E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPDPIV0023(DPP IV-inhibitory peptide)
DFBP ID DFBPDPIV0023
Peptide sequence YP
Type Native peptide
Peptide/Function name DPP-IV inhibitory peptide, Anti-diabetic peptide
Function-activity relationship
Main bioactivity DPP-IV inhibitory activity
Otheir bioactivity ACE-inhibitory activity [D1], Antihypertensive activity [D2], Antioxidative activity [D3], α-Glucosidase inhibitory activity [D4], Opioid activity [D5], Multifunctional activity [D6]
Calculated physicochemical properties
Three-letter amino acid Tyr-Pro
Single-letter amino acid YP
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 278.30 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
IC50 N.D
pIC50 N.D
GRAVY -1.4500 c
Hydrophilic residue ratio 50% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Rice
Precursor protein Defated rice bran
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin
Source.3: DFBPPR0380 ---- Plant protein ---- Alpha-gliadin
Source.4: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin
Source.5: DFBPPR0382 ---- Plant protein ---- Alpha-gliadin
Source.6: DFBPPR0383 ---- Plant protein ---- Alpha-gliadin
Source.7: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin
Source.8: DFBPPR0385 ---- Plant protein ---- Alpha-gliadin
Source.9: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin
Source.10: DFBPPR0390 ---- Plant protein ---- B3144=ALPHA-gliadin derived CELIAC active peptide
Source.11: DFBPPR0391 ---- Plant protein ---- B3143=ALPHA-gliadin derived CELIAC active peptide
Source.12: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.13: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.14: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.15: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.16: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1
Source.17: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.18: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A
Source.19: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.20: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.21: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.22: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.23: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.24: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.25: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.26: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.27: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.28: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.29: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.30: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.31: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.32: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.33: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.34: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.35: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.36: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.37: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.38: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.39: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.40: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.41: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.42: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.43: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.44: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.45: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.46: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.47: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.48: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.49: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.50: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.51: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.52: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.53: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.54: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.55: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.56: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.57: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.58: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2
Source.59: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.60: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.61: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.62: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.63: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.64: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.65: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.66: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.67: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.68: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.69: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.70: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.71: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.72: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.73: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.74: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.75: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.76: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.77: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.78: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.79: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.80: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.81: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.82: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.83: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.84: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.85: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.86: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.87: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.88: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.89: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.90: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7
Source.91: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.92: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.93: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.94: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.95: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.96: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.97: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.98: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.99: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.100: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.101: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.102: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.103: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.104: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.105: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.106: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.107: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.108: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.109: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.110: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.111: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.112: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.113: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.114: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.115: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.116: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.117: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.118: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.119: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.120: DFBPPR1041 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 1
Source.121: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.122: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.123: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.124: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.125: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.126: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.127: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.128: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.129: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.130: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.131: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.132: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.133: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.134: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.135: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.136: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.137: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.138: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.139: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.140: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.141: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.142: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.143: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.144: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.145: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.146: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.147: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.148: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.149: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.150: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.151: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.152: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.153: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.154: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.155: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.156: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.157: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.158: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.159: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.160: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.161: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.162: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.163: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.164: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.165: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.166: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.167: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.168: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.169: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.170: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.171: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.172: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.173: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.174: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.175: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.176: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.177: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.178: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.179: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.180: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.181: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.182: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.183: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.184: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.185: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.186: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.187: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.188: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.189: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.190: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.191: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.192: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.193: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.194: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.195: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.196: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.197: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.198: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.199: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.200: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.201: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.202: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.203: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.204: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.205: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.206: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.207: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.208: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.209: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.210: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.211: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.212: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.213: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.214: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.215: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.216: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.217: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.218: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.219: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic
Source.220: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.221: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.222: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.223: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.224: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.225: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.226: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.227: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.228: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.229: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.230: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.231: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.232: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47
Source.233: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.234: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.235: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.236: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.237: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.238: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.239: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.240: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.241: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.242: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.243: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.244: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.245: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.246: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.247: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.248: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.249: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.250: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.251: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.252: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.253: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.254: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.255: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.256: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.257: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.258: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.259: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.260: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.261: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.262: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.263: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.264: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.265: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.266: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.267: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.268: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.269: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.270: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.271: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.272: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.273: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.274: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.275: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.276: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.277: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.278: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.279: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.280: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.281: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.282: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.283: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.284: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.285: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.286: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.287: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.288: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.289: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.290: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.291: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.292: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.293: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.294: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.295: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.296: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.297: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.298: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.299: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.300: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.301: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.302: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.303: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.304: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.305: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.306: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.307: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.308: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.309: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.310: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.311: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.312: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.313: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.314: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.315: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.316: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.317: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.318: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.319: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.320: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.321: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.322: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.323: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.324: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.325: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.326: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.327: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.328: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.329: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.330: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.331: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.332: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.333: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.334: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.335: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.336: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.337: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.338: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.339: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.340: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.341: DFBPPR1581 ---- Plant proteins ---- Peroxiredoxin-2C
Source.342: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.343: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.344: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.345: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.346: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.347: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.348: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.349: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.350: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.351: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.352: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.353: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.354: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.355: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.356: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.357: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.358: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.359: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.360: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.361: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.362: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.363: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.364: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.365: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.366: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.367: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.368: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.369: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.370: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.371: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.372: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.373: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.374: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.375: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.376: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19
Source.377: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.378: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.379: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.380: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.381: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.382: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.383: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.384: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.385: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.386: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.387: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.388: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062
Source.389: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.390: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.391: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.392: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.393: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.394: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.395: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.396: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.397: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.398: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.399: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.400: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.401: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.402: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.403: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.404: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.405: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.406: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.407: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.408: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.409: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.410: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.411: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.412: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.413: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.414: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.415: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.416: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.417: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.418: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.419: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.420: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.421: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.422: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.423: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.424: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.425: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.426: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.427: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.428: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.429: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.430: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.431: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.432: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.433: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.434: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.435: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.436: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.437: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.438: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.439: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.440: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.441: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.442: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.443: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1
Source.444: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.445: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.446: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.447: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.448: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.449: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.450: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.451: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.452: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.453: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.454: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.455: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.456: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.457: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.458: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.459: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.460: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.461: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.462: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.463: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.464: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.465: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.466: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.467: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.468: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.469: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.470: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.471: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.472: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.473: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.474: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.475: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.476: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.477: DFBPPR1887 ---- Plant proteins ---- Probable glutathione S-transferase DHAR2, chloroplastic
Source.478: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.479: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.480: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.481: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.482: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.483: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.484: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.485: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.486: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.487: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.488: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.489: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.490: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.491: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.492: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.493: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.494: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.495: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.496: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.497: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.498: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.499: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.500: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.501: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.502: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.503: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.504: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.505: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.506: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B
Source.507: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.508: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.509: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.510: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.511: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.512: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.513: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.514: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.515: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.516: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.517: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.518: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.519: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.520: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.521: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.522: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.523: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.524: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.525: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.526: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.527: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.528: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.529: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.530: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.531: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.532: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.533: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.534: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.535: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.536: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.537: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.538: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.539: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.540: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.541: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.542: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.543: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.544: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.545: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.546: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.547: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.548: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.549: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.550: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.551: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.552: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.553: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.554: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.555: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.556: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.557: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.558: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.559: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.560: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.561: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.562: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.563: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.564: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.565: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.566: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.567: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.568: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.569: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.570: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.571: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.572: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.573: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.574: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.575: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.576: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.577: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.578: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.579: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.580: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.581: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.582: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.583: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.584: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1
Source.585: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.586: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.587: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.588: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.589: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.590: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.591: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.592: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.593: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.594: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.595: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.596: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.597: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.598: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A
Source.599: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.600: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.601: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.602: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.603: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.604: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.605: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.606: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.607: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.608: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.609: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.610: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.611: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.612: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.613: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.614: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.615: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.616: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.617: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.618: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.619: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.620: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.621: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.622: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.623: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.624: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.625: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.626: DFBPPR2223 ---- Plant proteins ---- Urease
Source.627: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.628: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.629: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.630: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.631: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.632: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.633: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.634: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.635: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.636: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.637: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.638: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.639: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.640: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.641: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.642: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.643: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.644: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.645: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.646: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.647: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.648: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.649: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.650: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.651: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.652: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.653: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.654: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.655: DFBPPR2302 ---- Plant proteins ---- Bowman-Birk type bran trypsin inhibitor
Source.656: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.657: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.658: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.659: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.660: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.661: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.662: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.663: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.664: DFBPPR2329 ---- Plant proteins ---- Protein HEADING DATE REPRESSOR 1
Source.665: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.666: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.667: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.668: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.669: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.670: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.671: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.672: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.673: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.674: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.675: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.676: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.677: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.678: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.679: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.680: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.681: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.682: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.683: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.684: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.685: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.686: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.687: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.688: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.689: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.690: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.691: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.692: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.693: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.694: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.695: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.696: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase
Source.697: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.698: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.699: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.700: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.701: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.702: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.703: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.704: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.705: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.706: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.707: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.708: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.709: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.710: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.711: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.712: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.713: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.714: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3
Source.715: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.716: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.717: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.718: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.719: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.720: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.721: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34
Source.722: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2
Source.723: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.724: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.725: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.726: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.727: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.728: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.729: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.730: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.731: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.732: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.733: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.734: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.735: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.736: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.737: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.738: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.739: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.740: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.741: DFBPPR2520 ---- Plant proteins ---- Metallothionein-like protein 4C
Source.742: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.743: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.744: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.745: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.746: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.747: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.748: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.749: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.750: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.751: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.752: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.753: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.754: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.755: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.756: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.757: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.758: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.759: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.760: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.761: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.762: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.763: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.764: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.765: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.766: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.767: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.768: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.769: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.770: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.771: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.772: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.773: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.774: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.775: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.776: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.777: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.778: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.779: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.780: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.781: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.782: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.783: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.784: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial
Source.785: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.786: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.787: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.788: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2
Source.789: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein
Source.790: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.791: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.792: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.793: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.794: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.795: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.796: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.797: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.798: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.799: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.800: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.801: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.802: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.803: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.804: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.805: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.806: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.807: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.808: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.809: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.810: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.811: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.812: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.813: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.814: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.815: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.816: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.817: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.818: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.819: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.820: DFBPPR2733 ---- Plant proteins ---- Metallothionein-like protein 1B
Source.821: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.822: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C
Source.823: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.824: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.825: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.826: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.827: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.828: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.829: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.830: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.831: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.832: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.833: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.834: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.835: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.836: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.837: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.838: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.839: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.840: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.841: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.842: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.843: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.844: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.845: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.846: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.847: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.848: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.849: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.850: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.851: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.852: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.853: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.854: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.855: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.856: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.857: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.858: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.859: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.860: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.861: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.862: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.863: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.864: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.865: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.866: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.867: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.868: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.869: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.870: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.871: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.872: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.873: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.874: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.875: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.876: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.877: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.878: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.879: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.880: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.881: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.882: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.883: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.884: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.885: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.886: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.887: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.888: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.889: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.890: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.891: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.892: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.893: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.894: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.895: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.896: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.897: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.898: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.899: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.900: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.901: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2
Source.902: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1
Source.903: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.904: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.905: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.906: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.907: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.908: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.909: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.910: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.911: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.912: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.913: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.914: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.915: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.916: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.917: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.918: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.919: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.920: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.921: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.922: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.923: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.924: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.925: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.926: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.927: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.928: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.929: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.930: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.931: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.932: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.933: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.934: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.935: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.936: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.937: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.938: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.939: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.940: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.941: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.942: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.943: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.944: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.945: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.946: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.947: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.948: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.949: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.950: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.951: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.952: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.953: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.954: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.955: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.956: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.957: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.958: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.959: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic
Source.960: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.961: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.962: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.963: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.964: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.965: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.966: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.967: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.968: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.969: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.970: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.971: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.972: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.973: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.974: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.975: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.976: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.977: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.978: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.979: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.980: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.981: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.982: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.983: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.984: DFBPPR3108 ---- Plant proteins ---- Thioredoxin H4-2
Source.985: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.986: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.987: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1
Source.988: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1
Source.989: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.990: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.991: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.992: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.993: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.994: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.995: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.996: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.997: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.998: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.999: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1000: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1001: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.1002: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.1003: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.1004: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.1005: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1006: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.1007: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1008: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.1009: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1010: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1011: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1012: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1013: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1014: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.1015: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1016: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.1017: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1018: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1019: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1020: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1021: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1022: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1023: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1024: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1025: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1026: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1027: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.1028: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1029: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1030: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1031: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1032: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1033: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.1034: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1035: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.1036: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1037: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.1038: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.1039: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1040: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.1041: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1042: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1043: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1044: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1045: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1046: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D
Source.1047: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.1048: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1049: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1050: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1051: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.1052: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1053: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16
Source.1054: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1055: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1056: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1057: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1058: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1059: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1060: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.1061: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.1062: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.1063: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1064: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1065: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1066: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1067: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.1068: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.1069: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1070: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1071: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1072: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.1073: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.1074: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1075: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1076: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1077: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1078: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1079: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1080: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1081: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.1082: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1083: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1084: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1085: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1086: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1087: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.1088: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1089: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1090: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1091: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1092: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1093: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1094: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1095: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.1096: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.1097: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1098: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1099: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1100: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5
Source.1101: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1102: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1103: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1104: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1105: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1106: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.1107: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.1108: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1109: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.1110: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.1111: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1112: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.1113: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1114: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1115: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1116: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C
Source.1117: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1118: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.1119: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1120: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.1121: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1122: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.1123: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.1124: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.1125: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1126: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.1127: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1128: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1129: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1130: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1131: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1132: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1133: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1134: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.1135: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1136: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1137: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1138: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1139: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.1140: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.1141: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.1142: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.1143: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1144: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2
Source.1145: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1146: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1147: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.1148: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1149: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1150: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1151: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1152: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.1153: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.1154: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.1155: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1156: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1157: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1158: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.1159: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.1160: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1
Source.1161: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1162: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1163: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1164: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1165: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.1166: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1167: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1168: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1169: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.1170: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1171: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.1172: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1173: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1174: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1175: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1176: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1177: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D
Source.1178: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1179: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1180: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.1181: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1182: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1183: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1184: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2
Source.1185: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1186: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1187: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.1188: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1189: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1190: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1191: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1192: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.1193: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1194: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1195: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1196: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1197: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.1198: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1199: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1200: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.1201: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1202: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.1203: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1204: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.1205: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.1206: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.1207: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase
Source.1208: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4
Source.1209: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1210: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.1211: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.1212: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1213: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.1214: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.1215: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.1216: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1217: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.1218: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1219: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.1220: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.1221: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1222: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1223: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.1224: DFBPPR3760 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.1225: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.1226: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.1227: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.1228: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.1229: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.1230: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.1231: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1232: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1233: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1234: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1235: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.1236: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1237: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.1238: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.1239: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.1240: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.1241: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.1242: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.1243: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1244: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.1245: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1246: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1247: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.1248: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.1249: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.1250: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1251: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.1252: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.1253: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1254: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.1255: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1256: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.1257: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.1258: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.1259: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1260: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.1261: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.1262: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.1263: DFBPPR3908 ---- Plant proteins ---- Metallothionein-like protein 1A
Source.1264: DFBPPR3909 ---- Plant proteins ---- LIM domain-containing protein PLIM2b
Source.1265: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1266: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1267: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.1268: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.1269: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.1270: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.1271: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.1272: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1273: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.1274: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1275: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.1276: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1277: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1278: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.1279: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.1280: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.1281: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1282: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1283: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.1284: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.1285: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.1286: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.1287: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.1288: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.1289: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1290: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1291: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1292: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1293: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.1294: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.1295: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1296: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.1297: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.1298: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1299: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.1300: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1301: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.1302: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1303: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3
Source.1304: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1305: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.1306: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.1307: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1308: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1309: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1310: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.1311: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1312: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.1313: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1314: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.1315: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.1316: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.1317: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.1318: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.1319: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.1320: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.1321: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1322: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1323: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.1324: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.1325: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1326: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1327: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.1328: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.1329: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1330: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1331: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4
Source.1332: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.1333: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.1334: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1335: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1336: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1337: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.1338: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1339: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.1340: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.1341: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1342: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1343: DFBPPR4151 ---- Plant proteins ---- Metallothionein-like protein 4A
Source.1344: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.1345: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.1346: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.1347: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1348: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6
Source.1349: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.1350: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1351: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.1352: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1353: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1354: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.1355: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3
Source.1356: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.1357: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.1358: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.1359: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1360: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.1361: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1362: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.1363: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1364: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1365: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1366: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1367: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.1368: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1369: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1370: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.1371: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1372: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.1373: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.1374: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1375: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1376: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1377: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.1378: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.1379: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1380: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.1381: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1382: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1383: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic
Source.1384: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.1385: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.1386: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1387: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1388: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.1389: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1390: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1391: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1392: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1393: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.1394: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1395: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.1396: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.1397: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.1398: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.1399: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.1400: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.1401: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1
Source.1402: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1403: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1404: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.1405: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.1406: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1407: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.1408: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.1409: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.1410: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.1411: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1412: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1413: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1414: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1415: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.1416: DFBPPR4328 ---- Plant proteins ---- Metallothionein-like protein 2A
Source.1417: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.1418: DFBPPR4331 ---- Plant proteins ---- 60S ribosomal protein L10-2
Source.1419: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1420: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.1421: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.1422: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1423: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.1424: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1425: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.1426: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.1427: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.1428: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1429: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.1430: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1431: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1432: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.1433: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1434: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1435: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1436: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1437: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.1438: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2
Source.1439: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.1440: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1441: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.1442: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.1443: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.1444: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1445: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog
Source.1446: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1447: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1448: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1
Source.1449: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.1450: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.1451: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1452: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.1453: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1454: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1455: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1456: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.1457: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1458: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.1459: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.1460: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1461: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1462: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.1463: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.1464: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1465: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.1466: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.1467: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.1468: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.1469: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.1470: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1471: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.1472: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.1473: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.1474: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1475: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.1476: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.1477: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1478: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1479: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.1480: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.1481: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.1482: DFBPPR4501 ---- Plant proteins ---- Metallothionein-like protein 4B
Source.1483: DFBPPR4504 ---- Plant proteins ---- 60S ribosomal protein L10-1
Source.1484: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.1485: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.1486: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.1487: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.1488: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.1489: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.1490: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.1491: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.1492: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1493: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.1494: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1495: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.1496: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1497: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.1498: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.1499: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1500: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.1501: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.1502: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.1503: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.1504: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1505: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.1506: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.1507: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.1508: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1509: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1510: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.1511: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.1512: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.1513: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.1514: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.1515: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.1516: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1517: DFBPPR4607 ---- Plant proteins ---- Protein LOL2
Source.1518: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.1519: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.1520: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.1521: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1522: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1523: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.1524: DFBPPR4620 ---- Plant proteins ---- Protein LOL1
Source.1525: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.1526: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.1527: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.1528: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.1529: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.1530: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1531: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.1532: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.1533: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.1534: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.1535: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1536: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1537: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.1538: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1539: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.1540: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.1541: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.1542: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.1543: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2
Source.1544: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.1545: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1546: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.1547: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.1548: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.1549: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.1550: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1551: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.1552: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.1553: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1554: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1555: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.1556: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.1557: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4
Source.1558: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.1559: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1560: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.1561: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.1562: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.1563: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1564: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1565: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.1566: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.1567: DFBPPR4776 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 3
Source.1568: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.1569: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1
Source.1570: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2
Source.1571: DFBPPR4800 ---- Plant proteins ---- Protein BUD31 homolog 2
Source.1572: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.1573: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.1574: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.1575: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.1576: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000
Source.1577: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.1578: DFBPPR4829 ---- Plant proteins ---- Protein BUD31 homolog 3
Source.1579: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1580: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400
Source.1581: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.1582: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1583: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.1584: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.1585: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1586: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.1587: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.1588: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.1589: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.1590: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.1591: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.1592: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1593: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1594: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.1595: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1
Source.1596: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.1597: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1598: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.1599: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic
Source.1600: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.1601: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.1602: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.1603: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.1604: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.1605: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1606: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1607: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.1608: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.1609: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1610: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.1611: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1612: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1613: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.1614: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.1615: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.1616: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.1617: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.1618: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.1619: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1620: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.1621: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.1622: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.1623: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.1624: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.1625: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.1626: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.1627: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.1628: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.1629: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.1630: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.1631: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.1632: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1633: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.1634: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.1635: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.1636: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.1637: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1
Source.1638: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.1639: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1640: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1641: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1642: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.1643: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1644: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1645: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.1646: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.1647: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.1648: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1649: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.1650: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.1651: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1652: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.1653: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1654: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.1655: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.1656: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1657: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.1658: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase
Source.1659: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1660: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.1661: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.1662: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1663: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.1664: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.1665: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.1666: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1667: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1668: DFBPPR5051 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor
Source.1669: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.1670: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1671: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1672: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.1673: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.1674: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.1675: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.1676: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.1677: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.1678: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.1679: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.1680: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.1681: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.1682: DFBPPR5079 ---- Plant proteins ---- Albumin-1
Source.1683: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1684: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1685: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.1686: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.1687: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1688: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1689: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1690: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.1691: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1692: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.1693: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1694: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.1695: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.1696: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.1697: DFBPPR5111 ---- Plant proteins ---- Lectin
Source.1698: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.1699: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.1700: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.1701: DFBPPR5122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1702: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1703: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1704: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.1705: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1706: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.1707: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.1708: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1709: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.1710: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.1711: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1712: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1713: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.1714: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1715: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1716: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2
Source.1717: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1718: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1719: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.1720: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1721: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1722: DFBPPR5179 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1723: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1
Source.1724: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.1725: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.1726: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A
Source.1727: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1728: DFBPPR5192 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1729: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1730: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.1731: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.1732: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1733: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1734: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.1735: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.1736: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.1737: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.1738: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.1739: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.1740: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1741: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein
Source.1742: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1743: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.1744: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2
Source.1745: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1746: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1747: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1748: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1749: DFBPPR5274 ---- Plant proteins ---- Early nodulin-75
Source.1750: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.1751: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.1752: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.1753: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1754: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.1755: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1756: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.1757: DFBPPR5314 ---- Plant proteins ---- Hydrophobic seed protein
Source.1758: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.1759: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.1760: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.1761: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.1762: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1763: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.1764: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3
Source.1765: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B
Source.1766: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.1767: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.1768: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.1769: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.1770: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1771: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.1772: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1773: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1774: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1775: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1776: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1777: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1778: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1779: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1780: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1781: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.1782: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.1783: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.1784: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1785: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.1786: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1787: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1788: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.1789: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.1790: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1791: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1792: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.1793: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.1794: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.1795: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.1796: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.1797: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.1798: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.1799: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.1800: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1801: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.1802: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1803: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1804: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic
Source.1805: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha
Source.1806: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.1807: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1808: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.1809: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1810: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1811: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.1812: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1813: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1814: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.1815: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1816: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1817: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1818: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1819: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1820: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.1821: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1822: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.1823: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.1824: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.1825: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1826: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1827: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1828: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.1829: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic
Source.1830: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.1831: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.1832: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1833: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.1834: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1835: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.1836: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic
Source.1837: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1838: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.1839: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1840: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.1841: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1842: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.1843: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.1844: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1845: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.1846: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1847: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1848: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.1849: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.1850: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1851: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1852: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1853: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1854: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.1855: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.1856: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1857: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.1858: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.1859: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.1860: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.1861: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1862: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.1863: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.1864: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.1865: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.1866: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.1867: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.1868: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.1869: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.1870: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1871: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1872: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1873: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1874: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1875: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.1876: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1877: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1878: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.1879: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1880: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.1881: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1882: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1883: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.1884: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.1885: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.1886: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1887: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1888: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1889: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.1890: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1891: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1892: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.1893: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.1894: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.1895: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1896: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1897: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1898: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.1899: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.1900: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.1901: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.1902: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.1903: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.1904: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1905: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.1906: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1907: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1908: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1909: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1910: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.1911: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.1912: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.1913: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.1914: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1915: DFBPPR5706 ---- Plant proteins ---- Glutelin-2
Source.1916: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.1917: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1918: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.1919: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1920: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1921: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.1922: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.1923: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.1924: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1925: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.1926: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1927: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1928: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.1929: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1930: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.1931: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1932: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.1933: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.1934: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1935: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.1936: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1937: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.1938: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.1939: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.1940: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1941: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.1942: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.1943: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1944: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic
Source.1945: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.1946: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1947: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.1948: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.1949: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1950: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic
Source.1951: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.1952: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.1953: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1954: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1955: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2
Source.1956: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.1957: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1958: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1959: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.1960: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1961: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1962: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1963: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1964: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1965: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1966: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.1967: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1968: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.1969: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.1970: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1971: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.1972: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.1973: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A
Source.1974: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.1975: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.1976: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.1977: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic
Source.1978: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1979: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1980: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1981: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1982: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.1983: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1984: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1985: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.1986: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1987: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1988: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1989: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1990: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1991: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1992: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.1993: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1994: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2
Source.1995: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1996: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.1997: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.1998: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.1999: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.2000: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.2001: DFBPPR5924 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.2002: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.2003: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein
Source.2004: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.2005: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.2006: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.2007: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.2008: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.2009: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.2010: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.2011: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.2012: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5
Source.2013: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.2014: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2015: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.2016: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.2017: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.2018: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.2019: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.2020: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3
Source.2021: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.2022: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.2023: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.2024: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2025: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.2026: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2027: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.2028: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.2029: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.2030: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.2031: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4
Source.2032: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.2033: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.2034: DFBPPR6059 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.2035: DFBPPR6060 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.2036: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.2037: DFBPPR6064 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.2038: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2039: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.2040: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.2041: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.2042: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.2043: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.2044: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.2045: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99
Source.2046: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.2047: DFBPPR6094 ---- Plant proteins ---- Zein-alpha PZ19.1
Source.2048: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.2049: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.2050: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.2051: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.2052: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.2053: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2054: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.2055: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.2056: DFBPPR6142 ---- Plant proteins ---- Metallothionein-like protein 1
Source.2057: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.2058: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.2059: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.2060: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.2061: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.2062: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.2063: DFBPPR6177 ---- Plant proteins ---- Unknown protein from spot 159 of 2D-PAGE of etiolated coleoptile
Source.2064: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile
Source.2065: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile
Source.2066: DFBPPR6200 ---- Plant proteins ---- Unknown protein from spot 443 of 2D-PAGE of etiolated coleoptile
Source.2067: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.2068: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2069: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.2070: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.2071: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.2072: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2073: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.2074: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.2075: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.2076: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.2077: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.2078: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2079: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.2080: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.2081: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.2082: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.2083: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.2084: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.2085: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.2086: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2087: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.2088: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.2089: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2090: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.2091: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.2092: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.2093: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.2094: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.2095: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2096: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2097: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2098: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.2099: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2100: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.2101: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.2102: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.2103: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.2104: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2105: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2106: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.2107: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.2108: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.2109: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2110: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.2111: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2112: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein
Source.2113: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2114: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.2115: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2116: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.2117: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2118: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2119: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.2120: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.2121: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.2122: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.2123: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.2124: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.2125: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.2126: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2127: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2128: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.2129: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.2130: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.2131: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F
Source.2132: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2133: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2134: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.2135: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2136: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.2137: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2138: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.2139: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.2140: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.2141: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.2142: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2143: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.2144: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2145: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2146: DFBPPR6358 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2147: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2148: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2149: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.2150: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2151: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2152: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2153: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.2154: DFBPPR6377 ---- Plant proteins ---- Lectin
Source.2155: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D
Source.2156: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.2157: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2158: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.2159: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.2160: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.2161: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.2162: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.2163: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.2164: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2165: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2166: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.2167: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.2168: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2169: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2170: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic
Source.2171: DFBPPR6430 ---- Plant proteins ---- Legumin J
Source.2172: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2173: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B
Source.2174: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A
Source.2175: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72
Source.2176: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.2177: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.2178: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.2179: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.2180: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.2181: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.2182: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.2183: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.2184: DFBPPR6455 ---- Plant proteins ---- Legumin K
Source.2185: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.2186: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.2187: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.2188: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.2189: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.2190: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.2191: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.2192: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.2193: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.2194: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.2195: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.2196: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.2197: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E
Source.2198: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.2199: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.2200: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.2201: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2202: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.2203: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.2204: DFBPPR6534 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.2205: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2206: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2207: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.2208: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.2209: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.2210: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.2211: DFBPPR6594 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.2212: DFBPPR6595 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.2213: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28
Source.2214: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2215: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.2216: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.2217: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.2218: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.2219: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.2220: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.2221: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.2222: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2223: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.2224: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2225: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.2226: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.2227: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.2228: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.2229: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.2230: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.2231: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.2232: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2233: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.2234: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.2235: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2236: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2237: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.2238: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.2239: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.2240: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.2241: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2242: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2
Source.2243: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.2244: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.2245: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5
Source.2246: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.2247: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2248: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.2249: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.2250: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2251: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.2252: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.2253: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.2254: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.2255: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.2256: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.2257: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.2258: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.2259: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2260: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.2261: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.2262: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.2263: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.2264: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.2265: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2266: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2267: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.2268: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.2269: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.2270: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.2271: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2272: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.2273: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2274: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.2275: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2276: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.2277: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.2278: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic
Source.2279: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2280: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.2281: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.2282: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.2283: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z
Source.2284: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.2285: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.2286: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.2287: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.2288: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2289: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2290: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3
Source.2291: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2292: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2293: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.2294: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7
Source.2295: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2296: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2297: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.2298: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.2299: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.2300: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2301: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.2302: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2303: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2304: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.2305: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2306: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.2307: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.2308: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.2309: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.2310: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.2311: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2312: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2313: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512
Source.2314: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.2315: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.2316: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2317: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.2318: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2319: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.2320: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2321: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10
Source.2322: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.2323: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.2324: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.2325: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12
Source.2326: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.2327: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2328: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2329: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.2330: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.2331: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212
Source.2332: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2333: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2334: DFBPPR6924 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC256
Source.2335: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin
Source.2336: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215
Source.2337: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II
Source.2338: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV
Source.2339: DFBPPR6938 ---- Plant proteins ---- Alpha/beta-gliadin clone PW8142
Source.2340: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V
Source.2341: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III
Source.2342: DFBPPR6941 ---- Plant proteins ---- Alpha/beta-gliadin A-I
Source.2343: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2344: DFBPPR6954 ---- Plant proteins ---- Alpha/beta-gliadin clone PTO-A10
Source.2345: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.2346: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin
Source.2347: DFBPPR6963 ---- Plant proteins ---- Metallothionein-like protein 1
Source.2348: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B
Source.2349: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin
Source.2350: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.2351: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.2352: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.2353: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.2354: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.2355: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.2356: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.2357: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2358: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.2359: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.2360: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.2361: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1
Source.2362: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.2363: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.2364: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.2365: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.2366: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.2367: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.2368: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2369: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.2370: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.2371: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.2372: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.2373: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.2374: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.2375: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2376: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2377: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.2378: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.2379: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.2380: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.2381: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2382: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2383: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2384: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.2385: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2386: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.2387: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.2388: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.2389: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.2390: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.2391: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.2392: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.2393: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.2394: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2395: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.2396: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.2397: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.2398: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2399: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2400: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.2401: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.2402: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2403: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.2404: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.2405: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.2406: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2407: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2408: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2409: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.2410: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.2411: DFBPPR7132 ---- Plant proteins ---- Beta-galactosidase
Source.2412: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2413: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.2414: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.2415: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2416: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.2417: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.2418: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.2419: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.2420: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.2421: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2422: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.2423: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.2424: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.2425: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.2426: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2427: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.2428: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2429: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.2430: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.2431: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2432: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2433: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.2434: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.2435: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2436: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2437: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2438: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.2439: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.2440: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.2441: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.2442: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.2443: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2444: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.2445: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.2446: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.2447: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2448: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2449: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.2450: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.2451: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.2452: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2453: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.2454: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2455: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.2456: DFBPPR7223 ---- Plant proteins ---- Ferredoxin
Source.2457: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.2458: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.2459: DFBPPR7246 ---- Plant proteins ---- Leaf-specific thionin
Source.2460: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.2461: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.2462: DFBPPR7251 ---- Plant proteins ---- Leaf-specific thionin DB4
Source.2463: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.2464: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic
Source.2465: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6
Source.2466: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.2467: DFBPPR7267 ---- Plant proteins ---- Thionin BTH7
Source.2468: DFBPPR7268 ---- Plant proteins ---- Probable leaf thionin
Source.2469: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.2470: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.2471: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B
Source.2472: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C
Source.2473: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.2474: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2475: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.2476: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein
Source.2477: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.2478: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.2479: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.2480: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.2481: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.2482: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.2483: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1
Source.2484: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2485: DFBPPR7318 ---- Plant proteins ---- B3-hordein
Source.2486: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.2487: DFBPPR7322 ---- Plant proteins ---- Metallothionein-like protein 1
Source.2488: DFBPPR7335 ---- Plant proteins ---- C-hordein
Source.2489: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.2490: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2491: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.2492: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.2493: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.2494: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.2495: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.2496: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.2497: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.2498: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.2499: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.2500: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.2501: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.2502: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2503: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.2504: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.2505: DFBPPR7419 ---- Plant proteins ---- Cytochrome b
Source.2506: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.2507: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.2508: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.2509: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.2510: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2511: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2512: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4
Source.2513: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2514: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.2515: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2516: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2517: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2518: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2
Source.2519: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1
Source.2520: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.2521: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2522: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.2523: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.2524: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.2525: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II
Source.2526: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.2527: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.2528: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.2529: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.2530: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2531: DFBPPR7499 ---- Plant proteins ---- Ferredoxin
Source.2532: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.2533: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.2534: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.2535: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2536: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.2537: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2538: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.2539: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.2540: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2541: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76
Source.2542: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.2543: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.2544: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.2545: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.2546: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.2547: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.2548: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.2549: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.2550: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.2551: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.2552: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.2553: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.2554: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.2555: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.2556: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.2557: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.2558: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.2559: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.2560: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.2561: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2562: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2563: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain
Source.2564: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2565: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.2566: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.2567: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.2568: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.2569: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.2570: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.2571: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.2572: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.2573: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.2574: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.2575: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.2576: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.2577: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.2578: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2579: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.2580: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.2581: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2582: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12
Source.2583: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.2584: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.2585: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2586: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.2587: DFBPPR7663 ---- Milk proteins ---- Kappa-casein
Source.2588: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein
Source.2589: DFBPPR7665 ---- Milk proteins ---- Beta-casein
Source.2590: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.2591: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.2592: DFBPPR7673 ---- Milk proteins ---- Kappa-casein
Source.2593: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.2594: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A
Source.2595: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.2596: DFBPPR7681 ---- Milk proteins ---- Beta-casein
Source.2597: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.2598: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.2599: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.2600: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein
Source.2601: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.2602: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.2603: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2604: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein
Source.2605: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.2606: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.2607: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.2608: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.2609: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.2610: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.2611: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.2612: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.2613: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.2614: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.2615: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.2616: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.2617: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.2618: DFBPPR7725 ---- Plant proteins ---- Avenin-3
Source.2619: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.2620: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.2621: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2622: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2623: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.2624: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.2625: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.2626: DFBPPR7741 ---- Plant proteins ---- Avenin-F
Source.2627: DFBPPR7742 ---- Plant proteins ---- Avenin-A
Source.2628: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.2629: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.2630: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.2631: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.2632: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.2633: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.2634: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.2635: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.2636: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.2637: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.2638: DFBPPR8357 ---- Plant proteins ---- 2S albumin
Source.2639: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.2640: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.2641: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.2642: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.2643: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.2644: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2645: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.2646: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2647: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.2648: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.2649: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin
Source.2650: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.2651: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2652: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101
Source.2653: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.2654: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.2655: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.2656: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.2657: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2658: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1
Source.2659: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2660: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2661: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.2662: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2663: DFBPPR8434 ---- Plant proteins ---- Lectin
Source.2664: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.2665: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.2666: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.2667: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.2668: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.2669: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.2670: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.2671: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.2672: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.2673: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2674: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.2675: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2676: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.2677: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.2678: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2679: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2680: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.2681: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.2682: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.2683: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.2684: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.2685: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.2686: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.2687: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.2688: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.2689: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.2690: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.2691: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.2692: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.2693: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2694: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2695: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.2696: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.2697: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.2698: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.2699: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.2700: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.2701: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.2702: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.2703: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2704: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.2705: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2706: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.2707: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.2708: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.2709: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2710: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2711: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.2712: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.2713: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.2714: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.2715: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.2716: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.2717: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.2718: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.2719: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.2720: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.2721: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.2722: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.2723: DFBPPR15988 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2724: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.2725: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2726: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.2727: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2728: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.2729: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.2730: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.2731: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.2732: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2733: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.2734: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.2735: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2736: DFBPPR16013 ---- Animal proteins ---- Osteocalcin
Source.2737: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.2738: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2739: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2740: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.2741: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.2742: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA
Source.2743: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2744: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2745: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.2746: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.2747: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2748: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.2749: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2750: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2751: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.2752: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2753: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.2754: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.2755: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.2756: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.2757: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2758: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.2759: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.2760: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.2761: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.2762: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.2763: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.2764: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.2765: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.2766: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.2767: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.2768: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2769: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.2770: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.2771: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.2772: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.2773: DFBPPR16093 ---- Animal proteins ---- Menin
Source.2774: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.2775: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.2776: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.2777: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.2778: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2779: DFBPPR16103 ---- Animal proteins ---- Laforin
Source.2780: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2781: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.2782: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.2783: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.2784: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.2785: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2786: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.2787: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.2788: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.2789: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.2790: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2791: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.2792: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.2793: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.2794: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.2795: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2796: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.2797: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.2798: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.2799: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.2800: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.2801: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.2802: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.2803: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.2804: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.2805: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.2806: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.2807: DFBPPR16154 ---- Animal proteins ---- Apolipoprotein C-II
Source.2808: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.2809: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.2810: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.2811: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.2812: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.2813: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.2814: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.2815: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.2816: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.2817: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.2818: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2819: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.2820: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.2821: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.2822: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2823: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.2824: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2825: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.2826: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.2827: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2828: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.2829: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2830: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2831: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.2832: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2833: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2834: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.2835: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2836: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.2837: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.2838: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.2839: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.2840: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.2841: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2842: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.2843: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2844: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.2845: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.2846: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24
Source.2847: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2848: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.2849: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.2850: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.2851: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.2852: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2853: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.2854: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.2855: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2856: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain
Source.2857: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.2858: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2859: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.2860: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.2861: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2862: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.2863: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.2864: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.2865: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone
Source.2866: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.2867: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.2868: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.2869: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.2870: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.2871: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta
Source.2872: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.2873: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.2874: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.2875: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.2876: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1
Source.2877: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2878: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.2879: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2880: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.2881: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.2882: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.2883: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.2884: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.2885: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2886: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.2887: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.2888: DFBPPR16305 ---- Animal proteins ---- Phosducin
Source.2889: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2890: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.2891: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.2892: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.2893: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.2894: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.2895: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.2896: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.2897: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.2898: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.2899: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.2900: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.2901: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.2902: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.2903: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.2904: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.2905: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.2906: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.2907: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2908: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.2909: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.2910: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.2911: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.2912: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta
Source.2913: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.2914: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2915: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.2916: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.2917: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.2918: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.2919: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin
Source.2920: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin
Source.2921: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.2922: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.2923: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.2924: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.2925: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.2926: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.2927: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.2928: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.2929: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.2930: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.2931: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.2932: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.2933: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.2934: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.2935: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.2936: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.2937: DFBPPR16499 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.2938: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.2939: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2940: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.2941: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.2942: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.2943: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2944: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.2945: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.2946: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2947: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.2948: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.2949: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.2950: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B
Source.2951: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.2952: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2953: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2954: DFBPPR16543 ---- Animal proteins ---- ATP synthase protein 8
Source.2955: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2956: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.2957: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2958: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.2959: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.2960: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.2961: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2962: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.2963: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2964: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.2965: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.2966: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.2967: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.2968: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.2969: DFBPPR16588 ---- Animal proteins ---- Peptide YY
Source.2970: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.2971: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S
Source.2972: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.2973: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.2974: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2975: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.2976: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.2977: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.2978: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.2979: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.2980: DFBPPR16611 ---- Animal proteins ---- Nuclear transition protein 2
Source.2981: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.2982: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4
Source.2983: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2984: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.2985: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.2986: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2987: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.2988: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.2989: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.2990: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.2991: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.2992: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2993: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2994: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27
Source.2995: DFBPPR16660 ---- Animal proteins ---- Gamma-crystallin C
Source.2996: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.2997: DFBPPR16663 ---- Animal proteins ---- Involucrin
Source.2998: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.2999: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.3000: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.3001: DFBPPR16680 ---- Animal proteins ---- Gastrin-releasing peptide
Source.3002: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.3003: DFBPPR16689 ---- Animal proteins ---- Gamma-crystallin B
Source.3004: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3
Source.3005: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor
Source.3006: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.3007: DFBPPR16707 ---- Animal proteins ---- Trefoil factor 2
Source.3008: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190
Source.3009: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3010: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.3011: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.3012: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1
Source.3013: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.3014: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.3015: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM
Source.3016: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3017: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3018: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.3019: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3020: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.3021: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.3022: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.3023: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.3024: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.3025: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.3026: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.3027: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.3028: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta
Source.3029: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.3030: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.3031: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.3032: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.3033: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.3034: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3035: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3036: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.3037: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.3038: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3039: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.3040: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.3041: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3042: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3043: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta
Source.3044: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.3045: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.3046: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.3047: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.3048: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3049: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.3050: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.3051: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3052: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3053: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3054: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.3055: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.3056: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.3057: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial
Source.3058: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.3059: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.3060: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.3061: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.3062: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.3063: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.3064: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.3065: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.3066: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3067: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3068: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.3069: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3070: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.3071: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.3072: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.3073: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain
Source.3074: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.3075: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.3076: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3077: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3078: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3079: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.3080: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.3081: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3082: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.3083: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.3084: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3085: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3086: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3087: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A
Source.3088: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.3089: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.3090: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.3091: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.3092: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA
Source.3093: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3094: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.3095: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.3096: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.3097: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.3098: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3099: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3100: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.3101: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.3102: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.3103: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.3104: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.3105: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.3106: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3107: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.3108: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.3109: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3110: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.3111: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.3112: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.3113: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.3114: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.3115: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.3116: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.3117: DFBPPR16991 ---- Animal proteins ---- Osteocalcin
Source.3118: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.3119: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.3120: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3121: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.3122: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3123: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.3124: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.3125: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.3126: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.3127: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.3128: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2
Source.3129: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3130: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3131: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.3132: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.3133: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.3134: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.3135: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.3136: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.3137: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.3138: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.3139: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3140: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.3141: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3142: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.3143: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.3144: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.3145: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.3146: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.3147: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3148: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.3149: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.3150: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.3151: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.3152: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.3153: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.3154: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3155: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.3156: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.3157: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.3158: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168
Source.3159: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.3160: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3161: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.3162: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3163: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.3164: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.3165: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.3166: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.3167: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.3168: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.3169: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.3170: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.3171: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.3172: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.3173: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3174: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.3175: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.3176: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.3177: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.3178: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.3179: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.3180: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3181: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.3182: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.3183: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.3184: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3185: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.3186: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.3187: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3188: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3189: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.3190: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.3191: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.3192: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3193: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3194: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3195: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.3196: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.3197: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.3198: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.3199: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1
Source.3200: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.3201: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.3202: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.3203: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.3204: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.3205: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3206: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.3207: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.3208: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2
Source.3209: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.3210: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.3211: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.3212: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3213: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.3214: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.3215: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.3216: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.3217: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.3218: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.3219: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.3220: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.3221: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.3222: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.3223: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.3224: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.3225: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.3226: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.3227: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.3228: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.3229: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.3230: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.3231: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.3232: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.3233: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.3234: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.3235: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.3236: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.3237: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.3238: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.3239: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.3240: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.3241: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.3242: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.3243: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3244: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.3245: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3246: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.3247: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.3248: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.3249: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.3250: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.3251: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3252: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.3253: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.3254: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.3255: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.3256: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.3257: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3258: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.3259: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3260: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3261: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.3262: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.3263: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.3264: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.3265: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.3266: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.3267: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.3268: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.3269: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.3270: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.3271: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.3272: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.3273: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.3274: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.3275: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.3276: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.3277: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.3278: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.3279: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.3280: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.3281: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.3282: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.3283: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.3284: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.3285: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.3286: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.3287: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.3288: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3289: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.3290: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.3291: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.3292: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.3293: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.3294: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.3295: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.3296: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.3297: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.3298: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.3299: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.3300: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.3301: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.3302: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.3303: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.3304: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.3305: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.3306: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.3307: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.3308: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.3309: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.3310: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.3311: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.3312: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.3313: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.3314: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.3315: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.3316: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.3317: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.3318: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.3319: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.3320: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3321: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.3322: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.3323: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.3324: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.3325: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.3326: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.3327: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.3328: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3329: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.3330: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b
Source.3331: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3332: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.3333: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3334: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.3335: DFBPPR17517 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.3336: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.3337: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3338: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.3339: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.3340: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.3341: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.3342: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.3343: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.3344: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.3345: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.3346: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.3347: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3348: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.3349: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.3350: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.3351: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.3352: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.3353: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.3354: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.3355: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.3356: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.3357: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.3358: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.3359: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.3360: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.3361: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.3362: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.3363: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.3364: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.3365: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.3366: DFBPPR17586 ---- Animal proteins ---- Dermatopontin
Source.3367: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.3368: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3369: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.3370: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.3371: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.3372: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.3373: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.3374: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.3375: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.3376: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.3377: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3378: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1
Source.3379: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.3380: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.3381: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.3382: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.3383: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.3384: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.3385: DFBPPR17646 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial
Source.3386: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.3387: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.3388: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.3389: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.3390: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.3391: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.3392: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.3393: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.3394: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.3395: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.3396: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3397: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6
Source.3398: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3399: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.3400: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.3401: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.3402: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.3403: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.3404: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3405: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.3406: DFBPPR17752 ---- Animal proteins ---- Follistatin
Source.3407: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.3408: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.3409: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.3410: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.3411: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.3412: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.3413: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.3414: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3415: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.3416: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.3417: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.3418: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.3419: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.3420: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.3421: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.3422: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3423: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.3424: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.3425: DFBPPR17793 ---- Animal proteins ---- Interleukin-17A
Source.3426: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.3427: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.3428: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.3429: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.3430: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.3431: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.3432: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.3433: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3434: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.3435: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.3436: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.3437: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.3438: DFBPPR17816 ---- Animal proteins ---- Lumican
Source.3439: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2
Source.3440: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3441: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.3442: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3443: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.3444: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.3445: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.3446: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.3447: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3
Source.3448: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.3449: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3450: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B
Source.3451: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.3452: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.3453: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3454: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.3455: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3456: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.3457: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.3458: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.3459: DFBPPR17858 ---- Animal proteins ---- Calsenilin
Source.3460: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.3461: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.3462: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.3463: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.3464: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.3465: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.3466: DFBPPR17879 ---- Animal proteins ---- Menin
Source.3467: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.3468: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.3469: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3470: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.3471: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.3472: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.3473: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3474: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.3475: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.3476: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.3477: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.3478: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.3479: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein
Source.3480: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.3481: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.3482: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.3483: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.3484: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.3485: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.3486: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3487: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.3488: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.3489: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.3490: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.3491: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3492: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.3493: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.3494: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.3495: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.3496: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.3497: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.3498: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.3499: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.3500: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.3501: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.3502: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.3503: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.3504: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.3505: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase
Source.3506: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.3507: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.3508: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.3509: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.3510: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.3511: DFBPPR17968 ---- Animal proteins ---- Cathelicidin-2
Source.3512: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.3513: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.3514: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.3515: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.3516: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.3517: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.3518: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.3519: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.3520: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.3521: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.3522: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3523: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.3524: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.3525: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.3526: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.3527: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.3528: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3529: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.3530: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.3531: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.3532: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.3533: DFBPPR18017 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19
Source.3534: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.3535: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.3536: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3537: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.3538: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.3539: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.3540: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.3541: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.3542: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1
Source.3543: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.3544: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3545: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3546: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T
Source.3547: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.3548: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.3549: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.3550: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.3551: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.3552: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.3553: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.3554: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.3555: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.3556: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.3557: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.3558: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.3559: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3560: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.3561: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.3562: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.3563: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.3564: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.3565: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.3566: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.3567: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.3568: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.3569: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.3570: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.3571: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.3572: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3573: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.3574: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.3575: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.3576: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3577: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3578: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.3579: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.3580: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.3581: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.3582: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.3583: DFBPPR18136 ---- Animal proteins ---- Septin-8
Source.3584: DFBPPR18137 ---- Animal proteins ---- Septin-8
Source.3585: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.3586: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1
Source.3587: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.3588: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.3589: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.3590: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.3591: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.3592: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.3593: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.3594: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.3595: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.3596: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.3597: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.3598: DFBPPR18168 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 W
Source.3599: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.3600: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.3601: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.3602: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.3603: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3604: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.3605: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.3606: DFBPPR18199 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 N
Source.3607: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.3608: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.3609: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.3610: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3611: DFBPPR18211 ---- Animal proteins ---- Phosducin
Source.3612: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.3613: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor
Source.3614: DFBPPR18221 ---- Animal proteins ---- Gamma-crystallin B
Source.3615: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.3616: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.3617: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B
Source.3618: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.3619: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.3620: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3621: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.3622: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.3623: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.3624: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.3625: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.3626: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3627: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.3628: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.3629: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.3630: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.3631: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3632: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.3633: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.3634: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.3635: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.3636: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.3637: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.3638: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.3639: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.3640: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.3641: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3642: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.3643: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.3644: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.3645: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3646: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.3647: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.3648: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.3649: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.3650: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.3651: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3652: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.3653: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.3654: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.3655: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.3656: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3657: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.3658: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.3659: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.3660: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1
Source.3661: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.3662: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.3663: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.3664: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.3665: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.3666: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.3667: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.3668: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.3669: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.3670: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.3671: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3672: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.3673: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.3674: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.3675: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.3676: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.3677: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.3678: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.3679: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3680: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.3681: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.3682: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.3683: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.3684: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3685: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.3686: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.3687: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3688: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3689: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.3690: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.3691: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.3692: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.3693: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.3694: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.3695: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.3696: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.3697: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.3698: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.3699: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.3700: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.3701: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.3702: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.3703: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3704: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.3705: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.3706: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.3707: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.3708: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.3709: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.3710: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.3711: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.3712: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.3713: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.3714: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.3715: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.3716: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.3717: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.3718: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.3719: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.3720: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.3721: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.3722: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.3723: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.3724: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.3725: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.3726: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.3727: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.3728: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.3729: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.3730: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.3731: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.3732: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.3733: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.3734: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3735: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.3736: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.3737: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.3738: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3739: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.3740: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.3741: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.3742: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.3743: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.3744: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.3745: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.3746: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.3747: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.3748: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.3749: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3750: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.3751: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.3752: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.3753: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.3754: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.3755: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.3756: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.3757: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.3758: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.3759: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.3760: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.3761: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.3762: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.3763: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.3764: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.3765: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.3766: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.3767: DFBPPR18563 ---- Animal proteins ---- Collectin-43
Source.3768: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.3769: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.3770: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.3771: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.3772: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S
Source.3773: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.3774: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1
Source.3775: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.3776: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.3777: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.3778: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.3779: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.3780: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.3781: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.3782: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.3783: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.3784: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.3785: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26
Source.3786: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3787: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.3788: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.3789: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.3790: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha
Source.3791: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.3792: DFBPPR18619 ---- Animal proteins ---- Ras-related protein Rab-7b
Source.3793: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3794: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.3795: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.3796: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.3797: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3798: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.3799: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.3800: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.3801: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3
Source.3802: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.3803: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.3804: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.3805: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.3806: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.3807: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.3808: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.3809: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3810: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor
Source.3811: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase
Source.3812: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.3813: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.3814: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.3815: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.3816: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.3817: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3818: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.3819: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.3820: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.3821: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3822: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.3823: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.3824: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.3825: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.3826: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.3827: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.3828: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3
Source.3829: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.3830: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.3831: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.3832: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.3833: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.3834: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.3835: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.3836: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.3837: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.3838: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.3839: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU
Source.3840: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.3841: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.3842: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.3843: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.3844: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.3845: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.3846: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.3847: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.3848: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.3849: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.3850: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.3851: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.3852: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.3853: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.3854: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.3855: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.3856: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.3857: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3858: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.3859: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.3860: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.3861: DFBPPR18828 ---- Animal proteins ---- Follitropin subunit beta
Source.3862: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1
Source.3863: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.3864: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.3865: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.3866: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.3867: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.3868: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.3869: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.3870: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.3871: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.3872: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.3873: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.3874: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.3875: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.3876: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.3877: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.3878: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.3879: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.3880: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.3881: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.3882: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.3883: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.3884: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.3885: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.3886: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.3887: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.3888: DFBPPR18894 ---- Animal proteins ---- NEDD8-conjugating enzyme Ubc12
Source.3889: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.3890: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.3891: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.3892: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.3893: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.3894: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.3895: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.3896: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.3897: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3898: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.3899: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.3900: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.3901: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.3902: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.3903: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.3904: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.3905: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.3906: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.3907: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.3908: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.3909: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.3910: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.3911: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.3912: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.3913: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.3914: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.3915: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.3916: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.3917: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.3918: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.3919: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.3920: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.3921: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.3922: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.3923: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.3924: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.3925: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.3926: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.3927: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19
Source.3928: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1
Source.3929: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.3930: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.3931: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.3932: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.3933: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3934: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.3935: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.3936: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.3937: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.3938: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.3939: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.3940: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.3941: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.3942: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.3943: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.3944: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.3945: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.3946: DFBPPR19051 ---- Animal proteins ---- Pro-neuropeptide Y
Source.3947: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.3948: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.3949: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.3950: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.3951: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3952: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.3953: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.3954: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.3955: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.3956: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.3957: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.3958: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.3959: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.3960: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A
Source.3961: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.3962: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.3963: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.3964: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.3965: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.3966: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.3967: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.3968: DFBPPR19108 ---- Animal proteins ---- Hepatocyte cell adhesion molecule
Source.3969: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.3970: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.3971: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.3972: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.3973: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.3974: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.3975: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.3976: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.3977: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.3978: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.3979: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.3980: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.3981: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.3982: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11
Source.3983: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.3984: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.3985: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.3986: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.3987: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.3988: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.3989: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.3990: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial
Source.3991: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.3992: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.3993: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.3994: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.3995: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.3996: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.3997: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3998: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.3999: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.4000: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.4001: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.4002: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.4003: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.4004: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.4005: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.4006: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.4007: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.4008: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.4009: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.4010: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.4011: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.4012: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.4013: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.4014: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.4015: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.4016: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.4017: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.4018: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.4019: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.4020: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.4021: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.4022: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.4023: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.4024: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.4025: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4026: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.4027: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.4028: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.4029: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.4030: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.4031: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.4032: DFBPPR19278 ---- Animal proteins ---- R-spondin-3
Source.4033: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.4034: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.4035: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.4036: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3
Source.4037: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.4038: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.4039: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.4040: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.4041: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.4042: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.4043: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.4044: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.4045: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.4046: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.4047: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.4048: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.4049: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.4050: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.4051: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.4052: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.4053: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.4054: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.4055: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.4056: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.4057: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.4058: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.4059: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.4060: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.4061: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.4062: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.4063: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.4064: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.4065: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.4066: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.4067: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.4068: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.4069: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.4070: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.4071: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.4072: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.4073: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.4074: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.4075: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20
Source.4076: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.4077: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog
Source.4078: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.4079: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.4080: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.4081: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.4082: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.4083: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.4084: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.4085: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.4086: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.4087: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.4088: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.4089: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.4090: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.4091: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.4092: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.4093: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.4094: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.4095: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.4096: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.4097: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.4098: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.4099: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.4100: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.4101: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.4102: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.4103: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4104: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.4105: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.4106: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.4107: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.4108: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.4109: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.4110: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.4111: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.4112: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.4113: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.4114: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.4115: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.4116: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N
Source.4117: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.4118: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.4119: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.4120: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.4121: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.4122: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.4123: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.4124: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.4125: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.4126: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.4127: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.4128: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.4129: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase
Source.4130: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.4131: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.4132: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.4133: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.4134: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1
Source.4135: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.4136: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.4137: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.4138: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.4139: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.4140: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.4141: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.4142: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.4143: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.4144: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4145: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.4146: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.4147: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.4148: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.4149: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.4150: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.4151: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1
Source.4152: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.4153: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.4154: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.4155: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.4156: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.4157: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.4158: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.4159: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.4160: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.4161: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.4162: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.4163: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.4164: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog
Source.4165: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.4166: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.4167: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.4168: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.4169: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.4170: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.4171: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.4172: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.4173: DFBPPR19654 ---- Animal proteins ---- Alpha-endosulfine
Source.4174: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.4175: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.4176: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.4177: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E
Source.4178: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.4179: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.4180: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.4181: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1
Source.4182: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.4183: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.4184: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.4185: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.4186: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.4187: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.4188: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.4189: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.4190: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.4191: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.4192: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.4193: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.4194: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.4195: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.4196: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.4197: DFBPPR19745 ---- Animal proteins ---- Collectin-46
Source.4198: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.4199: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.4200: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.4201: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.4202: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.4203: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.4204: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.4205: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.4206: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.4207: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.4208: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.4209: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.4210: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.4211: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.4212: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.4213: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.4214: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.4215: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.4216: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.4217: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.4218: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.4219: DFBPPR19820 ---- Animal proteins ---- Septin-10
Source.4220: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.4221: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.4222: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.4223: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.4224: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.4225: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.4226: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.4227: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.4228: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.4229: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.4230: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.4231: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.4232: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.4233: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.4234: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.4235: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.4236: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.4237: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.4238: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.4239: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.4240: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.4241: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.4242: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1
Source.4243: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.4244: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.4245: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.4246: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.4247: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.4248: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.4249: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.4250: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.4251: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase
Source.4252: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.4253: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.4254: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30
Source.4255: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.4256: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.4257: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.4258: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.4259: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.4260: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.4261: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18
Source.4262: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.4263: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.4264: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.4265: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6
Source.4266: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.4267: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.4268: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial
Source.4269: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.4270: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.4271: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.4272: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.4273: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.4274: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.4275: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4276: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10
Source.4277: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.4278: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.4279: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.4280: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial
Source.4281: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4
Source.4282: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.4283: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.4284: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.4285: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1
Source.4286: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.4287: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.4288: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.4289: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.4290: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.4291: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.4292: DFBPPR19995 ---- Animal proteins ---- 39S ribosomal protein L55, mitochondrial
Source.4293: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16
Source.4294: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.4295: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.4296: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.4297: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.4298: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.4299: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.4300: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4301: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.4302: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.4303: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.4304: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.4305: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.4306: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.4307: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.4308: DFBPPR20036 ---- Animal proteins ---- Urocortin-3
Source.4309: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.4310: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.4311: DFBPPR20045 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 2, mitochondrial
Source.4312: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2
Source.4313: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.4314: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.4315: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.4316: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.4317: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.4318: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial
Source.4319: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.4320: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.4321: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.4322: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.4323: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.4324: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.4325: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.4326: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.4327: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.4328: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.4329: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4330: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.4331: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.4332: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.4333: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.4334: DFBPPR20123 ---- Animal proteins ---- Securin
Source.4335: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.4336: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.4337: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.4338: DFBPPR20145 ---- Animal proteins ---- Adipogenin
Source.4339: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.4340: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.4341: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.4342: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.4343: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2
Source.4344: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.4345: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.4346: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.4347: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.4348: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98
Source.4349: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.4350: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4
Source.4351: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.4352: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4353: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.4354: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1
Source.4355: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.4356: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.4357: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.4358: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.4359: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.4360: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.4361: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.4362: DFBPPR20235 ---- Animal proteins ---- Gamma-crystallin A
Source.4363: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B
Source.4364: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.4365: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.4366: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.4367: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.4368: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.4369: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4370: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.4371: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.4372: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.4373: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.4374: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.4375: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.4376: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.4377: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.4378: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.4379: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.4380: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.4381: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.4382: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.4383: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3
Source.4384: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV
Source.4385: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.4386: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.4387: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4388: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4389: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial
Source.4390: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.4391: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.4392: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.4393: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.4394: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.4395: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.4396: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.4397: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.4398: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.4399: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.4400: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.4401: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1
Source.4402: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.4403: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2
Source.4404: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.4405: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.4406: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.4407: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.4408: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.4409: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.4410: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.4411: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.4412: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.4413: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.4414: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.4415: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.4416: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.4417: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.4418: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.4419: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.4420: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.4421: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.4422: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.4423: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.4424: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.4425: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.4426: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.4427: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.4428: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.4429: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.4430: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP
Source.4431: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.4432: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.4433: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.4434: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.4435: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1
Source.4436: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.4437: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.4438: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.4439: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.4440: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.4441: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.4442: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.4443: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.4444: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.4445: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.4446: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2
Source.4447: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.4448: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.4449: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.4450: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.4451: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.4452: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.4453: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.4454: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.4455: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.4456: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.4457: DFBPPR20537 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 3
Source.4458: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.4459: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.4460: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.4461: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.4462: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.4463: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.4464: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.4465: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.4466: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.4467: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10
Source.4468: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.4469: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.4470: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a
Source.4471: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.4472: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.4473: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.4474: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.4475: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.4476: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74
Source.4477: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.4478: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.4479: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.4480: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.4481: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.4482: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.4483: DFBPPR20613 ---- Animal proteins ---- Gamma-crystallin D
Source.4484: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.4485: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.4486: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.4487: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.4488: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.4489: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.4490: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47
Source.4491: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.4492: DFBPPR20638 ---- Animal proteins ---- DPH3 homolog
Source.4493: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.4494: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.4495: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.4496: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.4497: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.4498: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.4499: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.4500: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.4501: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.4502: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.4503: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.4504: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.4505: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.4506: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.4507: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.4508: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.4509: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.4510: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4511: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.4512: DFBPPR20699 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 31
Source.4513: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.4514: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.4515: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.4516: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.4517: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.4518: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.4519: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.4520: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.4521: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.4522: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.4523: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.4524: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.4525: DFBPPR20730 ---- Animal proteins ---- Gamma-crystallin F
Source.4526: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.4527: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K
Source.4528: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.4529: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.4530: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.4531: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.4532: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.4533: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.4534: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.4535: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.4536: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.4537: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.4538: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.4539: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.4540: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.4541: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.4542: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4543: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.4544: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.4545: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4
Source.4546: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.4547: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.4548: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.4549: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.4550: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.4551: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.4552: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4553: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.4554: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.4555: DFBPPR20828 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.4556: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.4557: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.4558: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.4559: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.4560: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.4561: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.4562: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.4563: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.4564: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.4565: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.4566: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.4567: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.4568: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.4569: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5
Source.4570: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.4571: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.4572: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.4573: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.4574: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.4575: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.4576: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.4577: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.4578: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3
Source.4579: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.4580: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.4581: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.4582: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.4583: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.4584: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.4585: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.4586: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.4587: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.4588: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.4589: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.4590: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.4591: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.4592: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.4593: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.4594: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4
Source.4595: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.4596: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.4597: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B
Source.4598: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9
Source.4599: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.4600: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.4601: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.4602: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog
Source.4603: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.4604: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.4605: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.4606: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.4607: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.4608: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4609: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.4610: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.4611: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27
Source.4612: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial
Source.4613: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.4614: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.4615: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.4616: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.4617: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.4618: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.4619: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.4620: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2
Source.4621: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.4622: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.4623: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.4624: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.4625: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.4626: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.4627: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.4628: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.4629: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1
Source.4630: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.4631: DFBPPR21040 ---- Animal proteins ---- Neuritin
Source.4632: DFBPPR21041 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.4633: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.4634: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.4635: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.4636: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.4637: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.4638: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B
Source.4639: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4640: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.4641: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.4642: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.4643: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial
Source.4644: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.4645: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.4646: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.4647: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.4648: DFBPPR21090 ---- Animal proteins ---- Developmental pluripotency-associated protein 3
Source.4649: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.4650: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.4651: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.4652: DFBPPR21095 ---- Animal proteins ---- 28S ribosomal protein S33, mitochondrial
Source.4653: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.4654: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.4655: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.4656: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.4657: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.4658: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.4659: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein
Source.4660: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.4661: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.4662: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.4663: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1
Source.4664: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.4665: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1
Source.4666: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4
Source.4667: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.4668: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.4669: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.4670: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.4671: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.4672: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.4673: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.4674: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.4675: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.4676: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4
Source.4677: DFBPPR21197 ---- Animal proteins ---- Spindle and kinetochore-associated protein 2
Source.4678: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.4679: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.4680: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.4681: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1
Source.4682: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.4683: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.4684: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.4685: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.4686: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.4687: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.4688: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.4689: DFBPPR21242 ---- Animal proteins ---- Tachykinin-3
Source.4690: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.4691: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.4692: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.4693: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.4694: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.4695: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.4696: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.4697: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.4698: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.4699: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.4700: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.4701: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.4702: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.4703: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.4704: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.4705: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.4706: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.4707: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.4708: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.4709: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.4710: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.4711: DFBPPR21323 ---- Animal proteins ---- Trefoil factor 3
Source.4712: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.4713: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.4714: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.4715: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.4716: DFBPPR21343 ---- Animal proteins ---- DNA polymerase delta subunit 4
Source.4717: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.4718: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.4719: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.4720: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.4721: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.4722: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4
Source.4723: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.4724: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.4725: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.4726: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.4727: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.4728: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.4729: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.4730: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.4731: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu
Source.4732: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.4733: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.4734: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.4735: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.4736: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.4737: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.4738: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4739: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.4740: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.4741: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.4742: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37
Source.4743: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.4744: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.4745: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.4746: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.4747: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.4748: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.4749: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.4750: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.4751: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.4752: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.4753: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5
Source.4754: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.4755: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.4756: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.4757: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.4758: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.4759: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.4760: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.4761: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.4762: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.4763: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.4764: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.4765: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.4766: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.4767: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.4768: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.4769: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.4770: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.4771: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.4772: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.4773: DFBPPR21486 ---- Animal proteins ---- Caspase recruitment domain-containing protein 19
Source.4774: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.4775: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.4776: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.4777: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.4778: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.4779: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.4780: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2
Source.4781: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.4782: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.4783: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.4784: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.4785: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.4786: DFBPPR21546 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 29
Source.4787: DFBPPR21548 ---- Animal proteins ---- Cornifelin
Source.4788: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.4789: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma
Source.4790: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.4791: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.4792: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1
Source.4793: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.4794: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.4795: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.4796: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.4797: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.4798: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein
Source.4799: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.4800: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.4801: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.4802: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.4803: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.4804: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.4805: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.4806: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.4807: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.4808: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.4809: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.4810: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.4811: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.4812: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.4813: DFBPPR21631 ---- Animal proteins ---- 39S ribosomal protein L49, mitochondrial
Source.4814: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.4815: DFBPPR21640 ---- Animal proteins ---- 60S ribosomal protein L35
Source.4816: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein
Source.4817: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.4818: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.4819: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.4820: DFBPPR21654 ---- Animal proteins ---- DET1- and DDB1-associated protein 1
Source.4821: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.4822: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.4823: DFBPPR21667 ---- Animal proteins ---- Four and a half LIM domains protein 5
Source.4824: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.4825: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.4826: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.4827: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.4828: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.4829: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.4830: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.4831: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.4832: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.4833: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.4834: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.4835: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.4836: DFBPPR21740 ---- Animal proteins ---- 60S ribosomal protein L36
Source.4837: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.4838: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.4839: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190
Source.4840: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.4841: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.4842: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.4843: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.4844: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.4845: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.4846: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.4847: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.4848: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.4849: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.4850: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.4851: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.4852: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.4853: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.4854: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4855: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.4856: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24
Source.4857: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.4858: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.4859: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.4860: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.4861: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD
Source.4862: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.4863: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.4864: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.4865: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.4866: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2
Source.4867: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.4868: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS
Source.4869: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.4870: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.4871: DFBPPR21878 ---- Animal proteins ---- Statherin
Source.4872: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.4873: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.4874: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.4875: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial
Source.4876: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.4877: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.4878: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.4879: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.4880: DFBPPR21920 ---- Animal proteins ---- Protein DPCD
Source.4881: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.4882: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4883: DFBPPR21930 ---- Animal proteins ---- Protein Churchill
Source.4884: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8
Source.4885: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.4886: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.4887: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.4888: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.4889: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.4890: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.4891: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.4892: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.4893: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.4894: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.4895: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.4896: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.4897: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.4898: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.4899: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6
Source.4900: DFBPPR21978 ---- Animal proteins ---- Cx9C motif-containing protein 4
Source.4901: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.4902: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4903: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.4904: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.4905: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.4906: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1
Source.4907: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.4908: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.4909: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a
Source.4910: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.4911: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.4912: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.4913: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.4914: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.4915: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.4916: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.4917: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.4918: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.4919: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.4920: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.4921: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.4922: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.4923: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.4924: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.4925: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.4926: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog
Source.4927: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ
Source.4928: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.4929: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.4930: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.4931: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like
Source.4932: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.4933: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.4934: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.4935: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.4936: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.4937: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.4938: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.4939: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.4940: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.4941: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.4942: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.4943: DFBPPR22099 ---- Animal proteins ---- Beta-centractin
Source.4944: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.4945: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.4946: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.4947: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.4948: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.4949: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.4950: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.4951: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.4952: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.4953: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.4954: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.4955: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.4956: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.4957: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.4958: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.4959: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.4960: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.4961: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.4962: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.4963: DFBPPR22173 ---- Animal proteins ---- Electron transfer flavoprotein regulatory factor 1
Source.4964: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.4965: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.4966: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.4967: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.4968: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.4969: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.4970: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein
Source.4971: DFBPPR22200 ---- Animal proteins ---- Profilin-4
Source.4972: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.4973: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.4974: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.4975: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.4976: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog
Source.4977: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.4978: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.4979: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.4980: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.4981: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.4982: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.4983: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.4984: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.4985: DFBPPR22246 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor
Source.4986: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.4987: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.4988: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1
Source.4989: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.4990: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial
Source.4991: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.4992: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.4993: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.4994: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.4995: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.4996: DFBPPR22297 ---- Animal proteins ---- Histatherin
Source.4997: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.4998: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.4999: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2
Source.5000: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.5001: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.5002: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.5003: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.5004: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.5005: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.5006: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.5007: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.5008: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.5009: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.5010: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.5011: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.5012: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.5013: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.5014: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.5015: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5
Source.5016: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A
Source.5017: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.5018: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.5019: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.5020: DFBPPR22399 ---- Animal proteins ---- Transgelin-3
Source.5021: DFBPPR22402 ---- Animal proteins ---- Alternative prion protein
Source.5022: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog
Source.5023: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.5024: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.5025: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.5026: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.5027: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1
Source.5028: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.5029: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2
Source.5030: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.5031: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.5032: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein
Source.5033: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13
Source.5034: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.5035: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.5036: DFBPPR22479 ---- Animal proteins ---- Transcription elongation factor A protein-like 1
Source.5037: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.5038: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.5039: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.5040: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1
Source.5041: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.5042: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.5043: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.5044: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141
Source.5045: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.5046: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.5047: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C
Source.5048: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.5049: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.5050: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.5051: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.5052: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.5053: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1
Source.5054: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.5055: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.5056: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.5057: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.5058: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog
Source.5059: DFBPPR22577 ---- Animal proteins ---- Uncharacterized protein C12orf31 homolog
Source.5060: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1
Source.5061: DFBPPR22582 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein
Source.5062: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2
Source.5063: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.5064: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.5065: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.5066: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71
Source.5067: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.5068: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.5069: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.5070: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1
Source.5071: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30
Source.5072: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.5073: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.5074: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.5075: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.5076: DFBPPR22650 ---- Animal proteins ---- Protein FAM183A
Source.5077: DFBPPR22653 ---- Animal proteins ---- Coiled-coil domain-containing protein 152
Source.5078: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.5079: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.5080: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.5081: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.5082: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.5083: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.5084: DFBPPR22682 ---- Animal proteins ---- Protein FAM216A
Source.5085: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.5086: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.5087: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.5088: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.5089: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein
Source.5090: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.5091: DFBPPR22710 ---- Animal proteins ---- RIIa domain-containing protein 1
Source.5092: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.5093: DFBPPR22731 ---- Animal proteins ---- Uncharacterized protein C12orf54 homolog
Source.5094: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog
Source.5095: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog
Source.5096: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.5097: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.5098: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.5099: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.5100: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.5101: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.5102: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.5103: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5104: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.5105: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.5106: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.5107: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.5108: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.5109: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.5110: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.5111: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.5112: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.5113: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.5114: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.5115: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.5116: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.5117: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.5118: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.5119: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.5120: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.5121: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.5122: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.5123: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5124: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.5125: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.5126: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.5127: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.5128: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.5129: DFBPPR8568 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.5130: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.5131: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5132: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.5133: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.5134: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5135: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.5136: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.5137: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.5138: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.5139: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.5140: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.5141: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.5142: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.5143: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.5144: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.5145: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.5146: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.5147: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.5148: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.5149: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.5150: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.5151: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.5152: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.5153: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.5154: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.5155: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.5156: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5157: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.5158: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.5159: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.5160: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.5161: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.5162: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.5163: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.5164: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.5165: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.5166: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.5167: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.5168: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.5169: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.5170: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.5171: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.5172: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.5173: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.5174: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.5175: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.5176: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.5177: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.5178: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.5179: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.5180: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.5181: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.5182: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.5183: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.5184: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.5185: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.5186: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.5187: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.5188: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.5189: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5190: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.5191: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.5192: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.5193: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.5194: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.5195: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.5196: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.5197: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.5198: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.5199: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.5200: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.5201: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.5202: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.5203: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.5204: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.5205: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.5206: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.5207: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.5208: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.5209: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.5210: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.5211: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.5212: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.5213: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.5214: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.5215: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5216: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.5217: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.5218: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.5219: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.5220: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.5221: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5222: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.5223: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.5224: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.5225: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.5226: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.5227: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.5228: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.5229: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.5230: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.5231: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.5232: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.5233: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.5234: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.5235: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.5236: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.5237: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II
Source.5238: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.5239: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.5240: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.5241: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.5242: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.5243: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.5244: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.5245: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.5246: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2
Source.5247: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.5248: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.5249: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.5250: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.5251: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.5252: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.5253: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.5254: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.5255: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.5256: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.5257: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.5258: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.5259: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.5260: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.5261: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.5262: DFBPPR8870 ---- Animal proteins ---- Ribonuclease K3
Source.5263: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.5264: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.5265: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.5266: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.5267: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.5268: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.5269: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.5270: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.5271: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.5272: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.5273: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.5274: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.5275: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.5276: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.5277: DFBPPR8926 ---- Animal proteins ---- Osteocalcin
Source.5278: DFBPPR8927 ---- Animal proteins ---- Pro-neuropeptide Y
Source.5279: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.5280: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta
Source.5281: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5282: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.5283: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.5284: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.5285: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.5286: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.5287: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.5288: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.5289: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.5290: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.5291: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.5292: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.5293: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.5294: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta
Source.5295: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.5296: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.5297: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.5298: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.5299: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.5300: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.5301: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.5302: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.5303: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.5304: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.5305: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.5306: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.5307: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.5308: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.5309: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.5310: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.5311: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.5312: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain
Source.5313: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.5314: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5315: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.5316: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.5317: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.5318: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.5319: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.5320: DFBPPR9074 ---- Animal proteins ---- Trefoil factor 2
Source.5321: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5322: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.5323: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.5324: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.5325: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.5326: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.5327: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.5328: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.5329: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.5330: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.5331: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.5332: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.5333: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.5334: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.5335: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.5336: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5337: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.5338: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.5339: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.5340: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.5341: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.5342: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.5343: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5344: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.5345: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.5346: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.5347: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.5348: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.5349: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.5350: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.5351: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.5352: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.5353: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.5354: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.5355: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase
Source.5356: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.5357: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.5358: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.5359: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.5360: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.5361: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.5362: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.5363: DFBPPR9189 ---- Animal proteins ---- Follitropin subunit beta
Source.5364: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.5365: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2
Source.5366: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.5367: DFBPPR9198 ---- Animal proteins ---- Fibroblast growth factor 7
Source.5368: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.5369: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.5370: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D
Source.5371: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.5372: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.5373: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.5374: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.5375: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.5376: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.5377: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.5378: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.5379: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.5380: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.5381: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.5382: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.5383: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.5384: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.5385: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.5386: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.5387: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.5388: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.5389: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.5390: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.5391: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.5392: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.5393: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.5394: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.5395: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.5396: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.5397: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.5398: DFBPPR9266 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.5399: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.5400: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.5401: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.5402: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.5403: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.5404: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.5405: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.5406: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.5407: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.5408: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.5409: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.5410: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27
Source.5411: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.5412: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.5413: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10
Source.5414: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2
Source.5415: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.5416: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.5417: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.5418: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.5419: DFBPPR9304 ---- Animal proteins ---- Peroxiredoxin-2
Source.5420: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.5421: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.5422: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.5423: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.5424: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.5425: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.5426: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.5427: DFBPPR9318 ---- Animal proteins ---- Alpha-endosulfine
Source.5428: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.5429: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.5430: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.5431: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.5432: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.5433: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.5434: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.5435: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.5436: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.5437: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.5438: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.5439: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.5440: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.5441: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.5442: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.5443: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.5444: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.5445: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.5446: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5447: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.5448: DFBPPR9367 ---- Animal proteins ---- Peptide YY
Source.5449: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.5450: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.5451: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.5452: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.5453: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.5454: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.5455: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.5456: DFBPPR9404 ---- Animal proteins ---- Tryptase
Source.5457: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.5458: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.5459: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.5460: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.5461: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.5462: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.5463: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.5464: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.5465: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.5466: DFBPPR9428 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.5467: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.5468: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.5469: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.5470: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.5471: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.5472: DFBPPR9445 ---- Animal proteins ---- Securin
Source.5473: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.5474: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.5475: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.5476: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.5477: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.5478: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.5479: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.5480: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.5481: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.5482: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.5483: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.5484: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.5485: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.5486: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.5487: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.5488: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.5489: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.5490: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.5491: DFBPPR9523 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.5492: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.5493: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.5494: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.5495: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE
Source.5496: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.5497: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.5498: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.5499: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.5500: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.5501: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.5502: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.5503: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.5504: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.5505: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.5506: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.5507: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.5508: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.5509: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.5510: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.5511: DFBPPR9588 ---- Animal proteins ---- ATP synthase protein 8
Source.5512: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.5513: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.5514: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor
Source.5515: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.5516: DFBPPR9602 ---- Animal proteins ---- Gastrin-releasing peptide
Source.5517: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.5518: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.5519: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor
Source.5520: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.5521: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.5522: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.5523: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.5524: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.5525: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.5526: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.5527: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.5528: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.5529: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.5530: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.5531: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.5532: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.5533: DFBPPR9662 ---- Animal proteins ---- 60S ribosomal protein L35
Source.5534: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.5535: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.5536: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.5537: DFBPPR9669 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.5538: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.5539: DFBPPR9673 ---- Animal proteins ---- Neurokinin-B
Source.5540: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.5541: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5542: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.5543: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.5544: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1
Source.5545: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.5546: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.5547: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.5548: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta
Source.5549: DFBPPR9711 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.5550: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.5551: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.5552: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.5553: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.5554: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.5555: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.5556: DFBPPR9730 ---- Animal proteins ---- Urotensin-2
Source.5557: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.5558: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.5559: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.5560: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis
Source.5561: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.5562: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.5563: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.5564: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region
Source.5565: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.5566: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide
Source.5567: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.5568: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.5569: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.5570: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.5571: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.5572: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.5573: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.5574: DFBPPR9786 ---- Animal proteins ---- Adipogenin
Source.5575: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.5576: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.5577: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.5578: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.5579: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.5580: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.5581: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.5582: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.5583: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.5584: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.5585: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1
Source.5586: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.5587: DFBPPR9843 ---- Animal proteins ---- P protein
Source.5588: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.5589: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.5590: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.5591: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.5592: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.5593: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3
Source.5594: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.5595: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.5596: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.5597: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.5598: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3
Source.5599: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.5600: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin
Source.5601: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.5602: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.5603: DFBPPR9947 ---- Animal proteins ---- Hypothalamic tetradecapeptide
Source.5604: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.5605: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.5606: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.5607: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.5608: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.5609: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.5610: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.5611: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.5612: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.5613: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.5614: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.5615: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.5616: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.5617: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.5618: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.5619: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.5620: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.5621: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.5622: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.5623: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.5624: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.5625: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.5626: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.5627: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.5628: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.5629: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.5630: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.5631: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.5632: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.5633: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.5634: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.5635: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.5636: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.5637: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.5638: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.5639: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.5640: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.5641: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.5642: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.5643: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.5644: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.5645: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.5646: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.5647: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.5648: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a
Source.5649: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.5650: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.5651: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.5652: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.5653: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6
Source.5654: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.5655: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.5656: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.5657: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.5658: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.5659: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.5660: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.5661: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.5662: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.5663: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.5664: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5665: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor
Source.5666: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.5667: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.5668: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.5669: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.5670: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.5671: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.5672: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.5673: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.5674: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.5675: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.5676: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.5677: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.5678: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.5679: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.5680: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.5681: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.5682: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.5683: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.5684: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.5685: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5686: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.5687: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.5688: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.5689: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.5690: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.5691: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.5692: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.5693: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.5694: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.5695: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.5696: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.5697: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.5698: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.5699: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.5700: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.5701: DFBPPR10172 ---- Animal proteins ---- Basic helix-loop-helix transcription factor scleraxis
Source.5702: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.5703: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.5704: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.5705: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.5706: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.5707: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.5708: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.5709: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.5710: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.5711: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9
Source.5712: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.5713: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.5714: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.5715: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.5716: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.5717: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.5718: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.5719: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.5720: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.5721: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.5722: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.5723: DFBPPR10217 ---- Animal proteins ---- Follistatin
Source.5724: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.5725: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.5726: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.5727: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.5728: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.5729: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.5730: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.5731: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.5732: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.5733: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.5734: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.5735: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8
Source.5736: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.5737: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.5738: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.5739: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.5740: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.5741: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.5742: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.5743: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.5744: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.5745: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.5746: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.5747: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.5748: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.5749: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.5750: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.5751: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.5752: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.5753: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.5754: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.5755: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.5756: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.5757: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.5758: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.5759: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.5760: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.5761: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.5762: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.5763: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.5764: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5765: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.5766: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.5767: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.5768: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.5769: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.5770: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.5771: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.5772: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.5773: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.5774: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.5775: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.5776: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.5777: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.5778: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.5779: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.5780: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.5781: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.5782: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.5783: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.5784: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.5785: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.5786: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.5787: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5788: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.5789: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC
Source.5790: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.5791: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.5792: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.5793: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.5794: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta
Source.5795: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.5796: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.5797: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.5798: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.5799: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.5800: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.5801: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.5802: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.5803: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.5804: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.5805: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.5806: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.5807: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.5808: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.5809: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.5810: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.5811: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.5812: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.5813: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.5814: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.5815: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.5816: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.5817: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.5818: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.5819: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.5820: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.5821: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.5822: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.5823: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.5824: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.5825: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.5826: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.5827: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.5828: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.5829: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.5830: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.5831: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.5832: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.5833: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.5834: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.5835: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.5836: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.5837: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.5838: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.5839: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.5840: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.5841: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.5842: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.5843: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.5844: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.5845: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.5846: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.5847: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.5848: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.5849: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.5850: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.5851: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.5852: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.5853: DFBPPR10477 ---- Animal proteins ---- Aprataxin
Source.5854: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.5855: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.5856: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.5857: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.5858: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.5859: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.5860: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.5861: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.5862: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1
Source.5863: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.5864: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.5865: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.5866: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.5867: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.5868: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.5869: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.5870: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.5871: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.5872: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.5873: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.5874: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2
Source.5875: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.5876: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.5877: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.5878: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.5879: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5880: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.5881: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.5882: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.5883: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.5884: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.5885: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.5886: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.5887: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.5888: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.5889: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.5890: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.5891: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5892: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.5893: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.5894: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.5895: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.5896: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.5897: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.5898: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.5899: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.5900: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.5901: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5902: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.5903: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.5904: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.5905: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.5906: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.5907: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.5908: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.5909: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.5910: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.5911: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.5912: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.5913: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.5914: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.5915: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.5916: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.5917: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.5918: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.5919: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.5920: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.5921: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.5922: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.5923: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.5924: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.5925: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.5926: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.5927: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.5928: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.5929: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.5930: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.5931: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5932: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.5933: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.5934: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.5935: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.5936: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.5937: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.5938: DFBPPR10634 ---- Animal proteins ---- Procathepsin L
Source.5939: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.5940: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.5941: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.5942: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.5943: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.5944: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.5945: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.5946: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.5947: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.5948: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.5949: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.5950: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.5951: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.5952: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.5953: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.5954: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.5955: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.5956: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.5957: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi
Source.5958: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.5959: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.5960: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.5961: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.5962: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.5963: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.5964: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.5965: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase
Source.5966: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.5967: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5968: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.5969: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.5970: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.5971: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.5972: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.5973: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.5974: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.5975: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.5976: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.5977: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.5978: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.5979: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.5980: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.5981: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.5982: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.5983: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.5984: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.5985: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.5986: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.5987: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.5988: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.5989: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.5990: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10
Source.5991: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.5992: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.5993: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.5994: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.5995: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.5996: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.5997: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.5998: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.5999: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.6000: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.6001: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.6002: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.6003: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6004: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.6005: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.6006: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.6007: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.6008: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.6009: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.6010: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.6011: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.6012: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.6013: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.6014: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.6015: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.6016: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.6017: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.6018: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.6019: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.6020: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.6021: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.6022: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.6023: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.6024: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.6025: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1
Source.6026: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.6027: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.6028: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.6029: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.6030: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.6031: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.6032: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.6033: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6034: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.6035: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.6036: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.6037: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.6038: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.6039: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.6040: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.6041: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.6042: DFBPPR10873 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-2
Source.6043: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.6044: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.6045: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.6046: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.6047: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.6048: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.6049: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.6050: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.6051: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.6052: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.6053: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.6054: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.6055: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.6056: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.6057: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.6058: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.6059: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2
Source.6060: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.6061: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.6062: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.6063: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.6064: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.6065: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6066: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.6067: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.6068: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.6069: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.6070: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.6071: DFBPPR10934 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.6072: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.6073: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.6074: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.6075: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.6076: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.6077: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.6078: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.6079: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.6080: DFBPPR10954 ---- Animal proteins ---- Protein max
Source.6081: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2
Source.6082: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.6083: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.6084: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.6085: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.6086: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.6087: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.6088: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.6089: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.6090: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.6091: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.6092: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.6093: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.6094: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.6095: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.6096: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.6097: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.6098: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.6099: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.6100: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.6101: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.6102: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.6103: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.6104: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.6105: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.6106: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.6107: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.6108: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.6109: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.6110: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.6111: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.6112: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.6113: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.6114: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.6115: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.6116: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.6117: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.6118: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.6119: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.6120: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.6121: DFBPPR11048 ---- Animal proteins ---- Calcitonin
Source.6122: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.6123: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.6124: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.6125: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.6126: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.6127: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.6128: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.6129: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.6130: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.6131: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.6132: DFBPPR11070 ---- Animal proteins ---- Protein sprouty homolog 1
Source.6133: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.6134: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.6135: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.6136: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.6137: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.6138: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6139: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.6140: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.6141: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.6142: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.6143: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.6144: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.6145: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.6146: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.6147: DFBPPR11091 ---- Animal proteins ---- Pro-neuropeptide Y
Source.6148: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.6149: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.6150: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.6151: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.6152: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.6153: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.6154: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.6155: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6156: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.6157: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.6158: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.6159: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.6160: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.6161: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.6162: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.6163: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.6164: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.6165: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.6166: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.6167: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.6168: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.6169: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.6170: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.6171: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.6172: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.6173: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.6174: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.6175: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.6176: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.6177: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.6178: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.6179: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.6180: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.6181: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6182: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b
Source.6183: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.6184: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.6185: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.6186: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.6187: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.6188: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.6189: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.6190: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.6191: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.6192: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.6193: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.6194: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.6195: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.6196: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.6197: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.6198: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.6199: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.6200: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.6201: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.6202: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.6203: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.6204: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.6205: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.6206: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.6207: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.6208: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.6209: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.6210: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6211: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.6212: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.6213: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.6214: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.6215: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.6216: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.6217: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.6218: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.6219: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.6220: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.6221: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.6222: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.6223: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.6224: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.6225: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.6226: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.6227: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.6228: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.6229: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.6230: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.6231: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.6232: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein
Source.6233: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.6234: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.6235: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.6236: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.6237: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.6238: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.6239: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.6240: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.6241: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.6242: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.6243: DFBPPR11301 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19
Source.6244: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.6245: DFBPPR11306 ---- Animal proteins ---- Transcription factor 15
Source.6246: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.6247: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.6248: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.6249: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.6250: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.6251: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.6252: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.6253: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.6254: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.6255: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.6256: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.6257: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.6258: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.6259: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.6260: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.6261: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.6262: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.6263: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.6264: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.6265: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.6266: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.6267: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.6268: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.6269: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR
Source.6270: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.6271: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.6272: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.6273: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.6274: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.6275: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.6276: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.6277: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.6278: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.6279: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.6280: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.6281: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.6282: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.6283: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6284: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.6285: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.6286: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.6287: DFBPPR11397 ---- Animal proteins ---- Frizzled-3
Source.6288: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.6289: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.6290: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.6291: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.6292: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.6293: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.6294: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.6295: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.6296: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.6297: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.6298: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.6299: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.6300: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.6301: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.6302: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.6303: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6
Source.6304: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.6305: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6306: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.6307: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.6308: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.6309: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.6310: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.6311: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.6312: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.6313: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.6314: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.6315: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.6316: DFBPPR11478 ---- Animal proteins ---- Gastrin-releasing peptide
Source.6317: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.6318: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.6319: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.6320: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.6321: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.6322: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.6323: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein
Source.6324: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.6325: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.6326: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.6327: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.6328: DFBPPR11510 ---- Animal proteins ---- Gonadoliberin-2
Source.6329: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.6330: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.6331: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.6332: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide
Source.6333: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.6334: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.6335: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.6336: DFBPPR11529 ---- Animal proteins ---- Alpha-endosulfine
Source.6337: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.6338: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.6339: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.6340: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.6341: DFBPPR11537 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.6342: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.6343: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.6344: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.6345: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.6346: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.6347: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.6348: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.6349: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.6350: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.6351: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.6352: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.6353: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.6354: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.6355: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.6356: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.6357: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.6358: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.6359: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.6360: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.6361: DFBPPR11597 ---- Animal proteins ---- Trypsin inhibitor ClTI-1
Source.6362: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.6363: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.6364: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.6365: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.6366: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.6367: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.6368: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.6369: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.6370: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6371: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3
Source.6372: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.6373: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.6374: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6375: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.6376: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.6377: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.6378: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.6379: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.6380: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.6381: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.6382: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.6383: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.6384: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.6385: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.6386: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.6387: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.6388: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.6389: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.6390: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6391: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.6392: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.6393: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.6394: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.6395: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein
Source.6396: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.6397: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.6398: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.6399: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.6400: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.6401: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.6402: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain
Source.6403: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4
Source.6404: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.6405: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.6406: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.6407: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.6408: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.6409: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.6410: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.6411: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1
Source.6412: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.6413: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.6414: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8
Source.6415: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.6416: DFBPPR11725 ---- Animal proteins ---- D-dopachrome decarboxylase
Source.6417: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.6418: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.6419: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.6420: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.6421: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.6422: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.6423: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.6424: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.6425: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.6426: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.6427: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.6428: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.6429: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.6430: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.6431: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.6432: DFBPPR11765 ---- Animal proteins ---- Peptide YY-like
Source.6433: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.6434: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.6435: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.6436: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.6437: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.6438: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.6439: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.6440: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.6441: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.6442: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.6443: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.6444: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.6445: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.6446: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.6447: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.6448: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17
Source.6449: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.6450: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.6451: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.6452: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27
Source.6453: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.6454: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.6455: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.6456: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.6457: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.6458: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.6459: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.6460: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.6461: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.6462: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.6463: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.6464: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1
Source.6465: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.6466: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.6467: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.6468: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.6469: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.6470: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.6471: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.6472: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.6473: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.6474: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.6475: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.6476: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.6477: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.6478: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.6479: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.6480: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.6481: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant
Source.6482: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.6483: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.6484: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.6485: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.6486: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.6487: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.6488: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.6489: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.6490: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.6491: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.6492: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.6493: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.6494: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.6495: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.6496: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.6497: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.6498: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.6499: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.6500: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.6501: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.6502: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.6503: DFBPPR11945 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.6504: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.6505: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.6506: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.6507: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.6508: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.6509: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.6510: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.6511: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.6512: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.6513: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.6514: DFBPPR11964 ---- Animal proteins ---- Protein LLP homolog
Source.6515: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.6516: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.6517: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.6518: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.6519: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.6520: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.6521: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.6522: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.6523: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.6524: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.6525: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.6526: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.6527: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.6528: DFBPPR11996 ---- Animal proteins ---- Homeobox protein Hox-A6
Source.6529: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.6530: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.6531: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.6532: DFBPPR12011 ---- Animal proteins ---- Protein Churchill
Source.6533: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.6534: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein
Source.6535: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.6536: DFBPPR12023 ---- Animal proteins ---- 60S ribosomal protein L35
Source.6537: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.6538: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.6539: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.6540: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.6541: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.6542: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.6543: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.6544: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.6545: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.6546: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.6547: DFBPPR12049 ---- Animal proteins ---- 60S ribosomal protein L36
Source.6548: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.6549: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.6550: DFBPPR12057 ---- Animal proteins ---- Fatty acid-binding protein, smooth muscle
Source.6551: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.6552: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.6553: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.6554: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.6555: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.6556: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4
Source.6557: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.6558: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.6559: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.6560: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.6561: DFBPPR12086 ---- Animal proteins ---- DET1- and DDB1-associated protein 1
Source.6562: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.6563: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.6564: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.6565: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.6566: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.6567: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.6568: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.6569: DFBPPR12106 ---- Animal proteins ---- Ig lambda chain C region
Source.6570: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.6571: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.6572: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.6573: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.6574: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.6575: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.6576: DFBPPR12127 ---- Animal proteins ---- SRY-related protein CH3
Source.6577: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.6578: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.6579: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.6580: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.6581: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.6582: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.6583: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.6584: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.6585: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.6586: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.6587: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.6588: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.6589: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.6590: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.6591: DFBPPR12178 ---- Animal proteins ---- SRY-related protein CH32
Source.6592: DFBPPR12179 ---- Animal proteins ---- SRY-related protein CH31
Source.6593: DFBPPR12182 ---- Animal proteins ---- SRY-related protein CH1
Source.6594: DFBPPR12183 ---- Animal proteins ---- SRY-related protein CH4
Source.6595: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.6596: DFBPPR12185 ---- Animal proteins ---- SRY-related protein CH2
Source.6597: DFBPPR12186 ---- Animal proteins ---- SRY-related protein CH7
Source.6598: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.6599: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.6600: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.6601: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.6602: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.6603: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.6604: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.6605: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.6606: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.6607: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50
Source.6608: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.6609: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.6610: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.6611: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.6612: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.6613: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.6614: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog
Source.6615: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.6616: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.6617: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.6618: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.6619: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.6620: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.6621: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor
Source.6622: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.6623: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.6624: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.6625: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.6626: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.6627: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.6628: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.6629: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.6630: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.6631: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.6632: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.6633: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.6634: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.6635: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.6636: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.6637: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.6638: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.6639: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.6640: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.6641: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.6642: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.6643: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.6644: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.6645: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.6646: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.6647: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.6648: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.6649: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.6650: DFBPPR12308 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.6651: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.6652: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.6653: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.6654: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.6655: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.6656: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.6657: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.6658: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.6659: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.6660: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.6661: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.6662: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.6663: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.6664: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.6665: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.6666: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.6667: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.6668: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.6669: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.6670: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.6671: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.6672: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.6673: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.6674: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.6675: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.6676: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.6677: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1
Source.6678: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.6679: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.6680: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.6681: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.6682: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.6683: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.6684: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.6685: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.6686: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.6687: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.6688: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.6689: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.6690: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6691: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.6692: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.6693: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.6694: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.6695: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.6696: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.6697: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.6698: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.6699: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.6700: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.6701: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.6702: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.6703: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.6704: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.6705: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.6706: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.6707: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6708: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.6709: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.6710: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.6711: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2
Source.6712: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.6713: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.6714: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.6715: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.6716: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.6717: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.6718: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.6719: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.6720: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.6721: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.6722: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.6723: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.6724: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.6725: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.6726: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.6727: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.6728: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.6729: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6730: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.6731: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.6732: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.6733: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.6734: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.6735: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.6736: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.6737: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.6738: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.6739: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.6740: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.6741: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.6742: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6743: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.6744: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.6745: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.6746: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.6747: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.6748: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.6749: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6750: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.6751: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.6752: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.6753: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.6754: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.6755: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.6756: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.6757: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.6758: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.6759: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.6760: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.6761: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII
Source.6762: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.6763: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.6764: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.6765: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.6766: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.6767: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.6768: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.6769: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.6770: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.6771: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.6772: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.6773: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.6774: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.6775: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.6776: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.6777: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.6778: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6779: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.6780: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.6781: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.6782: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.6783: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.6784: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.6785: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.6786: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.6787: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.6788: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.6789: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.6790: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.6791: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.6792: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.6793: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.6794: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.6795: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.6796: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.6797: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.6798: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.6799: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.6800: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.6801: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.6802: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.6803: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.6804: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.6805: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.6806: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.6807: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.6808: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.6809: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.6810: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.6811: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.6812: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.6813: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6814: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.6815: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.6816: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6817: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.6818: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.6819: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.6820: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.6821: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.6822: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.6823: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin
Source.6824: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.6825: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.6826: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.6827: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.6828: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.6829: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.6830: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.6831: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.6832: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.6833: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.6834: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.6835: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.6836: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.6837: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.6838: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.6839: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.6840: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.6841: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.6842: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.6843: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.6844: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.6845: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.6846: DFBPPR12767 ---- Animal proteins ---- Follitropin subunit beta
Source.6847: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.6848: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.6849: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.6850: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.6851: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.6852: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.6853: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.6854: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.6855: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.6856: DFBPPR12790 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 4
Source.6857: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.6858: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.6859: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.6860: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.6861: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.6862: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.6863: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.6864: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2
Source.6865: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.6866: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.6867: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.6868: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma
Source.6869: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.6870: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.6871: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.6872: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.6873: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.6874: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain
Source.6875: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.6876: DFBPPR12836 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.6877: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.6878: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.6879: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.6880: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.6881: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.6882: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.6883: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.6884: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.6885: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6886: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.6887: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.6888: DFBPPR12878 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.6889: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.6890: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.6891: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.6892: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.6893: DFBPPR12890 ---- Animal proteins ---- ATP synthase protein 8
Source.6894: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.6895: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.6896: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.6897: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6898: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.6899: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.6900: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.6901: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.6902: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.6903: DFBPPR12915 ---- Animal proteins ---- Small proline-rich protein 3
Source.6904: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.6905: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.6906: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.6907: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.6908: DFBPPR12933 ---- Animal proteins ---- Peptide YY
Source.6909: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.6910: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6911: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6912: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.6913: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.6914: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.6915: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6916: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.6917: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.6918: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.6919: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.6920: DFBPPR12971 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase
Source.6921: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.6922: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.6923: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.6924: DFBPPR12984 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.6925: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.6926: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.6927: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.6928: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.6929: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.6930: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.6931: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.6932: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6933: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.6934: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6935: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.6936: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.6937: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.6938: DFBPPR13018 ---- Animal proteins ---- Neuropeptide Y
Source.6939: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.6940: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.6941: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.6942: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A
Source.6943: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S
Source.6944: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.6945: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.6946: DFBPPR13040 ---- Animal proteins ---- Pancreatic hormone
Source.6947: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.6948: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.6949: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.6950: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.6951: DFBPPR13067 ---- Animal proteins ---- Beta-casein
Source.6952: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.6953: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6954: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.6955: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.6956: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.6957: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.6958: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.6959: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.6960: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain
Source.6961: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6962: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.6963: DFBPPR13120 ---- Animal proteins ---- Ig lambda chain C region
Source.6964: DFBPPR13135 ---- Animal proteins ---- Ig kappa-b4 chain C region
Source.6965: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.6966: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.6967: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6968: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.6969: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.6970: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.6971: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.6972: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.6973: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.6974: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.6975: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.6976: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.6977: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.6978: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1
Source.6979: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6980: DFBPPR13174 ---- Animal proteins ---- Clusterin
Source.6981: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.6982: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.6983: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.6984: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.6985: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.6986: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6987: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.6988: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.6989: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.6990: DFBPPR13207 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.6991: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.6992: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.6993: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.6994: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.6995: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.6996: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.6997: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.6998: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.6999: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7000: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.7001: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.7002: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7003: DFBPPR13232 ---- Animal proteins ---- Osteocalcin
Source.7004: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.7005: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain
Source.7006: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.7007: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.7008: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7009: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta
Source.7010: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.7011: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7012: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.7013: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.7014: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.7015: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.7016: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7017: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.7018: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.7019: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.7020: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7021: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.7022: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.7023: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.7024: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.7025: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.7026: DFBPPR13300 ---- Animal proteins ---- Sex-determining region Y protein
Source.7027: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.7028: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.7029: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.7030: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.7031: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.7032: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.7033: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.7034: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.7035: DFBPPR13329 ---- Animal proteins ---- Follitropin subunit beta
Source.7036: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.7037: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.7038: DFBPPR13339 ---- Animal proteins ---- Runt-related transcription factor 2
Source.7039: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.7040: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.7041: DFBPPR13352 ---- Animal proteins ---- ATP synthase protein 8
Source.7042: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7043: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.7044: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A
Source.7045: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7046: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.7047: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.7048: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.7049: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.7050: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7051: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7052: DFBPPR13389 ---- Animal proteins ---- Phosducin
Source.7053: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7054: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.7055: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7056: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.7057: DFBPPR13407 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 1
Source.7058: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.7059: DFBPPR13418 ---- Animal proteins ---- 40S ribosomal protein S4
Source.7060: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7061: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.7062: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.7063: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7064: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7065: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7066: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.7067: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.7068: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.7069: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.7070: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.7071: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7072: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A
Source.7073: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.7074: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7075: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.7076: DFBPPR13448 ---- Animal proteins ---- Osteocalcin
Source.7077: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7078: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.7079: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.7080: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.7081: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.7082: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.7083: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.7084: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.7085: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1
Source.7086: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.7087: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta
Source.7088: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.7089: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.7090: DFBPPR13485 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.7091: DFBPPR13487 ---- Animal proteins ---- Cathelicidin-3.4
Source.7092: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.7093: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.7094: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.7095: DFBPPR13497 ---- Animal proteins ---- Plasminogen
Source.7096: DFBPPR13501 ---- Animal proteins ---- Follitropin subunit beta
Source.7097: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor
Source.7098: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.7099: DFBPPR13523 ---- Animal proteins ---- Keratin-associated protein 15-1
Source.7100: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.7101: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.7102: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.7103: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.7104: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7105: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.7106: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.7107: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.7108: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.7109: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.7110: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7111: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.7112: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7113: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.7114: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.7115: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.7116: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.7117: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.7118: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.7119: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.7120: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.7121: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.7122: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.7123: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.7124: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.7125: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.7126: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.7127: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.7128: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.7129: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7130: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.7131: DFBPPR13602 ---- Animal proteins ---- Acrosin
Source.7132: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.7133: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.7134: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.7135: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.7136: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.7137: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.7138: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.7139: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.7140: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.7141: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta
Source.7142: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.7143: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.7144: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.7145: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.7146: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.7147: DFBPPR13631 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.7148: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.7149: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.7150: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.7151: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7152: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.7153: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.7154: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.7155: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.7156: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.7157: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7158: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain
Source.7159: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.7160: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.7161: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.7162: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.7163: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.7164: DFBPPR13688 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.7165: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7166: DFBPPR13692 ---- Animal proteins ---- Pro-neuropeptide Y
Source.7167: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.7168: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.7169: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.7170: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.7171: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.7172: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta
Source.7173: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.7174: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.7175: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.7176: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1
Source.7177: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.7178: DFBPPR13738 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.7179: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.7180: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.7181: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.7182: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.7183: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.7184: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.7185: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.7186: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7187: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.7188: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.7189: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.7190: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.7191: DFBPPR13789 ---- Animal proteins ---- Tryptase-2
Source.7192: DFBPPR13790 ---- Animal proteins ---- Follitropin subunit beta
Source.7193: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.7194: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.7195: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone
Source.7196: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.7197: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.7198: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.7199: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1
Source.7200: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.7201: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.7202: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.7203: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.7204: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10
Source.7205: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.7206: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.7207: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.7208: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.7209: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.7210: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.7211: DFBPPR13876 ---- Animal proteins ---- Follistatin
Source.7212: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.7213: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7214: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7215: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7216: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.7217: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.7218: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.7219: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.7220: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7221: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.7222: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.7223: DFBPPR13914 ---- Animal proteins ---- Homeobox protein Hox-C6
Source.7224: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.7225: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.7226: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.7227: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.7228: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.7229: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7230: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.7231: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.7232: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.7233: DFBPPR13985 ---- Animal proteins ---- Gonadotropin subunit beta-2
Source.7234: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.7235: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7236: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B
Source.7237: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.7238: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.7239: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog
Source.7240: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.7241: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.7242: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1
Source.7243: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.7244: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2
Source.7245: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1
Source.7246: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.7247: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.7248: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.7249: DFBPPR14024 ---- Animal proteins ---- Gamma-crystallin S
Source.7250: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.7251: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.7252: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.7253: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.7254: DFBPPR14054 ---- Animal proteins ---- Pro-neuropeptide Y
Source.7255: DFBPPR14071 ---- Marine protein ---- Somatotropin
Source.7256: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.7257: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.7258: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7259: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.7260: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha
Source.7261: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.7262: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.7263: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.7264: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.7265: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.7266: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.7267: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.7268: DFBPPR14120 ---- Marine protein ---- Thyrotropin subunit beta
Source.7269: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.7270: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.7271: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.7272: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.7273: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.7274: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.7275: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.7276: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.7277: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.7278: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.7279: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.7280: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.7281: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.7282: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.7283: DFBPPR14175 ---- Marine protein ---- Draxin-B
Source.7284: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine
Source.7285: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.7286: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.7287: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.7288: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.7289: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.7290: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.7291: DFBPPR14213 ---- Marine protein ---- Electron transfer flavoprotein regulatory factor 1
Source.7292: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.7293: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.7294: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1
Source.7295: DFBPPR14227 ---- Marine protein ---- LYR motif-containing protein 4B
Source.7296: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog
Source.7297: DFBPPR14231 ---- Marine protein ---- Somatotropin
Source.7298: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.7299: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.7300: DFBPPR14236 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.7301: DFBPPR14238 ---- Marine protein ---- Insulin
Source.7302: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.7303: DFBPPR14243 ---- Marine protein ---- Glycoprotein hormones alpha chain 2
Source.7304: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1
Source.7305: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.7306: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.7307: DFBPPR14265 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.7308: DFBPPR14266 ---- Marine protein ---- Gonadotropin subunit beta-1
Source.7309: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.7310: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.7311: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.7312: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.7313: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.7314: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.7315: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.7316: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.7317: DFBPPR14309 ---- Marine protein ---- 50S ribosomal protein L21, chloroplastic
Source.7318: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.7319: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region
Source.7320: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.7321: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.7322: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.7323: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7324: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.7325: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7326: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.7327: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.7328: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.7329: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.7330: DFBPPR14357 ---- Marine protein ---- Ferredoxin
Source.7331: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.7332: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.7333: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42
Source.7334: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.7335: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.7336: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.7337: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.7338: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta
Source.7339: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.7340: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha
Source.7341: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.7342: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.7343: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.7344: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.7345: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.7346: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic
Source.7347: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.7348: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain
Source.7349: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.7350: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.7351: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator
Source.7352: DFBPPR14431 ---- Marine protein ---- 50S ribosomal protein L31, chloroplastic
Source.7353: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.7354: DFBPPR14444 ---- Marine protein ---- 50S ribosomal protein L23, chloroplastic
Source.7355: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.7356: DFBPPR14485 ---- Marine protein ---- Uncharacterized N-acetyltransferase ycf52
Source.7357: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.7358: DFBPPR14506 ---- Marine protein ---- Photosystem I reaction center subunit IV
Source.7359: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.7360: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.7361: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.7362: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53
Source.7363: DFBPPR14519 ---- Marine protein ---- Uncharacterized protein ycf21
Source.7364: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56
Source.7365: DFBPPR14530 ---- Marine protein ---- Uncharacterized protein ycf34
Source.7366: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.7367: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.7368: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.7369: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.7370: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.7371: DFBPPR14541 ---- Marine protein ---- Somatotropin-1
Source.7372: DFBPPR14542 ---- Marine protein ---- Somatotropin-2
Source.7373: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.7374: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.7375: DFBPPR14547 ---- Marine protein ---- Interleukin-6
Source.7376: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.7377: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.7378: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.7379: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.7380: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.7381: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.7382: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.7383: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.7384: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.7385: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.7386: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1
Source.7387: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.7388: DFBPPR14581 ---- Marine protein ---- Interferon alpha/beta receptor 2
Source.7389: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4
Source.7390: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.7391: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.7392: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.7393: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1
Source.7394: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.7395: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.7396: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7397: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1
Source.7398: DFBPPR14608 ---- Marine protein ---- Polysialoglycoprotein
Source.7399: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.7400: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.7401: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.7402: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.7403: DFBPPR14625 ---- Marine protein ---- Somatostatin-2
Source.7404: DFBPPR14628 ---- Marine protein ---- C-type natriuretic peptide 1
Source.7405: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.7406: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.7407: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin
Source.7408: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.7409: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.7410: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.7411: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.7412: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.7413: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.7414: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2
Source.7415: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc
Source.7416: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.7417: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.7418: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.7419: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.7420: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.7421: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2
Source.7422: DFBPPR14695 ---- Marine protein ---- C-type natriuretic peptide 2
Source.7423: DFBPPR14700 ---- Marine protein ---- Neuropeptide Y
Source.7424: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.7425: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.7426: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.7427: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.7428: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.7429: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.7430: DFBPPR14730 ---- Marine protein ---- Peptide YY-like
Source.7431: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.7432: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.7433: DFBPPR14768 ---- Marine protein ---- Tachylectin-2
Source.7434: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.7435: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.7436: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.7437: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.7438: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.7439: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.7440: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.7441: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.7442: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.7443: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.7444: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.7445: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.7446: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.7447: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.7448: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.7449: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.7450: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.7451: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.7452: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.7453: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.7454: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.7455: DFBPPR14839 ---- Marine protein ---- Hemocyanin subunit 2
Source.7456: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.7457: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.7458: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7459: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.7460: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.7461: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.7462: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.7463: DFBPPR14867 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.7464: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7465: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.7466: DFBPPR14873 ---- Marine protein ---- Somatolactin
Source.7467: DFBPPR14875 ---- Marine protein ---- Probable pancreatic secretory proteinase inhibitor
Source.7468: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.7469: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.7470: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.7471: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.7472: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.7473: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.7474: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.7475: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.7476: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.7477: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.7478: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.7479: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.7480: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.7481: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.7482: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.7483: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.7484: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.7485: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.7486: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.7487: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.7488: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.7489: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.7490: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.7491: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.7492: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.7493: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.7494: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.7495: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.7496: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.7497: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.7498: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.7499: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.7500: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.7501: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.7502: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.7503: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.7504: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.7505: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.7506: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.7507: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.7508: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.7509: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.7510: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.7511: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.7512: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.7513: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.7514: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.7515: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.7516: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.7517: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.7518: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.7519: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.7520: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.7521: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.7522: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1
Source.7523: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.7524: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.7525: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.7526: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.7527: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.7528: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.7529: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.7530: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1
Source.7531: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.7532: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.7533: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.7534: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.7535: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6
Source.7536: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.7537: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.7538: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.7539: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.7540: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.7541: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.7542: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.7543: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.7544: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1
Source.7545: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.7546: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.7547: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.7548: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.7549: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.7550: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.7551: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.7552: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.7553: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.7554: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.7555: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.7556: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.7557: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.7558: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10
Source.7559: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.7560: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.7561: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.7562: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.7563: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.7564: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.7565: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.7566: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.7567: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.7568: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12
Source.7569: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.7570: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.7571: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase
Source.7572: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.7573: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.7574: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.7575: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.7576: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.7577: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.7578: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.7579: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6
Source.7580: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.7581: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.7582: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.7583: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.7584: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.7585: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.7586: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.7587: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.7588: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase
Source.7589: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.7590: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.7591: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.7592: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.7593: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.7594: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.7595: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.7596: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.7597: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.7598: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.7599: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D
Source.7600: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.7601: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.7602: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.7603: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.7604: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.7605: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.7606: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.7607: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.7608: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.7609: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.7610: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.7611: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.7612: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.7613: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.7614: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.7615: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.7616: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.7617: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1
Source.7618: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.7619: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.7620: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.7621: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.7622: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.7623: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.7624: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.7625: DFBPPR15222 ---- Microorganism protein ---- DASH complex subunit ASK1
Source.7626: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.7627: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.7628: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.7629: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.7630: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6
Source.7631: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.7632: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.7633: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.7634: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.7635: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.7636: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.7637: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.7638: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.7639: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.7640: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3
Source.7641: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.7642: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.7643: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.7644: DFBPPR15276 ---- Microorganism protein ---- Guanine nucleotide-binding protein subunit gamma
Source.7645: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.7646: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5
Source.7647: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.7648: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12
Source.7649: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.7650: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2
Source.7651: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.7652: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.7653: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14
Source.7654: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7655: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.7656: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.7657: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.7658: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.7659: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.7660: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.7661: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.7662: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.7663: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.7664: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.7665: DFBPPR15328 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 31
Source.7666: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.7667: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.7668: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.7669: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.7670: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.7671: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.7672: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.7673: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.7674: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.7675: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.7676: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog
Source.7677: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.7678: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.7679: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.7680: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.7681: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.7682: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.7683: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.7684: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.7685: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.7686: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.7687: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.7688: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.7689: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.7690: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.7691: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.7692: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.7693: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.7694: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4
Source.7695: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.7696: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82
Source.7697: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.7698: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3
Source.7699: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.7700: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.7701: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.7702: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.7703: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1
Source.7704: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.7705: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.7706: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1
Source.7707: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.7708: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.7709: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.7710: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1
Source.7711: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.7712: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.7713: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.7714: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.7715: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.7716: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.7717: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.7718: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.7719: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.7720: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.7721: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.7722: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.7723: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.7724: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.7725: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.7726: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101
Source.7727: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1
Source.7728: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.7729: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5
Source.7730: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.7731: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.7732: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.7733: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.7734: DFBPPR15543 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 7
Source.7735: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.7736: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.7737: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.7738: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.7739: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.7740: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.7741: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.7742: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.7743: DFBPPR15576 ---- Microorganism protein ---- Cytochrome c oxidase-assembly factor COX23, mitochondrial
Source.7744: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.7745: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.7746: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.7747: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.7748: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.7749: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.7750: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.7751: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.7752: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.7753: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.7754: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.7755: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.7756: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.7757: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.7758: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.7759: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.7760: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11
Source.7761: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.7762: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.7763: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.7764: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25
Source.7765: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.7766: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.7767: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.7768: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.7769: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase
Source.7770: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.7771: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6
Source.7772: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.7773: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.7774: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.7775: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.7776: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.7777: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial
Source.7778: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.7779: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.7780: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1
Source.7781: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.7782: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.7783: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.7784: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.7785: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.7786: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.7787: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.7788: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.7789: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1
Source.7790: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.7791: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.7792: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.7793: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.7794: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.7795: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.7796: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1
Source.7797: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.7798: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.7799: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.7800: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial
Source.7801: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.7802: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.7803: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.7804: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.7805: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.7806: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.7807: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.7808: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1
Source.7809: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.7810: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.7811: DFBPPR15794 ---- Microorganism protein ---- Uncharacterized protein KLLA0E17732g
Source.7812: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.7813: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.7814: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase
Source.7815: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.7816: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.7817: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.7818: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.7819: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.7820: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.7821: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.7822: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.7823: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.7824: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.7825: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.7826: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.7827: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.7828: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.7829: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.7830: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.7831: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.7832: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.7833: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.7834: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.7835: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.7836: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.7837: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.7838: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.7839: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.7840: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.7841: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.7842: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.7843: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.7844: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.7845: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2
Source.7846: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.7847: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.7848: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.7849: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.7850: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.7851: DFBPPR15889 ---- Marine protein ---- Ferredoxin
Source.7852: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.7853: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.7854: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.7855: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7856: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.7857: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.7858: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.7859: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.7860: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.7861: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.7862: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.7863: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.7864: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.7865: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.7866: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.7867: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7868: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.7869: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.7870: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.7871: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.7872: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.7873: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7874: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.7875: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.7876: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.7877: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.7878: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.7879: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.7880: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.7881: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.7882: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.7883: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7884: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.7885: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.7886: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.7887: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.7888: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7889: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.7890: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.7891: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.7892: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.7893: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7894: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7895: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.7896: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.7897: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.7898: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2
Source.7899: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1
Source.7900: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.7901: DFBPPR7832 ---- Plant protein ---- Extensin
Source.7902: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.7903: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.7904: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.7905: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.7906: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.7907: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.7908: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.7909: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.7910: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.7911: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.7912: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.7913: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.7914: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic
Source.7915: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.7916: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.7917: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.7918: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.7919: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.7920: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.7921: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.7922: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.7923: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.7924: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.7925: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.7926: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.7927: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.7928: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7929: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.7930: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.7931: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.7932: DFBPPR7954 ---- Plant protein ---- Favin
Source.7933: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.7934: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.7935: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.7936: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.7937: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.7938: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.7939: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7940: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.7941: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7942: DFBPPR7997 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.7943: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.7944: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.7945: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.7946: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.7947: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.7948: DFBPPR8029 ---- Plant protein ---- Vignain
Source.7949: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.7950: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.7951: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.7952: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.7953: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.7954: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.7955: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.7956: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.7957: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.7958: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.7959: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.7960: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.7961: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.7962: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.7963: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.7964: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.7965: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.7966: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.7967: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.7968: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.7969: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.7970: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.7971: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.7972: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.7973: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.7974: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.7975: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.7976: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.7977: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.7978: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.7979: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.7980: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.7981: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.7982: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.7983: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.7984: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.7985: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.7986: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin
Source.7987: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.7988: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.7989: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.7990: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.7991: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.7992: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.7993: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.7994: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.7995: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.7996: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.7997: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.7998: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.7999: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0
Source.8000: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.8001: DFBPPR8183 ---- Plant protein ---- 26 kDa cell wall protein
Source.8002: DFBPPR8185 ---- Plant protein ---- Uncharacterized basic polypeptide
Source.8003: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.8004: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.8005: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.8006: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.8007: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.8008: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.8009: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.8010: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.8011: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.8012: DFBPPR8235 ---- Plant protein ---- Catalase
Source.8013: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.8014: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.8015: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.8016: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.8017: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.8018: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.8019: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.8020: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.8021: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.8022: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.8023: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.8024: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.8025: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.8026: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.8027: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.8028: DFBPPR8270 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.8029: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.8030: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.8031: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase
Source.8032: DFBPPR8296 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.8033: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.8034: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Source.8035: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.8036: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.8037: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.8038: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.8039: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1
Source.8040: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3
Source.8041: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Source.8042: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
Link 1: DFBPDPIV0140----Bovine milk proteins----β-Casein, αs1-Casein, ...
Biological/Functional activity & target protein
DPP IV-inhibitory activity

(1) Inhibitor of human Dipeptidyl Peptidase IV (EC 3.4.14.5). Tyr-Pro exhibited inhibitory effect to some degree, as shown in Table 1.
(2) The dipeptides Tyr–Pro showed hDPPIV inhibitory effects (inhibition ratio, >50%) [5].
(3) The peptide showed low inhibitory activity against Dipeptidyl-peptidase IV (EC 3.4.14.5) with the IC50 value of 658.1 μM, and its DPP-IV inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern [6].

Table 1 IC50 (mM) values of synthetic peptides against DPP-IV activity
Peptides
IC50 (mM)
Relative
Diprotin A (Ile-Pro-Ile) [3]0.21 ± 0.01
0.5
Ile-Pro0.41 ± 0.071.0
Met-Pro
0.87 ± 0.01
2.1
Val-Pro
0.88 ± 0.09
2.1
Arg-Pro
2.24 ± 0.29
5.5
Thr-Pro
2.37 ± 0.605.8
Leu-Pro
2.37 ± 0.17
5.8
Lys-Pro
2.54 ± 0.88
6.2
His-Pro
2.82 ± 0.58
6.9
Tyr-Pro
3.17 ± 0.44
7.7
Phe-Pro
3.63 ± 0.51
8.9
Trp-Pro
4.53 ± 0.33
11.0
Pro-Pro
5.86 ± 0.55
14.3
Ser-Pro
5.98 ± 0.42
14.6
Ala-Pro
7.95 ± 0.38
19.4
Gly-Pro
No inhibition

Pro-Ile
No inhibition
Specific target protein(s) Specific Target Protein(s):
Dipeptidyl peptidase 4
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

No enzyme

Stability & Cytotoxicity
Peptide stability
Literature report:

The peptide was unstable for gastrointestinal enzymes (cleavaged by pepsin) [6].

EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

(1) Although the peptide is a synthetic peptide, its IC50 value has been determined (it has inhibitory activity against DPP-IV) and may be present in other food-borne proteins, so the peptide is included here.
(2) The peptide was found in milk proteins [D1, 1].
(3) The results presented herein are relevant to the management of type 2 diabetes with functional foods involving multi-target sites for DPP-IV inhibition in humans
[4].

Database cross-references
DFBP
[D1] DFBPACEI0348, DFBPACEI1315, DFBPACEI1540, DFBPACEI1901
[D2] DFBPANHY0869, DFBPANHY0886
[D3] DFBPANOX0681
[D4] DFBPALGL0021
[D5] DFBPOPIO0147
[D6] DFBPMUFU0106
BIOPEP-UWM [D7] 3666, 8521, 9548
APD [D8] -
BioPepDB [D9] -
MBPDB [D10] -
Reference(s)
Primary literature Hatanaka T, Inoue Y, Arima J, Kumagai Y, Usuki H, Kawakami K, Kimura M, Mukaihara T. Production of dipeptidyl peptidase IV inhibitory peptides from defatted rice bran. Food Chem. 2012 Sep 15;134(2):797-802.
PMID: 23107693
Other literature(s)

[1] Nongonierma A B, Fitzgerald R J. Inhibition of dipeptidyl peptidase IV (DPP-IV) by proline containing casein-derived peptides[J]. Journal of Functional Foods, 2013, 5(4):1909-1917.
[2] Rosa A P B D L, Montoya A B, Martínez-Cuevas P, et al. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: Antihypertensive role of amaranth peptides[J]. Nitric Oxide, 2010, 23(2):106-111.
[3] Umezawa H, Aoyagi T, Ogawa K, et al. Diprotins A and B, inhibitors of dipeptidyl aminopeptidase IV, produced by bacteria[J]. Journal of Antibiotics, 1984, 37(4):422.
[4] Nongonierma A B, Fitzgerald R J. Susceptibility of milk protein-derived peptides to dipeptidyl peptidase IV (DPP-IV) hydrolysis[J]. Food Chemistry, 2014, 145(145C):845-852.
[5] Bella A M ,  Erickson R H ,  Kim Y S . Rat intestinal brush border membrane dipeptidyl-aminopeptidase IV: kinetic properties and substrate specificities of the purified enzyme[J]. Archives of Biochemistry & Biophysics, 1982, 218(1):156-162.
[6] Nongonierma A B, Fitzgerald R J. Inhibition of dipeptidyl peptidase IV (DPP-IV) by proline containing casein-derived peptides[J]. Journal of Functional Foods, 2013, 5(4):1909-1917.
[7] Nongonierma A B, Fitzgerald R J. Structure activity relationship modelling of milk protein-derived peptides with dipeptidyl peptidase IV (DPP-IV) inhibitory activity[J]. Peptides, 2016, 79:1-7.

PubDate 2012
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214