asp-Ala

Single-letter amino acid

LDA

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	317.33 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.13 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

0.7000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0387 ---- Plant protein ---- Alpha purothionin Source.3: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.4: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.5: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.6: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.7: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.8: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.9: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.10: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.11: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.12: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.13: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.14: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.15: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.16: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.17: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.18: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.19: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.20: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.21: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.22: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.23: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.24: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3 Source.25: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.26: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.27: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7 Source.28: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.29: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.30: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.31: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.32: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.33: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.34: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.35: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.36: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.37: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.38: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.39: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.40: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.41: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.42: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.43: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.44: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62 Source.45: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.46: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.47: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.48: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.49: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3 Source.50: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.51: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.52: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1 Source.53: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.54: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.55: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.56: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.57: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.58: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.59: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A Source.60: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.61: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.62: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.63: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic Source.64: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18 Source.65: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.66: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.67: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.68: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.69: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1 Source.70: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.71: DFBPPR1253 ---- Plant proteins ---- Phospholipase A2 homolog 3 Source.72: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.73: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.74: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.75: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23 Source.76: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.77: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.78: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3 Source.79: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.80: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.81: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.82: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.83: DFBPPR1300 ---- Plant proteins ---- Protein G1 Source.84: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic Source.85: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.86: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7 Source.87: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12 Source.88: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5 Source.89: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.90: DFBPPR1351 ---- Plant proteins ---- Probable phospholipase A2 homolog 2 Source.91: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.92: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.93: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.94: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.95: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.96: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.97: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.98: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.99: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.100: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.101: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.102: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.103: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.104: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.105: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.106: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.107: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.108: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.109: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.110: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.111: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.112: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29 Source.113: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.114: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.115: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.116: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.117: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c Source.118: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.119: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.120: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.121: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.122: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.123: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.124: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.125: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.126: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.127: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.128: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.129: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.130: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.131: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.132: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.133: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.134: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.135: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.136: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.137: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.138: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.139: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.140: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.141: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.142: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.143: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.144: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.145: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.146: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.147: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.148: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.149: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.150: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.151: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.152: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7 Source.153: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.154: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.155: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.156: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.157: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.158: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.159: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.160: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.161: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.162: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.163: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.164: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.165: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.166: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.167: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.168: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.169: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.170: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.171: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.172: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.173: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic Source.174: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.175: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.176: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1 Source.177: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.178: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.179: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.180: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.181: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.182: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4 Source.183: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.184: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.185: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.186: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.187: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.188: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.189: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.190: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.191: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2 Source.192: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.193: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.194: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.195: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.196: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.197: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.198: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.199: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.200: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.201: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.202: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.203: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.204: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.205: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.206: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.207: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.208: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.209: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.210: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.211: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.212: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1 Source.213: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.214: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.215: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.216: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.217: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.218: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.219: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.220: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.221: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.222: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.223: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.224: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.225: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.226: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.227: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.228: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.229: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.230: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.231: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.232: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.233: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.234: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.235: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.236: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.237: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.238: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.239: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.240: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.241: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.242: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.243: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.244: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.245: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.246: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.247: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.248: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.249: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.250: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.251: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.252: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.253: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.254: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.255: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.256: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.257: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.258: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.259: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.260: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.261: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.262: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.263: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.264: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.265: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.266: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.267: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.268: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.269: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.270: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.271: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.272: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1 Source.273: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.274: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.275: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.276: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.277: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.278: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.279: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.280: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.281: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.282: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.283: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.284: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.285: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3 Source.286: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.287: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B Source.288: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4 Source.289: DFBPPR2305 ---- Plant proteins ---- Actin-depolymerizing factor 4 Source.290: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3 Source.291: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.292: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.293: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.294: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.295: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.296: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.297: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.298: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.299: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.300: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5 Source.301: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.302: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.303: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.304: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.305: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.306: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.307: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.308: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.309: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.310: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.311: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.312: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.313: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.314: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.315: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.316: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.317: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial Source.318: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.319: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.320: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.321: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.322: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.323: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.324: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.325: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.326: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.327: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.328: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.329: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.330: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.331: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4 Source.332: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.333: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic Source.334: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.335: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2 Source.336: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.337: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1 Source.338: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.339: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.340: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.341: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.342: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5 Source.343: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.344: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.345: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.346: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin Source.347: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2 Source.348: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.349: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.350: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.351: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.352: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.353: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.354: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.355: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.356: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.357: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.358: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.359: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.360: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.361: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.362: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.363: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.364: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.365: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.366: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.367: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.368: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.369: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.370: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.371: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.372: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.373: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.374: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.375: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.376: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.377: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.378: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.379: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.380: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.381: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.382: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.383: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.384: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.385: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.386: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.387: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.388: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.389: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103 Source.390: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3 Source.391: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1 Source.392: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.393: DFBPPR2884 ---- Plant proteins ---- Expansin-B2 Source.394: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.395: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.396: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.397: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.398: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.399: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic Source.400: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.401: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.402: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.403: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.404: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.405: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.406: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.407: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.408: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.409: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.410: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase Source.411: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.412: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.413: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.414: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.415: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.416: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.417: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.418: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.419: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.420: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.421: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.422: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.423: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.424: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.425: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.426: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.427: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.428: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.429: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.430: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.431: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6 Source.432: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.433: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.434: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.435: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.436: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.437: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48 Source.438: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.439: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.440: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.441: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.442: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.443: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.444: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.445: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.446: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.447: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.448: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.449: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1 Source.450: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.451: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.452: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70 Source.453: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.454: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.455: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3 Source.456: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.457: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.458: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.459: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.460: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C Source.461: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.462: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B Source.463: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.464: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.465: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.466: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.467: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.468: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.469: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.470: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.471: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.472: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.473: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.474: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2 Source.475: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.476: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.477: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.478: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.479: DFBPPR3418 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 3 Source.480: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.481: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.482: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.483: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.484: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.485: DFBPPR3452 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit K Source.486: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12 Source.487: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.488: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34 Source.489: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.490: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.491: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1 Source.492: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.493: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.494: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.495: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.496: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.497: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4 Source.498: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.499: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.500: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2 Source.501: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.502: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.503: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.504: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.505: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.506: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.507: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial Source.508: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.509: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1 Source.510: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.511: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3 Source.512: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.513: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.514: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.515: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.516: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.517: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.518: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.519: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.520: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.521: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4 Source.522: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1 Source.523: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.524: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.525: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.526: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin Source.527: DFBPPR3653 ---- Plant proteins ---- Protein YABBY 7 Source.528: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3 Source.529: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.530: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3 Source.531: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d Source.532: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.533: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3 Source.534: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.535: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.536: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase Source.537: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.538: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.539: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.540: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.541: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.542: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.543: DFBPPR3763 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.544: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.545: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9 Source.546: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.547: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1 Source.548: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42 Source.549: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.550: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.551: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.552: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.553: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.554: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.555: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.556: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.557: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.558: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.559: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7 Source.560: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8 Source.561: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.562: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit Source.563: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.564: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.565: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.566: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.567: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.568: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.569: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.570: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein Source.571: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.572: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.573: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.574: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1 Source.575: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial Source.576: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.577: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.578: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.579: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.580: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.581: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.582: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9 Source.583: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2 Source.584: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6 Source.585: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5 Source.586: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2 Source.587: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4 Source.588: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.589: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.590: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.591: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.592: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.593: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like Source.594: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.595: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.596: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.597: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.598: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.599: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.600: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.601: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.602: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.603: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.604: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.605: DFBPPR4128 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 2 Source.606: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.607: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.608: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.609: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.610: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.611: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1 Source.612: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.613: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4 Source.614: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.615: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.616: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.617: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic Source.618: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.619: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.620: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.621: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.622: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1 Source.623: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27 Source.624: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.625: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.626: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.627: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.628: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.629: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.630: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.631: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.632: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.633: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.634: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.635: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.636: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.637: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.638: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3 Source.639: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2 Source.640: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.641: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.642: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like Source.643: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.644: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2 Source.645: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic Source.646: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.647: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.648: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.649: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.650: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.651: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.652: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.653: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.654: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.655: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.656: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.657: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.658: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.659: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.660: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.661: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.662: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.663: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.664: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28 Source.665: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.666: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.667: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.668: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.669: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.670: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.671: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.672: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.673: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.674: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.675: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27 Source.676: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.677: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.678: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.679: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F Source.680: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15 Source.681: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10 Source.682: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.683: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.684: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.685: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.686: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21 Source.687: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3 Source.688: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.689: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.690: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11 Source.691: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.692: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1 Source.693: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2 Source.694: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.695: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.696: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.697: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.698: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.699: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400 Source.700: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.701: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8 Source.702: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.703: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.704: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.705: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1 Source.706: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000 Source.707: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.708: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6 Source.709: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.710: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.711: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.712: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.713: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300 Source.714: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.715: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58 Source.716: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.717: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.718: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein Source.719: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.720: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.721: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.722: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase Source.723: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.724: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.725: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.726: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.727: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.728: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.729: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.730: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d Source.731: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.732: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.733: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.734: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.735: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.736: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.737: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.738: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.739: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.740: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.741: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1 Source.742: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.743: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha Source.744: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.745: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.746: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.747: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.748: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.749: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.750: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.751: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.752: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.753: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.754: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.755: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.756: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.757: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.758: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.759: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein Source.760: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.761: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.762: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase Source.763: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein Source.764: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.765: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.766: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.767: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.768: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.769: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1 Source.770: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.771: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.772: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.773: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.774: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.775: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.776: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.777: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.778: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic Source.779: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42 Source.780: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.781: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1 Source.782: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.783: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.784: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.785: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.786: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.787: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.788: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.789: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.790: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.791: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.792: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.793: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.794: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.795: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.796: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.797: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.798: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.799: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.800: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.801: DFBPPR5627 ---- Plant proteins ---- Expansin-B11 Source.802: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.803: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.804: DFBPPR5652 ---- Plant proteins ---- Expansin-B10 Source.805: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.806: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.807: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.808: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.809: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial Source.810: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial Source.811: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.812: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.813: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.814: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.815: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.816: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2 Source.817: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.818: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.819: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.820: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.821: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.822: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.823: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase Source.824: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.825: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.826: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.827: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.828: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic Source.829: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.830: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.831: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.832: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.833: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor Source.834: DFBPPR5884 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.835: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.836: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1 Source.837: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.838: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.839: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.840: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.841: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.842: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.843: DFBPPR5931 ---- Plant proteins ---- Glycine-rich RNA-binding, abscisic acid-inducible protein Source.844: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2 Source.845: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.846: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic Source.847: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.848: DFBPPR5973 ---- Plant proteins ---- Cortical cell-delineating protein Source.849: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.850: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.851: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.852: DFBPPR6024 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.853: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.854: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.855: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.856: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1 Source.857: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1 Source.858: DFBPPR6103 ---- Plant proteins ---- 60S ribosomal protein L10 Source.859: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13 Source.860: DFBPPR6132 ---- Plant proteins ---- 40S ribosomal protein S21 Source.861: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.862: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34 Source.863: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.864: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.865: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.866: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.867: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.868: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.869: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.870: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.871: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.872: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3 Source.873: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.874: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.875: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.876: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.877: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS Source.878: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.879: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.880: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.881: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.882: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.883: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.884: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.885: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.886: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.887: DFBPPR6438 ---- Plant proteins ---- Ferredoxin-2 Source.888: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.889: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.890: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.891: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.892: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.893: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.894: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.895: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.896: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.897: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.898: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.899: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.900: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.901: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.902: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4 Source.903: DFBPPR6584 ---- Plant proteins ---- Organ-specific protein S2 Source.904: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.905: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.906: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.907: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.908: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.909: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.910: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.911: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase Source.912: DFBPPR6742 ---- Plant proteins ---- Alpha-1-purothionin Source.913: DFBPPR6745 ---- Plant proteins ---- Purothionin A-1 Source.914: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.915: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.916: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.917: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase Source.918: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.919: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.920: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.921: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.922: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.923: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.924: DFBPPR6868 ---- Plant proteins ---- Alpha-2-purothionin Source.925: DFBPPR6869 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.926: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.927: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial Source.928: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.929: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.930: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.931: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.932: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.933: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.934: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.935: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.936: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.937: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.938: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.939: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.940: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.941: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.942: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.943: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.944: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4 Source.945: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.946: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.947: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.948: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.949: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.950: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.951: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic Source.952: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.953: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.954: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.955: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.956: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.957: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.958: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.959: DFBPPR7232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.960: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.961: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic Source.962: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.963: DFBPPR7317 ---- Plant proteins ---- Horcolin Source.964: DFBPPR7324 ---- Plant proteins ---- Antifungal protein S Source.965: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.966: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.967: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.968: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic Source.969: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase Source.970: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.971: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.972: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase Source.973: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.974: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.975: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.976: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.977: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.978: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25 Source.979: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.980: DFBPPR7499 ---- Plant proteins ---- Ferredoxin Source.981: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.982: DFBPPR7508 ---- Plant proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5 Source.983: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.984: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.985: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2 Source.986: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.987: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.988: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.989: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.990: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.991: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.992: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.993: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.994: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein Source.995: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.996: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.997: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.998: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.999: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein Source.1000: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.1001: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.1002: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.1003: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.1004: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.1005: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.1006: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.1007: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1008: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1009: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.1010: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.1011: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.1012: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1013: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1014: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.1015: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.1016: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1017: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.1018: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.1019: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.1020: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase Source.1021: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1022: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.1023: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.1024: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.1025: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.1026: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.1027: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.1028: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.1029: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.1030: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1031: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase Source.1032: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1033: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1034: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1035: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.1036: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.1037: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.1038: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1039: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.1040: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1041: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.1042: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1043: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.1044: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1045: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.1046: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.1047: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1048: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1049: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1050: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1051: DFBPPR16073 ---- Animal proteins ---- Endothelin-1 Source.1052: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1053: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1054: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1055: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.1056: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1057: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1058: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1059: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1060: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.1061: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1062: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.1063: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase Source.1064: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.1065: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1066: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.1067: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1068: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.1069: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15 Source.1070: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.1071: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1072: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1073: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1074: DFBPPR16315 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.1075: DFBPPR16316 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.1076: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.1077: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.1078: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.1079: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1080: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.1081: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1082: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1083: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1084: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1085: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.1086: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.1087: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin Source.1088: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin Source.1089: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1090: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1091: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1092: DFBPPR16467 ---- Animal proteins ---- Opticin Source.1093: DFBPPR16471 ---- Animal proteins ---- Interferon alpha-3 Source.1094: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N Source.1095: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.1096: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.1097: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1098: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein Source.1099: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan Source.1100: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1101: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3 Source.1102: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.1103: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.1104: DFBPPR16613 ---- Animal proteins ---- Ferritin light chain Source.1105: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.1106: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1107: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.1108: DFBPPR16704 ---- Animal proteins ---- Retbindin Source.1109: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1110: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.1111: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.1112: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.1113: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.1114: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1115: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.1116: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1117: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.1118: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109 Source.1119: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1120: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1121: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.1122: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.1123: DFBPPR16879 ---- Animal proteins ---- Inhibin beta A chain Source.1124: DFBPPR16894 ---- Animal proteins ---- Procathepsin L Source.1125: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1126: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1127: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.1128: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.1129: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor Source.1130: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1 Source.1131: DFBPPR16985 ---- Animal proteins ---- Filensin Source.1132: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.1133: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.1134: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.1135: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.1136: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.1137: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1138: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.1139: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.1140: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.1141: DFBPPR17082 ---- Animal proteins ---- Calbindin Source.1142: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1143: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1144: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.1145: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.1146: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.1147: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.1148: DFBPPR17107 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma Source.1149: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.1150: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1151: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1152: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1153: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1154: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1155: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1 Source.1156: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1157: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.1158: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.1159: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.1160: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1161: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.1162: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1 Source.1163: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.1164: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.1165: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.1166: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II Source.1167: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1168: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.1169: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.1170: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.1171: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1172: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.1173: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.1174: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.1175: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1 Source.1176: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.1177: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.1178: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1179: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.1180: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.1181: DFBPPR17423 ---- Animal proteins ---- Furin Source.1182: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.1183: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.1184: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1185: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1186: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein Source.1187: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.1188: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.1189: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.1190: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.1191: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.1192: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.1193: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.1194: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.1195: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1196: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD Source.1197: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b Source.1198: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1199: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.1200: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1 Source.1201: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein Source.1202: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1203: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.1204: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2 Source.1205: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1206: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.1207: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.1208: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.1209: DFBPPR17568 ---- Animal proteins ---- Interferon tau-2 Source.1210: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B Source.1211: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.1212: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1213: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.1214: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.1215: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.1216: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1217: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.1218: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.1219: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.1220: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1221: DFBPPR17734 ---- Animal proteins ---- Protein S100-A12 Source.1222: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.1223: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1224: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1225: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1226: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD Source.1227: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.1228: DFBPPR17807 ---- Animal proteins ---- Opticin Source.1229: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2 Source.1230: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.1231: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.1232: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1233: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.1234: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.1235: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.1236: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1 Source.1237: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.1238: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1239: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.1240: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.1241: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8 Source.1242: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126 Source.1243: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.1244: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1245: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.1246: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1247: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase Source.1248: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A Source.1249: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.1250: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.1251: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.1252: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.1253: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase Source.1254: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1255: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.1256: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.1257: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.1258: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.1259: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.1260: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1261: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.1262: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.1263: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1264: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1265: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1 Source.1266: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1267: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.1268: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1269: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.1270: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.1271: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.1272: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4 Source.1273: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1274: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.1275: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.1276: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41 Source.1277: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1278: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1279: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1280: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1281: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.1282: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.1283: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.1284: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1285: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1286: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1287: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.1288: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.1289: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.1290: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.1291: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.1292: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43 Source.1293: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.1294: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14 Source.1295: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1296: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1297: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.1298: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2 Source.1299: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1300: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.1301: DFBPPR18489 ---- Animal proteins ---- Beta-2-microglobulin Source.1302: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.1303: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.1304: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.1305: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit Source.1306: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.1307: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.1308: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.1309: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.1310: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1311: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.1312: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.1313: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.1314: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1315: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.1316: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.1317: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.1318: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1319: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.1320: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.1321: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.1322: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.1323: DFBPPR18746 ---- Animal proteins ---- Anamorsin Source.1324: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.1325: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.1326: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1327: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.1328: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E Source.1329: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein Source.1330: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.1331: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1 Source.1332: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.1333: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.1334: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.1335: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.1336: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.1337: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.1338: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1339: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.1340: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1341: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.1342: DFBPPR18868 ---- Animal proteins ---- Haptoglobin Source.1343: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta Source.1344: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1345: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.1346: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1347: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.1348: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.1349: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless Source.1350: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.1351: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18 Source.1352: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.1353: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.1354: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.1355: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.1356: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1357: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.1358: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.1359: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1 Source.1360: DFBPPR18995 ---- Animal proteins ---- Tektin-3 Source.1361: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.1362: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.1363: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19 Source.1364: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.1365: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.1366: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.1367: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1368: DFBPPR19037 ---- Animal proteins ---- Transthyretin Source.1369: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1370: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.1371: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.1372: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.1373: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.1374: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1375: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.1376: DFBPPR19106 ---- Animal proteins ---- Natural killer cells antigen CD94 Source.1377: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1378: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1 Source.1379: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.1380: DFBPPR19158 ---- Animal proteins ---- Tuberoinfundibular peptide of 39 residues Source.1381: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2 Source.1382: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.1383: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.1384: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.1385: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2 Source.1386: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.1387: DFBPPR19225 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase Source.1388: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.1389: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1390: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.1391: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.1392: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.1393: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like Source.1394: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.1395: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.1396: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.1397: DFBPPR19312 ---- Animal proteins ---- Copine-1 Source.1398: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.1399: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.1400: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4 Source.1401: DFBPPR19331 ---- Animal proteins ---- Cathelicidin-6 Source.1402: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9 Source.1403: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.1404: DFBPPR19359 ---- Animal proteins ---- Spartin Source.1405: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1406: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.1407: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1408: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1409: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.1410: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6 Source.1411: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2 Source.1412: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1413: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137 Source.1414: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.1415: DFBPPR19496 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.1416: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG Source.1417: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.1418: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72 Source.1419: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1420: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1 Source.1421: DFBPPR19539 ---- Animal proteins ---- MICOS complex subunit MIC19 Source.1422: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.1423: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.1424: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial Source.1425: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4 Source.1426: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.1427: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.1428: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.1429: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.1430: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.1431: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1432: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.1433: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1434: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.1435: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.1436: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.1437: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1438: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7 Source.1439: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1 Source.1440: DFBPPR19707 ---- Animal proteins ---- Neurotensin/neuromedin N Source.1441: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein Source.1442: DFBPPR19761 ---- Animal proteins ---- N-chimaerin Source.1443: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.1444: DFBPPR19769 ---- Animal proteins ---- Septin-14 Source.1445: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.1446: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1 Source.1447: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2 Source.1448: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3 Source.1449: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.1450: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.1451: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.1452: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1453: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.1454: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8 Source.1455: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1456: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.1457: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1 Source.1458: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78 Source.1459: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80 Source.1460: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.1461: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.1462: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1 Source.1463: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.1464: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.1465: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.1466: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2 Source.1467: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.1468: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.1469: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase Source.1470: DFBPPR20065 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3 Source.1471: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4 Source.1472: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2 Source.1473: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.1474: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.1475: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2 Source.1476: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4 Source.1477: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.1478: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.1479: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98 Source.1480: DFBPPR20188 ---- Animal proteins ---- Protein S100-A16 Source.1481: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.1482: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.1483: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1484: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.1485: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1486: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79 Source.1487: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.1488: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6 Source.1489: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.1490: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.1491: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.1492: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3 Source.1493: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3 Source.1494: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.1495: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.1496: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.1497: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1498: DFBPPR20348 ---- Animal proteins ---- V-type proton ATPase subunit F Source.1499: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase Source.1500: DFBPPR20372 ---- Animal proteins ---- WASH complex subunit 3 Source.1501: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1502: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1503: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1504: DFBPPR20401 ---- Animal proteins ---- Bystin Source.1505: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61 Source.1506: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.1507: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5 Source.1508: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.1509: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF Source.1510: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.1511: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.1512: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.1513: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog Source.1514: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein Source.1515: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2 Source.1516: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.1517: DFBPPR20518 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5 Source.1518: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2 Source.1519: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4 Source.1520: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.1521: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.1522: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein Source.1523: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.1524: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.1525: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.1526: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A Source.1527: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1528: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1 Source.1529: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.1530: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.1531: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.1532: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52 Source.1533: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91 Source.1534: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3 Source.1535: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1536: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2 Source.1537: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.1538: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1539: DFBPPR20669 ---- Animal proteins ---- D site-binding protein Source.1540: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.1541: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.1542: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11 Source.1543: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.1544: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.1545: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.1546: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial Source.1547: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.1548: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1 Source.1549: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.1550: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.1551: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.1552: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.1553: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.1554: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.1555: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2 Source.1556: DFBPPR20853 ---- Animal proteins ---- Hemopexin Source.1557: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.1558: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.1559: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4 Source.1560: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.1561: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1 Source.1562: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.1563: DFBPPR20954 ---- Animal proteins ---- Secretagogin Source.1564: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1 Source.1565: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.1566: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor Source.1567: DFBPPR20978 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 B Source.1568: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1569: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.1570: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.1571: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.1572: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.1573: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26 Source.1574: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.1575: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter Source.1576: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.1577: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.1578: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.1579: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha Source.1580: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.1581: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.1582: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.1583: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.1584: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24 Source.1585: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.1586: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29 Source.1587: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.1588: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.1589: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.1590: DFBPPR21285 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.1591: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.1592: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.1593: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha Source.1594: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692 Source.1595: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.1596: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.1597: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1598: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.1599: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.1600: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like Source.1601: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.1602: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.1603: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.1604: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A Source.1605: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.1606: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5 Source.1607: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1608: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.1609: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.1610: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.1611: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.1612: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.1613: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.1614: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.1615: DFBPPR21513 ---- Animal proteins ---- Profilin-3 Source.1616: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase Source.1617: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.1618: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.1619: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.1620: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.1621: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.1622: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.1623: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein Source.1624: DFBPPR21636 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP3 Source.1625: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.1626: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2 Source.1627: DFBPPR21675 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2B Source.1628: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.1629: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog Source.1630: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.1631: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A Source.1632: DFBPPR21768 ---- Animal proteins ---- Tektin-4 Source.1633: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1634: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1635: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein Source.1636: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1 Source.1637: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.1638: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.1639: DFBPPR21864 ---- Animal proteins ---- Arpin Source.1640: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.1641: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.1642: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1 Source.1643: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2 Source.1644: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.1645: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.1646: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.1647: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.1648: DFBPPR21959 ---- Animal proteins ---- DDB1- and CUL4-associated factor 16 Source.1649: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.1650: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6 Source.1651: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1 Source.1652: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog Source.1653: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.1654: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8 Source.1655: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3 Source.1656: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.1657: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.1658: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4 Source.1659: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.1660: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C Source.1661: DFBPPR22049 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 5 Source.1662: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog Source.1663: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.1664: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.1665: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.1666: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.1667: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3 Source.1668: DFBPPR22100 ---- Animal proteins ---- Centromere protein M Source.1669: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.1670: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1 Source.1671: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.1672: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.1673: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.1674: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3 Source.1675: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.1676: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1 Source.1677: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106 Source.1678: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.1679: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1680: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1681: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.1682: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.1683: DFBPPR22223 ---- Animal proteins ---- Calretinin Source.1684: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9 Source.1685: DFBPPR22234 ---- Animal proteins ---- COMM domain-containing protein 3 Source.1686: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog Source.1687: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40 Source.1688: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.1689: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.1690: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.1691: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1 Source.1692: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35 Source.1693: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.1694: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.1695: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog Source.1696: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11 Source.1697: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.1698: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein Source.1699: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.1700: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.1701: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5 Source.1702: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.1703: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.1704: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474 Source.1705: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.1706: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2 Source.1707: DFBPPR22446 ---- Animal proteins ---- Tektin-5 Source.1708: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.1709: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C Source.1710: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1 Source.1711: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.1712: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.1713: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.1714: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.1715: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C Source.1716: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.1717: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2 Source.1718: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.1719: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.1720: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A Source.1721: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog Source.1722: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog Source.1723: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.1724: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.1725: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72 Source.1726: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30 Source.1727: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1 Source.1728: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5 Source.1729: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.1730: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog Source.1731: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A Source.1732: DFBPPR22700 ---- Animal proteins ---- Protein FAM89A Source.1733: DFBPPR22704 ---- Animal proteins ---- Uncharacterized protein C17orf64 homolog Source.1734: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11 Source.1735: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog Source.1736: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog Source.1737: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.1738: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.1739: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.1740: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.1741: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1742: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.1743: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1 Source.1744: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.1745: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.1746: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.1747: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.1748: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1749: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.1750: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.1751: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.1752: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.1753: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.1754: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.1755: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1756: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.1757: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.1758: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1759: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1760: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.1761: DFBPPR8699 ---- Animal proteins ---- ADP-ribosylation factor 6 Source.1762: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1763: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.1764: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.1765: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1766: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase Source.1767: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1768: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1769: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.1770: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein Source.1771: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.1772: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1773: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1774: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.1775: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.1776: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.1777: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1778: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.1779: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1780: DFBPPR8792 ---- Animal proteins ---- Plasminogen Source.1781: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.1782: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1783: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.1784: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.1785: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.1786: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.1787: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog Source.1788: DFBPPR8865 ---- Animal proteins ---- Haptoglobin Source.1789: DFBPPR8866 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma Source.1790: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.1791: DFBPPR8904 ---- Animal proteins ---- Osteopontin Source.1792: DFBPPR8907 ---- Animal proteins ---- Protein S100-A12 Source.1793: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1794: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1 Source.1795: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1796: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.1797: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1798: DFBPPR9015 ---- Animal proteins ---- Serotransferrin Source.1799: DFBPPR9018 ---- Animal proteins ---- Transthyretin Source.1800: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.1801: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.1802: DFBPPR9093 ---- Animal proteins ---- Hemopexin Source.1803: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.1804: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1805: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.1806: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1807: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.1808: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1809: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.1810: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1811: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.1812: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1813: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a Source.1814: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10 Source.1815: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase Source.1816: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.1817: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase Source.1818: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.1819: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.1820: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1821: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1822: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2 Source.1823: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.1824: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.1825: DFBPPR9314 ---- Animal proteins ---- Regucalcin Source.1826: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.1827: DFBPPR9368 ---- Animal proteins ---- Myosin-11 Source.1828: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.1829: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1830: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.1831: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.1832: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.1833: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.1834: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.1835: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1836: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1837: DFBPPR9456 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.1838: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.1839: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.1840: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.1841: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.1842: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1 Source.1843: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.1844: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1845: DFBPPR9578 ---- Animal proteins ---- Biglycan Source.1846: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.1847: DFBPPR9584 ---- Animal proteins ---- FXYD domain-containing ion transport regulator 3 Source.1848: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.1849: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.1850: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.1851: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform Source.1852: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2 Source.1853: DFBPPR9624 ---- Animal proteins ---- Cadherin-3 Source.1854: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.1855: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.1856: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.1857: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1858: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle Source.1859: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.1860: DFBPPR9728 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.1861: DFBPPR9729 ---- Animal proteins ---- Secretagogin Source.1862: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.1863: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.1864: DFBPPR9779 ---- Animal proteins ---- Beta-2-microglobulin Source.1865: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.1866: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.1867: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1 Source.1868: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.1869: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.1870: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.1871: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1872: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1873: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.1874: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.1875: DFBPPR10009 ---- Animal proteins ---- Transthyretin Source.1876: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.1877: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.1878: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16 Source.1879: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.1880: DFBPPR10030 ---- Animal proteins ---- Calbindin Source.1881: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.1882: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.1883: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1884: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1 Source.1885: DFBPPR10105 ---- Animal proteins ---- ADP-ribosylation factor 6 Source.1886: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.1887: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.1888: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.1889: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.1890: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.1891: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.1892: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.1893: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1894: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.1895: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.1896: DFBPPR10172 ---- Animal proteins ---- Basic helix-loop-helix transcription factor scleraxis Source.1897: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.1898: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.1899: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.1900: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.1901: DFBPPR10220 ---- Animal proteins ---- Paxillin Source.1902: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.1903: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.1904: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1 Source.1905: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.1906: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.1907: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.1908: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1 Source.1909: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.1910: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.1911: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1 Source.1912: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.1913: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.1914: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.1915: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.1916: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.1917: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.1918: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1919: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.1920: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1921: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1922: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1923: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.1924: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.1925: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.1926: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.1927: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.1928: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.1929: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1930: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.1931: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1932: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1933: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.1934: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.1935: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.1936: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.1937: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1938: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.1939: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1940: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1941: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.1942: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.1943: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.1944: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.1945: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.1946: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.1947: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros Source.1948: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1949: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.1950: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.1951: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.1952: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.1953: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.1954: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.1955: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6 Source.1956: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1957: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.1958: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.1959: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.1960: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.1961: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.1962: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.1963: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.1964: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.1965: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.1966: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.1967: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.1968: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.1969: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1970: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.1971: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.1972: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin Source.1973: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1974: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.1975: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3 Source.1976: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.1977: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.1978: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.1979: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.1980: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.1981: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor Source.1982: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor Source.1983: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.1984: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.1985: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.1986: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1987: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle Source.1988: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.1989: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.1990: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.1991: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.1992: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1993: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.1994: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa Source.1995: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5 Source.1996: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1997: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.1998: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.1999: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.2000: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.2001: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2 Source.2002: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.2003: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.2004: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.2005: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.2006: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.2007: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.2008: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2009: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.2010: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.2011: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.2012: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.2013: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.2014: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1 Source.2015: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.2016: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.2017: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.2018: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.2019: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.2020: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.2021: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.2022: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.2023: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.2024: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.2025: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.2026: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.2027: DFBPPR11133 ---- Animal proteins ---- Transcription factor MafG Source.2028: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.2029: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2030: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein Source.2031: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.2032: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3 Source.2033: DFBPPR11169 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase Source.2034: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1 Source.2035: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.2036: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2037: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.2038: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.2039: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.2040: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.2041: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.2042: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1 Source.2043: DFBPPR11243 ---- Animal proteins ---- Epiphycan Source.2044: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.2045: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7 Source.2046: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.2047: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.2048: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.2049: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4 Source.2050: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.2051: DFBPPR11312 ---- Animal proteins ---- Transcription factor MafK Source.2052: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.2053: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8 Source.2054: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.2055: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1 Source.2056: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.2057: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2058: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.2059: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.2060: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.2061: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4 Source.2062: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1 Source.2063: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46 Source.2064: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.2065: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.2066: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.2067: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.2068: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2 Source.2069: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.2070: DFBPPR11495 ---- Animal proteins ---- Calretinin Source.2071: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.2072: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein Source.2073: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.2074: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.2075: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.2076: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform Source.2077: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.2078: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.2079: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2080: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.2081: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein Source.2082: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.2083: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.2084: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.2085: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.2086: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.2087: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.2088: DFBPPR11618 ---- Animal proteins ---- Adrenodoxin, mitochondrial Source.2089: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2090: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.2091: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.2092: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.2093: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.2094: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.2095: DFBPPR11660 ---- Animal proteins ---- Cathepsin K Source.2096: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.2097: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1 Source.2098: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.2099: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.2100: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2101: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.2102: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2103: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1 Source.2104: DFBPPR11738 ---- Animal proteins ---- Ensconsin Source.2105: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.2106: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.2107: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.2108: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.2109: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5 Source.2110: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.2111: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.2112: DFBPPR11822 ---- Animal proteins ---- Inversin Source.2113: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36 Source.2114: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.2115: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.2116: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein Source.2117: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.2118: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.2119: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.2120: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61 Source.2121: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.2122: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN Source.2123: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.2124: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.2125: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog Source.2126: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.2127: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2128: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2 Source.2129: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.2130: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.2131: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.2132: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.2133: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.2134: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.2135: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.2136: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.2137: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.2138: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.2139: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2140: DFBPPR12138 ---- Animal proteins ---- Protein LZIC Source.2141: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.2142: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2143: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.2144: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2145: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein Source.2146: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.2147: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Source.2148: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1 Source.2149: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.2150: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.2151: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.2152: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.2153: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2154: DFBPPR12251 ---- Animal proteins ---- Serotransferrin Source.2155: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.2156: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2157: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.2158: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2159: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2160: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2161: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.2162: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2163: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.2164: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.2165: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2166: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.2167: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3 Source.2168: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.2169: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.2170: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.2171: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.2172: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.2173: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type Source.2174: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.2175: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.2176: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.2177: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.2178: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.2179: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.2180: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.2181: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.2182: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2183: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.2184: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2185: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.2186: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4 Source.2187: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.2188: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.2189: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2190: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.2191: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.2192: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.2193: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.2194: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.2195: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.2196: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.2197: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.2198: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.2199: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.2200: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase Source.2201: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.2202: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.2203: DFBPPR12536 ---- Animal proteins ---- Albumin Source.2204: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.2205: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.2206: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.2207: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2208: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.2209: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1 Source.2210: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2211: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.2212: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.2213: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.2214: DFBPPR12642 ---- Animal proteins ---- Haptoglobin Source.2215: DFBPPR12643 ---- Animal proteins ---- Haptoglobin Source.2216: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5 Source.2217: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.2218: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.2219: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.2220: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2 Source.2221: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.2222: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.2223: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.2224: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1 Source.2225: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2226: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.2227: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3 Source.2228: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4 Source.2229: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2230: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle Source.2231: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.2232: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.2233: DFBPPR12796 ---- Animal proteins ---- Caspase-3 Source.2234: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2235: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.2236: DFBPPR12821 ---- Animal proteins ---- Gastricsin Source.2237: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain Source.2238: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2239: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.2240: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.2241: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.2242: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.2243: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn] Source.2244: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.2245: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.2246: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.2247: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.2248: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.2249: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.2250: DFBPPR12931 ---- Animal proteins ---- Transthyretin Source.2251: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.2252: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.2253: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.2254: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.2255: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.2256: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2257: DFBPPR13003 ---- Animal proteins ---- Calcyphosin Source.2258: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.2259: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.2260: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1 Source.2261: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein Source.2262: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain Source.2263: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1 Source.2264: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207 Source.2265: DFBPPR13142 ---- Animal proteins ---- Phospholipase A2 Source.2266: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.2267: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.2268: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2269: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2270: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase Source.2271: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.2272: DFBPPR13188 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.2273: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2274: DFBPPR13195 ---- Animal proteins ---- Albumin Source.2275: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.2276: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2277: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.2278: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.2279: DFBPPR13252 ---- Animal proteins ---- Ferritin light chain Source.2280: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.2281: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2282: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.2283: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.2284: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.2285: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.2286: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.2287: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.2288: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2289: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.2290: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.2291: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.2292: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.2293: DFBPPR13464 ---- Animal proteins ---- Interferon tau Source.2294: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein Source.2295: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3 Source.2296: DFBPPR13508 ---- Animal proteins ---- Fibrinogen beta chain Source.2297: DFBPPR13552 ---- Animal proteins ---- Inhibin beta A chain Source.2298: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.2299: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2300: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1 Source.2301: DFBPPR13599 ---- Animal proteins ---- Beta-2-microglobulin Source.2302: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.2303: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2304: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.2305: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.2306: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2 Source.2307: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6 Source.2308: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11 Source.2309: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3 Source.2310: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.2311: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1 Source.2312: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2313: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.2314: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10 Source.2315: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.2316: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5 Source.2317: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9 Source.2318: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8 Source.2319: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7 Source.2320: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4 Source.2321: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase Source.2322: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.2323: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor Source.2324: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor Source.2325: DFBPPR13810 ---- Animal proteins ---- Transthyretin Source.2326: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.2327: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.2328: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.2329: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor Source.2330: DFBPPR13903 ---- Animal proteins ---- Fibrinogen beta chain Source.2331: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.2332: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter Source.2333: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.2334: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.2335: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.2336: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.2337: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2338: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.2339: DFBPPR14046 ---- Animal proteins ---- Myoglobin Source.2340: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2341: DFBPPR14102 ---- Marine protein ---- Anamorsin-B Source.2342: DFBPPR14104 ---- Marine protein ---- Anamorsin-A Source.2343: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.2344: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.2345: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.2346: DFBPPR14133 ---- Marine protein ---- Calumenin-B Source.2347: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.2348: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.2349: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein Source.2350: DFBPPR14222 ---- Marine protein ---- Neuropeptide-like protein C4orf48 homolog Source.2351: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin Source.2352: DFBPPR14270 ---- Marine protein ---- Myoglobin Source.2353: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain Source.2354: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2355: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.2356: DFBPPR14325 ---- Marine protein ---- Uncharacterized protein ycf20 Source.2357: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2358: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2359: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.2360: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.2361: DFBPPR14357 ---- Marine protein ---- Ferredoxin Source.2362: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.2363: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.2364: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2365: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.2366: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain Source.2367: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein Source.2368: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain Source.2369: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic Source.2370: DFBPPR14423 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic Source.2371: DFBPPR14430 ---- Marine protein ---- 30S ribosomal protein S12, chloroplastic Source.2372: DFBPPR14473 ---- Marine protein ---- Photosystem II reaction center Psb28 protein Source.2373: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.2374: DFBPPR14530 ---- Marine protein ---- Uncharacterized protein ycf34 Source.2375: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor Source.2376: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B Source.2377: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2378: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.2379: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta Source.2380: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.2381: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros Source.2382: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.2383: DFBPPR14604 ---- Marine protein ---- Anamorsin Source.2384: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.2385: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.2386: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.2387: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A Source.2388: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B Source.2389: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2 Source.2390: DFBPPR14750 ---- Marine protein ---- Parvalbumin beta Source.2391: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.2392: DFBPPR14776 ---- Marine protein ---- Proteinase inhibitor Source.2393: DFBPPR14783 ---- Marine protein ---- Enolase Source.2394: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.2395: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2396: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1 Source.2397: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B Source.2398: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2399: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle Source.2400: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.2401: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.2402: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.2403: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.2404: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.2405: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit Source.2406: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.2407: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2408: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2409: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.2410: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.2411: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.2412: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.2413: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.2414: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.2415: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.2416: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2417: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1 Source.2418: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.2419: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.2420: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.2421: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1 Source.2422: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.2423: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1 Source.2424: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.2425: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.2426: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.2427: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.2428: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.2429: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.2430: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.2431: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.2432: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5 Source.2433: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.2434: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.2435: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.2436: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9 Source.2437: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.2438: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.2439: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.2440: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.2441: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.2442: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.2443: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2444: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.2445: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.2446: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5 Source.2447: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.2448: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1 Source.2449: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.2450: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.2451: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.2452: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.2453: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase Source.2454: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.2455: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.2456: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6 Source.2457: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.2458: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2459: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase Source.2460: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81 Source.2461: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.2462: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.2463: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.2464: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.2465: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.2466: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2467: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.2468: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C Source.2469: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.2470: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I Source.2471: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.2472: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13 Source.2473: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.2474: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.2475: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.2476: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1 Source.2477: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8 Source.2478: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.2479: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial Source.2480: DFBPPR15249 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 9 Source.2481: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.2482: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.2483: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.2484: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.2485: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.2486: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.2487: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2488: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.2489: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.2490: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2 Source.2491: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2 Source.2492: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4 Source.2493: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.2494: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.2495: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101 Source.2496: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase Source.2497: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial Source.2498: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.2499: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1 Source.2500: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.2501: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.2502: DFBPPR15490 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit NOP10 Source.2503: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.2504: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14 Source.2505: DFBPPR15534 ---- Microorganism protein ---- 60S ribosomal protein L30 Source.2506: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.2507: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2508: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.2509: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.2510: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.2511: DFBPPR15579 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit CNL1 Source.2512: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6 Source.2513: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.2514: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.2515: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.2516: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.2517: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7 Source.2518: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.2519: DFBPPR15669 ---- Microorganism protein ---- Serine palmitoyltransferase-regulating protein TSC3 Source.2520: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.2521: DFBPPR15688 ---- Microorganism protein ---- Nuclear transport factor 2 Source.2522: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.2523: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.2524: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial Source.2525: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.2526: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3 Source.2527: DFBPPR15781 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 5 Source.2528: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.2529: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component Source.2530: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.2531: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.2532: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component Source.2533: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.2534: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.2535: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.2536: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.2537: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase Source.2538: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.2539: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.2540: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase Source.2541: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2542: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2543: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.2544: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.2545: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.2546: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.2547: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.2548: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2549: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.2550: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2551: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.2552: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.2553: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2554: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.2555: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2556: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.2557: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.2558: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.2559: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.2560: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.2561: DFBPPR7843 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.2562: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.2563: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.2564: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.2565: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3 Source.2566: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1 Source.2567: DFBPPR7910 ---- Plant protein ---- Glycine-rich RNA-binding protein 2 Source.2568: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1 Source.2569: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.2570: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.2571: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.2572: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.2573: DFBPPR7967 ---- Plant protein ---- Plastocyanin Source.2574: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2575: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.2576: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2577: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.2578: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2579: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2580: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.2581: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.2582: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2583: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.2584: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.2585: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5 Source.2586: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.2587: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.2588: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2589: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2590: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2591: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2592: DFBPPR8292 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.2593: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide LDA showed low antioxidant activity with a relative antioxidant activity of 0.17 ± 0.00 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015