Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0910(Antioxidative peptide)

DFBP ID	DFBPANOX0910
Peptide sequence	VLV
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Val-Leu-Val

Single-letter amino acid

VLV

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	329.44 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

4.0667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.4: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.5: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.7: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.8: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71 Source.9: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.10: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase Source.11: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.12: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.13: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.14: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.15: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.16: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.17: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.18: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic Source.19: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.20: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.21: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.22: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.23: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.24: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.25: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.26: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.27: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.28: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.29: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.30: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.31: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.32: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.33: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.34: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.35: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.36: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.37: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.38: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.39: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.40: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.41: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.42: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.43: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.44: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.45: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.46: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1 Source.47: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.48: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.49: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.50: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.51: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.52: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.53: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.54: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.55: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.56: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.57: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.58: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79 Source.59: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.60: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.61: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic Source.62: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic Source.63: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.64: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.65: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.66: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.67: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.68: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.69: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.70: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.71: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.72: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.73: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.74: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.75: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.76: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.77: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.78: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.79: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.80: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.81: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.82: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.83: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.84: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.85: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.86: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.87: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.88: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.89: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.90: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.91: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a Source.92: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.93: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.94: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.95: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.96: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.97: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.98: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.99: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.100: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.101: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.102: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.103: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.104: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.105: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.106: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2 Source.107: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.108: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.109: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.110: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.111: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.112: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.113: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.114: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.115: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7 Source.116: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.117: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.118: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.119: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.120: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.121: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.122: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.123: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.124: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.125: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.126: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.127: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.128: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.129: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.130: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4 Source.131: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.132: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.133: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.134: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.135: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.136: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.137: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.138: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.139: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.140: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.141: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.142: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.143: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.144: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.145: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.146: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.147: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.148: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.149: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.150: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.151: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.152: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2 Source.153: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3 Source.154: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.155: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.156: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.157: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.158: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.159: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.160: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.161: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.162: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.163: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.164: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.165: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.166: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.167: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.168: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.169: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.170: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1 Source.171: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.172: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.173: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.174: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.175: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2 Source.176: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.177: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.178: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.179: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.180: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.181: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1 Source.182: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4 Source.183: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.184: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.185: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.186: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3 Source.187: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1 Source.188: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.189: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.190: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.191: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.192: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.193: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.194: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.195: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.196: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.197: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.198: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.199: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.200: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.201: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.202: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.203: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.204: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.205: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.206: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.207: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.208: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.209: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.210: DFBPPR1912 ---- Plant proteins ---- Expansin-B3 Source.211: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.212: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.213: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.214: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.215: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.216: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1 Source.217: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic Source.218: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.219: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.220: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.221: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.222: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.223: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.224: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1 Source.225: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17 Source.226: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.227: DFBPPR1962 ---- Plant proteins ---- Expansin-A2 Source.228: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.229: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.230: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.231: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.232: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2 Source.233: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.234: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.235: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.236: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.237: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.238: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.239: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.240: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.241: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.242: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.243: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.244: DFBPPR2045 ---- Plant proteins ---- Expansin-A5 Source.245: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11 Source.246: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.247: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.248: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase Source.249: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.250: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.251: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.252: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.253: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.254: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.255: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.256: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.257: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.258: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.259: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.260: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.261: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.262: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.263: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.264: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.265: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57 Source.266: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.267: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.268: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.269: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.270: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.271: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.272: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.273: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.274: DFBPPR2146 ---- Plant proteins ---- Expansin-B4 Source.275: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.276: DFBPPR2157 ---- Plant proteins ---- Expansin-B6 Source.277: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.278: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.279: DFBPPR2176 ---- Plant proteins ---- Expansin-B11 Source.280: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.281: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.282: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.283: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.284: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.285: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.286: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21 Source.287: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.288: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.289: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.290: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.291: DFBPPR2230 ---- Plant proteins ---- Proteasome subunit alpha type-2 Source.292: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic Source.293: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.294: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.295: DFBPPR2242 ---- Plant proteins ---- Expansin-A3 Source.296: DFBPPR2244 ---- Plant proteins ---- Expansin-A6 Source.297: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.298: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.299: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.300: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.301: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.302: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.303: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.304: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.305: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.306: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.307: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.308: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.309: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.310: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.311: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.312: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.313: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.314: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic Source.315: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.316: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.317: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.318: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.319: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A Source.320: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.321: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.322: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.323: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.324: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11 Source.325: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.326: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.327: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic Source.328: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.329: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.330: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.331: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.332: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.333: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.334: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.335: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.336: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.337: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.338: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.339: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13 Source.340: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.341: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1 Source.342: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.343: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B Source.344: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.345: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.346: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.347: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.348: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.349: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.350: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.351: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3 Source.352: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.353: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.354: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.355: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.356: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.357: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7 Source.358: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2 Source.359: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.360: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.361: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10 Source.362: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.363: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.364: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.365: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.366: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27 Source.367: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.368: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.369: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.370: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.371: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.372: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.373: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.374: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.375: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.376: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.377: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.378: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.379: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2 Source.380: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.381: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3 Source.382: DFBPPR2624 ---- Plant proteins ---- Transcription initiation factor IIA subunit 2 Source.383: DFBPPR2625 ---- Plant proteins ---- 18.6 kDa class III heat shock protein Source.384: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.385: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.386: DFBPPR2636 ---- Plant proteins ---- Expansin-B8 Source.387: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.388: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic Source.389: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.390: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.391: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.392: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.393: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.394: DFBPPR2676 ---- Plant proteins ---- Expansin-A11 Source.395: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.396: DFBPPR2699 ---- Plant proteins ---- Expansin-A8 Source.397: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.398: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.399: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.400: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.401: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.402: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.403: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4 Source.404: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.405: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.406: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.407: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic Source.408: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.409: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.410: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.411: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.412: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.413: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase Source.414: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.415: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a Source.416: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS Source.417: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.418: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.419: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.420: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.421: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.422: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic Source.423: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9 Source.424: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8 Source.425: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.426: DFBPPR2836 ---- Plant proteins ---- Two-component response regulator ORR12 Source.427: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.428: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.429: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.430: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.431: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6 Source.432: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B Source.433: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.434: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.435: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.436: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.437: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.438: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.439: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.440: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.441: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.442: DFBPPR2883 ---- Plant proteins ---- Expansin-B9 Source.443: DFBPPR2884 ---- Plant proteins ---- Expansin-B2 Source.444: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.445: DFBPPR2888 ---- Plant proteins ---- Expansin-B10 Source.446: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6 Source.447: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.448: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.449: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.450: DFBPPR2910 ---- Plant proteins ---- Expansin-B5 Source.451: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d Source.452: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.453: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5 Source.454: DFBPPR2925 ---- Plant proteins ---- Two-component response regulator ORR13 Source.455: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4 Source.456: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14 Source.457: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1 Source.458: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.459: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.460: DFBPPR2948 ---- Plant proteins ---- Expansin-A25 Source.461: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.462: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.463: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.464: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.465: DFBPPR2964 ---- Plant proteins ---- Expansin-A14 Source.466: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.467: DFBPPR2970 ---- Plant proteins ---- Germin-like protein 1-2 Source.468: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.469: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.470: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.471: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic Source.472: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.473: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.474: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.475: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.476: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.477: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.478: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b Source.479: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.480: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3 Source.481: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.482: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.483: DFBPPR3075 ---- Plant proteins ---- Thiamine pyrophosphokinase 2 Source.484: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.485: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.486: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.487: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.488: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.489: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.490: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.491: DFBPPR3102 ---- Plant proteins ---- Expansin-B18 Source.492: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.493: DFBPPR3124 ---- Plant proteins ---- Two-component response regulator ORR8 Source.494: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.495: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.496: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.497: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.498: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.499: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.500: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13 Source.501: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.502: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.503: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.504: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.505: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.506: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5 Source.507: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.508: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.509: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.510: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.511: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.512: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.513: DFBPPR3206 ---- Plant proteins ---- Expansin-B15 Source.514: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.515: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.516: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.517: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.518: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.519: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.520: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.521: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.522: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.523: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.524: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase Source.525: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.526: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP Source.527: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.528: DFBPPR3302 ---- Plant proteins ---- Expansin-A21 Source.529: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.530: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5 Source.531: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.532: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.533: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.534: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a Source.535: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a Source.536: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.537: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.538: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.539: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.540: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.541: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.542: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic Source.543: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.544: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.545: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.546: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.547: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.548: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.549: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.550: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.551: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7 Source.552: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.553: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.554: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.555: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.556: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.557: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.558: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.559: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.560: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.561: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1 Source.562: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.563: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.564: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.565: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.566: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.567: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.568: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.569: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.570: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.571: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.572: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic Source.573: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.574: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2 Source.575: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45 Source.576: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.577: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.578: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.579: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.580: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.581: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1 Source.582: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.583: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e Source.584: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.585: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.586: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1 Source.587: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.588: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.589: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.590: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.591: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.592: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.593: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2 Source.594: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.595: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.596: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.597: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.598: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.599: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.600: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.601: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25 Source.602: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.603: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.604: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.605: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1 Source.606: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.607: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.608: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.609: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.610: DFBPPR3701 ---- Plant proteins ---- Non-specific lipid-transfer protein C4 Source.611: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.612: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.613: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.614: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.615: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.616: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.617: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.618: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.619: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.620: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.621: DFBPPR3763 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.622: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51 Source.623: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4 Source.624: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.625: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial Source.626: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.627: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.628: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.629: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.630: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.631: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.632: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39 Source.633: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54 Source.634: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8 Source.635: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.636: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.637: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1 Source.638: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.639: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.640: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.641: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.642: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.643: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.644: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.645: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.646: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.647: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.648: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.649: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.650: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.651: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.652: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.653: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.654: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3 Source.655: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.656: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2 Source.657: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.658: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.659: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2 Source.660: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.661: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.662: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.663: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.664: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.665: DFBPPR4004 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.666: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.667: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.668: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1 Source.669: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8 Source.670: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.671: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.672: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A Source.673: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11 Source.674: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.675: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.676: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.677: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.678: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.679: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.680: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.681: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.682: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10 Source.683: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.684: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.685: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.686: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4 Source.687: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.688: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.689: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.690: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.691: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.692: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7 Source.693: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.694: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.695: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.696: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.697: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3 Source.698: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3 Source.699: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.700: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.701: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial Source.702: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.703: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.704: DFBPPR4207 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4B Source.705: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.706: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.707: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.708: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.709: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.710: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.711: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.712: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4 Source.713: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.714: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H Source.715: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.716: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.717: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.718: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.719: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.720: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3 Source.721: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6 Source.722: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.723: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.724: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.725: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.726: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.727: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.728: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic Source.729: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.730: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.731: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.732: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.733: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.734: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.735: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1 Source.736: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.737: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.738: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.739: DFBPPR4405 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4A Source.740: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.741: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.742: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.743: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.744: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.745: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.746: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2 Source.747: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.748: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.749: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3 Source.750: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13 Source.751: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.752: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.753: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4 Source.754: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.755: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.756: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.757: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.758: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1 Source.759: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein Source.760: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.761: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.762: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.763: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3 Source.764: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.765: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.766: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.767: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14 Source.768: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.769: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.770: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.771: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.772: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.773: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.774: DFBPPR4605 ---- Plant proteins ---- Protein LOL4 Source.775: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.776: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5 Source.777: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.778: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1 Source.779: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.780: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.781: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.782: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51 Source.783: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.784: DFBPPR4721 ---- Plant proteins ---- Protein YY1 Source.785: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4 Source.786: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160 Source.787: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic Source.788: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2 Source.789: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic Source.790: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4 Source.791: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.792: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.793: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2 Source.794: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100 Source.795: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34 Source.796: DFBPPR4809 ---- Plant proteins ---- B3 domain-containing protein Os03g0164300 Source.797: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8 Source.798: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.799: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3 Source.800: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2 Source.801: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1 Source.802: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.803: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.804: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.805: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.806: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.807: DFBPPR4880 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 29 Source.808: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940 Source.809: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.810: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.811: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A Source.812: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.813: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.814: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.815: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30 Source.816: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.817: DFBPPR4966 ---- Plant proteins ---- Glycinin G5 Source.818: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1 Source.819: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.820: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.821: DFBPPR4995 ---- Plant proteins ---- Glycinin G4 Source.822: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.823: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.824: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.825: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.826: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.827: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.828: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.829: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.830: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.831: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.832: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.833: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.834: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.835: DFBPPR5111 ---- Plant proteins ---- Lectin Source.836: DFBPPR5124 ---- Plant proteins ---- Nodulin-26 Source.837: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A Source.838: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2 Source.839: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.840: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.841: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.842: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.843: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.844: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum Source.845: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.846: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.847: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.848: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.849: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.850: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.851: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.852: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.853: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.854: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.855: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.856: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9 Source.857: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.858: DFBPPR5222 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.859: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein Source.860: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.861: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.862: DFBPPR5233 ---- Plant proteins ---- Ras-related protein Rab7 Source.863: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.864: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.865: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.866: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2 Source.867: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein Source.868: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.869: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.870: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.871: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.872: DFBPPR5276 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.873: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.874: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1 Source.875: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1 Source.876: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.877: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.878: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.879: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.880: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.881: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.882: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.883: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.884: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.885: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.886: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.887: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.888: DFBPPR5432 ---- Plant proteins ---- Expansin-B1 Source.889: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.890: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.891: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.892: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.893: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.894: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.895: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.896: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1 Source.897: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.898: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.899: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66 Source.900: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.901: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.902: DFBPPR5508 ---- Plant proteins ---- Expansin-B9 Source.903: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.904: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.905: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.906: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.907: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II Source.908: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.909: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.910: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.911: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.912: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.913: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.914: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.915: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.916: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.917: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.918: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10 Source.919: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.920: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.921: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.922: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.923: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.924: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.925: DFBPPR5627 ---- Plant proteins ---- Expansin-B11 Source.926: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.927: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.928: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.929: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.930: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.931: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.932: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.933: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.934: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.935: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.936: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.937: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic Source.938: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.939: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.940: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1 Source.941: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.942: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.943: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.944: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4 Source.945: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1 Source.946: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23 Source.947: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.948: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.949: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1 Source.950: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.951: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.952: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.953: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic Source.954: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog Source.955: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.956: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.957: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.958: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.959: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic Source.960: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.961: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.962: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.963: DFBPPR5865 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.964: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.965: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.966: DFBPPR5884 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.967: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein Source.968: DFBPPR5896 ---- Plant proteins ---- 50 kDa gamma-zein Source.969: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.970: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.971: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.972: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.973: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.974: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.975: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.976: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.977: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic Source.978: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.979: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.980: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.981: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.982: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.983: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.984: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.985: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein Source.986: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.987: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7 Source.988: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.989: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2 Source.990: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein Source.991: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.992: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.993: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.994: DFBPPR6025 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.995: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2 Source.996: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4 Source.997: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1 Source.998: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3 Source.999: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.1000: DFBPPR6077 ---- Plant proteins ---- Pollen-specific protein C13 Source.1001: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1 Source.1002: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA Source.1003: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1004: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.1005: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.1006: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.1007: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.1008: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1009: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1010: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.1011: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.1012: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.1013: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1014: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.1015: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.1016: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.1017: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1018: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.1019: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.1020: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.1021: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.1022: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.1023: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.1024: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1025: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase Source.1026: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1 Source.1027: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1028: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.1029: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1030: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.1031: DFBPPR6410 ---- Plant proteins ---- Vicilin, 14 kDa component Source.1032: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.1033: DFBPPR6439 ---- Plant proteins ---- 20 kDa chaperonin, chloroplastic Source.1034: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.1035: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.1036: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.1037: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.1038: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.1039: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.1040: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.1041: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.1042: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.1043: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1044: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1045: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.1046: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.1047: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1 Source.1048: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.1049: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like Source.1050: DFBPPR6561 ---- Plant proteins ---- Blue copper protein Source.1051: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.1052: DFBPPR6613 ---- Plant proteins ---- Ras-related protein Rab7 Source.1053: DFBPPR6619 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.1054: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.1055: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.1056: DFBPPR6642 ---- Plant proteins ---- Peroxidase Source.1057: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.1058: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase Source.1059: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.1060: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.1061: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.1062: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.1063: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1064: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.1065: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.1066: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.1067: DFBPPR6712 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM16 Source.1068: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.1069: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.1070: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase Source.1071: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.1072: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1 Source.1073: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.1074: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.1075: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1076: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1077: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.1078: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.1079: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.1080: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.1081: DFBPPR6832 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.1082: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.1083: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.1084: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1085: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1086: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1087: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A Source.1088: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1089: DFBPPR6869 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.1090: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1091: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1092: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.1093: DFBPPR6931 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP Source.1094: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.1095: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.1096: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.1097: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic Source.1098: DFBPPR7031 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMb Source.1099: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.1100: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa Source.1101: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1102: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1103: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.1104: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.1105: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.1106: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4 Source.1107: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.1108: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.1109: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.1110: DFBPPR7132 ---- Plant proteins ---- Beta-galactosidase Source.1111: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.1112: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.1113: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1114: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1115: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.1116: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3 Source.1117: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1118: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.1119: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1120: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.1121: DFBPPR7200 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.1 Source.1122: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.1123: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.1124: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1125: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.1126: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1127: DFBPPR7227 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.2 Source.1128: DFBPPR7232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.1129: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.1130: DFBPPR7253 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1131: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.1132: DFBPPR7261 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.3 Source.1133: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6 Source.1134: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.1135: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A Source.1136: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C Source.1137: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.1138: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1139: DFBPPR7299 ---- Plant proteins ---- Low temperature-induced protein lt101.1 Source.1140: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1 Source.1141: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.1142: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2 Source.1143: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.1144: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.1145: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.1146: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.1147: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.1148: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic Source.1149: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.1150: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase Source.1151: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.1152: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.1153: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1154: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.1155: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.1156: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.1157: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.1158: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.1159: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.1160: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1161: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1162: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2 Source.1163: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2 Source.1164: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.1165: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.1166: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.1167: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.1168: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1169: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1170: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.1171: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.1172: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.1173: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.1174: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.1175: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.1176: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.1177: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.1178: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.1179: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.1180: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.1181: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1182: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.1183: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1 Source.1184: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin Source.1185: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101 Source.1186: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102 Source.1187: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.1188: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103 Source.1189: DFBPPR8398 ---- Plant proteins ---- Conglutin Source.1190: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101 Source.1191: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102 Source.1192: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.1193: DFBPPR8424 ---- Plant proteins ---- Oleosin H1 Source.1194: DFBPPR8425 ---- Plant proteins ---- Oleosin L Source.1195: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1196: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2 Source.1197: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1198: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1199: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1200: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.1201: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6 Source.1202: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5 Source.1203: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1204: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.1205: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.1206: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.1207: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1208: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.1209: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.1210: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.1211: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1212: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1213: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1 Source.1214: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.1215: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.1216: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.1217: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.1218: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1219: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.1220: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1221: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase Source.1222: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1223: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.1224: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1225: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.1226: DFBPPR16001 ---- Animal proteins ---- Battenin Source.1227: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1228: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1229: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.1230: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1231: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV Source.1232: DFBPPR16028 ---- Animal proteins ---- Presenilin-1 Source.1233: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1234: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1235: DFBPPR16032 ---- Animal proteins ---- Ras-related protein Rab-7a Source.1236: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1237: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1238: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1239: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.1240: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1241: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.1242: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1243: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1244: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4 Source.1245: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.1246: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2 Source.1247: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1248: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1249: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1250: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.1251: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1252: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.1253: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1254: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.1255: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.1256: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1257: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.1258: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1259: DFBPPR16142 ---- Animal proteins ---- Procathepsin L Source.1260: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.1261: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1262: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1263: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta Source.1264: DFBPPR16159 ---- Animal proteins ---- Apolipoprotein C-I Source.1265: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1266: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.1267: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.1268: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.1269: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.1270: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.1271: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.1272: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone Source.1273: DFBPPR16189 ---- Animal proteins ---- Albumin Source.1274: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.1275: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.1276: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1277: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1278: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1279: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1280: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1281: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.1282: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.1283: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.1284: DFBPPR16244 ---- Animal proteins ---- Interleukin-2 Source.1285: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1286: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1287: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.1288: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.1289: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.1290: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.1291: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1292: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta Source.1293: DFBPPR16279 ---- Animal proteins ---- Galactokinase Source.1294: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.1295: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1296: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1297: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1298: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21 Source.1299: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.1300: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1301: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41 Source.1302: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.1303: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1304: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype Source.1305: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1306: DFBPPR16378 ---- Animal proteins ---- Arginine esterase Source.1307: DFBPPR16429 ---- Animal proteins ---- C-C motif chemokine 4 Source.1308: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.1309: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.1310: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.1311: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1312: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2 Source.1313: DFBPPR16485 ---- Animal proteins ---- Cathepsin S Source.1314: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.1315: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor Source.1316: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.1317: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.1318: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.1319: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1320: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1321: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.1322: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3 Source.1323: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83 Source.1324: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.1325: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.1326: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1327: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1328: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.1329: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.1330: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1331: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1332: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3 Source.1333: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a Source.1334: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1335: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3 Source.1336: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.1337: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.1338: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c Source.1339: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.1340: DFBPPR16595 ---- Animal proteins ---- Annexin A4 Source.1341: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.1342: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.1343: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.1344: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1 Source.1345: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1 Source.1346: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1347: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6 Source.1348: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.1349: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1350: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27 Source.1351: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.1352: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.1353: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3 Source.1354: DFBPPR16691 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1355: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator Source.1356: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.1357: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252 Source.1358: DFBPPR16714 ---- Animal proteins ---- Protein fosB Source.1359: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1360: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1 Source.1361: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.1362: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.1363: DFBPPR16753 ---- Animal proteins ---- Nicolin-1 Source.1364: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.1365: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.1366: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial Source.1367: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.1368: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.1369: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease Source.1370: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic Source.1371: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta Source.1372: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II Source.1373: DFBPPR16826 ---- Animal proteins ---- Phospholipase A2 Source.1374: DFBPPR16827 ---- Animal proteins ---- S-arrestin Source.1375: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1376: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1377: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.1378: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.1379: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.1380: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.1381: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.1382: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.1383: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 Source.1384: DFBPPR16893 ---- Animal proteins ---- Annexin A4 Source.1385: DFBPPR16894 ---- Animal proteins ---- Procathepsin L Source.1386: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.1387: DFBPPR16897 ---- Animal proteins ---- Interleukin-4 Source.1388: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1389: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.1390: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1391: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.1392: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.1393: DFBPPR16918 ---- Animal proteins ---- Spastin Source.1394: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1395: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1396: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease Source.1397: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.1398: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1399: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3 Source.1400: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase Source.1401: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.1402: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1403: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.1404: DFBPPR17013 ---- Animal proteins ---- Presenilin-1 Source.1405: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.1406: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.1407: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1408: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor Source.1409: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1410: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain Source.1411: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.1412: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog Source.1413: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1414: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1415: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.1416: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1417: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1418: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.1419: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.1420: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.1421: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.1422: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.1423: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1424: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.1425: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1426: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.1427: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.1428: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1429: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1430: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1431: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1432: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1433: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.1434: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.1435: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.1436: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.1437: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1438: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1439: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1440: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.1441: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.1442: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.1443: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1444: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1445: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.1446: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.1447: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.1448: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1 Source.1449: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1450: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR Source.1451: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.1452: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.1453: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.1454: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1455: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.1456: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1457: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.1458: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.1459: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.1460: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1461: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II Source.1462: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1463: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase Source.1464: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1465: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1466: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.1467: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1468: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.1469: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2 Source.1470: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.1471: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1 Source.1472: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.1473: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.1474: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1475: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1476: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1477: DFBPPR17423 ---- Animal proteins ---- Furin Source.1478: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.1479: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.1480: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.1481: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1482: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.1483: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1484: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1485: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.1486: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1487: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.1488: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.1489: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.1490: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.1491: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1492: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1493: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1494: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.1495: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1 Source.1496: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1497: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.1498: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.1499: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase Source.1500: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1 Source.1501: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.1502: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.1503: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1504: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH) Source.1505: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7 Source.1506: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.1507: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1508: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.1509: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.1510: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.1511: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1512: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.1513: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.1514: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1515: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3 Source.1516: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.1517: DFBPPR17734 ---- Animal proteins ---- Protein S100-A12 Source.1518: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6 Source.1519: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1520: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1521: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.1522: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1 Source.1523: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1524: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1 Source.1525: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.1526: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3 Source.1527: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.1528: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.1529: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.1530: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.1531: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.1532: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.1533: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2 Source.1534: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.1535: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.1536: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.1537: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.1538: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.1539: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3 Source.1540: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1541: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1542: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1543: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1544: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1545: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1546: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.1547: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1548: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1549: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.1550: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.1551: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein Source.1552: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.1553: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.1554: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.1555: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.1556: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.1557: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1558: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.1559: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.1560: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.1561: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 Source.1562: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1563: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1 Source.1564: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.1565: DFBPPR17970 ---- Animal proteins ---- Profilin-2 Source.1566: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.1567: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.1568: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B Source.1569: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1570: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.1571: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.1572: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17 Source.1573: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B Source.1574: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.1575: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1576: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.1577: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.1578: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.1579: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1580: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a Source.1581: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1582: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.1583: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1584: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1 Source.1585: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.1586: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1587: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.1588: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.1589: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1590: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8 Source.1591: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4 Source.1592: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.1593: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.1594: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.1595: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1596: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.1597: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1 Source.1598: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1599: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1600: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1601: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.1602: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.1603: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.1604: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.1605: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.1606: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.1607: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.1608: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.1609: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.1610: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1611: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.1612: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.1613: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.1614: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.1615: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1616: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6 Source.1617: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1618: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.1619: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1620: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.1621: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.1622: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.1623: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1624: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.1625: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.1626: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1 Source.1627: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.1628: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta Source.1629: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1630: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1631: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.1632: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6 Source.1633: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha Source.1634: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.1635: DFBPPR18339 ---- Animal proteins ---- SPARC Source.1636: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase Source.1637: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.1638: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q Source.1639: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.1640: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1641: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase Source.1642: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1643: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1644: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1645: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1646: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16 Source.1647: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12 Source.1648: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1649: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2 Source.1650: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.1651: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.1652: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.1653: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.1654: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.1655: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.1656: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.1657: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.1658: DFBPPR18516 ---- Animal proteins ---- Galactokinase Source.1659: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.1660: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.1661: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.1662: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.1663: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.1664: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1665: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.1666: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3 Source.1667: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.1668: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.1669: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.1670: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.1671: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.1672: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.1673: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III Source.1674: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.1675: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.1676: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog Source.1677: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.1678: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1679: DFBPPR18711 ---- Animal proteins ---- Protein S100-G Source.1680: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.1681: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.1682: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor Source.1683: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.1684: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.1685: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor Source.1686: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1 Source.1687: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.1688: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.1689: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.1690: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.1691: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone Source.1692: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.1693: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU Source.1694: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein Source.1695: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A Source.1696: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2 Source.1697: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.1698: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.1699: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1700: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1701: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.1702: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1703: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D Source.1704: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1705: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7 Source.1706: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.1707: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.1708: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.1709: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.1710: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.1711: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5 Source.1712: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.1713: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b Source.1714: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1715: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.1716: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1717: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.1718: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.1719: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.1720: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial Source.1721: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1 Source.1722: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.1723: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1 Source.1724: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.1725: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.1726: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1727: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.1728: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.1729: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.1730: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.1731: DFBPPR18995 ---- Animal proteins ---- Tektin-3 Source.1732: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.1733: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.1734: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.1735: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase Source.1736: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.1737: DFBPPR19034 ---- Animal proteins ---- Sialomucin core protein 24 Source.1738: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.1739: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1740: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.1741: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.1742: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.1743: DFBPPR19071 ---- Animal proteins ---- Collectrin Source.1744: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3 Source.1745: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.1746: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.1747: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.1748: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa Source.1749: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1750: DFBPPR19108 ---- Animal proteins ---- Hepatocyte cell adhesion molecule Source.1751: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.1752: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.1753: DFBPPR19131 ---- Animal proteins ---- Nectin-4 Source.1754: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease Source.1755: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.1756: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1757: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator Source.1758: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.1759: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.1760: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1761: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.1762: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.1763: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.1764: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.1765: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.1766: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.1767: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3 Source.1768: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.1769: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1770: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.1771: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1772: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.1773: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein Source.1774: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.1775: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1776: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B Source.1777: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28 Source.1778: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2 Source.1779: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6 Source.1780: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.1781: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.1782: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.1783: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3 Source.1784: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5 Source.1785: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6 Source.1786: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.1787: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.1788: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.1789: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4 Source.1790: DFBPPR19329 ---- Animal proteins ---- CD302 antigen Source.1791: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9 Source.1792: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel Source.1793: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.1794: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.1795: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.1796: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.1797: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein Source.1798: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.1799: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22 Source.1800: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1 Source.1801: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2 Source.1802: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1803: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1 Source.1804: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.1805: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137 Source.1806: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.1807: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.1808: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.1809: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1 Source.1810: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1811: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1812: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.1813: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.1814: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1815: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1 Source.1816: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase Source.1817: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.1818: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.1819: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1820: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.1821: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.1822: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.1823: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin Source.1824: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.1825: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.1826: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1827: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.1828: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2 Source.1829: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.1830: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.1831: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.1832: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.1833: DFBPPR19668 ---- Animal proteins ---- Calicin Source.1834: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1835: DFBPPR19703 ---- Animal proteins ---- Claudin-10 Source.1836: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29 Source.1837: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.1838: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4 Source.1839: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2 Source.1840: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.1841: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.1842: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.1843: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1844: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.1845: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.1846: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH Source.1847: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.1848: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.1849: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.1850: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1851: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial Source.1852: DFBPPR19846 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8B Source.1853: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.1854: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1855: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1856: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase Source.1857: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.1858: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1859: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A Source.1860: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.1861: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial Source.1862: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.1863: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic Source.1864: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27 Source.1865: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3 Source.1866: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.1867: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1 Source.1868: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.1869: DFBPPR19949 ---- Animal proteins ---- Syndecan-2 Source.1870: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.1871: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1 Source.1872: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.1873: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B Source.1874: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.1875: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.1876: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor Source.1877: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.1878: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.1879: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39 Source.1880: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2 Source.1881: DFBPPR19992 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm3 Source.1882: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1 Source.1883: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C Source.1884: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.1885: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase Source.1886: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4 Source.1887: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.1888: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1889: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B Source.1890: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.1891: DFBPPR20051 ---- Animal proteins ---- 28S ribosomal protein S18a, mitochondrial Source.1892: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.1893: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.1894: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.1895: DFBPPR20089 ---- Animal proteins ---- Fascin-2 Source.1896: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1 Source.1897: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.1898: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.1899: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial Source.1900: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1 Source.1901: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2 Source.1902: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.1903: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial Source.1904: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.1905: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9 Source.1906: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A Source.1907: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.1908: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4 Source.1909: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98 Source.1910: DFBPPR20188 ---- Animal proteins ---- Protein S100-A16 Source.1911: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.1912: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9 Source.1913: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.1914: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.1915: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1916: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30 Source.1917: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2 Source.1918: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53 Source.1919: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor Source.1920: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14 Source.1921: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.1922: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.1923: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV Source.1924: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog Source.1925: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.1926: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.1927: DFBPPR20325 ---- Animal proteins ---- 28S ribosomal protein S12, mitochondrial Source.1928: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.1929: DFBPPR20328 ---- Animal proteins ---- 40S ribosomal protein S23 Source.1930: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1931: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.1932: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.1933: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1934: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.1935: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.1936: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56 Source.1937: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.1938: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a Source.1939: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.1940: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.1941: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial Source.1942: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial Source.1943: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.1944: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.1945: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170 Source.1946: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase Source.1947: DFBPPR20440 ---- Animal proteins ---- 28S ribosomal protein S25, mitochondrial Source.1948: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2 Source.1949: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.1950: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.1951: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1 Source.1952: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.1953: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.1954: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.1955: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.1956: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Source.1957: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1 Source.1958: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D Source.1959: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.1960: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.1961: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.1962: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1963: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.1964: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.1965: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.1966: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52 Source.1967: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial Source.1968: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa Source.1969: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein Source.1970: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.1971: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.1972: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.1973: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.1974: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.1975: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.1976: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6 Source.1977: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11 Source.1978: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.1979: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.1980: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B Source.1981: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.1982: DFBPPR20766 ---- Animal proteins ---- Torsin-2A Source.1983: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6 Source.1984: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.1985: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13 Source.1986: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.1987: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1988: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.1989: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1990: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.1991: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6 Source.1992: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.1993: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4 Source.1994: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1 Source.1995: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1 Source.1996: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.1997: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B Source.1998: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237 Source.1999: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.2000: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.2001: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog Source.2002: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor Source.2003: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2 Source.2004: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2005: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2006: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2007: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.2008: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14 Source.2009: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1 Source.2010: DFBPPR20950 ---- Animal proteins ---- WAP four-disulfide core domain protein 18 Source.2011: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.2012: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2013: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27 Source.2014: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.2015: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2 Source.2016: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.2017: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.2018: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26 Source.2019: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.2020: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.2021: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.2022: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.2023: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.2024: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter Source.2025: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5 Source.2026: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.2027: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.2028: DFBPPR21081 ---- Animal proteins ---- Uteroglobin Source.2029: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.2030: DFBPPR21087 ---- Animal proteins ---- Claudin-11 Source.2031: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.2032: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.2033: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32 Source.2034: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.2035: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7 Source.2036: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.2037: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.2038: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88 Source.2039: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350 Source.2040: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3 Source.2041: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.2042: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3 Source.2043: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.2044: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2 Source.2045: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.2046: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.2047: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2 Source.2048: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2 Source.2049: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.2050: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1 Source.2051: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.2052: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3 Source.2053: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198 Source.2054: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.2055: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.2056: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.2057: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.2058: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.2059: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog Source.2060: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.2061: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.2062: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.2063: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.2064: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.2065: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.2066: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2 Source.2067: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.2068: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115 Source.2069: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma Source.2070: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.2071: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204 Source.2072: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2 Source.2073: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.2074: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.2075: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial Source.2076: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2 Source.2077: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.2078: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.2079: DFBPPR21424 ---- Animal proteins ---- Chromosome transmission fidelity protein 8 homolog Source.2080: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.2081: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2 Source.2082: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4 Source.2083: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.2084: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2 Source.2085: DFBPPR21455 ---- Animal proteins ---- Apolipoprotein C-IV Source.2086: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2 Source.2087: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2088: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.2089: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8 Source.2090: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.2091: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2 Source.2092: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.2093: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor Source.2094: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.2095: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23 Source.2096: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma Source.2097: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2098: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.2099: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10 Source.2100: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.2101: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2 Source.2102: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.2103: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial Source.2104: DFBPPR21649 ---- Animal proteins ---- NTF2-related export protein 1 Source.2105: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8 Source.2106: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.2107: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator Source.2108: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog Source.2109: DFBPPR21712 ---- Animal proteins ---- Serpin E3 Source.2110: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.2111: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.2112: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1 Source.2113: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.2114: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.2115: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.2116: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25 Source.2117: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1 Source.2118: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.2119: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6 Source.2120: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.2121: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.2122: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.2123: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2124: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.2125: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2 Source.2126: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.2127: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B Source.2128: DFBPPR21866 ---- Animal proteins ---- c-Myc-binding protein Source.2129: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.2130: DFBPPR21871 ---- Animal proteins ---- Serpin B10 Source.2131: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.2132: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1 Source.2133: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2 Source.2134: DFBPPR21920 ---- Animal proteins ---- Protein DPCD Source.2135: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4 Source.2136: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.2137: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7 Source.2138: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.2139: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.2140: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.2141: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2142: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1 Source.2143: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like Source.2144: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.2145: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81 Source.2146: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1 Source.2147: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4 Source.2148: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.2149: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.2150: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein Source.2151: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.2152: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.2153: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.2154: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.2155: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3 Source.2156: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.2157: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.2158: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.2159: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.2160: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.2161: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.2162: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.2163: DFBPPR22099 ---- Animal proteins ---- Beta-centractin Source.2164: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.2165: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial Source.2166: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.2167: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.2168: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572 Source.2169: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1 Source.2170: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.2171: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.2172: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.2173: DFBPPR22170 ---- Animal proteins ---- Transmembrane protein 106C Source.2174: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog Source.2175: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.2176: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B Source.2177: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9 Source.2178: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36 Source.2179: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.2180: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.2181: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.2182: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2 Source.2183: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.2184: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog Source.2185: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1 Source.2186: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B Source.2187: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a Source.2188: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.2189: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2 Source.2190: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.2191: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.2192: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.2193: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.2194: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.2195: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1 Source.2196: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86 Source.2197: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B Source.2198: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.2199: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.2200: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog Source.2201: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3 Source.2202: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.2203: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.2204: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.2205: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein Source.2206: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.2207: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2208: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.2209: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.2210: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2 Source.2211: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234 Source.2212: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.2213: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.2214: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.2215: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein Source.2216: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5 Source.2217: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.2218: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A Source.2219: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171 Source.2220: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.2221: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253 Source.2222: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4 Source.2223: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog Source.2224: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.2225: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.2226: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.2227: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6 Source.2228: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.2229: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.2230: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2231: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.2232: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2233: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.2234: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.2235: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.2236: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.2237: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.2238: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial Source.2239: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.2240: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.2241: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.2242: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.2243: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.2244: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.2245: DFBPPR8595 ---- Animal proteins ---- Annexin A4 Source.2246: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.2247: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2248: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2249: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.2250: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.2251: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2252: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.2253: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.2254: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.2255: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.2256: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2257: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.2258: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.2259: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.2260: DFBPPR8683 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2261: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.2262: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.2263: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.2264: DFBPPR8694 ---- Animal proteins ---- Spastin Source.2265: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.2266: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.2267: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.2268: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A Source.2269: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.2270: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.2271: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.2272: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.2273: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2274: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.2275: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2276: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.2277: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.2278: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.2279: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.2280: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone Source.2281: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.2282: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.2283: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.2284: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2285: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2 Source.2286: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2287: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1 Source.2288: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.2289: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1 Source.2290: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein Source.2291: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2292: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.2293: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.2294: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.2295: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.2296: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.2297: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2298: DFBPPR8907 ---- Animal proteins ---- Protein S100-A12 Source.2299: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.2300: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.2301: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.2302: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.2303: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.2304: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.2305: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.2306: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.2307: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.2308: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.2309: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.2310: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.2311: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.2312: DFBPPR9065 ---- Animal proteins ---- GTPase NRas Source.2313: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.2314: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.2315: DFBPPR9089 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2316: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.2317: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32 Source.2318: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2319: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.2320: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2321: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6 Source.2322: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6 Source.2323: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.2324: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2325: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2326: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2327: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.2328: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.2329: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.2330: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.2331: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2 Source.2332: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2333: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.2334: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2335: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2336: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.2337: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase Source.2338: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10 Source.2339: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain Source.2340: DFBPPR9210 ---- Animal proteins ---- 40S ribosomal protein S23 Source.2341: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.2342: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.2343: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.2344: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.2345: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.2346: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.2347: DFBPPR9273 ---- Animal proteins ---- C-C motif chemokine 4 Source.2348: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.2349: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.2350: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2351: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27 Source.2352: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel Source.2353: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.2354: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2 Source.2355: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.2356: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.2357: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.2358: DFBPPR9315 ---- Animal proteins ---- Protein S100-G Source.2359: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.2360: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor Source.2361: DFBPPR9338 ---- Animal proteins ---- SPARC Source.2362: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2363: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.2364: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor Source.2365: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2366: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.2367: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.2368: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59 Source.2369: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59 Source.2370: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.2371: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2372: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase Source.2373: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.2374: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2375: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.2376: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.2377: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.2378: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.2379: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2380: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.2381: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.2382: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein Source.2383: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2384: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.2385: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.2386: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E Source.2387: DFBPPR9559 ---- Animal proteins ---- CD302 antigen Source.2388: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C Source.2389: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3 Source.2390: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.2391: DFBPPR9578 ---- Animal proteins ---- Biglycan Source.2392: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.2393: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.2394: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.2395: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.2396: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.2397: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1 Source.2398: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.2399: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4 Source.2400: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39 Source.2401: DFBPPR9705 ---- Animal proteins ---- Elafin Source.2402: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.2403: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2404: DFBPPR9740 ---- Animal proteins ---- Neprilysin Source.2405: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain Source.2406: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10 Source.2407: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.2408: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.2409: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3 Source.2410: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A Source.2411: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a Source.2412: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15 Source.2413: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32 Source.2414: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2 Source.2415: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.2416: DFBPPR9792 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.2417: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.2418: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.2419: DFBPPR9811 ---- Animal proteins ---- Protein WAP-3 Source.2420: DFBPPR9822 ---- Animal proteins ---- Selenoprotein W Source.2421: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1 Source.2422: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2423: DFBPPR9847 ---- Animal proteins ---- Liver-expressed antimicrobial peptide 2 Source.2424: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase Source.2425: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.2426: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.2427: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2428: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1 Source.2429: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2430: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.2431: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.2432: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.2433: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.2434: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2435: DFBPPR9968 ---- Animal proteins ---- Beta-2-microglobulin Source.2436: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin Source.2437: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.2438: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.2439: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.2440: DFBPPR10004 ---- Animal proteins ---- Spastin Source.2441: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.2442: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6 Source.2443: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.2444: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I Source.2445: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.2446: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.2447: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.2448: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.2449: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.2450: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2451: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4 Source.2452: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2453: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.2454: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.2455: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1 Source.2456: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.2457: DFBPPR10107 ---- Animal proteins ---- Ovomucoid Source.2458: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.2459: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.2460: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.2461: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.2462: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.2463: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.2464: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.2465: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5 Source.2466: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2467: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.2468: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.2469: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.2470: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.2471: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.2472: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.2473: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.2474: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2 Source.2475: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.2476: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2477: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2478: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.2479: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.2480: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.2481: DFBPPR10218 ---- Animal proteins ---- Occludin Source.2482: DFBPPR10219 ---- Animal proteins ---- Presenilin-1 Source.2483: DFBPPR10226 ---- Animal proteins ---- GTPase HRas Source.2484: DFBPPR10228 ---- Animal proteins ---- Presenilin-2 Source.2485: DFBPPR10231 ---- Animal proteins ---- Basigin Source.2486: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.2487: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.2488: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.2489: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.2490: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1 Source.2491: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.2492: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein Source.2493: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2494: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1 Source.2495: DFBPPR10271 ---- Animal proteins ---- Cadherin-7 Source.2496: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.2497: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.2498: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.2499: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2500: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.2501: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.2502: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.2503: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.2504: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.2505: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.2506: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2507: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.2508: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.2509: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.2510: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2511: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.2512: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2513: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2514: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.2515: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.2516: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.2517: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.2518: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2519: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.2520: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.2521: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.2522: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.2523: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.2524: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.2525: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.2526: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.2527: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.2528: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.2529: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.2530: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.2531: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2 Source.2532: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta Source.2533: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.2534: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2 Source.2535: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.2536: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.2537: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.2538: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2539: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.2540: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.2541: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1 Source.2542: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.2543: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.2544: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.2545: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6 Source.2546: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin Source.2547: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1 Source.2548: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.2549: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.2550: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2551: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.2552: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.2553: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.2554: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.2555: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.2556: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.2557: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2558: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.2559: DFBPPR10634 ---- Animal proteins ---- Procathepsin L Source.2560: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.2561: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2562: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.2563: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.2564: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.2565: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.2566: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.2567: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.2568: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.2569: DFBPPR10709 ---- Animal proteins ---- Docking protein 3 Source.2570: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2571: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.2572: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2573: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.2574: DFBPPR10755 ---- Animal proteins ---- Draxin Source.2575: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.2576: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.2577: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2 Source.2578: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4 Source.2579: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.2580: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.2581: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.2582: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.2583: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.2584: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.2585: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.2586: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.2587: DFBPPR10837 ---- Animal proteins ---- GTPase NRas Source.2588: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2589: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.2590: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.2591: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.2592: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152 Source.2593: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2 Source.2594: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.2595: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.2596: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.2597: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.2598: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.2599: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor Source.2600: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.2601: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta Source.2602: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.2603: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.2604: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.2605: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.2606: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.2607: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.2608: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.2609: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.2610: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.2611: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2612: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.2613: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.2614: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.2615: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.2616: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.2617: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.2618: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.2619: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.2620: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.2621: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.2622: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.2623: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.2624: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.2625: DFBPPR11118 ---- Animal proteins ---- Filensin Source.2626: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5 Source.2627: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.2628: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.2629: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2630: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.2631: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.2632: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1 Source.2633: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.2634: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.2635: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38 Source.2636: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.2637: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.2638: DFBPPR11243 ---- Animal proteins ---- Epiphycan Source.2639: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.2640: DFBPPR11260 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8A Source.2641: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.2642: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3 Source.2643: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.2644: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein Source.2645: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.2646: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.2647: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.2648: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.2649: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2 Source.2650: DFBPPR11358 ---- Animal proteins ---- Lysozyme g Source.2651: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.2652: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.2653: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.2654: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B Source.2655: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.2656: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.2657: DFBPPR11387 ---- Animal proteins ---- Amphiphysin Source.2658: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.2659: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.2660: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2661: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.2662: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1 Source.2663: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1 Source.2664: DFBPPR11475 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-B Source.2665: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3 Source.2666: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X Source.2667: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.2668: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29 Source.2669: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.2670: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.2671: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.2672: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.2673: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.2674: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog Source.2675: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4 Source.2676: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.2677: DFBPPR11578 ---- Animal proteins ---- Lymphocyte antigen 86 Source.2678: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.2679: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.2680: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.2681: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2682: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.2683: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.2684: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2685: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2 Source.2686: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.2687: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2688: DFBPPR11651 ---- Animal proteins ---- Vitelline membrane outer layer protein 1 Source.2689: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2690: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.2691: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.2692: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain Source.2693: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit Source.2694: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2695: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2696: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1 Source.2697: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.2698: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.2699: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3 Source.2700: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2 Source.2701: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.2702: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.2703: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.2704: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.2705: DFBPPR11789 ---- Animal proteins ---- NF-kappa-B inhibitor-interacting Ras-like protein 2 Source.2706: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1 Source.2707: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62 Source.2708: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27 Source.2709: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.2710: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2711: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.2712: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2713: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.2714: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.2715: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.2716: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.2717: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.2718: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C Source.2719: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.2720: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.2721: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2 Source.2722: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B Source.2723: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2724: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.2725: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.2726: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.2727: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2728: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.2729: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.2730: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.2731: DFBPPR11995 ---- Animal proteins ---- Protein orai-2 Source.2732: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.2733: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.2734: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.2735: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.2736: DFBPPR12041 ---- Animal proteins ---- Paladin Source.2737: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.2738: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.2739: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.2740: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.2741: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121 Source.2742: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.2743: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic Source.2744: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.2745: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2746: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.2747: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial Source.2748: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3 Source.2749: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.2750: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.2751: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.2752: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.2753: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.2754: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.2755: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3 Source.2756: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.2757: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.2758: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2759: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2760: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.2761: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2762: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.2763: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.2764: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2765: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2766: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3 Source.2767: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.2768: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.2769: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2770: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5 Source.2771: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2772: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.2773: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.2774: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.2775: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.2776: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.2777: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.2778: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.2779: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2780: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.2781: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.2782: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2783: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.2784: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.2785: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.2786: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2787: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.2788: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2789: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.2790: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2 Source.2791: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2792: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.2793: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.2794: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.2795: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2 Source.2796: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.2797: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.2798: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.2799: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2800: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.2801: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.2802: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.2803: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.2804: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2805: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.2806: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.2807: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3 Source.2808: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2809: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109 Source.2810: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.2811: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.2812: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.2813: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.2814: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2815: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.2816: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2817: DFBPPR12554 ---- Animal proteins ---- Ras-related protein Rab-7a Source.2818: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.2819: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.2820: DFBPPR12575 ---- Animal proteins ---- CD63 antigen Source.2821: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.2822: DFBPPR12583 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.2823: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2824: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.2825: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.2826: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.2827: DFBPPR12607 ---- Animal proteins ---- Basigin Source.2828: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4 Source.2829: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase Source.2830: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2831: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.2832: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain Source.2833: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.2834: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2835: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.2836: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.2837: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.2838: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2839: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.2840: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor Source.2841: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.2842: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.2843: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.2844: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.2845: DFBPPR12728 ---- Animal proteins ---- Cytochrome b Source.2846: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2847: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2848: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.2849: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1 Source.2850: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2851: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.2852: DFBPPR12762 ---- Animal proteins ---- SPARC Source.2853: DFBPPR12772 ---- Animal proteins ---- Colipase Source.2854: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.2855: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.2856: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain Source.2857: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.2858: DFBPPR12787 ---- Animal proteins ---- Protein S100-A12 Source.2859: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.2860: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.2861: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6 Source.2862: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.2863: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma Source.2864: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B Source.2865: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.2866: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.2867: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor Source.2868: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.2869: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein Source.2870: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.2871: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.2872: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.2873: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.2874: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.2875: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.2876: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.2877: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.2878: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.2879: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A Source.2880: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.2881: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B Source.2882: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.2883: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.2884: DFBPPR12948 ---- Animal proteins ---- Apolipoprotein C-IV Source.2885: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.2886: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3 Source.2887: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.2888: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.2889: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.2890: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.2891: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.2892: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.2893: DFBPPR13028 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.2894: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5 Source.2895: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2896: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.2897: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form Source.2898: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region Source.2899: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2 Source.2900: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain Source.2901: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2902: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region Source.2903: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2904: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2905: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2906: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2907: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.2908: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.2909: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.2910: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2911: DFBPPR13195 ---- Animal proteins ---- Albumin Source.2912: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.2913: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23 Source.2914: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.2915: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.2916: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein Source.2917: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2918: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B Source.2919: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.2920: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta Source.2921: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2 Source.2922: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2923: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.2924: DFBPPR13275 ---- Animal proteins ---- Interleukin-6 Source.2925: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.2926: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.2927: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.2928: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha Source.2929: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2930: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2931: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.2932: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2933: DFBPPR13361 ---- Animal proteins ---- Protein S100-G Source.2934: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.2935: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.2936: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.2937: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2938: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22 Source.2939: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2940: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.2941: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.2942: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase Source.2943: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.2944: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.2945: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A Source.2946: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2947: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.2948: DFBPPR13464 ---- Animal proteins ---- Interferon tau Source.2949: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.2950: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.2951: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.2952: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.2953: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2954: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.2955: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.2956: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase Source.2957: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.2958: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.2959: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2960: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.2961: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.2962: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.2963: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.2964: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2965: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.2966: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.2967: DFBPPR13613 ---- Animal proteins ---- Phospholipase A2 Source.2968: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.2969: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta Source.2970: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2971: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.2972: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2 Source.2973: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2974: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.2975: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6 Source.2976: DFBPPR13646 ---- Animal proteins ---- Procathepsin L Source.2977: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2978: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11 Source.2979: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic Source.2980: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.2981: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.2982: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1 Source.2983: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.2984: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.2985: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.2986: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d Source.2987: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10 Source.2988: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2989: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5 Source.2990: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9 Source.2991: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8 Source.2992: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7 Source.2993: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4 Source.2994: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2995: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.2996: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.2997: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24 Source.2998: DFBPPR13804 ---- Animal proteins ---- Calcium and integrin-binding family member 2 Source.2999: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3 Source.3000: DFBPPR13834 ---- Animal proteins ---- Biglycan Source.3001: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.3002: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.3003: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.3004: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.3005: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.3006: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.3007: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.3008: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3 Source.3009: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.3010: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter Source.3011: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2 Source.3012: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3013: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1 Source.3014: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3015: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.3016: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1 Source.3017: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.3018: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.3019: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3020: DFBPPR14010 ---- Animal proteins ---- GTPase KRas Source.3021: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3022: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2 Source.3023: DFBPPR14014 ---- Animal proteins ---- Somatotropin Source.3024: DFBPPR14017 ---- Animal proteins ---- Ependymin Source.3025: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3026: DFBPPR14046 ---- Animal proteins ---- Myoglobin Source.3027: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.3028: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B Source.3029: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha Source.3030: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran Source.3031: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1 Source.3032: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.3033: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.3034: DFBPPR14128 ---- Marine protein ---- F-box/LRR-repeat protein 15 Source.3035: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase Source.3036: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.3037: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.3038: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial Source.3039: DFBPPR14168 ---- Marine protein ---- Transcription and mRNA export factor ENY2-2 Source.3040: DFBPPR14169 ---- Marine protein ---- Transcription and mRNA export factor ENY2-1 Source.3041: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.3042: DFBPPR14178 ---- Marine protein ---- Hepcidin-1 Source.3043: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.3044: DFBPPR14185 ---- Marine protein ---- Parvalbumin beta 1 Source.3045: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein Source.3046: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein Source.3047: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9 Source.3048: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial Source.3049: DFBPPR14270 ---- Marine protein ---- Myoglobin Source.3050: DFBPPR14298 ---- Marine protein ---- Acetolactate synthase small subunit Source.3051: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.3052: DFBPPR14343 ---- Marine protein ---- Anthranilate synthase component 2 Source.3053: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.3054: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase Source.3055: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.3056: DFBPPR14358 ---- Marine protein ---- Thiazole synthase Source.3057: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit Source.3058: DFBPPR14366 ---- Marine protein ---- Thioredoxin Source.3059: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.3060: DFBPPR14394 ---- Marine protein ---- Cytochrome b6-f complex subunit 7 Source.3061: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic Source.3062: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.3063: DFBPPR14459 ---- Marine protein ---- Photosystem II reaction center protein Z Source.3064: DFBPPR14466 ---- Marine protein ---- 30S ribosomal protein S11, chloroplastic Source.3065: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic Source.3066: DFBPPR14480 ---- Marine protein ---- Photosystem II reaction center protein Ycf12 Source.3067: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein Source.3068: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.3069: DFBPPR14506 ---- Marine protein ---- Photosystem I reaction center subunit IV Source.3070: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.3071: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92 Source.3072: DFBPPR14528 ---- Marine protein ---- Uracil phosphoribosyltransferase homolog Source.3073: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.3074: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.3075: DFBPPR14547 ---- Marine protein ---- Interleukin-6 Source.3076: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.3077: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor Source.3078: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.3079: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.3080: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53 Source.3081: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.3082: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.3083: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2 Source.3084: DFBPPR14597 ---- Marine protein ---- Parvalbumin beta 1 Source.3085: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.3086: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha Source.3087: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.3088: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.3089: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.3090: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.3091: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.3092: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.3093: DFBPPR14745 ---- Marine protein ---- Parvalbumin beta 2 Source.3094: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1 Source.3095: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.3096: DFBPPR14798 ---- Marine protein ---- Panusin Source.3097: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.3098: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.3099: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.3100: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.3101: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.3102: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.3103: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4 Source.3104: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.3105: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.3106: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.3107: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.3108: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.3109: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.3110: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32 Source.3111: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.3112: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.3113: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2 Source.3114: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.3115: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.3116: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.3117: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.3118: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.3119: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.3120: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.3121: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.3122: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8 Source.3123: DFBPPR15018 ---- Microorganism protein ---- Sorting nexin-4 Source.3124: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.3125: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.3126: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.3127: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.3128: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.3129: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.3130: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.3131: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.3132: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase Source.3133: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial Source.3134: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.3135: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.3136: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.3137: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.3138: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.3139: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.3140: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.3141: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.3142: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase Source.3143: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.3144: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.3145: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase Source.3146: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.3147: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2 Source.3148: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.3149: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.3150: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.3151: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.3152: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1 Source.3153: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.3154: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.3155: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.3156: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20 Source.3157: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.3158: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2 Source.3159: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase Source.3160: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25 Source.3161: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.3162: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.3163: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14 Source.3164: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.3165: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3 Source.3166: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.3167: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter Source.3168: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter Source.3169: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.3170: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.3171: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1 Source.3172: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.3173: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.3174: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.3175: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.3176: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.3177: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.3178: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.3179: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1 Source.3180: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71 Source.3181: DFBPPR15424 ---- Microorganism protein ---- Diphthamide biosynthesis protein 4 Source.3182: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.3183: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3 Source.3184: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter Source.3185: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.3186: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.3187: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.3188: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.3189: DFBPPR15474 ---- Microorganism protein ---- GPN-loop GTPase 3 Source.3190: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.3191: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6 Source.3192: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.3193: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.3194: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6 Source.3195: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.3196: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.3197: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.3198: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28 Source.3199: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1 Source.3200: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.3201: DFBPPR15601 ---- Microorganism protein ---- Ubiquitin-like modifier HUB1 Source.3202: DFBPPR15688 ---- Microorganism protein ---- Nuclear transport factor 2 Source.3203: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3 Source.3204: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1 Source.3205: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1 Source.3206: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2 Source.3207: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4 Source.3208: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog Source.3209: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial Source.3210: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.3211: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial Source.3212: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4 Source.3213: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.3214: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32 Source.3215: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase Source.3216: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.3217: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.3218: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase Source.3219: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.3220: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.3221: DFBPPR15840 ---- Microorganism protein ---- Protein RecA Source.3222: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.3223: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase Source.3224: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.3225: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.3226: DFBPPR15856 ---- Microorganism protein ---- Laccase-2 Source.3227: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.3228: DFBPPR15865 ---- Microorganism protein ---- Hydrophobin-1 Source.3229: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2 Source.3230: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.3231: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.3232: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.3233: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog Source.3234: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.3235: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.3236: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.3237: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.3238: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.3239: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.3240: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.3241: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3242: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.3243: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.3244: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.3245: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3246: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.3247: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.3248: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a Source.3249: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.3250: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.3251: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.3252: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.3253: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.3254: DFBPPR7843 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.3255: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.3256: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.3257: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.3258: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.3259: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a Source.3260: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1 Source.3261: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z Source.3262: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.3263: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2 Source.3264: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1 Source.3265: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.3266: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.3267: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3268: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.3269: DFBPPR7960 ---- Plant protein ---- Vicilin Source.3270: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.3271: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1 Source.3272: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.3273: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.3274: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.3275: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.3276: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.3277: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4 Source.3278: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.3279: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.3280: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3281: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.3282: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3283: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.3284: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.3285: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.3286: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.3287: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3288: DFBPPR8115 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.3289: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.3290: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1 Source.3291: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.3292: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.3293: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.3294: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.3295: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.3296: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.3297: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.3298: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.3299: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.3300: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.3301: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3302: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.3303: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.3304: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.3305: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3306: DFBPPR8292 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.3307: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.3308: DFBPPR8307 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic Source.3309: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3 Source.3310: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.3311: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII Source.3312: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide VLV showed moderate antioxidant activity with a relative antioxidant activity of 3.36 ± 0.25 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015