Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0903(Antioxidative peptide)

DFBP ID	DFBPANOX0903
Peptide sequence	DAL
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Asp-Ala-Leu

Single-letter amino acid

DAL

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	317.33 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.13 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

0.7000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.3: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.4: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.5: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A Source.6: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.7: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.8: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.9: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.10: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.11: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.12: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.13: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.14: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.15: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.16: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.17: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.18: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.19: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.20: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.21: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.22: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.23: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.24: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.25: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.26: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.27: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.28: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.29: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.30: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.31: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.32: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.33: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.34: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.35: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.36: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.37: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.38: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.39: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1 Source.40: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.41: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.42: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.43: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.44: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.45: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.46: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.47: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.48: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24 Source.49: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.50: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.51: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.52: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.53: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB Source.54: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.55: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.56: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.57: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.58: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6 Source.59: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.60: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13 Source.61: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.62: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.63: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.64: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.65: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic Source.66: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic Source.67: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.68: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18 Source.69: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.70: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.71: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.72: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.73: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.74: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.75: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.76: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.77: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.78: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.79: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.80: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3 Source.81: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.82: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a Source.83: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.84: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.85: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.86: DFBPPR1297 ---- Plant proteins ---- Peroxygenase Source.87: DFBPPR1300 ---- Plant proteins ---- Protein G1 Source.88: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.89: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.90: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.91: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.92: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.93: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.94: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.95: DFBPPR1351 ---- Plant proteins ---- Probable phospholipase A2 homolog 2 Source.96: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.97: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic Source.98: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic Source.99: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.100: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3 Source.101: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.102: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.103: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.104: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.105: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.106: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6 Source.107: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.108: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.109: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.110: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.111: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.112: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.113: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.114: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.115: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.116: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.117: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1 Source.118: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase Source.119: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.120: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.121: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.122: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.123: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.124: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.125: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.126: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.127: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.128: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.129: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.130: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.131: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.132: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.133: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.134: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.135: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.136: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.137: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.138: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.139: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.140: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.141: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.142: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.143: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.144: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.145: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.146: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.147: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.148: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.149: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17 Source.150: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.151: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.152: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.153: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.154: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.155: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.156: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.157: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.158: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.159: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a Source.160: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.161: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.162: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.163: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.164: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.165: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic Source.166: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.167: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.168: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.169: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.170: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.171: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.172: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.173: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.174: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.175: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.176: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.177: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.178: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3 Source.179: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.180: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.181: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic Source.182: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic Source.183: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.184: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic Source.185: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.186: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.187: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.188: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.189: DFBPPR1796 ---- Plant proteins ---- Fibrillin protein 5 homolog Source.190: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.191: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.192: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.193: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a Source.194: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.195: DFBPPR1818 ---- Plant proteins ---- Chitinase 9 Source.196: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.197: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.198: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.199: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.200: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.201: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.202: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.203: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.204: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.205: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.206: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.207: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.208: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.209: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.210: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.211: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.212: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.213: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.214: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.215: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.216: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.217: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.218: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.219: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.220: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.221: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.222: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.223: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.224: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.225: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.226: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.227: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4 Source.228: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.229: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28 Source.230: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.231: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.232: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.233: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.234: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.235: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.236: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.237: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.238: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.239: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.240: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.241: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.242: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.243: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.244: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.245: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.246: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.247: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.248: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.249: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.250: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.251: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.252: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.253: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.254: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.255: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.256: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.257: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.258: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.259: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.260: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.261: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.262: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.263: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.264: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.265: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.266: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.267: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.268: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.269: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.270: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.271: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.272: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.273: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.274: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.275: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.276: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.277: DFBPPR2206 ---- Plant proteins ---- Leucine-rich repeat protein 1 Source.278: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.279: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.280: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.281: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.282: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.283: DFBPPR2223 ---- Plant proteins ---- Urease Source.284: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.285: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6 Source.286: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.287: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1 Source.288: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.289: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.290: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8 Source.291: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.292: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3 Source.293: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic Source.294: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.295: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.296: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial Source.297: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.298: DFBPPR2305 ---- Plant proteins ---- Actin-depolymerizing factor 4 Source.299: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.300: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.301: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.302: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.303: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.304: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3 Source.305: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.306: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.307: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.308: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.309: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.310: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.311: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.312: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.313: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.314: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.315: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.316: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.317: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.318: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.319: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.320: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.321: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.322: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.323: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.324: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial Source.325: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase Source.326: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.327: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.328: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.329: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.330: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.331: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b Source.332: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.333: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2 Source.334: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.335: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.336: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.337: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.338: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.339: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.340: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.341: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.342: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.343: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.344: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.345: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic Source.346: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.347: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.348: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5 Source.349: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.350: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.351: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.352: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.353: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.354: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25 Source.355: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.356: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.357: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.358: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.359: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic Source.360: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.361: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.362: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.363: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16 Source.364: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.365: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.366: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.367: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.368: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.369: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.370: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.371: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.372: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.373: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.374: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.375: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.376: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.377: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.378: DFBPPR2784 ---- Plant proteins ---- Chitinase 11 Source.379: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.380: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.381: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.382: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.383: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.384: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.385: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1 Source.386: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.387: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.388: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.389: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.390: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.391: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.392: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.393: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.394: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.395: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1 Source.396: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.397: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.398: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21 Source.399: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.400: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.401: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.402: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.403: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.404: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.405: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.406: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.407: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.408: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.409: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.410: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.411: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.412: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.413: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.414: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.415: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.416: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.417: DFBPPR2987 ---- Plant proteins ---- 1-Cys peroxiredoxin B Source.418: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.419: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.420: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.421: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.422: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.423: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.424: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.425: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.426: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.427: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.428: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.429: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3 Source.430: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.431: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.432: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.433: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.434: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.435: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.436: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.437: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20 Source.438: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.439: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.440: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.441: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.442: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.443: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.444: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.445: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic Source.446: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.447: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.448: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.449: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.450: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.451: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.452: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain Source.453: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7 Source.454: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.455: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.456: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.457: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.458: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.459: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.460: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.461: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.462: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.463: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.464: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.465: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8 Source.466: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8 Source.467: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.468: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.469: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.470: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A Source.471: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.472: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.473: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.474: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.475: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19 Source.476: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.477: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.478: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.479: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.480: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.481: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.482: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.483: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.484: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.485: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.486: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.487: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A Source.488: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.489: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.490: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.491: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.492: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.493: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.494: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.495: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.496: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.497: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.498: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1 Source.499: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.500: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.501: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.502: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.503: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic Source.504: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.505: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.506: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.507: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.508: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3 Source.509: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.510: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic Source.511: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.512: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.513: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.514: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.515: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.516: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.517: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.518: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.519: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.520: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3 Source.521: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.522: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.523: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.524: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.525: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6 Source.526: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.527: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3 Source.528: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1 Source.529: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2 Source.530: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.531: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.532: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.533: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.534: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.535: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.536: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.537: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12 Source.538: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.539: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1 Source.540: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.541: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.542: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.543: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase Source.544: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42 Source.545: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.546: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E Source.547: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.548: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.549: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.550: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.551: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39 Source.552: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic Source.553: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.554: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.555: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.556: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.557: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.558: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.559: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.560: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.561: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.562: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.563: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7 Source.564: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8 Source.565: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.566: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.567: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2 Source.568: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.569: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.570: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.571: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.572: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.573: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.574: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1 Source.575: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.576: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.577: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.578: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2 Source.579: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.580: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.581: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.582: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2 Source.583: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9 Source.584: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2 Source.585: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6 Source.586: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5 Source.587: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3 Source.588: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4 Source.589: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.590: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.591: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G Source.592: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.593: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.594: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.595: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.596: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.597: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.598: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.599: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5 Source.600: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.601: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.602: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.603: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.604: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.605: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.606: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.607: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4 Source.608: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.609: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.610: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.611: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2 Source.612: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.613: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.614: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.615: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1 Source.616: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.617: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.618: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.619: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.620: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.621: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.622: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.623: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.624: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.625: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.626: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.627: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.628: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.629: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.630: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.631: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.632: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.633: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.634: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.635: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1 Source.636: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.637: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.638: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.639: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.640: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.641: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.642: DFBPPR4319 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.643: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.644: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.645: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.646: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.647: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.648: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic Source.649: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.650: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.651: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.652: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.653: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.654: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.655: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4 Source.656: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.657: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.658: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.659: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.660: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.661: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.662: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.663: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.664: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.665: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1 Source.666: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.667: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.668: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.669: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.670: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15 Source.671: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.672: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.673: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.674: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.675: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.676: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.677: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27 Source.678: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.679: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.680: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.681: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.682: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.683: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.684: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F Source.685: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15 Source.686: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.687: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.688: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.689: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.690: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3 Source.691: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.692: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.693: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2 Source.694: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.695: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.696: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.697: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.698: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.699: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11 Source.700: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.701: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.702: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.703: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.704: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.705: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9 Source.706: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13 Source.707: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3 Source.708: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.709: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10 Source.710: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.711: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.712: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.713: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.714: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2 Source.715: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.716: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5 Source.717: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1 Source.718: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080 Source.719: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.720: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.721: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.722: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.723: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.724: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.725: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.726: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2 Source.727: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.728: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.729: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.730: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.731: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.732: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.733: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.734: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.735: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.736: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.737: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.738: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.739: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.740: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.741: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.742: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.743: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.744: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.745: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.746: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.747: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.748: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.749: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.750: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB Source.751: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.752: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.753: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.754: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A Source.755: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.756: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.757: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic Source.758: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.759: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.760: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic Source.761: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.762: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.763: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.764: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.765: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.766: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22 Source.767: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.768: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha Source.769: DFBPPR5137 ---- Plant proteins ---- Cytochrome f Source.770: DFBPPR5144 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-A Source.771: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.772: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.773: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.774: DFBPPR5254 ---- Plant proteins ---- Chalcone--flavonone isomerase 3 Source.775: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.776: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.777: DFBPPR5310 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.778: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1 Source.779: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2 Source.780: DFBPPR5337 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial Source.781: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase Source.782: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.783: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.784: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.785: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.786: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.787: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.788: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.789: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.790: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.791: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.792: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein Source.793: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.794: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.795: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.796: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.797: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.798: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1 Source.799: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1 Source.800: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.801: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.802: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.803: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.804: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.805: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.806: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2 Source.807: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.808: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.809: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.810: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit Source.811: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.812: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.813: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.814: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.815: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.816: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.817: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.818: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.819: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10 Source.820: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7 Source.821: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.822: DFBPPR5571 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 1 Source.823: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.824: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.825: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.826: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.827: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.828: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic Source.829: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.830: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.831: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.832: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase Source.833: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.834: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.835: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.836: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.837: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.838: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.839: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1 Source.840: DFBPPR5681 ---- Plant proteins ---- Single myb histone 4 Source.841: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.842: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.843: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.844: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3 Source.845: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.846: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.847: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform Source.848: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.849: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.850: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.851: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.852: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.853: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.854: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.855: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.856: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.857: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase Source.858: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.859: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic Source.860: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.861: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.862: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.863: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.864: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.865: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.866: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P Source.867: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1 Source.868: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B Source.869: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1 Source.870: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic Source.871: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.872: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.873: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.874: DFBPPR5955 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-2, chloroplastic Source.875: DFBPPR5973 ---- Plant proteins ---- Cortical cell-delineating protein Source.876: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.877: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.878: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2 Source.879: DFBPPR6012 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 2 Source.880: DFBPPR6035 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.881: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.882: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4 Source.883: DFBPPR6122 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 4 Source.884: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A Source.885: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13 Source.886: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.887: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B Source.888: DFBPPR6191 ---- Plant proteins ---- Unknown protein from spot 502 of 2D-PAGE of etiolated coleoptile Source.889: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.890: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.891: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.892: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.893: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.894: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.895: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.896: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.897: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.898: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.899: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.900: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.901: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor Source.902: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.903: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.904: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.905: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.906: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.907: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.908: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.909: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.910: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.911: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.912: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.913: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.914: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.915: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.916: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.917: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein Source.918: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.919: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2 Source.920: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.921: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5 Source.922: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.923: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.924: DFBPPR6573 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial Source.925: DFBPPR6613 ---- Plant proteins ---- Ras-related protein Rab7 Source.926: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.927: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.928: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.929: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.930: DFBPPR6656 ---- Plant proteins ---- Catalase Source.931: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.932: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.933: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.934: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.935: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5 Source.936: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.937: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.938: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.939: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.940: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.941: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.942: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38) Source.943: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.944: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.945: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10 Source.946: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.947: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.948: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12 Source.949: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.950: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212 Source.951: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.952: DFBPPR6924 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC256 Source.953: DFBPPR6925 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC237 Source.954: DFBPPR6943 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.955: DFBPPR6953 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.956: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2 Source.957: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.958: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe Source.959: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.960: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.961: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.962: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.963: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic Source.964: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.965: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.966: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.967: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.968: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.969: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.970: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.971: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.972: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.973: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.974: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.975: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A Source.976: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B Source.977: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.978: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.979: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.980: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2 Source.981: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.982: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1 Source.983: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.984: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.985: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.986: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.987: DFBPPR7233 ---- Plant proteins ---- Photosystem I reaction center subunit IX Source.988: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic Source.989: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.990: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3 Source.991: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.992: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.993: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.994: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.995: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.996: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1 Source.997: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C Source.998: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B Source.999: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic Source.1000: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.1001: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1002: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase Source.1003: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1004: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1005: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1006: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1007: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.1008: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.1009: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.1010: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.1011: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.1012: DFBPPR7508 ---- Plant proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5 Source.1013: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1014: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.1015: DFBPPR7520 ---- Plant proteins ---- 40S ribosomal protein S15a Source.1016: DFBPPR7543 ---- Plant proteins ---- Polcalcin Bra n 2 Source.1017: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.1018: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.1019: DFBPPR7611 ---- Milk proteins ---- Clusterin Source.1020: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.1021: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.1022: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1023: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.1024: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.1025: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.1026: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor Source.1027: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.1028: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.1029: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1030: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.1031: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.1032: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.1033: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.1034: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1035: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.1036: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein Source.1037: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.1038: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.1039: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.1040: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.1041: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1042: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1043: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.1044: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.1045: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.1046: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.1047: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1048: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1049: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.1050: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1051: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.1052: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1053: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase Source.1054: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1055: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.1056: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.1057: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1058: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.1059: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1060: DFBPPR15934 ---- Animal proteins ---- Apolipoprotein A-I Source.1061: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E Source.1062: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1063: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.1064: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1065: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase Source.1066: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.1067: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.1068: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1069: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1070: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.1071: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1072: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1073: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase Source.1074: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.1075: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1076: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1077: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.1078: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1079: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.1080: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1081: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1082: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1083: DFBPPR16072 ---- Animal proteins ---- Clusterin Source.1084: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.1085: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.1086: DFBPPR16103 ---- Animal proteins ---- Laforin Source.1087: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1088: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1089: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1090: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.1091: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1092: DFBPPR16168 ---- Animal proteins ---- Annexin A2 Source.1093: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1094: DFBPPR16189 ---- Animal proteins ---- Albumin Source.1095: DFBPPR16191 ---- Animal proteins ---- Somatotropin Source.1096: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.1097: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I Source.1098: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle Source.1099: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1100: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1101: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.1102: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.1103: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein Source.1104: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1105: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.1106: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1107: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha Source.1108: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin Source.1109: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.1110: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.1111: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1112: DFBPPR16305 ---- Animal proteins ---- Phosducin Source.1113: DFBPPR16312 ---- Animal proteins ---- C-C motif chemokine 13 Source.1114: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.1115: DFBPPR16325 ---- Animal proteins ---- Peripherin-2 Source.1116: DFBPPR16326 ---- Animal proteins ---- Desmin Source.1117: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1118: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.1119: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.1120: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.1121: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1122: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1123: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1124: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1125: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1126: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.1127: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.1128: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1129: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1130: DFBPPR16467 ---- Animal proteins ---- Opticin Source.1131: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1132: DFBPPR16485 ---- Animal proteins ---- Cathepsin S Source.1133: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.1134: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1135: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1136: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.1137: DFBPPR16553 ---- Animal proteins ---- Tapasin Source.1138: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1139: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1140: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1141: DFBPPR16594 ---- Animal proteins ---- Macoilin Source.1142: DFBPPR16595 ---- Animal proteins ---- Annexin A4 Source.1143: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.1144: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.1145: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1146: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1147: DFBPPR16655 ---- Animal proteins ---- Somatostatin Source.1148: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.1149: DFBPPR16723 ---- Animal proteins ---- Ig heavy chain V region GOM Source.1150: DFBPPR16732 ---- Animal proteins ---- HORMA domain-containing protein 2 Source.1151: DFBPPR16739 ---- Animal proteins ---- Lengsin Source.1152: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.1153: DFBPPR16749 ---- Animal proteins ---- Keratinocyte differentiation-associated protein Source.1154: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1155: DFBPPR16799 ---- Animal proteins ---- Somatotropin Source.1156: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.1157: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.1158: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.1159: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.1160: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1161: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.1162: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.1163: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I Source.1164: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Source.1165: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.1166: DFBPPR16893 ---- Animal proteins ---- Annexin A4 Source.1167: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.1168: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.1169: DFBPPR16919 ---- Animal proteins ---- VIP peptides Source.1170: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1171: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.1172: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1173: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.1174: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1175: DFBPPR16952 ---- Animal proteins ---- Annexin A2 Source.1176: DFBPPR16960 ---- Animal proteins ---- Catalase Source.1177: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.1178: DFBPPR16981 ---- Animal proteins ---- Clusterin Source.1179: DFBPPR16985 ---- Animal proteins ---- Filensin Source.1180: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.1181: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1182: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.1183: DFBPPR17000 ---- Animal proteins ---- Vimentin Source.1184: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.1185: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.1186: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.1187: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.1188: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1189: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1190: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta Source.1191: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1192: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.1193: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.1194: DFBPPR17082 ---- Animal proteins ---- Calbindin Source.1195: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.1196: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1197: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1198: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.1199: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1200: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1201: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1202: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle Source.1203: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.1204: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1205: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1206: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2 Source.1207: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1 Source.1208: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.1209: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial Source.1210: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1211: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.1212: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B Source.1213: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.1214: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1215: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.1216: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.1217: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1 Source.1218: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B Source.1219: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.1220: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.1221: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.1222: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.1223: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.1224: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.1225: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.1226: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1227: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1228: DFBPPR17341 ---- Animal proteins ---- Radixin Source.1229: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1230: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.1231: DFBPPR17349 ---- Animal proteins ---- Sialidase-3 Source.1232: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.1233: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2 Source.1234: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.1235: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.1236: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6 Source.1237: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5 Source.1238: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.1239: DFBPPR17401 ---- Animal proteins ---- Moesin Source.1240: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.1241: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.1242: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.1243: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1244: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1 Source.1245: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.1246: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.1247: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.1248: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.1249: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.1250: DFBPPR17454 ---- Animal proteins ---- Peripherin-2 Source.1251: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)] Source.1252: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.1253: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.1254: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.1255: DFBPPR17481 ---- Animal proteins ---- Apolipoprotein C-III Source.1256: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.1257: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1258: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1259: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein Source.1260: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.1261: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1262: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.1263: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1264: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta Source.1265: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1266: DFBPPR17577 ---- Animal proteins ---- Interleukin-1 alpha Source.1267: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase Source.1268: DFBPPR17594 ---- Animal proteins ---- E-selectin Source.1269: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.1270: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1271: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.1272: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.1273: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.1274: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1275: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1276: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1277: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.1278: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.1279: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1280: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1281: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.1282: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.1283: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1284: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD Source.1285: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein Source.1286: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3 Source.1287: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.1288: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1289: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.1290: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.1291: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.1292: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13 Source.1293: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1294: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1295: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.1296: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.1297: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.1298: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein Source.1299: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.1300: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial Source.1301: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1302: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.1303: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1304: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.1305: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.1306: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1307: DFBPPR17947 ---- Animal proteins ---- Erythropoietin Source.1308: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.1309: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1310: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1311: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.1312: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1313: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.1314: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.1315: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.1316: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.1317: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.1318: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5 Source.1319: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.1320: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.1321: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1322: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.1323: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.1324: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4 Source.1325: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.1326: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3 Source.1327: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1328: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1329: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.1330: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1331: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase Source.1332: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.1333: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.1334: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.1335: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1 Source.1336: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4 Source.1337: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.1338: DFBPPR18211 ---- Animal proteins ---- Phosducin Source.1339: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.1340: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.1341: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.1342: DFBPPR18227 ---- Animal proteins ---- Desmin Source.1343: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.1344: DFBPPR18284 ---- Animal proteins ---- ATP synthase subunit epsilon, mitochondrial Source.1345: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.1346: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.1347: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1348: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.1349: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha Source.1350: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.1351: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1 Source.1352: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.1353: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1354: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.1355: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.1356: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.1357: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.1358: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6 Source.1359: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.1360: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.1361: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos Source.1362: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.1363: DFBPPR18433 ---- Animal proteins ---- Basigin Source.1364: DFBPPR18448 ---- Animal proteins ---- Septin-1 Source.1365: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.1366: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1 Source.1367: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.1368: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.1369: DFBPPR18470 ---- Animal proteins ---- Perilipin-5 Source.1370: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1371: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.1372: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3 Source.1373: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1374: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Source.1375: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.1376: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.1377: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.1378: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.1379: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1 Source.1380: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.1381: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1 Source.1382: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1383: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.1384: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.1385: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561 Source.1386: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.1387: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1388: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.1389: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.1390: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3 Source.1391: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1392: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.1393: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1394: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.1395: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.1396: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.1397: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.1398: DFBPPR18812 ---- Animal proteins ---- Vesicle-associated membrane protein 3 Source.1399: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1400: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.1401: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1402: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.1403: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.1404: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.1405: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.1406: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1407: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.1408: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.1409: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.1410: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.1411: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3 Source.1412: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11 Source.1413: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.1414: DFBPPR18936 ---- Animal proteins ---- S-methyl-5'-thioadenosine phosphorylase Source.1415: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein Source.1416: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.1417: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.1418: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3 Source.1419: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.1420: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.1421: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.1422: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6 Source.1423: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.1424: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1 Source.1425: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.1426: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1 Source.1427: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19 Source.1428: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1 Source.1429: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.1430: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog Source.1431: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.1432: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.1433: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.1434: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.1435: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.1436: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5 Source.1437: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.1438: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A Source.1439: DFBPPR19096 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase Source.1440: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.1441: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.1442: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1 Source.1443: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1444: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.1445: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial Source.1446: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.1447: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.1448: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1449: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.1450: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1451: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.1452: DFBPPR19219 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A2, mitochondrial Source.1453: DFBPPR19230 ---- Animal proteins ---- Interferon alpha-G Source.1454: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Source.1455: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1456: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1457: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1458: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1459: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like Source.1460: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28 Source.1461: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4 Source.1462: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.1463: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.1464: DFBPPR19288 ---- Animal proteins ---- Interferon alpha-C Source.1465: DFBPPR19291 ---- Animal proteins ---- Multicilin Source.1466: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic Source.1467: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.1468: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.1469: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1 Source.1470: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85 Source.1471: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4 Source.1472: DFBPPR19429 ---- Animal proteins ---- Protein Spindly Source.1473: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71 Source.1474: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.1475: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.1476: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2 Source.1477: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73 Source.1478: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG Source.1479: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1480: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1481: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.1482: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.1483: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial Source.1484: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.1485: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.1486: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4 Source.1487: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.1488: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.1489: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.1490: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1491: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial Source.1492: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.1493: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.1494: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C Source.1495: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.1496: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.1497: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1498: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1499: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase Source.1500: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.1501: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.1502: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.1503: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.1504: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1 Source.1505: DFBPPR19663 ---- Animal proteins ---- Synembryn-A Source.1506: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.1507: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1508: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.1509: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.1510: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1511: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7 Source.1512: DFBPPR19709 ---- Animal proteins ---- Centromere protein X Source.1513: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.1514: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1 Source.1515: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog Source.1516: DFBPPR19728 ---- Animal proteins ---- THO complex subunit 7 homolog Source.1517: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.1518: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.1519: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit Source.1520: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein Source.1521: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1522: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3 Source.1523: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.1524: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.1525: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.1526: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1 Source.1527: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.1528: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.1529: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1530: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.1531: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B Source.1532: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.1533: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1534: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8 Source.1535: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta Source.1536: DFBPPR19895 ---- Animal proteins ---- 39S ribosomal protein L24, mitochondrial Source.1537: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.1538: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.1539: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase Source.1540: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80 Source.1541: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.1542: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.1543: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.1544: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1545: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7 Source.1546: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C Source.1547: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2 Source.1548: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.1549: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17 Source.1550: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12 Source.1551: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1552: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.1553: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.1554: DFBPPR20067 ---- Animal proteins ---- Glutaredoxin-2, mitochondrial Source.1555: DFBPPR20072 ---- Animal proteins ---- Adenine phosphoribosyltransferase Source.1556: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1557: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.1558: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.1559: DFBPPR20089 ---- Animal proteins ---- Fascin-2 Source.1560: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.1561: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.1562: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.1563: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A Source.1564: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.1565: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4 Source.1566: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase Source.1567: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.1568: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4 Source.1569: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1570: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2 Source.1571: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.1572: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein Source.1573: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1574: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54 Source.1575: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1 Source.1576: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A Source.1577: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.1578: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B Source.1579: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.1580: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.1581: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2 Source.1582: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase Source.1583: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.1584: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1 Source.1585: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.1586: DFBPPR20401 ---- Animal proteins ---- Bystin Source.1587: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2 Source.1588: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.1589: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1590: DFBPPR20410 ---- Animal proteins ---- Protein AF1q Source.1591: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.1592: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.1593: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.1594: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1595: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF Source.1596: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.1597: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38 Source.1598: DFBPPR20467 ---- Animal proteins ---- Tetranectin Source.1599: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.1600: DFBPPR20478 ---- Animal proteins ---- Macoilin Source.1601: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.1602: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog Source.1603: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial Source.1604: DFBPPR20518 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5 Source.1605: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6 Source.1606: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A Source.1607: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.1608: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog Source.1609: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1610: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4 Source.1611: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Source.1612: DFBPPR20560 ---- Animal proteins ---- Draxin Source.1613: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.1614: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.1615: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.1616: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog Source.1617: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1 Source.1618: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.1619: DFBPPR20598 ---- Animal proteins ---- Oncostatin-M Source.1620: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1621: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.1622: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.1623: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1624: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain Source.1625: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1626: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.1627: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.1628: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial Source.1629: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11 Source.1630: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.1631: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2 Source.1632: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.1633: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1 Source.1634: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.1635: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B Source.1636: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.1637: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.1638: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1639: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.1640: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.1641: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.1642: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2 Source.1643: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial Source.1644: DFBPPR20821 ---- Animal proteins ---- Prefoldin subunit 4 Source.1645: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV Source.1646: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2 Source.1647: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.1648: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1649: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.1650: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.1651: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.1652: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3 Source.1653: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2 Source.1654: DFBPPR20913 ---- Animal proteins ---- Somatostatin Source.1655: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1656: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1657: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.1658: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.1659: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9 Source.1660: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3 Source.1661: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.1662: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1663: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1664: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1 Source.1665: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.1666: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.1667: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein Source.1668: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.1669: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D Source.1670: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.1671: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog Source.1672: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.1673: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.1674: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.1675: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2 Source.1676: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1677: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III Source.1678: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.1679: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7 Source.1680: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.1681: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1 Source.1682: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6 Source.1683: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.1684: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.1685: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.1686: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.1687: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.1688: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.1689: DFBPPR21209 ---- Animal proteins ---- 40S ribosomal protein S6 Source.1690: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29 Source.1691: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2 Source.1692: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.1693: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen Source.1694: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.1695: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1696: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.1697: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3 Source.1698: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.1699: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1 Source.1700: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1701: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.1702: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1 Source.1703: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.1704: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.1705: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.1706: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.1707: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1708: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.1709: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B Source.1710: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase Source.1711: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.1712: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.1713: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4 Source.1714: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23 Source.1715: DFBPPR21564 ---- Animal proteins ---- HORMA domain-containing protein 2 Source.1716: DFBPPR21575 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 6 Source.1717: DFBPPR21579 ---- Animal proteins ---- Protein phosphatase inhibitor 2 Source.1718: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1719: DFBPPR21621 ---- Animal proteins ---- Death-associated protein-like 1 Source.1720: DFBPPR21629 ---- Animal proteins ---- Annexin A3 Source.1721: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1 Source.1722: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.1723: DFBPPR21668 ---- Animal proteins ---- Putative deoxyribonuclease TATDN1 Source.1724: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog Source.1725: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1 Source.1726: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.1727: DFBPPR21706 ---- Animal proteins ---- Small membrane A-kinase anchor protein Source.1728: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2 Source.1729: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.1730: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28 Source.1731: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2 Source.1732: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog Source.1733: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.1734: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial Source.1735: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.1736: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.1737: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1738: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein Source.1739: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17 Source.1740: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.1741: DFBPPR21854 ---- Animal proteins ---- Suppressor of IKBKE 1 Source.1742: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.1743: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.1744: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial Source.1745: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.1746: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1 Source.1747: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.1748: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.1749: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.1750: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.1751: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.1752: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.1753: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.1754: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.1755: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.1756: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.1757: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1 Source.1758: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1 Source.1759: DFBPPR21991 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC7-like Source.1760: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX Source.1761: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.1762: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.1763: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.1764: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.1765: DFBPPR22083 ---- Animal proteins ---- 40S ribosomal protein S15a Source.1766: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1 Source.1767: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3 Source.1768: DFBPPR22100 ---- Animal proteins ---- Centromere protein M Source.1769: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2 Source.1770: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2 Source.1771: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.1772: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.1773: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3 Source.1774: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.1775: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8 Source.1776: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.1777: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.1778: DFBPPR22223 ---- Animal proteins ---- Calretinin Source.1779: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36 Source.1780: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.1781: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.1782: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.1783: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.1784: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.1785: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1 Source.1786: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.1787: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35 Source.1788: DFBPPR22329 ---- Animal proteins ---- Coiled-coil domain-containing protein 172 Source.1789: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39 Source.1790: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2 Source.1791: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11 Source.1792: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.1793: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.1794: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.1795: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.1796: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474 Source.1797: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.1798: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.1799: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B Source.1800: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149 Source.1801: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2 Source.1802: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A Source.1803: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1 Source.1804: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog Source.1805: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8 Source.1806: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C Source.1807: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.1808: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2 Source.1809: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein Source.1810: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.1811: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.1812: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog Source.1813: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2 Source.1814: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.1815: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.1816: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105 Source.1817: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54 Source.1818: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1 Source.1819: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B Source.1820: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175 Source.1821: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4 Source.1822: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.1823: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein Source.1824: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.1825: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.1826: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89 Source.1827: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1 Source.1828: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B Source.1829: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11 Source.1830: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog Source.1831: DFBPPR22734 ---- Animal proteins ---- Uncharacterized protein C1orf226 homolog Source.1832: DFBPPR22757 ---- Animal proteins ---- Uncharacterized protein CXorf65 homolog Source.1833: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1834: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.1835: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.1836: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.1837: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1838: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.1839: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1840: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.1841: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.1842: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B Source.1843: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.1844: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.1845: DFBPPR8595 ---- Animal proteins ---- Annexin A4 Source.1846: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.1847: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.1848: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.1849: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.1850: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1851: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1852: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1 Source.1853: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.1854: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.1855: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1856: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.1857: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.1858: DFBPPR8657 ---- Animal proteins ---- Annexin A2 Source.1859: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1860: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1 Source.1861: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.1862: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.1863: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.1864: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1865: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.1866: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1867: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1868: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.1869: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1870: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1871: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C Source.1872: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha Source.1873: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1874: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.1875: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase Source.1876: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.1877: DFBPPR8733 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial Source.1878: DFBPPR8734 ---- Animal proteins ---- Clusterin Source.1879: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.1880: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.1881: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.1882: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1883: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.1884: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1 Source.1885: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.1886: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.1887: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.1888: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.1889: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1890: DFBPPR8851 ---- Animal proteins ---- Vimentin Source.1891: DFBPPR8852 ---- Animal proteins ---- Vimentin Source.1892: DFBPPR8854 ---- Animal proteins ---- Vimentin Source.1893: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1894: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.1895: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.1896: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.1897: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1898: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.1899: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.1900: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.1901: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.1902: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1903: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.1904: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.1905: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.1906: DFBPPR9039 ---- Animal proteins ---- Desmin Source.1907: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.1908: DFBPPR9069 ---- Animal proteins ---- E-selectin Source.1909: DFBPPR9081 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.1910: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.1911: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.1912: DFBPPR9108 ---- Animal proteins ---- Somatostatin Source.1913: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I Source.1914: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1915: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1916: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.1917: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.1918: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1919: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.1920: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1921: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.1922: DFBPPR9179 ---- Animal proteins ---- Hemoglobin subunit alpha Source.1923: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6 Source.1924: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1925: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10 Source.1926: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.1927: DFBPPR9212 ---- Animal proteins ---- Dihydrofolate reductase Source.1928: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.1929: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.1930: DFBPPR9236 ---- Animal proteins ---- Radixin Source.1931: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.1932: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.1933: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.1934: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.1935: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.1936: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1937: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2 Source.1938: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.1939: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.1940: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.1941: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.1942: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.1943: DFBPPR9363 ---- Animal proteins ---- Moesin Source.1944: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1945: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.1946: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase Source.1947: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.1948: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34 Source.1949: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.1950: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.1951: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5 Source.1952: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.1953: DFBPPR9484 ---- Animal proteins ---- Macoilin Source.1954: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.1955: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.1956: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.1957: DFBPPR9539 ---- Animal proteins ---- Neurofilament heavy polypeptide Source.1958: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.1959: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.1960: DFBPPR9555 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.1961: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.1962: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1 Source.1963: DFBPPR9578 ---- Animal proteins ---- Biglycan Source.1964: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A Source.1965: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1 Source.1966: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2 Source.1967: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.1968: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1969: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561 Source.1970: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase Source.1971: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.1972: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1973: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.1974: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1975: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.1976: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1977: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.1978: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.1979: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1980: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.1981: DFBPPR9837 ---- Animal proteins ---- Troponin T, fast skeletal muscle Source.1982: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase Source.1983: DFBPPR9850 ---- Animal proteins ---- Retinol-binding protein 2 Source.1984: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2 Source.1985: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17 Source.1986: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.1987: DFBPPR9961 ---- Animal proteins ---- Somatotropin Source.1988: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1989: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2 Source.1990: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.1991: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.1992: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.1993: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I Source.1994: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.1995: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16 Source.1996: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.1997: DFBPPR10030 ---- Animal proteins ---- Calbindin Source.1998: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.1999: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.2000: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.2001: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.2002: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.2003: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.2004: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2005: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.2006: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.2007: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7 Source.2008: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.2009: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.2010: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2011: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.2012: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.2013: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5 Source.2014: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.2015: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.2016: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.2017: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.2018: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.2019: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1 Source.2020: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein Source.2021: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.2022: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.2023: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.2024: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.2025: DFBPPR10220 ---- Animal proteins ---- Paxillin Source.2026: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.2027: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.2028: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3 Source.2029: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1 Source.2030: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein Source.2031: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.2032: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.2033: DFBPPR10270 ---- Animal proteins ---- Agrin Source.2034: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.2035: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.2036: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.2037: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.2038: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.2039: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.2040: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.2041: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.2042: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor Source.2043: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.2044: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2 Source.2045: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.2046: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.2047: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR Source.2048: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.2049: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.2050: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.2051: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.2052: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.2053: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2054: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.2055: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2056: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.2057: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.2058: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.2059: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.2060: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c Source.2061: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.2062: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.2063: DFBPPR10452 ---- Animal proteins ---- Desmin Source.2064: DFBPPR10459 ---- Animal proteins ---- Reelin Source.2065: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.2066: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.2067: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.2068: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.2069: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.2070: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3 Source.2071: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros Source.2072: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.2073: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.2074: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.2075: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.2076: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.2077: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.2078: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.2079: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.2080: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1 Source.2081: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.2082: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2083: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.2084: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1 Source.2085: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.2086: DFBPPR10590 ---- Animal proteins ---- Centromere protein X Source.2087: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.2088: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1 Source.2089: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.2090: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.2091: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.2092: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.2093: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2094: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.2095: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.2096: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.2097: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.2098: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.2099: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.2100: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2101: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.2102: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.2103: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.2104: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2105: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.2106: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2107: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.2108: DFBPPR10731 ---- Animal proteins ---- Protein cereblon Source.2109: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2110: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.2111: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain Source.2112: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.2113: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.2114: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1 Source.2115: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.2116: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.2117: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11 Source.2118: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.2119: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.2120: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.2121: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.2122: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.2123: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.2124: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2 Source.2125: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12 Source.2126: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.2127: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.2128: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta Source.2129: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.2130: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.2131: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.2132: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.2133: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.2134: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.2135: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.2136: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2137: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.2138: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.2139: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.2140: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.2141: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.2142: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.2143: DFBPPR11043 ---- Animal proteins ---- Centromere protein H Source.2144: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.2145: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.2146: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.2147: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.2148: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.2149: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.2150: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.2151: DFBPPR11133 ---- Animal proteins ---- Transcription factor MafG Source.2152: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2153: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.2154: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2155: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3 Source.2156: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.2157: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3 Source.2158: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1 Source.2159: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.2160: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.2161: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1 Source.2162: DFBPPR11209 ---- Animal proteins ---- Protein S100-A11 Source.2163: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.2164: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.2165: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.2166: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A Source.2167: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B Source.2168: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4 Source.2169: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.2170: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1 Source.2171: DFBPPR11312 ---- Animal proteins ---- Transcription factor MafK Source.2172: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.2173: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.2174: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.2175: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.2176: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase Source.2177: DFBPPR11359 ---- Animal proteins ---- Mesogenin-1 Source.2178: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.2179: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.2180: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.2181: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.2182: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2183: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.2184: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.2185: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.2186: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.2187: DFBPPR11495 ---- Animal proteins ---- Calretinin Source.2188: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.2189: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.2190: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.2191: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.2192: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.2193: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2 Source.2194: DFBPPR11554 ---- Animal proteins ---- Troponin I, cardiac muscle Source.2195: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.2196: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog Source.2197: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2198: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.2199: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein Source.2200: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.2201: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.2202: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.2203: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.2204: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.2205: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2206: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.2207: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.2208: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit Source.2209: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.2210: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.2211: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2212: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.2213: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.2214: DFBPPR11738 ---- Animal proteins ---- Ensconsin Source.2215: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.2216: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.2217: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.2218: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6 Source.2219: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1 Source.2220: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B Source.2221: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.2222: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4 Source.2223: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2 Source.2224: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22 Source.2225: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3 Source.2226: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5 Source.2227: DFBPPR11822 ---- Animal proteins ---- Inversin Source.2228: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog Source.2229: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2230: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.2231: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.2232: DFBPPR11864 ---- Animal proteins ---- Radixin Source.2233: DFBPPR11869 ---- Animal proteins ---- BH3-interacting domain death agonist Source.2234: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.2235: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2 Source.2236: DFBPPR11906 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 1 Source.2237: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna Source.2238: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2239: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.2240: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.2241: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2 Source.2242: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7 Source.2243: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.2244: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.2245: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.2246: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.2247: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.2248: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1 Source.2249: DFBPPR11996 ---- Animal proteins ---- Homeobox protein Hox-A6 Source.2250: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal Source.2251: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.2252: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.2253: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.2254: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.2255: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.2256: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.2257: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.2258: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.2259: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.2260: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.2261: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.2262: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2263: DFBPPR12122 ---- Animal proteins ---- Fibroblast growth factor-binding protein 2 Source.2264: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1 Source.2265: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.2266: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19 Source.2267: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.2268: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.2269: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX Source.2270: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2271: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.2272: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.2273: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2274: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.2275: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2276: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2277: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2278: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2279: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2280: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.2281: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.2282: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.2283: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a Source.2284: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.2285: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.2286: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.2287: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.2288: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.2289: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.2290: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2291: DFBPPR12389 ---- Animal proteins ---- Clusterin Source.2292: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2293: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.2294: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.2295: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2 Source.2296: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.2297: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.2298: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.2299: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2300: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.2301: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.2302: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.2303: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.2304: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2305: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2306: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2307: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.2308: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2309: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.2310: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.2311: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.2312: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.2313: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.2314: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2315: DFBPPR12499 ---- Animal proteins ---- Interleukin-1 alpha Source.2316: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.2317: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.2318: DFBPPR12536 ---- Animal proteins ---- Albumin Source.2319: DFBPPR12538 ---- Animal proteins ---- Troponin T, fast skeletal muscle Source.2320: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2321: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.2322: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.2323: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2324: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2325: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2326: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.2327: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.2328: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.2329: DFBPPR12602 ---- Animal proteins ---- Osteopontin Source.2330: DFBPPR12603 ---- Animal proteins ---- Osteopontin Source.2331: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.2332: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I Source.2333: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2334: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide Source.2335: DFBPPR12636 ---- Animal proteins ---- Complement component C9 Source.2336: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.2337: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.2338: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.2339: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.2340: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.2341: DFBPPR12709 ---- Animal proteins ---- Somatotropin Source.2342: DFBPPR12710 ---- Animal proteins ---- Endoplasmin Source.2343: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.2344: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.2345: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.2346: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2347: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.2348: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.2349: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain Source.2350: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.2351: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein Source.2352: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.2353: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2354: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.2355: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.2356: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.2357: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.2358: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.2359: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D Source.2360: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.2361: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.2362: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.2363: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial Source.2364: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.2365: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.2366: DFBPPR12940 ---- Animal proteins ---- Interleukin-4 Source.2367: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2368: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.2369: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.2370: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2371: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2372: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.2373: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.2374: DFBPPR13030 ---- Animal proteins ---- T-cell surface glycoprotein CD1b Source.2375: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D Source.2376: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1 Source.2377: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.2378: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2379: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.2380: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.2381: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2382: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase Source.2383: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2384: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.2385: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.2386: DFBPPR13195 ---- Animal proteins ---- Albumin Source.2387: DFBPPR13199 ---- Animal proteins ---- Hemoglobin subunit alpha Source.2388: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.2389: DFBPPR13220 ---- Animal proteins ---- Latherin Source.2390: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.2391: DFBPPR13242 ---- Animal proteins ---- E-selectin Source.2392: DFBPPR13245 ---- Animal proteins ---- Somatotropin Source.2393: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2394: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2395: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2396: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2397: DFBPPR13270 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.2398: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.2399: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.2400: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.2401: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha Source.2402: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I Source.2403: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.2404: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.2405: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2406: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle Source.2407: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.2408: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.2409: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.2410: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2411: DFBPPR13389 ---- Animal proteins ---- Phosducin Source.2412: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.2413: DFBPPR13397 ---- Animal proteins ---- Hemoglobin subunit theta-1 Source.2414: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.2415: DFBPPR13445 ---- Animal proteins ---- Interleukin-1 alpha Source.2416: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I Source.2417: DFBPPR13481 ---- Animal proteins ---- Somatotropin Source.2418: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2419: DFBPPR13540 ---- Animal proteins ---- Somatotropin Source.2420: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2421: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.2422: DFBPPR13584 ---- Animal proteins ---- Calpain-3 Source.2423: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.2424: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2425: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta Source.2426: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.2427: DFBPPR13627 ---- Animal proteins ---- Erythropoietin Source.2428: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6 Source.2429: DFBPPR13672 ---- Animal proteins ---- Annexin A2 Source.2430: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I Source.2431: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.2432: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain Source.2433: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2434: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.2435: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.2436: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.2437: DFBPPR13734 ---- Animal proteins ---- Perilipin-5 Source.2438: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase Source.2439: DFBPPR13773 ---- Animal proteins ---- Interleukin-1 alpha Source.2440: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.2441: DFBPPR13788 ---- Animal proteins ---- Albumin Source.2442: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4 Source.2443: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561 Source.2444: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor Source.2445: DFBPPR13896 ---- Animal proteins ---- Somatostatin Source.2446: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.2447: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2448: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2449: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.2450: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.2451: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.2452: DFBPPR13993 ---- Animal proteins ---- Insulin Source.2453: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2454: DFBPPR14002 ---- Animal proteins ---- Cytochrome b Source.2455: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2456: DFBPPR14082 ---- Marine protein ---- Estrogen receptor Source.2457: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1 Source.2458: DFBPPR14100 ---- Marine protein ---- Cytochrome b Source.2459: DFBPPR14102 ---- Marine protein ---- Anamorsin-B Source.2460: DFBPPR14104 ---- Marine protein ---- Anamorsin-A Source.2461: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.2462: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.2463: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog Source.2464: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.2465: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.2466: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1 Source.2467: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.2468: DFBPPR14238 ---- Marine protein ---- Insulin Source.2469: DFBPPR14241 ---- Marine protein ---- Cystatin Source.2470: DFBPPR14242 ---- Marine protein ---- Cytochrome b Source.2471: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3 Source.2472: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain Source.2473: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.2474: DFBPPR14319 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic Source.2475: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein Source.2476: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.2477: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.2478: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.2479: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic Source.2480: DFBPPR14455 ---- Marine protein ---- 30S ribosomal protein S10, chloroplastic Source.2481: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.2482: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.2483: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.2484: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.2485: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.2486: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta Source.2487: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.2488: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.2489: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2490: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros Source.2491: DFBPPR14590 ---- Marine protein ---- Cytochrome b Source.2492: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.2493: DFBPPR14604 ---- Marine protein ---- Anamorsin Source.2494: DFBPPR14608 ---- Marine protein ---- Polysialoglycoprotein Source.2495: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.2496: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18 Source.2497: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.2498: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2 Source.2499: DFBPPR14698 ---- Marine protein ---- Cystatin Source.2500: DFBPPR14751 ---- Marine protein ---- Insulin Source.2501: DFBPPR14783 ---- Marine protein ---- Enolase Source.2502: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.2503: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain Source.2504: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain Source.2505: DFBPPR14818 ---- Marine protein ---- Tropomyosin Source.2506: DFBPPR14828 ---- Marine protein ---- Tropomyosin Source.2507: DFBPPR14861 ---- Marine protein ---- Cytochrome b Source.2508: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2509: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.2510: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.2511: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system Source.2512: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.2513: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.2514: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.2515: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.2516: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.2517: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.2518: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.2519: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.2520: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.2521: DFBPPR14906 ---- Microorganism protein ---- Autophagy-related protein 8 Source.2522: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit Source.2523: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2524: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.2525: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.2526: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1 Source.2527: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase Source.2528: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1 Source.2529: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.2530: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.2531: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.2532: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2533: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit Source.2534: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.2535: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.2536: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.2537: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.2538: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.2539: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.2540: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21 Source.2541: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.2542: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52 Source.2543: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.2544: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.2545: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.2546: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2 Source.2547: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13 Source.2548: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2549: DFBPPR15093 ---- Microorganism protein ---- Inner kinetochore subunit AME1 Source.2550: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase Source.2551: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.2552: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.2553: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.2554: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.2555: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.2556: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase Source.2557: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2558: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase Source.2559: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.2560: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2 Source.2561: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2 Source.2562: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.2563: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.2564: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.2565: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.2566: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.2567: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.2568: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.2569: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.2570: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1 Source.2571: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8 Source.2572: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5 Source.2573: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19 Source.2574: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2 Source.2575: DFBPPR15267 ---- Microorganism protein ---- Cofilin Source.2576: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.2577: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3 Source.2578: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D Source.2579: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.2580: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase Source.2581: DFBPPR15307 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 21 Source.2582: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.2583: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.2584: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase Source.2585: DFBPPR15349 ---- Microorganism protein ---- Mitochondrial fission 1 protein Source.2586: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.2587: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.2588: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.2589: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2590: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.2591: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial Source.2592: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.2593: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.2594: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59 Source.2595: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4 Source.2596: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4 Source.2597: DFBPPR15424 ---- Microorganism protein ---- Diphthamide biosynthesis protein 4 Source.2598: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1 Source.2599: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.2600: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121 Source.2601: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.2602: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.2603: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.2604: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.2605: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32 Source.2606: DFBPPR15510 ---- Microorganism protein ---- Autophagy-related protein 29 Source.2607: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.2608: DFBPPR15518 ---- Microorganism protein ---- Chromatin modification-related protein EAF6 Source.2609: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.2610: DFBPPR15547 ---- Microorganism protein ---- SWR1-complex protein 5 Source.2611: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2612: DFBPPR15561 ---- Microorganism protein ---- Ribosome biogenesis protein SLX9 Source.2613: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1 Source.2614: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.2615: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.2616: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.2617: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.2618: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7 Source.2619: DFBPPR15638 ---- Microorganism protein ---- ATP-dependent kinase YFH7 Source.2620: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1 Source.2621: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25 Source.2622: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.2623: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.2624: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.2625: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial Source.2626: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1 Source.2627: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.2628: DFBPPR15716 ---- Microorganism protein ---- 40S ribosomal protein S22 Source.2629: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.2630: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial Source.2631: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.2632: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.2633: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1 Source.2634: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3 Source.2635: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11 Source.2636: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.2637: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.2638: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD Source.2639: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.2640: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.2641: DFBPPR15831 ---- Microorganism protein ---- Probable transcriptional regulator flp Source.2642: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.2643: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.2644: DFBPPR15867 ---- Microorganism protein ---- Superoxide dismutase [Mn], mitochondrial Source.2645: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.2646: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.2647: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.2648: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.2649: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.2650: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.2651: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.2652: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.2653: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.2654: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.2655: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.2656: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.2657: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.2658: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.2659: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.2660: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.2661: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1 Source.2662: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.2663: DFBPPR7896 ---- Plant protein ---- Photosystem I reaction center subunit IX Source.2664: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.2665: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.2666: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.2667: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.2668: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.2669: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.2670: DFBPPR8017 ---- Plant protein ---- Unknown protein 9 Source.2671: DFBPPR8029 ---- Plant protein ---- Vignain Source.2672: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.2673: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic Source.2674: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.2675: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.2676: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2677: DFBPPR8141 ---- Plant protein ---- Photosystem I reaction center subunit IX Source.2678: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2 Source.2679: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.2680: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.2681: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2682: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.2683: DFBPPR8326 ---- Plant protein ---- Photosystem I reaction center subunit IX
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide DAL showed low antioxidant activity with a relative antioxidant activity of 0.01 ± 0.01 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015