Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0912(Antioxidative peptide)

DFBP ID	DFBPANOX0912
Peptide sequence	VLD
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Val-Leu-Asp

Single-letter amino acid

VLD

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	345.39 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.13 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.5000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.4: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.5: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.6: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5 Source.7: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.8: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.9: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.10: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.11: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.12: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.13: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.14: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.15: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.16: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.17: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.18: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.19: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.20: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2 Source.21: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.22: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.23: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.24: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.25: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.26: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.27: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.28: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.29: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.30: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.31: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.32: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.33: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.34: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.35: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.36: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.37: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.38: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.39: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1 Source.40: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.41: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.42: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4 Source.43: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.44: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.45: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.46: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.47: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A Source.48: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.49: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.50: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.51: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.52: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.53: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.54: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.55: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.56: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.57: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.58: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.59: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.60: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.61: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.62: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3 Source.63: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.64: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial Source.65: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.66: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.67: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.68: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.69: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.70: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.71: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.72: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.73: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.74: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.75: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial Source.76: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.77: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.78: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.79: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.80: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.81: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.82: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24 Source.83: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.84: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.85: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.86: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.87: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.88: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.89: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B Source.90: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.91: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.92: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.93: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.94: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.95: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.96: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.97: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.98: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.99: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12 Source.100: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.101: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.102: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.103: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.104: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.105: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.106: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.107: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.108: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.109: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.110: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.111: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.112: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.113: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.114: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.115: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3 Source.116: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.117: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.118: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.119: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.120: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.121: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.122: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.123: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.124: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.125: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.126: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.127: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.128: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.129: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.130: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.131: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.132: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.133: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1 Source.134: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.135: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.136: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.137: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.138: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.139: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.140: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.141: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.142: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.143: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.144: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.145: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.146: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.147: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.148: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.149: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.150: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.151: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.152: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.153: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.154: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.155: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.156: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.157: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.158: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.159: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.160: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.161: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.162: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.163: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.164: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.165: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.166: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.167: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094 Source.168: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.169: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.170: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.171: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.172: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.173: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.174: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.175: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.176: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.177: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.178: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.179: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.180: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.181: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.182: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.183: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.184: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.185: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.186: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.187: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.188: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.189: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.190: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.191: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.192: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.193: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.194: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.195: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.196: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.197: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.198: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.199: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.200: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.201: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.202: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.203: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.204: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.205: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.206: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a Source.207: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.208: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.209: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.210: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.211: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.212: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.213: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.214: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.215: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.216: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.217: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.218: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.219: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.220: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.221: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.222: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.223: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.224: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1 Source.225: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.226: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.227: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.228: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.229: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.230: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.231: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1 Source.232: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1 Source.233: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.234: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.235: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.236: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1 Source.237: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.238: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.239: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.240: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.241: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.242: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.243: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9 Source.244: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.245: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.246: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.247: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.248: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha Source.249: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.250: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.251: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.252: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.253: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.254: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.255: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.256: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.257: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.258: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.259: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.260: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.261: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.262: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.263: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.264: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.265: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.266: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase Source.267: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.268: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089 Source.269: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.270: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3 Source.271: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.272: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.273: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.274: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.275: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.276: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.277: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.278: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.279: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.280: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.281: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.282: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.283: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.284: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.285: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.286: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.287: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.288: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.289: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase Source.290: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4 Source.291: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.292: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.293: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic Source.294: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.295: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.296: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.297: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.298: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2 Source.299: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.300: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2 Source.301: DFBPPR2625 ---- Plant proteins ---- 18.6 kDa class III heat shock protein Source.302: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.303: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.304: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.305: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.306: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.307: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2 Source.308: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.309: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.310: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.311: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.312: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.313: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.314: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.315: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.316: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.317: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.318: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.319: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.320: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.321: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.322: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.323: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.324: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.325: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic Source.326: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.327: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.328: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.329: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.330: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.331: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.332: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.333: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.334: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase Source.335: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.336: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1 Source.337: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.338: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.339: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.340: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.341: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.342: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.343: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.344: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.345: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.346: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.347: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.348: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.349: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.350: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.351: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.352: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.353: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.354: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.355: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.356: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.357: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1 Source.358: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.359: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase Source.360: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.361: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.362: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.363: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.364: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.365: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.366: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.367: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.368: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.369: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.370: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.371: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.372: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.373: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.374: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.375: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial Source.376: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.377: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.378: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.379: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.380: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.381: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.382: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.383: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.384: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6 Source.385: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.386: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.387: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.388: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.389: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.390: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.391: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.392: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.393: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.394: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.395: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.396: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain Source.397: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.398: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS Source.399: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.400: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.401: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase Source.402: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3 Source.403: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.404: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.405: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.406: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.407: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.408: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.409: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7 Source.410: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C Source.411: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.412: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.413: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.414: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.415: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.416: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.417: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.418: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.419: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.420: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.421: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.422: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.423: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.424: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.425: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.426: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.427: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.428: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.429: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.430: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6 Source.431: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.432: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.433: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.434: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.435: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4 Source.436: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.437: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.438: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.439: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58 Source.440: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.441: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.442: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.443: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1 Source.444: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.445: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e Source.446: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.447: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1 Source.448: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.449: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.450: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.451: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.452: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.453: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.454: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin Source.455: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.456: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.457: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41 Source.458: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.459: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.460: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.461: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.462: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic Source.463: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.464: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.465: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.466: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.467: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.468: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.469: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.470: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.471: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900 Source.472: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.473: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.474: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.475: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.476: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.477: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1 Source.478: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.479: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.480: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial Source.481: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.482: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.483: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.484: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.485: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.486: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.487: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.488: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.489: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.490: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.491: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3 Source.492: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.493: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.494: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.495: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.496: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.497: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.498: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.499: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.500: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.501: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.502: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial Source.503: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.504: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.505: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.506: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.507: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.508: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.509: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.510: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.511: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.512: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.513: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.514: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.515: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.516: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11 Source.517: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.518: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.519: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.520: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.521: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.522: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.523: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.524: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1 Source.525: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.526: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.527: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.528: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4 Source.529: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.530: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.531: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.532: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.533: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.534: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.535: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1 Source.536: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.537: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.538: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.539: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.540: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.541: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.542: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.543: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.544: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.545: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.546: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.547: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H Source.548: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.549: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.550: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.551: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.552: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.553: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.554: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.555: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.556: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.557: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.558: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.559: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.560: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.561: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.562: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.563: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.564: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.565: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.566: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.567: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.568: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.569: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.570: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.571: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.572: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.573: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.574: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.575: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.576: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.577: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.578: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.579: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.580: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.581: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.582: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.583: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.584: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.585: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.586: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.587: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2 Source.588: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.589: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.590: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.591: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.592: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6 Source.593: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.594: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.595: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.596: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.597: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.598: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7 Source.599: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.600: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5 Source.601: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.602: DFBPPR4576 ---- Plant proteins ---- Probable calcium-binding protein CML7 Source.603: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.604: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.605: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.606: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.607: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4 Source.608: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.609: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5 Source.610: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43 Source.611: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1 Source.612: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.613: DFBPPR4658 ---- Plant proteins ---- 60S ribosomal protein L9 Source.614: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.615: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1 Source.616: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.617: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.618: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.619: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.620: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.621: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.622: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900 Source.623: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42 Source.624: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.625: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.626: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.627: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.628: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.629: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.630: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.631: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.632: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.633: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial Source.634: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.635: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.636: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.637: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1 Source.638: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.639: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.640: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.641: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.642: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.643: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A Source.644: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.645: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.646: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.647: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.648: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.649: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.650: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.651: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2 Source.652: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.653: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.654: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.655: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.656: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.657: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.658: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha Source.659: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.660: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1 Source.661: DFBPPR5185 ---- Plant proteins ---- Actin-1 Source.662: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.663: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.664: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.665: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.666: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.667: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.668: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B Source.669: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1 Source.670: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2 Source.671: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.672: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.673: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.674: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.675: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1 Source.676: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.677: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1 Source.678: DFBPPR5354 ---- Plant proteins ---- Protein P21 Source.679: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.680: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.681: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.682: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.683: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.684: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.685: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.686: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.687: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.688: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.689: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.690: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.691: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.692: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.693: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1 Source.694: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.695: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.696: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.697: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.698: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.699: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.700: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.701: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.702: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.703: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.704: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.705: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.706: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.707: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.708: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase Source.709: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.710: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.711: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.712: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.713: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.714: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.715: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.716: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7 Source.717: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.718: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.719: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.720: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.721: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.722: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.723: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.724: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.725: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.726: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.727: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.728: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase Source.729: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.730: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.731: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A Source.732: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.733: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.734: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.735: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.736: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.737: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.738: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.739: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.740: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.741: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.742: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.743: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.744: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.745: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.746: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.747: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.748: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.749: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.750: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.751: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.752: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.753: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1 Source.754: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2 Source.755: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.756: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.757: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase Source.758: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.759: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.760: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.761: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.762: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha Source.763: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.764: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.765: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19 Source.766: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.767: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.768: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.769: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.770: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.771: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.772: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.773: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.774: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.775: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.776: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.777: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.778: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.779: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3 Source.780: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.781: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.782: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.783: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase Source.784: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.785: DFBPPR6024 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.786: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4 Source.787: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.788: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.789: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B Source.790: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA Source.791: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A Source.792: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.793: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase Source.794: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.795: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.796: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein Source.797: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.798: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.799: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.800: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.801: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.802: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein Source.803: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta Source.804: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.805: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.806: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial Source.807: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.808: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase Source.809: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.810: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.811: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.812: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.813: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.814: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.815: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.816: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.817: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.818: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.819: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.820: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.821: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.822: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.823: DFBPPR6453 ---- Plant proteins ---- Convicilin Source.824: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.825: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.826: DFBPPR6470 ---- Plant proteins ---- Vicilin Source.827: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.828: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.829: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic Source.830: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.831: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.832: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.833: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A Source.834: DFBPPR6563 ---- Plant proteins ---- 60S ribosomal protein L9 Source.835: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.836: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.837: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.838: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.839: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.840: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase Source.841: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic Source.842: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.843: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.844: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.845: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.846: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.847: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.848: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase Source.849: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.850: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.851: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.852: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.853: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.854: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.855: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase Source.856: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.857: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.858: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.859: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha Source.860: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.861: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.862: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.863: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.864: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.865: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.866: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.867: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.868: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1 Source.869: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.870: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.871: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.872: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.873: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.874: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.875: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.876: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.877: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4 Source.878: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.879: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.880: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.881: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.882: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.883: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic Source.884: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha Source.885: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.886: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.887: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.888: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.889: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain Source.890: DFBPPR7209 ---- Plant proteins ---- Photosystem I reaction center subunit psaK, chloroplastic Source.891: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.892: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2 Source.893: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.894: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.895: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.896: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.897: DFBPPR7317 ---- Plant proteins ---- Horcolin Source.898: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.899: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1 Source.900: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2 Source.901: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein Source.902: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor Source.903: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.904: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.905: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.906: DFBPPR7417 ---- Plant proteins ---- Cruciferin Source.907: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.908: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.909: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.910: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.911: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1 Source.912: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1 Source.913: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.914: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.915: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.916: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1 Source.917: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.918: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.919: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.920: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.921: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.922: DFBPPR7499 ---- Plant proteins ---- Ferredoxin Source.923: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.924: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.925: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.926: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.927: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.928: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.929: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4 Source.930: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein Source.931: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.932: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.933: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.934: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.935: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.936: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.937: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.938: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.939: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.940: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.941: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.942: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.943: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.944: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.945: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.946: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.947: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.948: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.949: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.950: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.951: DFBPPR8370 ---- Plant proteins ---- Maturase K Source.952: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.953: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.954: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.955: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.956: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.957: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.958: DFBPPR8458 ---- Plant proteins ---- Catalase Source.959: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.960: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.961: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.962: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.963: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.964: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.965: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.966: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.967: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.968: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.969: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.970: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.971: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.972: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.973: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.974: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.975: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.976: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.977: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.978: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.979: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.980: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.981: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.982: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.983: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.984: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.985: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.986: DFBPPR16110 ---- Animal proteins ---- Pro-glucagon Source.987: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66 Source.988: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.989: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.990: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.991: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.992: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.993: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.994: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.995: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.996: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.997: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A Source.998: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.999: DFBPPR16189 ---- Animal proteins ---- Albumin Source.1000: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1001: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1002: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1003: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.1004: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1005: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain Source.1006: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.1007: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.1008: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.1009: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1010: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.1011: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1012: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor Source.1013: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1014: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1015: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.1016: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.1017: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1018: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1019: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1020: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1021: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1022: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.1023: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.1024: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1025: DFBPPR16467 ---- Animal proteins ---- Opticin Source.1026: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase Source.1027: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N Source.1028: DFBPPR16502 ---- Animal proteins ---- Natural killer cells antigen CD94 Source.1029: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.1030: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein Source.1031: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1032: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.1033: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1034: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan Source.1035: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.1036: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1037: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a Source.1038: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.1039: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S Source.1040: DFBPPR16593 ---- Animal proteins ---- Calcyphosin Source.1041: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9 Source.1042: DFBPPR16680 ---- Animal proteins ---- Gastrin-releasing peptide Source.1043: DFBPPR16689 ---- Animal proteins ---- Gamma-crystallin B Source.1044: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.1045: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1046: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.1047: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.1048: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.1049: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1050: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1051: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta Source.1052: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1053: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.1054: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.1055: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.1056: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1057: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1058: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.1059: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1060: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.1061: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain Source.1062: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1063: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1064: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1065: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.1066: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.1067: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor Source.1068: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1069: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.1070: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.1071: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1072: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1 Source.1073: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.1074: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.1075: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.1076: DFBPPR17014 ---- Animal proteins ---- Microtubule-associated proteins 1A/1B light chain 3B Source.1077: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.1078: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.1079: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1080: DFBPPR17037 ---- Animal proteins ---- Annexin A1 Source.1081: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1082: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.1083: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.1084: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.1085: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1086: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.1087: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1088: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.1089: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.1090: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.1091: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.1092: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.1093: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1094: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog Source.1095: DFBPPR17133 ---- Animal proteins ---- Pro-glucagon Source.1096: DFBPPR17134 ---- Animal proteins ---- Pro-glucagon Source.1097: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1098: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1 Source.1099: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1 Source.1100: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1 Source.1101: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein Source.1102: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.1103: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.1104: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1105: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1106: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.1107: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.1108: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1109: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1110: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B Source.1111: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1112: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1113: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.1114: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1115: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.1116: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1 Source.1117: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.1118: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.1119: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.1120: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II Source.1121: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.1122: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1123: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.1124: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.1125: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6 Source.1126: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1127: DFBPPR17376 ---- Animal proteins ---- Flotillin-1 Source.1128: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.1129: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.1130: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.1131: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.1132: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD Source.1133: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.1134: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.1135: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1136: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1137: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.1138: DFBPPR17423 ---- Animal proteins ---- Furin Source.1139: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.1140: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.1141: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein Source.1142: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1143: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.1144: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.1145: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1146: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.1147: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.1148: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.1149: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.1150: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.1151: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.1152: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1153: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1 Source.1154: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.1155: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.1156: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1157: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.1158: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.1159: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.1160: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.1161: DFBPPR17586 ---- Animal proteins ---- Dermatopontin Source.1162: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.1163: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1164: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1165: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1166: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16 Source.1167: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.1168: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1169: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1170: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.1171: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1172: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD Source.1173: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.1174: DFBPPR17768 ---- Animal proteins ---- Microtubule-associated proteins 1A/1B light chain 3A Source.1175: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.1176: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.1177: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.1178: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1179: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1180: DFBPPR17807 ---- Animal proteins ---- Opticin Source.1181: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.1182: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.1183: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.1184: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.1185: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.1186: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.1187: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1188: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.1189: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.1190: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase Source.1191: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1192: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1193: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.1194: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1195: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1196: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1197: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.1198: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.1199: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.1200: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.1201: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.1202: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1203: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1204: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.1205: DFBPPR17954 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member A Source.1206: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.1207: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3 Source.1208: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2 Source.1209: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.1210: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1211: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.1212: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.1213: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1214: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1215: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.1216: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1217: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.1218: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1 Source.1219: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.1220: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1221: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1222: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.1223: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C Source.1224: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.1225: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.1226: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.1227: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.1228: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.1229: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.1230: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1231: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.1232: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1 Source.1233: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41 Source.1234: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1235: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.1236: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase Source.1237: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1238: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.1239: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain Source.1240: DFBPPR18313 ---- Animal proteins ---- Septin-12 Source.1241: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial Source.1242: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.1243: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.1244: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.1245: DFBPPR18354 ---- Animal proteins ---- Charged multivesicular body protein 2b Source.1246: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase Source.1247: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.1248: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1249: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4 Source.1250: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1251: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.1252: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1253: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5 Source.1254: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.1255: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.1256: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.1257: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.1258: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.1259: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.1260: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1 Source.1261: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos Source.1262: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1263: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.1264: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.1265: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1266: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.1267: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.1268: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6 Source.1269: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.1270: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.1271: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.1272: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit Source.1273: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain Source.1274: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.1275: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain Source.1276: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain Source.1277: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.1278: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.1279: DFBPPR18552 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 8 Source.1280: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.1281: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.1282: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1283: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.1284: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1285: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.1286: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase Source.1287: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.1288: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.1289: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.1290: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1291: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.1292: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1293: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.1294: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.1295: DFBPPR18703 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase Source.1296: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.1297: DFBPPR18732 ---- Animal proteins ---- RNA-binding protein 8A Source.1298: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.1299: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.1300: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.1301: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.1302: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.1303: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.1304: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.1305: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.1306: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.1307: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.1308: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.1309: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.1310: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.1311: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.1312: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase Source.1313: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1314: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.1315: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1316: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.1317: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1318: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1 Source.1319: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.1320: DFBPPR18855 ---- Animal proteins ---- Tubulin-specific chaperone A Source.1321: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1322: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.1323: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.1324: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1325: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.1326: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.1327: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.1328: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase Source.1329: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10 Source.1330: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1 Source.1331: DFBPPR18958 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein Source.1332: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7 Source.1333: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog Source.1334: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.1335: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6 Source.1336: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.1337: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.1338: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa Source.1339: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.1340: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic Source.1341: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19 Source.1342: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.1343: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.1344: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1345: DFBPPR19037 ---- Animal proteins ---- Transthyretin Source.1346: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.1347: DFBPPR19055 ---- Animal proteins ---- Complement factor D Source.1348: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.1349: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.1350: DFBPPR19084 ---- Animal proteins ---- V-type proton ATPase subunit G 1 Source.1351: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.1352: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.1353: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.1354: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.1355: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.1356: DFBPPR19131 ---- Animal proteins ---- Nectin-4 Source.1357: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.1358: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5 Source.1359: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.1360: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.1361: DFBPPR19158 ---- Animal proteins ---- Tuberoinfundibular peptide of 39 residues Source.1362: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein Source.1363: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.1364: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1365: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.1366: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.1367: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3 Source.1368: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4 Source.1369: DFBPPR19224 ---- Animal proteins ---- Fetuin-B Source.1370: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.1371: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1372: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.1373: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.1374: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.1375: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1376: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.1377: DFBPPR19280 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF183 Source.1378: DFBPPR19291 ---- Animal proteins ---- Multicilin Source.1379: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6 Source.1380: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.1381: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.1382: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.1383: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.1384: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial Source.1385: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1 Source.1386: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.1387: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.1388: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9 Source.1389: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.1390: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.1391: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1392: DFBPPR19384 ---- Animal proteins ---- Complement component C9 Source.1393: DFBPPR19389 ---- Animal proteins ---- Small nuclear ribonucleoprotein E Source.1394: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.1395: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A Source.1396: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.1397: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.1398: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4 Source.1399: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1400: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.1401: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.1402: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1 Source.1403: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.1404: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.1405: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.1406: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1407: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1408: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase Source.1409: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.1410: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein Source.1411: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1412: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.1413: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.1414: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.1415: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.1416: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.1417: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.1418: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.1419: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.1420: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog Source.1421: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.1422: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1423: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.1424: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25 Source.1425: DFBPPR19642 ---- Animal proteins ---- Agouti-related protein Source.1426: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.1427: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1428: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.1429: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.1430: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.1431: DFBPPR19695 ---- Animal proteins ---- Protein UXT Source.1432: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7 Source.1433: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.1434: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17 Source.1435: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.1436: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1437: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.1438: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.1439: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.1440: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog Source.1441: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.1442: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.1443: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1444: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.1445: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.1446: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.1447: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.1448: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.1449: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.1450: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.1451: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.1452: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1453: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.1454: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1455: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.1456: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial Source.1457: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.1458: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.1459: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.1460: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain Source.1461: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.1462: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.1463: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.1464: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.1465: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.1466: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1 Source.1467: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.1468: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.1469: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C Source.1470: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1 Source.1471: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.1472: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1473: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1 Source.1474: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1475: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.1476: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.1477: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.1478: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2 Source.1479: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.1480: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.1481: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O Source.1482: DFBPPR20098 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.1483: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.1484: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.1485: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A Source.1486: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.1487: DFBPPR20166 ---- Animal proteins ---- Programmed cell death protein 5 Source.1488: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.1489: DFBPPR20175 ---- Animal proteins ---- Selenoprotein K Source.1490: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.1491: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1492: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.1493: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.1494: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.1495: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1496: DFBPPR20283 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 1 Source.1497: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.1498: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.1499: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.1500: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.1501: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9 Source.1502: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3 Source.1503: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial Source.1504: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.1505: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.1506: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.1507: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.1508: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2 Source.1509: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1510: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1511: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.1512: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4 Source.1513: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.1514: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial Source.1515: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.1516: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a Source.1517: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1518: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1 Source.1519: DFBPPR20401 ---- Animal proteins ---- Bystin Source.1520: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2 Source.1521: DFBPPR20404 ---- Animal proteins ---- Protein tilB homolog Source.1522: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial Source.1523: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial Source.1524: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1525: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.1526: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C Source.1527: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38 Source.1528: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP Source.1529: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.1530: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54 Source.1531: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.1532: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase Source.1533: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1534: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.1535: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial Source.1536: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1537: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein Source.1538: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.1539: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.1540: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.1541: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein Source.1542: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1543: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.1544: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.1545: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C Source.1546: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3 Source.1547: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.1548: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial Source.1549: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial Source.1550: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.1551: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.1552: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.1553: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.1554: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1555: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.1556: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.1557: DFBPPR20766 ---- Animal proteins ---- Torsin-2A Source.1558: DFBPPR20767 ---- Animal proteins ---- GTP cyclohydrolase 1 feedback regulatory protein Source.1559: DFBPPR20787 ---- Animal proteins ---- UBX domain-containing protein 8 Source.1560: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.1561: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.1562: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1563: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.1564: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial Source.1565: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1566: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.1567: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.1568: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.1569: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.1570: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1 Source.1571: DFBPPR20874 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC2 Source.1572: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1 Source.1573: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2 Source.1574: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12 Source.1575: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog Source.1576: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial Source.1577: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4 Source.1578: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1 Source.1579: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog Source.1580: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.1581: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.1582: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.1583: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.1584: DFBPPR21038 ---- Animal proteins ---- Sodium channel modifier 1 Source.1585: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.1586: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.1587: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.1588: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.1589: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog Source.1590: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.1591: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha Source.1592: DFBPPR21117 ---- Animal proteins ---- Spindlin-2 Source.1593: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog Source.1594: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.1595: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52 Source.1596: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.1597: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2 Source.1598: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.1599: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.1600: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.1601: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.1602: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.1603: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.1604: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.1605: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1606: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha Source.1607: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34 Source.1608: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.1609: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1610: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.1611: DFBPPR21380 ---- Animal proteins ---- AP-4 complex subunit sigma-1 Source.1612: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.1613: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.1614: DFBPPR21415 ---- Animal proteins ---- Leucine-rich repeat-containing protein 39 Source.1615: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A Source.1616: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.1617: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.1618: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1619: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.1620: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.1621: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like Source.1622: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3 Source.1623: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1 Source.1624: DFBPPR21513 ---- Animal proteins ---- Profilin-3 Source.1625: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4 Source.1626: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19 Source.1627: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.1628: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.1629: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.1630: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.1631: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.1632: DFBPPR21575 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 6 Source.1633: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10 Source.1634: DFBPPR21590 ---- Animal proteins ---- Rhombotin-1 Source.1635: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.1636: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1637: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1 Source.1638: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial Source.1639: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7 Source.1640: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.1641: DFBPPR21674 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3B Source.1642: DFBPPR21676 ---- Animal proteins ---- ER membrane protein complex subunit 6 Source.1643: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11 Source.1644: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18 Source.1645: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.1646: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.1647: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial Source.1648: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A Source.1649: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7 Source.1650: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog Source.1651: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.1652: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1653: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1654: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.1655: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.1656: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.1657: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.1658: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1 Source.1659: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17 Source.1660: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.1661: DFBPPR21866 ---- Animal proteins ---- c-Myc-binding protein Source.1662: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.1663: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.1664: DFBPPR21901 ---- Animal proteins ---- Calcyphosin Source.1665: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.1666: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4 Source.1667: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.1668: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.1669: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.1670: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.1671: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.1672: DFBPPR21947 ---- Animal proteins ---- rRNA-processing protein UTP23 homolog Source.1673: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.1674: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.1675: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.1676: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.1677: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.1678: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1 Source.1679: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.1680: DFBPPR22030 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 25 kDa protein Source.1681: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.1682: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C Source.1683: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B Source.1684: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.1685: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.1686: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.1687: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41 Source.1688: DFBPPR22099 ---- Animal proteins ---- Beta-centractin Source.1689: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.1690: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1 Source.1691: DFBPPR22134 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8 Source.1692: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.1693: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1 Source.1694: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24 Source.1695: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.1696: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1697: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.1698: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1699: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36 Source.1700: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22 Source.1701: DFBPPR22234 ---- Animal proteins ---- COMM domain-containing protein 3 Source.1702: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.1703: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.1704: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.1705: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1706: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1 Source.1707: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1 Source.1708: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.1709: DFBPPR22283 ---- Animal proteins ---- F-box only protein 8 Source.1710: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial Source.1711: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein Source.1712: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80 Source.1713: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.1714: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1 Source.1715: DFBPPR22380 ---- Animal proteins ---- G patch domain-containing protein 4 Source.1716: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.1717: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10 Source.1718: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.1719: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3 Source.1720: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.1721: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1 Source.1722: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog Source.1723: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B Source.1724: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.1725: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2 Source.1726: DFBPPR22466 ---- Animal proteins ---- Transcription factor BTF3 homolog 4 Source.1727: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.1728: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B Source.1729: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169 Source.1730: DFBPPR22533 ---- Animal proteins ---- Coiled-coil domain-containing protein 160 Source.1731: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B Source.1732: DFBPPR22546 ---- Animal proteins ---- ADP-ribosylation factor-like protein 15 Source.1733: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2 Source.1734: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187 Source.1735: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.1736: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.1737: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54 Source.1738: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61 Source.1739: DFBPPR22639 ---- Animal proteins ---- UPF0235 protein C15orf40 homolog Source.1740: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.1741: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog Source.1742: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8 Source.1743: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein Source.1744: DFBPPR22719 ---- Animal proteins ---- Uncharacterized protein C12orf45 homolog Source.1745: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog Source.1746: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.1747: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1748: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.1749: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1750: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.1751: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1752: DFBPPR8589 ---- Animal proteins ---- Pro-glucagon Source.1753: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2 Source.1754: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.1755: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.1756: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1757: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.1758: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.1759: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.1760: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.1761: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.1762: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1763: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.1764: DFBPPR8668 ---- Animal proteins ---- Annexin A1 Source.1765: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.1766: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1767: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.1768: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.1769: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1770: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.1771: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.1772: DFBPPR8707 ---- Animal proteins ---- Flotillin-1 Source.1773: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1774: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1775: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.1776: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1777: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.1778: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.1779: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.1780: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1781: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1782: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain Source.1783: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain Source.1784: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.1785: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.1786: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.1787: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.1788: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1789: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.1790: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase Source.1791: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase Source.1792: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.1793: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.1794: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.1795: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.1796: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1797: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.1798: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.1799: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.1800: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1801: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.1802: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.1803: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.1804: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1805: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.1806: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3 Source.1807: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1808: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1809: DFBPPR9018 ---- Animal proteins ---- Transthyretin Source.1810: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.1811: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.1812: DFBPPR9056 ---- Animal proteins ---- Protein S100-A11 Source.1813: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain Source.1814: DFBPPR9063 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1815: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.1816: DFBPPR9073 ---- Animal proteins ---- Vitronectin Source.1817: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.1818: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1819: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.1820: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase Source.1821: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6 Source.1822: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.1823: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.1824: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1825: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.1826: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1827: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.1828: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1829: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein Source.1830: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.1831: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1832: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.1833: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.1834: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.1835: DFBPPR9254 ---- Animal proteins ---- Complement factor D Source.1836: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.1837: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.1838: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.1839: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1840: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.1841: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1842: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.1843: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.1844: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.1845: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.1846: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1847: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.1848: DFBPPR9355 ---- Animal proteins ---- Agouti-related protein Source.1849: DFBPPR9359 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase Source.1850: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1851: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.1852: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.1853: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.1854: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.1855: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.1856: DFBPPR9402 ---- Animal proteins ---- Small nuclear ribonucleoprotein E Source.1857: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.1858: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.1859: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.1860: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.1861: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.1862: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.1863: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1864: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.1865: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.1866: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.1867: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.1868: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.1869: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.1870: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.1871: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.1872: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1873: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.1874: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.1875: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.1876: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor Source.1877: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.1878: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.1879: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.1880: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.1881: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.1882: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1883: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.1884: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.1885: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2 Source.1886: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.1887: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a Source.1888: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.1889: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.1890: DFBPPR9819 ---- Animal proteins ---- 40S ribosomal protein S9 Source.1891: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1892: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1 Source.1893: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1 Source.1894: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.1895: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.1896: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.1897: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B Source.1898: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.1899: DFBPPR9919 ---- Animal proteins ---- Retinol-binding protein 3 Source.1900: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.1901: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.1902: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.1903: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1 Source.1904: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.1905: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.1906: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1907: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.1908: DFBPPR10009 ---- Animal proteins ---- Transthyretin Source.1909: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.1910: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein Source.1911: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7 Source.1912: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.1913: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.1914: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2 Source.1915: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.1916: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.1917: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1918: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a Source.1919: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.1920: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.1921: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1922: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.1923: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.1924: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.1925: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.1926: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.1927: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.1928: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.1929: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.1930: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.1931: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1932: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2 Source.1933: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.1934: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.1935: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.1936: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.1937: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.1938: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1 Source.1939: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.1940: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein Source.1941: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.1942: DFBPPR10205 ---- Animal proteins ---- Noelin Source.1943: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.1944: DFBPPR10222 ---- Animal proteins ---- Podocalyxin Source.1945: DFBPPR10231 ---- Animal proteins ---- Basigin Source.1946: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.1947: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.1948: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.1949: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1 Source.1950: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.1951: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1 Source.1952: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B Source.1953: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.1954: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.1955: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.1956: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1957: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1958: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.1959: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.1960: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.1961: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.1962: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.1963: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.1964: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3 Source.1965: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.1966: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1967: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.1968: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1969: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.1970: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.1971: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR Source.1972: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1973: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.1974: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.1975: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2 Source.1976: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.1977: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.1978: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.1979: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.1980: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.1981: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1982: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.1983: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1984: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.1985: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1 Source.1986: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.1987: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.1988: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.1989: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.1990: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.1991: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.1992: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.1993: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.1994: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1995: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros Source.1996: DFBPPR10508 ---- Animal proteins ---- Septin-2 Source.1997: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1998: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta Source.1999: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.2000: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.2001: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.2002: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.2003: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.2004: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.2005: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.2006: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.2007: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.2008: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.2009: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1 Source.2010: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain Source.2011: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.2012: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2013: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.2014: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.2015: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4 Source.2016: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.2017: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2018: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.2019: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase Source.2020: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.2021: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.2022: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.2023: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2024: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.2025: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.2026: DFBPPR10660 ---- Animal proteins ---- Tsukushin Source.2027: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.2028: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.2029: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.2030: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.2031: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.2032: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.2033: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2034: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.2035: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.2036: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2037: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.2038: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.2039: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1 Source.2040: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.2041: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.2042: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.2043: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6 Source.2044: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.2045: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2 Source.2046: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.2047: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase Source.2048: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.2049: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.2050: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3 Source.2051: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.2052: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2053: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa Source.2054: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.2055: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.2056: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2057: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein Source.2058: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9 Source.2059: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11 Source.2060: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.2061: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.2062: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain Source.2063: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.2064: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.2065: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.2066: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.2067: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.2068: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3 Source.2069: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.2070: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.2071: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.2072: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2073: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.2074: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.2075: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.2076: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.2077: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta Source.2078: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C Source.2079: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.2080: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.2081: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.2082: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.2083: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.2084: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.2085: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.2086: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2087: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.2088: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.2089: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.2090: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.2091: DFBPPR11034 ---- Animal proteins ---- Small nuclear ribonucleoprotein E Source.2092: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.2093: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.2094: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.2095: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.2096: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.2097: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2098: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.2099: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.2100: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5 Source.2101: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.2102: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.2103: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.2104: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.2105: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.2106: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2107: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.2108: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.2109: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2110: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.2111: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.2112: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1 Source.2113: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.2114: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2115: DFBPPR11237 ---- Animal proteins ---- Fibroblast growth factor 3 Source.2116: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3 Source.2117: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.2118: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.2119: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B Source.2120: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.2121: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.2122: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.2123: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.2124: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.2125: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3 Source.2126: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.2127: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1 Source.2128: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.2129: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.2130: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2131: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2132: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.2133: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2134: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.2135: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.2136: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.2137: DFBPPR11423 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member E Source.2138: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.2139: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.2140: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.2141: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.2142: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.2143: DFBPPR11441 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.2144: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a Source.2145: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2 Source.2146: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.2147: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.2148: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10 Source.2149: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.2150: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.2151: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.2152: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.2153: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.2154: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.2155: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.2156: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2157: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.2158: DFBPPR11577 ---- Animal proteins ---- Vasotocin-neurophysin VT Source.2159: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6 Source.2160: DFBPPR11580 ---- Animal proteins ---- Cilia- and flagella-associated protein 20 Source.2161: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.2162: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.2163: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2164: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2165: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4 Source.2166: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.2167: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.2168: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.2169: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon Source.2170: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13 Source.2171: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2 Source.2172: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2173: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1 Source.2174: DFBPPR11713 ---- Animal proteins ---- Charged multivesicular body protein 2b Source.2175: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.2176: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1 Source.2177: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2 Source.2178: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.2179: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.2180: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.2181: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.2182: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.2183: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.2184: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13 Source.2185: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2186: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z Source.2187: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.2188: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.2189: DFBPPR11856 ---- Animal proteins ---- Spindlin-W Source.2190: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82 Source.2191: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.2192: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1 Source.2193: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.2194: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein Source.2195: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.2196: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3 Source.2197: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.2198: DFBPPR11924 ---- Animal proteins ---- Centromere protein P Source.2199: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.2200: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog Source.2201: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.2202: DFBPPR11966 ---- Animal proteins ---- Protein CREG1 Source.2203: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2204: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.2205: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.2206: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.2207: DFBPPR12041 ---- Animal proteins ---- Paladin Source.2208: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.2209: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.2210: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.2211: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.2212: DFBPPR12089 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein Source.2213: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.2214: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.2215: DFBPPR12103 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.2216: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.2217: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.2218: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1 Source.2219: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8 Source.2220: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.2221: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.2222: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.2223: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.2224: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2225: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.2226: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2227: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.2228: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.2229: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.2230: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.2231: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.2232: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.2233: DFBPPR12220 ---- Animal proteins ---- Transcription factor BTF3 homolog 4 Source.2234: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.2235: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.2236: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.2237: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2238: DFBPPR12246 ---- Animal proteins ---- Uncharacterized protein KIAA1143 homolog Source.2239: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.2240: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2241: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.2242: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2243: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2244: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2245: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.2246: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.2247: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2248: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3 Source.2249: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.2250: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.2251: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2252: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.2253: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2254: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.2255: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2256: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.2257: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2 Source.2258: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.2259: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.2260: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2261: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.2262: DFBPPR12389 ---- Animal proteins ---- Clusterin Source.2263: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.2264: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.2265: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.2266: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I Source.2267: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.2268: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.2269: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2270: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.2271: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2272: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.2273: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2274: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.2275: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.2276: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.2277: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.2278: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.2279: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.2280: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14 Source.2281: DFBPPR12490 ---- Animal proteins ---- Uteroglobin Source.2282: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2283: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.2284: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2285: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase Source.2286: DFBPPR12536 ---- Animal proteins ---- Albumin Source.2287: DFBPPR12551 ---- Animal proteins ---- C-reactive protein Source.2288: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2289: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.2290: DFBPPR12560 ---- Animal proteins ---- Calumenin Source.2291: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.2292: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2293: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.2294: DFBPPR12579 ---- Animal proteins ---- Troponin I, slow skeletal muscle Source.2295: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.2296: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2297: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.2298: DFBPPR12607 ---- Animal proteins ---- Basigin Source.2299: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2300: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2301: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.2302: DFBPPR12636 ---- Animal proteins ---- Complement component C9 Source.2303: DFBPPR12637 ---- Animal proteins ---- Thioredoxin Source.2304: DFBPPR12638 ---- Animal proteins ---- Thioredoxin Source.2305: DFBPPR12680 ---- Animal proteins ---- Tubulin-specific chaperone A Source.2306: DFBPPR12681 ---- Animal proteins ---- Myosin-7 Source.2307: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase Source.2308: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.2309: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.2310: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2 Source.2311: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.2312: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.2313: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.2314: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.2315: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain Source.2316: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.2317: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2 Source.2318: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2319: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2320: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.2321: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B Source.2322: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.2323: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain Source.2324: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.2325: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain Source.2326: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.2327: DFBPPR12880 ---- Animal proteins ---- Corticostatin 1 Source.2328: DFBPPR12931 ---- Animal proteins ---- Transthyretin Source.2329: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.2330: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2331: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.2332: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12 Source.2333: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.2334: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.2335: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.2336: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.2337: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S Source.2338: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1 Source.2339: DFBPPR13107 ---- Animal proteins ---- Retinol-binding protein 3 Source.2340: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.2341: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region Source.2342: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2343: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.2344: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.2345: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2346: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2347: DFBPPR13174 ---- Animal proteins ---- Clusterin Source.2348: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.2349: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2350: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.2351: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23 Source.2352: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain Source.2353: DFBPPR13240 ---- Animal proteins ---- Decorin Source.2354: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2355: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2356: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2357: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.2358: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.2359: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein Source.2360: DFBPPR13296 ---- Animal proteins ---- Complement component C9 Source.2361: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.2362: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.2363: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.2364: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.2365: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A Source.2366: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.2367: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.2368: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.2369: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta Source.2370: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.2371: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.2372: DFBPPR13512 ---- Animal proteins ---- Interleukin-2 Source.2373: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2374: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.2375: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2376: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.2377: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.2378: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.2379: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta Source.2380: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2381: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta Source.2382: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.2383: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain Source.2384: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.2385: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.2386: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain Source.2387: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.2388: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2389: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.2390: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2391: DFBPPR13709 ---- Animal proteins ---- Pro-glucagon Source.2392: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta Source.2393: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.2394: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.2395: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.2396: DFBPPR13735 ---- Animal proteins ---- Thyroid hormone receptor beta Source.2397: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2398: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.2399: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.2400: DFBPPR13763 ---- Animal proteins ---- Interleukin-2 Source.2401: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2402: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.2403: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.2404: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.2405: DFBPPR13810 ---- Animal proteins ---- Transthyretin Source.2406: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.2407: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.2408: DFBPPR13867 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.2409: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15 Source.2410: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.2411: DFBPPR13962 ---- Animal proteins ---- Retinol-binding protein 3 Source.2412: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.2413: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.2414: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.2415: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.2416: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.2417: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.2418: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.2419: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.2420: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2421: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1 Source.2422: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2 Source.2423: DFBPPR14024 ---- Animal proteins ---- Gamma-crystallin S Source.2424: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III Source.2425: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.2426: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1 Source.2427: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha Source.2428: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.2429: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A Source.2430: DFBPPR14134 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B Source.2431: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.2432: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.2433: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.2434: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.2435: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain Source.2436: DFBPPR14250 ---- Marine protein ---- Vasotocin-neurophysin VT 2 Source.2437: DFBPPR14253 ---- Marine protein ---- Vasotocin-neurophysin VT 1 Source.2438: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial Source.2439: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.2440: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.2441: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.2442: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.2443: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2444: DFBPPR14376 ---- Marine protein ---- ATP synthase subunit b', chloroplastic Source.2445: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha Source.2446: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.2447: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.2448: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.2449: DFBPPR14411 ---- Marine protein ---- 50S ribosomal protein L22, chloroplastic Source.2450: DFBPPR14485 ---- Marine protein ---- Uncharacterized N-acetyltransferase ycf52 Source.2451: DFBPPR14526 ---- Marine protein ---- Uncharacterized protein ycf91 Source.2452: DFBPPR14528 ---- Marine protein ---- Uracil phosphoribosyltransferase homolog Source.2453: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.2454: DFBPPR14552 ---- Marine protein ---- Lysozyme C II Source.2455: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.2456: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific Source.2457: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2458: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros Source.2459: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.2460: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.2461: DFBPPR14597 ---- Marine protein ---- Parvalbumin beta 1 Source.2462: DFBPPR14604 ---- Marine protein ---- Anamorsin Source.2463: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a Source.2464: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b Source.2465: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.2466: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1 Source.2467: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.2468: DFBPPR14643 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B Source.2469: DFBPPR14674 ---- Marine protein ---- Glucagon-1 Source.2470: DFBPPR14675 ---- Marine protein ---- Glucagon-2 Source.2471: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2 Source.2472: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.2473: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.2474: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2475: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.2476: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.2477: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase Source.2478: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain Source.2479: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain Source.2480: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain Source.2481: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2482: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase Source.2483: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.2484: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.2485: DFBPPR14837 ---- Marine protein ---- Hemocyanin subunit 6 Source.2486: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2487: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2488: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system Source.2489: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.2490: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.2491: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.2492: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8 Source.2493: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2494: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15 Source.2495: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2496: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.2497: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.2498: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.2499: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.2500: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.2501: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.2502: DFBPPR14935 ---- Microorganism protein ---- Actin Source.2503: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.2504: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5 Source.2505: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.2506: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma Source.2507: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.2508: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1 Source.2509: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.2510: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.2511: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19 Source.2512: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.2513: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.2514: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2515: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.2516: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.2517: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1 Source.2518: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.2519: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.2520: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.2521: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.2522: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1 Source.2523: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13 Source.2524: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.2525: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.2526: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.2527: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.2528: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.2529: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.2530: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase Source.2531: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2532: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6 Source.2533: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.2534: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.2535: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.2536: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.2537: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1 Source.2538: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.2539: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.2540: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial Source.2541: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.2542: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.2543: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.2544: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.2545: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.2546: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6 Source.2547: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.2548: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.2549: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.2550: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.2551: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.2552: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.2553: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C Source.2554: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I Source.2555: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.2556: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.2557: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1 Source.2558: DFBPPR15202 ---- Microorganism protein ---- DASH complex subunit DAD3 Source.2559: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.2560: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.2561: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4 Source.2562: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.2563: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.2564: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2 Source.2565: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.2566: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.2567: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.2568: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.2569: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.2570: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase Source.2571: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.2572: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.2573: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.2574: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.2575: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1 Source.2576: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1 Source.2577: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.2578: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.2579: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase Source.2580: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2581: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.2582: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.2583: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2 Source.2584: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.2585: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.2586: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.2587: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.2588: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4 Source.2589: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.2590: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.2591: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.2592: DFBPPR15427 ---- Microorganism protein ---- RNA exonuclease 4 Source.2593: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.2594: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.2595: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.2596: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.2597: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1 Source.2598: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9 Source.2599: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.2600: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1 Source.2601: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1 Source.2602: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123 Source.2603: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.2604: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.2605: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14 Source.2606: DFBPPR15520 ---- Microorganism protein ---- Protein YAE1 Source.2607: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3 Source.2608: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.2609: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6 Source.2610: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.2611: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.2612: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.2613: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.2614: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1 Source.2615: DFBPPR15634 ---- Microorganism protein ---- Hsp70 nucleotide exchange factor FES1 Source.2616: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.2617: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1 Source.2618: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.2619: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.2620: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.2621: DFBPPR15722 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 18, mitochondrial Source.2622: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.2623: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2 Source.2624: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.2625: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.2626: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.2627: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8 Source.2628: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86 Source.2629: DFBPPR15758 ---- Microorganism protein ---- Required for respiratory growth protein 8, mitochondrial Source.2630: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.2631: DFBPPR15777 ---- Microorganism protein ---- FAS1 domain-containing protein KLLA0E16841g Source.2632: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.2633: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.2634: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.2635: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.2636: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase Source.2637: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.2638: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.2639: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.2640: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase Source.2641: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.2642: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT Source.2643: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region Source.2644: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.2645: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2 Source.2646: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.2647: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.2648: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase Source.2649: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.2650: DFBPPR15889 ---- Marine protein ---- Ferredoxin Source.2651: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1 Source.2652: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2 Source.2653: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.2654: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.2655: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.2656: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.2657: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.2658: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.2659: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.2660: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.2661: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.2662: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.2663: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2664: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2665: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2666: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2667: DFBPPR7844 ---- Plant protein ---- Actin-1 Source.2668: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.2669: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3 Source.2670: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.2671: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1 Source.2672: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1 Source.2673: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.2674: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.2675: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.2676: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.2677: DFBPPR7960 ---- Plant protein ---- Vicilin Source.2678: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.2679: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.2680: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.2681: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.2682: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.2683: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2684: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2685: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2686: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1 Source.2687: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.2688: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.2689: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.2690: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.2691: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.2692: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.2693: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.2694: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.2695: DFBPPR8262 ---- Plant protein ---- ATP-dependent zinc metalloprotease FTSH, chloroplastic Source.2696: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2697: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2698: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.2699: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2700: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog Source.2701: DFBPPR8314 ---- Plant protein ---- Maturase K Source.2702: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide VLD showed low antioxidant activity with a relative antioxidant activity of 0.24 ± 0.03 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015