E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPDPIV0017(DPP IV-inhibitory peptide)
DFBP ID DFBPDPIV0017
Peptide sequence WP
Type Native peptide
Peptide/Function name DPP-IV inhibitory peptide, Anti-diabetic peptide
Function-activity relationship
Main bioactivity DPP-IV inhibitory activity
Otheir bioactivity Antioxidative activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Trp-Pro
Single-letter amino acid WP
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 301.34 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY -1.2500 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Rice
Precursor protein Defated rice bran
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0393 ---- Plant protein ---- Gamma 2 gliadin
Source.2: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5
Source.3: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3
Source.4: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.5: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.6: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.7: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.8: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.9: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.10: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.11: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.12: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.13: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.14: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.15: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.16: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.17: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.18: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.19: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.20: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.21: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.22: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.23: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1
Source.24: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.25: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.26: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.27: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.28: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.29: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.30: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.31: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.32: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.33: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.34: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.35: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.36: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.37: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.38: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.39: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.40: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.41: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.42: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.43: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.44: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.45: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.46: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.47: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.48: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.49: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.50: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.51: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.52: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.53: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.54: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.55: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.56: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.57: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.58: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.59: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.60: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.61: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.62: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.63: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.64: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.65: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.66: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.67: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.68: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2
Source.69: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.70: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.71: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.72: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3
Source.73: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.74: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.75: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.76: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.77: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.78: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.79: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.80: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.81: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.82: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.83: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.84: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.85: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.86: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.87: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17
Source.88: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.89: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.90: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.91: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.92: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.93: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.94: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.95: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.96: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.97: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.98: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.99: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.100: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.101: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2
Source.102: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.103: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.104: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.105: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.106: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic
Source.107: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.108: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.109: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.110: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.111: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.112: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.113: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.114: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.115: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.116: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.117: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.118: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.119: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.120: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.121: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.122: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.123: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.124: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.125: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.126: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.127: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.128: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.129: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.130: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.131: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.132: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic
Source.133: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.134: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.135: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.136: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.137: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.138: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.139: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.140: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.141: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.142: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.143: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.144: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.145: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.146: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.147: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.148: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.149: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.150: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.151: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.152: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.153: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.154: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.155: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.156: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.157: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.158: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.159: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.160: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.161: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.162: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.163: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.164: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.165: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.166: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.167: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.168: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.169: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.170: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.171: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.172: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.173: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.174: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.175: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.176: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.177: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.178: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.179: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.180: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.181: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.182: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.183: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.184: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.185: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.186: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.187: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.188: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.189: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.190: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.191: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.192: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.193: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.194: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.195: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.196: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.197: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.198: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.199: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.200: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.201: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.202: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.203: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.204: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.205: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.206: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.207: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.208: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.209: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.210: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.211: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.212: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.213: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.214: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.215: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.216: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.217: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.218: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.219: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8
Source.220: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.221: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.222: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.223: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.224: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.225: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.226: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.227: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.228: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.229: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.230: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.231: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.232: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.233: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.234: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.235: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.236: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.237: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.238: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.239: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.240: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.241: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1
Source.242: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.243: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.244: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2
Source.245: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.246: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.247: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.248: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.249: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.250: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3
Source.251: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.252: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.253: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.254: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.255: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.256: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.257: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.258: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.259: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.260: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.261: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.262: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.263: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.264: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.265: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.266: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.267: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.268: DFBPPR1803 ---- Plant proteins ---- Chitinase 5
Source.269: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.270: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.271: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.272: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.273: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.274: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.275: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.276: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.277: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1
Source.278: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.279: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.280: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.281: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.282: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.283: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.284: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.285: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.286: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.287: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.288: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.289: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.290: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.291: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.292: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.293: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.294: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.295: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.296: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.297: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.298: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.299: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.300: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.301: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.302: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.303: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.304: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.305: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.306: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.307: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.308: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.309: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.310: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.311: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.312: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.313: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.314: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.315: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.316: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein
Source.317: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.318: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.319: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.320: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.321: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.322: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.323: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.324: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.325: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.326: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.327: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.328: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.329: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.330: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.331: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.332: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.333: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.334: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.335: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.336: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.337: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.338: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.339: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.340: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.341: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.342: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.343: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.344: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.345: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.346: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.347: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.348: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.349: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.350: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.351: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.352: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.353: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.354: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.355: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.356: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.357: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.358: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.359: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.360: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.361: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.362: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.363: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.364: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.365: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.366: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.367: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.368: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.369: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.370: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.371: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.372: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.373: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.374: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.375: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.376: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.377: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.378: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.379: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.380: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.381: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.382: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.383: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.384: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.385: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.386: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.387: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.388: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.389: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.390: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.391: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.392: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.393: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.394: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.395: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.396: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.397: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.398: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.399: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.400: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.401: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.402: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.403: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.404: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.405: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.406: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.407: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.408: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.409: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3
Source.410: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.411: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56
Source.412: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.413: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.414: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.415: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.416: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.417: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.418: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.419: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.420: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.421: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.422: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.423: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.424: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.425: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.426: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300
Source.427: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5
Source.428: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.429: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.430: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.431: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.432: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.433: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.434: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.435: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.436: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.437: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.438: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.439: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.440: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.441: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.442: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.443: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.444: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.445: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.446: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.447: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.448: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.449: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial
Source.450: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.451: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.452: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.453: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.454: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.455: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.456: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.457: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.458: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.459: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.460: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.461: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.462: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.463: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.464: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.465: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.466: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.467: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.468: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.469: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.470: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.471: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.472: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.473: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.474: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.475: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.476: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.477: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.478: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.479: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.480: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.481: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.482: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.483: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.484: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.485: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.486: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.487: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.488: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.489: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.490: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.491: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131
Source.492: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.493: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.494: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.495: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.496: DFBPPR2889 ---- Plant proteins ---- Monothiol glutaredoxin-S1, mitochondrial
Source.497: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6
Source.498: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.499: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.500: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.501: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.502: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.503: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.504: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.505: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.506: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.507: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.508: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4
Source.509: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.510: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.511: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.512: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.513: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.514: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.515: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.516: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.517: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.518: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.519: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.520: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23
Source.521: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3
Source.522: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.523: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.524: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.525: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.526: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.527: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.528: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.529: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.530: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.531: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.532: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.533: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1
Source.534: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.535: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.536: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.537: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.538: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.539: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.540: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.541: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.542: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.543: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.544: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.545: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.546: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.547: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.548: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.549: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.550: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.551: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.552: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.553: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.554: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.555: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.556: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.557: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic
Source.558: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.559: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.560: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.561: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.562: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.563: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.564: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.565: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.566: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.567: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.568: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.569: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic
Source.570: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.571: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.572: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.573: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.574: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.575: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21
Source.576: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.577: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.578: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.579: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.580: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.581: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.582: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.583: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.584: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.585: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.586: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.587: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.588: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.589: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.590: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.591: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.592: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.593: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.594: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.595: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18
Source.596: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.597: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.598: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.599: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.600: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.601: DFBPPR3392 ---- Plant proteins ---- Auxin-responsive protein IAA9
Source.602: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.603: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.604: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.605: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.606: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12
Source.607: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.608: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.609: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.610: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.611: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.612: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.613: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.614: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.615: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.616: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.617: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.618: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.619: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.620: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.621: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.622: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.623: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.624: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.625: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31
Source.626: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.627: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.628: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.629: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.630: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.631: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.632: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.633: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.634: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.635: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.636: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.637: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4
Source.638: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.639: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.640: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.641: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.642: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.643: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.644: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.645: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.646: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4
Source.647: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.648: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.649: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.650: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.651: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.652: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17
Source.653: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.654: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.655: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.656: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10
Source.657: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.658: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.659: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.660: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.661: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.662: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic
Source.663: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.664: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.665: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.666: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.667: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.668: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.669: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.670: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.671: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.672: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.673: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.674: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.675: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.676: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.677: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.678: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.679: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.680: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.681: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.682: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.683: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.684: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.685: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.686: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.687: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.688: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.689: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.690: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.691: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.692: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.693: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.694: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1
Source.695: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.696: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.697: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.698: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.699: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.700: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.701: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.702: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.703: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.704: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.705: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.706: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.707: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.708: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.709: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.710: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.711: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.712: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.713: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.714: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.715: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.716: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.717: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3
Source.718: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.719: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.720: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.721: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g
Source.722: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.723: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.724: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.725: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2
Source.726: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.727: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.728: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.729: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.730: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.731: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.732: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.733: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.734: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.735: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.736: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.737: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.738: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.739: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.740: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.741: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.742: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.743: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.744: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.745: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.746: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.747: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.748: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.749: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.750: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.751: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.752: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.753: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.754: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.755: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.756: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.757: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.758: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.759: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.760: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.761: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.762: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.763: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.764: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.765: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.766: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.767: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.768: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.769: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.770: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.771: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.772: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.773: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.774: DFBPPR4140 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3, chloroplastic
Source.775: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.776: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.777: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.778: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.779: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.780: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.781: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.782: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.783: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.784: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.785: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.786: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.787: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.788: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1
Source.789: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.790: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.791: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.792: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.793: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.794: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.795: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.796: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.797: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.798: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.799: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.800: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.801: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.802: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.803: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.804: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.805: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.806: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.807: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.808: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.809: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.810: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.811: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.812: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.813: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.814: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.815: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.816: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic
Source.817: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.818: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.819: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.820: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.821: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.822: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2
Source.823: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5
Source.824: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.825: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.826: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4
Source.827: DFBPPR4417 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 3
Source.828: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.829: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1
Source.830: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.831: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.832: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.833: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.834: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.835: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.836: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.837: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.838: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.839: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.840: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.841: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.842: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.843: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial
Source.844: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.845: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.846: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.847: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.848: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.849: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.850: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.851: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.852: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.853: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.854: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.855: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.856: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.857: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.858: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.859: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.860: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2
Source.861: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.862: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.863: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.864: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.865: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.866: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.867: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.868: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.869: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.870: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.871: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.872: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.873: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.874: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.875: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.876: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.877: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.878: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.879: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.880: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.881: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.882: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.883: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.884: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.885: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.886: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.887: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.888: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.889: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.890: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.891: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial
Source.892: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.893: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.894: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.895: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.896: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.897: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.898: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.899: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.900: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H
Source.901: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.902: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.903: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.904: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1
Source.905: DFBPPR4800 ---- Plant proteins ---- Protein BUD31 homolog 2
Source.906: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.907: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.908: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.909: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.910: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.911: DFBPPR4829 ---- Plant proteins ---- Protein BUD31 homolog 3
Source.912: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.913: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.914: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.915: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.916: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.917: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.918: DFBPPR4876 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 3
Source.919: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.920: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.921: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.922: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4
Source.923: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.924: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.925: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.926: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.927: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.928: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.929: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.930: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.931: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.932: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.933: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.934: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.935: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.936: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.937: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.938: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.939: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.940: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.941: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.942: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.943: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.944: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.945: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.946: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.947: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.948: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.949: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.950: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.951: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.952: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.953: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.954: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.955: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.956: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.957: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.958: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.959: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.960: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.961: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.962: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.963: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.964: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.965: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.966: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.967: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.968: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.969: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.970: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.971: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.972: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.973: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.974: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.975: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.976: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.977: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.978: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.979: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.980: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.981: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.982: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.983: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.984: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.985: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.986: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.987: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.988: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.989: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.990: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.991: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.992: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.993: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.994: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.995: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.996: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.997: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.998: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.999: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1000: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.1001: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.1002: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.1003: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.1004: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1005: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1006: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1007: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1008: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1009: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1010: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.1011: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1012: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1013: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1014: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.1015: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1016: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1017: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1018: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.1019: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.1020: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.1021: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1022: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1023: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1024: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.1025: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.1026: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1027: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.1028: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.1029: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1030: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1031: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1032: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1033: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.1034: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1035: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.1036: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.1037: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1038: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.1039: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.1040: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1041: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1042: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.1043: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.1044: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1045: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.1046: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.1047: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.1048: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1049: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.1050: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.1051: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1052: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1053: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1054: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1055: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.1056: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.1057: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.1058: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.1059: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.1060: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1061: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1062: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.1063: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1064: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.1065: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1066: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1067: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1068: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1069: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1070: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.1071: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.1072: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1073: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.1074: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1075: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1076: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1077: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1078: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.1079: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1080: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.1081: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.1082: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1083: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.1084: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1085: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1086: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1087: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.1088: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1089: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.1090: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.1091: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1092: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.1093: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1094: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.1095: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1096: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.1097: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1098: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.1099: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.1100: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1101: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.1102: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1103: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1104: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1
Source.1105: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.1106: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1107: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1108: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1109: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1110: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.1111: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1112: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1113: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1114: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1115: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1
Source.1116: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1117: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1118: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1119: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1120: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1121: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1122: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1123: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1124: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.1125: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.1126: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1127: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1128: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.1129: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1130: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1131: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic
Source.1132: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1133: DFBPPR5924 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1134: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.1135: DFBPPR5955 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-2, chloroplastic
Source.1136: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1137: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.1138: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.1139: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5
Source.1140: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.1141: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1142: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.1143: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.1144: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3
Source.1145: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1146: DFBPPR6055 ---- Plant proteins ---- 14 kDa zinc-binding protein
Source.1147: DFBPPR6059 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.1148: DFBPPR6060 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.1149: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.1150: DFBPPR6064 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.1151: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1152: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1153: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17
Source.1154: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1155: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.1156: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1157: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.1158: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.1159: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.1160: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.1161: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1162: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1163: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.1164: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.1165: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1166: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2
Source.1167: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1168: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1169: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.1170: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1171: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.1172: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.1173: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.1174: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1175: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.1176: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1177: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.1178: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.1179: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.1180: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic
Source.1181: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.1182: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.1183: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.1184: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1185: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.1186: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1187: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1188: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.1189: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.1190: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.1191: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.1192: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.1193: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1194: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.1195: DFBPPR6464 ---- Plant proteins ---- 50S ribosomal protein 5, chloroplastic
Source.1196: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.1197: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.1198: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.1199: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.1200: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.1201: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.1202: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1203: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6
Source.1204: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1205: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.1206: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.1207: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1208: DFBPPR6640 ---- Plant proteins ---- Puroindoline-B
Source.1209: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.1210: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.1211: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.1212: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.1213: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8
Source.1214: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.1215: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.1216: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.1217: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1218: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1219: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.1220: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.1221: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.1222: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.1223: DFBPPR6684 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor WSCI
Source.1224: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.1225: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1226: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.1227: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.1228: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.1229: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.1230: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1231: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.1232: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.1233: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.1234: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1235: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.1236: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.1237: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1238: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.1239: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.1240: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.1241: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1242: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1243: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1244: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1245: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1246: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.1247: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1248: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1249: DFBPPR6895 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor
Source.1250: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1251: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin
Source.1252: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B
Source.1253: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin
Source.1254: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin
Source.1255: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2
Source.1256: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1257: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.1258: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1259: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1260: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.1261: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.1262: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1263: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.1264: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1
Source.1265: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.1266: DFBPPR7032 ---- Plant proteins ---- Hordoindoline-B2
Source.1267: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.1268: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2
Source.1269: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1270: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.1271: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.1272: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1273: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1274: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.1275: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.1276: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1277: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.1278: DFBPPR7069 ---- Plant proteins ---- Hordoindoline-B1
Source.1279: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.1280: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1281: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1282: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.1283: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2
Source.1284: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.1285: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.1286: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1287: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.1288: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1289: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1290: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.1291: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1292: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.1293: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.1294: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.1295: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.1296: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1297: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.1298: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1299: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.1300: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1301: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1302: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.1303: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1304: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.1305: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1306: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1307: DFBPPR7175 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2A
Source.1308: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.1309: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.1310: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.1311: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.1312: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1313: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.1314: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1315: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.1316: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1317: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.1318: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.1319: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B
Source.1320: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C
Source.1321: DFBPPR7277 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2B
Source.1322: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic
Source.1323: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.1324: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.1325: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1
Source.1326: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C
Source.1327: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B
Source.1328: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.1329: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.1330: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.1331: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.1332: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase
Source.1333: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1334: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1335: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.1336: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.1337: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1338: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.1339: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25
Source.1340: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.1341: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.1342: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.1343: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1344: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1345: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.1346: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1347: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1348: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.1349: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1350: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1351: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.1352: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1353: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.1354: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1355: DFBPPR7630 ---- Milk proteins ---- Folate receptor alpha
Source.1356: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1357: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1358: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.1359: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.1360: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1361: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein
Source.1362: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.1363: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.1364: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein
Source.1365: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.1366: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.1367: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.1368: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.1369: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.1370: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.1371: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.1372: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.1373: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.1374: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.1375: DFBPPR8198 ---- Plant proteins ---- Inhibitor of trypsin and hageman factor
Source.1376: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.1377: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.1378: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.1379: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.1380: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.1381: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1382: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.1383: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.1384: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.1385: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.1386: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1387: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.1388: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C
Source.1389: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.1390: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.1391: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.1392: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1393: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.1394: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.1395: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1396: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1397: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.1398: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.1399: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.1400: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1401: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.1402: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1403: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1404: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1405: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1406: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.1407: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1408: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.1409: DFBPPR15973 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.1410: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.1411: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.1412: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1413: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.1414: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.1415: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1416: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1417: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1418: DFBPPR16006 ---- Animal proteins ---- Leptin
Source.1419: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1420: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.1421: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1422: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1423: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1424: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.1425: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.1426: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1427: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1428: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.1429: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1430: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.1431: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1432: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.1433: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1434: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.1435: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.1436: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1437: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.1438: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1439: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1440: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1441: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.1442: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1443: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1444: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1445: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1446: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1447: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.1448: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1449: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.1450: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.1451: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1452: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.1453: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.1454: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.1455: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1456: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1457: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1458: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1459: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.1460: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.1461: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1462: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.1463: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1464: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.1465: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.1466: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1467: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.1468: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.1469: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.1470: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1471: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1472: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.1473: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1474: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.1475: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.1476: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.1477: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.1478: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1479: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.1480: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.1481: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.1482: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.1483: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.1484: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.1485: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.1486: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.1487: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.1488: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1489: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.1490: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1491: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.1492: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.1493: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.1494: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.1495: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.1496: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1497: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.1498: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1499: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1500: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.1501: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.1502: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.1503: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.1504: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.1505: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.1506: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.1507: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1508: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1509: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.1510: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.1511: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.1512: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.1513: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1514: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.1515: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1516: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1517: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.1518: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.1519: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.1520: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.1521: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1522: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1523: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.1524: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1525: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1526: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.1527: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1
Source.1528: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein
Source.1529: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1530: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.1531: DFBPPR16703 ---- Animal proteins ---- Beta-defensin 119
Source.1532: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1533: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1534: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23
Source.1535: DFBPPR16751 ---- Animal proteins ---- Small integral membrane protein 12
Source.1536: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.1537: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.1538: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.1539: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.1540: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.1541: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.1542: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.1543: DFBPPR16835 ---- Animal proteins ---- Insulin
Source.1544: DFBPPR16838 ---- Animal proteins ---- Leptin
Source.1545: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1546: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.1547: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.1548: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.1549: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.1550: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.1551: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1552: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.1553: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.1554: DFBPPR16877 ---- Animal proteins ---- Peptidoglycan recognition protein 1
Source.1555: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.1556: DFBPPR16919 ---- Animal proteins ---- VIP peptides
Source.1557: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1558: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1559: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1560: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1561: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.1562: DFBPPR16937 ---- Animal proteins ---- GTP:AMP phosphotransferase AK3, mitochondrial
Source.1563: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1564: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.1565: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1566: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.1567: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1568: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.1569: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.1570: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1571: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.1572: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.1573: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1574: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.1575: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.1576: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.1577: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.1578: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.1579: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1580: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1581: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.1582: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.1583: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.1584: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.1585: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1586: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.1587: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.1588: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.1589: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1590: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1591: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.1592: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.1593: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.1594: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.1595: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1596: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1597: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.1598: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1599: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.1600: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.1601: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.1602: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.1603: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.1604: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.1605: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.1606: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.1607: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.1608: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.1609: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.1610: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.1611: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.1612: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.1613: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1614: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.1615: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.1616: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1617: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1618: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.1619: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.1620: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.1621: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1622: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1623: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial
Source.1624: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.1625: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.1626: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.1627: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.1628: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.1629: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.1630: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.1631: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.1632: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.1633: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.1634: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.1635: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1636: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1637: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.1638: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.1639: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1640: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1641: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1642: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1643: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.1644: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.1645: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.1646: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.1647: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.1648: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.1649: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.1650: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.1651: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.1652: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.1653: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.1654: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.1655: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.1656: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.1657: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.1658: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.1659: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1660: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1661: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1662: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.1663: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.1664: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.1665: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1666: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1667: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.1668: DFBPPR17447 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.1669: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1670: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1671: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1672: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.1673: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.1674: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.1675: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.1676: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.1677: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.1678: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.1679: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b
Source.1680: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.1681: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.1682: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.1683: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.1684: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.1685: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1686: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.1687: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.1688: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.1689: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.1690: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.1691: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.1692: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.1693: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1694: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.1695: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.1696: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.1697: DFBPPR17647 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.1698: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.1699: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1700: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.1701: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.1702: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1703: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.1704: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.1705: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10
Source.1706: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.1707: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1
Source.1708: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.1709: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.1710: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1711: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.1712: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.1713: DFBPPR17786 ---- Animal proteins ---- Cathelicidin-4
Source.1714: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1715: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1716: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.1717: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1718: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1719: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.1720: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.1721: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.1722: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.1723: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1724: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.1725: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1726: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.1727: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.1728: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1729: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1730: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.1731: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.1732: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.1733: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.1734: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1735: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.1736: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1737: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.1738: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1739: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1740: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1741: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.1742: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.1743: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.1744: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.1745: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.1746: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1747: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.1748: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3
Source.1749: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.1750: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1751: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.1752: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.1753: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1754: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.1755: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.1756: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.1757: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.1758: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.1759: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.1760: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.1761: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.1762: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1763: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1764: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8
Source.1765: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1766: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1767: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.1768: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1769: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.1770: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.1771: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.1772: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.1773: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1774: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.1775: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1776: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1777: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.1778: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1779: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.1780: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.1781: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.1782: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1783: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.1784: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.1785: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.1786: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.1787: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.1788: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.1789: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.1790: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.1791: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.1792: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.1793: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.1794: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.1795: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.1796: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.1797: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1798: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1799: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.1800: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.1801: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.1802: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1803: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.1804: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.1805: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.1806: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.1807: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A
Source.1808: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1809: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.1810: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.1811: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1812: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1813: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1814: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.1815: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein
Source.1816: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.1817: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.1818: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1819: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.1820: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1821: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.1822: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.1823: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.1824: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.1825: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.1826: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1827: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.1828: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.1829: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.1830: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1831: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.1832: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.1833: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.1834: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.1835: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.1836: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.1837: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.1838: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.1839: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.1840: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.1841: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.1842: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.1843: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.1844: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.1845: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.1846: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1847: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.1848: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.1849: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.1850: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.1851: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1852: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor
Source.1853: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase
Source.1854: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.1855: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1856: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.1857: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5
Source.1858: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.1859: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.1860: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.1861: DFBPPR18743 ---- Animal proteins ---- Sperm-egg fusion protein TMEM95
Source.1862: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase
Source.1863: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.1864: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1865: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1866: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.1867: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.1868: DFBPPR18779 ---- Animal proteins ---- Mucin-15
Source.1869: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.1870: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.1871: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1872: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.1873: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.1874: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1875: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.1876: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.1877: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1878: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.1879: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.1880: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1881: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1882: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1883: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.1884: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1885: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.1886: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.1887: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.1888: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.1889: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.1890: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1891: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1892: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.1893: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.1894: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1895: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.1896: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1897: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.1898: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1899: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.1900: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.1901: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.1902: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.1903: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.1904: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.1905: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1906: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.1907: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1908: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.1909: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.1910: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.1911: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial
Source.1912: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.1913: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.1914: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.1915: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.1916: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.1917: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.1918: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.1919: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.1920: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.1921: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1922: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.1923: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.1924: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1925: DFBPPR19164 ---- Animal proteins ---- RNA-binding protein with serine-rich domain 1
Source.1926: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.1927: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.1928: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1929: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.1930: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.1931: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.1932: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2
Source.1933: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.1934: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.1935: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.1936: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1937: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.1938: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.1939: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.1940: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.1941: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1942: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.1943: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.1944: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1945: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.1946: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.1947: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.1948: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.1949: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.1950: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.1951: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial
Source.1952: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.1953: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.1954: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1955: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.1956: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.1957: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1958: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.1959: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.1960: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.1961: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.1962: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.1963: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.1964: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.1965: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.1966: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog
Source.1967: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.1968: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.1969: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.1970: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1971: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1972: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1973: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.1974: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1975: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1976: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.1977: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.1978: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2
Source.1979: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5
Source.1980: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.1981: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.1982: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.1983: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.1984: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein
Source.1985: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.1986: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1987: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.1988: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.1989: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.1990: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.1991: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1992: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1993: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.1994: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.1995: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1996: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.1997: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.1998: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.1999: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C
Source.2000: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.2001: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2002: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2003: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.2004: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.2005: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.2006: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.2007: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.2008: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2009: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B
Source.2010: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.2011: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.2012: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2013: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.2014: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2015: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.2016: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1
Source.2017: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.2018: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.2019: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.2020: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23
Source.2021: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.2022: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.2023: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.2024: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog
Source.2025: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.2026: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit
Source.2027: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.2028: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.2029: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.2030: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.2031: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.2032: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.2033: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2034: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.2035: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.2036: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.2037: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.2038: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.2039: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.2040: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.2041: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.2042: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.2043: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8
Source.2044: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.2045: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.2046: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.2047: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2048: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.2049: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.2050: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.2051: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.2052: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.2053: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.2054: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.2055: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.2056: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.2057: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.2058: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.2059: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.2060: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.2061: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.2062: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.2063: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.2064: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR
Source.2065: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2066: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.2067: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2068: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.2069: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.2070: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.2071: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.2072: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.2073: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.2074: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.2075: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2076: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.2077: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.2078: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.2079: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.2080: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.2081: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.2082: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.2083: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.2084: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.2085: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.2086: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.2087: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B
Source.2088: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.2089: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2090: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.2091: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3
Source.2092: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2093: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.2094: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.2095: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.2096: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4
Source.2097: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2098: DFBPPR20292 ---- Animal proteins ---- Caltrin
Source.2099: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.2100: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.2101: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.2102: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2103: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.2104: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.2105: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.2106: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2107: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.2108: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.2109: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.2110: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.2111: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.2112: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.2113: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.2114: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.2115: DFBPPR20365 ---- Animal proteins ---- Interleukin-21
Source.2116: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.2117: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.2118: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.2119: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.2120: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.2121: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.2122: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.2123: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.2124: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.2125: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2126: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.2127: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.2128: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.2129: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.2130: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.2131: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.2132: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.2133: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.2134: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.2135: DFBPPR20453 ---- Animal proteins ---- Cysteine dioxygenase type 1
Source.2136: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.2137: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.2138: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP
Source.2139: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.2140: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator
Source.2141: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog
Source.2142: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.2143: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.2144: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.2145: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.2146: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.2147: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.2148: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.2149: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.2150: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.2151: DFBPPR20570 ---- Animal proteins ---- Intraflagellar transport protein 22 homolog
Source.2152: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.2153: DFBPPR20585 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 3
Source.2154: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.2155: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.2156: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1
Source.2157: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.2158: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.2159: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.2160: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.2161: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.2162: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.2163: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2164: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.2165: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.2166: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.2167: DFBPPR20644 ---- Animal proteins ---- Dynein regulatory complex protein 9
Source.2168: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2169: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.2170: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.2171: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.2172: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.2173: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2
Source.2174: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.2175: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.2176: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2177: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.2178: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.2179: DFBPPR20728 ---- Animal proteins ---- Serine protease 45
Source.2180: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.2181: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.2182: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.2183: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.2184: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.2185: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.2186: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.2187: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.2188: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.2189: DFBPPR20809 ---- Animal proteins ---- F-box and leucine-rich protein 22
Source.2190: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.2191: DFBPPR20838 ---- Animal proteins ---- Cytochrome c oxidase subunit 6B2
Source.2192: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.2193: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.2194: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.2195: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.2196: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.2197: DFBPPR20867 ---- Animal proteins ---- Protein BUD31 homolog
Source.2198: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.2199: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.2200: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.2201: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.2202: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.2203: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.2204: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2205: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.2206: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2207: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.2208: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4
Source.2209: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.2210: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B
Source.2211: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2212: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.2213: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.2214: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.2215: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.2216: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.2217: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.2218: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.2219: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.2220: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.2221: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1
Source.2222: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.2223: DFBPPR21034 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 25
Source.2224: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2225: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.2226: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.2227: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.2228: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma
Source.2229: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.2230: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.2231: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.2232: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.2233: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.2234: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.2235: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.2236: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B
Source.2237: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor
Source.2238: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.2239: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2240: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.2241: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2242: DFBPPR21203 ---- Animal proteins ---- Nuclear protein 2
Source.2243: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4
Source.2244: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.2245: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.2246: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.2247: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3
Source.2248: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2249: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.2250: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.2251: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.2252: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.2253: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2
Source.2254: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.2255: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.2256: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.2257: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.2258: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.2259: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.2260: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.2261: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.2262: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.2263: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.2264: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.2265: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.2266: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.2267: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.2268: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2269: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.2270: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.2271: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.2272: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.2273: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.2274: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.2275: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.2276: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.2277: DFBPPR21428 ---- Animal proteins ---- Protein LBH
Source.2278: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.2279: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.2280: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.2281: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.2282: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.2283: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.2284: DFBPPR21454 ---- Animal proteins ---- Cyclin-dependent kinase 2-interacting protein
Source.2285: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.2286: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A
Source.2287: DFBPPR21465 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD
Source.2288: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.2289: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.2290: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.2291: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.2292: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.2293: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14
Source.2294: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.2295: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.2296: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.2297: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.2298: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.2299: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.2300: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1
Source.2301: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.2302: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.2303: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1
Source.2304: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.2305: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein
Source.2306: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.2307: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2308: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.2309: DFBPPR21603 ---- Animal proteins ---- Beta-defensin 119
Source.2310: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.2311: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.2312: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.2313: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.2314: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.2315: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.2316: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.2317: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2
Source.2318: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.2319: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.2320: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.2321: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2322: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.2323: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.2324: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.2325: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.2326: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.2327: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.2328: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.2329: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.2330: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.2331: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A
Source.2332: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.2333: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.2334: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.2335: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.2336: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.2337: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.2338: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.2339: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog
Source.2340: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.2341: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.2342: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.2343: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410
Source.2344: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.2345: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2
Source.2346: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD
Source.2347: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17
Source.2348: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.2349: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.2350: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.2351: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial
Source.2352: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein
Source.2353: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.2354: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.2355: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.2356: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.2357: DFBPPR21938 ---- Animal proteins ---- Protein RER1
Source.2358: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.2359: DFBPPR21959 ---- Animal proteins ---- DDB1- and CUL4-associated factor 16
Source.2360: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.2361: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.2362: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.2363: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.2364: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.2365: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.2366: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.2367: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.2368: DFBPPR21987 ---- Animal proteins ---- Ribonuclease H2 subunit C
Source.2369: DFBPPR21994 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial
Source.2370: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.2371: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.2372: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.2373: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.2374: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.2375: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.2376: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.2377: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2378: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18
Source.2379: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.2380: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2381: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial
Source.2382: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.2383: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.2384: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.2385: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.2386: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4
Source.2387: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.2388: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.2389: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.2390: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.2391: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.2392: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.2393: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.2394: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.2395: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.2396: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.2397: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.2398: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.2399: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.2400: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.2401: DFBPPR22190 ---- Animal proteins ---- Protein NKG7
Source.2402: DFBPPR22204 ---- Animal proteins ---- Ubiquitin-like protein 3
Source.2403: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.2404: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog
Source.2405: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.2406: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3
Source.2407: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.2408: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.2409: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.2410: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.2411: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.2412: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.2413: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.2414: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.2415: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.2416: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.2417: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.2418: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.2419: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.2420: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.2421: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.2422: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.2423: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.2424: DFBPPR22323 ---- Animal proteins ---- Meiosis expressed gene 1 protein homolog
Source.2425: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.2426: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.2427: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.2428: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.2429: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.2430: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.2431: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.2432: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.2433: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.2434: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.2435: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein
Source.2436: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.2437: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5
Source.2438: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.2439: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog
Source.2440: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.2441: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.2442: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.2443: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.2444: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.2445: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.2446: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.2447: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.2448: DFBPPR22475 ---- Animal proteins ---- Small integral membrane protein 12
Source.2449: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.2450: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.2451: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.2452: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.2453: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C
Source.2454: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.2455: DFBPPR22534 ---- Animal proteins ---- Protein FAM162B
Source.2456: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.2457: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.2458: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25
Source.2459: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.2460: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.2461: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B
Source.2462: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.2463: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog
Source.2464: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5
Source.2465: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.2466: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.2467: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.2468: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.2469: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A
Source.2470: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254
Source.2471: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.2472: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.2473: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.2474: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.2475: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.2476: DFBPPR22662 ---- Animal proteins ---- Uncharacterized protein C11orf94 homolog
Source.2477: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.2478: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.2479: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.2480: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.2481: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.2482: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.2483: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.2484: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19
Source.2485: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.2486: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.2487: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein
Source.2488: DFBPPR22722 ---- Animal proteins ---- Uncharacterized protein C11orf91 homolog
Source.2489: DFBPPR22725 ---- Animal proteins ---- Uncharacterized protein C4orf46 homolog
Source.2490: DFBPPR22726 ---- Animal proteins ---- Uncharacterized protein C16orf90 homolog
Source.2491: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.2492: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.2493: DFBPPR22739 ---- Animal proteins ---- Testis, prostate and placenta-expressed protein
Source.2494: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.2495: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog
Source.2496: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.2497: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.2498: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.2499: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.2500: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2501: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.2502: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.2503: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.2504: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.2505: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.2506: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.2507: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.2508: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.2509: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.2510: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.2511: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.2512: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.2513: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.2514: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.2515: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.2516: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.2517: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.2518: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.2519: DFBPPR8588 ---- Animal proteins ---- Leptin
Source.2520: DFBPPR8598 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.2521: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.2522: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.2523: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.2524: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.2525: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2526: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.2527: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.2528: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.2529: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2530: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.2531: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.2532: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.2533: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.2534: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.2535: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.2536: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.2537: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.2538: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.2539: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.2540: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.2541: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.2542: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2543: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.2544: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.2545: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2546: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.2547: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2548: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.2549: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.2550: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.2551: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.2552: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.2553: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.2554: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2555: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.2556: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.2557: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.2558: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2559: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.2560: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.2561: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.2562: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2563: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.2564: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2565: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.2566: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.2567: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.2568: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.2569: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.2570: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.2571: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.2572: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2573: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.2574: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.2575: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.2576: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.2577: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.2578: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.2579: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2580: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.2581: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.2582: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2583: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.2584: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.2585: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.2586: DFBPPR8983 ---- Animal proteins ---- Receptor activity-modifying protein 1
Source.2587: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2588: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.2589: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.2590: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2591: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2592: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.2593: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2594: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.2595: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.2596: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.2597: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.2598: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.2599: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.2600: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.2601: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.2602: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.2603: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.2604: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.2605: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2606: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.2607: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.2608: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.2609: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2610: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.2611: DFBPPR9113 ---- Animal proteins ---- Prophenin and tritrpticin precursor
Source.2612: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.2613: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.2614: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2615: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2616: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.2617: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.2618: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.2619: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.2620: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.2621: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.2622: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.2623: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.2624: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.2625: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.2626: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.2627: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.2628: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.2629: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23
Source.2630: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2631: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2632: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.2633: DFBPPR9212 ---- Animal proteins ---- Dihydrofolate reductase
Source.2634: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.2635: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.2636: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.2637: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.2638: DFBPPR9239 ---- Animal proteins ---- Prophenin-2
Source.2639: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.2640: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9
Source.2641: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.2642: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.2643: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1
Source.2644: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.2645: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.2646: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.2647: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2648: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2649: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.2650: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.2651: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.2652: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2
Source.2653: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.2654: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.2655: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2656: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.2657: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.2658: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.2659: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.2660: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.2661: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3
Source.2662: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.2663: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.2664: DFBPPR9347 ---- Animal proteins ---- C-reactive protein
Source.2665: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.2666: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.2667: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.2668: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2669: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2670: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2671: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.2672: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.2673: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.2674: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.2675: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.2676: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.2677: DFBPPR9404 ---- Animal proteins ---- Tryptase
Source.2678: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.2679: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.2680: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.2681: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2682: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.2683: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.2684: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.2685: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.2686: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2687: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2688: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.2689: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.2690: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.2691: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.2692: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.2693: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.2694: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.2695: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.2696: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.2697: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.2698: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.2699: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.2700: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta
Source.2701: DFBPPR9556 ---- Animal proteins ---- N(4)-(Beta-N-acetylglucosaminyl)-L-asparaginase
Source.2702: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.2703: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.2704: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.2705: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.2706: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.2707: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.2708: DFBPPR9608 ---- Animal proteins ---- Interleukin-21
Source.2709: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2710: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2711: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.2712: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2713: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.2714: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.2715: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.2716: DFBPPR9685 ---- Animal proteins ---- Interleukin-27 subunit alpha
Source.2717: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.2718: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.2719: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.2720: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2721: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis
Source.2722: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.2723: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.2724: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.2725: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.2726: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.2727: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.2728: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2729: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.2730: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.2731: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.2732: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.2733: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.2734: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.2735: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.2736: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.2737: DFBPPR9912 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial
Source.2738: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.2739: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.2740: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.2741: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.2742: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.2743: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.2744: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.2745: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.2746: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.2747: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2748: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.2749: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.2750: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.2751: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2752: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2753: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2754: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.2755: DFBPPR10046 ---- Animal proteins ---- Gallinacin-2
Source.2756: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.2757: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.2758: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.2759: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.2760: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.2761: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2762: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.2763: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2764: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7
Source.2765: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.2766: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.2767: DFBPPR10082 ---- Animal proteins ---- Pinopsin
Source.2768: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.2769: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2770: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.2771: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.2772: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.2773: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.2774: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.2775: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.2776: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.2777: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.2778: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.2779: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.2780: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.2781: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.2782: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.2783: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.2784: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.2785: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.2786: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.2787: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2788: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.2789: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.2790: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.2791: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.2792: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.2793: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.2794: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.2795: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.2796: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1
Source.2797: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.2798: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.2799: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein
Source.2800: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.2801: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.2802: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.2803: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.2804: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.2805: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.2806: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.2807: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.2808: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2809: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2810: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.2811: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.2812: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.2813: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2814: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.2815: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.2816: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.2817: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.2818: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.2819: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.2820: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.2821: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.2822: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.2823: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.2824: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.2825: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2826: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.2827: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.2828: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.2829: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.2830: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.2831: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2832: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2833: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.2834: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.2835: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.2836: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2837: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.2838: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.2839: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.2840: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.2841: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.2842: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.2843: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2844: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.2845: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.2846: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.2847: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.2848: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.2849: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.2850: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.2851: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.2852: DFBPPR10530 ---- Animal proteins ---- Osteopontin
Source.2853: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.2854: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.2855: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2856: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.2857: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.2858: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.2859: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.2860: DFBPPR10563 ---- Animal proteins ---- Optineurin
Source.2861: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.2862: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.2863: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.2864: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2865: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.2866: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.2867: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.2868: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.2869: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.2870: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2871: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.2872: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.2873: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.2874: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.2875: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.2876: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.2877: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.2878: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.2879: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.2880: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.2881: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2882: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.2883: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.2884: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.2885: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.2886: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.2887: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2888: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.2889: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.2890: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2891: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.2892: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase
Source.2893: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.2894: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.2895: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.2896: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2897: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.2898: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2899: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.2900: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.2901: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.2902: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2903: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.2904: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.2905: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.2906: DFBPPR10755 ---- Animal proteins ---- Draxin
Source.2907: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.2908: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.2909: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.2910: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.2911: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.2912: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.2913: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.2914: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.2915: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.2916: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2
Source.2917: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3
Source.2918: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.2919: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.2920: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2921: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.2922: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.2923: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.2924: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2925: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.2926: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.2927: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.2928: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.2929: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.2930: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.2931: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.2932: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.2933: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.2934: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.2935: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2936: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5
Source.2937: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.2938: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.2939: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.2940: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.2941: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.2942: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.2943: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.2944: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.2945: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.2946: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.2947: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.2948: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.2949: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2950: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.2951: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.2952: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.2953: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.2954: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.2955: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.2956: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.2957: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.2958: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.2959: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.2960: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.2961: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.2962: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.2963: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.2964: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.2965: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.2966: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.2967: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.2968: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.2969: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.2970: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.2971: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.2972: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.2973: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2974: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.2975: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.2976: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2977: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.2978: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.2979: DFBPPR11102 ---- Animal proteins ---- Interferon type A3
Source.2980: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.2981: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.2982: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.2983: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.2984: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2985: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.2986: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.2987: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.2988: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.2989: DFBPPR11146 ---- Animal proteins ---- Formin
Source.2990: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2991: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185
Source.2992: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.2993: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2994: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.2995: DFBPPR11174 ---- Animal proteins ---- Gallinacin-6
Source.2996: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.2997: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.2998: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.2999: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3000: DFBPPR11205 ---- Animal proteins ---- Protein 4.1
Source.3001: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.3002: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.3003: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.3004: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.3005: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.3006: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.3007: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.3008: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.3009: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.3010: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.3011: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.3012: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3013: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3014: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.3015: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.3016: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.3017: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.3018: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.3019: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.3020: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.3021: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.3022: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.3023: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.3024: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.3025: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.3026: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.3027: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.3028: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.3029: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.3030: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.3031: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3032: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.3033: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.3034: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.3035: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.3036: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide
Source.3037: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3038: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.3039: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.3040: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.3041: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12
Source.3042: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.3043: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.3044: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.3045: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.3046: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32
Source.3047: DFBPPR11578 ---- Animal proteins ---- Lymphocyte antigen 86
Source.3048: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.3049: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.3050: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.3051: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.3052: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.3053: DFBPPR11608 ---- Animal proteins ---- ATP synthase protein 8
Source.3054: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein
Source.3055: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.3056: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3057: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.3058: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.3059: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3060: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.3061: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.3062: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.3063: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.3064: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.3065: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.3066: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.3067: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.3068: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.3069: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.3070: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.3071: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.3072: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.3073: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.3074: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.3075: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.3076: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62
Source.3077: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.3078: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.3079: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.3080: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog
Source.3081: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.3082: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.3083: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.3084: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.3085: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.3086: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.3087: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.3088: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3089: DFBPPR11894 ---- Animal proteins ---- Centromere protein K
Source.3090: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.3091: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.3092: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.3093: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD
Source.3094: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.3095: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.3096: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.3097: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.3098: DFBPPR11966 ---- Animal proteins ---- Protein CREG1
Source.3099: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.3100: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.3101: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.3102: DFBPPR12015 ---- Animal proteins ---- Homeobox protein Hox-D1
Source.3103: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1
Source.3104: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein
Source.3105: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.3106: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.3107: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.3108: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.3109: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.3110: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.3111: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.3112: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.3113: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.3114: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.3115: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.3116: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.3117: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.3118: DFBPPR12112 ---- Animal proteins ---- Protein LBH
Source.3119: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.3120: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.3121: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3122: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.3123: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.3124: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.3125: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.3126: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.3127: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.3128: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.3129: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.3130: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog
Source.3131: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.3132: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.3133: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.3134: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.3135: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3136: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.3137: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3138: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.3139: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3140: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.3141: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.3142: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.3143: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.3144: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.3145: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.3146: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.3147: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.3148: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.3149: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.3150: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3151: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3152: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.3153: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3154: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.3155: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.3156: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.3157: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.3158: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.3159: DFBPPR12333 ---- Animal proteins ---- Angiogenin
Source.3160: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.3161: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.3162: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.3163: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.3164: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.3165: DFBPPR12358 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.3166: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3167: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.3168: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.3169: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.3170: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.3171: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.3172: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.3173: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.3174: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3175: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.3176: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.3177: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.3178: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3179: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.3180: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.3181: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.3182: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.3183: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3184: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.3185: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3186: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.3187: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.3188: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.3189: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.3190: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.3191: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.3192: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.3193: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.3194: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.3195: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.3196: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.3197: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.3198: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.3199: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14
Source.3200: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3201: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3202: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.3203: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3204: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.3205: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.3206: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3207: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.3208: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.3209: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3210: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.3211: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.3212: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.3213: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.3214: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.3215: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.3216: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.3217: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3218: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.3219: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.3220: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3221: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.3222: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.3223: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.3224: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.3225: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.3226: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.3227: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3228: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.3229: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.3230: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.3231: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.3232: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.3233: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3234: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.3235: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.3236: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3237: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.3238: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.3239: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.3240: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.3241: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.3242: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.3243: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.3244: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3245: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3246: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.3247: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.3248: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.3249: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.3250: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.3251: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.3252: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.3253: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.3254: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.3255: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.3256: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.3257: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.3258: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.3259: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3260: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.3261: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.3262: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.3263: DFBPPR12836 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.3264: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3265: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3266: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.3267: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.3268: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.3269: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor
Source.3270: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.3271: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.3272: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.3273: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.3274: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3275: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.3276: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.3277: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.3278: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.3279: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.3280: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.3281: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.3282: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.3283: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.3284: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.3285: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3286: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.3287: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.3288: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3289: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.3290: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3291: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.3292: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.3293: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.3294: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.3295: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.3296: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.3297: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3298: DFBPPR13083 ---- Animal proteins ---- Promotilin
Source.3299: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3300: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.3301: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4
Source.3302: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.3303: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3304: DFBPPR13156 ---- Animal proteins ---- Leptin
Source.3305: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.3306: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3307: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.3308: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3309: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.3310: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.3311: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.3312: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha
Source.3313: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.3314: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.3315: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.3316: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3317: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.3318: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.3319: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3320: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.3321: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3322: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3323: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2
Source.3324: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.3325: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3326: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3327: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3328: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.3329: DFBPPR13297 ---- Animal proteins ---- Plasminogen
Source.3330: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3331: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.3332: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.3333: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.3334: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.3335: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.3336: DFBPPR13344 ---- Animal proteins ---- Interferon omega-2
Source.3337: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.3338: DFBPPR13367 ---- Animal proteins ---- Neutrophil elastase 2B
Source.3339: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.3340: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3341: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3342: DFBPPR13420 ---- Animal proteins ---- Small integral membrane protein 12
Source.3343: DFBPPR13424 ---- Animal proteins ---- Leptin
Source.3344: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.3345: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3346: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.3347: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.3348: DFBPPR13441 ---- Animal proteins ---- Acrosin
Source.3349: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3350: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3351: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.3352: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.3353: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.3354: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.3355: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.3356: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.3357: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.3358: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3359: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3360: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.3361: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3362: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.3363: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.3364: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3365: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.3366: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.3367: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3368: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3369: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.3370: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.3371: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.3372: DFBPPR13602 ---- Animal proteins ---- Acrosin
Source.3373: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.3374: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3375: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.3376: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3377: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.3378: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.3379: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.3380: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3381: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.3382: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.3383: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3384: DFBPPR13713 ---- Animal proteins ---- Plasminogen
Source.3385: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3386: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.3387: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.3388: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1
Source.3389: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.3390: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3391: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.3392: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3393: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.3394: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3395: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.3396: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3397: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.3398: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.3399: DFBPPR13789 ---- Animal proteins ---- Tryptase-2
Source.3400: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain
Source.3401: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.3402: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.3403: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.3404: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.3405: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.3406: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3407: DFBPPR13902 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.3408: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.3409: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3410: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3411: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3412: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.3413: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.3414: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.3415: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.3416: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin
Source.3417: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3418: DFBPPR14039 ---- Animal proteins ---- ATP synthase protein 8
Source.3419: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3420: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.3421: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.3422: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.3423: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.3424: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.3425: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.3426: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.3427: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.3428: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.3429: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.3430: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.3431: DFBPPR14155 ---- Marine protein ---- ATP synthase protein 8
Source.3432: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.3433: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog
Source.3434: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.3435: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.3436: DFBPPR14175 ---- Marine protein ---- Draxin-B
Source.3437: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.3438: DFBPPR14189 ---- Marine protein ---- Protein Flattop
Source.3439: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.3440: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.3441: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.3442: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.3443: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.3444: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.3445: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3446: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.3447: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.3448: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.3449: DFBPPR14405 ---- Marine protein ---- Uncharacterized monothiol glutaredoxin ycf64
Source.3450: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4
Source.3451: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.3452: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic
Source.3453: DFBPPR14524 ---- Marine protein ---- Uncharacterized protein ycf36
Source.3454: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.3455: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.3456: DFBPPR14534 ---- Marine protein ---- Uncharacterized protein ORF62
Source.3457: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.3458: DFBPPR14546 ---- Marine protein ---- Stanniocalcin
Source.3459: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.3460: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.3461: DFBPPR14562 ---- Marine protein ---- Ladderlectin
Source.3462: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.3463: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.3464: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.3465: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.3466: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.3467: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.3468: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.3469: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.3470: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.3471: DFBPPR14625 ---- Marine protein ---- Somatostatin-2
Source.3472: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.3473: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.3474: DFBPPR14651 ---- Marine protein ---- ATP synthase protein 8
Source.3475: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.3476: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.3477: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.3478: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.3479: DFBPPR14686 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.3480: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog
Source.3481: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein
Source.3482: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.3483: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.3484: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.3485: DFBPPR14755 ---- Marine protein ---- Techylectin-5A
Source.3486: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit
Source.3487: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.3488: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.3489: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.3490: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.3491: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.3492: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.3493: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.3494: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.3495: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.3496: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha
Source.3497: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.3498: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.3499: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system
Source.3500: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.3501: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.3502: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.3503: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.3504: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.3505: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.3506: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.3507: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.3508: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.3509: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.3510: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.3511: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1
Source.3512: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.3513: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.3514: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.3515: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.3516: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.3517: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.3518: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1
Source.3519: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.3520: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.3521: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.3522: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.3523: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.3524: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.3525: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.3526: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.3527: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial
Source.3528: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.3529: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.3530: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.3531: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12
Source.3532: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.3533: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.3534: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial
Source.3535: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.3536: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.3537: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.3538: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.3539: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.3540: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.3541: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3542: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase
Source.3543: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.3544: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.3545: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.3546: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2
Source.3547: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.3548: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.3549: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.3550: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.3551: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17
Source.3552: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.3553: DFBPPR15216 ---- Microorganism protein ---- Golgi to ER traffic protein 1
Source.3554: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.3555: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.3556: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.3557: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.3558: DFBPPR15248 ---- Microorganism protein ---- DASH complex subunit SPC34
Source.3559: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.3560: DFBPPR15262 ---- Microorganism protein ---- Inner kinetochore subunit NKP1
Source.3561: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.3562: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.3563: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.3564: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.3565: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.3566: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.3567: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.3568: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.3569: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.3570: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.3571: DFBPPR15418 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 4
Source.3572: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.3573: DFBPPR15456 ---- Microorganism protein ---- RNA polymerase II holoenzyme cyclin-like subunit
Source.3574: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.3575: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.3576: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.3577: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.3578: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.3579: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.3580: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.3581: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.3582: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.3583: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3
Source.3584: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial
Source.3585: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.3586: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.3587: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.3588: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.3589: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.3590: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.3591: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.3592: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.3593: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.3594: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.3595: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.3596: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.3597: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.3598: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial
Source.3599: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.3600: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.3601: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.3602: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial
Source.3603: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1
Source.3604: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.3605: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.3606: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.3607: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.3608: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.3609: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.3610: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.3611: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.3612: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.3613: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.3614: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.3615: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.3616: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.3617: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.3618: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.3619: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.3620: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1
Source.3621: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.3622: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.3623: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.3624: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.3625: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.3626: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.3627: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.3628: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.3629: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.3630: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.3631: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.3632: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3633: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.3634: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.3635: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.3636: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.3637: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.3638: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.3639: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3640: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.3641: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3642: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.3643: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.3644: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.3645: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.3646: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.3647: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.3648: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.3649: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.3650: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.3651: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.3652: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.3653: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.3654: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.3655: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.3656: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.3657: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.3658: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.3659: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.3660: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.3661: DFBPPR7970 ---- Plant protein ---- Subtilisin inhibitor
Source.3662: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.3663: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3664: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.3665: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.3666: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.3667: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.3668: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3669: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.3670: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.3671: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.3672: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.3673: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.3674: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.3675: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.3676: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.3677: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.3678: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.3679: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3680: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.3681: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.3682: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.3683: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.3684: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.3685: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3686: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.3687: DFBPPR8235 ---- Plant protein ---- Catalase
Source.3688: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3689: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.3690: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3
Source.3691: DFBPPR8262 ---- Plant protein ---- ATP-dependent zinc metalloprotease FTSH, chloroplastic
Source.3692: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.3693: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.3694: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3695: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3696: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.3697: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.3698: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.3699: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
DPP IV-inhibitory activity

(2) The dipeptides Trp–Pro showed potent inhibitory activity for Dipeptidyl-peptidase IV (EC 3.4.14.5) , the inhibition ratio was > 75%. The inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern (Ki value was 0.04 mM) [3]. As shown in Table 1.

Table 1 IC50 (mM) values of synthetic peptides against DPP-IV activity
Peptides
IC50 (mM)
Relative
Diprotin A (Ile-Pro-Ile) [2]0.21 ± 0.01
0.5
Ile-Pro0.41 ± 0.071.0
Met-Pro
0.87 ± 0.01
2.1
Val-Pro
0.88 ± 0.09
2.1
Arg-Pro
2.24 ± 0.29
5.5
Thr-Pro
2.37 ± 0.60
5.8
Leu-Pro2.37 ± 0.175.8
Lys-Pro
2.54 ± 0.88
6.2
His-Pro
2.82 ± 0.58
6.9
Tyr-Pro
3.17 ± 0.44
7.7
Phe-Pro
3.63 ± 0.51
8.9
Trp-Pro
4.53 ± 0.33
11.0
Pro-Pro
5.86 ± 0.55
14.3
Ser-Pro
5.98 ± 0.42
14.6
Ala-Pro
7.95 ± 0.38
19.4
Gly-Pro
No inhibition

Pro-Ile
No inhibition
Specific target protein(s) Specific Target Protein(s):
Dipeptidyl peptidase 4
Taste properties & Structure
Bitterness
Literature report

Bitter peptide according to BIOPEP database of sensory peptides and amino acids.

Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

No enzyme

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

(1) Although the peptide is a synthetic peptide, its IC50 value has been determined (it has inhibitory activity against DPP-IV) and may be present in other food-borne proteins, so the peptide is included here.
(2) The results presented herein are relevant to the management of type 2 diabetes with functional foods involving multi-target sites for DPP-IV inhibition in humans [3].

Database cross-references
DFBP
[D1] DFBPANOX0636
[D2] DFBPMUFU0679
BIOPEP-UWM [D3] 8504
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Hatanaka T, Inoue Y, Arima J, Kumagai Y, Usuki H, Kawakami K, Kimura M, Mukaihara T. Production of dipeptidyl peptidase IV inhibitory peptides from defatted rice bran. Food Chem. 2012 Sep 15;134(2):797-802.
PMID: 23107693
Other literature(s)

[1] Yamada M, Okagaki C, Higashijima T, et al. A potent dipeptide inhibitor of dipeptidyl peptidase IV.[J]. Bioorganic & Medicinal Chemistry Letters, 1998, 8(12):1537.
[2] Umezawa H, Aoyagi T, Ogawa K, et al. Diprotins A and B, inhibitors of dipeptidyl aminopeptidase IV, produced by bacteria[J]. Journal of Antibiotics, 1984, 37(4):422.
[3] Hikida A, Ito K, Motoyama T, et al. Systematic analysis of a dipeptide library for inhibitor development using human dipeptidyl peptidase IV produced by a Saccharomyces cerevisiae expression system.[J]. Biochemical & Biophysical Research Communications, 2013, 430(4):1217-1222.
[4] Lan V T, Ito K, Ohno M, et al. Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor[J]. Food Chemistry, 2015, 175:66-73.

PubDate 2012
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214