Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0860(Antioxidative peptide)

DFBP ID	DFBPANOX0860
Peptide sequence	VYV
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Val-Tyr-Val

Single-letter amino acid

VYV

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	379.46 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.92 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

2.3667^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.3: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.4: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.5: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.6: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.7: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.8: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.9: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1 Source.10: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.11: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.12: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.13: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.14: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A Source.15: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.16: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.17: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.18: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.19: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.20: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.21: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.22: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.23: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.24: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.25: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.26: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.27: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.28: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.29: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.30: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.31: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.32: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.33: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.34: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.35: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.36: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.37: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.38: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.39: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.40: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.41: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5 Source.42: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.43: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.44: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.45: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.46: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.47: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.48: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.49: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.50: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.51: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.52: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.53: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.54: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.55: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.56: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.57: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.58: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.59: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.60: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.61: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.62: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.63: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.64: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B Source.65: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.66: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.67: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.68: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.69: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.70: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.71: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.72: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.73: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.74: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.75: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.76: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.77: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.78: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.79: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2 Source.80: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.81: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23 Source.82: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.83: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.84: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.85: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.86: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.87: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.88: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.89: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.90: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic Source.91: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.92: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3 Source.93: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.94: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.95: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1 Source.96: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.97: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.98: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.99: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.100: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.101: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.102: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.103: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.104: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.105: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.106: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.107: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.108: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.109: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1 Source.110: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.111: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.112: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.113: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.114: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1 Source.115: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.116: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5 Source.117: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.118: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.119: DFBPPR2728 ---- Plant proteins ---- Autophagy-related protein 8B Source.120: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C Source.121: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A Source.122: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.123: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A Source.124: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.125: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.126: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.127: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.128: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.129: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.130: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.131: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.132: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.133: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B Source.134: DFBPPR2880 ---- Plant proteins ---- Nuclear cap-binding protein subunit 2 Source.135: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A Source.136: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.137: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.138: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1 Source.139: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.140: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.141: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.142: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.143: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.144: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.145: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.146: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.147: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.148: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.149: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.150: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.151: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.152: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.153: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.154: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a Source.155: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.156: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.157: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18 Source.158: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.159: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.160: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.161: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase Source.162: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.163: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.164: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.165: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.166: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.167: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.168: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.169: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19 Source.170: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.171: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.172: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.173: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.174: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.175: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.176: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.177: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.178: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.179: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.180: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900 Source.181: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.182: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51 Source.183: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial Source.184: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.185: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12 Source.186: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.187: DFBPPR3914 ---- Plant proteins ---- Derlin-2 Source.188: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.189: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.190: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.191: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.192: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.193: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.194: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.195: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.196: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.197: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16 Source.198: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.199: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.200: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial Source.201: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1 Source.202: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.203: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.204: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.205: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.206: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.207: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.208: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500 Source.209: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.210: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160 Source.211: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.212: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600 Source.213: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8 Source.214: DFBPPR4832 ---- Plant proteins ---- Protein GOS9 Source.215: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.216: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1 Source.217: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.218: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.219: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase Source.220: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.221: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.222: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.223: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1 Source.224: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.225: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.226: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.227: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.228: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.229: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.230: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.231: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.232: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.233: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.234: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase Source.235: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1 Source.236: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C Source.237: DFBPPR5363 ---- Plant proteins ---- Auxin-induced protein 10A5 Source.238: DFBPPR5364 ---- Plant proteins ---- Auxin-induced protein X10A Source.239: DFBPPR5365 ---- Plant proteins ---- Auxin-induced protein 6B Source.240: DFBPPR5366 ---- Plant proteins ---- Auxin-induced protein 15A Source.241: DFBPPR5367 ---- Plant proteins ---- Auxin-induced protein X15 Source.242: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.243: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.244: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.245: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.246: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.247: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.248: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.249: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.250: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.251: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.252: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.253: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.254: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1 Source.255: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1 Source.256: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.257: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase Source.258: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.259: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.260: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.261: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.262: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.263: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.264: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.265: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.266: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.267: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1 Source.268: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1 Source.269: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2 Source.270: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.271: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.272: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.273: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.274: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.275: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.276: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.277: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.278: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.279: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.280: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase Source.281: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.282: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1 Source.283: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.284: DFBPPR6119 ---- Plant proteins ---- Signal recognition particle 9 kDa protein Source.285: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.286: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.287: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic Source.288: DFBPPR6310 ---- Plant proteins ---- Catalase Source.289: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.290: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.291: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.292: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.293: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.294: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.295: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.296: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.297: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.298: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.299: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.300: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.301: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.302: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.303: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.304: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.305: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase Source.306: DFBPPR6736 ---- Plant proteins ---- ATP-dependent 6-phosphofructokinase Source.307: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.308: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.309: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.310: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.311: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic Source.312: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.313: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.314: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.315: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic Source.316: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic Source.317: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.318: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B Source.319: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin Source.320: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin Source.321: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.322: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.323: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.324: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.325: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.326: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.327: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.328: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.329: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.330: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.331: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.332: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.333: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic Source.334: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic Source.335: DFBPPR7299 ---- Plant proteins ---- Low temperature-induced protein lt101.1 Source.336: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2 Source.337: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2 Source.338: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.339: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.340: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1 Source.341: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.342: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.343: DFBPPR7499 ---- Plant proteins ---- Ferredoxin Source.344: DFBPPR7618 ---- Milk proteins ---- Plasminogen Source.345: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.346: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein Source.347: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.348: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.349: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.350: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.351: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.352: DFBPPR7725 ---- Plant proteins ---- Avenin-3 Source.353: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2 Source.354: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1 Source.355: DFBPPR7739 ---- Plant proteins ---- Avenin-E Source.356: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.357: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.358: DFBPPR15934 ---- Animal proteins ---- Apolipoprotein A-I Source.359: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.360: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.361: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.362: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.363: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.364: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.365: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.366: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.367: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.368: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.369: DFBPPR16103 ---- Animal proteins ---- Laforin Source.370: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.371: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule Source.372: DFBPPR16148 ---- Animal proteins ---- Haptoglobin Source.373: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.374: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.375: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.376: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.377: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.378: DFBPPR16258 ---- Animal proteins ---- Decorin Source.379: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha Source.380: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.381: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.382: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.383: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.384: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.385: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.386: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.387: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.388: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.389: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.390: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.391: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.392: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22 Source.393: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.394: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region Source.395: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8 Source.396: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.397: DFBPPR16816 ---- Animal proteins ---- Decorin Source.398: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.399: DFBPPR16827 ---- Animal proteins ---- S-arrestin Source.400: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.401: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.402: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.403: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.404: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.405: DFBPPR16918 ---- Animal proteins ---- Spastin Source.406: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.407: DFBPPR16930 ---- Animal proteins ---- Apolipoprotein A-I Source.408: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.409: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.410: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase Source.411: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2 Source.412: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.413: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.414: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.415: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.416: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.417: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.418: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.419: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.420: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.421: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.422: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.423: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.424: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.425: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.426: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.427: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.428: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.429: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.430: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.431: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.432: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.433: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.434: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.435: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.436: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.437: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.438: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.439: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.440: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.441: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta Source.442: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.443: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.444: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta Source.445: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.446: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.447: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.448: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.449: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.450: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial Source.451: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.452: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.453: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.454: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.455: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.456: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B Source.457: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.458: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.459: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8 Source.460: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.461: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.462: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.463: DFBPPR18170 ---- Animal proteins ---- Histone H2B type 1 Source.464: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.465: DFBPPR18201 ---- Animal proteins ---- Histone H2B type 1-K Source.466: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.467: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4 Source.468: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.469: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7 Source.470: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.471: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.472: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.473: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.474: DFBPPR18427 ---- Animal proteins ---- Cystatin-C Source.475: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.476: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.477: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.478: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6 Source.479: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Source.480: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.481: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB Source.482: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.483: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2 Source.484: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.485: DFBPPR18721 ---- Animal proteins ---- Histone H2B type 1-N Source.486: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.487: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.488: DFBPPR18752 ---- Animal proteins ---- Serine/arginine-rich splicing factor 3 Source.489: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.490: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.491: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.492: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.493: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.494: DFBPPR18868 ---- Animal proteins ---- Haptoglobin Source.495: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1 Source.496: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b Source.497: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1 Source.498: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.499: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.500: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.501: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.502: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.503: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.504: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.505: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.506: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.507: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.508: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.509: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.510: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.511: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Source.512: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.513: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.514: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.515: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.516: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.517: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.518: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.519: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.520: DFBPPR19429 ---- Animal proteins ---- Protein Spindly Source.521: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.522: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.523: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.524: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.525: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.526: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit Source.527: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.528: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3 Source.529: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.530: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.531: DFBPPR19798 ---- Animal proteins ---- Uricase Source.532: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.533: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.534: DFBPPR19914 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2 Source.535: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor Source.536: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.537: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1 Source.538: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.539: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.540: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9 Source.541: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.542: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan Source.543: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A Source.544: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.545: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.546: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial Source.547: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.548: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.549: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.550: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.551: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.552: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1 Source.553: DFBPPR20557 ---- Animal proteins ---- Asporin Source.554: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.555: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein Source.556: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2 Source.557: DFBPPR20671 ---- Animal proteins ---- 39S ribosomal protein L27, mitochondrial Source.558: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.559: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.560: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.561: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.562: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial Source.563: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Source.564: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4 Source.565: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.566: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3 Source.567: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.568: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.569: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1 Source.570: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.571: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2 Source.572: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.573: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21 Source.574: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.575: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.576: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.577: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148 Source.578: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.579: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24 Source.580: DFBPPR21219 ---- Animal proteins ---- Zinc finger CCHC-type and RNA-binding motif-containing protein 1 Source.581: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.582: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.583: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.584: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein Source.585: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.586: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.587: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.588: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.589: DFBPPR21514 ---- Animal proteins ---- Splenin Source.590: DFBPPR21549 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y Source.591: DFBPPR21620 ---- Animal proteins ---- Claudin-12 Source.592: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1 Source.593: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein Source.594: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6 Source.595: DFBPPR21683 ---- Animal proteins ---- Serine protease 23 Source.596: DFBPPR21688 ---- Animal proteins ---- Thymopoietin-1 Source.597: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11 Source.598: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1 Source.599: DFBPPR21696 ---- Animal proteins ---- Thymopoietin-2 Source.600: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.601: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.602: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12 Source.603: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.604: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.605: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.606: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6 Source.607: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.608: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.609: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.610: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.611: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.612: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1 Source.613: DFBPPR22267 ---- Animal proteins ---- Keratin-associated protein 12-2 Source.614: DFBPPR22283 ---- Animal proteins ---- F-box only protein 8 Source.615: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.616: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A Source.617: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.618: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1 Source.619: DFBPPR22426 ---- Animal proteins ---- Single-pass membrane and coiled-coil domain-containing protein 4 Source.620: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1 Source.621: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.622: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.623: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein Source.624: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28 Source.625: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.626: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.627: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.628: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.629: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.630: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.631: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.632: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.633: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.634: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.635: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta Source.636: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.637: DFBPPR8694 ---- Animal proteins ---- Spastin Source.638: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.639: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.640: DFBPPR8792 ---- Animal proteins ---- Plasminogen Source.641: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.642: DFBPPR8865 ---- Animal proteins ---- Haptoglobin Source.643: DFBPPR8880 ---- Animal proteins ---- Apolipoprotein A-I Source.644: DFBPPR8883 ---- Animal proteins ---- Apolipoprotein A-I Source.645: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.646: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.647: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.648: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.649: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.650: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.651: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.652: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.653: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.654: DFBPPR9081 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.655: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.656: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.657: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.658: DFBPPR9166 ---- Animal proteins ---- Uricase Source.659: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.660: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.661: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1 Source.662: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.663: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.664: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.665: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor Source.666: DFBPPR9347 ---- Animal proteins ---- C-reactive protein Source.667: DFBPPR9366 ---- Animal proteins ---- Decorin Source.668: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.669: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.670: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.671: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.672: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.673: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.674: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.675: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.676: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.677: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.678: DFBPPR9843 ---- Animal proteins ---- P protein Source.679: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.680: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.681: DFBPPR10004 ---- Animal proteins ---- Spastin Source.682: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.683: DFBPPR10037 ---- Animal proteins ---- Leptin Source.684: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.685: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.686: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.687: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.688: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8 Source.689: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.690: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.691: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.692: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein Source.693: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.694: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.695: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.696: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.697: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.698: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.699: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.700: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.701: DFBPPR10317 ---- Animal proteins ---- Nucleophosmin Source.702: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.703: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.704: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.705: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.706: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.707: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.708: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.709: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.710: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.711: DFBPPR10513 ---- Animal proteins ---- Parafibromin Source.712: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.713: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.714: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.715: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1 Source.716: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.717: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.718: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.719: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein Source.720: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.721: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.722: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.723: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.724: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.725: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.726: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1 Source.727: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b Source.728: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.729: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.730: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.731: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.732: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.733: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.734: DFBPPR10915 ---- Animal proteins ---- Hepatic lectin Source.735: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.736: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.737: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C Source.738: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.739: DFBPPR10988 ---- Animal proteins ---- Midkine Source.740: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase Source.741: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.742: DFBPPR11060 ---- Animal proteins ---- Netrin-3 Source.743: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.744: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.745: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.746: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.747: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein Source.748: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.749: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.750: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein Source.751: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.752: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.753: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.754: DFBPPR11241 ---- Animal proteins ---- Lymphocyte antigen 6E Source.755: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.756: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.757: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.758: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.759: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.760: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.761: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.762: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.763: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.764: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.765: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.766: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.767: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.768: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.769: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4 Source.770: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.771: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.772: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.773: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.774: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.775: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.776: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.777: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.778: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21 Source.779: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.780: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.781: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.782: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3 Source.783: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.784: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62 Source.785: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.786: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.787: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region Source.788: DFBPPR11887 ---- Animal proteins ---- Angiotensinogen Source.789: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A Source.790: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.791: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.792: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.793: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.794: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2 Source.795: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.796: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.797: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1 Source.798: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.799: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.800: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.801: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.802: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.803: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.804: DFBPPR12245 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.805: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.806: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.807: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.808: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.809: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.810: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.811: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.812: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.813: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Source.814: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.815: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3 Source.816: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.817: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I Source.818: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.819: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.820: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.821: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.822: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.823: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.824: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.825: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.826: DFBPPR12642 ---- Animal proteins ---- Haptoglobin Source.827: DFBPPR12643 ---- Animal proteins ---- Haptoglobin Source.828: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8 Source.829: DFBPPR12725 ---- Animal proteins ---- Uricase Source.830: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1 Source.831: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.832: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.833: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.834: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.835: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.836: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.837: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin Source.838: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.839: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.840: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.841: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.842: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.843: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.844: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.845: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form Source.846: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.847: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.848: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.849: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.850: DFBPPR13240 ---- Animal proteins ---- Decorin Source.851: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.852: DFBPPR13262 ---- Animal proteins ---- Gastrin Source.853: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.854: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.855: DFBPPR13297 ---- Animal proteins ---- Plasminogen Source.856: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta Source.857: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22 Source.858: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.859: DFBPPR13524 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.860: DFBPPR13526 ---- Animal proteins ---- Pregnancy-associated glycoprotein 62 Source.861: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.862: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.863: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein Source.864: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.865: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.866: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.867: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.868: DFBPPR13713 ---- Animal proteins ---- Plasminogen Source.869: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.870: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.871: DFBPPR13793 ---- Animal proteins ---- Decorin Source.872: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.873: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1 Source.874: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9 Source.875: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase Source.876: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase Source.877: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.878: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a Source.879: DFBPPR14240 ---- Marine protein ---- Otolin-1 Source.880: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.881: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.882: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.883: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.884: DFBPPR14478 ---- Marine protein ---- Photosystem II reaction center protein T Source.885: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.886: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.887: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1 Source.888: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9 Source.889: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.890: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.891: DFBPPR14660 ---- Marine protein ---- Otolin-1 Source.892: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.893: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.894: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.895: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.896: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system Source.897: DFBPPR14906 ---- Microorganism protein ---- Autophagy-related protein 8 Source.898: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.899: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.900: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.901: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.902: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.903: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.904: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor Source.905: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.906: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.907: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.908: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.909: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.910: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.911: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35 Source.912: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.913: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.914: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.915: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.916: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.917: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6 Source.918: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.919: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.920: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1 Source.921: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14 Source.922: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.923: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3 Source.924: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.925: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.926: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase Source.927: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10 Source.928: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.929: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.930: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.931: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.932: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.933: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.934: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11 Source.935: DFBPPR15510 ---- Microorganism protein ---- Autophagy-related protein 29 Source.936: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5 Source.937: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.938: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2 Source.939: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.940: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.941: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5 Source.942: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1 Source.943: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.944: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase Source.945: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3 Source.946: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.947: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.948: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.949: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.950: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog Source.951: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.952: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A Source.953: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.954: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.955: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.956: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase Source.957: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.958: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.959: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.960: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.961: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.962: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.963: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.964: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.965: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.966: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.967: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.968: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.969: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.970: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.971: DFBPPR8331 ---- Plant protein ---- Auxin-responsive protein SAUR50
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide VYV showed moderate antioxidant activity with a relative antioxidant activity of 15.38 ± 0.09 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015