| DFBP ID - DFBPCYPE0004(Cytotoxic peptide) |
| DFBP ID |
DFBPCYPE0004 |
| Peptide sequence |
WIRGCRL |
| Type |
Native peptide |
| Peptide/Function name |
Cytotoxic peptide |
|
| Function-activity relationship |
| Main bioactivity |
Cytotoxic peptide activity |
| Otheir bioactivity |
Antioxidative activity [D1], Multifunctional activity [D2] |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Trp-Ile-Arg-Gly-Cys-Arg-Leu |
| Single-letter amino acid |
WIRGCRL |
| Peptide length |
7 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| 902.7 Da |
903.11 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
10.89 c |
| IC50 |
N.D |
| pIC50 |
N.D |
| GRAVY |
0.0714 c |
| Hydrophilic residue ratio |
57.14% c |
| Peptide calculator |
|
|
| Peptide source & Food-borne protein(s) search |
| Classification |
Animal |
| Organism/Source |
Hen |
| Precursor protein |
Egg-white lysozyme |
| Residue position |
f(123-129)
|
|
Precursor protein(s) search
|
|
|
Link-research
|
There are no literature reports on the discovery of this sequence in other food-source proteins. |
|
| Biological/Functional activity & target protein |
| Cytotoxic activity |
Oxygen radical absorbance capacity-fluorescein (ORAC-FL) assay
| The peptide presented antioxidant activity with values of 2.393 ± 0.280 umol Trolox/umol peptide.
| | Thiobarbituric acid reactive substances (TBARS) in zebrafish larvae | The peptide was found to efficiently inhibit lipid perosidation (63.2 % inhibition of lipid peroxidation). | Toxicity in the Zebrafish model (Danio rerio) | The peptide was not toxic in zebrafish eggs and larvae at concentrations lower than 50 ug/ml. Concentrations higher than 50 ug/ml was toxic for both zebrafish eggs and larvae.
|
|
| Specific target protein(s) |
N.D |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Bitter taste prediction |
|
| SMILES |
N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Enzymatic hydrolysis |
| Enzyme(s)/starter culture |
Lysozyme was hydrolyzed in situ with pepsin to generate positive charged peptides. |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
| Literature report: |
In the zebrafish larvae test, this peptide does not present toxicity at a
concentration of 50 ug/ml for zebrafish eggs. However, concentration
higher than 50 ug/ml of peptide was cytotoxic to zebrafish egg after 24
hours of incubation. |
| Prediction: |
ToxinPred |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Carrillo, W., Gómez-Ruiz, J.A., Miralles, B., Ramos, M., Barrio, D., Recio, I. Identification of antioxidant peptides of hen egg-white lysozyme and evaluation of inhibition of lipid peroxidation and cytotoxicity in the Zebrafish model. European Food Research and Technology. 2016, 242, 1777-85.
|
| Other literature(s) |
N.D |
| PubDate |
2016 |
|