Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0940(Antioxidative peptide)

DFBP ID	DFBPANOX0940
Peptide sequence	EVD
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	ACE-inhibitory activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Glu-Val-Asp

Single-letter amino acid

EVD

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	361.35 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.04 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-0.9333^c

Hydrophilic residue ratio

33.33%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.4: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.5: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.6: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.7: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.8: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.9: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.10: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.11: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.12: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.13: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.14: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.15: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.16: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.17: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.18: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.19: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.20: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.21: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.22: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.23: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.24: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.25: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.26: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.27: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.28: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.29: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.30: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.31: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.32: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.33: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.34: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.35: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.36: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.37: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4 Source.38: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.39: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.40: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.41: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.42: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.43: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.44: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.45: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.46: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.47: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.48: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.49: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.50: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial Source.51: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.52: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.53: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.54: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.55: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.56: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.57: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.58: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.59: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.60: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.61: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.62: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.63: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17 Source.64: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.65: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.66: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.67: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.68: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.69: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.70: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.71: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.72: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.73: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.74: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.75: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.76: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.77: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.78: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.79: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.80: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.81: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.82: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.83: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.84: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.85: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.86: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.87: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.88: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.89: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.90: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.91: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.92: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3 Source.93: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.94: DFBPPR1566 ---- Plant proteins ---- Transcription factor ILI5 Source.95: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17 Source.96: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.97: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8 Source.98: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.99: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.100: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.101: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.102: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.103: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.104: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.105: DFBPPR1641 ---- Plant proteins ---- Enolase Source.106: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.107: DFBPPR1648 ---- Plant proteins ---- Transcription factor ILI4 Source.108: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.109: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog Source.110: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b Source.111: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.112: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.113: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1 Source.114: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.115: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.116: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.117: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.118: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.119: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.120: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a Source.121: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2 Source.122: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.123: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2 Source.124: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.125: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.126: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein Source.127: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.128: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1 Source.129: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.130: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.131: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.132: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.133: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.134: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.135: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.136: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.137: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.138: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.139: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.140: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.141: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.142: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.143: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.144: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.145: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.146: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.147: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.148: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.149: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.150: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.151: DFBPPR1902 ---- Plant proteins ---- Transcription factor ILI6 Source.152: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.153: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.154: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.155: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.156: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.157: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.158: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1 Source.159: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.160: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.161: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.162: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.163: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.164: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.165: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.166: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.167: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.168: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a Source.169: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5 Source.170: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.171: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.172: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial Source.173: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11 Source.174: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.175: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.176: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1 Source.177: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.178: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.179: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.180: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.181: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.182: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.183: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.184: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.185: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.186: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein Source.187: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.188: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.189: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.190: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.191: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.192: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.193: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.194: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.195: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.196: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.197: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.198: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.199: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.200: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3 Source.201: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.202: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.203: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.204: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial Source.205: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.206: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.207: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.208: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.209: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.210: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.211: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.212: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.213: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.214: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.215: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.216: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein Source.217: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.218: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.219: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.220: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.221: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.222: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.223: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.224: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.225: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.226: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.227: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.228: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.229: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.230: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.231: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.232: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1 Source.233: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.234: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.235: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.236: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.237: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.238: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.239: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27 Source.240: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9 Source.241: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.242: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6 Source.243: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.244: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.245: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.246: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5 Source.247: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19 Source.248: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.249: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.250: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.251: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1 Source.252: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.253: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.254: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.255: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.256: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.257: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.258: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1 Source.259: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.260: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77 Source.261: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5 Source.262: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.263: DFBPPR2745 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor EL2 Source.264: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.265: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.266: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.267: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.268: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.269: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.270: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.271: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.272: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.273: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.274: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.275: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.276: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103 Source.277: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.278: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.279: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.280: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c Source.281: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.282: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.283: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.284: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.285: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.286: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.287: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.288: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog Source.289: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.290: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.291: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.292: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.293: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.294: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.295: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.296: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A Source.297: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.298: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.299: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.300: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1 Source.301: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.302: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.303: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.304: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.305: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.306: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.307: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.308: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.309: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.310: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15 Source.311: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17 Source.312: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.313: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.314: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.315: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.316: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.317: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic Source.318: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.319: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.320: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.321: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1 Source.322: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.323: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18 Source.324: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.325: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b Source.326: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.327: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5 Source.328: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.329: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.330: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.331: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.332: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.333: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.334: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.335: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.336: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.337: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.338: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.339: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.340: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein Source.341: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.342: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.343: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2 Source.344: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.345: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.346: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.347: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.348: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.349: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.350: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic Source.351: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.352: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.353: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.354: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.355: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.356: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3 Source.357: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.358: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.359: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.360: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.361: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1 Source.362: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.363: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.364: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.365: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3 Source.366: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.367: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41 Source.368: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.369: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2 Source.370: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB Source.371: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.372: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.373: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase Source.374: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.375: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.376: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.377: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1 Source.378: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8 Source.379: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.380: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.381: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.382: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.383: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.384: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.385: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.386: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78 Source.387: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.388: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.389: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.390: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.391: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit Source.392: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.393: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.394: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit Source.395: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8 Source.396: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3 Source.397: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.398: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.399: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.400: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.401: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.402: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.403: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.404: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.405: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.406: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta Source.407: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.408: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.409: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.410: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.411: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.412: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4 Source.413: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.414: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.415: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.416: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.417: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.418: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.419: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.420: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.421: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.422: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.423: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.424: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.425: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.426: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.427: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.428: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.429: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2 Source.430: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2 Source.431: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.432: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4 Source.433: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.434: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.435: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.436: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.437: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.438: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.439: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.440: DFBPPR4343 ---- Plant proteins ---- Transcription factor ILI7 Source.441: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.442: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.443: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.444: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.445: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.446: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.447: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.448: DFBPPR4381 ---- Plant proteins ---- Transcription factor ILI3 Source.449: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.450: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.451: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.452: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.453: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.454: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.455: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial Source.456: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.457: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.458: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.459: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1 Source.460: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.461: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.462: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.463: DFBPPR4576 ---- Plant proteins ---- Probable calcium-binding protein CML7 Source.464: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.465: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.466: DFBPPR4625 ---- Plant proteins ---- Actin-depolymerizing factor 2 Source.467: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3 Source.468: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.469: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.470: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1 Source.471: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2 Source.472: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.473: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.474: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.475: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.476: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1 Source.477: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13 Source.478: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.479: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.480: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 Source.481: DFBPPR4809 ---- Plant proteins ---- B3 domain-containing protein Os03g0164300 Source.482: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.483: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.484: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.485: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080 Source.486: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.487: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic Source.488: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.489: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.490: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1 Source.491: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.492: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.493: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.494: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.495: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.496: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.497: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.498: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.499: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.500: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.501: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.502: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.503: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.504: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.505: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial Source.506: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.507: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.508: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.509: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.510: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.511: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.512: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.513: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2 Source.514: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.515: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.516: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.517: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1 Source.518: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3 Source.519: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.520: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.521: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.522: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.523: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.524: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.525: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.526: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.527: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1 Source.528: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.529: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.530: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.531: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.532: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.533: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.534: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.535: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.536: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.537: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A Source.538: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1 Source.539: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.540: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.541: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.542: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.543: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic Source.544: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.545: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.546: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.547: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.548: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.549: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.550: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.551: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.552: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase Source.553: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.554: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.555: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.556: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.557: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5 Source.558: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.559: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.560: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic Source.561: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.562: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.563: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.564: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.565: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.566: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19 Source.567: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.568: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.569: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.570: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.571: DFBPPR5945 ---- Plant proteins ---- Calmodulin Source.572: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.573: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.574: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.575: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.576: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.577: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38 Source.578: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2 Source.579: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.580: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.581: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.582: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A Source.583: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.584: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.585: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.586: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.587: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.588: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.589: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.590: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.591: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.592: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.593: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic Source.594: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.595: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.596: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.597: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.598: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.599: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.600: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.601: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.602: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.603: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial Source.604: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.605: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.606: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.607: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.608: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.609: DFBPPR6470 ---- Plant proteins ---- Vicilin Source.610: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.611: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic Source.612: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.613: DFBPPR6499 ---- Plant proteins ---- Provicilin Source.614: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A Source.615: DFBPPR6594 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid Source.616: DFBPPR6595 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid Source.617: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.618: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.619: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.620: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.621: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.622: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.623: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.624: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.625: DFBPPR6705 ---- Plant proteins ---- Calmodulin Source.626: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.627: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.628: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase Source.629: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D Source.630: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.631: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.632: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.633: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.634: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.635: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.636: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.637: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.638: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.639: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta Source.640: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin Source.641: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.642: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2 Source.643: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.644: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1 Source.645: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.646: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase Source.647: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.648: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.649: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.650: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.651: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.652: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.653: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.654: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.655: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.656: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.657: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.658: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1 Source.659: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.660: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.661: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.662: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.663: DFBPPR7228 ---- Plant proteins ---- Calmodulin Source.664: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.665: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2 Source.666: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.667: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.668: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.669: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.670: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.671: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.672: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.673: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1 Source.674: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.675: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic Source.676: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.677: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.678: DFBPPR7478 ---- Plant proteins ---- Napin embryo-specific Source.679: DFBPPR7482 ---- Plant proteins ---- Napin Source.680: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.681: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS Source.682: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15 Source.683: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit Source.684: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.685: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.686: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.687: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.688: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.689: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.690: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.691: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.692: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.693: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.694: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.695: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.696: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.697: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.698: DFBPPR8458 ---- Plant proteins ---- Catalase Source.699: DFBPPR8491 ---- Milk proteins ---- Osteopontin Source.700: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.701: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.702: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.703: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2 Source.704: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.705: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.706: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.707: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase Source.708: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.709: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.710: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.711: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.712: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.713: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.714: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.715: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.716: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.717: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln Source.718: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.719: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2 Source.720: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.721: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A Source.722: DFBPPR16083 ---- Animal proteins ---- Annexin A13 Source.723: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.724: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.725: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.726: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C Source.727: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.728: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.729: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2 Source.730: DFBPPR16168 ---- Animal proteins ---- Annexin A2 Source.731: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.732: DFBPPR16170 ---- Animal proteins ---- Inversin Source.733: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.734: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.735: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.736: DFBPPR16189 ---- Animal proteins ---- Albumin Source.737: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.738: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.739: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.740: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.741: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.742: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.743: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.744: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.745: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase Source.746: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.747: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.748: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.749: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.750: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.751: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.752: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.753: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.754: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.755: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.756: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.757: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.758: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.759: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.760: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1 Source.761: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.762: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4 Source.763: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.764: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.765: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.766: DFBPPR16674 ---- Animal proteins ---- Double-headed protease inhibitor, submandibular gland Source.767: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252 Source.768: DFBPPR16733 ---- Animal proteins ---- 40S ribosomal protein S17 Source.769: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.770: DFBPPR16739 ---- Animal proteins ---- Lengsin Source.771: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.772: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37 Source.773: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.774: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35 Source.775: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.776: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.777: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1 Source.778: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.779: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.780: DFBPPR16843 ---- Animal proteins ---- Calmodulin Source.781: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.782: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.783: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain Source.784: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.785: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.786: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.787: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Source.788: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.789: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C Source.790: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.791: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.792: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.793: DFBPPR16918 ---- Animal proteins ---- Spastin Source.794: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.795: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.796: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.797: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A Source.798: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.799: DFBPPR16952 ---- Animal proteins ---- Annexin A2 Source.800: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.801: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.802: DFBPPR16981 ---- Animal proteins ---- Clusterin Source.803: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase Source.804: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.805: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.806: DFBPPR17000 ---- Animal proteins ---- Vimentin Source.807: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.808: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.809: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.810: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.811: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.812: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.813: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.814: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.815: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.816: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.817: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.818: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168 Source.819: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.820: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.821: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.822: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.823: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.824: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.825: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.826: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.827: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1 Source.828: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1 Source.829: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.830: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.831: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.832: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.833: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.834: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.835: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.836: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.837: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.838: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.839: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.840: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.841: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.842: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.843: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.844: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.845: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.846: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.847: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.848: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.849: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.850: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.851: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.852: DFBPPR17504 ---- Animal proteins ---- Duodenase-1 Source.853: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.854: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase Source.855: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.856: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.857: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1 Source.858: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.859: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.860: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1 Source.861: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.862: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.863: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.864: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16 Source.865: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.866: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform Source.867: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.868: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1 Source.869: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.870: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.871: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b Source.872: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1 Source.873: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.874: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.875: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.876: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.877: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.878: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.879: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.880: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1 Source.881: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.882: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.883: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.884: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.885: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.886: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.887: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.888: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38 Source.889: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.890: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.891: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.892: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.893: DFBPPR17954 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member A Source.894: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.895: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1 Source.896: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.897: DFBPPR17974 ---- Animal proteins ---- Mimecan Source.898: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.899: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.900: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.901: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.902: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.903: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5 Source.904: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.905: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.906: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.907: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.908: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.909: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta Source.910: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.911: DFBPPR18104 ---- Animal proteins ---- Thioredoxin Source.912: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1 Source.913: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.914: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.915: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.916: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.917: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.918: DFBPPR18247 ---- Animal proteins ---- Interferon regulatory factor 1 Source.919: DFBPPR18258 ---- Animal proteins ---- Prothymosin alpha Source.920: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.921: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.922: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.923: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.924: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.925: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.926: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.927: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.928: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2 Source.929: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.930: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.931: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.932: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.933: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14 Source.934: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.935: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.936: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.937: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase Source.938: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.939: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.940: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.941: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.942: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.943: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.944: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.945: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.946: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.947: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.948: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1 Source.949: DFBPPR18563 ---- Animal proteins ---- Collectin-43 Source.950: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.951: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1 Source.952: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.953: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4 Source.954: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.955: DFBPPR18609 ---- Animal proteins ---- ERO1-like protein alpha Source.956: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.957: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.958: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.959: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB Source.960: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.961: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4 Source.962: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.963: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.964: DFBPPR18713 ---- Animal proteins ---- Arginase-1 Source.965: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.966: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.967: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.968: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.969: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha Source.970: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.971: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.972: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.973: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.974: DFBPPR18839 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 12 Source.975: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15 Source.976: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.977: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.978: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.979: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.980: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.981: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.982: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.983: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog Source.984: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS Source.985: DFBPPR18995 ---- Animal proteins ---- Tektin-3 Source.986: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.987: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.988: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.989: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.990: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.991: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.992: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3 Source.993: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.994: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.995: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7 Source.996: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.997: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4 Source.998: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.999: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1 Source.1000: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Source.1001: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.1002: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.1003: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1004: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like Source.1005: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.1006: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.1007: DFBPPR19291 ---- Animal proteins ---- Multicilin Source.1008: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.1009: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.1010: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.1011: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.1012: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85 Source.1013: DFBPPR19346 ---- Animal proteins ---- Cylicin-1 Source.1014: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.1015: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5 Source.1016: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1017: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein Source.1018: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.1019: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein Source.1020: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20 Source.1021: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.1022: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1023: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta Source.1024: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E Source.1025: DFBPPR19530 ---- Animal proteins ---- Tuftelin Source.1026: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.1027: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein Source.1028: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.1029: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1030: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1 Source.1031: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.1032: DFBPPR19592 ---- Animal proteins ---- Ras-related protein Rab-18 Source.1033: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin Source.1034: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1035: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.1036: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.1037: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.1038: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.1039: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.1040: DFBPPR19663 ---- Animal proteins ---- Synembryn-A Source.1041: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1042: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.1043: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.1044: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7 Source.1045: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.1046: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.1047: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.1048: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1 Source.1049: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.1050: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1 Source.1051: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.1052: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.1053: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.1054: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.1055: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4 Source.1056: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Source.1057: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.1058: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.1059: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.1060: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.1061: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.1062: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.1063: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1064: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1065: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1066: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.1067: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.1068: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1 Source.1069: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2 Source.1070: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.1071: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2 Source.1072: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20 Source.1073: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.1074: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha Source.1075: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.1076: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1 Source.1077: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1078: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1079: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.1080: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.1081: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.1082: DFBPPR20098 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.1083: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.1084: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.1085: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3 Source.1086: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1087: DFBPPR20198 ---- Animal proteins ---- Calcium-binding protein 2 Source.1088: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial Source.1089: DFBPPR20213 ---- Animal proteins ---- Coiled-coil domain-containing protein 115 Source.1090: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.1091: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1 Source.1092: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1093: DFBPPR20340 ---- Animal proteins ---- Peripherin Source.1094: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1095: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1096: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1 Source.1097: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.1098: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1099: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.1100: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1101: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.1102: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4 Source.1103: DFBPPR20404 ---- Animal proteins ---- Protein tilB homolog Source.1104: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.1105: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.1106: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.1107: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1108: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.1109: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.1110: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF Source.1111: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial Source.1112: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3 Source.1113: DFBPPR20481 ---- Animal proteins ---- Ropporin-1 Source.1114: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.1115: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.1116: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.1117: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1118: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.1119: DFBPPR20584 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5-like protein Source.1120: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1121: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.1122: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.1123: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog Source.1124: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5 Source.1125: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial Source.1126: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa Source.1127: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1128: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1129: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.1130: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease Source.1131: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B Source.1132: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.1133: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.1134: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.1135: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1136: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B Source.1137: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.1138: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1 Source.1139: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.1140: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3 Source.1141: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.1142: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.1143: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.1144: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.1145: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1146: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.1147: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.1148: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1 Source.1149: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B Source.1150: DFBPPR20898 ---- Animal proteins ---- Transaldolase Source.1151: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.1152: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator Source.1153: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.1154: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial Source.1155: DFBPPR20954 ---- Animal proteins ---- Secretagogin Source.1156: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10 Source.1157: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.1158: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2 Source.1159: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.1160: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A Source.1161: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.1162: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.1163: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.1164: DFBPPR21063 ---- Animal proteins ---- Zinc finger protein 691 Source.1165: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.1166: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.1167: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.1168: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1 Source.1169: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2 Source.1170: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H Source.1171: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.1172: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24 Source.1173: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.1174: DFBPPR21197 ---- Animal proteins ---- Spindle and kinetochore-associated protein 2 Source.1175: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog Source.1176: DFBPPR21209 ---- Animal proteins ---- 40S ribosomal protein S6 Source.1177: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein Source.1178: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.1179: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.1180: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8 Source.1181: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.1182: DFBPPR21260 ---- Animal proteins ---- 40S ribosomal protein S21 Source.1183: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.1184: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen Source.1185: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.1186: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.1187: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.1188: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.1189: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4 Source.1190: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2 Source.1191: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform Source.1192: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A Source.1193: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.1194: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2 Source.1195: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1 Source.1196: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.1197: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase Source.1198: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.1199: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.1200: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein Source.1201: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.1202: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3 Source.1203: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1204: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.1205: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.1206: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.1207: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.1208: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2 Source.1209: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.1210: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.1211: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2 Source.1212: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25 Source.1213: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1214: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.1215: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7 Source.1216: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A Source.1217: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2 Source.1218: DFBPPR21843 ---- Animal proteins ---- Tektin-1 Source.1219: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2 Source.1220: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2 Source.1221: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.1222: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.1223: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial Source.1224: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.1225: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog Source.1226: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog Source.1227: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.1228: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.1229: DFBPPR22036 ---- Animal proteins ---- Anaphase-promoting complex subunit 15 Source.1230: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41 Source.1231: DFBPPR22105 ---- Animal proteins ---- Centromere protein L Source.1232: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.1233: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2 Source.1234: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1235: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial Source.1236: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein Source.1237: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.1238: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.1239: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.1240: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.1241: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog Source.1242: DFBPPR22298 ---- Animal proteins ---- 40S ribosomal protein S17 Source.1243: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16 Source.1244: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.1245: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.1246: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1 Source.1247: DFBPPR22410 ---- Animal proteins ---- Small acidic protein Source.1248: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1 Source.1249: DFBPPR22446 ---- Animal proteins ---- Tektin-5 Source.1250: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37 Source.1251: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97 Source.1252: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1 Source.1253: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.1254: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1 Source.1255: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2 Source.1256: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.1257: DFBPPR22601 ---- Animal proteins ---- Leukocyte receptor cluster member 1 homolog Source.1258: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36 Source.1259: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.1260: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1 Source.1261: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65 Source.1262: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.1263: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8 Source.1264: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog Source.1265: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.1266: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.1267: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.1268: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1 Source.1269: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.1270: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.1271: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1272: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1273: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.1274: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.1275: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.1276: DFBPPR8657 ---- Animal proteins ---- Annexin A2 Source.1277: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.1278: DFBPPR8673 ---- Animal proteins ---- Calreticulin Source.1279: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.1280: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.1281: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.1282: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1283: DFBPPR8694 ---- Animal proteins ---- Spastin Source.1284: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1285: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1286: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C Source.1287: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1288: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.1289: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1290: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.1291: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.1292: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.1293: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.1294: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.1295: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.1296: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase Source.1297: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.1298: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.1299: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase Source.1300: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1301: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.1302: DFBPPR8851 ---- Animal proteins ---- Vimentin Source.1303: DFBPPR8852 ---- Animal proteins ---- Vimentin Source.1304: DFBPPR8854 ---- Animal proteins ---- Vimentin Source.1305: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.1306: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.1307: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.1308: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1309: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.1310: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1311: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.1312: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.1313: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.1314: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.1315: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.1316: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.1317: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1318: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1319: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.1320: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.1321: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.1322: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.1323: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.1324: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1325: DFBPPR9162 ---- Animal proteins ---- Thioredoxin Source.1326: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.1327: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.1328: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1329: DFBPPR9194 ---- Animal proteins ---- Arginase-1 Source.1330: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1331: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.1332: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1333: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.1334: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.1335: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1336: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.1337: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.1338: DFBPPR9312 ---- Animal proteins ---- 40S ribosomal protein S21 Source.1339: DFBPPR9327 ---- Animal proteins ---- Multicilin Source.1340: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.1341: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta Source.1342: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.1343: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.1344: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.1345: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.1346: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.1347: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.1348: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.1349: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.1350: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.1351: DFBPPR9487 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles Source.1352: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.1353: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.1354: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.1355: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.1356: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1357: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.1358: DFBPPR9581 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.1359: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2 Source.1360: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.1361: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.1362: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1363: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog Source.1364: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.1365: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1366: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.1367: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle Source.1368: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.1369: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2 Source.1370: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.1371: DFBPPR9729 ---- Animal proteins ---- Secretagogin Source.1372: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.1373: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2 Source.1374: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.1375: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.1376: DFBPPR9870 ---- Animal proteins ---- 40S ribosomal protein S17 Source.1377: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.1378: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1379: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1380: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.1381: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1382: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.1383: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1384: DFBPPR10004 ---- Animal proteins ---- Spastin Source.1385: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.1386: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.1387: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.1388: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.1389: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.1390: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1391: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.1392: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.1393: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.1394: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.1395: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.1396: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.1397: DFBPPR10107 ---- Animal proteins ---- Ovomucoid Source.1398: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase Source.1399: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3 Source.1400: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.1401: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.1402: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein Source.1403: DFBPPR10136 ---- Animal proteins ---- Annexin A2 Source.1404: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.1405: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1406: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.1407: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1408: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.1409: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.1410: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.1411: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.1412: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.1413: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.1414: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1 Source.1415: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.1416: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1417: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.1418: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.1419: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1420: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein Source.1421: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.1422: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.1423: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B Source.1424: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.1425: DFBPPR10306 ---- Animal proteins ---- D-erythrulose reductase Source.1426: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1427: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.1428: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1 Source.1429: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.1430: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.1431: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.1432: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.1433: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.1434: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.1435: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.1436: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.1437: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.1438: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.1439: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1440: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.1441: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.1442: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.1443: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform Source.1444: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.1445: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.1446: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.1447: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1 Source.1448: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.1449: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1450: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.1451: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2 Source.1452: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1453: DFBPPR10513 ---- Animal proteins ---- Parafibromin Source.1454: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.1455: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.1456: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.1457: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.1458: DFBPPR10546 ---- Animal proteins ---- Calmodulin Source.1459: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.1460: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.1461: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.1462: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.1463: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.1464: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.1465: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.1466: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.1467: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.1468: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.1469: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.1470: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.1471: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1472: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.1473: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.1474: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.1475: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.1476: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.1477: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.1478: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.1479: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8 Source.1480: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.1481: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.1482: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle Source.1483: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1484: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.1485: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.1486: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase Source.1487: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1488: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1 Source.1489: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.1490: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.1491: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1492: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1493: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.1494: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.1495: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.1496: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.1497: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11 Source.1498: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.1499: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3 Source.1500: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.1501: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.1502: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.1503: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.1504: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.1505: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.1506: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.1507: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.1508: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.1509: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.1510: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.1511: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.1512: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.1513: DFBPPR11027 ---- Animal proteins ---- Ras-related protein Rab-18 Source.1514: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.1515: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.1516: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.1517: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.1518: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.1519: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.1520: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.1521: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.1522: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.1523: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1524: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b Source.1525: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.1526: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1527: DFBPPR11151 ---- Animal proteins ---- SPARC Source.1528: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta Source.1529: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3 Source.1530: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.1531: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1532: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1533: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF Source.1534: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.1535: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.1536: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1537: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.1538: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.1539: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.1540: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1541: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.1542: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta Source.1543: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.1544: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2 Source.1545: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.1546: DFBPPR11364 ---- Animal proteins ---- Interleukin-18 Source.1547: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX Source.1548: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29 Source.1549: DFBPPR11376 ---- Animal proteins ---- Lamin-A Source.1550: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.1551: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.1552: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.1553: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.1554: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.1555: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.1556: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.1557: DFBPPR11467 ---- Animal proteins ---- Synembryn-A Source.1558: DFBPPR11498 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles Source.1559: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.1560: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform Source.1561: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.1562: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.1563: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.1564: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.1565: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.1566: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle Source.1567: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.1568: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.1569: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.1570: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.1571: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.1572: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.1573: DFBPPR11660 ---- Animal proteins ---- Cathepsin K Source.1574: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2 Source.1575: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1576: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.1577: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.1578: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.1579: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1580: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.1581: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.1582: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.1583: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.1584: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15 Source.1585: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.1586: DFBPPR11822 ---- Animal proteins ---- Inversin Source.1587: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.1588: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3 Source.1589: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.1590: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1591: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.1592: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.1593: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.1594: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.1595: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.1596: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle Source.1597: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.1598: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1599: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.1600: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1601: DFBPPR11953 ---- Animal proteins ---- Protein NEL Source.1602: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.1603: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.1604: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.1605: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1 Source.1606: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.1607: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein Source.1608: DFBPPR12024 ---- Animal proteins ---- 40S ribosomal protein S6 Source.1609: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.1610: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.1611: DFBPPR12041 ---- Animal proteins ---- Paladin Source.1612: DFBPPR12043 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 5 Source.1613: DFBPPR12072 ---- Animal proteins ---- 40S ribosomal protein S17 Source.1614: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.1615: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.1616: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2 Source.1617: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.1618: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.1619: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.1620: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.1621: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.1622: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1 Source.1623: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A Source.1624: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin Source.1625: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.1626: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.1627: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.1628: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.1629: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.1630: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.1631: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.1632: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.1633: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.1634: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.1635: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.1636: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.1637: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.1638: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1639: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.1640: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.1641: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1642: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.1643: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1644: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.1645: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.1646: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.1647: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.1648: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.1649: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1650: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.1651: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.1652: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.1653: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4 Source.1654: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.1655: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.1656: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1657: DFBPPR12585 ---- Animal proteins ---- Calmodulin Source.1658: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.1659: DFBPPR12611 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A Source.1660: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.1661: DFBPPR12637 ---- Animal proteins ---- Thioredoxin Source.1662: DFBPPR12638 ---- Animal proteins ---- Thioredoxin Source.1663: DFBPPR12642 ---- Animal proteins ---- Haptoglobin Source.1664: DFBPPR12643 ---- Animal proteins ---- Haptoglobin Source.1665: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1666: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1667: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.1668: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.1669: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln Source.1670: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.1671: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1672: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle Source.1673: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1674: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.1675: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.1676: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.1677: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.1678: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.1679: DFBPPR12857 ---- Animal proteins ---- Arginase-1 Source.1680: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.1681: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta Source.1682: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.1683: DFBPPR12876 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.1684: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase Source.1685: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.1686: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3 Source.1687: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain Source.1688: DFBPPR12992 ---- Animal proteins ---- Mimecan Source.1689: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1690: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.1691: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1692: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.1693: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2 Source.1694: DFBPPR13117 ---- Animal proteins ---- Ig kappa-b4 chain C region Source.1695: DFBPPR13123 ---- Animal proteins ---- Ig kappa-b5 chain C region Source.1696: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.1697: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.1698: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.1699: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1700: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1701: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1702: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.1703: DFBPPR13223 ---- Animal proteins ---- Caspase-1 Source.1704: DFBPPR13237 ---- Animal proteins ---- Thioredoxin Source.1705: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1706: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1707: DFBPPR13264 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1708: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E Source.1709: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.1710: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1711: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.1712: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.1713: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.1714: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.1715: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.1716: DFBPPR13454 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1717: DFBPPR13463 ---- Animal proteins ---- Cathelicidin-2 Source.1718: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1719: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.1720: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta Source.1721: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1722: DFBPPR13508 ---- Animal proteins ---- Fibrinogen beta chain Source.1723: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase Source.1724: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.1725: DFBPPR13564 ---- Animal proteins ---- Calmodulin Source.1726: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.1727: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.1728: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1729: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1730: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1731: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1732: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.1733: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1734: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.1735: DFBPPR13656 ---- Animal proteins ---- Thioredoxin Source.1736: DFBPPR13672 ---- Animal proteins ---- Annexin A2 Source.1737: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.1738: DFBPPR13698 ---- Animal proteins ---- Progonadoliberin-1 Source.1739: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta Source.1740: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.1741: DFBPPR13788 ---- Animal proteins ---- Albumin Source.1742: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.1743: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.1744: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.1745: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.1746: DFBPPR13867 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.1747: DFBPPR13874 ---- Animal proteins ---- Cathelicidin-2 Source.1748: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1749: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3 Source.1750: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1751: DFBPPR13903 ---- Animal proteins ---- Fibrinogen beta chain Source.1752: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.1753: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.1754: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1755: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.1756: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.1757: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1758: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.1759: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.1760: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1761: DFBPPR14017 ---- Animal proteins ---- Ependymin Source.1762: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b Source.1763: DFBPPR14019 ---- Animal proteins ---- Vimentin Source.1764: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.1765: DFBPPR14081 ---- Marine protein ---- Beta-enolase Source.1766: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III Source.1767: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.1768: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.1769: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146 Source.1770: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1 Source.1771: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.1772: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.1773: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.1774: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog Source.1775: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B Source.1776: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein Source.1777: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A Source.1778: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit Source.1779: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3 Source.1780: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.1781: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.1782: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha Source.1783: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.1784: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.1785: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53 Source.1786: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.1787: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.1788: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.1789: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase Source.1790: DFBPPR14591 ---- Marine protein ---- Vimentin Source.1791: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.1792: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.1793: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.1794: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.1795: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.1796: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.1797: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A Source.1798: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B Source.1799: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.1800: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13 Source.1801: DFBPPR14725 ---- Marine protein ---- 40S ribosomal protein S6 Source.1802: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.1803: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1 Source.1804: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.1805: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3 Source.1806: DFBPPR14783 ---- Marine protein ---- Enolase Source.1807: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.1808: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.1809: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.1810: DFBPPR14818 ---- Marine protein ---- Tropomyosin Source.1811: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2 Source.1812: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1 Source.1813: DFBPPR14828 ---- Marine protein ---- Tropomyosin Source.1814: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B Source.1815: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A Source.1816: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1817: DFBPPR14862 ---- Marine protein ---- Insulin Source.1818: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle Source.1819: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.1820: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.1821: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.1822: DFBPPR14897 ---- Microorganism protein ---- Calmodulin Source.1823: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.1824: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit Source.1825: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.1826: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.1827: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.1828: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1 Source.1829: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1830: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.1831: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.1832: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.1833: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1 Source.1834: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.1835: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.1836: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.1837: DFBPPR15060 ---- Microorganism protein ---- Transaldolase Source.1838: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.1839: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.1840: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.1841: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase Source.1842: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.1843: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase Source.1844: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3 Source.1845: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.1846: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase Source.1847: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.1848: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.1849: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.1850: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.1851: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1 Source.1852: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase Source.1853: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.1854: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.1855: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase Source.1856: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.1857: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.1858: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8 Source.1859: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2 Source.1860: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.1861: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.1862: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.1863: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha Source.1864: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1 Source.1865: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.1866: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.1867: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.1868: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.1869: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.1870: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.1871: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.1872: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1873: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.1874: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.1875: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.1876: DFBPPR15410 ---- Microorganism protein ---- Mitochondrial inner membrane protease ATP23 Source.1877: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2 Source.1878: DFBPPR15420 ---- Microorganism protein ---- EKC/KEOPS complex subunit GON7 Source.1879: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.1880: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2 Source.1881: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.1882: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase Source.1883: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.1884: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.1885: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1 Source.1886: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.1887: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.1888: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.1889: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1 Source.1890: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.1891: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.1892: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.1893: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3 Source.1894: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.1895: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110 Source.1896: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.1897: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9 Source.1898: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27 Source.1899: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1 Source.1900: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.1901: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.1902: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.1903: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1 Source.1904: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5 Source.1905: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25 Source.1906: DFBPPR15674 ---- Microorganism protein ---- DNA polymerase epsilon subunit C Source.1907: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6 Source.1908: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.1909: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1 Source.1910: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.1911: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.1912: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.1913: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial Source.1914: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1 Source.1915: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.1916: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.1917: DFBPPR15780 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 8 Source.1918: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9 Source.1919: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.1920: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.1921: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.1922: DFBPPR15845 ---- Microorganism protein ---- Calmodulin Source.1923: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.1924: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.1925: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.1926: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.1927: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1928: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.1929: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1 Source.1930: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.1931: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1 Source.1932: DFBPPR7960 ---- Plant protein ---- Vicilin Source.1933: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.1934: DFBPPR8030 ---- Plant protein ---- Arcelin-5A Source.1935: DFBPPR8073 ---- Plant protein ---- Arcelin-5B Source.1936: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1937: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.1938: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.1939: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase Source.1940: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.1941: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.1942: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1943: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.1944: DFBPPR8284 ---- Plant protein ---- Calmodulin Source.1945: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog Source.1946: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.1947: DFBPPR8331 ---- Plant protein ---- Auxin-responsive protein SAUR50 Source.1948: DFBPPR8352 ---- Plant protein ---- Putative uncharacterized protein ycf15
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide EVD showed low antioxidant activity with a relative antioxidant activity of 0.01 ± 0.03 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

DFBP

[D1]	DFBPACEI2141
[D2]	DFBPMUFU0623

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015