E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPANOX0910(Antioxidative peptide)
DFBP ID DFBPANOX0910
Peptide sequence VLV
Type Native peptide
Peptide/Function name Antioxidative peptide
Function-activity relationship
Main bioactivity Antioxidative activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Val-Leu-Val
Single-letter amino acid VLV
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 329.44 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 4.0667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine whey protein
Precursor protein β-Lactoglobulin
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.2: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.4: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.5: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.7: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.8: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.9: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.10: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.11: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.12: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.13: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.14: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.15: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.16: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.17: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.18: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.19: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.20: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.21: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.22: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.23: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.24: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.25: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.26: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.27: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.28: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.29: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.30: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.31: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.32: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.33: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.34: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.35: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.36: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.37: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.38: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.39: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.40: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.41: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.42: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.43: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.44: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.45: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.46: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.47: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.48: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.49: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.50: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.51: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.52: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.53: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.54: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.55: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.56: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.57: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.58: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.59: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.60: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.61: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.62: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic
Source.63: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.64: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.65: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.66: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.67: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.68: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.69: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.70: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.71: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.72: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.73: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.74: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.75: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.76: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.77: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.78: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.79: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.80: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.81: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.82: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.83: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.84: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.85: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.86: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.87: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.88: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.89: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.90: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.91: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.92: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.93: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.94: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.95: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.96: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.97: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.98: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.99: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.100: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.101: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.102: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.103: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.104: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.105: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.106: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.107: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.108: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.109: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.110: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.111: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.112: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.113: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.114: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.115: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7
Source.116: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.117: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.118: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.119: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.120: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.121: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.122: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.123: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.124: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.125: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.126: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.127: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.128: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.129: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.130: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4
Source.131: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.132: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.133: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.134: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.135: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.136: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.137: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.138: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.139: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.140: DFBPPR1580 ---- Plant proteins ---- Expansin-A4
Source.141: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.142: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.143: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.144: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.145: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.146: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.147: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.148: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.149: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.150: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.151: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.152: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2
Source.153: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.154: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.155: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.156: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.157: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.158: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.159: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.160: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.161: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.162: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.163: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.164: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.165: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.166: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.167: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.168: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.169: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.170: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.171: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.172: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.173: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.174: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.175: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.176: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.177: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.178: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.179: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.180: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.181: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.182: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.183: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.184: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.185: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.186: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.187: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.188: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.189: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.190: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.191: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.192: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.193: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.194: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.195: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.196: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.197: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.198: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.199: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.200: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.201: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.202: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.203: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.204: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.205: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.206: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.207: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.208: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.209: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.210: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.211: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.212: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.213: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.214: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.215: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.216: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.217: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic
Source.218: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.219: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.220: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.221: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.222: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.223: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.224: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.225: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.226: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.227: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.228: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.229: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.230: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.231: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.232: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.233: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.234: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.235: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.236: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.237: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.238: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.239: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.240: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.241: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.242: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.243: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.244: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.245: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.246: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.247: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.248: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.249: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.250: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.251: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.252: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.253: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.254: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.255: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.256: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.257: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.258: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.259: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.260: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.261: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.262: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.263: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.264: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.265: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.266: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.267: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.268: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.269: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.270: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.271: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.272: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.273: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.274: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.275: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.276: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.277: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.278: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.279: DFBPPR2176 ---- Plant proteins ---- Expansin-B11
Source.280: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.281: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.282: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.283: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.284: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.285: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.286: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21
Source.287: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.288: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.289: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.290: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.291: DFBPPR2230 ---- Plant proteins ---- Proteasome subunit alpha type-2
Source.292: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic
Source.293: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.294: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.295: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.296: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.297: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.298: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.299: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.300: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.301: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.302: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.303: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.304: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.305: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.306: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa
Source.307: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1
Source.308: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.309: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.310: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.311: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.312: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.313: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.314: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic
Source.315: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.316: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.317: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.318: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.319: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.320: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.321: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.322: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.323: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.324: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.325: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.326: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.327: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.328: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.329: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.330: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.331: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.332: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.333: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2
Source.334: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.335: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.336: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.337: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.338: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.339: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.340: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.341: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1
Source.342: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.343: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.344: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.345: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.346: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.347: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.348: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.349: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3
Source.350: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.351: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3
Source.352: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.353: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.354: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.355: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.356: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.357: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7
Source.358: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.359: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.360: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.361: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10
Source.362: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.363: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.364: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.365: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.366: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.367: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.368: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.369: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.370: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.371: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.372: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.373: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.374: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.375: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.376: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.377: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.378: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.379: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.380: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.381: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3
Source.382: DFBPPR2624 ---- Plant proteins ---- Transcription initiation factor IIA subunit 2
Source.383: DFBPPR2625 ---- Plant proteins ---- 18.6 kDa class III heat shock protein
Source.384: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.385: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.386: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.387: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.388: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.389: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.390: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.391: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.392: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1
Source.393: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.394: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.395: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.396: DFBPPR2699 ---- Plant proteins ---- Expansin-A8
Source.397: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.398: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.399: DFBPPR2721 ---- Plant proteins ---- Expansin-A18
Source.400: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.401: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.402: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.403: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.404: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.405: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.406: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.407: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.408: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.409: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.410: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.411: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.412: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.413: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.414: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.415: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.416: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS
Source.417: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.418: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.419: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.420: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.421: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.422: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.423: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9
Source.424: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8
Source.425: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.426: DFBPPR2836 ---- Plant proteins ---- Two-component response regulator ORR12
Source.427: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.428: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.429: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.430: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.431: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6
Source.432: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B
Source.433: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.434: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.435: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.436: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.437: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.438: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.439: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.440: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.441: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.442: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.443: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.444: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.445: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.446: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6
Source.447: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.448: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.449: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.450: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.451: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.452: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.453: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.454: DFBPPR2925 ---- Plant proteins ---- Two-component response regulator ORR13
Source.455: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4
Source.456: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.457: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.458: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.459: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.460: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.461: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.462: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.463: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.464: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.465: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.466: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.467: DFBPPR2970 ---- Plant proteins ---- Germin-like protein 1-2
Source.468: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.469: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.470: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.471: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.472: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.473: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.474: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.475: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.476: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.477: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.478: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b
Source.479: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.480: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.481: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.482: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.483: DFBPPR3075 ---- Plant proteins ---- Thiamine pyrophosphokinase 2
Source.484: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.485: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.486: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.487: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.488: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.489: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.490: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.491: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.492: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.493: DFBPPR3124 ---- Plant proteins ---- Two-component response regulator ORR8
Source.494: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.495: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.496: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.497: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.498: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.499: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.500: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13
Source.501: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.502: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.503: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic
Source.504: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.505: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.506: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.507: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.508: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.509: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.510: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.511: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.512: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.513: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.514: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.515: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.516: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.517: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.518: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.519: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.520: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.521: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.522: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.523: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.524: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.525: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.526: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP
Source.527: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.528: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.529: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.530: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.531: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.532: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.533: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.534: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.535: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.536: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.537: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.538: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.539: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.540: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.541: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.542: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.543: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.544: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.545: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.546: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.547: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.548: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.549: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.550: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.551: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.552: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.553: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.554: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.555: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.556: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.557: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.558: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.559: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.560: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.561: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.562: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.563: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.564: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.565: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.566: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.567: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.568: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.569: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.570: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.571: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.572: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.573: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.574: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2
Source.575: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.576: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.577: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.578: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.579: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.580: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.581: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.582: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.583: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e
Source.584: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.585: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.586: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.587: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.588: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.589: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.590: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.591: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.592: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.593: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.594: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.595: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.596: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.597: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.598: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.599: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.600: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.601: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.602: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.603: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.604: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.605: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.606: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.607: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.608: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.609: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.610: DFBPPR3701 ---- Plant proteins ---- Non-specific lipid-transfer protein C4
Source.611: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.612: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.613: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.614: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.615: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.616: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.617: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.618: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.619: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.620: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.621: DFBPPR3763 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.622: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.623: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4
Source.624: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.625: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial
Source.626: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.627: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.628: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.629: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.630: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.631: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.632: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.633: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54
Source.634: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.635: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.636: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.637: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.638: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.639: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.640: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.641: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.642: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.643: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.644: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.645: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.646: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.647: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.648: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g
Source.649: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.650: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.651: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.652: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.653: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.654: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.655: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.656: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.657: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.658: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.659: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.660: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.661: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.662: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.663: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.664: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.665: DFBPPR4004 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.666: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.667: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.668: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.669: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.670: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.671: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.672: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A
Source.673: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.674: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.675: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.676: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.677: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.678: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.679: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.680: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.681: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.682: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.683: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.684: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.685: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.686: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4
Source.687: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.688: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.689: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.690: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.691: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.692: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.693: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.694: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.695: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.696: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.697: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.698: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.699: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.700: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.701: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial
Source.702: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.703: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.704: DFBPPR4207 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4B
Source.705: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.706: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.707: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.708: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.709: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.710: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.711: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.712: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.713: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.714: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.715: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.716: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.717: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.718: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.719: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.720: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.721: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.722: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.723: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.724: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.725: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.726: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.727: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.728: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic
Source.729: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.730: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.731: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.732: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.733: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.734: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.735: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1
Source.736: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.737: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.738: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.739: DFBPPR4405 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4A
Source.740: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.741: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.742: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.743: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.744: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.745: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.746: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2
Source.747: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.748: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.749: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.750: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.751: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.752: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.753: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.754: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.755: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.756: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.757: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.758: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.759: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.760: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.761: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.762: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.763: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.764: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.765: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.766: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.767: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.768: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.769: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.770: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.771: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.772: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.773: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.774: DFBPPR4605 ---- Plant proteins ---- Protein LOL4
Source.775: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.776: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.777: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.778: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.779: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.780: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.781: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.782: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.783: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.784: DFBPPR4721 ---- Plant proteins ---- Protein YY1
Source.785: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4
Source.786: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.787: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.788: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.789: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.790: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4
Source.791: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.792: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.793: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2
Source.794: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100
Source.795: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34
Source.796: DFBPPR4809 ---- Plant proteins ---- B3 domain-containing protein Os03g0164300
Source.797: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8
Source.798: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.799: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.800: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.801: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.802: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.803: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.804: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.805: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.806: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.807: DFBPPR4880 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 29
Source.808: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.809: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.810: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.811: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A
Source.812: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.813: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.814: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.815: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.816: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.817: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.818: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.819: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.820: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.821: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.822: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.823: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.824: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.825: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.826: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.827: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.828: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.829: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.830: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.831: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.832: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.833: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.834: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.835: DFBPPR5111 ---- Plant proteins ---- Lectin
Source.836: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.837: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A
Source.838: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.839: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.840: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.841: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.842: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.843: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.844: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.845: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.846: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.847: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.848: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.849: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.850: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.851: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.852: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.853: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.854: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.855: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.856: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.857: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.858: DFBPPR5222 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.859: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.860: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.861: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.862: DFBPPR5233 ---- Plant proteins ---- Ras-related protein Rab7
Source.863: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.864: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.865: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.866: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2
Source.867: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.868: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.869: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.870: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.871: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.872: DFBPPR5276 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.873: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.874: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.875: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.876: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.877: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.878: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.879: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.880: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.881: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.882: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.883: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.884: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.885: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.886: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.887: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.888: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.889: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.890: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.891: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.892: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.893: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.894: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.895: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.896: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.897: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.898: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.899: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66
Source.900: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.901: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.902: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.903: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.904: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.905: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.906: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.907: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II
Source.908: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.909: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.910: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.911: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.912: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.913: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.914: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.915: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.916: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.917: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.918: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.919: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.920: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.921: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.922: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.923: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.924: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.925: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.926: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.927: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.928: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.929: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.930: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.931: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.932: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.933: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.934: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.935: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.936: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.937: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.938: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.939: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.940: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.941: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.942: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.943: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.944: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.945: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.946: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.947: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.948: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.949: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.950: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.951: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.952: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.953: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.954: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog
Source.955: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.956: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.957: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.958: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.959: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic
Source.960: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.961: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.962: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.963: DFBPPR5865 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.964: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.965: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.966: DFBPPR5884 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.967: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.968: DFBPPR5896 ---- Plant proteins ---- 50 kDa gamma-zein
Source.969: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.970: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.971: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.972: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.973: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.974: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.975: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.976: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.977: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.978: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.979: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.980: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.981: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.982: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.983: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.984: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.985: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.986: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.987: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.988: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.989: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.990: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.991: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.992: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.993: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.994: DFBPPR6025 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.995: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.996: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4
Source.997: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1
Source.998: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.999: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.1000: DFBPPR6077 ---- Plant proteins ---- Pollen-specific protein C13
Source.1001: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.1002: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.1003: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1004: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.1005: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.1006: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.1007: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.1008: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1009: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1010: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1011: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.1012: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1013: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1014: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.1015: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1016: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.1017: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1018: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.1019: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.1020: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.1021: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1022: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1023: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1024: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.1025: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.1026: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.1027: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1028: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.1029: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1030: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.1031: DFBPPR6410 ---- Plant proteins ---- Vicilin, 14 kDa component
Source.1032: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1033: DFBPPR6439 ---- Plant proteins ---- 20 kDa chaperonin, chloroplastic
Source.1034: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.1035: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.1036: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.1037: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.1038: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.1039: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.1040: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.1041: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.1042: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.1043: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1044: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1045: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.1046: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.1047: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.1048: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1049: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1050: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.1051: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.1052: DFBPPR6613 ---- Plant proteins ---- Ras-related protein Rab7
Source.1053: DFBPPR6619 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1054: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.1055: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1056: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.1057: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.1058: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.1059: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.1060: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1061: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1062: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.1063: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1064: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.1065: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1066: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1
Source.1067: DFBPPR6712 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM16
Source.1068: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.1069: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.1070: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.1071: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.1072: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1
Source.1073: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.1074: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.1075: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1076: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1077: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.1078: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1079: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1080: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.1081: DFBPPR6832 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.1082: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.1083: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1084: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1085: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1086: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1087: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A
Source.1088: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1089: DFBPPR6869 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.1090: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1091: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1092: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.1093: DFBPPR6931 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP
Source.1094: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1095: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.1096: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.1097: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.1098: DFBPPR7031 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMb
Source.1099: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.1100: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa
Source.1101: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1102: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1103: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.1104: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.1105: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.1106: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.1107: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.1108: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.1109: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1110: DFBPPR7132 ---- Plant proteins ---- Beta-galactosidase
Source.1111: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.1112: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1113: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1114: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1115: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.1116: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.1117: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1118: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1119: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.1120: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.1121: DFBPPR7200 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.1
Source.1122: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.1123: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.1124: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1125: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.1126: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1127: DFBPPR7227 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.2
Source.1128: DFBPPR7232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.1129: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1130: DFBPPR7253 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1131: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.1132: DFBPPR7261 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.3
Source.1133: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6
Source.1134: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.1135: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.1136: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C
Source.1137: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.1138: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1139: DFBPPR7299 ---- Plant proteins ---- Low temperature-induced protein lt101.1
Source.1140: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1
Source.1141: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.1142: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2
Source.1143: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.1144: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.1145: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.1146: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1147: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.1148: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1149: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1150: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.1151: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1152: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.1153: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1154: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.1155: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.1156: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.1157: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase
Source.1158: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.1159: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.1160: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1161: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1162: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2
Source.1163: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.1164: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1165: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.1166: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.1167: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain
Source.1168: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1169: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.1170: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1171: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.1172: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1173: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.1174: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.1175: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.1176: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.1177: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.1178: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.1179: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.1180: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.1181: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.1182: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.1183: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1
Source.1184: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin
Source.1185: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101
Source.1186: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102
Source.1187: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.1188: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103
Source.1189: DFBPPR8398 ---- Plant proteins ---- Conglutin
Source.1190: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101
Source.1191: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102
Source.1192: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.1193: DFBPPR8424 ---- Plant proteins ---- Oleosin H1
Source.1194: DFBPPR8425 ---- Plant proteins ---- Oleosin L
Source.1195: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1196: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.1197: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1198: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.1199: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.1200: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.1201: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6
Source.1202: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5
Source.1203: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1204: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.1205: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.1206: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.1207: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.1208: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.1209: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.1210: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1211: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1212: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.1213: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.1214: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.1215: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.1216: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1217: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.1218: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1219: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.1220: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1221: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.1222: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1223: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1224: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1225: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1226: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.1227: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1228: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1229: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1230: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1231: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1232: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.1233: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1234: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1235: DFBPPR16032 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.1236: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1237: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1238: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1239: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.1240: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1241: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.1242: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1243: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1244: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.1245: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.1246: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.1247: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1248: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1249: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1250: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.1251: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.1252: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.1253: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1254: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.1255: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.1256: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1257: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.1258: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1259: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.1260: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.1261: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1262: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.1263: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta
Source.1264: DFBPPR16159 ---- Animal proteins ---- Apolipoprotein C-I
Source.1265: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1266: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1267: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.1268: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.1269: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.1270: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.1271: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1272: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone
Source.1273: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.1274: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.1275: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.1276: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1277: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1278: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1279: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1280: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1281: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.1282: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.1283: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.1284: DFBPPR16244 ---- Animal proteins ---- Interleukin-2
Source.1285: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1286: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.1287: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.1288: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.1289: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1290: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.1291: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1292: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta
Source.1293: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.1294: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1295: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.1296: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1297: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1298: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.1299: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.1300: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1301: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.1302: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.1303: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.1304: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.1305: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1306: DFBPPR16378 ---- Animal proteins ---- Arginine esterase
Source.1307: DFBPPR16429 ---- Animal proteins ---- C-C motif chemokine 4
Source.1308: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.1309: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.1310: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.1311: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1312: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.1313: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.1314: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.1315: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.1316: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1317: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.1318: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.1319: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.1320: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1321: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1322: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.1323: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.1324: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1325: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.1326: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1327: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.1328: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.1329: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1330: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1331: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1332: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3
Source.1333: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.1334: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1335: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.1336: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.1337: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.1338: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c
Source.1339: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1340: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.1341: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.1342: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.1343: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.1344: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.1345: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.1346: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1347: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6
Source.1348: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1349: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1350: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27
Source.1351: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1352: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.1353: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3
Source.1354: DFBPPR16691 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.1355: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.1356: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.1357: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.1358: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.1359: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1360: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1
Source.1361: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.1362: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.1363: DFBPPR16753 ---- Animal proteins ---- Nicolin-1
Source.1364: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.1365: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.1366: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.1367: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.1368: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.1369: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.1370: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.1371: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta
Source.1372: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.1373: DFBPPR16826 ---- Animal proteins ---- Phospholipase A2
Source.1374: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.1375: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1376: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1377: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.1378: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.1379: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.1380: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.1381: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.1382: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.1383: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.1384: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.1385: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.1386: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.1387: DFBPPR16897 ---- Animal proteins ---- Interleukin-4
Source.1388: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.1389: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.1390: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.1391: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.1392: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1393: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.1394: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1395: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.1396: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.1397: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.1398: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.1399: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.1400: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.1401: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.1402: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1403: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.1404: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.1405: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.1406: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.1407: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1408: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.1409: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1410: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.1411: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1412: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.1413: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1414: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1415: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.1416: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1417: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1418: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1419: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1420: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.1421: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.1422: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.1423: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1424: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1425: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.1426: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.1427: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.1428: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.1429: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.1430: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.1431: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.1432: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.1433: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.1434: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.1435: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.1436: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1437: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1438: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.1439: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.1440: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.1441: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.1442: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.1443: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1444: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1445: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.1446: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1447: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.1448: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1
Source.1449: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1450: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.1451: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.1452: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.1453: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1454: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1455: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1456: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1457: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.1458: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.1459: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1460: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1461: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.1462: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1463: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.1464: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1465: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1466: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.1467: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1468: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.1469: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2
Source.1470: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.1471: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.1472: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.1473: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.1474: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1475: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.1476: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1477: DFBPPR17423 ---- Animal proteins ---- Furin
Source.1478: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1479: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.1480: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.1481: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1482: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.1483: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1484: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1485: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.1486: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1487: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.1488: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.1489: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.1490: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.1491: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1492: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.1493: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1494: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.1495: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.1496: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1497: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.1498: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.1499: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.1500: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.1501: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.1502: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1503: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1504: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.1505: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7
Source.1506: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.1507: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.1508: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.1509: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.1510: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.1511: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1512: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.1513: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.1514: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.1515: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3
Source.1516: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.1517: DFBPPR17734 ---- Animal proteins ---- Protein S100-A12
Source.1518: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6
Source.1519: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1520: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1521: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.1522: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1
Source.1523: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.1524: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.1525: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.1526: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.1527: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1528: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.1529: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.1530: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1531: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.1532: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.1533: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.1534: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1535: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.1536: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.1537: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1538: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.1539: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.1540: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1541: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.1542: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.1543: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1544: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1545: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1546: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.1547: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1548: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.1549: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1550: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.1551: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein
Source.1552: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.1553: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.1554: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.1555: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.1556: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.1557: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1558: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1559: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.1560: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.1561: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.1562: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.1563: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1
Source.1564: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.1565: DFBPPR17970 ---- Animal proteins ---- Profilin-2
Source.1566: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1567: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.1568: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.1569: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1570: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1571: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.1572: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.1573: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B
Source.1574: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.1575: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1576: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.1577: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.1578: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.1579: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1580: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.1581: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1582: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.1583: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1584: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1
Source.1585: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.1586: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1587: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.1588: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.1589: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1590: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.1591: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4
Source.1592: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.1593: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.1594: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.1595: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1596: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.1597: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.1598: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1599: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1600: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1601: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.1602: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1603: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.1604: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.1605: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.1606: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.1607: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.1608: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.1609: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.1610: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.1611: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.1612: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.1613: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.1614: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.1615: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1616: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.1617: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1618: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.1619: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.1620: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1621: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.1622: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.1623: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1624: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein
Source.1625: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.1626: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.1627: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.1628: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.1629: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.1630: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1631: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.1632: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.1633: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha
Source.1634: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.1635: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.1636: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.1637: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.1638: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.1639: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.1640: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1641: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.1642: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1643: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1644: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1645: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1646: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.1647: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.1648: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1649: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.1650: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.1651: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.1652: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.1653: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.1654: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.1655: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.1656: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.1657: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.1658: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.1659: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.1660: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.1661: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.1662: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.1663: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1664: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1665: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1666: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.1667: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.1668: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.1669: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.1670: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.1671: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.1672: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.1673: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.1674: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.1675: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.1676: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog
Source.1677: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.1678: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.1679: DFBPPR18711 ---- Animal proteins ---- Protein S100-G
Source.1680: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.1681: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.1682: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.1683: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.1684: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.1685: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.1686: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.1687: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.1688: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.1689: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.1690: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.1691: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone
Source.1692: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.1693: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU
Source.1694: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.1695: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.1696: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.1697: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.1698: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.1699: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1700: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1701: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.1702: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1703: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.1704: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1705: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.1706: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1707: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.1708: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.1709: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.1710: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1711: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.1712: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.1713: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.1714: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1715: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1716: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1717: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.1718: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.1719: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.1720: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial
Source.1721: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1
Source.1722: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1723: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.1724: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1725: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.1726: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1727: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1728: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor
Source.1729: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.1730: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1731: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.1732: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.1733: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.1734: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.1735: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.1736: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.1737: DFBPPR19034 ---- Animal proteins ---- Sialomucin core protein 24
Source.1738: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.1739: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1740: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.1741: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.1742: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.1743: DFBPPR19071 ---- Animal proteins ---- Collectrin
Source.1744: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.1745: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.1746: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.1747: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.1748: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.1749: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1750: DFBPPR19108 ---- Animal proteins ---- Hepatocyte cell adhesion molecule
Source.1751: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.1752: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.1753: DFBPPR19131 ---- Animal proteins ---- Nectin-4
Source.1754: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.1755: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.1756: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1757: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.1758: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.1759: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.1760: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1761: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.1762: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.1763: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.1764: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.1765: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.1766: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.1767: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.1768: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.1769: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.1770: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.1771: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.1772: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.1773: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.1774: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.1775: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1776: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.1777: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.1778: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.1779: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.1780: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.1781: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.1782: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.1783: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3
Source.1784: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.1785: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6
Source.1786: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.1787: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.1788: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.1789: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.1790: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.1791: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9
Source.1792: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.1793: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.1794: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.1795: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.1796: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.1797: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.1798: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.1799: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22
Source.1800: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.1801: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.1802: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1803: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1
Source.1804: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.1805: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.1806: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.1807: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1808: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1809: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1
Source.1810: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1811: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.1812: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.1813: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.1814: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1815: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.1816: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase
Source.1817: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.1818: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase
Source.1819: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1820: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.1821: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.1822: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.1823: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.1824: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.1825: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.1826: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1827: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.1828: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.1829: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.1830: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.1831: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.1832: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2
Source.1833: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.1834: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.1835: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.1836: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.1837: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.1838: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.1839: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.1840: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.1841: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.1842: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.1843: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.1844: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.1845: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.1846: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH
Source.1847: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.1848: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.1849: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.1850: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.1851: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.1852: DFBPPR19846 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8B
Source.1853: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.1854: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1855: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.1856: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.1857: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.1858: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.1859: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.1860: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.1861: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.1862: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.1863: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.1864: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.1865: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.1866: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1867: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1
Source.1868: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.1869: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.1870: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1871: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.1872: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.1873: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B
Source.1874: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.1875: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.1876: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.1877: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.1878: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1879: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.1880: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.1881: DFBPPR19992 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm3
Source.1882: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.1883: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.1884: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.1885: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.1886: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.1887: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.1888: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1889: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B
Source.1890: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.1891: DFBPPR20051 ---- Animal proteins ---- 28S ribosomal protein S18a, mitochondrial
Source.1892: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.1893: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.1894: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1895: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.1896: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1
Source.1897: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.1898: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1899: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.1900: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.1901: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.1902: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1903: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.1904: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.1905: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.1906: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A
Source.1907: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.1908: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.1909: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98
Source.1910: DFBPPR20188 ---- Animal proteins ---- Protein S100-A16
Source.1911: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.1912: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.1913: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.1914: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1915: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1916: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30
Source.1917: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.1918: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53
Source.1919: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor
Source.1920: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.1921: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.1922: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.1923: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV
Source.1924: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.1925: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.1926: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.1927: DFBPPR20325 ---- Animal proteins ---- 28S ribosomal protein S12, mitochondrial
Source.1928: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.1929: DFBPPR20328 ---- Animal proteins ---- 40S ribosomal protein S23
Source.1930: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1931: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.1932: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.1933: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1934: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.1935: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.1936: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.1937: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.1938: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.1939: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.1940: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.1941: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial
Source.1942: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.1943: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.1944: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.1945: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.1946: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.1947: DFBPPR20440 ---- Animal proteins ---- 28S ribosomal protein S25, mitochondrial
Source.1948: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.1949: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.1950: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.1951: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.1952: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.1953: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.1954: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.1955: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.1956: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.1957: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.1958: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D
Source.1959: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.1960: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.1961: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.1962: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.1963: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.1964: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1965: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1966: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.1967: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.1968: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.1969: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.1970: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45
Source.1971: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.1972: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.1973: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1974: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.1975: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.1976: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.1977: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.1978: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.1979: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.1980: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B
Source.1981: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.1982: DFBPPR20766 ---- Animal proteins ---- Torsin-2A
Source.1983: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6
Source.1984: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.1985: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.1986: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.1987: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1988: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1989: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1990: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.1991: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6
Source.1992: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1993: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.1994: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.1995: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.1996: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.1997: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B
Source.1998: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.1999: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.2000: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.2001: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.2002: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.2003: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2
Source.2004: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2005: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2006: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2007: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.2008: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.2009: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1
Source.2010: DFBPPR20950 ---- Animal proteins ---- WAP four-disulfide core domain protein 18
Source.2011: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2012: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2013: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27
Source.2014: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.2015: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2
Source.2016: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.2017: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.2018: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.2019: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.2020: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2021: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.2022: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.2023: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.2024: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.2025: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.2026: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.2027: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.2028: DFBPPR21081 ---- Animal proteins ---- Uteroglobin
Source.2029: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.2030: DFBPPR21087 ---- Animal proteins ---- Claudin-11
Source.2031: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.2032: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.2033: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.2034: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.2035: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.2036: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.2037: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.2038: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.2039: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.2040: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3
Source.2041: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2042: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.2043: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.2044: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.2045: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.2046: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.2047: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.2048: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.2049: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.2050: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.2051: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.2052: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3
Source.2053: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2054: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.2055: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.2056: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.2057: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.2058: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.2059: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog
Source.2060: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.2061: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.2062: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.2063: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.2064: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.2065: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.2066: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2
Source.2067: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.2068: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.2069: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma
Source.2070: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.2071: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.2072: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.2073: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.2074: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.2075: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial
Source.2076: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2
Source.2077: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.2078: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.2079: DFBPPR21424 ---- Animal proteins ---- Chromosome transmission fidelity protein 8 homolog
Source.2080: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.2081: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.2082: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.2083: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.2084: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.2085: DFBPPR21455 ---- Animal proteins ---- Apolipoprotein C-IV
Source.2086: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2
Source.2087: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2088: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.2089: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.2090: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.2091: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.2092: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.2093: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor
Source.2094: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.2095: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.2096: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma
Source.2097: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2098: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.2099: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10
Source.2100: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.2101: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2
Source.2102: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.2103: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial
Source.2104: DFBPPR21649 ---- Animal proteins ---- NTF2-related export protein 1
Source.2105: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.2106: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.2107: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.2108: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.2109: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.2110: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.2111: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.2112: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.2113: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.2114: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.2115: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.2116: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.2117: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1
Source.2118: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.2119: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6
Source.2120: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.2121: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.2122: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.2123: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2124: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.2125: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.2126: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.2127: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.2128: DFBPPR21866 ---- Animal proteins ---- c-Myc-binding protein
Source.2129: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.2130: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.2131: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.2132: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1
Source.2133: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.2134: DFBPPR21920 ---- Animal proteins ---- Protein DPCD
Source.2135: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.2136: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.2137: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.2138: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.2139: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.2140: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.2141: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2142: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.2143: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.2144: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.2145: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81
Source.2146: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.2147: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.2148: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.2149: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.2150: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.2151: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.2152: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.2153: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2154: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B
Source.2155: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.2156: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.2157: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.2158: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2159: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.2160: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.2161: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.2162: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.2163: DFBPPR22099 ---- Animal proteins ---- Beta-centractin
Source.2164: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.2165: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.2166: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.2167: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.2168: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.2169: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.2170: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.2171: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.2172: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.2173: DFBPPR22170 ---- Animal proteins ---- Transmembrane protein 106C
Source.2174: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.2175: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.2176: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.2177: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.2178: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.2179: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.2180: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.2181: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.2182: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.2183: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.2184: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog
Source.2185: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.2186: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.2187: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a
Source.2188: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.2189: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.2190: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.2191: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.2192: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.2193: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.2194: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.2195: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.2196: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86
Source.2197: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.2198: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.2199: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.2200: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog
Source.2201: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.2202: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.2203: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.2204: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.2205: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein
Source.2206: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.2207: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.2208: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.2209: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.2210: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.2211: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234
Source.2212: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.2213: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.2214: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.2215: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein
Source.2216: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5
Source.2217: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.2218: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.2219: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.2220: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125
Source.2221: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253
Source.2222: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.2223: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.2224: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.2225: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.2226: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.2227: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.2228: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.2229: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.2230: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2231: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.2232: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.2233: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.2234: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.2235: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.2236: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.2237: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.2238: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.2239: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.2240: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.2241: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.2242: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.2243: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.2244: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.2245: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.2246: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.2247: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.2248: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2249: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.2250: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.2251: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2252: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.2253: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.2254: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.2255: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.2256: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2257: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.2258: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.2259: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.2260: DFBPPR8683 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.2261: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.2262: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.2263: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.2264: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.2265: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.2266: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.2267: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2268: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A
Source.2269: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.2270: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.2271: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.2272: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.2273: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2274: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.2275: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2276: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.2277: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.2278: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2279: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2280: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone
Source.2281: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.2282: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.2283: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.2284: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2285: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2
Source.2286: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2287: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.2288: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.2289: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.2290: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein
Source.2291: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2292: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.2293: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.2294: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.2295: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.2296: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.2297: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2298: DFBPPR8907 ---- Animal proteins ---- Protein S100-A12
Source.2299: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2300: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.2301: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.2302: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.2303: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.2304: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.2305: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.2306: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.2307: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2308: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2309: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.2310: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.2311: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.2312: DFBPPR9065 ---- Animal proteins ---- GTPase NRas
Source.2313: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.2314: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.2315: DFBPPR9089 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.2316: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.2317: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32
Source.2318: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2319: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2320: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.2321: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.2322: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6
Source.2323: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.2324: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2325: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2326: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2327: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.2328: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.2329: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.2330: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.2331: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.2332: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2333: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.2334: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2335: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2336: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.2337: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2338: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.2339: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.2340: DFBPPR9210 ---- Animal proteins ---- 40S ribosomal protein S23
Source.2341: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.2342: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.2343: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.2344: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.2345: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.2346: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.2347: DFBPPR9273 ---- Animal proteins ---- C-C motif chemokine 4
Source.2348: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2349: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.2350: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2351: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27
Source.2352: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.2353: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.2354: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.2355: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.2356: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.2357: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2358: DFBPPR9315 ---- Animal proteins ---- Protein S100-G
Source.2359: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.2360: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.2361: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.2362: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2363: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.2364: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.2365: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2366: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.2367: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.2368: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.2369: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.2370: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.2371: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2372: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.2373: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2374: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2375: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.2376: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.2377: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.2378: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.2379: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.2380: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.2381: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.2382: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.2383: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2384: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.2385: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.2386: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E
Source.2387: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.2388: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.2389: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.2390: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.2391: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.2392: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2393: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin
Source.2394: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.2395: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.2396: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2397: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.2398: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.2399: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.2400: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2401: DFBPPR9705 ---- Animal proteins ---- Elafin
Source.2402: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.2403: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2404: DFBPPR9740 ---- Animal proteins ---- Neprilysin
Source.2405: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.2406: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.2407: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.2408: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.2409: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3
Source.2410: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A
Source.2411: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.2412: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.2413: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.2414: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2
Source.2415: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.2416: DFBPPR9792 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.2417: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.2418: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.2419: DFBPPR9811 ---- Animal proteins ---- Protein WAP-3
Source.2420: DFBPPR9822 ---- Animal proteins ---- Selenoprotein W
Source.2421: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.2422: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2423: DFBPPR9847 ---- Animal proteins ---- Liver-expressed antimicrobial peptide 2
Source.2424: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.2425: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2426: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.2427: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2428: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.2429: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2430: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.2431: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.2432: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.2433: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.2434: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2435: DFBPPR9968 ---- Animal proteins ---- Beta-2-microglobulin
Source.2436: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.2437: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.2438: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.2439: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.2440: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.2441: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.2442: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6
Source.2443: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2444: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I
Source.2445: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.2446: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.2447: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.2448: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.2449: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.2450: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.2451: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.2452: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2453: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.2454: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.2455: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.2456: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.2457: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.2458: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.2459: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.2460: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.2461: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.2462: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.2463: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.2464: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.2465: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.2466: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2467: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.2468: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.2469: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.2470: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.2471: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.2472: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.2473: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.2474: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.2475: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.2476: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2477: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.2478: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.2479: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.2480: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.2481: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.2482: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.2483: DFBPPR10226 ---- Animal proteins ---- GTPase HRas
Source.2484: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.2485: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.2486: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.2487: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.2488: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.2489: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.2490: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.2491: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.2492: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein
Source.2493: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.2494: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.2495: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.2496: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.2497: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.2498: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.2499: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2500: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.2501: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.2502: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.2503: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.2504: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.2505: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.2506: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.2507: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.2508: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.2509: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.2510: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.2511: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.2512: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.2513: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.2514: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.2515: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.2516: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.2517: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.2518: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.2519: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.2520: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.2521: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.2522: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.2523: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.2524: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.2525: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.2526: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.2527: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.2528: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.2529: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.2530: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.2531: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.2532: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.2533: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.2534: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2
Source.2535: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.2536: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.2537: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.2538: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2539: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.2540: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.2541: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1
Source.2542: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.2543: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.2544: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.2545: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6
Source.2546: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.2547: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1
Source.2548: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.2549: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2550: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.2551: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.2552: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.2553: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.2554: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6
Source.2555: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.2556: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b
Source.2557: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.2558: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.2559: DFBPPR10634 ---- Animal proteins ---- Procathepsin L
Source.2560: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.2561: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2562: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.2563: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2564: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.2565: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.2566: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.2567: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.2568: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2569: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.2570: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.2571: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.2572: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2573: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.2574: DFBPPR10755 ---- Animal proteins ---- Draxin
Source.2575: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.2576: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.2577: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2
Source.2578: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.2579: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.2580: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.2581: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.2582: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.2583: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.2584: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.2585: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2586: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.2587: DFBPPR10837 ---- Animal proteins ---- GTPase NRas
Source.2588: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2589: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.2590: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.2591: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.2592: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152
Source.2593: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.2594: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.2595: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.2596: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.2597: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.2598: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.2599: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.2600: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.2601: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.2602: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.2603: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2604: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.2605: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.2606: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.2607: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.2608: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.2609: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.2610: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2611: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.2612: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.2613: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.2614: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.2615: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.2616: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.2617: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.2618: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.2619: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.2620: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.2621: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.2622: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.2623: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2624: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.2625: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.2626: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.2627: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.2628: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2629: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.2630: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2631: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2632: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.2633: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.2634: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.2635: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.2636: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.2637: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.2638: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.2639: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.2640: DFBPPR11260 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8A
Source.2641: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.2642: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.2643: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.2644: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein
Source.2645: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.2646: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2647: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.2648: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.2649: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.2650: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.2651: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2652: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.2653: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.2654: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.2655: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.2656: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.2657: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.2658: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.2659: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.2660: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2661: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.2662: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.2663: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.2664: DFBPPR11475 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-B
Source.2665: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3
Source.2666: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.2667: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.2668: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.2669: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.2670: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.2671: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.2672: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.2673: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.2674: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.2675: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4
Source.2676: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.2677: DFBPPR11578 ---- Animal proteins ---- Lymphocyte antigen 86
Source.2678: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.2679: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.2680: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.2681: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2682: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.2683: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.2684: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.2685: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.2686: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.2687: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2688: DFBPPR11651 ---- Animal proteins ---- Vitelline membrane outer layer protein 1
Source.2689: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2690: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.2691: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.2692: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain
Source.2693: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.2694: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2695: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.2696: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1
Source.2697: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.2698: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.2699: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.2700: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2
Source.2701: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.2702: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.2703: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.2704: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.2705: DFBPPR11789 ---- Animal proteins ---- NF-kappa-B inhibitor-interacting Ras-like protein 2
Source.2706: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.2707: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62
Source.2708: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27
Source.2709: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.2710: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2711: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.2712: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.2713: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.2714: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1
Source.2715: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.2716: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.2717: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.2718: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.2719: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.2720: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.2721: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.2722: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.2723: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.2724: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.2725: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.2726: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.2727: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2728: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.2729: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.2730: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.2731: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.2732: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.2733: DFBPPR12027 ---- Animal proteins ---- Centromere protein L
Source.2734: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.2735: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.2736: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.2737: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.2738: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.2739: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.2740: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.2741: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.2742: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.2743: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic
Source.2744: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.2745: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.2746: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.2747: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.2748: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.2749: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.2750: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.2751: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.2752: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.2753: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.2754: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.2755: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.2756: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.2757: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.2758: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2759: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.2760: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.2761: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2762: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.2763: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.2764: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2765: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2766: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.2767: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.2768: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2769: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2770: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.2771: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2772: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.2773: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2774: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.2775: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2776: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2777: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.2778: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.2779: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2780: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.2781: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.2782: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.2783: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2784: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.2785: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.2786: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2787: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.2788: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.2789: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.2790: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.2791: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2792: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.2793: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.2794: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.2795: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.2796: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.2797: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.2798: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.2799: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2800: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.2801: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.2802: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.2803: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.2804: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.2805: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.2806: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.2807: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.2808: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.2809: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109
Source.2810: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2811: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.2812: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.2813: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.2814: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2815: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.2816: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2817: DFBPPR12554 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.2818: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.2819: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2820: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.2821: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2822: DFBPPR12583 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.2823: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2824: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.2825: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.2826: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.2827: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.2828: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.2829: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.2830: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2831: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.2832: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.2833: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.2834: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2835: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.2836: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.2837: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.2838: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2839: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.2840: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.2841: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.2842: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.2843: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.2844: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2845: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.2846: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2847: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.2848: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.2849: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.2850: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.2851: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.2852: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.2853: DFBPPR12772 ---- Animal proteins ---- Colipase
Source.2854: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.2855: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.2856: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.2857: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.2858: DFBPPR12787 ---- Animal proteins ---- Protein S100-A12
Source.2859: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.2860: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.2861: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.2862: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.2863: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma
Source.2864: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.2865: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.2866: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.2867: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor
Source.2868: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.2869: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.2870: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.2871: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.2872: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.2873: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.2874: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.2875: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.2876: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.2877: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.2878: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.2879: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A
Source.2880: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30
Source.2881: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B
Source.2882: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.2883: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.2884: DFBPPR12948 ---- Animal proteins ---- Apolipoprotein C-IV
Source.2885: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.2886: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.2887: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.2888: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2889: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.2890: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.2891: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.2892: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.2893: DFBPPR13028 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2894: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.2895: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2896: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.2897: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.2898: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.2899: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.2900: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain
Source.2901: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2902: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region
Source.2903: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.2904: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2905: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2906: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.2907: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.2908: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2909: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.2910: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2911: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.2912: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.2913: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.2914: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.2915: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.2916: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.2917: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2918: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.2919: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.2920: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta
Source.2921: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.2922: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.2923: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2924: DFBPPR13275 ---- Animal proteins ---- Interleukin-6
Source.2925: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.2926: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.2927: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.2928: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha
Source.2929: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.2930: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2931: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.2932: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2933: DFBPPR13361 ---- Animal proteins ---- Protein S100-G
Source.2934: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.2935: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2936: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.2937: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2938: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22
Source.2939: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2940: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.2941: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.2942: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.2943: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.2944: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.2945: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A
Source.2946: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2947: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.2948: DFBPPR13464 ---- Animal proteins ---- Interferon tau
Source.2949: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.2950: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.2951: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2952: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.2953: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2954: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.2955: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.2956: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.2957: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.2958: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.2959: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.2960: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.2961: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.2962: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.2963: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2964: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2965: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.2966: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.2967: DFBPPR13613 ---- Animal proteins ---- Phospholipase A2
Source.2968: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2969: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta
Source.2970: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2971: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.2972: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2
Source.2973: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2974: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.2975: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6
Source.2976: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.2977: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.2978: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11
Source.2979: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.2980: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2981: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.2982: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1
Source.2983: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.2984: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.2985: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.2986: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.2987: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10
Source.2988: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2989: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5
Source.2990: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9
Source.2991: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8
Source.2992: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7
Source.2993: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4
Source.2994: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.2995: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.2996: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.2997: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.2998: DFBPPR13804 ---- Animal proteins ---- Calcium and integrin-binding family member 2
Source.2999: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.3000: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.3001: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.3002: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.3003: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.3004: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.3005: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3006: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.3007: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.3008: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.3009: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.3010: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.3011: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2
Source.3012: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3013: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.3014: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3015: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.3016: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1
Source.3017: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.3018: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.3019: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3020: DFBPPR14010 ---- Animal proteins ---- GTPase KRas
Source.3021: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3022: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2
Source.3023: DFBPPR14014 ---- Animal proteins ---- Somatotropin
Source.3024: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.3025: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3026: DFBPPR14046 ---- Animal proteins ---- Myoglobin
Source.3027: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3028: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.3029: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.3030: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.3031: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.3032: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.3033: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.3034: DFBPPR14128 ---- Marine protein ---- F-box/LRR-repeat protein 15
Source.3035: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.3036: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E
Source.3037: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.3038: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial
Source.3039: DFBPPR14168 ---- Marine protein ---- Transcription and mRNA export factor ENY2-2
Source.3040: DFBPPR14169 ---- Marine protein ---- Transcription and mRNA export factor ENY2-1
Source.3041: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.3042: DFBPPR14178 ---- Marine protein ---- Hepcidin-1
Source.3043: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.3044: DFBPPR14185 ---- Marine protein ---- Parvalbumin beta 1
Source.3045: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.3046: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.3047: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9
Source.3048: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.3049: DFBPPR14270 ---- Marine protein ---- Myoglobin
Source.3050: DFBPPR14298 ---- Marine protein ---- Acetolactate synthase small subunit
Source.3051: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.3052: DFBPPR14343 ---- Marine protein ---- Anthranilate synthase component 2
Source.3053: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.3054: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.3055: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.3056: DFBPPR14358 ---- Marine protein ---- Thiazole synthase
Source.3057: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit
Source.3058: DFBPPR14366 ---- Marine protein ---- Thioredoxin
Source.3059: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.3060: DFBPPR14394 ---- Marine protein ---- Cytochrome b6-f complex subunit 7
Source.3061: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.3062: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.3063: DFBPPR14459 ---- Marine protein ---- Photosystem II reaction center protein Z
Source.3064: DFBPPR14466 ---- Marine protein ---- 30S ribosomal protein S11, chloroplastic
Source.3065: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.3066: DFBPPR14480 ---- Marine protein ---- Photosystem II reaction center protein Ycf12
Source.3067: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.3068: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.3069: DFBPPR14506 ---- Marine protein ---- Photosystem I reaction center subunit IV
Source.3070: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.3071: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92
Source.3072: DFBPPR14528 ---- Marine protein ---- Uracil phosphoribosyltransferase homolog
Source.3073: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.3074: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.3075: DFBPPR14547 ---- Marine protein ---- Interleukin-6
Source.3076: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.3077: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.3078: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3079: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.3080: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.3081: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.3082: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.3083: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2
Source.3084: DFBPPR14597 ---- Marine protein ---- Parvalbumin beta 1
Source.3085: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.3086: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.3087: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.3088: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.3089: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.3090: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.3091: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.3092: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.3093: DFBPPR14745 ---- Marine protein ---- Parvalbumin beta 2
Source.3094: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.3095: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.3096: DFBPPR14798 ---- Marine protein ---- Panusin
Source.3097: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.3098: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.3099: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.3100: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.3101: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.3102: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.3103: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.3104: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.3105: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.3106: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.3107: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.3108: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.3109: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.3110: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32
Source.3111: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.3112: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1
Source.3113: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.3114: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial
Source.3115: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.3116: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.3117: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.3118: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.3119: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.3120: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.3121: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.3122: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.3123: DFBPPR15018 ---- Microorganism protein ---- Sorting nexin-4
Source.3124: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.3125: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.3126: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.3127: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.3128: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial
Source.3129: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.3130: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.3131: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.3132: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.3133: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial
Source.3134: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.3135: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.3136: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.3137: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.3138: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.3139: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.3140: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.3141: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.3142: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase
Source.3143: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.3144: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.3145: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.3146: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.3147: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2
Source.3148: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.3149: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.3150: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.3151: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.3152: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.3153: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17
Source.3154: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.3155: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.3156: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.3157: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.3158: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2
Source.3159: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.3160: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25
Source.3161: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5
Source.3162: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.3163: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14
Source.3164: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.3165: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3
Source.3166: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.3167: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.3168: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.3169: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.3170: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.3171: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1
Source.3172: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.3173: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.3174: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.3175: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.3176: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.3177: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.3178: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.3179: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.3180: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.3181: DFBPPR15424 ---- Microorganism protein ---- Diphthamide biosynthesis protein 4
Source.3182: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.3183: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.3184: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.3185: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.3186: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.3187: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.3188: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.3189: DFBPPR15474 ---- Microorganism protein ---- GPN-loop GTPase 3
Source.3190: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.3191: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.3192: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.3193: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.3194: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.3195: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.3196: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.3197: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.3198: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.3199: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.3200: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.3201: DFBPPR15601 ---- Microorganism protein ---- Ubiquitin-like modifier HUB1
Source.3202: DFBPPR15688 ---- Microorganism protein ---- Nuclear transport factor 2
Source.3203: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.3204: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.3205: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1
Source.3206: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2
Source.3207: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.3208: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.3209: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial
Source.3210: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.3211: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial
Source.3212: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.3213: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.3214: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.3215: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.3216: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.3217: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.3218: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.3219: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase
Source.3220: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.3221: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.3222: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.3223: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.3224: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.3225: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.3226: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.3227: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.3228: DFBPPR15865 ---- Microorganism protein ---- Hydrophobin-1
Source.3229: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2
Source.3230: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.3231: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.3232: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.3233: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.3234: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.3235: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.3236: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.3237: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.3238: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.3239: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.3240: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.3241: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3242: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.3243: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.3244: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.3245: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3246: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.3247: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.3248: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.3249: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.3250: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.3251: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.3252: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.3253: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.3254: DFBPPR7843 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.3255: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.3256: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.3257: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.3258: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.3259: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.3260: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.3261: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z
Source.3262: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.3263: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.3264: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.3265: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.3266: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.3267: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3268: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.3269: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.3270: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.3271: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.3272: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.3273: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.3274: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.3275: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.3276: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.3277: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.3278: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.3279: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.3280: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3281: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.3282: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3283: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.3284: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.3285: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.3286: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.3287: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.3288: DFBPPR8115 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.3289: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.3290: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.3291: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.3292: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.3293: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.3294: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.3295: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.3296: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.3297: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.3298: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.3299: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.3300: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.3301: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3302: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.3303: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.3304: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.3305: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3306: DFBPPR8292 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.3307: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.3308: DFBPPR8307 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.3309: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.3310: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.3311: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII
Source.3312: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe3+/mol peptide) was measured as a positive control. The peptide VLV showed moderate antioxidant activity with a relative antioxidant activity of 3.36 ± 0.25 mmol Fe3+/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s) N.D
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63.
Other literature(s) N.D
PubDate 2015
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214