E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0896(Antioxidative peptide)
DFBP ID DFBPANOX0896
Peptide sequence IPA
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity ACE-inhibitory activity [D1], Antihypertensive activity [D2], DPP IV-inhibitory activity [D3], Multifunctional activity [D4]
Calculated physicochemical properties
Three-letter amino acid Ile-Pro-Ala
Single-letter amino acid IPA
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 299.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 1.5667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine whey protein
Precursor protein β-Lactoglobulin
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.2: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.3: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.4: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.5: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.6: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.7: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.8: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.9: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.10: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.11: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.12: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.13: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.14: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.15: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.16: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.17: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.18: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.19: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.20: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.21: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.22: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1
Source.23: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.24: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.25: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.26: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.27: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.28: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.29: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.30: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.31: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.32: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.33: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.34: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.35: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.36: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.37: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.38: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.39: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.40: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.41: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.42: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.43: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.44: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.45: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.46: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.47: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.48: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.49: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.50: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.51: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.52: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.53: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.54: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.55: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.56: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.57: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.58: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.59: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.60: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.61: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.62: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.63: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.64: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.65: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.66: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.67: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.68: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.69: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.70: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.71: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.72: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.73: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.74: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.75: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.76: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.77: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.78: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.79: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1
Source.80: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.81: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.82: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.83: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.84: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.85: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.86: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.87: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.88: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.89: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.90: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.91: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.92: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.93: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.94: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.95: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.96: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.97: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.98: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.99: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.100: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.101: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.102: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.103: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.104: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.105: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.106: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.107: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.108: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.109: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.110: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.111: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.112: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.113: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.114: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.115: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.116: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.117: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.118: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.119: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.120: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.121: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.122: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.123: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.124: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.125: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.126: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.127: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.128: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.129: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.130: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.131: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.132: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.133: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.134: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.135: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.136: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.137: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.138: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.139: DFBPPR2176 ---- Plant proteins ---- Expansin-B11
Source.140: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.141: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.142: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4
Source.143: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.144: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.145: DFBPPR2223 ---- Plant proteins ---- Urease
Source.146: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.147: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.148: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.149: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3
Source.150: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.151: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.152: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.153: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.154: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.155: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.156: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.157: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.158: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.159: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.160: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.161: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.162: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.163: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.164: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.165: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.166: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.167: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.168: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.169: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.170: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.171: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.172: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.173: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.174: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.175: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.176: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.177: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.178: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.179: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.180: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.181: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.182: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.183: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.184: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.185: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.186: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.187: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.188: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.189: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.190: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.191: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.192: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.193: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.194: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.195: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.196: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.197: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.198: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.199: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.200: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.201: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.202: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.203: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.204: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.205: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.206: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.207: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.208: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.209: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.210: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.211: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.212: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.213: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.214: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.215: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.216: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.217: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.218: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8
Source.219: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.220: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.221: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.222: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.223: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.224: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.225: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.226: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.227: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.228: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.229: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.230: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.231: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.232: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.233: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.234: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta
Source.235: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.236: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.237: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.238: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.239: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.240: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18
Source.241: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.242: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.243: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.244: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.245: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.246: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic
Source.247: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.248: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.249: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.250: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.251: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.252: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.253: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.254: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.255: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.256: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.257: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.258: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.259: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.260: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.261: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.262: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.263: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.264: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.265: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic
Source.266: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.267: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.268: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.269: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.270: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.271: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.272: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.273: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.274: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.275: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.276: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.277: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.278: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.279: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.280: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.281: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.282: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.283: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.284: DFBPPR4030 ---- Plant proteins ---- Cytochrome b5
Source.285: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.286: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.287: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.288: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.289: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.290: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.291: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1
Source.292: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.293: DFBPPR4129 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 1
Source.294: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.295: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.296: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.297: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.298: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.299: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.300: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.301: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.302: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.303: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.304: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.305: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.306: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.307: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.308: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.309: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3
Source.310: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7
Source.311: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.312: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.313: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9
Source.314: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.315: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.316: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.317: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.318: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.319: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.320: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.321: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.322: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.323: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.324: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.325: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.326: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.327: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.328: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.329: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.330: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.331: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.332: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.333: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.334: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.335: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.336: DFBPPR4682 ---- Plant proteins ---- Protein SPIRAL1-like 1
Source.337: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.338: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.339: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.340: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.341: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.342: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.343: DFBPPR4768 ---- Plant proteins ---- Protein SPIRAL1-like 2
Source.344: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.345: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.346: DFBPPR4836 ---- Plant proteins ---- Protein SPIRAL1-like 3
Source.347: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.348: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.349: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.350: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.351: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.352: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.353: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.354: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.355: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.356: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.357: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.358: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.359: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.360: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.361: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.362: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.363: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.364: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.365: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.366: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.367: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B
Source.368: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.369: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.370: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.371: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.372: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.373: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.374: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.375: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.376: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.377: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.378: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.379: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase
Source.380: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.381: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11
Source.382: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.383: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.384: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.385: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.386: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.387: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.388: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.389: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.390: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.391: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.392: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.393: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.394: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.395: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.396: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.397: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.398: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.399: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.400: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.401: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.402: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.403: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.404: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.405: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.406: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.407: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.408: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.409: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.410: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.411: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.412: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.413: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.414: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.415: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.416: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.417: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.418: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.419: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.420: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.421: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.422: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.423: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B
Source.424: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.425: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.426: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.427: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.428: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.429: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.430: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.431: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.432: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11
Source.433: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.434: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.435: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.436: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.437: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.438: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.439: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.440: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.441: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.442: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.443: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.444: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.445: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.446: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.447: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.448: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.449: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.450: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.451: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.452: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.453: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.454: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.455: DFBPPR6499 ---- Plant proteins ---- Provicilin
Source.456: DFBPPR6510 ---- Plant proteins ---- 50S ribosomal protein 6, chloroplastic
Source.457: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.458: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.459: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.460: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.461: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.462: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.463: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.464: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.465: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.466: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.467: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5
Source.468: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.469: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.470: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.471: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.472: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.473: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.474: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.475: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.476: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10
Source.477: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12
Source.478: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212
Source.479: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.480: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.481: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.482: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.483: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.484: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.485: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.486: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.487: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.488: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe
Source.489: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.490: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.491: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.492: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.493: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.494: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.495: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.496: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.497: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.498: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.499: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.500: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.501: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.502: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.503: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.504: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.505: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.506: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.507: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.508: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.509: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.510: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.511: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.512: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1
Source.513: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.514: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.515: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.516: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.517: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.518: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.519: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.520: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.521: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.522: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.523: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.524: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.525: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.526: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.527: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.528: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.529: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.530: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.531: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.532: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.533: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.534: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.535: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin
Source.536: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.537: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.538: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.539: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.540: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.541: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.542: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.543: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.544: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.545: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.546: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.547: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.548: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.549: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.550: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.551: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.552: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.553: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.554: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2
Source.555: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.556: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.557: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.558: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.559: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.560: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.561: DFBPPR16120 ---- Animal proteins ---- C-X-C motif chemokine 10
Source.562: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.563: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.564: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.565: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule
Source.566: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.567: DFBPPR16159 ---- Animal proteins ---- Apolipoprotein C-I
Source.568: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.569: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.570: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.571: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.572: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.573: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.574: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.575: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.576: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.577: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.578: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.579: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.580: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.581: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.582: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.583: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.584: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.585: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.586: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.587: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.588: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.589: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190
Source.590: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.591: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.592: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.593: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.594: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.595: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.596: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.597: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.598: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.599: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.600: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.601: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.602: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain
Source.603: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.604: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.605: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.606: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.607: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.608: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.609: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.610: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.611: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.612: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau
Source.613: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2
Source.614: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.615: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.616: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.617: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.618: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.619: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.620: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.621: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.622: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.623: DFBPPR17107 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma
Source.624: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.625: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.626: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.627: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.628: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.629: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.630: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.631: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.632: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.633: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.634: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.635: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.636: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.637: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.638: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.639: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.640: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.641: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.642: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.643: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.644: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.645: DFBPPR17532 ---- Animal proteins ---- Cytochrome b5
Source.646: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.647: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.648: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.649: DFBPPR17559 ---- Animal proteins ---- C-X-C motif chemokine 10
Source.650: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.651: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.652: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.653: DFBPPR17647 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.654: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.655: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.656: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.657: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.658: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.659: DFBPPR17820 ---- Animal proteins ---- Osteomodulin
Source.660: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.661: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.662: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.663: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.664: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.665: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.666: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.667: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.668: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.669: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.670: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.671: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.672: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.673: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.674: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.675: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.676: DFBPPR18054 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 9
Source.677: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.678: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.679: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.680: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.681: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.682: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.683: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.684: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.685: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.686: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.687: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.688: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.689: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.690: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.691: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.692: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.693: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.694: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.695: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.696: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.697: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.698: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.699: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.700: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.701: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.702: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.703: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.704: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.705: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.706: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.707: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.708: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.709: DFBPPR18623 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.710: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.711: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.712: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.713: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.714: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.715: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.716: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.717: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor
Source.718: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.719: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.720: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.721: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.722: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.723: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.724: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1
Source.725: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.726: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.727: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.728: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.729: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.730: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.731: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.732: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.733: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.734: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.735: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.736: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.737: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1
Source.738: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.739: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.740: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.741: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.742: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.743: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.744: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.745: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.746: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.747: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.748: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.749: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.750: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2
Source.751: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.752: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha
Source.753: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.754: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.755: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.756: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.757: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.758: DFBPPR19351 ---- Animal proteins ---- Caveolae-associated protein 3
Source.759: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.760: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.761: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.762: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.763: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.764: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12
Source.765: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.766: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.767: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.768: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.769: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.770: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase
Source.771: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.772: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase
Source.773: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.774: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.775: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.776: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.777: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.778: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1
Source.779: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.780: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.781: DFBPPR19686 ---- Animal proteins ---- Spindle and kinetochore-associated protein 1
Source.782: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.783: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.784: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.785: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.786: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.787: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.788: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.789: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.790: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.791: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.792: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.793: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.794: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.795: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.796: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.797: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.798: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.799: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.800: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.801: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.802: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.803: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1
Source.804: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.805: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.806: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.807: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54
Source.808: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.809: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.810: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3
Source.811: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.812: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.813: DFBPPR20348 ---- Animal proteins ---- V-type proton ATPase subunit F
Source.814: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.815: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.816: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.817: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.818: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.819: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.820: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.821: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.822: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.823: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.824: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.825: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201
Source.826: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.827: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.828: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.829: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.830: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.831: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.832: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.833: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.834: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.835: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.836: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.837: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.838: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein
Source.839: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3
Source.840: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.841: DFBPPR20897 ---- Animal proteins ---- Polyadenylate-binding protein-interacting protein 2
Source.842: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator
Source.843: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.844: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18
Source.845: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.846: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.847: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.848: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.849: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.850: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.851: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.852: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.853: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.854: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog
Source.855: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.856: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.857: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.858: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.859: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.860: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.861: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.862: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.863: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.864: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.865: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.866: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.867: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.868: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.869: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.870: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.871: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.872: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.873: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.874: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.875: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.876: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.877: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.878: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.879: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.880: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.881: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.882: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.883: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.884: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14
Source.885: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.886: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.887: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.888: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.889: DFBPPR21588 ---- Animal proteins ---- Diazepam-binding inhibitor-like 5
Source.890: DFBPPR21590 ---- Animal proteins ---- Rhombotin-1
Source.891: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.892: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.893: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.894: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.895: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.896: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.897: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.898: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190
Source.899: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28
Source.900: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.901: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.902: DFBPPR21855 ---- Animal proteins ---- Proline-rich nuclear receptor coactivator 2
Source.903: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.904: DFBPPR21904 ---- Animal proteins ---- Protein TBATA
Source.905: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.906: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.907: DFBPPR21925 ---- Animal proteins ---- Heat shock factor-binding protein 1
Source.908: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.909: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.910: DFBPPR21957 ---- Animal proteins ---- LIM domain transcription factor LMO4
Source.911: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.912: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.913: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.914: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.915: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.916: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10
Source.917: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.918: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.919: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.920: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.921: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.922: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.923: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3
Source.924: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.925: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.926: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.927: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1
Source.928: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.929: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.930: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.931: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.932: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A
Source.933: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog
Source.934: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.935: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.936: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.937: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1
Source.938: DFBPPR22641 ---- Animal proteins ---- LIM domain only protein 3
Source.939: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.940: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2
Source.941: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.942: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog
Source.943: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.944: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.945: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.946: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.947: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.948: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.949: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.950: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.951: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.952: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.953: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.954: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.955: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.956: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.957: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.958: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.959: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.960: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.961: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.962: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.963: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.964: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.965: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.966: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.967: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.968: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.969: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.970: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.971: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.972: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.973: DFBPPR8866 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma
Source.974: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.975: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.976: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.977: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.978: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.979: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.980: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.981: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.982: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.983: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.984: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.985: DFBPPR9054 ---- Animal proteins ---- Secretin
Source.986: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.987: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32
Source.988: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.989: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.990: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.991: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.992: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.993: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.994: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.995: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.996: DFBPPR9247 ---- Animal proteins ---- Alveolar macrophage chemotactic factor 2
Source.997: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.998: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.999: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.1000: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.1001: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1002: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1003: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.1004: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1005: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.1006: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1007: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.1008: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.1009: DFBPPR9462 ---- Animal proteins ---- Cytochrome c oxidase copper chaperone
Source.1010: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.1011: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.1012: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.1013: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1014: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1015: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain
Source.1016: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain
Source.1017: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.1018: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.1019: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.1020: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.1021: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.1022: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.1023: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1024: DFBPPR9961 ---- Animal proteins ---- Somatotropin
Source.1025: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1026: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1027: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1028: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.1029: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1030: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.1031: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1032: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.1033: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1034: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.1035: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.1036: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.1037: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1038: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.1039: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.1040: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.1041: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1042: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.1043: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.1044: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.1045: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.1046: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.1047: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.1048: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.1049: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.1050: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1051: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1052: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1053: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1054: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.1055: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.1056: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.1057: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.1058: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.1059: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.1060: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1061: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.1062: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.1063: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1064: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.1065: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.1066: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.1067: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.1068: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1069: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1070: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.1071: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1072: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1073: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.1074: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.1075: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1076: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.1077: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.1078: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1079: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.1080: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.1081: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.1082: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1
Source.1083: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.1084: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1085: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.1086: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1087: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.1088: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1089: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.1090: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.1091: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.1092: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.1093: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.1094: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.1095: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1096: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.1097: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.1098: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1099: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.1100: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1101: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1102: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.1103: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.1104: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1105: DFBPPR10785 ---- Animal proteins ---- Cytochrome b5
Source.1106: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.1107: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.1108: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.1109: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1110: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1111: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.1112: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.1113: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.1114: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.1115: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.1116: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152
Source.1117: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1118: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.1119: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.1120: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1121: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.1122: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.1123: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.1124: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.1125: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.1126: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.1127: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.1128: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.1129: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1130: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.1131: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1
Source.1132: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.1133: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.1134: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.1135: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.1136: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1137: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.1138: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1139: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1140: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1141: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.1142: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.1143: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1144: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.1145: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1
Source.1146: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.1147: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.1148: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.1149: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.1150: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.1151: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.1152: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.1153: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.1154: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.1155: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.1156: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.1157: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.1158: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1159: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.1160: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.1161: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.1162: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2
Source.1163: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.1164: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.1165: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.1166: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.1167: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1168: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4
Source.1169: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1170: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1171: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.1172: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.1173: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.1174: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.1175: DFBPPR11623 ---- Animal proteins ---- Polyadenylate-binding protein-interacting protein 2
Source.1176: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.1177: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1178: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.1179: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.1180: DFBPPR11687 ---- Animal proteins ---- Antithrombin-III
Source.1181: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1182: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1183: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.1184: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.1185: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.1186: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.1187: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.1188: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.1189: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.1190: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.1191: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.1192: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.1193: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.1194: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.1195: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.1196: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.1197: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.1198: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.1199: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.1200: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.1201: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.1202: DFBPPR12097 ---- Animal proteins ---- Photoreceptor outer segment membrane glycoprotein 2
Source.1203: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.1204: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.1205: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.1206: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.1207: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.1208: DFBPPR12240 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.1209: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1210: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.1211: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1212: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.1213: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1214: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.1215: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1216: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1217: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.1218: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.1219: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1220: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1221: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1222: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1223: DFBPPR12358 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.1224: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.1225: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.1226: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.1227: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1228: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1229: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.1230: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1231: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.1232: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.1233: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.1234: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.1235: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.1236: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.1237: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.1238: DFBPPR12436 ---- Animal proteins ---- Cytochrome b5
Source.1239: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.1240: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.1241: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.1242: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1243: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1244: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.1245: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.1246: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.1247: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.1248: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.1249: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1250: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1251: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1252: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.1253: DFBPPR12579 ---- Animal proteins ---- Troponin I, slow skeletal muscle
Source.1254: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1255: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.1256: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.1257: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.1258: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1259: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1260: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.1261: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.1262: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.1263: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.1264: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.1265: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.1266: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.1267: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.1268: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.1269: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.1270: DFBPPR12865 ---- Animal proteins ---- Sperm surface protein Sp17
Source.1271: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.1272: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.1273: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.1274: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.1275: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.1276: DFBPPR13014 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.1277: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.1278: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.1279: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1280: DFBPPR13092 ---- Animal proteins ---- Testin
Source.1281: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.1282: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1283: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1284: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5
Source.1285: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1286: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.1287: DFBPPR13188 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2
Source.1288: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2
Source.1289: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1290: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.1291: DFBPPR13251 ---- Animal proteins ---- Cytochrome b5
Source.1292: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.1293: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.1294: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1295: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.1296: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.1297: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1298: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.1299: DFBPPR13297 ---- Animal proteins ---- Plasminogen
Source.1300: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1301: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.1302: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau
Source.1303: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1304: DFBPPR13458 ---- Animal proteins ---- Interleukin-4
Source.1305: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.1306: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1307: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.1308: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1309: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1310: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1311: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1312: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.1313: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1314: DFBPPR13663 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.1315: DFBPPR13713 ---- Animal proteins ---- Plasminogen
Source.1316: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1317: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1318: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1319: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.1320: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1321: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1322: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.1323: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1324: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1325: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.1326: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.1327: DFBPPR13839 ---- Animal proteins ---- Interleukin-4
Source.1328: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.1329: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1330: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1331: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1332: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.1333: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.1334: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.1335: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.1336: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.1337: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E
Source.1338: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12
Source.1339: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.1340: DFBPPR14207 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.1341: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.1342: DFBPPR14222 ---- Marine protein ---- Neuropeptide-like protein C4orf48 homolog
Source.1343: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.1344: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.1345: DFBPPR14306 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1346: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.1347: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.1348: DFBPPR14321 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.1349: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.1350: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1351: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha
Source.1352: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.1353: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.1354: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.1355: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53
Source.1356: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.1357: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.1358: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1359: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.1360: DFBPPR14628 ---- Marine protein ---- C-type natriuretic peptide 1
Source.1361: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.1362: DFBPPR14695 ---- Marine protein ---- C-type natriuretic peptide 2
Source.1363: DFBPPR14737 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.1364: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.1365: DFBPPR14760 ---- Marine protein ---- Big defensin
Source.1366: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.1367: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.1368: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1369: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.1370: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.1371: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.1372: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.1373: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.1374: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.1375: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.1376: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.1377: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.1378: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.1379: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.1380: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.1381: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.1382: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.1383: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.1384: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1
Source.1385: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.1386: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.1387: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.1388: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.1389: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.1390: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.1391: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.1392: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.1393: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.1394: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.1395: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.1396: DFBPPR15128 ---- Microorganism protein ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.1397: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase
Source.1398: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.1399: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.1400: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.1401: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.1402: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.1403: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.1404: DFBPPR15216 ---- Microorganism protein ---- Golgi to ER traffic protein 1
Source.1405: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.1406: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.1407: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.1408: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.1409: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.1410: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25
Source.1411: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.1412: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.1413: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.1414: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.1415: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.1416: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.1417: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.1418: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.1419: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.1420: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.1421: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381
Source.1422: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.1423: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.1424: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.1425: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.1426: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.1427: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.1428: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.1429: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.1430: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.1431: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.1432: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.1433: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.1434: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.1435: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.1436: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial
Source.1437: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.1438: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2
Source.1439: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.1440: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.1441: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.1442: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.1443: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.1444: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.1445: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.1446: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.1447: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.1448: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.1449: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.1450: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.1451: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.1452: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.1453: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.1454: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.1455: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.1456: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.1457: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1458: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.1459: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4
Source.1460: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.1461: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.1462: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.1463: DFBPPR7933 ---- Plant protein ---- FK506-binding protein 2
Source.1464: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.1465: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.1466: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.1467: DFBPPR7998 ---- Plant protein ---- Antifungal protein ginkbilobin-1
Source.1468: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.1469: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.1470: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.1471: DFBPPR8082 ---- Plant protein ---- Plastocyanin
Source.1472: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.1473: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.1474: DFBPPR8168 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor PVI-4
Source.1475: DFBPPR8169 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor PVI-3(2)
Source.1476: DFBPPR8181 ---- Plant protein ---- 33 kDa cell wall protein
Source.1477: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.1478: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1479: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe3+/mol peptide) was measured as a positive control. The peptide IPA showed low antioxidant activity with a relative antioxidant activity of 0.14 ± 0.02 mmol Fe3+/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references
DFBP
[D1] DFBPACEI0356
[D2] DFBPANHY0516
[D3] DFBPDPIV0009
[D4] DFBPMUFU0109
BIOPEP-UWM [D5] 3507, 8304
APD [D6] -
BioPepDB [D7] -
MBPDB [D8] -
Reference(s)
Primary literature Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63.
Other literature(s) N.D
PubDate 2015
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214