Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0999(Antioxidative peptide)

DFBP ID	DFBPANOX0999
Peptide sequence	GGE
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Gly-Gly-Glu

Single-letter amino acid

GGE

Peptide length

Peptide mass

Experimental mass	Theoretical mass
263.08 Da	261.24 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.34 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-1.4333^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Fish, Marine
Organism/Source	Sardinelle (Sardinella aurita)
Precursor protein	Sardinelle by-products protein
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.2: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.3: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3 Source.4: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.5: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.6: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.7: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.8: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.9: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.10: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.11: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.12: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.13: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.14: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.15: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.16: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.17: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.18: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.19: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.20: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.21: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.22: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2 Source.23: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.24: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1 Source.25: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.26: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.27: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.28: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.29: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.30: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8 Source.31: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.32: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.33: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.34: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.35: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10 Source.36: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.37: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7 Source.38: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.39: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.40: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.41: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.42: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.43: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.44: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6 Source.45: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.46: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.47: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.48: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.49: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.50: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase Source.51: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.52: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA Source.53: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.54: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.55: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9 Source.56: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.57: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.58: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.59: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.60: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.61: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3 Source.62: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4 Source.63: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.64: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1 Source.65: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.66: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.67: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1 Source.68: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.69: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.70: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10 Source.71: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3 Source.72: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.73: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.74: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.75: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24 Source.76: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.77: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.78: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.79: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5 Source.80: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.81: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.82: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.83: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.84: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.85: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.86: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.87: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.88: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.89: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.90: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4 Source.91: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.92: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.93: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.94: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.95: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13 Source.96: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.97: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.98: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A Source.99: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13 Source.100: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.101: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17 Source.102: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.103: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.104: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.105: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2 Source.106: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.107: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.108: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.109: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase Source.110: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.111: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.112: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.113: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.114: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10 Source.115: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24 Source.116: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.117: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.118: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.119: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.120: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.121: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23 Source.122: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.123: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.124: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.125: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.126: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.127: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.128: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.129: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b Source.130: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.131: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.132: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.133: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17 Source.134: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.135: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.136: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.137: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12 Source.138: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.139: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.140: DFBPPR1353 ---- Plant proteins ---- Transcription factor UDT1 Source.141: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.142: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.143: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.144: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.145: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.146: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.147: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.148: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.149: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.150: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.151: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.152: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.153: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.154: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.155: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.156: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.157: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.158: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.159: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.160: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.161: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1 Source.162: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.163: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.164: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1 Source.165: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.166: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.167: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.168: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.169: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.170: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.171: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.172: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.173: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.174: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.175: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1 Source.176: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.177: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.178: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.179: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.180: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8 Source.181: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.182: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.183: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.184: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.185: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.186: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.187: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.188: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.189: DFBPPR1561 ---- Plant proteins ---- Chitinase 4 Source.190: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.191: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17 Source.192: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9 Source.193: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.194: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.195: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8 Source.196: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.197: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.198: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase Source.199: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.200: DFBPPR1609 ---- Plant proteins ---- Expansin-B1 Source.201: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.202: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.203: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.204: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.205: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.206: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.207: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.208: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C Source.209: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C Source.210: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19 Source.211: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.212: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.213: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial Source.214: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.215: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.216: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.217: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.218: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.219: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.220: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.221: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.222: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.223: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.224: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062 Source.225: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.226: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.227: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.228: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.229: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.230: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1 Source.231: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.232: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a Source.233: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2 Source.234: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.235: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.236: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.237: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.238: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1 Source.239: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.240: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP Source.241: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.242: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.243: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.244: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.245: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.246: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.247: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9 Source.248: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.249: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3 Source.250: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.251: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.252: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.253: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.254: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.255: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.256: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.257: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.258: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.259: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.260: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.261: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.262: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.263: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.264: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.265: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.266: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.267: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a Source.268: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.269: DFBPPR1945 ---- Plant proteins ---- Histone H2B.2 Source.270: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.271: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.272: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.273: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.274: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1 Source.275: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17 Source.276: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.277: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.278: DFBPPR1983 ---- Plant proteins ---- Histone H2B.11 Source.279: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16 Source.280: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33 Source.281: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.282: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a Source.283: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.284: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.285: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.286: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.287: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.288: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.289: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.290: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.291: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.292: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.293: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1 Source.294: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.295: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.296: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.297: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.298: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.299: DFBPPR2101 ---- Plant proteins ---- Cupincin Source.300: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.301: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.302: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.303: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.304: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.305: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.306: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.307: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.308: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.309: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.310: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic Source.311: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.312: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.313: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.314: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.315: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein Source.316: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.317: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.318: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21 Source.319: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32 Source.320: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.321: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.322: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.323: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.324: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.325: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9 Source.326: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.327: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.328: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.329: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.330: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.331: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.332: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.333: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.334: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.335: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.336: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.337: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.338: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2 Source.339: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.340: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.341: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.342: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.343: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.344: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.345: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.346: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.347: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3 Source.348: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.349: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.350: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.351: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.352: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.353: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.354: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.355: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.356: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.357: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.358: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.359: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.360: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10 Source.361: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5 Source.362: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.363: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.364: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.365: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.366: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.367: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.368: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.369: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.370: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.371: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.372: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.373: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.374: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.375: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.376: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.377: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.378: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.379: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.380: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20 Source.381: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.382: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.383: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.384: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.385: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.386: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.387: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.388: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a Source.389: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.390: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9 Source.391: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.392: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.393: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.394: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.395: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.396: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.397: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a Source.398: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.399: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.400: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.401: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.402: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.403: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.404: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.405: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.406: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.407: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8 Source.408: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.409: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.410: DFBPPR2673 ---- Plant proteins ---- Expansin-B13 Source.411: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1 Source.412: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.413: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.414: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.415: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27 Source.416: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.417: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.418: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.419: DFBPPR2732 ---- Plant proteins ---- Small ubiquitin-related modifier 1 Source.420: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.421: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.422: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.423: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.424: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.425: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.426: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.427: DFBPPR2784 ---- Plant proteins ---- Chitinase 11 Source.428: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase Source.429: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.430: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.431: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.432: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.433: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.434: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.435: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1 Source.436: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4 Source.437: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.438: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.439: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.440: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.441: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.442: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.443: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.444: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.445: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.446: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.447: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.448: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.449: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.450: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.451: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.452: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.453: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.454: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.455: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.456: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.457: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.458: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein Source.459: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.460: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.461: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.462: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.463: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.464: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.465: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.466: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.467: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.468: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.469: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.470: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.471: DFBPPR2987 ---- Plant proteins ---- 1-Cys peroxiredoxin B Source.472: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.473: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.474: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.475: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.476: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.477: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.478: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein Source.479: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.480: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8 Source.481: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.482: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic Source.483: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.484: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.485: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.486: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.487: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.488: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.489: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.490: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.491: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.492: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.493: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.494: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.495: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.496: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.497: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3 Source.498: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.499: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.500: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.501: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.502: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48 Source.503: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.504: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.505: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.506: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.507: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.508: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.509: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.510: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.511: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.512: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit Source.513: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18 Source.514: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic Source.515: DFBPPR3296 ---- Plant proteins ---- MADS-box transcription factor 32 Source.516: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.517: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.518: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.519: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.520: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1 Source.521: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.522: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5 Source.523: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.524: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.525: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.526: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.527: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.528: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.529: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1 Source.530: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.531: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.532: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2 Source.533: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.534: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.535: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.536: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase Source.537: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.538: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1 Source.539: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1 Source.540: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.541: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.542: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.543: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12 Source.544: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.545: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.546: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.547: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.548: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.549: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.550: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8 Source.551: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.552: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.553: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.554: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.555: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog Source.556: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.557: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.558: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.559: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.560: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.561: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.562: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.563: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.564: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.565: DFBPPR3547 ---- Plant proteins ---- Probable BRI1 kinase inhibitor 1 Source.566: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2 Source.567: DFBPPR3551 ---- Plant proteins ---- Salt stress-induced protein Source.568: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.569: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.570: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.571: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58 Source.572: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.573: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.574: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.575: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.576: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.577: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6 Source.578: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.579: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.580: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.581: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.582: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.583: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.584: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.585: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin Source.586: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.587: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.588: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3 Source.589: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.590: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.591: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.592: DFBPPR3701 ---- Plant proteins ---- Non-specific lipid-transfer protein C4 Source.593: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.594: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.595: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.596: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.597: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.598: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.599: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1 Source.600: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.601: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.602: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.603: DFBPPR3750 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.604: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.605: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.606: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.607: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4 Source.608: DFBPPR3795 ---- Plant proteins ---- NRR repressor homolog 1 Source.609: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1 Source.610: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1 Source.611: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.612: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.613: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.614: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.615: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.616: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.617: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.618: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.619: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.620: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73 Source.621: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.622: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5 Source.623: DFBPPR3873 ---- Plant proteins ---- Putative glutaredoxin-C14 Source.624: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.625: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.626: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.627: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.628: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.629: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.630: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.631: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.632: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.633: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.634: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.635: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.636: DFBPPR3967 ---- Plant proteins ---- Embryonic abundant protein 1 Source.637: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.638: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1 Source.639: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.640: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.641: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2 Source.642: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.643: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7 Source.644: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.645: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1 Source.646: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.647: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.648: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.649: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.650: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58 Source.651: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C Source.652: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.653: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11 Source.654: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.655: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.656: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5 Source.657: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.658: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.659: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.660: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.661: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.662: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.663: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.664: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.665: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.666: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.667: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.668: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.669: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.670: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.671: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.672: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3 Source.673: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.674: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.675: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.676: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.677: DFBPPR4218 ---- Plant proteins ---- Glycine-rich cell wall structural protein 2 Source.678: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.679: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.680: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.681: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1 Source.682: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.683: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.684: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.685: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6 Source.686: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2 Source.687: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.688: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4 Source.689: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.690: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.691: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1 Source.692: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.693: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8 Source.694: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.695: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.696: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.697: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.698: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2 Source.699: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like Source.700: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.701: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.702: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25 Source.703: DFBPPR4364 ---- Plant proteins ---- Two-component response regulator ORR42 Source.704: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.705: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.706: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.707: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.708: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6 Source.709: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.710: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.711: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.712: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8 Source.713: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D Source.714: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.715: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.716: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4 Source.717: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.718: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.719: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.720: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.721: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.722: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.723: DFBPPR4455 ---- Plant proteins ---- CASP-like protein 5A2 Source.724: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28 Source.725: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.726: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.727: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.728: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.729: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.730: DFBPPR4509 ---- Plant proteins ---- Putative glycine-rich cell wall structural protein 1 Source.731: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.732: DFBPPR4512 ---- Plant proteins ---- Actin-depolymerizing factor 3 Source.733: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.734: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.735: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.736: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.737: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.738: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10 Source.739: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.740: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9 Source.741: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.742: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4 Source.743: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500 Source.744: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.745: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.746: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.747: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2 Source.748: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1 Source.749: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1 Source.750: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100 Source.751: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.752: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.753: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D Source.754: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.755: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1 Source.756: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2 Source.757: DFBPPR4701 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 15 Source.758: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4 Source.759: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800 Source.760: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5 Source.761: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.762: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.763: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10 Source.764: DFBPPR4726 ---- Plant proteins ---- 40S ribosomal protein S10-2 Source.765: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.766: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.767: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400 Source.768: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.769: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2 Source.770: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.771: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2 Source.772: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.773: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400 Source.774: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21 Source.775: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A Source.776: DFBPPR4768 ---- Plant proteins ---- Protein SPIRAL1-like 2 Source.777: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H Source.778: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.779: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900 Source.780: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.781: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.782: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.783: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800 Source.784: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.785: DFBPPR4815 ---- Plant proteins ---- 40S ribosomal protein S10-1 Source.786: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.787: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.788: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.789: DFBPPR4836 ---- Plant proteins ---- Protein SPIRAL1-like 3 Source.790: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400 Source.791: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48 Source.792: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900 Source.793: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100 Source.794: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.795: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58 Source.796: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.797: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4 Source.798: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.799: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.800: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.801: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1 Source.802: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.803: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic Source.804: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.805: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.806: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.807: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.808: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.809: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.810: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.811: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.812: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.813: DFBPPR4966 ---- Plant proteins ---- Glycinin G5 Source.814: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase Source.815: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.816: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.817: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase Source.818: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.819: DFBPPR5010 ---- Plant proteins ---- Protein SLE1 Source.820: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB Source.821: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.822: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.823: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.824: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1 Source.825: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.826: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.827: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.828: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.829: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein Source.830: DFBPPR5197 ---- Plant proteins ---- Nodulin-21 Source.831: DFBPPR5205 ---- Plant proteins ---- Urease Source.832: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial Source.833: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.834: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic Source.835: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.836: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.837: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.838: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.839: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic Source.840: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.841: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic Source.842: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.843: DFBPPR5293 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.844: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.845: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.846: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.847: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.848: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D Source.849: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.850: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic Source.851: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.852: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1 Source.853: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.854: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein Source.855: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.856: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.857: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.858: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.859: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial Source.860: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial Source.861: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.862: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.863: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.864: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.865: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1 Source.866: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.867: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.868: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.869: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.870: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.871: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.872: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.873: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.874: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.875: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.876: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.877: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.878: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.879: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B Source.880: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A Source.881: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.882: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.883: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.884: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.885: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1 Source.886: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.887: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.888: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.889: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.890: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.891: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.892: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.893: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6 Source.894: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.895: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial Source.896: DFBPPR5639 ---- Plant proteins ---- Histone H2B.1 Source.897: DFBPPR5640 ---- Plant proteins ---- Histone H2B.4 Source.898: DFBPPR5641 ---- Plant proteins ---- Histone H2B.2 Source.899: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.900: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.901: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.902: DFBPPR5656 ---- Plant proteins ---- Histone H2B.3 Source.903: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.904: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial Source.905: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial Source.906: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.907: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.908: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.909: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.910: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.911: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.912: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.913: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17 Source.914: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.915: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.916: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.917: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.918: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.919: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.920: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.921: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.922: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.923: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P Source.924: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.925: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.926: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.927: DFBPPR5919 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.928: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2 Source.929: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.930: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.931: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.932: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.933: DFBPPR6073 ---- Plant proteins ---- Protein IAL1 Source.934: DFBPPR6104 ---- Plant proteins ---- Late embryogenesis abundant protein EMB564 Source.935: DFBPPR6128 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.936: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.937: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.938: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.939: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.940: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.941: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.942: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.943: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.944: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.945: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.946: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.947: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.948: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.949: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.950: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta Source.951: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.952: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.953: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic Source.954: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.955: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.956: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.957: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.958: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.959: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.960: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.961: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.962: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.963: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.964: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.965: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.966: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.967: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.968: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.969: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.970: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.971: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic Source.972: DFBPPR6494 ---- Plant proteins ---- 50S ribosomal protein L1, chloroplastic Source.973: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.974: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.975: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.976: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.977: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.978: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.979: DFBPPR6660 ---- Plant proteins ---- Histone H2B.2 Source.980: DFBPPR6681 ---- Plant proteins ---- Histone H2B.4 Source.981: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.982: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.983: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.984: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.985: DFBPPR6724 ---- Plant proteins ---- Putative ATP synthase protein YMF19 Source.986: DFBPPR6729 ---- Plant proteins ---- Protein H2A.6 Source.987: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase Source.988: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.989: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3 Source.990: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.991: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.992: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.993: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.994: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B Source.995: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D Source.996: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A Source.997: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.998: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.999: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1000: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1001: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410 Source.1002: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1003: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1004: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.1005: DFBPPR6914 ---- Plant proteins ---- Em protein CS41 Source.1006: DFBPPR6916 ---- Plant proteins ---- Em protein H5 Source.1007: DFBPPR6917 ---- Plant proteins ---- Em protein H2 Source.1008: DFBPPR6920 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.1009: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.1010: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.1011: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3 Source.1012: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.1013: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.1014: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1 Source.1015: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1016: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.1017: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3 Source.1018: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1019: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1020: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1021: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase Source.1022: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1023: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1024: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1025: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.1026: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1027: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.1028: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.1029: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1030: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.1031: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1032: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1033: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.1034: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.1035: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1036: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1037: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.1038: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2 Source.1039: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic Source.1040: DFBPPR7282 ---- Plant proteins ---- Late embryogenesis abundant protein B19.4 Source.1041: DFBPPR7283 ---- Plant proteins ---- Late embryogenesis abundant protein B19.3 Source.1042: DFBPPR7284 ---- Plant proteins ---- Late embryogenesis abundant protein B19.1A Source.1043: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.1044: DFBPPR7292 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.1045: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein Source.1046: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.1047: DFBPPR7357 ---- Plant proteins ---- Late embryogenesis abundant protein B19.1B Source.1048: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.1049: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20 Source.1050: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1 Source.1051: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.1052: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.1053: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3 Source.1054: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4 Source.1055: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.1056: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1057: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic Source.1058: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.1059: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II Source.1060: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.1061: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.1062: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS Source.1063: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.1064: DFBPPR7550 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein Source.1065: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.1066: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.1067: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1068: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1069: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.1070: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.1071: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.1072: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.1073: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.1074: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1075: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B Source.1076: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17 Source.1077: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.1078: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1079: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1080: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase Source.1081: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1082: DFBPPR8471 ---- Plant proteins ---- Beta-amylase Source.1083: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.1084: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.1085: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.1086: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.1087: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.1088: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1089: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.1090: DFBPPR15953 ---- Animal proteins ---- Occludin Source.1091: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1092: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1093: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.1094: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.1095: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.1096: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1097: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1098: DFBPPR15988 ---- Animal proteins ---- Vascular endothelial growth factor A Source.1099: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2 Source.1100: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.1101: DFBPPR16001 ---- Animal proteins ---- Battenin Source.1102: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1103: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1104: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.1105: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1106: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1107: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1108: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1109: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1110: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog Source.1111: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1112: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.1113: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.1114: DFBPPR16098 ---- Animal proteins ---- Fibroblast growth factor 7 Source.1115: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1116: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1117: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.1118: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.1119: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1120: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.1121: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.1122: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1123: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.1124: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1125: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.1126: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.1127: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1128: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.1129: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha Source.1130: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1131: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.1132: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta Source.1133: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1134: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1135: DFBPPR16305 ---- Animal proteins ---- Phosducin Source.1136: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1137: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1138: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1139: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1140: DFBPPR16470 ---- Animal proteins ---- WAP four-disulfide core domain protein 2 Source.1141: DFBPPR16474 ---- Animal proteins ---- Pinin Source.1142: DFBPPR16501 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.1143: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1144: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.1145: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin Source.1146: DFBPPR16524 ---- Animal proteins ---- Suppressor of cytokine signaling 3 Source.1147: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.1148: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein Source.1149: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.1150: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.1151: DFBPPR16667 ---- Animal proteins ---- 60S ribosomal protein L12 Source.1152: DFBPPR16693 ---- Animal proteins ---- Cingulin Source.1153: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein Source.1154: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor Source.1155: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog Source.1156: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190 Source.1157: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252 Source.1158: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1159: DFBPPR16747 ---- Animal proteins ---- Pleckstrin Source.1160: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A Source.1161: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.1162: DFBPPR16810 ---- Animal proteins ---- Cathepsin B Source.1163: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta Source.1164: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1 Source.1165: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II Source.1166: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1167: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1168: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.1169: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.1170: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1171: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.1172: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.1173: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 Source.1174: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1175: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.1176: DFBPPR16886 ---- Animal proteins ---- Platelet factor 4 Source.1177: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.1178: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1179: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.1180: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1181: DFBPPR16918 ---- Animal proteins ---- Spastin Source.1182: DFBPPR16928 ---- Animal proteins ---- Endothelin-1 Source.1183: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A Source.1184: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1185: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.1186: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2 Source.1187: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.1188: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.1189: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.1190: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.1191: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1192: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1193: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.1194: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1195: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.1196: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.1197: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1198: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1199: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.1200: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.1201: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.1202: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog Source.1203: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1204: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.1205: DFBPPR17101 ---- Animal proteins ---- Annexin A5 Source.1206: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.1207: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.1208: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1209: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.1210: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.1211: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.1212: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Source.1213: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1214: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.1215: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1216: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1217: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1218: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1219: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1220: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1221: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1222: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1223: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1224: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.1225: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR Source.1226: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.1227: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.1228: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.1229: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.1230: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1231: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase Source.1232: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.1233: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.1234: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.1235: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.1236: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.1237: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5 Source.1238: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.1239: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.1240: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.1241: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.1242: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1243: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)] Source.1244: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.1245: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain Source.1246: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.1247: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1248: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1 Source.1249: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.1250: DFBPPR17532 ---- Animal proteins ---- Cytochrome b5 Source.1251: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.1252: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.1253: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5 Source.1254: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog Source.1255: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1256: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.1257: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.1258: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1 Source.1259: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.1260: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16 Source.1261: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.1262: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1263: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.1264: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta Source.1265: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.1266: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.1267: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.1268: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.1269: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1 Source.1270: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.1271: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.1272: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.1273: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.1274: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.1275: DFBPPR17849 ---- Animal proteins ---- Fibromodulin Source.1276: DFBPPR17865 ---- Animal proteins ---- Protein phosphatase 1A Source.1277: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1278: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1279: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase Source.1280: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1281: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1282: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.1283: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.1284: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1285: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.1286: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1287: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.1288: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1289: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.1290: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.1291: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.1292: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.1293: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.1294: DFBPPR17970 ---- Animal proteins ---- Profilin-2 Source.1295: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1296: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.1297: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.1298: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.1299: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.1300: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.1301: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1302: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.1303: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1304: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.1305: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1306: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.1307: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1308: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1309: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII Source.1310: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin Source.1311: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.1312: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.1313: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5 Source.1314: DFBPPR18211 ---- Animal proteins ---- Phosducin Source.1315: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6 Source.1316: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1317: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.1318: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1319: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.1320: DFBPPR18258 ---- Animal proteins ---- Prothymosin alpha Source.1321: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1322: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial Source.1323: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.1324: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.1325: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.1326: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1327: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.1328: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7 Source.1329: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.1330: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.1331: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.1332: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B Source.1333: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1334: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.1335: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1336: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.1337: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.1338: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.1339: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3 Source.1340: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.1341: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial Source.1342: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.1343: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.1344: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma Source.1345: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.1346: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.1347: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.1348: DFBPPR18558 ---- Animal proteins ---- Troponin T, cardiac muscle Source.1349: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.1350: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.1351: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1352: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.1353: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.1354: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.1355: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.1356: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1357: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.1358: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.1359: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3 Source.1360: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2 Source.1361: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1362: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.1363: DFBPPR18732 ---- Animal proteins ---- RNA-binding protein 8A Source.1364: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.1365: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1366: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.1367: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.1368: DFBPPR18779 ---- Animal proteins ---- Mucin-15 Source.1369: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.1370: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.1371: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.1372: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1373: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6 Source.1374: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.1375: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.1376: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1377: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.1378: DFBPPR18898 ---- Animal proteins ---- Complexin-3 Source.1379: DFBPPR18904 ---- Animal proteins ---- Protein KASH5 Source.1380: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.1381: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.1382: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.1383: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.1384: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A Source.1385: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.1386: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.1387: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.1388: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.1389: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1390: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Source.1391: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1392: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.1393: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1394: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.1395: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.1396: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.1397: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3 Source.1398: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8 Source.1399: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1400: DFBPPR19185 ---- Animal proteins ---- Partner of Y14 and mago Source.1401: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.1402: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.1403: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.1404: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2 Source.1405: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.1406: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1407: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4 Source.1408: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.1409: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1410: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1411: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1412: DFBPPR19273 ---- Animal proteins ---- Protein BEX3 Source.1413: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.1414: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.1415: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.1416: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85 Source.1417: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1418: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.1419: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1420: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.1421: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.1422: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.1423: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.1424: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.1425: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.1426: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1 Source.1427: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.1428: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71 Source.1429: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1430: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.1431: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.1432: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72 Source.1433: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1434: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.1435: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L Source.1436: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1437: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.1438: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.1439: DFBPPR19555 ---- Animal proteins ---- cAMP-regulated phosphoprotein 21 Source.1440: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.1441: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1442: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1 Source.1443: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.1444: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.1445: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2 Source.1446: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25 Source.1447: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.1448: DFBPPR19664 ---- Animal proteins ---- Protein OS-9 Source.1449: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2 Source.1450: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17 Source.1451: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.1452: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1453: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.1454: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.1455: DFBPPR19756 ---- Animal proteins ---- Ras-related protein Rab-1B Source.1456: DFBPPR19767 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.1457: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.1458: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.1459: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.1460: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1461: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.1462: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.1463: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1464: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC Source.1465: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1466: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.1467: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1468: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.1469: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.1470: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform Source.1471: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2 Source.1472: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.1473: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.1474: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4 Source.1475: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma Source.1476: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.1477: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.1478: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3 Source.1479: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.1480: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1 Source.1481: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1 Source.1482: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12 Source.1483: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20 Source.1484: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1485: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.1486: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.1487: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.1488: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.1489: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6 Source.1490: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.1491: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23 Source.1492: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.1493: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.1494: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein Source.1495: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.1496: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1497: DFBPPR20184 ---- Animal proteins ---- Centromere protein H Source.1498: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1499: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.1500: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1501: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.1502: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan Source.1503: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2 Source.1504: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.1505: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1 Source.1506: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.1507: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase Source.1508: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.1509: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.1510: DFBPPR20350 ---- Animal proteins ---- Pinin Source.1511: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1512: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial Source.1513: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.1514: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5 Source.1515: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1516: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2 Source.1517: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.1518: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.1519: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.1520: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6 Source.1521: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.1522: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein Source.1523: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.1524: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.1525: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74 Source.1526: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1527: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.1528: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog Source.1529: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.1530: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13 Source.1531: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.1532: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.1533: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.1534: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.1535: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease Source.1536: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.1537: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.1538: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.1539: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like Source.1540: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.1541: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.1542: DFBPPR20743 ---- Animal proteins ---- Myozenin-1 Source.1543: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.1544: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1 Source.1545: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.1546: DFBPPR20766 ---- Animal proteins ---- Torsin-2A Source.1547: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15 Source.1548: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial Source.1549: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.1550: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.1551: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein Source.1552: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.1553: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.1554: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.1555: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.1556: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A Source.1557: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.1558: DFBPPR20955 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm5 Source.1559: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein Source.1560: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1561: DFBPPR20984 ---- Animal proteins ---- Neuroglobin Source.1562: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial Source.1563: DFBPPR20990 ---- Animal proteins ---- 60S ribosomal protein L12 Source.1564: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.1565: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A Source.1566: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Source.1567: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.1568: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.1569: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.1570: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D Source.1571: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.1572: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.1573: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.1574: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.1575: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein Source.1576: DFBPPR21144 ---- Animal proteins ---- Repressor of RNA polymerase III transcription MAF1 homolog Source.1577: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor Source.1578: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6 Source.1579: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.1580: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.1581: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.1582: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog Source.1583: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21 Source.1584: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1585: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.1586: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.1587: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha Source.1588: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3 Source.1589: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3 Source.1590: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.1591: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.1592: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein Source.1593: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.1594: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1595: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial Source.1596: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1 Source.1597: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.1598: DFBPPR21456 ---- Animal proteins ---- Fatty acid-binding protein, intestinal Source.1599: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330 Source.1600: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.1601: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1602: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.1603: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3 Source.1604: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2 Source.1605: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.1606: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.1607: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1 Source.1608: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40 Source.1609: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1 Source.1610: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.1611: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1 Source.1612: DFBPPR21540 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.1613: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B Source.1614: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.1615: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1616: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.1617: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.1618: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1619: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.1620: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4 Source.1621: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1 Source.1622: DFBPPR21709 ---- Animal proteins ---- PEST proteolytic signal-containing nuclear protein Source.1623: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.1624: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2 Source.1625: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2 Source.1626: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.1627: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.1628: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190 Source.1629: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.1630: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3 Source.1631: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1632: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog Source.1633: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.1634: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2 Source.1635: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.1636: DFBPPR21855 ---- Animal proteins ---- Proline-rich nuclear receptor coactivator 2 Source.1637: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.1638: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10 Source.1639: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1 Source.1640: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1 Source.1641: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.1642: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.1643: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor Source.1644: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.1645: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.1646: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.1647: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11 Source.1648: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.1649: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.1650: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1 Source.1651: DFBPPR22157 ---- Animal proteins ---- Protein BEX5 Source.1652: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106 Source.1653: DFBPPR22179 ---- Animal proteins ---- CDKN2AIP N-terminal-like protein Source.1654: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.1655: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2 Source.1656: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1657: DFBPPR22253 ---- Animal proteins ---- Inhibitory synaptic factor 1 Source.1658: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.1659: DFBPPR22286 ---- Animal proteins ---- Oxidoreductase NAD-binding domain-containing protein 1 Source.1660: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.1661: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.1662: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein Source.1663: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.1664: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.1665: DFBPPR22376 ---- Animal proteins ---- 60S ribosomal protein L31 Source.1666: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10 Source.1667: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.1668: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9 Source.1669: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.1670: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.1671: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A Source.1672: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.1673: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101 Source.1674: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205 Source.1675: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.1676: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2 Source.1677: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.1678: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A Source.1679: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog Source.1680: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.1681: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175 Source.1682: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1 Source.1683: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89 Source.1684: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein Source.1685: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.1686: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1 Source.1687: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D Source.1688: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog Source.1689: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog Source.1690: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.1691: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1692: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1693: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.1694: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.1695: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.1696: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1 Source.1697: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.1698: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.1699: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.1700: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.1701: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.1702: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.1703: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.1704: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.1705: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1706: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.1707: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.1708: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog Source.1709: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.1710: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.1711: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1 Source.1712: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.1713: DFBPPR8694 ---- Animal proteins ---- Spastin Source.1714: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1715: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.1716: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.1717: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1718: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1719: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.1720: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.1721: DFBPPR8739 ---- Animal proteins ---- Metallothionein-3 Source.1722: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1723: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.1724: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.1725: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1 Source.1726: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1727: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.1728: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.1729: DFBPPR8787 ---- Animal proteins ---- Cathepsin D Source.1730: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II Source.1731: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1732: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.1733: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1734: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1735: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide Source.1736: DFBPPR8906 ---- Animal proteins ---- Sialidase-1 Source.1737: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.1738: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.1739: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1740: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta Source.1741: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1742: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.1743: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.1744: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1745: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.1746: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.1747: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.1748: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.1749: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.1750: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.1751: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1752: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1753: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.1754: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1755: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.1756: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.1757: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase Source.1758: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.1759: DFBPPR9198 ---- Animal proteins ---- Fibroblast growth factor 7 Source.1760: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.1761: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.1762: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1 Source.1763: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10 Source.1764: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1 Source.1765: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.1766: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.1767: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.1768: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.1769: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.1770: DFBPPR9308 ---- Animal proteins ---- Aromatase 3 Source.1771: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.1772: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.1773: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.1774: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.1775: DFBPPR9346 ---- Animal proteins ---- Myozenin-1 Source.1776: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1777: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.1778: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.1779: DFBPPR9448 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1780: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.1781: DFBPPR9518 ---- Animal proteins ---- Interleukin-5 Source.1782: DFBPPR9547 ---- Animal proteins ---- Ras-related protein Rab-1B Source.1783: DFBPPR9555 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.1784: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1785: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.1786: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.1787: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein Source.1788: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.1789: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta Source.1790: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.1791: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain Source.1792: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain Source.1793: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.1794: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.1795: DFBPPR9751 ---- Animal proteins ---- Perilipin-3 Source.1796: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.1797: DFBPPR9843 ---- Animal proteins ---- P protein Source.1798: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19 Source.1799: DFBPPR9871 ---- Animal proteins ---- DNA-binding protein inhibitor ID-4 Source.1800: DFBPPR9881 ---- Animal proteins ---- 60S ribosomal protein L31 Source.1801: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.1802: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.1803: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1804: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.1805: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1806: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.1807: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1808: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1809: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain Source.1810: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.1811: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.1812: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.1813: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.1814: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.1815: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog Source.1816: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.1817: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.1818: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7 Source.1819: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.1820: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.1821: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.1822: DFBPPR10136 ---- Animal proteins ---- Annexin A2 Source.1823: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.1824: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5 Source.1825: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II Source.1826: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.1827: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1 Source.1828: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.1829: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20 Source.1830: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.1831: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1832: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1 Source.1833: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.1834: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain Source.1835: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.1836: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1837: DFBPPR10271 ---- Animal proteins ---- Cadherin-7 Source.1838: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk Source.1839: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.1840: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.1841: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1842: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.1843: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.1844: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1845: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1846: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.1847: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.1848: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.1849: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1850: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.1851: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.1852: DFBPPR10385 ---- Animal proteins ---- Centromere protein S Source.1853: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.1854: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.1855: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.1856: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1857: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1858: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.1859: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1860: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.1861: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.1862: DFBPPR10459 ---- Animal proteins ---- Reelin Source.1863: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.1864: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.1865: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1866: DFBPPR10480 ---- Animal proteins ---- Cathepsin D Source.1867: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1 Source.1868: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.1869: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.1870: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1871: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.1872: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.1873: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.1874: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.1875: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.1876: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.1877: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.1878: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.1879: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.1880: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1881: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.1882: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6 Source.1883: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.1884: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.1885: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.1886: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.1887: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.1888: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.1889: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.1890: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.1891: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.1892: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.1893: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.1894: DFBPPR10674 ---- Animal proteins ---- Myelin basic protein Source.1895: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.1896: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.1897: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.1898: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.1899: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.1900: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.1901: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.1902: DFBPPR10747 ---- Animal proteins ---- Cathepsin B Source.1903: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.1904: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.1905: DFBPPR10785 ---- Animal proteins ---- Cytochrome b5 Source.1906: DFBPPR10796 ---- Animal proteins ---- Protrudin Source.1907: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.1908: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.1909: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1910: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.1911: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.1912: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.1913: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.1914: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.1915: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.1916: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.1917: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.1918: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.1919: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.1920: DFBPPR10919 ---- Animal proteins ---- Ski oncogene Source.1921: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.1922: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.1923: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.1924: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.1925: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type Source.1926: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.1927: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.1928: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.1929: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1930: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.1931: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor Source.1932: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.1933: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.1934: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.1935: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.1936: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.1937: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.1938: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.1939: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.1940: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.1941: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1942: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA Source.1943: DFBPPR11113 ---- Animal proteins ---- POU domain, class 4, transcription factor 1 Source.1944: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.1945: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1946: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1947: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain Source.1948: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.1949: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.1950: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1951: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.1952: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1 Source.1953: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.1954: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.1955: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.1956: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.1957: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.1958: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1 Source.1959: DFBPPR11269 ---- Animal proteins ---- Anosmin-1 Source.1960: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.1961: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES Source.1962: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.1963: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2 Source.1964: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.1965: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.1966: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.1967: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.1968: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3 Source.1969: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4 Source.1970: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4 Source.1971: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.1972: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.1973: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.1974: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.1975: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX Source.1976: DFBPPR11371 ---- Animal proteins ---- Suppressor of cytokine signaling 3 Source.1977: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.1978: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.1979: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.1980: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4 Source.1981: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.1982: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.1983: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.1984: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6 Source.1985: DFBPPR11444 ---- Animal proteins ---- Troponin T, cardiac muscle isoforms Source.1986: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1987: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.1988: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2 Source.1989: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein Source.1990: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.1991: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.1992: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.1993: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.1994: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1995: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC Source.1996: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein Source.1997: DFBPPR11583 ---- Animal proteins ---- Translin Source.1998: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.1999: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.2000: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.2001: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.2002: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein Source.2003: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon Source.2004: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37 Source.2005: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.2006: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.2007: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2 Source.2008: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2 Source.2009: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2010: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.2011: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2012: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8 Source.2013: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3 Source.2014: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.2015: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.2016: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.2017: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.2018: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22 Source.2019: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.2020: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62 Source.2021: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.2022: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.2023: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2024: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B Source.2025: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.2026: DFBPPR11851 ---- Animal proteins ---- Borealin Source.2027: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.2028: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5 Source.2029: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.2030: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.2031: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.2032: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2 Source.2033: DFBPPR11906 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 1 Source.2034: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta Source.2035: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.2036: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.2037: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.2038: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.2039: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1 Source.2040: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4 Source.2041: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.2042: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog Source.2043: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.2044: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.2045: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.2046: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC Source.2047: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.2048: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.2049: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma Source.2050: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2 Source.2051: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.2052: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.2053: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.2054: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.2055: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.2056: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2057: DFBPPR12157 ---- Animal proteins ---- Proline-rich nuclear receptor coactivator 2 Source.2058: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.2059: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Source.2060: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.2061: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1 Source.2062: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2063: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.2064: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.2065: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.2066: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.2067: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2068: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2069: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2070: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2071: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.2072: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.2073: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.2074: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.2075: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.2076: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.2077: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.2078: DFBPPR12340 ---- Animal proteins ---- Metallothionein-3 Source.2079: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2080: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2 Source.2081: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.2082: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.2083: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.2084: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2085: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2086: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2087: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2088: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.2089: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.2090: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.2091: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.2092: DFBPPR12431 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2 Source.2093: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.2094: DFBPPR12436 ---- Animal proteins ---- Cytochrome b5 Source.2095: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.2096: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.2097: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2 Source.2098: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2099: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2100: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.2101: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.2102: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.2103: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A Source.2104: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A Source.2105: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.2106: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2107: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2108: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.2109: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.2110: DFBPPR12613 ---- Animal proteins ---- Glutathione peroxidase 1 Source.2111: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2112: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.2113: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Source.2114: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.2115: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.2116: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2117: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.2118: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.2119: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2120: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.2121: DFBPPR12848 ---- Animal proteins ---- Sarcoplasmic reticulum histidine-rich calcium-binding protein Source.2122: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.2123: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.2124: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.2125: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.2126: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A Source.2127: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.2128: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B Source.2129: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.2130: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.2131: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.2132: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.2133: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.2134: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2135: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.2136: DFBPPR13017 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.2137: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.2138: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D Source.2139: DFBPPR13083 ---- Animal proteins ---- Promotilin Source.2140: DFBPPR13088 ---- Animal proteins ---- Tachykinin-4 Source.2141: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2142: DFBPPR13094 ---- Animal proteins ---- Atherin Source.2143: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain Source.2144: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2145: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.2146: DFBPPR13163 ---- Animal proteins ---- Metallothionein-3 Source.2147: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2148: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II Source.2149: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.2150: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.2151: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta Source.2152: DFBPPR13251 ---- Animal proteins ---- Cytochrome b5 Source.2153: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2154: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.2155: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.2156: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.2157: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.2158: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2159: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.2160: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2161: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta Source.2162: DFBPPR13376 ---- Animal proteins ---- Interleukin-5 Source.2163: DFBPPR13389 ---- Animal proteins ---- Phosducin Source.2164: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.2165: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.2166: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.2167: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.2168: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1 Source.2169: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.2170: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.2171: DFBPPR13515 ---- Animal proteins ---- Fibrinogen alpha chain Source.2172: DFBPPR13516 ---- Animal proteins ---- Keratin-associated protein 11-1 Source.2173: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2174: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.2175: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.2176: DFBPPR13556 ---- Animal proteins ---- Metallothionein-3 Source.2177: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2178: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.2179: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein Source.2180: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.2181: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.2182: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2183: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II Source.2184: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.2185: DFBPPR13657 ---- Animal proteins ---- Platelet factor 4 Source.2186: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.2187: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.2188: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma Source.2189: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.2190: DFBPPR13708 ---- Animal proteins ---- Renin Source.2191: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX Source.2192: DFBPPR13716 ---- Animal proteins ---- Trichohyalin Source.2193: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.2194: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2195: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain Source.2196: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.2197: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.2198: DFBPPR13838 ---- Animal proteins ---- Endothelin-1 Source.2199: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2200: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.2201: DFBPPR13864 ---- Animal proteins ---- Interleukin-5 Source.2202: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2203: DFBPPR13890 ---- Animal proteins ---- Fibroblast growth factor 7 Source.2204: DFBPPR13920 ---- Animal proteins ---- Troponin T, cardiac muscle Source.2205: DFBPPR13922 ---- Animal proteins ---- Fibrinogen alpha chain Source.2206: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2207: DFBPPR13960 ---- Animal proteins ---- Homeobox protein Hox-D4 Source.2208: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.2209: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.2210: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2211: DFBPPR14019 ---- Animal proteins ---- Vimentin Source.2212: DFBPPR14046 ---- Animal proteins ---- Myoglobin Source.2213: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1 Source.2214: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2 Source.2215: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.2216: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A Source.2217: DFBPPR14141 ---- Marine protein ---- Ependymin-2 Source.2218: DFBPPR14178 ---- Marine protein ---- Hepcidin-1 Source.2219: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase Source.2220: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.2221: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.2222: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2 Source.2223: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial Source.2224: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.2225: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.2226: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2227: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.2228: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.2229: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.2230: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.2231: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.2232: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.2233: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.2234: DFBPPR14441 ---- Marine protein ---- 30S ribosomal protein S8, chloroplastic Source.2235: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic Source.2236: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.2237: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.2238: DFBPPR14500 ---- Marine protein ---- 50S ribosomal protein L27, chloroplastic Source.2239: DFBPPR14531 ---- Marine protein ---- Protein PYP1 Source.2240: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A Source.2241: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor Source.2242: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.2243: DFBPPR14556 ---- Marine protein ---- Interleukin-1 beta Source.2244: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.2245: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta Source.2246: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.2247: DFBPPR14591 ---- Marine protein ---- Vimentin Source.2248: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.2249: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.2250: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.2251: DFBPPR14618 ---- Marine protein ---- Ependymin-1 Source.2252: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.2253: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.2254: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.2255: DFBPPR14645 ---- Marine protein ---- Ependymin-2 Source.2256: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2 Source.2257: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.2258: DFBPPR14701 ---- Marine protein ---- Hepcidin Source.2259: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1 Source.2260: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2 Source.2261: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2 Source.2262: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1 Source.2263: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog Source.2264: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2265: DFBPPR14768 ---- Marine protein ---- Tachylectin-2 Source.2266: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.2267: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.2268: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain Source.2269: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial Source.2270: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.2271: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form Source.2272: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha Source.2273: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2274: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.2275: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.2276: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.2277: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.2278: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2279: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.2280: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.2281: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.2282: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.2283: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.2284: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.2285: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase Source.2286: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.2287: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.2288: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.2289: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.2290: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.2291: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.2292: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.2293: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial Source.2294: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.2295: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.2296: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.2297: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4 Source.2298: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.2299: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2 Source.2300: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.2301: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.2302: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2 Source.2303: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I Source.2304: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.2305: DFBPPR15239 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 9 Source.2306: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.2307: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.2308: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D Source.2309: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7 Source.2310: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5 Source.2311: DFBPPR15349 ---- Microorganism protein ---- Mitochondrial fission 1 protein Source.2312: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1 Source.2313: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.2314: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.2315: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2 Source.2316: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.2317: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.2318: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.2319: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.2320: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.2321: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3 Source.2322: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.2323: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1 Source.2324: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14 Source.2325: DFBPPR15523 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 3, mitochondrial Source.2326: DFBPPR15535 ---- Microorganism protein ---- 60S ribosomal protein L44 Source.2327: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.2328: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1 Source.2329: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1 Source.2330: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16 Source.2331: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.2332: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8 Source.2333: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.2334: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial Source.2335: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.2336: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.2337: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.2338: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.2339: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase Source.2340: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.2341: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.2342: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase Source.2343: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.2344: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2345: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic Source.2346: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.2347: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.2348: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2349: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.2350: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.2351: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.2352: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.2353: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.2354: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2355: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2356: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.2357: DFBPPR7878 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.2358: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.2359: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic Source.2360: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.2361: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.2362: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1 Source.2363: DFBPPR8002 ---- Plant protein ---- Plastocyanin Source.2364: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.2365: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.2366: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.2367: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2368: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.2369: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2370: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3 Source.2371: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.2372: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.2373: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.2374: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2375: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2376: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.2377: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1 Source.2378: DFBPPR8130 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.2379: DFBPPR8135 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.2380: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.2381: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.2382: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.2383: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2384: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.2385: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.2386: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.2387: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.2388: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.2389: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.2390: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2391: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2392: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.2393: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase Source.2394: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.2395: DFBPPR8309 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.2396: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity	The peptide displayed intermediate DPPH radical-scavenging activity (38 ± 1.27%; at 150 μg/ml). *DPPH - the stable free radical 2,2-diphenyl-1-picrylhydrazyl
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

NCC(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Peptide obtained by hydrolysis of sardinelle (Sardinella aurita) by-products proteins by use of crude enzyme extract from viscera of sardine (Sardina pilchardus).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

These results suggest that hydrolysate from sardinelle by-products could be used as natural antioxidant in enhancing antioxidants properties of functional foods and in preventing oxidation reactions in food processing.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Bougatef, A., Nedjar-Arroume, N., Manni, L., Ravallec, R., Barkia, A., Guillochon, D., et al. Purification and identification of novel antioxidant peptides from enzymatic hydrolysates of sardinelle (Sardinella aurita) by-products proteins. Food Chem. 2010, 118, 559-65. DOI: 10.1016/j.foodchem.2009.05.021
Other literature(s)	N.D
PubDate	2010