E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPDPIV0010(DPP IV-inhibitory peptide)
DFBP ID DFBPDPIV0010
Peptide sequence VPL
Type Native peptide
Peptide/Function name DPP IV-inhibitory peptide, Anti-diabetic peptide
Function-activity relationship
Main bioactivity DPP-IV inhibitory activity
Otheir bioactivity Stimulating activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Val-Pro-Leu
Single-letter amino acid VPL
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 327.42 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 2.1333 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Barley (Hordeum vulgare)
Precursor protein B hordein
Residue position

f(278-280)

Precursor protein(s) search
Source.1: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin
Source.2: DFBPPR0380 ---- Plant protein ---- Alpha-gliadin
Source.3: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin
Source.4: DFBPPR0382 ---- Plant protein ---- Alpha-gliadin
Source.5: DFBPPR0383 ---- Plant protein ---- Alpha-gliadin
Source.6: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin
Source.7: DFBPPR0385 ---- Plant protein ---- Alpha-gliadin
Source.8: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit
Source.9: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin
Source.10: DFBPPR0390 ---- Plant protein ---- B3144=ALPHA-gliadin derived CELIAC active peptide
Source.11: DFBPPR0391 ---- Plant protein ---- B3143=ALPHA-gliadin derived CELIAC active peptide
Source.12: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.13: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.14: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.15: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.16: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.17: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.18: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.19: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.20: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.21: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.22: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.23: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.24: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.25: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.26: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.27: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.28: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.29: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.30: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.31: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.32: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.33: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.34: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.35: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.36: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.37: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.38: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.39: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.40: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.41: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.42: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.43: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.44: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.45: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.46: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.47: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.48: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.49: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.50: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.51: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.52: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.53: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.54: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.55: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.56: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.57: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.58: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.59: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.60: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.61: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.62: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.63: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.64: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.65: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.66: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.67: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.68: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.69: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.70: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.71: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.72: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.73: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.74: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.75: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.76: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.77: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.78: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.79: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.80: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.81: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.82: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.83: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.84: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.85: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.86: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.87: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.88: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.89: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.90: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.91: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.92: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.93: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.94: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.95: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.96: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.97: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.98: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.99: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.100: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.101: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.102: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.103: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.104: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.105: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.106: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.107: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.108: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.109: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.110: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.111: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.112: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.113: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.114: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.115: DFBPPR1431 ---- Plant proteins ---- Glutaredoxin-C6
Source.116: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.117: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.118: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.119: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.120: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.121: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.122: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.123: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.124: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.125: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.126: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.127: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.128: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.129: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.130: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.131: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.132: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.133: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.134: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.135: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.136: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.137: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.138: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.139: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.140: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5
Source.141: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.142: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.143: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.144: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.145: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.146: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.147: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.148: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.149: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.150: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.151: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.152: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.153: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.154: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.155: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.156: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.157: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.158: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.159: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.160: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.161: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.162: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.163: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.164: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.165: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.166: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.167: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.168: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.169: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.170: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.171: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.172: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.173: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.174: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.175: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.176: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.177: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.178: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.179: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.180: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.181: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.182: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.183: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.184: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.185: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.186: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.187: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.188: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.189: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.190: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.191: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.192: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.193: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.194: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.195: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.196: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.197: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.198: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.199: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.200: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.201: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.202: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.203: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.204: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.205: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.206: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.207: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.208: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.209: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.210: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.211: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.212: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.213: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.214: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.215: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.216: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.217: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.218: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.219: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.220: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.221: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.222: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.223: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.224: DFBPPR2148 ---- Plant proteins ---- Auxin-responsive protein SAUR36
Source.225: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.226: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.227: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.228: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.229: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.230: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.231: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.232: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.233: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.234: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.235: DFBPPR2223 ---- Plant proteins ---- Urease
Source.236: DFBPPR2226 ---- Plant proteins ---- Two-component response regulator ORR7
Source.237: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.238: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.239: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.240: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.241: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.242: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.243: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic
Source.244: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.245: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.246: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.247: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.248: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.249: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.250: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.251: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.252: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.253: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.254: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.255: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.256: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.257: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.258: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.259: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.260: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.261: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.262: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.263: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.264: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.265: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26
Source.266: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.267: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.268: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.269: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.270: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.271: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.272: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.273: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.274: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.275: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.276: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.277: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.278: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.279: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.280: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.281: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.282: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.283: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.284: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.285: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.286: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.287: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.288: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.289: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.290: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.291: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.292: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.293: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.294: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.295: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.296: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.297: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.298: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.299: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.300: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.301: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.302: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.303: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.304: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.305: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.306: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.307: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.308: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.309: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.310: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.311: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.312: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.313: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.314: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.315: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.316: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.317: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.318: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.319: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6
Source.320: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.321: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.322: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.323: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.324: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.325: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4
Source.326: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.327: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.328: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.329: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.330: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.331: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.332: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.333: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.334: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5
Source.335: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.336: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.337: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.338: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.339: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.340: DFBPPR3044 ---- Plant proteins ---- Thioredoxin-like 4, chloroplastic
Source.341: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.342: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.343: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.344: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.345: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.346: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.347: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.348: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.349: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.350: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1
Source.351: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.352: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.353: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.354: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.355: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.356: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.357: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.358: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.359: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.360: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.361: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.362: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.363: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.364: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.365: DFBPPR3262 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.366: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.367: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.368: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.369: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.370: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.371: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.372: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.373: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2
Source.374: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.375: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.376: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.377: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.378: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.379: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.380: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.381: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.382: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.383: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.384: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.385: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.386: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.387: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.388: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.389: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.390: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.391: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.392: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3
Source.393: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.394: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5
Source.395: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.396: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.397: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.398: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.399: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.400: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.401: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.402: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.403: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.404: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.405: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.406: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.407: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.408: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.409: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.410: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.411: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.412: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.413: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.414: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.415: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.416: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.417: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.418: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.419: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.420: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.421: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.422: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.423: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.424: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.425: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.426: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.427: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.428: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55
Source.429: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.430: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.431: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.432: DFBPPR3813 ---- Plant proteins ---- Monothiol glutaredoxin-S8
Source.433: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.434: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.435: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.436: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11
Source.437: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.438: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.439: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.440: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.441: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.442: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.443: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.444: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.445: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.446: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.447: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.448: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.449: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.450: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.451: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.452: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.453: DFBPPR4030 ---- Plant proteins ---- Cytochrome b5
Source.454: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.455: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.456: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.457: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.458: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.459: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.460: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.461: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.462: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.463: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.464: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1
Source.465: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.466: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.467: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.468: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.469: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.470: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.471: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.472: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.473: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.474: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.475: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.476: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.477: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.478: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2
Source.479: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.480: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.481: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.482: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.483: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.484: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.485: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.486: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.487: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.488: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.489: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.490: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.491: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.492: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.493: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.494: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.495: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.496: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.497: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.498: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.499: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.500: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.501: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.502: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.503: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.504: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.505: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.506: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.507: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.508: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.509: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.510: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.511: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.512: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.513: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.514: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.515: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.516: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.517: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.518: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.519: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.520: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.521: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.522: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.523: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.524: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.525: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.526: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.527: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.528: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.529: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.530: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.531: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.532: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7
Source.533: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.534: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.535: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.536: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.537: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.538: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.539: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1
Source.540: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.541: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.542: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.543: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.544: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.545: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.546: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.547: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.548: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.549: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.550: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.551: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.552: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.553: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.554: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.555: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.556: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.557: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.558: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.559: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.560: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.561: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.562: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.563: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.564: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.565: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.566: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.567: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.568: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.569: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.570: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.571: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.572: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.573: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.574: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.575: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.576: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.577: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.578: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.579: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.580: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.581: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.582: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.583: DFBPPR5193 ---- Plant proteins ---- HMG-Y-related protein B
Source.584: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.585: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.586: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.587: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.588: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.589: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.590: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.591: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.592: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.593: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.594: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.595: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2
Source.596: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1
Source.597: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.598: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.599: DFBPPR5317 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.600: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.601: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.602: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.603: DFBPPR5337 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial
Source.604: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.605: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.606: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.607: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.608: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.609: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.610: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.611: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.612: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.613: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.614: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.615: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.616: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.617: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial
Source.618: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.619: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.620: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.621: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.622: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.623: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.624: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.625: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.626: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.627: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.628: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.629: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.630: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.631: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.632: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.633: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.634: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.635: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.636: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial
Source.637: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.638: DFBPPR5648 ---- Plant proteins ---- AP-2 complex subunit sigma
Source.639: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.640: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial
Source.641: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.642: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial
Source.643: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.644: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.645: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.646: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.647: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.648: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.649: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.650: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.651: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.652: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.653: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.654: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.655: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.656: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.657: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.658: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.659: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.660: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.661: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.662: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.663: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.664: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.665: DFBPPR5973 ---- Plant proteins ---- Cortical cell-delineating protein
Source.666: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.667: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.668: DFBPPR6046 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.669: DFBPPR6077 ---- Plant proteins ---- Pollen-specific protein C13
Source.670: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.671: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.672: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.673: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.674: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.675: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.676: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.677: DFBPPR6262 ---- Plant proteins ---- Nodule lectin
Source.678: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.679: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.680: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.681: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.682: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.683: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.684: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.685: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.686: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.687: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.688: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.689: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.690: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.691: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.692: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.693: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.694: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.695: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.696: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.697: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.698: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.699: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.700: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.701: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.702: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.703: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin
Source.704: DFBPPR6612 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.705: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.706: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.707: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.708: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.709: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.710: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.711: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.712: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8
Source.713: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.714: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.715: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.716: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.717: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.718: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.719: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.720: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.721: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.722: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.723: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z
Source.724: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.725: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.726: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.727: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.728: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI
Source.729: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.730: DFBPPR6801 ---- Plant proteins ---- Peroxidase
Source.731: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.732: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.733: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1
Source.734: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.735: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.736: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.737: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.738: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit
Source.739: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1
Source.740: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.741: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.742: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin
Source.743: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215
Source.744: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II
Source.745: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV
Source.746: DFBPPR6938 ---- Plant proteins ---- Alpha/beta-gliadin clone PW8142
Source.747: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V
Source.748: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III
Source.749: DFBPPR6941 ---- Plant proteins ---- Alpha/beta-gliadin A-I
Source.750: DFBPPR6949 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.751: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B
Source.752: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.753: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin
Source.754: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.755: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.756: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.757: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.758: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.759: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.760: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2
Source.761: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.762: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.763: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.764: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.765: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.766: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.767: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.768: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.769: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.770: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.771: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2
Source.772: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.773: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.774: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.775: DFBPPR7198 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.776: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.777: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.778: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.779: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.780: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.781: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.782: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.783: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.784: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.785: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.786: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B
Source.787: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C
Source.788: DFBPPR7278 ---- Plant proteins ---- Protein BLT4
Source.789: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.790: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.791: DFBPPR7318 ---- Plant proteins ---- B3-hordein
Source.792: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.793: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.794: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.795: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.796: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.797: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.798: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.799: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.800: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.801: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.802: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.803: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.804: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2
Source.805: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.806: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.807: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.808: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.809: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.810: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.811: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.812: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.813: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.814: DFBPPR7597 ---- Milk proteins ---- Alpha-lactalbumin
Source.815: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.816: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain
Source.817: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.818: DFBPPR7630 ---- Milk proteins ---- Folate receptor alpha
Source.819: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.820: DFBPPR7666 ---- Milk proteins ---- Whey acidic protein
Source.821: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2
Source.822: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin
Source.823: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein
Source.824: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.825: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.826: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.827: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.828: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.829: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.830: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.831: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.832: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.833: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.834: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.835: DFBPPR8434 ---- Plant proteins ---- Lectin
Source.836: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.837: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.838: DFBPPR8485 ---- Milk proteins ---- Folate receptor alpha
Source.839: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.840: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.841: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.842: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.843: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.844: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.845: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.846: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.847: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.848: DFBPPR15988 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.849: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.850: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.851: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.852: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.853: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.854: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.855: DFBPPR16024 ---- Animal proteins ---- Podocalyxin
Source.856: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.857: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.858: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.859: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.860: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.861: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.862: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.863: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.864: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.865: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.866: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.867: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.868: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.869: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.870: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.871: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.872: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.873: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.874: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.875: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.876: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.877: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.878: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.879: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.880: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.881: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.882: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.883: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.884: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.885: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.886: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.887: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.888: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.889: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.890: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.891: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.892: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.893: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.894: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.895: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.896: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.897: DFBPPR16501 ---- Animal proteins ---- F-box/LRR-repeat protein 15
Source.898: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.899: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.900: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.901: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.902: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.903: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.904: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.905: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.906: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.907: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.908: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.909: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.910: DFBPPR16663 ---- Animal proteins ---- Involucrin
Source.911: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.912: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1
Source.913: DFBPPR16678 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A
Source.914: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.915: DFBPPR16755 ---- Animal proteins ---- Glyoxalase domain-containing protein 5
Source.916: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.917: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.918: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.919: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.920: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.921: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.922: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.923: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.924: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.925: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.926: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.927: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.928: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.929: DFBPPR16886 ---- Animal proteins ---- Platelet factor 4
Source.930: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.931: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.932: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.933: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.934: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.935: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.936: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.937: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.938: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.939: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.940: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.941: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.942: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.943: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.944: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.945: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.946: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.947: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.948: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.949: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.950: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.951: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.952: DFBPPR17031 ---- Animal proteins ---- Aurora kinase A
Source.953: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.954: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.955: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.956: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.957: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.958: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.959: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.960: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.961: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.962: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.963: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.964: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.965: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.966: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.967: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.968: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.969: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.970: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.971: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.972: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.973: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.974: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.975: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.976: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.977: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.978: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.979: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.980: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.981: DFBPPR17274 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.982: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.983: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.984: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.985: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.986: DFBPPR17319 ---- Animal proteins ---- Integrin beta-1-binding protein 1
Source.987: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.988: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.989: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.990: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.991: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.992: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.993: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.994: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.995: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.996: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.997: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.998: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.999: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1000: DFBPPR17433 ---- Animal proteins ---- Caveolin-3
Source.1001: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.1002: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.1003: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.1004: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.1005: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.1006: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.1007: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.1008: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.1009: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.1010: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.1011: DFBPPR17559 ---- Animal proteins ---- C-X-C motif chemokine 10
Source.1012: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.1013: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.1014: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1015: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1016: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.1017: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.1018: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.1019: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.1020: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.1021: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.1022: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1023: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.1024: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.1025: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.1026: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.1027: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1028: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.1029: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1030: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.1031: DFBPPR17795 ---- Animal proteins ---- Acyl-coenzyme A thioesterase THEM4
Source.1032: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1033: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.1034: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B
Source.1035: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.1036: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.1037: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1038: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1039: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1040: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1041: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1042: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.1043: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8
Source.1044: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.1045: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.1046: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1047: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1048: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.1049: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.1050: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.1051: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1052: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.1053: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.1054: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.1055: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1
Source.1056: DFBPPR17974 ---- Animal proteins ---- Mimecan
Source.1057: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1058: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.1059: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1060: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.1061: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B
Source.1062: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.1063: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.1064: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.1065: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1066: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1067: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1068: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1069: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.1070: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1071: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.1072: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.1073: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1074: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1075: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.1076: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.1077: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.1078: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.1079: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.1080: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.1081: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.1082: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.1083: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.1084: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4
Source.1085: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1086: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.1087: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.1088: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.1089: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.1090: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.1091: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10
Source.1092: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1093: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1094: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.1095: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.1096: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1097: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.1098: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1099: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.1100: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1101: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.1102: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.1103: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.1104: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.1105: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1106: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1107: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.1108: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen
Source.1109: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.1110: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.1111: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1112: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.1113: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1114: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.1115: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.1116: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1117: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.1118: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.1119: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.1120: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.1121: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.1122: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.1123: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.1124: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1
Source.1125: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1126: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1127: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.1128: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.1129: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1130: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1131: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1132: DFBPPR18589 ---- Animal proteins ---- Interleukin-13
Source.1133: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.1134: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1135: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1136: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1137: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.1138: DFBPPR18622 ---- Animal proteins ---- CYFIP-related Rac1 interactor B
Source.1139: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.1140: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.1141: DFBPPR18779 ---- Animal proteins ---- Mucin-15
Source.1142: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1143: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.1144: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1145: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1146: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.1147: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.1148: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor
Source.1149: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1150: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1151: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.1152: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.1153: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase
Source.1154: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.1155: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1156: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.1157: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.1158: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.1159: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1160: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1161: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.1162: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.1163: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1164: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.1165: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog
Source.1166: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1167: DFBPPR18982 ---- Animal proteins ---- Gastrin-releasing peptide
Source.1168: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.1169: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.1170: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.1171: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1172: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.1173: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.1174: DFBPPR19053 ---- Animal proteins ---- Transmembrane protein 100
Source.1175: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.1176: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21
Source.1177: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.1178: DFBPPR19102 ---- Animal proteins ---- Cytoplasmic FMR1-interacting protein 1
Source.1179: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.1180: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.1181: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.1182: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1183: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.1184: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.1185: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.1186: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1187: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.1188: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.1189: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.1190: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.1191: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2
Source.1192: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.1193: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.1194: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.1195: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit
Source.1196: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.1197: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1198: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.1199: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.1200: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.1201: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1202: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.1203: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.1204: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.1205: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.1206: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.1207: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.1208: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1209: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1210: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.1211: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.1212: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.1213: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.1214: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.1215: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.1216: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1217: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1218: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1219: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.1220: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.1221: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.1222: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1
Source.1223: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.1224: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.1225: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1226: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N
Source.1227: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1228: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.1229: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.1230: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.1231: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1
Source.1232: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.1233: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.1234: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.1235: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.1236: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.1237: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1238: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1239: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1240: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1241: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.1242: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1243: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.1244: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.1245: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.1246: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.1247: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1248: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.1249: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1250: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.1251: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.1252: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.1253: DFBPPR19747 ---- Animal proteins ---- Organic solute transporter subunit beta
Source.1254: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.1255: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.1256: DFBPPR19767 ---- Animal proteins ---- F-box/LRR-repeat protein 15
Source.1257: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.1258: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1259: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1260: DFBPPR19806 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.1261: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.1262: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.1263: DFBPPR19828 ---- Animal proteins ---- Transmembrane protein 14C
Source.1264: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.1265: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.1266: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.1267: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.1268: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.1269: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.1270: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.1271: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.1272: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.1273: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.1274: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.1275: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.1276: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2
Source.1277: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.1278: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.1279: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.1280: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1281: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.1282: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5
Source.1283: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.1284: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.1285: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.1286: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein
Source.1287: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.1288: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.1289: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.1290: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.1291: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.1292: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.1293: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.1294: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.1295: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1296: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.1297: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.1298: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1299: DFBPPR20123 ---- Animal proteins ---- Securin
Source.1300: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.1301: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.1302: DFBPPR20145 ---- Animal proteins ---- Adipogenin
Source.1303: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.1304: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.1305: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.1306: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.1307: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.1308: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1309: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1310: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.1311: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.1312: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.1313: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.1314: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.1315: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1316: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.1317: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1318: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1319: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.1320: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase
Source.1321: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.1322: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.1323: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.1324: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1325: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.1326: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1327: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.1328: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.1329: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.1330: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1331: DFBPPR20396 ---- Animal proteins ---- Claudin-5
Source.1332: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.1333: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.1334: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.1335: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1336: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.1337: DFBPPR20440 ---- Animal proteins ---- 28S ribosomal protein S25, mitochondrial
Source.1338: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1339: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.1340: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1341: DFBPPR20476 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.1342: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.1343: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.1344: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.1345: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.1346: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.1347: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.1348: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D
Source.1349: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.1350: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.1351: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.1352: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.1353: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.1354: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.1355: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A
Source.1356: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.1357: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1358: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.1359: DFBPPR20644 ---- Animal proteins ---- Dynein regulatory complex protein 9
Source.1360: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.1361: DFBPPR20668 ---- Animal proteins ---- BLOC-1-related complex subunit 5
Source.1362: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1363: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.1364: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.1365: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.1366: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.1367: DFBPPR20728 ---- Animal proteins ---- Serine protease 45
Source.1368: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.1369: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.1370: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.1371: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.1372: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.1373: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.1374: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.1375: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.1376: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.1377: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.1378: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.1379: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.1380: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.1381: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.1382: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.1383: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.1384: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.1385: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.1386: DFBPPR20877 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD5
Source.1387: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.1388: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.1389: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1390: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2
Source.1391: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.1392: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25
Source.1393: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1
Source.1394: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.1395: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.1396: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.1397: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.1398: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.1399: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.1400: DFBPPR21023 ---- Animal proteins ---- Ribosome biogenesis protein NSA2 homolog
Source.1401: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.1402: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.1403: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.1404: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.1405: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.1406: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.1407: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.1408: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.1409: DFBPPR21089 ---- Animal proteins ---- 39S ribosomal protein L11, mitochondrial
Source.1410: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.1411: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.1412: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.1413: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.1414: DFBPPR21143 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog
Source.1415: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.1416: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11
Source.1417: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.1418: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1419: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.1420: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.1421: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.1422: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.1423: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.1424: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.1425: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.1426: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.1427: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124
Source.1428: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.1429: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.1430: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1431: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.1432: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.1433: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.1434: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.1435: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.1436: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.1437: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.1438: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14
Source.1439: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.1440: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.1441: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1
Source.1442: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1
Source.1443: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.1444: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1
Source.1445: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1446: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.1447: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.1448: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.1449: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1450: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.1451: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.1452: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.1453: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.1454: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.1455: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1456: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.1457: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11
Source.1458: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.1459: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.1460: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1461: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.1462: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2
Source.1463: DFBPPR21723 ---- Animal proteins ---- OCIA domain-containing protein 1
Source.1464: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.1465: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1466: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.1467: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.1468: DFBPPR21777 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 10
Source.1469: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.1470: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.1471: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.1472: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.1473: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.1474: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17
Source.1475: DFBPPR21887 ---- Animal proteins ---- Cyclin-G1
Source.1476: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1
Source.1477: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.1478: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.1479: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.1480: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.1481: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.1482: DFBPPR21959 ---- Animal proteins ---- DDB1- and CUL4-associated factor 16
Source.1483: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.1484: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.1485: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.1486: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.1487: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1488: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.1489: DFBPPR21991 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC7-like
Source.1490: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.1491: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.1492: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.1493: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.1494: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.1495: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.1496: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.1497: DFBPPR22059 ---- Animal proteins ---- Immediate early response 3-interacting protein 1
Source.1498: DFBPPR22067 ---- Animal proteins ---- Microfibril-associated glycoprotein 3
Source.1499: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.1500: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.1501: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1
Source.1502: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.1503: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.1504: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.1505: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256
Source.1506: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.1507: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1508: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.1509: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.1510: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22
Source.1511: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.1512: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.1513: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1
Source.1514: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.1515: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.1516: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.1517: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.1518: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.1519: DFBPPR22310 ---- Animal proteins ---- B-cell CLL/lymphoma 7 protein family member B
Source.1520: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.1521: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.1522: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11
Source.1523: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.1524: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.1525: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.1526: DFBPPR22386 ---- Animal proteins ---- DPY30 domain-containing protein 2
Source.1527: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog
Source.1528: DFBPPR22407 ---- Animal proteins ---- TSSK6-activating co-chaperone protein
Source.1529: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.1530: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3
Source.1531: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.1532: DFBPPR22436 ---- Animal proteins ---- Transmembrane protein 263
Source.1533: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.1534: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.1535: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.1536: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.1537: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3
Source.1538: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46
Source.1539: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.1540: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126
Source.1541: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.1542: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.1543: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1
Source.1544: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.1545: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein
Source.1546: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.1547: DFBPPR22574 ---- Animal proteins ---- Uncharacterized protein C1orf54 homolog
Source.1548: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.1549: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.1550: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.1551: DFBPPR22612 ---- Animal proteins ---- Glutamate-rich protein 5
Source.1552: DFBPPR22632 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 1
Source.1553: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.1554: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.1555: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.1556: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83
Source.1557: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2
Source.1558: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.1559: DFBPPR22722 ---- Animal proteins ---- Uncharacterized protein C11orf91 homolog
Source.1560: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.1561: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.1562: DFBPPR22757 ---- Animal proteins ---- Uncharacterized protein CXorf65 homolog
Source.1563: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.1564: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1565: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.1566: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.1567: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.1568: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.1569: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.1570: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1571: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.1572: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1573: DFBPPR8568 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.1574: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1575: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.1576: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1577: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.1578: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1579: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1580: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.1581: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1582: DFBPPR8655 ---- Animal proteins ---- Azurocidin
Source.1583: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.1584: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.1585: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1586: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.1587: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.1588: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1589: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.1590: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.1591: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.1592: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1593: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.1594: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1595: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1596: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.1597: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1598: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1599: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.1600: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1601: DFBPPR8759 ---- Animal proteins ---- Caveolin-3
Source.1602: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1603: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1604: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1605: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.1606: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1607: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.1608: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.1609: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.1610: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.1611: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.1612: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.1613: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.1614: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1615: DFBPPR8836 ---- Animal proteins ---- Myogenin
Source.1616: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.1617: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.1618: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.1619: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.1620: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1621: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.1622: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1623: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.1624: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1625: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1626: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.1627: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.1628: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1629: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1630: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.1631: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.1632: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1633: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.1634: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.1635: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1636: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.1637: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1638: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1639: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.1640: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1641: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1642: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1643: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1644: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1645: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1646: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.1647: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.1648: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1649: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.1650: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.1651: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.1652: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.1653: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.1654: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1
Source.1655: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1656: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1657: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.1658: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.1659: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1660: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.1661: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.1662: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1663: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.1664: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.1665: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.1666: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.1667: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.1668: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.1669: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.1670: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1671: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.1672: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1673: DFBPPR9397 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1674: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.1675: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.1676: DFBPPR9445 ---- Animal proteins ---- Securin
Source.1677: DFBPPR9448 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.1678: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.1679: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.1680: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.1681: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1682: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.1683: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.1684: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1685: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.1686: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1687: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.1688: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1689: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor
Source.1690: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.1691: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.1692: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1693: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.1694: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.1695: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.1696: DFBPPR9665 ---- Animal proteins ---- 60S ribosomal protein L21
Source.1697: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.1698: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.1699: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.1700: DFBPPR9710 ---- Animal proteins ---- Gastricsin
Source.1701: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1702: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1703: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.1704: DFBPPR9741 ---- Animal proteins ---- Syndecan-4
Source.1705: DFBPPR9748 ---- Animal proteins ---- Involucrin
Source.1706: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide
Source.1707: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.1708: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.1709: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.1710: DFBPPR9786 ---- Animal proteins ---- Adipogenin
Source.1711: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1712: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.1713: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8
Source.1714: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.1715: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.1716: DFBPPR9839 ---- Animal proteins ---- Nurim
Source.1717: DFBPPR9843 ---- Animal proteins ---- P protein
Source.1718: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.1719: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.1720: DFBPPR9892 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog
Source.1721: DFBPPR9903 ---- Animal proteins ---- Cyclin-G1
Source.1722: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1723: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.1724: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1725: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.1726: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40
Source.1727: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.1728: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.1729: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.1730: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.1731: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1732: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.1733: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1734: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.1735: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.1736: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.1737: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.1738: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.1739: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1740: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1741: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.1742: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.1743: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1744: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.1745: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.1746: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.1747: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.1748: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.1749: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.1750: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.1751: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.1752: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.1753: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1754: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.1755: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1756: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1757: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.1758: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.1759: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.1760: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1761: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.1762: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1763: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.1764: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.1765: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.1766: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.1767: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.1768: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.1769: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.1770: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.1771: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.1772: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.1773: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.1774: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.1775: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.1776: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.1777: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1778: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1779: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.1780: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.1781: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.1782: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1783: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1784: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1785: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.1786: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.1787: DFBPPR10317 ---- Animal proteins ---- Nucleophosmin
Source.1788: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.1789: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.1790: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.1791: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.1792: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.1793: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.1794: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.1795: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.1796: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1797: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.1798: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.1799: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.1800: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1801: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1802: DFBPPR10424 ---- Animal proteins ---- Charged multivesicular body protein 4b
Source.1803: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.1804: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1805: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.1806: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.1807: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.1808: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.1809: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.1810: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1811: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.1812: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.1813: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.1814: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.1815: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.1816: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.1817: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1818: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.1819: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.1820: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.1821: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.1822: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1823: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.1824: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.1825: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1826: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1827: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1828: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1829: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.1830: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.1831: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.1832: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1833: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.1834: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.1835: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.1836: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1837: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.1838: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.1839: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.1840: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.1841: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.1842: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1843: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.1844: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1845: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.1846: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.1847: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.1848: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.1849: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1850: DFBPPR10710 ---- Animal proteins ---- Linker for activation of T-cells family member 2
Source.1851: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1852: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.1853: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.1854: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.1855: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.1856: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1857: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.1858: DFBPPR10755 ---- Animal proteins ---- Draxin
Source.1859: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.1860: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1861: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.1862: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.1863: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.1864: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.1865: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.1866: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1867: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.1868: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.1869: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.1870: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.1871: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.1872: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.1873: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1874: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.1875: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.1876: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.1877: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.1878: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.1879: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.1880: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.1881: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.1882: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.1883: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.1884: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.1885: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1886: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1887: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1888: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1
Source.1889: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.1890: DFBPPR11028 ---- Animal proteins ---- Interleukin-6
Source.1891: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.1892: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.1893: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.1894: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1895: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.1896: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.1897: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.1898: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.1899: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.1900: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.1901: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1902: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1903: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.1904: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.1905: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1906: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.1907: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.1908: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.1909: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.1910: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.1911: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.1912: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.1913: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.1914: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.1915: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.1916: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.1917: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.1918: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1919: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.1920: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.1921: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.1922: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1923: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR
Source.1924: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.1925: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.1926: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.1927: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1928: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.1929: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.1930: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.1931: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.1932: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.1933: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.1934: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.1935: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.1936: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.1937: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.1938: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2
Source.1939: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.1940: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.1941: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.1942: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.1943: DFBPPR11533 ---- Animal proteins ---- Mimecan
Source.1944: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1945: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1946: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.1947: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.1948: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.1949: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.1950: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1951: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.1952: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.1953: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.1954: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.1955: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.1956: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.1957: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1958: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.1959: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1960: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein
Source.1961: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.1962: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7
Source.1963: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.1964: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1965: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.1966: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.1967: DFBPPR11722 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.1968: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.1969: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.1970: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.1971: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.1972: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.1973: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.1974: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1975: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.1976: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.1977: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.1978: DFBPPR11852 ---- Animal proteins ---- Endothelial differentiation-related factor 1 homolog
Source.1979: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.1980: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.1981: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.1982: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.1983: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.1984: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.1985: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1986: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.1987: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.1988: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1989: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.1990: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.1991: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.1992: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.1993: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.1994: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.1995: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.1996: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.1997: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1
Source.1998: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.1999: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.2000: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.2001: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.2002: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.2003: DFBPPR12036 ---- Animal proteins ---- BLOC-1-related complex subunit 5
Source.2004: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.2005: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.2006: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.2007: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.2008: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.2009: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.2010: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.2011: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.2012: DFBPPR12100 ---- Animal proteins ---- Centromere protein Q
Source.2013: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.2014: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.2015: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.2016: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.2017: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.2018: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.2019: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.2020: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme
Source.2021: DFBPPR12197 ---- Animal proteins ---- Transmembrane protein 263
Source.2022: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.2023: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.2024: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.2025: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.2026: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.2027: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.2028: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2029: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.2030: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.2031: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2032: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.2033: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2034: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.2035: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2036: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.2037: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.2038: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.2039: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.2040: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.2041: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.2042: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.2043: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2044: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.2045: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.2046: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.2047: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.2048: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.2049: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.2050: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.2051: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2052: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.2053: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.2054: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.2055: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.2056: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2057: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.2058: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2059: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2060: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.2061: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.2062: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.2063: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.2064: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2065: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.2066: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.2067: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.2068: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.2069: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin
Source.2070: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII
Source.2071: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.2072: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.2073: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.2074: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2075: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase
Source.2076: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.2077: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.2078: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.2079: DFBPPR12611 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A
Source.2080: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.2081: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2082: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.2083: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2084: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2085: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.2086: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.2087: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.2088: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.2089: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.2090: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.2091: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.2092: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.2093: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.2094: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.2095: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.2096: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.2097: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.2098: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.2099: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.2100: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2101: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.2102: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.2103: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.2104: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2
Source.2105: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.2106: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.2107: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.2108: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.2109: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2110: DFBPPR12849 ---- Animal proteins ---- WAP four-disulfide core domain protein 2
Source.2111: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.2112: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.2113: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2114: DFBPPR12899 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.2115: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2116: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.2117: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.2118: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2119: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.2120: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.2121: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2122: DFBPPR12992 ---- Animal proteins ---- Mimecan
Source.2123: DFBPPR13000 ---- Animal proteins ---- Cystatin-C
Source.2124: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.2125: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.2126: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein
Source.2127: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.2128: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain
Source.2129: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2130: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.2131: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.2132: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.2133: DFBPPR13166 ---- Animal proteins ---- CD44 antigen
Source.2134: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.2135: DFBPPR13207 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2136: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.2137: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.2138: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.2139: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2140: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.2141: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2142: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2143: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2144: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2145: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.2146: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.2147: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2
Source.2148: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2149: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2150: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.2151: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.2152: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2153: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2154: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2155: DFBPPR13463 ---- Animal proteins ---- Cathelicidin-2
Source.2156: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2157: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2158: DFBPPR13520 ---- Animal proteins ---- 60S ribosomal protein L21
Source.2159: DFBPPR13526 ---- Animal proteins ---- Pregnancy-associated glycoprotein 62
Source.2160: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.2161: DFBPPR13544 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.2162: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.2163: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2164: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.2165: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2166: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor
Source.2167: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2168: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2169: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.2170: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.2171: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2172: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2173: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.2174: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2175: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.2176: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2177: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.2178: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.2179: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.2180: DFBPPR13722 ---- Animal proteins ---- Insulin
Source.2181: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.2182: DFBPPR13738 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2183: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.2184: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.2185: DFBPPR13765 ---- Animal proteins ---- Ferritin heavy chain
Source.2186: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2187: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.2188: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.2189: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1
Source.2190: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2191: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.2192: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.2193: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.2194: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2195: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.2196: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2197: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.2198: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2199: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.2200: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.2201: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2202: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.2203: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2204: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.2205: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.2206: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2207: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2208: DFBPPR14038 ---- Animal proteins ---- UI
Source.2209: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.2210: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.2211: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.2212: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.2213: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.2214: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2215: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial
Source.2216: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.2217: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.2218: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.2219: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.2220: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.2221: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase
Source.2222: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.2223: DFBPPR14187 ---- Marine protein ---- Secreted phosphoprotein 24
Source.2224: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor
Source.2225: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.2226: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.2227: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.2228: DFBPPR14211 ---- Marine protein ---- WASH complex subunit 3
Source.2229: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.2230: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.2231: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.2232: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.2233: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.2234: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.2235: DFBPPR14354 ---- Marine protein ---- Cytochrome c-550
Source.2236: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.2237: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha
Source.2238: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.2239: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.2240: DFBPPR14409 ---- Marine protein ---- 30S ribosomal protein S5, chloroplastic
Source.2241: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.2242: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.2243: DFBPPR14475 ---- Marine protein ---- Photosystem I reaction center subunit VIII
Source.2244: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.2245: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.2246: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53
Source.2247: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.2248: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.2249: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.2250: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.2251: DFBPPR14581 ---- Marine protein ---- Interferon alpha/beta receptor 2
Source.2252: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.2253: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2254: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.2255: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2256: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.2257: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.2258: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.2259: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.2260: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.2261: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64
Source.2262: DFBPPR14711 ---- Marine protein ---- UI
Source.2263: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.2264: DFBPPR14771 ---- Marine protein ---- L-cystatin
Source.2265: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.2266: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.2267: DFBPPR14881 ---- Microorganism protein ---- Decapping and exoribonuclease protein 1
Source.2268: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2269: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.2270: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.2271: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.2272: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.2273: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.2274: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.2275: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.2276: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.2277: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.2278: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.2279: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.2280: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.2281: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.2282: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.2283: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.2284: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.2285: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2286: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.2287: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2288: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.2289: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.2290: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.2291: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.2292: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.2293: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.2294: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial
Source.2295: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.2296: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.2297: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.2298: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.2299: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.2300: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.2301: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.2302: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11
Source.2303: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.2304: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.2305: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.2306: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.2307: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.2308: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.2309: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35
Source.2310: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2311: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.2312: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.2313: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.2314: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.2315: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.2316: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.2317: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.2318: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.2319: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.2320: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.2321: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.2322: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.2323: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.2324: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.2325: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.2326: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.2327: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.2328: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial
Source.2329: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.2330: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.2331: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2332: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.2333: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.2334: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.2335: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17
Source.2336: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.2337: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.2338: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.2339: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10
Source.2340: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.2341: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.2342: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.2343: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.2344: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.2345: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.2346: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.2347: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.2348: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.2349: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.2350: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.2351: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.2352: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13
Source.2353: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.2354: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.2355: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.2356: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.2357: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3
Source.2358: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.2359: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.2360: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.2361: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.2362: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2
Source.2363: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.2364: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.2365: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45
Source.2366: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.2367: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1
Source.2368: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.2369: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3
Source.2370: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.2371: DFBPPR15766 ---- Microorganism protein ---- Protein ATC1/LIC4
Source.2372: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.2373: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.2374: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.2375: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.2376: DFBPPR15831 ---- Microorganism protein ---- Probable transcriptional regulator flp
Source.2377: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.2378: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.2379: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.2380: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.2381: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.2382: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.2383: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.2384: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.2385: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.2386: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic
Source.2387: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.2388: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.2389: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.2390: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2391: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2392: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.2393: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2394: DFBPPR7869 ---- Plant protein ---- Alpha-amylase inhibitor 5
Source.2395: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z
Source.2396: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.2397: DFBPPR7904 ---- Plant protein ---- Photosystem I reaction center subunit VIII
Source.2398: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.2399: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.2400: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.2401: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a
Source.2402: DFBPPR7954 ---- Plant protein ---- Favin
Source.2403: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.2404: DFBPPR7996 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.2405: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.2406: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.2407: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.2408: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.2409: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.2410: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.2411: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.2412: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.2413: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.2414: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.2415: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.2416: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2417: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2418: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.2419: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2420: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.2421: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.2422: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.2423: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.2424: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2425: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.2426: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2427: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.2428: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2429: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.2430: DFBPPR8308 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.2431: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.2432: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
DPP IV-inhibitory activity

The peptide showed potent inhibitory activity for Dipeptidyl-peptidase IV (EC 3.4.14.5) with the IC50 value of 15.8 μM.

Specific target protein(s) Specific Target Protein(s):
Dipeptidyl peptidase 4
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

37 °C, pH 7.2, 30 min with the synthetic substrate Gly-Pro-pNA (0.4 mM) DPP-IV units not disclosed.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPSTPE0001
[D2] DFBPMUFU0725
BIOPEP-UWM [D3] 3166, 3350, 8347
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Umezawa H, Aoyagi T, Ogawa K, Naganawa H, Hamada M, Takeuchi T. Diprotins A and B, inhibitors of dipeptidyl aminopeptidase IV, produced by bacteria. J Antibiot (Tokyo). 1984 Apr;37(4):422-5.
PMID: 6427168
Other literature(s)

[1] Nongonierma A B, Fitzgerald R J. An in silico model to predict the potential of dietary proteins as sources of dipeptidyl peptidase IV (DPP-IV) inhibitory peptides[J]. Food Chemistry, 2014, 165(20):489-498.

PubDate 1984
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214