Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0955(Antioxidative peptide)

DFBP ID	DFBPANOX0955
Peptide sequence	LPM
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Leu-Pro-Met

Single-letter amino acid

LPM

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	359.48 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.3667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine whey protein
Precursor protein	β-Lactoglobulin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.2: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.4: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.5: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.6: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.7: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.8: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.9: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.10: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.11: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.12: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.13: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.14: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.15: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.16: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.17: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.18: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.19: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6 Source.20: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.21: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.22: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.23: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.24: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.25: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d Source.26: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.27: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.28: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.29: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.30: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.31: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.32: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.33: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.34: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.35: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.36: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.37: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.38: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.39: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2 Source.40: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.41: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.42: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.43: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7 Source.44: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.45: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.46: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.47: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.48: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.49: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.50: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.51: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.52: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.53: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.54: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.55: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.56: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.57: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.58: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.59: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.60: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.61: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.62: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.63: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.64: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.65: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.66: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.67: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.68: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.69: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.70: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.71: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.72: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.73: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.74: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1 Source.75: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.76: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.77: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.78: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73 Source.79: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.80: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic Source.81: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.82: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.83: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.84: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.85: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.86: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.87: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.88: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic Source.89: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.90: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.91: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.92: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.93: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.94: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.95: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4 Source.96: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.97: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.98: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.99: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.100: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.101: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.102: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.103: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.104: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.105: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.106: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog Source.107: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.108: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.109: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.110: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.111: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.112: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.113: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4 Source.114: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.115: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.116: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.117: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.118: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.119: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.120: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.121: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.122: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.123: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.124: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.125: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.126: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.127: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.128: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.129: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.130: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.131: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.132: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.133: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.134: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.135: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.136: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.137: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.138: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.139: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3 Source.140: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.141: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.142: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.143: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.144: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.145: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.146: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.147: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.148: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.149: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.150: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.151: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.152: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.153: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.154: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2 Source.155: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.156: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.157: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.158: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58 Source.159: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.160: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.161: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.162: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.163: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.164: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.165: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.166: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.167: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.168: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.169: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A Source.170: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.171: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B Source.172: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C Source.173: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.174: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.175: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.176: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.177: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.178: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.179: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.180: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.181: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.182: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic Source.183: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.184: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.185: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.186: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.187: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.188: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.189: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.190: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.191: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.192: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.193: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.194: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.195: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.196: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.197: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.198: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.199: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.200: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.201: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2 Source.202: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.203: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400 Source.204: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.205: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.206: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400 Source.207: DFBPPR4864 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0625400 Source.208: DFBPPR4871 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0242900 Source.209: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.210: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.211: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.212: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.213: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.214: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.215: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.216: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.217: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.218: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase Source.219: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.220: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.221: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.222: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic Source.223: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic Source.224: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.225: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1 Source.226: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.227: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.228: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.229: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.230: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.231: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.232: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.233: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.234: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.235: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase Source.236: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.237: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.238: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.239: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.240: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.241: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.242: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.243: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.244: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.245: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.246: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.247: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.248: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.249: DFBPPR6049 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 2 Source.250: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.251: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.252: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.253: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic Source.254: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic Source.255: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.256: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.257: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5 Source.258: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.259: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.260: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.261: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.262: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.263: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.264: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.265: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z Source.266: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic Source.267: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic Source.268: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512 Source.269: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.270: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.271: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.272: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant Source.273: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.274: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.275: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.276: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.277: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3 Source.278: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic Source.279: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.280: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.281: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic Source.282: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.283: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.284: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3 Source.285: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4 Source.286: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.287: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.288: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.289: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.290: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.291: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.292: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.293: DFBPPR8420 ---- Plant proteins ---- Peroxygenase Source.294: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.295: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.296: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.297: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.298: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.299: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.300: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.301: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.302: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.303: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.304: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.305: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.306: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.307: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.308: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.309: DFBPPR16098 ---- Animal proteins ---- Fibroblast growth factor 7 Source.310: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.311: DFBPPR16138 ---- Animal proteins ---- Claudin-3 Source.312: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.313: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.314: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2 Source.315: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.316: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.317: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.318: DFBPPR16279 ---- Animal proteins ---- Galactokinase Source.319: DFBPPR16304 ---- Animal proteins ---- Cathepsin K Source.320: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.321: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.322: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.323: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.324: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.325: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.326: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.327: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.328: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4 Source.329: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3 Source.330: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.331: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.332: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.333: DFBPPR16808 ---- Animal proteins ---- Fibroblast growth factor 2 Source.334: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.335: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.336: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.337: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.338: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.339: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.340: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.341: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.342: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.343: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.344: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.345: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.346: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.347: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.348: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.349: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.350: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.351: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.352: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.353: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.354: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3 Source.355: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.356: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.357: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.358: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.359: DFBPPR17592 ---- Animal proteins ---- Claudin-3 Source.360: DFBPPR17593 ---- Animal proteins ---- Claudin-3 Source.361: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.362: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase Source.363: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.364: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.365: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor Source.366: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.367: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome Source.368: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.369: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG Source.370: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.371: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.372: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.373: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.374: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.375: DFBPPR18107 ---- Animal proteins ---- Lymphocyte antigen 96 Source.376: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.377: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.378: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.379: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1 Source.380: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.381: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.382: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.383: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.384: DFBPPR18307 ---- Animal proteins ---- Claudin-4 Source.385: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.386: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.387: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.388: DFBPPR18434 ---- Animal proteins ---- Interferon beta-3 Source.389: DFBPPR18448 ---- Animal proteins ---- Septin-1 Source.390: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.391: DFBPPR18470 ---- Animal proteins ---- Perilipin-5 Source.392: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.393: DFBPPR18516 ---- Animal proteins ---- Galactokinase Source.394: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.395: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.396: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D Source.397: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.398: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.399: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.400: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.401: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.402: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.403: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.404: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.405: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13 Source.406: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.407: DFBPPR19164 ---- Animal proteins ---- RNA-binding protein with serine-rich domain 1 Source.408: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain Source.409: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16 Source.410: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B Source.411: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like Source.412: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.413: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6 Source.414: DFBPPR19312 ---- Animal proteins ---- Copine-1 Source.415: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.416: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9 Source.417: DFBPPR19343 ---- Animal proteins ---- Interferon alpha-inducible protein 6 Source.418: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1 Source.419: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein Source.420: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2 Source.421: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1 Source.422: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.423: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.424: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.425: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.426: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.427: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit Source.428: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.429: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase Source.430: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.431: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.432: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.433: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.434: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.435: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.436: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3 Source.437: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.438: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.439: DFBPPR20396 ---- Animal proteins ---- Claudin-5 Source.440: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.441: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.442: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4 Source.443: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.444: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.445: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.446: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.447: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1 Source.448: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein Source.449: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.450: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.451: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.452: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.453: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9 Source.454: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.455: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2 Source.456: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.457: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.458: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.459: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.460: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.461: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.462: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4 Source.463: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial Source.464: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.465: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.466: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein Source.467: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H Source.468: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3 Source.469: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform Source.470: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.471: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.472: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2 Source.473: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.474: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.475: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18 Source.476: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.477: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.478: DFBPPR21549 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y Source.479: DFBPPR21628 ---- Animal proteins ---- G patch domain-containing protein 11 Source.480: DFBPPR21668 ---- Animal proteins ---- Putative deoxyribonuclease TATDN1 Source.481: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.482: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6 Source.483: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like Source.484: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.485: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.486: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7 Source.487: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein Source.488: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.489: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC Source.490: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial Source.491: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.492: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.493: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.494: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.495: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A Source.496: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7 Source.497: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.498: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.499: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.500: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.501: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70 Source.502: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.503: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.504: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog Source.505: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B Source.506: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.507: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.508: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.509: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.510: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.511: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105 Source.512: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71 Source.513: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.514: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.515: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.516: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.517: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.518: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.519: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.520: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.521: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.522: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.523: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.524: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.525: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.526: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.527: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.528: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.529: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.530: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.531: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.532: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.533: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.534: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.535: DFBPPR9072 ---- Animal proteins ---- CD9 antigen Source.536: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.537: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.538: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6 Source.539: DFBPPR9198 ---- Animal proteins ---- Fibroblast growth factor 7 Source.540: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.541: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.542: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.543: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3 Source.544: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.545: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.546: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.547: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1 Source.548: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.549: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.550: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.551: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha Source.552: DFBPPR9578 ---- Animal proteins ---- Biglycan Source.553: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.554: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.555: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.556: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.557: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.558: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.559: DFBPPR9751 ---- Animal proteins ---- Perilipin-3 Source.560: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.561: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H Source.562: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8 Source.563: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.564: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.565: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.566: DFBPPR9927 ---- Animal proteins ---- Protein BTG3 Source.567: DFBPPR9959 ---- Animal proteins ---- Interferon gamma Source.568: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.569: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6 Source.570: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.571: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.572: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.573: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2 Source.574: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.575: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.576: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.577: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor Source.578: DFBPPR10157 ---- Animal proteins ---- CD40 ligand Source.579: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.580: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.581: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.582: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.583: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.584: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.585: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.586: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.587: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.588: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.589: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.590: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.591: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.592: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.593: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.594: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.595: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.596: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.597: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.598: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.599: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta Source.600: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.601: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.602: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.603: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.604: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.605: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.606: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.607: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.608: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.609: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform Source.610: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1 Source.611: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.612: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.613: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.614: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform Source.615: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.616: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.617: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1 Source.618: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.619: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a Source.620: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.621: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1 Source.622: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.623: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.624: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.625: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.626: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.627: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2 Source.628: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.629: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6 Source.630: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.631: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3 Source.632: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.633: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.634: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.635: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle Source.636: DFBPPR11660 ---- Animal proteins ---- Cathepsin K Source.637: DFBPPR11690 ---- Animal proteins ---- CDC42 small effector protein 1 Source.638: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.639: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.640: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1 Source.641: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.642: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17 Source.643: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.644: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.645: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.646: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2 Source.647: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like Source.648: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.649: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13 Source.650: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.651: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.652: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.653: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.654: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme Source.655: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.656: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.657: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.658: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.659: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.660: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.661: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.662: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.663: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.664: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.665: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.666: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.667: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.668: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1 Source.669: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.670: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.671: DFBPPR12817 ---- Animal proteins ---- Cathepsin E Source.672: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.673: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.674: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein Source.675: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.676: DFBPPR13174 ---- Animal proteins ---- Clusterin Source.677: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.678: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.679: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.680: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.681: DFBPPR13267 ---- Animal proteins ---- Interferon beta Source.682: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.683: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.684: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.685: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.686: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.687: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.688: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.689: DFBPPR13569 ---- Animal proteins ---- Fibroblast growth factor 2 Source.690: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.691: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.692: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.693: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.694: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.695: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.696: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.697: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.698: DFBPPR13734 ---- Animal proteins ---- Perilipin-5 Source.699: DFBPPR13735 ---- Animal proteins ---- Thyroid hormone receptor beta Source.700: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.701: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.702: DFBPPR13834 ---- Animal proteins ---- Biglycan Source.703: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.704: DFBPPR13890 ---- Animal proteins ---- Fibroblast growth factor 7 Source.705: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.706: DFBPPR13912 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.707: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.708: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a Source.709: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.710: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1 Source.711: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha Source.712: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.713: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.714: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.715: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.716: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.717: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.718: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a Source.719: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha Source.720: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.721: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4 Source.722: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15 Source.723: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.724: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.725: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.726: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.727: DFBPPR14998 ---- Microorganism protein ---- Galactokinase Source.728: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b Source.729: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.730: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.731: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.732: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.733: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.734: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.735: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.736: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.737: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4 Source.738: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70 Source.739: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.740: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.741: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase Source.742: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.743: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.744: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1 Source.745: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41 Source.746: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4 Source.747: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.748: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.749: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1 Source.750: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23 Source.751: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.752: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21 Source.753: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component Source.754: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.755: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.756: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase Source.757: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2 Source.758: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.759: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.760: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a Source.761: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.762: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.763: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.764: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.765: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity

The antioxidant activity of the synthetic tripeptide was evaluated using a FRAP assay and the activity of glutathione (273.28 ± 12.13 mmol Fe³⁺/mol peptide) was measured as a positive control. The peptide LPM showed moderate antioxidant activity with a relative antioxidant activity of 10.99 ± 0.43 mmol Fe³⁺/mol peptide (The activity have been reported as the averages of three independent experiments ± standard deviation.).

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using solid phase Fmoc Chemistry.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The result of the QSAR modeling indicated that the electronic and hydrogen-bonding properties of the amino acids in the tripeptide sequences, as well as the steric properties of the amino acid residues at the C- and N-termini, played an important role in the antioxidant activities of the tripeptides. The antioxidant activities of the tripeptides were generally higher with Cys and Trp amino acid residues in the sequence.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Tian, M., Fang, B., Jiang, L., Guo, H., Cui, J., Ren, F. Structure-activity relationship of a series of antioxidant tripeptides derived from β-Lactoglobulin using QSAR modeling. Dairy Science & Technology. 2015, 95, 451-63. DOI: 10.1007/s13594-015-0226-5
Other literature(s)	N.D
PubDate	2015