Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPDPIV0023(DPP IV-inhibitory peptide)

DFBP ID	DFBPDPIV0023
Peptide sequence	YP
Type	Native peptide
Peptide/Function name	DPP-IV inhibitory peptide, Anti-diabetic peptide

Function-activity relationship

Main bioactivity	DPP-IV inhibitory activity
Otheir bioactivity	ACE-inhibitory activity ^[D1], Antihypertensive activity ^[D2], Antioxidative activity ^[D3], α-Glucosidase inhibitory activity ^[D4], Opioid activity ^[D5], Multifunctional activity ^[D6]

Calculated physicochemical properties

Three-letter amino acid

Tyr-Pro

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	278.30 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.92 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-1.4500^c

Hydrophilic residue ratio

50%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Plant
Organism/Source	Rice
Precursor protein	Defated rice bran
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin Source.3: DFBPPR0380 ---- Plant protein ---- Alpha-gliadin Source.4: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin Source.5: DFBPPR0382 ---- Plant protein ---- Alpha-gliadin Source.6: DFBPPR0383 ---- Plant protein ---- Alpha-gliadin Source.7: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin Source.8: DFBPPR0385 ---- Plant protein ---- Alpha-gliadin Source.9: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin Source.10: DFBPPR0390 ---- Plant protein ---- B3144=ALPHA-gliadin derived CELIAC active peptide Source.11: DFBPPR0391 ---- Plant protein ---- B3143=ALPHA-gliadin derived CELIAC active peptide Source.12: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.13: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.14: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.15: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.16: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.17: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.18: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A Source.19: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.20: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.21: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.22: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.23: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic Source.24: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.25: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5 Source.26: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.27: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.28: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.29: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.30: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.31: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.32: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.33: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5 Source.34: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.35: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.36: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.37: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.38: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.39: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.40: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.41: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.42: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.43: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic Source.44: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.45: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1 Source.46: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.47: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.48: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.49: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.50: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.51: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.52: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.53: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.54: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic Source.55: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.56: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.57: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.58: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2 Source.59: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12 Source.60: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.61: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.62: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.63: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.64: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.65: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.66: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.67: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.68: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.69: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.70: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8 Source.71: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.72: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.73: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.74: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3 Source.75: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10 Source.76: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.77: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7 Source.78: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.79: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.80: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.81: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.82: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.83: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.84: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.85: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7 Source.86: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.87: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic Source.88: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.89: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.90: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7 Source.91: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.92: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.93: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6 Source.94: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.95: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.96: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.97: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase Source.98: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1 Source.99: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.100: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.101: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9 Source.102: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.103: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.104: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.105: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.106: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.107: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.108: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.109: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.110: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic Source.111: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3 Source.112: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.113: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4 Source.114: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.115: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.116: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.117: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.118: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.119: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.120: DFBPPR1041 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 1 Source.121: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.122: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.123: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.124: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.125: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14 Source.126: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8 Source.127: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.128: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.129: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62 Source.130: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.131: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.132: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3 Source.133: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4 Source.134: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.135: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.136: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.137: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.138: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.139: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5 Source.140: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.141: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.142: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.143: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.144: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB Source.145: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic Source.146: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.147: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.148: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.149: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.150: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1 Source.151: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.152: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.153: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.154: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.155: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.156: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.157: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6 Source.158: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.159: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.160: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.161: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.162: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.163: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.164: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.165: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.166: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.167: DFBPPR1142 ---- Plant proteins ---- Calreticulin Source.168: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13 Source.169: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.170: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.171: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.172: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.173: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.174: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.175: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.176: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.177: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.178: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.179: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2 Source.180: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.181: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.182: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.183: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.184: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.185: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.186: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58 Source.187: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.188: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.189: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.190: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.191: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.192: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.193: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.194: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15 Source.195: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.196: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.197: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.198: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.199: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.200: DFBPPR1292 ---- Plant proteins ---- Chitinase 3 Source.201: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.202: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.203: DFBPPR1297 ---- Plant proteins ---- Peroxygenase Source.204: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.205: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.206: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.207: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.208: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.209: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.210: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.211: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17 Source.212: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7 Source.213: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.214: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.215: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d Source.216: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.217: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.218: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.219: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.220: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.221: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.222: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.223: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1 Source.224: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.225: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.226: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.227: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.228: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.229: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.230: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.231: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.232: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47 Source.233: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.234: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.235: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.236: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.237: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.238: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.239: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.240: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.241: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic Source.242: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3 Source.243: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.244: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.245: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.246: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.247: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2 Source.248: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.249: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.250: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.251: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.252: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.253: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.254: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.255: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.256: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.257: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.258: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.259: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.260: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.261: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3 Source.262: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.263: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.264: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.265: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.266: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.267: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.268: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1 Source.269: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.270: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.271: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.272: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.273: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.274: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.275: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.276: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.277: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.278: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.279: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.280: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.281: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.282: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.283: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8 Source.284: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.285: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.286: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.287: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.288: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.289: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2 Source.290: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.291: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.292: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.293: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.294: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.295: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.296: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.297: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.298: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.299: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.300: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.301: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.302: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.303: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.304: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.305: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.306: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.307: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.308: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.309: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.310: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.311: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.312: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.313: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3 Source.314: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.315: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.316: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.317: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.318: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.319: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2 Source.320: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.321: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.322: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.323: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.324: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.325: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.326: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.327: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.328: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.329: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.330: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.331: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1 Source.332: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.333: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.334: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3 Source.335: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.336: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.337: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.338: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33 Source.339: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.340: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.341: DFBPPR1581 ---- Plant proteins ---- Peroxiredoxin-2C Source.342: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.343: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.344: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.345: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.346: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.347: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.348: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.349: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.350: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.351: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.352: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.353: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.354: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.355: DFBPPR1609 ---- Plant proteins ---- Expansin-B1 Source.356: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.357: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.358: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.359: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.360: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.361: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.362: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.363: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.364: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.365: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.366: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.367: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.368: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.369: DFBPPR1641 ---- Plant proteins ---- Enolase Source.370: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.371: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.372: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.373: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.374: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein Source.375: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.376: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19 Source.377: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.378: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.379: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.380: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.381: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.382: DFBPPR1675 ---- Plant proteins ---- Protein LSD1 Source.383: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.384: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.385: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.386: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.387: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.388: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062 Source.389: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.390: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.391: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.392: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.393: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.394: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.395: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.396: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.397: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.398: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.399: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.400: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.401: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.402: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.403: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.404: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.405: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2 Source.406: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74 Source.407: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.408: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.409: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.410: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP Source.411: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.412: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.413: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.414: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.415: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.416: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2 Source.417: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.418: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.419: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.420: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.421: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.422: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.423: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.424: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2 Source.425: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.426: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.427: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.428: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.429: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1 Source.430: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.431: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.432: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.433: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.434: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.435: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.436: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.437: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.438: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.439: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.440: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.441: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.442: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.443: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1 Source.444: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.445: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3 Source.446: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.447: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.448: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.449: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.450: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.451: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.452: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.453: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.454: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.455: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.456: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.457: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.458: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.459: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.460: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.461: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.462: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.463: DFBPPR1863 ---- Plant proteins ---- Chitinase 6 Source.464: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.465: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.466: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.467: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.468: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.469: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.470: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.471: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.472: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.473: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8 Source.474: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.475: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.476: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.477: DFBPPR1887 ---- Plant proteins ---- Probable glutathione S-transferase DHAR2, chloroplastic Source.478: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.479: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.480: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8 Source.481: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2 Source.482: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.483: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.484: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.485: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.486: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.487: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.488: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.489: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.490: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.491: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6 Source.492: DFBPPR1912 ---- Plant proteins ---- Expansin-B3 Source.493: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.494: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21 Source.495: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.496: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10 Source.497: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.498: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.499: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.500: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.501: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1 Source.502: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.503: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.504: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.505: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.506: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B Source.507: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.508: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.509: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.510: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.511: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.512: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.513: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.514: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.515: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.516: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.517: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.518: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2 Source.519: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28 Source.520: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB Source.521: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.522: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.523: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.524: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.525: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A Source.526: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.527: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.528: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.529: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.530: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.531: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.532: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic Source.533: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain Source.534: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.535: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.536: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.537: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.538: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.539: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.540: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.541: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.542: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.543: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.544: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.545: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.546: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.547: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11 Source.548: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.549: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.550: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5 Source.551: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.552: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.553: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.554: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.555: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.556: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.557: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.558: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.559: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.560: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.561: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.562: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.563: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.564: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.565: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.566: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.567: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.568: DFBPPR2085 ---- Plant proteins ---- Protein LOL5 Source.569: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.570: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.571: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.572: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.573: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12 Source.574: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.575: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.576: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.577: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.578: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.579: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.580: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.581: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.582: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2 Source.583: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.584: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1 Source.585: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.586: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2 Source.587: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57 Source.588: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic Source.589: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.590: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.591: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.592: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.593: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1 Source.594: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.595: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.596: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.597: DFBPPR2146 ---- Plant proteins ---- Expansin-B4 Source.598: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A Source.599: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.600: DFBPPR2157 ---- Plant proteins ---- Expansin-B6 Source.601: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.602: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.603: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.604: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.605: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.606: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.607: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.608: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.609: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.610: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.611: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.612: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.613: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.614: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.615: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.616: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.617: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.618: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16 Source.619: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.620: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.621: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.622: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.623: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.624: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.625: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.626: DFBPPR2223 ---- Plant proteins ---- Urease Source.627: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1 Source.628: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain Source.629: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.630: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.631: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.632: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha Source.633: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.634: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.635: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.636: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.637: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.638: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.639: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6 Source.640: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.641: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2 Source.642: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog Source.643: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.644: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.645: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.646: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.647: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.648: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.649: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.650: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.651: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.652: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.653: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.654: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.655: DFBPPR2302 ---- Plant proteins ---- Bowman-Birk type bran trypsin inhibitor Source.656: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.657: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.658: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.659: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.660: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.661: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.662: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.663: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.664: DFBPPR2329 ---- Plant proteins ---- Protein HEADING DATE REPRESSOR 1 Source.665: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3 Source.666: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.667: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.668: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4 Source.669: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.670: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.671: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.672: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.673: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A Source.674: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.675: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.676: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.677: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.678: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.679: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6 Source.680: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.681: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.682: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.683: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.684: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.685: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.686: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1 Source.687: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.688: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.689: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.690: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.691: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.692: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100 Source.693: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic Source.694: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.695: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.696: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase Source.697: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.698: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.699: DFBPPR2408 ---- Plant proteins ---- Cytochrome f Source.700: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.701: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.702: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.703: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.704: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.705: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.706: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.707: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.708: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.709: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3 Source.710: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2 Source.711: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.712: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c Source.713: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain Source.714: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3 Source.715: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic Source.716: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial Source.717: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.718: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.719: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1 Source.720: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.721: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34 Source.722: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.723: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial Source.724: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.725: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.726: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.727: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.728: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.729: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.730: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.731: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.732: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.733: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.734: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.735: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.736: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.737: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.738: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.739: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.740: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1 Source.741: DFBPPR2520 ---- Plant proteins ---- Metallothionein-like protein 4C Source.742: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.743: DFBPPR2526 ---- Plant proteins ---- Chitinase 10 Source.744: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2 Source.745: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.746: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.747: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.748: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.749: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.750: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.751: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.752: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a Source.753: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.754: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.755: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.756: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.757: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.758: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase Source.759: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.760: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.761: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.762: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200 Source.763: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.764: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.765: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6 Source.766: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.767: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.768: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.769: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.770: DFBPPR2595 ---- Plant proteins ---- Expansin-B7 Source.771: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.772: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5 Source.773: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.774: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5 Source.775: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.776: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.777: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E Source.778: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.779: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.780: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.781: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.782: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12 Source.783: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.784: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial Source.785: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.786: DFBPPR2636 ---- Plant proteins ---- Expansin-B8 Source.787: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.788: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2 Source.789: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein Source.790: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.791: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.792: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic Source.793: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.794: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5 Source.795: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.796: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.797: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.798: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.799: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.800: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.801: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.802: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.803: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.804: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.805: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.806: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1 Source.807: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.808: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.809: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.810: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9 Source.811: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.812: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77 Source.813: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.814: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.815: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.816: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.817: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.818: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.819: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.820: DFBPPR2733 ---- Plant proteins ---- Metallothionein-like protein 1B Source.821: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.822: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C Source.823: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.824: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.825: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.826: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.827: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.828: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.829: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.830: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.831: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.832: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.833: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.834: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.835: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.836: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.837: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.838: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.839: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.840: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.841: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.842: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase Source.843: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.844: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.845: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.846: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.847: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic Source.848: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.849: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.850: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.851: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.852: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.853: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.854: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.855: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.856: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.857: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.858: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.859: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic Source.860: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.861: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.862: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.863: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.864: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.865: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4 Source.866: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.867: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.868: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.869: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.870: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.871: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.872: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.873: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.874: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.875: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.876: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.877: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.878: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4 Source.879: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D Source.880: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.881: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.882: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.883: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1 Source.884: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.885: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.886: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.887: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.888: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.889: DFBPPR2883 ---- Plant proteins ---- Expansin-B9 Source.890: DFBPPR2884 ---- Plant proteins ---- Expansin-B2 Source.891: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.892: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.893: DFBPPR2888 ---- Plant proteins ---- Expansin-B10 Source.894: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.895: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.896: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1 Source.897: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.898: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.899: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.900: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d Source.901: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2 Source.902: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1 Source.903: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.904: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.905: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.906: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.907: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4 Source.908: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.909: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.910: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.911: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.912: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.913: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.914: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.915: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.916: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.917: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.918: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.919: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.920: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.921: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.922: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.923: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.924: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.925: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.926: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.927: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.928: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.929: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.930: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.931: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.932: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.933: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.934: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.935: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.936: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.937: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.938: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3 Source.939: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.940: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.941: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.942: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.943: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.944: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.945: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.946: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.947: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.948: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.949: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.950: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.951: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.952: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.953: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.954: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.955: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.956: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.957: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.958: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.959: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic Source.960: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.961: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.962: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.963: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1 Source.964: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.965: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.966: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.967: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.968: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.969: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.970: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.971: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.972: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34 Source.973: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.974: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.975: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.976: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.977: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.978: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.979: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.980: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.981: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.982: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.983: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.984: DFBPPR3108 ---- Plant proteins ---- Thioredoxin H4-2 Source.985: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.986: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5 Source.987: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1 Source.988: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1 Source.989: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.990: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.991: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.992: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23 Source.993: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.994: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.995: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.996: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.997: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.998: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.999: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.1000: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.1001: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6 Source.1002: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.1003: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.1004: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11 Source.1005: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.1006: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.1007: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.1008: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.1009: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.1010: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1011: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.1012: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.1013: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.1014: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.1015: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.1016: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.1017: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.1018: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.1019: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1020: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.1021: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.1022: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.1023: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.1024: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.1025: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.1026: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.1027: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.1028: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.1029: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.1030: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.1031: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.1032: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.1033: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.1034: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.1035: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3 Source.1036: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain Source.1037: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.1038: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.1039: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.1040: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.1041: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.1042: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.1043: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.1044: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.1045: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.1046: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D Source.1047: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase Source.1048: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.1049: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.1050: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.1051: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.1052: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.1053: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.1054: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.1055: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35 Source.1056: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.1057: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.1058: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.1059: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.1060: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.1061: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1 Source.1062: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5 Source.1063: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13 Source.1064: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8 Source.1065: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.1066: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9 Source.1067: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.1068: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10 Source.1069: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11 Source.1070: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.1071: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.1072: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.1073: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.1074: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.1075: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4 Source.1076: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.1077: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.1078: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.1079: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.1080: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.1081: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.1082: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.1083: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.1084: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3 Source.1085: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.1086: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.1087: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.1088: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.1089: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.1090: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.1091: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.1092: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.1093: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.1094: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.1095: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2 Source.1096: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.1097: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.1098: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.1099: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2 Source.1100: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5 Source.1101: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.1102: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.1103: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.1104: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11 Source.1105: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.1106: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.1107: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.1108: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.1109: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.1110: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.1111: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.1112: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.1113: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.1114: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.1115: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.1116: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C Source.1117: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.1118: DFBPPR3456 ---- Plant proteins ---- Maturase K Source.1119: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.1120: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17 Source.1121: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.1122: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34 Source.1123: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.1124: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.1125: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.1126: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.1127: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.1128: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.1129: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3 Source.1130: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.1131: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.1132: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.1133: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.1134: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.1135: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.1136: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.1137: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.1138: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.1139: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.1140: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.1141: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic Source.1142: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1 Source.1143: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.1144: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2 Source.1145: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.1146: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.1147: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2 Source.1148: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.1149: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.1150: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.1151: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.1152: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3 Source.1153: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3 Source.1154: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.1155: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.1156: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.1157: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K Source.1158: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.1159: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B'' Source.1160: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.1161: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.1162: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.1163: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5 Source.1164: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.1165: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein Source.1166: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.1167: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.1168: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.1169: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2 Source.1170: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.1171: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1 Source.1172: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.1173: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.1174: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7 Source.1175: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.1176: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.1177: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D Source.1178: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.1179: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.1180: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.1181: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.1182: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.1183: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.1184: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.1185: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.1186: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.1187: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.1188: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.1189: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.1190: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.1191: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1192: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3 Source.1193: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.1194: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.1195: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.1196: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.1197: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.1198: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.1199: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.1200: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.1201: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.1202: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1 Source.1203: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.1204: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1 Source.1205: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2 Source.1206: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15 Source.1207: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase Source.1208: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4 Source.1209: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.1210: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1 Source.1211: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.1212: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.1213: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.1214: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic Source.1215: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.1216: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.1217: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.1218: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.1219: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.1220: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.1221: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1 Source.1222: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.1223: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.1224: DFBPPR3760 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.1225: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6 Source.1226: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.1227: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38 Source.1228: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2 Source.1229: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5 Source.1230: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.1231: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.1232: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.1233: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.1234: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.1235: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.1236: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.1237: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.1238: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.1239: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.1240: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog Source.1241: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.1242: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.1243: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.1244: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.1245: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic Source.1246: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14 Source.1247: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.1248: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.1249: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1 Source.1250: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.1251: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.1252: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.1253: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.1254: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.1255: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.1256: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.1257: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.1258: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.1259: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.1260: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.1261: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.1262: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9 Source.1263: DFBPPR3908 ---- Plant proteins ---- Metallothionein-like protein 1A Source.1264: DFBPPR3909 ---- Plant proteins ---- LIM domain-containing protein PLIM2b Source.1265: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.1266: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.1267: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.1268: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2 Source.1269: DFBPPR3914 ---- Plant proteins ---- Derlin-2 Source.1270: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.1271: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit Source.1272: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.1273: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.1274: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.1275: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.1276: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.1277: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.1278: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.1279: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit Source.1280: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.1281: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.1282: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.1283: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7 Source.1284: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.1285: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2 Source.1286: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.1287: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.1288: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.1289: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.1290: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.1291: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.1292: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.1293: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.1294: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.1295: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.1296: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2 Source.1297: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.1298: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.1299: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.1300: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.1301: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.1302: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.1303: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3 Source.1304: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.1305: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1 Source.1306: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.1307: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.1308: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58 Source.1309: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.1310: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.1311: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.1312: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.1313: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.1314: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F Source.1315: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.1316: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.1317: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.1318: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.1319: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.1320: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.1321: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.1322: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.1323: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.1324: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.1325: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.1326: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.1327: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B Source.1328: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3 Source.1329: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.1330: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.1331: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4 Source.1332: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75 Source.1333: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.1334: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.1335: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49 Source.1336: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.1337: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.1338: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.1339: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.1340: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2 Source.1341: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.1342: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.1343: DFBPPR4151 ---- Plant proteins ---- Metallothionein-like protein 4A Source.1344: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.1345: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1 Source.1346: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.1347: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.1348: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6 Source.1349: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.1350: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.1351: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A Source.1352: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.1353: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.1354: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.1355: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3 Source.1356: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.1357: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3 Source.1358: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B Source.1359: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.1360: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.1361: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40 Source.1362: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C Source.1363: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.1364: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.1365: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.1366: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.1367: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.1368: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.1369: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.1370: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.1371: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.1372: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.1373: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P Source.1374: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.1375: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.1376: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.1377: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5 Source.1378: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A Source.1379: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.1380: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.1381: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.1382: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.1383: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.1384: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2 Source.1385: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.1386: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.1387: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.1388: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2 Source.1389: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16 Source.1390: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.1391: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.1392: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.1393: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.1394: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6 Source.1395: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial Source.1396: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.1397: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.1398: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.1399: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.1400: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B Source.1401: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1 Source.1402: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.1403: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.1404: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.1405: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.1406: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.1407: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.1408: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17 Source.1409: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8 Source.1410: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28 Source.1411: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.1412: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1 Source.1413: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.1414: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like Source.1415: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.1416: DFBPPR4328 ---- Plant proteins ---- Metallothionein-like protein 2A Source.1417: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.1418: DFBPPR4331 ---- Plant proteins ---- 60S ribosomal protein L10-2 Source.1419: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.1420: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.1421: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5 Source.1422: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E Source.1423: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.1424: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.1425: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25 Source.1426: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.1427: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.1428: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12 Source.1429: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.1430: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.1431: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.1432: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.1433: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.1434: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.1435: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.1436: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.1437: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.1438: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2 Source.1439: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.1440: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.1441: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.1442: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.1443: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5 Source.1444: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.1445: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog Source.1446: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.1447: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.1448: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1 Source.1449: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.1450: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.1451: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.1452: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.1453: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.1454: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.1455: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.1456: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1 Source.1457: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.1458: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.1459: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.1460: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.1461: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.1462: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3 Source.1463: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13 Source.1464: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.1465: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.1466: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.1467: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.1468: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.1469: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.1470: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.1471: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.1472: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.1473: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.1474: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.1475: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1 Source.1476: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.1477: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.1478: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.1479: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial Source.1480: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2 Source.1481: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.1482: DFBPPR4501 ---- Plant proteins ---- Metallothionein-like protein 4B Source.1483: DFBPPR4504 ---- Plant proteins ---- 60S ribosomal protein L10-1 Source.1484: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B Source.1485: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.1486: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.1487: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.1488: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.1489: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.1490: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.1491: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.1492: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.1493: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5 Source.1494: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.1495: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.1496: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.1497: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14 Source.1498: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7 Source.1499: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.1500: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.1501: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.1502: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.1503: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase Source.1504: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.1505: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.1506: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F Source.1507: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1 Source.1508: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1 Source.1509: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.1510: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.1511: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3 Source.1512: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.1513: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.1514: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.1515: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.1516: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.1517: DFBPPR4607 ---- Plant proteins ---- Protein LOL2 Source.1518: DFBPPR4610 ---- Plant proteins ---- Protein LOL3 Source.1519: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.1520: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic Source.1521: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4 Source.1522: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.1523: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.1524: DFBPPR4620 ---- Plant proteins ---- Protein LOL1 Source.1525: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.1526: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.1527: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.1528: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.1529: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1 Source.1530: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.1531: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1 Source.1532: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.1533: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.1534: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.1535: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3 Source.1536: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1 Source.1537: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.1538: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.1539: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.1540: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17 Source.1541: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4 Source.1542: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.1543: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2 Source.1544: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.1545: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8 Source.1546: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4 Source.1547: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.1548: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5 Source.1549: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.1550: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.1551: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51 Source.1552: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5 Source.1553: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11 Source.1554: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.1555: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.1556: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.1557: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4 Source.1558: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5 Source.1559: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.1560: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.1561: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9 Source.1562: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic Source.1563: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2 Source.1564: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.1565: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.1566: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.1567: DFBPPR4776 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 3 Source.1568: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.1569: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1 Source.1570: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2 Source.1571: DFBPPR4800 ---- Plant proteins ---- Protein BUD31 homolog 2 Source.1572: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000 Source.1573: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.1574: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.1575: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.1576: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000 Source.1577: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a Source.1578: DFBPPR4829 ---- Plant proteins ---- Protein BUD31 homolog 3 Source.1579: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.1580: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400 Source.1581: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2 Source.1582: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5 Source.1583: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1 Source.1584: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.1585: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.1586: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42 Source.1587: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100 Source.1588: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.1589: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.1590: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940 Source.1591: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.1592: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.1593: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog Source.1594: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.1595: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1 Source.1596: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1 Source.1597: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.1598: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2 Source.1599: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic Source.1600: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.1601: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.1602: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.1603: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1 Source.1604: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1 Source.1605: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.1606: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.1607: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.1608: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.1609: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.1610: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1 Source.1611: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.1612: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.1613: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.1614: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.1615: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.1616: DFBPPR4966 ---- Plant proteins ---- Glycinin G5 Source.1617: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.1618: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.1619: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1620: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.1621: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase Source.1622: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.1623: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.1624: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.1625: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.1626: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.1627: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.1628: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1 Source.1629: DFBPPR4983 ---- Plant proteins ---- Protein SRC2 Source.1630: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1 Source.1631: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.1632: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1633: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.1634: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.1635: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.1636: DFBPPR4995 ---- Plant proteins ---- Glycinin G4 Source.1637: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1 Source.1638: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease Source.1639: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.1640: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.1641: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.1642: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.1643: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1644: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.1645: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.1646: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.1647: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.1648: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase Source.1649: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.1650: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.1651: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.1652: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.1653: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1654: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.1655: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.1656: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.1657: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB Source.1658: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase Source.1659: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.1660: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.1661: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.1662: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.1663: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.1664: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.1665: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.1666: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.1667: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1668: DFBPPR5051 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor Source.1669: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein Source.1670: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.1671: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog Source.1672: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.1673: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein Source.1674: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.1675: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.1676: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.1677: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.1678: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.1679: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.1680: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1 Source.1681: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.1682: DFBPPR5079 ---- Plant proteins ---- Albumin-1 Source.1683: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.1684: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.1685: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.1686: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.1687: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.1688: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.1689: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase Source.1690: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic Source.1691: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.1692: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.1693: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.1694: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1 Source.1695: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.1696: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.1697: DFBPPR5111 ---- Plant proteins ---- Lectin Source.1698: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic Source.1699: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic Source.1700: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.1701: DFBPPR5122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.1702: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1703: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.1704: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2 Source.1705: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha Source.1706: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6 Source.1707: DFBPPR5137 ---- Plant proteins ---- Cytochrome f Source.1708: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.1709: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.1710: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase Source.1711: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1712: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1713: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2 Source.1714: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.1715: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1716: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2 Source.1717: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1718: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.1719: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein Source.1720: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1721: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1722: DFBPPR5179 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1723: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1 Source.1724: DFBPPR5185 ---- Plant proteins ---- Actin-1 Source.1725: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum Source.1726: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A Source.1727: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1728: DFBPPR5192 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.1729: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.1730: DFBPPR5196 ---- Plant proteins ---- Arginase Source.1731: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.1732: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1733: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.1734: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.1735: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.1736: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.1737: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.1738: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.1739: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.1740: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.1741: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein Source.1742: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1743: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1 Source.1744: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2 Source.1745: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.1746: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1747: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.1748: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3 Source.1749: DFBPPR5274 ---- Plant proteins ---- Early nodulin-75 Source.1750: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9 Source.1751: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.1752: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.1753: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.1754: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.1755: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1756: DFBPPR5311 ---- Plant proteins ---- Nodulin-20 Source.1757: DFBPPR5314 ---- Plant proteins ---- Hydrophobic seed protein Source.1758: DFBPPR5319 ---- Plant proteins ---- Nodulin-22 Source.1759: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.1760: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6 Source.1761: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51 Source.1762: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.1763: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a Source.1764: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3 Source.1765: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B Source.1766: DFBPPR5342 ---- Plant proteins ---- Nodulin-44 Source.1767: DFBPPR5352 ---- Plant proteins ---- Nodulin-27 Source.1768: DFBPPR5354 ---- Plant proteins ---- Protein P21 Source.1769: DFBPPR5356 ---- Plant proteins ---- Nodulin-23 Source.1770: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.1771: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.1772: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.1773: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.1774: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.1775: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1 Source.1776: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.1777: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1778: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.1779: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.1780: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.1781: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.1782: DFBPPR5393 ---- Plant proteins ---- Endochitinase A Source.1783: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.1784: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1785: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.1786: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1 Source.1787: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.1788: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1789: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.1790: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.1791: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.1792: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.1793: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.1794: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A Source.1795: DFBPPR5432 ---- Plant proteins ---- Expansin-B1 Source.1796: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.1797: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1 Source.1798: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.1799: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.1800: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.1801: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1 Source.1802: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.1803: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.1804: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.1805: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha Source.1806: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.1807: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.1808: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.1809: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1810: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.1811: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.1812: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.1813: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1814: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.1815: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1816: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.1817: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein Source.1818: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.1819: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.1820: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.1821: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.1822: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.1823: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.1824: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.1825: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1826: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain Source.1827: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.1828: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.1829: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic Source.1830: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.1831: DFBPPR5508 ---- Plant proteins ---- Expansin-B9 Source.1832: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain Source.1833: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.1834: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain Source.1835: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.1836: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic Source.1837: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.1838: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase Source.1839: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1840: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.1841: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1842: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain Source.1843: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain Source.1844: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.1845: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase Source.1846: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.1847: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.1848: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1 Source.1849: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.1850: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.1851: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1852: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.1853: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.1854: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.1855: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.1856: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.1857: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.1858: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.1859: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.1860: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.1861: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.1862: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10 Source.1863: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.1864: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1 Source.1865: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.1866: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.1867: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.1868: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3 Source.1869: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.1870: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1871: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.1872: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.1873: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1874: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.1875: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.1876: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1877: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1878: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.1879: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9 Source.1880: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2 Source.1881: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1882: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.1883: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.1884: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.1885: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.1886: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.1887: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.1888: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1889: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.1890: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.1891: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.1892: DFBPPR5661 ---- Plant proteins ---- Albumin b-32 Source.1893: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.1894: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.1895: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1896: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.1897: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.1898: DFBPPR5670 ---- Plant proteins ---- Endochitinase B Source.1899: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.1900: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.1901: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein Source.1902: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3 Source.1903: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.1904: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.1905: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.1906: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.1907: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.1908: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1909: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.1910: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5 Source.1911: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.1912: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.1913: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1 Source.1914: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.1915: DFBPPR5706 ---- Plant proteins ---- Glutelin-2 Source.1916: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.1917: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.1918: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.1919: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.1920: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.1921: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4 Source.1922: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1 Source.1923: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.1924: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1925: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.1926: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.1927: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.1928: DFBPPR5728 ---- Plant proteins ---- Calreticulin Source.1929: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.1930: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3 Source.1931: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1932: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1 Source.1933: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23 Source.1934: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1935: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2 Source.1936: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.1937: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1 Source.1938: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.1939: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.1940: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1941: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform Source.1942: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.1943: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1944: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic Source.1945: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.1946: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.1947: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1 Source.1948: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A Source.1949: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1950: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic Source.1951: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1 Source.1952: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2 Source.1953: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.1954: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1955: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2 Source.1956: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.1957: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1958: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1959: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.1960: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1961: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1962: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.1963: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.1964: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1965: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.1966: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic Source.1967: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha Source.1968: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.1969: DFBPPR5828 ---- Plant proteins ---- Cytochrome f Source.1970: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.1971: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.1972: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.1973: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A Source.1974: DFBPPR5841 ---- Plant proteins ---- Actin-1 Source.1975: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.1976: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3 Source.1977: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic Source.1978: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.1979: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.1980: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.1981: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1982: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2 Source.1983: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1984: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1985: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1 Source.1986: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1 Source.1987: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.1988: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1 Source.1989: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.1990: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.1991: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.1992: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.1993: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1994: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2 Source.1995: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.1996: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.1997: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.1998: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3 Source.1999: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1 Source.2000: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.2001: DFBPPR5924 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.2002: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.2003: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein Source.2004: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.2005: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic Source.2006: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase Source.2007: DFBPPR5946 ---- Plant proteins ---- Maturase K Source.2008: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.2009: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10 Source.2010: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.2011: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.2012: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5 Source.2013: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.2014: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.2015: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.2016: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.2017: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor Source.2018: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.2019: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.2020: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3 Source.2021: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2 Source.2022: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.2023: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9 Source.2024: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.2025: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.2026: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.2027: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2 Source.2028: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.2029: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2 Source.2030: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1 Source.2031: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4 Source.2032: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3 Source.2033: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1 Source.2034: DFBPPR6059 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.2035: DFBPPR6060 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.2036: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.2037: DFBPPR6064 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.2038: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2039: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.2040: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2 Source.2041: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1 Source.2042: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1 Source.2043: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7 Source.2044: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30 Source.2045: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99 Source.2046: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10 Source.2047: DFBPPR6094 ---- Plant proteins ---- Zein-alpha PZ19.1 Source.2048: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11 Source.2049: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2 Source.2050: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2 Source.2051: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4 Source.2052: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4 Source.2053: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.2054: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3 Source.2055: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13 Source.2056: DFBPPR6142 ---- Plant proteins ---- Metallothionein-like protein 1 Source.2057: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.2058: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.2059: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8 Source.2060: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7 Source.2061: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.2062: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA Source.2063: DFBPPR6177 ---- Plant proteins ---- Unknown protein from spot 159 of 2D-PAGE of etiolated coleoptile Source.2064: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile Source.2065: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile Source.2066: DFBPPR6200 ---- Plant proteins ---- Unknown protein from spot 443 of 2D-PAGE of etiolated coleoptile Source.2067: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.2068: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.2069: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.2070: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.2071: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.2072: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.2073: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1 Source.2074: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.2075: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1 Source.2076: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.2077: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein Source.2078: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2079: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.2080: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.2081: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.2082: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.2083: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.2084: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.2085: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein Source.2086: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.2087: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic Source.2088: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.2089: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.2090: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.2091: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.2092: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.2093: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.2094: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.2095: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.2096: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.2097: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.2098: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.2099: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.2100: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.2101: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.2102: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1 Source.2103: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic Source.2104: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2105: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.2106: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.2107: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.2108: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic Source.2109: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.2110: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.2111: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain Source.2112: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein Source.2113: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.2114: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.2115: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.2116: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.2117: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2118: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.2119: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase Source.2120: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.2121: DFBPPR6310 ---- Plant proteins ---- Catalase Source.2122: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.2123: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.2124: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic Source.2125: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2 Source.2126: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2127: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.2128: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH Source.2129: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.2130: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.2131: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F Source.2132: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.2133: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.2134: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.2135: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.2136: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.2137: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.2138: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.2139: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.2140: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.2141: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.2142: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.2143: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.2144: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.2145: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.2146: DFBPPR6358 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.2147: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.2148: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.2149: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic Source.2150: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.2151: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.2152: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.2153: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic Source.2154: DFBPPR6377 ---- Plant proteins ---- Lectin Source.2155: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D Source.2156: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C Source.2157: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.2158: DFBPPR6392 ---- Plant proteins ---- Cytochrome f Source.2159: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.2160: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3 Source.2161: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.2162: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase Source.2163: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase Source.2164: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.2165: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.2166: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.2167: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.2168: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.2169: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.2170: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic Source.2171: DFBPPR6430 ---- Plant proteins ---- Legumin J Source.2172: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.2173: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B Source.2174: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A Source.2175: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72 Source.2176: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.2177: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.2178: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.2179: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.2180: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.2181: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.2182: DFBPPR6453 ---- Plant proteins ---- Convicilin Source.2183: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.2184: DFBPPR6455 ---- Plant proteins ---- Legumin K Source.2185: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.2186: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase Source.2187: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.2188: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.2189: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.2190: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.2191: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.2192: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.2193: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic Source.2194: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1 Source.2195: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic Source.2196: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.2197: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E Source.2198: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic Source.2199: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like Source.2200: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.2201: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2202: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.2203: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.2204: DFBPPR6534 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.2205: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.2206: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.2207: DFBPPR6542 ---- Plant proteins ---- Maturase K Source.2208: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.2209: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.2210: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.2211: DFBPPR6594 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid Source.2212: DFBPPR6595 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid Source.2213: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28 Source.2214: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2215: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.2216: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.2217: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.2218: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.2219: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.2220: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.2221: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.2222: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.2223: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.2224: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.2225: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D Source.2226: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.2227: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.2228: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase Source.2229: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.2230: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.2231: DFBPPR6656 ---- Plant proteins ---- Catalase Source.2232: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.2233: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.2234: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.2235: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.2236: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.2237: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.2238: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.2239: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19 Source.2240: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.2241: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.2242: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2 Source.2243: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B Source.2244: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A Source.2245: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5 Source.2246: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10 Source.2247: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.2248: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.2249: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1 Source.2250: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2251: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase Source.2252: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2 Source.2253: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.2254: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain Source.2255: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1 Source.2256: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1 Source.2257: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein Source.2258: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.2259: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.2260: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.2261: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.2262: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa Source.2263: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase Source.2264: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.2265: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.2266: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2267: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.2268: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.2269: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.2270: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.2271: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.2272: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.2273: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.2274: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.2275: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.2276: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.2277: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1 Source.2278: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic Source.2279: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2280: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.2281: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.2282: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase Source.2283: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z Source.2284: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.2285: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2 Source.2286: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3 Source.2287: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.2288: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.2289: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2290: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3 Source.2291: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.2292: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.2293: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.2294: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7 Source.2295: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha Source.2296: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.2297: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic Source.2298: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic Source.2299: DFBPPR6805 ---- Plant proteins ---- Cytochrome f Source.2300: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.2301: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.2302: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.2303: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.2304: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B Source.2305: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2306: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.2307: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.2308: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D Source.2309: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.2310: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A Source.2311: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.2312: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.2313: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512 Source.2314: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.2315: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2 Source.2316: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.2317: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase Source.2318: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.2319: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.2320: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.2321: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10 Source.2322: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1 Source.2323: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta Source.2324: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.2325: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12 Source.2326: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.2327: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.2328: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.2329: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.2330: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.2331: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212 Source.2332: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K Source.2333: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.2334: DFBPPR6924 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC256 Source.2335: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin Source.2336: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215 Source.2337: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II Source.2338: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV Source.2339: DFBPPR6938 ---- Plant proteins ---- Alpha/beta-gliadin clone PW8142 Source.2340: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V Source.2341: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III Source.2342: DFBPPR6941 ---- Plant proteins ---- Alpha/beta-gliadin A-I Source.2343: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2344: DFBPPR6954 ---- Plant proteins ---- Alpha/beta-gliadin clone PTO-A10 Source.2345: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.2346: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin Source.2347: DFBPPR6963 ---- Plant proteins ---- Metallothionein-like protein 1 Source.2348: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B Source.2349: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin Source.2350: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.2351: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3 Source.2352: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2 Source.2353: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant Source.2354: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.2355: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.2356: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.2357: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.2358: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.2359: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.2360: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.2361: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.2362: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.2363: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2 Source.2364: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic Source.2365: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.2366: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.2367: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.2368: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2369: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.2370: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.2371: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII Source.2372: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.2373: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.2374: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.2375: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.2376: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.2377: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.2378: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein Source.2379: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3 Source.2380: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.2381: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.2382: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain Source.2383: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.2384: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain Source.2385: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2386: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.2387: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase Source.2388: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic Source.2389: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.2390: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.2391: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.2392: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.2393: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.2394: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain Source.2395: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.2396: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.2397: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.2398: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.2399: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.2400: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.2401: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.2402: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2403: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.2404: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.2405: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.2406: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.2407: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.2408: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2409: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.2410: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A Source.2411: DFBPPR7132 ---- Plant proteins ---- Beta-galactosidase Source.2412: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.2413: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.2414: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.2415: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.2416: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.2417: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B Source.2418: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.2419: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.2420: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.2421: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.2422: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.2423: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.2424: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.2425: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.2426: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.2427: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.2428: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.2429: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic Source.2430: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.2431: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.2432: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha Source.2433: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.2434: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1 Source.2435: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.2436: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.2437: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.2438: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.2439: DFBPPR7194 ---- Plant proteins ---- Cytochrome f Source.2440: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.2441: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.2442: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1 Source.2443: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.2444: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.2445: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.2446: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain Source.2447: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.2448: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.2449: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.2450: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.2451: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.2452: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K Source.2453: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.2454: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.2455: DFBPPR7222 ---- Plant proteins ---- Protein HVA22 Source.2456: DFBPPR7223 ---- Plant proteins ---- Ferredoxin Source.2457: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.2458: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2 Source.2459: DFBPPR7246 ---- Plant proteins ---- Leaf-specific thionin Source.2460: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase Source.2461: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1 Source.2462: DFBPPR7251 ---- Plant proteins ---- Leaf-specific thionin DB4 Source.2463: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.2464: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic Source.2465: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6 Source.2466: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3 Source.2467: DFBPPR7267 ---- Plant proteins ---- Thionin BTH7 Source.2468: DFBPPR7268 ---- Plant proteins ---- Probable leaf thionin Source.2469: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.2470: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A Source.2471: DFBPPR7274 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1B Source.2472: DFBPPR7275 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1C Source.2473: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.2474: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.2475: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C Source.2476: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein Source.2477: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3 Source.2478: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.2479: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.2480: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.2481: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.2482: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.2483: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1 Source.2484: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2485: DFBPPR7318 ---- Plant proteins ---- B3-hordein Source.2486: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.2487: DFBPPR7322 ---- Plant proteins ---- Metallothionein-like protein 1 Source.2488: DFBPPR7335 ---- Plant proteins ---- C-hordein Source.2489: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24 Source.2490: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7 Source.2491: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein Source.2492: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.2493: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.2494: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.2495: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic Source.2496: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.2497: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.2498: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20 Source.2499: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase Source.2500: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4 Source.2501: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.2502: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.2503: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.2504: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.2505: DFBPPR7419 ---- Plant proteins ---- Cytochrome b Source.2506: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic Source.2507: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase Source.2508: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.2509: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.2510: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.2511: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.2512: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4 Source.2513: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.2514: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic Source.2515: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.2516: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.2517: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.2518: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2 Source.2519: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1 Source.2520: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.2521: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.2522: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic Source.2523: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.2524: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V Source.2525: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II Source.2526: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1 Source.2527: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.2528: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44 Source.2529: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.2530: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.2531: DFBPPR7499 ---- Plant proteins ---- Ferredoxin Source.2532: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.2533: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.2534: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.2535: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.2536: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A Source.2537: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.2538: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit Source.2539: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C Source.2540: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.2541: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76 Source.2542: DFBPPR7594 ---- Milk proteins ---- Lactadherin Source.2543: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.2544: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.2545: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.2546: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.2547: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein Source.2548: DFBPPR7605 ---- Milk proteins ---- Beta-casein Source.2549: DFBPPR7606 ---- Milk proteins ---- Osteopontin Source.2550: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.2551: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.2552: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.2553: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.2554: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase Source.2555: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.2556: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.2557: DFBPPR7618 ---- Milk proteins ---- Plasminogen Source.2558: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.2559: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.2560: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.2561: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4 Source.2562: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.2563: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.2564: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.2565: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.2566: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain Source.2567: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein Source.2568: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.2569: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.2570: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.2571: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.2572: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.2573: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator Source.2574: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.2575: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.2576: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor Source.2577: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6 Source.2578: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.2579: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.2580: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.2581: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.2582: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12 Source.2583: DFBPPR7657 ---- Milk proteins ---- Chymosin Source.2584: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin Source.2585: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.2586: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein Source.2587: DFBPPR7663 ---- Milk proteins ---- Kappa-casein Source.2588: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein Source.2589: DFBPPR7665 ---- Milk proteins ---- Beta-casein Source.2590: DFBPPR7668 ---- Milk proteins ---- Beta-casein Source.2591: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.2592: DFBPPR7673 ---- Milk proteins ---- Kappa-casein Source.2593: DFBPPR7676 ---- Milk proteins ---- Kappa-casein Source.2594: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A Source.2595: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.2596: DFBPPR7681 ---- Milk proteins ---- Beta-casein Source.2597: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.2598: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.2599: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.2600: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.2601: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein Source.2602: DFBPPR7692 ---- Milk proteins ---- Beta-casein Source.2603: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.2604: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.2605: DFBPPR7695 ---- Milk proteins ---- Kappa-casein Source.2606: DFBPPR7699 ---- Milk proteins ---- Chymosin Source.2607: DFBPPR7700 ---- Milk proteins ---- Beta-casein Source.2608: DFBPPR7706 ---- Milk proteins ---- Beta-casein Source.2609: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.2610: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.2611: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.2612: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.2613: DFBPPR7718 ---- Milk proteins ---- Beta-casein Source.2614: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.2615: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1 Source.2616: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.2617: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.2618: DFBPPR7725 ---- Plant proteins ---- Avenin-3 Source.2619: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.2620: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.2621: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2622: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.2623: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain Source.2624: DFBPPR7739 ---- Plant proteins ---- Avenin-E Source.2625: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.2626: DFBPPR7741 ---- Plant proteins ---- Avenin-F Source.2627: DFBPPR7742 ---- Plant proteins ---- Avenin-A Source.2628: DFBPPR7744 ---- Plant proteins ---- Maturase K Source.2629: DFBPPR7749 ---- Plant proteins ---- Avenin Source.2630: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.2631: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.2632: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.2633: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.2634: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.2635: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.2636: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1 Source.2637: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2 Source.2638: DFBPPR8357 ---- Plant proteins ---- 2S albumin Source.2639: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1 Source.2640: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3 Source.2641: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.2642: DFBPPR8370 ---- Plant proteins ---- Maturase K Source.2643: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.2644: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.2645: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.2646: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2647: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.2648: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase Source.2649: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin Source.2650: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.2651: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.2652: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101 Source.2653: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein Source.2654: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein Source.2655: DFBPPR8420 ---- Plant proteins ---- Peroxygenase Source.2656: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.2657: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.2658: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1 Source.2659: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2660: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.2661: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2 Source.2662: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.2663: DFBPPR8434 ---- Plant proteins ---- Lectin Source.2664: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.2665: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.2666: DFBPPR8445 ---- Plant proteins ---- Maturase K Source.2667: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase Source.2668: DFBPPR8448 ---- Plant proteins ---- Maturase K Source.2669: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.2670: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.2671: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein Source.2672: DFBPPR8458 ---- Plant proteins ---- Catalase Source.2673: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.2674: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta Source.2675: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.2676: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.2677: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.2678: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K Source.2679: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7 Source.2680: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.2681: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.2682: DFBPPR8489 ---- Milk proteins ---- Beta-casein Source.2683: DFBPPR8491 ---- Milk proteins ---- Osteopontin Source.2684: DFBPPR8492 ---- Milk proteins ---- Kappa-casein Source.2685: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.2686: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.2687: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.2688: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.2689: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.2690: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.2691: DFBPPR8505 ---- Milk proteins ---- Chymosin Source.2692: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.2693: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.2694: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.2695: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.2696: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.2697: DFBPPR8523 ---- Milk proteins ---- Perilipin-2 Source.2698: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.2699: DFBPPR15935 ---- Animal proteins ---- Catalase Source.2700: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.2701: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.2702: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.2703: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2704: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.2705: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2706: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.2707: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.2708: DFBPPR15953 ---- Animal proteins ---- Occludin Source.2709: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53 Source.2710: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2711: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase Source.2712: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.2713: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1 Source.2714: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.2715: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.2716: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.2717: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.2718: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.2719: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.2720: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.2721: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.2722: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.2723: DFBPPR15988 ---- Animal proteins ---- Vascular endothelial growth factor A Source.2724: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9 Source.2725: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.2726: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.2727: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2728: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.2729: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase Source.2730: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.2731: DFBPPR16001 ---- Animal proteins ---- Battenin Source.2732: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.2733: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein Source.2734: DFBPPR16007 ---- Animal proteins ---- Myocilin Source.2735: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.2736: DFBPPR16013 ---- Animal proteins ---- Osteocalcin Source.2737: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.2738: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.2739: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.2740: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36 Source.2741: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.2742: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.2743: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.2744: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2745: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Source.2746: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.2747: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.2748: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.2749: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.2750: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.2751: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.2752: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.2753: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.2754: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.2755: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog Source.2756: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.2757: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2758: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.2759: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.2760: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.2761: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type Source.2762: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor Source.2763: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln Source.2764: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.2765: DFBPPR16065 ---- Animal proteins ---- Caspase-3 Source.2766: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.2767: DFBPPR16071 ---- Animal proteins ---- CD44 antigen Source.2768: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.2769: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.2770: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A Source.2771: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.2772: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.2773: DFBPPR16093 ---- Animal proteins ---- Menin Source.2774: DFBPPR16094 ---- Animal proteins ---- Mastin Source.2775: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.2776: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.2777: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B Source.2778: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.2779: DFBPPR16103 ---- Animal proteins ---- Laforin Source.2780: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2781: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.2782: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.2783: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.2784: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.2785: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.2786: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.2787: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.2788: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.2789: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66 Source.2790: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.2791: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor Source.2792: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.2793: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.2794: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.2795: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2796: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.2797: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C Source.2798: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.2799: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.2800: DFBPPR16142 ---- Animal proteins ---- Procathepsin L Source.2801: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.2802: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.2803: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.2804: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.2805: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8 Source.2806: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.2807: DFBPPR16154 ---- Animal proteins ---- Apolipoprotein C-II Source.2808: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.2809: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.2810: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.2811: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.2812: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.2813: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.2814: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.2815: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A Source.2816: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.2817: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.2818: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.2819: DFBPPR16190 ---- Animal proteins ---- Aprataxin Source.2820: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.2821: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.2822: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2823: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.2824: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.2825: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2826: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.2827: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.2828: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.2829: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.2830: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.2831: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.2832: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2833: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.2834: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type Source.2835: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2836: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.2837: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.2838: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.2839: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.2840: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.2841: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2842: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.2843: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.2844: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.2845: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.2846: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24 Source.2847: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.2848: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein Source.2849: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.2850: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.2851: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.2852: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2853: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta Source.2854: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.2855: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2856: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain Source.2857: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15 Source.2858: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2859: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.2860: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.2861: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.2862: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.2863: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha Source.2864: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.2865: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone Source.2866: DFBPPR16265 ---- Animal proteins ---- Caspase-1 Source.2867: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.2868: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.2869: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin Source.2870: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2871: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta Source.2872: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.2873: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase Source.2874: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.2875: DFBPPR16279 ---- Animal proteins ---- Galactokinase Source.2876: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1 Source.2877: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2878: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.2879: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2880: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.2881: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.2882: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1 Source.2883: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.2884: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.2885: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2886: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.2887: DFBPPR16304 ---- Animal proteins ---- Cathepsin K Source.2888: DFBPPR16305 ---- Animal proteins ---- Phosducin Source.2889: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2890: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.2891: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.2892: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.2893: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.2894: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.2895: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.2896: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.2897: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.2898: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.2899: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.2900: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.2901: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.2902: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2903: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.2904: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.2905: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.2906: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5 Source.2907: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.2908: DFBPPR16368 ---- Animal proteins ---- Tyrosinase Source.2909: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.2910: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.2911: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.2912: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta Source.2913: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.2914: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.2915: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.2916: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.2917: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.2918: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.2919: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin Source.2920: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin Source.2921: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1 Source.2922: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.2923: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.2924: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.2925: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4 Source.2926: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.2927: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.2928: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase Source.2929: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.2930: DFBPPR16481 ---- Animal proteins ---- Caspase-12 Source.2931: DFBPPR16485 ---- Animal proteins ---- Cathepsin S Source.2932: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.2933: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha Source.2934: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1 Source.2935: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.2936: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.2937: DFBPPR16499 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.2938: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.2939: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2940: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.2941: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin Source.2942: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.2943: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.2944: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.2945: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.2946: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2947: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.2948: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.2949: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.2950: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B Source.2951: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.2952: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2953: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.2954: DFBPPR16543 ---- Animal proteins ---- ATP synthase protein 8 Source.2955: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.2956: DFBPPR16553 ---- Animal proteins ---- Tapasin Source.2957: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2958: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3 Source.2959: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.2960: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.2961: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.2962: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.2963: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2964: DFBPPR16582 ---- Animal proteins ---- Pepsin A Source.2965: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.2966: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein Source.2967: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.2968: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20 Source.2969: DFBPPR16588 ---- Animal proteins ---- Peptide YY Source.2970: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.2971: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S Source.2972: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.2973: DFBPPR16594 ---- Animal proteins ---- Macoilin Source.2974: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.2975: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A Source.2976: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.2977: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.2978: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain Source.2979: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.2980: DFBPPR16611 ---- Animal proteins ---- Nuclear transition protein 2 Source.2981: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.2982: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4 Source.2983: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2984: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.2985: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1 Source.2986: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2987: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.2988: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.2989: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.2990: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial Source.2991: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H Source.2992: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2993: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2994: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27 Source.2995: DFBPPR16660 ---- Animal proteins ---- Gamma-crystallin C Source.2996: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.2997: DFBPPR16663 ---- Animal proteins ---- Involucrin Source.2998: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin Source.2999: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.3000: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3 Source.3001: DFBPPR16680 ---- Animal proteins ---- Gastrin-releasing peptide Source.3002: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4 Source.3003: DFBPPR16689 ---- Animal proteins ---- Gamma-crystallin B Source.3004: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3 Source.3005: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor Source.3006: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.3007: DFBPPR16707 ---- Animal proteins ---- Trefoil factor 2 Source.3008: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190 Source.3009: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.3010: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.3011: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.3012: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1 Source.3013: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.3014: DFBPPR16739 ---- Animal proteins ---- Lengsin Source.3015: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM Source.3016: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.3017: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.3018: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.3019: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.3020: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.3021: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37 Source.3022: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial Source.3023: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A Source.3024: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35 Source.3025: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase Source.3026: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D Source.3027: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.3028: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta Source.3029: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8 Source.3030: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.3031: DFBPPR16796 ---- Animal proteins ---- Major prion protein Source.3032: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.3033: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.3034: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin Source.3035: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.3036: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease Source.3037: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.3038: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic Source.3039: DFBPPR16813 ---- Animal proteins ---- Prolactin Source.3040: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.3041: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.3042: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3043: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta Source.3044: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.3045: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II Source.3046: DFBPPR16827 ---- Animal proteins ---- S-arrestin Source.3047: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.3048: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.3049: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.3050: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6 Source.3051: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.3052: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.3053: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.3054: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.3055: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.3056: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.3057: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial Source.3058: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.3059: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.3060: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.3061: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin Source.3062: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.3063: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.3064: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Source.3065: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 Source.3066: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.3067: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.3068: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.3069: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.3070: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.3071: DFBPPR16894 ---- Animal proteins ---- Procathepsin L Source.3072: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.3073: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain Source.3074: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1 Source.3075: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.3076: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.3077: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.3078: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3079: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S Source.3080: DFBPPR16918 ---- Animal proteins ---- Spastin Source.3081: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.3082: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.3083: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.3084: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.3085: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor Source.3086: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.3087: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A Source.3088: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.3089: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease Source.3090: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.3091: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.3092: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.3093: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53 Source.3094: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.3095: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.3096: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin Source.3097: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.3098: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.3099: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3100: DFBPPR16960 ---- Animal proteins ---- Catalase Source.3101: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.3102: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.3103: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor Source.3104: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.3105: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta Source.3106: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.3107: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.3108: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8 Source.3109: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos Source.3110: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.3111: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1 Source.3112: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3 Source.3113: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase Source.3114: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.3115: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.3116: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.3117: DFBPPR16991 ---- Animal proteins ---- Osteocalcin Source.3118: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.3119: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1 Source.3120: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.3121: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.3122: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.3123: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.3124: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.3125: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.3126: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.3127: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.3128: DFBPPR17015 ---- Animal proteins ---- Microfibrillar-associated protein 2 Source.3129: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.3130: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.3131: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase Source.3132: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.3133: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.3134: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator Source.3135: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain Source.3136: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.3137: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2 Source.3138: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.3139: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.3140: DFBPPR17037 ---- Animal proteins ---- Annexin A1 Source.3141: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.3142: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.3143: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.3144: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.3145: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.3146: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.3147: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.3148: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.3149: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.3150: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin Source.3151: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1 Source.3152: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.3153: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.3154: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.3155: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5 Source.3156: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.3157: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.3158: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168 Source.3159: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.3160: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.3161: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.3162: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3163: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.3164: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.3165: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1 Source.3166: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.3167: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog Source.3168: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.3169: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.3170: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.3171: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1 Source.3172: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.3173: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.3174: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.3175: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.3176: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.3177: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.3178: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.3179: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.3180: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.3181: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.3182: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.3183: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Source.3184: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.3185: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1 Source.3186: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.3187: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.3188: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.3189: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta Source.3190: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2 Source.3191: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.3192: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.3193: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.3194: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.3195: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.3196: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.3197: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.3198: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.3199: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1 Source.3200: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.3201: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.3202: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6 Source.3203: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.3204: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2 Source.3205: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.3206: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.3207: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.3208: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2 Source.3209: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.3210: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.3211: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.3212: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.3213: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.3214: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.3215: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3 Source.3216: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.3217: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7 Source.3218: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.3219: DFBPPR17286 ---- Animal proteins ---- Septin-2 Source.3220: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.3221: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.3222: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1 Source.3223: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2 Source.3224: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B Source.3225: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.3226: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.3227: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.3228: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Source.3229: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.3230: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.3231: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha Source.3232: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.3233: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.3234: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.3235: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.3236: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.3237: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.3238: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.3239: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.3240: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.3241: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase Source.3242: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.3243: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.3244: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein Source.3245: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.3246: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.3247: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.3248: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.3249: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1 Source.3250: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.3251: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.3252: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating Source.3253: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.3254: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.3255: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.3256: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.3257: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.3258: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1 Source.3259: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.3260: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.3261: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.3262: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H Source.3263: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.3264: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.3265: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.3266: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5 Source.3267: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6 Source.3268: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.3269: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.3270: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.3271: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2 Source.3272: DFBPPR17379 ---- Animal proteins ---- Dematin Source.3273: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.3274: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2 Source.3275: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.3276: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.3277: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.3278: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.3279: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.3280: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.3281: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.3282: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C Source.3283: DFBPPR17401 ---- Animal proteins ---- Moesin Source.3284: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.3285: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.3286: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.3287: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.3288: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.3289: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.3290: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.3291: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type Source.3292: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5 Source.3293: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.3294: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.3295: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.3296: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.3297: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.3298: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.3299: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.3300: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5 Source.3301: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein Source.3302: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.3303: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.3304: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.3305: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.3306: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.3307: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.3308: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.3309: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.3310: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.3311: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.3312: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.3313: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.3314: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase Source.3315: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.3316: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.3317: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.3318: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.3319: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.3320: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.3321: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.3322: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3 Source.3323: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.3324: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.3325: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.3326: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.3327: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.3328: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.3329: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD Source.3330: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b Source.3331: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.3332: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.3333: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3334: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.3335: DFBPPR17517 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.3336: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase Source.3337: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.3338: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.3339: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Source.3340: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.3341: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.3342: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.3343: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E Source.3344: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.3345: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.3346: DFBPPR17538 ---- Animal proteins ---- Septin-7 Source.3347: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.3348: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.3349: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5 Source.3350: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.3351: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.3352: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.3353: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4 Source.3354: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.3355: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1 Source.3356: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.3357: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.3358: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.3359: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.3360: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta Source.3361: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.3362: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase Source.3363: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.3364: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1 Source.3365: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.3366: DFBPPR17586 ---- Animal proteins ---- Dermatopontin Source.3367: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.3368: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.3369: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.3370: DFBPPR17599 ---- Animal proteins ---- Tissue factor Source.3371: DFBPPR17600 ---- Animal proteins ---- Tissue factor Source.3372: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.3373: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH) Source.3374: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.3375: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.3376: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.3377: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.3378: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1 Source.3379: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.3380: DFBPPR17618 ---- Animal proteins ---- Synaptophysin Source.3381: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein Source.3382: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.3383: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.3384: DFBPPR17626 ---- Animal proteins ---- Elastin Source.3385: DFBPPR17646 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial Source.3386: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12 Source.3387: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.3388: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.3389: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta Source.3390: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2 Source.3391: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.3392: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.3393: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.3394: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.3395: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.3396: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.3397: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6 Source.3398: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.3399: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.3400: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.3401: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.3402: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A Source.3403: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.3404: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3405: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta Source.3406: DFBPPR17752 ---- Animal proteins ---- Follistatin Source.3407: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform Source.3408: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.3409: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.3410: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1 Source.3411: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.3412: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.3413: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein Source.3414: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta Source.3415: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.3416: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3 Source.3417: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.3418: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.3419: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.3420: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.3421: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C Source.3422: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.3423: DFBPPR17787 ---- Animal proteins ---- Septin-6 Source.3424: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.3425: DFBPPR17793 ---- Animal proteins ---- Interleukin-17A Source.3426: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.3427: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.3428: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.3429: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.3430: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.3431: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.3432: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.3433: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.3434: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1 Source.3435: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60 Source.3436: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.3437: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.3438: DFBPPR17816 ---- Animal proteins ---- Lumican Source.3439: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2 Source.3440: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.3441: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.3442: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.3443: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.3444: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.3445: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1 Source.3446: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6 Source.3447: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3 Source.3448: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13 Source.3449: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.3450: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B Source.3451: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase Source.3452: DFBPPR17849 ---- Animal proteins ---- Fibromodulin Source.3453: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.3454: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.3455: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.3456: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.3457: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.3458: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.3459: DFBPPR17858 ---- Animal proteins ---- Calsenilin Source.3460: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.3461: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.3462: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.3463: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.3464: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.3465: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.3466: DFBPPR17879 ---- Animal proteins ---- Menin Source.3467: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1 Source.3468: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.3469: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.3470: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase Source.3471: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.3472: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.3473: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.3474: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.3475: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.3476: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.3477: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.3478: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein Source.3479: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein Source.3480: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.3481: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.3482: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.3483: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.3484: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Source.3485: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.3486: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.3487: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.3488: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.3489: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2 Source.3490: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT Source.3491: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.3492: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.3493: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.3494: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.3495: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.3496: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.3497: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.3498: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.3499: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.3500: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.3501: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 Source.3502: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.3503: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.3504: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.3505: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase Source.3506: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.3507: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG Source.3508: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.3509: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.3510: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase Source.3511: DFBPPR17968 ---- Animal proteins ---- Cathelicidin-2 Source.3512: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.3513: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.3514: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.3515: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.3516: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.3517: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.3518: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein Source.3519: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B Source.3520: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.3521: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.3522: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.3523: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.3524: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.3525: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.3526: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase Source.3527: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.3528: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.3529: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.3530: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.3531: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.3532: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.3533: DFBPPR18017 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19 Source.3534: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.3535: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.3536: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3537: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta Source.3538: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.3539: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.3540: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.3541: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.3542: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1 Source.3543: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.3544: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.3545: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.3546: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T Source.3547: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.3548: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.3549: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2 Source.3550: DFBPPR18068 ---- Animal proteins ---- Annexin A11 Source.3551: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.3552: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.3553: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial Source.3554: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.3555: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta Source.3556: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.3557: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.3558: DFBPPR18088 ---- Animal proteins ---- Aprataxin Source.3559: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3560: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.3561: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.3562: DFBPPR18100 ---- Animal proteins ---- Derlin-1 Source.3563: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.3564: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.3565: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.3566: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.3567: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.3568: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.3569: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.3570: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.3571: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23 Source.3572: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.3573: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.3574: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.3575: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.3576: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.3577: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.3578: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.3579: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha Source.3580: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.3581: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.3582: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase Source.3583: DFBPPR18136 ---- Animal proteins ---- Septin-8 Source.3584: DFBPPR18137 ---- Animal proteins ---- Septin-8 Source.3585: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.3586: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1 Source.3587: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C Source.3588: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1 Source.3589: DFBPPR18142 ---- Animal proteins ---- Protein CASC3 Source.3590: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain Source.3591: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.3592: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.3593: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.3594: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.3595: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.3596: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.3597: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.3598: DFBPPR18168 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 W Source.3599: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin Source.3600: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.3601: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.3602: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.3603: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.3604: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1 Source.3605: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.3606: DFBPPR18199 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 N Source.3607: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.3608: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.3609: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.3610: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3611: DFBPPR18211 ---- Animal proteins ---- Phosducin Source.3612: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.3613: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.3614: DFBPPR18221 ---- Animal proteins ---- Gamma-crystallin B Source.3615: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.3616: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.3617: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B Source.3618: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3 Source.3619: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.3620: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.3621: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.3622: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2 Source.3623: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3 Source.3624: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa Source.3625: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.3626: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.3627: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.3628: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.3629: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.3630: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.3631: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.3632: DFBPPR18262 ---- Animal proteins ---- Claudin-1 Source.3633: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.3634: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.3635: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1 Source.3636: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.3637: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.3638: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial Source.3639: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B Source.3640: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.3641: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3642: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase Source.3643: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.3644: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56 Source.3645: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.3646: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.3647: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.3648: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein Source.3649: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.3650: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.3651: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.3652: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain Source.3653: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Source.3654: DFBPPR18313 ---- Animal proteins ---- Septin-12 Source.3655: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.3656: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.3657: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.3658: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.3659: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.3660: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1 Source.3661: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.3662: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase Source.3663: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.3664: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.3665: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.3666: DFBPPR18335 ---- Animal proteins ---- Septin-11 Source.3667: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2 Source.3668: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.3669: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.3670: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog Source.3671: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.3672: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.3673: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1 Source.3674: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B Source.3675: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase Source.3676: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q Source.3677: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.3678: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.3679: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.3680: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2 Source.3681: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.3682: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.3683: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.3684: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.3685: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.3686: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.3687: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.3688: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.3689: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.3690: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.3691: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.3692: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.3693: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.3694: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.3695: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6 Source.3696: DFBPPR18401 ---- Animal proteins ---- Protrudin Source.3697: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.3698: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.3699: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.3700: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos Source.3701: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.3702: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14 Source.3703: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.3704: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14 Source.3705: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.3706: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.3707: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.3708: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.3709: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.3710: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16 Source.3711: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1 Source.3712: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H Source.3713: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.3714: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.3715: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase Source.3716: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.3717: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2 Source.3718: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.3719: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4 Source.3720: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.3721: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1 Source.3722: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.3723: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.3724: DFBPPR18464 ---- Animal proteins ---- Regucalcin Source.3725: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.3726: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.3727: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.3728: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.3729: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.3730: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.3731: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.3732: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.3733: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.3734: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.3735: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase Source.3736: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6 Source.3737: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.3738: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.3739: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.3740: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.3741: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.3742: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.3743: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor Source.3744: DFBPPR18516 ---- Animal proteins ---- Galactokinase Source.3745: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.3746: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.3747: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.3748: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain Source.3749: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.3750: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain Source.3751: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain Source.3752: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.3753: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.3754: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.3755: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.3756: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.3757: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.3758: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1 Source.3759: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1 Source.3760: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.3761: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu Source.3762: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.3763: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.3764: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.3765: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.3766: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.3767: DFBPPR18563 ---- Animal proteins ---- Collectin-43 Source.3768: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.3769: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial Source.3770: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.3771: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.3772: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S Source.3773: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.3774: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1 Source.3775: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.3776: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.3777: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.3778: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.3779: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.3780: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.3781: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B Source.3782: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3 Source.3783: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.3784: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.3785: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26 Source.3786: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.3787: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3 Source.3788: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial Source.3789: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.3790: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha Source.3791: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.3792: DFBPPR18619 ---- Animal proteins ---- Ras-related protein Rab-7b Source.3793: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.3794: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.3795: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.3796: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2 Source.3797: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.3798: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB Source.3799: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.3800: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4 Source.3801: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3 Source.3802: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.3803: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.3804: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III Source.3805: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.3806: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.3807: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.3808: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.3809: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.3810: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor Source.3811: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase Source.3812: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.3813: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.3814: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Source.3815: DFBPPR18718 ---- Animal proteins ---- Chondroadherin Source.3816: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.3817: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.3818: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2 Source.3819: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.3820: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.3821: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.3822: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.3823: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.3824: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3 Source.3825: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.3826: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.3827: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.3828: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3 Source.3829: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.3830: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.3831: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.3832: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.3833: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1 Source.3834: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.3835: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.3836: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.3837: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.3838: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.3839: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU Source.3840: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.3841: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.3842: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.3843: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.3844: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.3845: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.3846: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.3847: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2 Source.3848: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.3849: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.3850: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.3851: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.3852: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.3853: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1 Source.3854: DFBPPR18815 ---- Animal proteins ---- Pantetheinase Source.3855: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.3856: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.3857: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.3858: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.3859: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.3860: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type Source.3861: DFBPPR18828 ---- Animal proteins ---- Follitropin subunit beta Source.3862: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1 Source.3863: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog Source.3864: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2 Source.3865: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.3866: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma Source.3867: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.3868: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.3869: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.3870: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.3871: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein Source.3872: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.3873: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.3874: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase Source.3875: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.3876: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.3877: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.3878: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.3879: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.3880: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.3881: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.3882: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.3883: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.3884: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.3885: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.3886: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.3887: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5 Source.3888: DFBPPR18894 ---- Animal proteins ---- NEDD8-conjugating enzyme Ubc12 Source.3889: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.3890: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.3891: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.3892: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.3893: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.3894: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3 Source.3895: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.3896: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.3897: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.3898: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.3899: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.3900: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.3901: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.3902: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.3903: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.3904: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.3905: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8 Source.3906: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.3907: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha Source.3908: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1 Source.3909: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.3910: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.3911: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.3912: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog Source.3913: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.3914: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb Source.3915: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3 Source.3916: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.3917: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.3918: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.3919: DFBPPR18986 ---- Animal proteins ---- Granzyme A Source.3920: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.3921: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5 Source.3922: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Source.3923: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa Source.3924: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.3925: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.3926: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.3927: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19 Source.3928: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1 Source.3929: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.3930: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.3931: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.3932: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.3933: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.3934: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.3935: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.3936: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.3937: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.3938: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.3939: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.3940: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.3941: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.3942: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.3943: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase Source.3944: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Source.3945: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.3946: DFBPPR19051 ---- Animal proteins ---- Pro-neuropeptide Y Source.3947: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.3948: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.3949: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.3950: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.3951: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.3952: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.3953: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.3954: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.3955: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.3956: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.3957: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.3958: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.3959: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2 Source.3960: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A Source.3961: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13 Source.3962: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.3963: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.3964: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9 Source.3965: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.3966: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.3967: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.3968: DFBPPR19108 ---- Animal proteins ---- Hepatocyte cell adhesion molecule Source.3969: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.3970: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.3971: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.3972: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2 Source.3973: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.3974: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2 Source.3975: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.3976: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.3977: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.3978: DFBPPR19124 ---- Animal proteins ---- Neuroguidin Source.3979: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1 Source.3980: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease Source.3981: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.3982: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11 Source.3983: DFBPPR19145 ---- Animal proteins ---- Pepsin A Source.3984: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.3985: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186 Source.3986: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.3987: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.3988: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.3989: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.3990: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial Source.3991: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.3992: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17 Source.3993: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone Source.3994: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33 Source.3995: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.3996: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1 Source.3997: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.3998: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.3999: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.4000: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.4001: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.4002: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.4003: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639 Source.4004: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7 Source.4005: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.4006: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2 Source.4007: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.4008: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.4009: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.4010: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.4011: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3 Source.4012: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4 Source.4013: DFBPPR19224 ---- Animal proteins ---- Fetuin-B Source.4014: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1 Source.4015: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.4016: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Source.4017: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.4018: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.4019: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.4020: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein Source.4021: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.4022: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.4023: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.4024: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.4025: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.4026: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4 Source.4027: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6 Source.4028: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.4029: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6 Source.4030: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1 Source.4031: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.4032: DFBPPR19278 ---- Animal proteins ---- R-spondin-3 Source.4033: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.4034: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.4035: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.4036: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3 Source.4037: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.4038: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1 Source.4039: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.4040: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.4041: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.4042: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial Source.4043: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.4044: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.4045: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.4046: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.4047: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.4048: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.4049: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4 Source.4050: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.4051: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9 Source.4052: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.4053: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.4054: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A Source.4055: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.4056: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.4057: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3 Source.4058: DFBPPR19359 ---- Animal proteins ---- Spartin Source.4059: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.4060: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1 Source.4061: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.4062: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.4063: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.4064: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.4065: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.4066: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1 Source.4067: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.4068: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A Source.4069: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.4070: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.4071: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.4072: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.4073: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1 Source.4074: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein Source.4075: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20 Source.4076: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4 Source.4077: DFBPPR19411 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 1 homolog Source.4078: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.4079: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.4080: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.4081: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.4082: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase Source.4083: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.4084: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.4085: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.4086: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase Source.4087: DFBPPR19429 ---- Animal proteins ---- Protein Spindly Source.4088: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1 Source.4089: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.4090: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59 Source.4091: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.4092: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3 Source.4093: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2 Source.4094: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.4095: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.4096: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial Source.4097: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.4098: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2 Source.4099: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.4100: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.4101: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.4102: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.4103: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.4104: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.4105: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.4106: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase Source.4107: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.4108: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5 Source.4109: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3 Source.4110: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.4111: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4 Source.4112: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.4113: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1 Source.4114: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.4115: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72 Source.4116: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N Source.4117: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.4118: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase Source.4119: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.4120: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2 Source.4121: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.4122: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L Source.4123: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.4124: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta Source.4125: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.4126: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1 Source.4127: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.4128: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase Source.4129: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase Source.4130: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.4131: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.4132: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.4133: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.4134: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1 Source.4135: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.4136: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.4137: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2 Source.4138: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.4139: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.4140: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.4141: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.4142: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.4143: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.4144: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.4145: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.4146: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.4147: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.4148: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial Source.4149: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.4150: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.4151: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1 Source.4152: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.4153: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1 Source.4154: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.4155: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1 Source.4156: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1 Source.4157: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin Source.4158: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.4159: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein Source.4160: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.4161: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.4162: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.4163: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.4164: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog Source.4165: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase Source.4166: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.4167: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.4168: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25 Source.4169: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4 Source.4170: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.4171: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.4172: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.4173: DFBPPR19654 ---- Animal proteins ---- Alpha-endosulfine Source.4174: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter Source.4175: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.4176: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.4177: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.4178: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3 Source.4179: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.4180: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.4181: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1 Source.4182: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.4183: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.4184: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase Source.4185: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.4186: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29 Source.4187: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.4188: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10 Source.4189: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.4190: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.4191: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase Source.4192: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog Source.4193: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.4194: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.4195: DFBPPR19738 ---- Animal proteins ---- Translocator protein Source.4196: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3 Source.4197: DFBPPR19745 ---- Animal proteins ---- Collectin-46 Source.4198: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.4199: DFBPPR19761 ---- Animal proteins ---- N-chimaerin Source.4200: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.4201: DFBPPR19769 ---- Animal proteins ---- Septin-14 Source.4202: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.4203: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.4204: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.4205: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.4206: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.4207: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1 Source.4208: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.4209: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.4210: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1 Source.4211: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3 Source.4212: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.4213: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.4214: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.4215: DFBPPR19810 ---- Animal proteins ---- Seipin Source.4216: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.4217: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.4218: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6 Source.4219: DFBPPR19820 ---- Animal proteins ---- Septin-10 Source.4220: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.4221: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.4222: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.4223: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial Source.4224: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1 Source.4225: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.4226: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.4227: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.4228: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.4229: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.4230: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.4231: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.4232: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.4233: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.4234: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.4235: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.4236: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1 Source.4237: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B Source.4238: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.4239: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.4240: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.4241: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.4242: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1 Source.4243: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.4244: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.4245: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3 Source.4246: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A Source.4247: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1 Source.4248: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.4249: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2 Source.4250: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial Source.4251: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase Source.4252: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.4253: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic Source.4254: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30 Source.4255: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.4256: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase Source.4257: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.4258: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial Source.4259: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.4260: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.4261: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18 Source.4262: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain Source.4263: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.4264: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.4265: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6 Source.4266: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial Source.4267: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1 Source.4268: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial Source.4269: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.4270: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor Source.4271: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform Source.4272: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.4273: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.4274: DFBPPR19949 ---- Animal proteins ---- Syndecan-2 Source.4275: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.4276: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10 Source.4277: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24 Source.4278: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein Source.4279: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.4280: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial Source.4281: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4 Source.4282: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.4283: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.4284: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.4285: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1 Source.4286: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.4287: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.4288: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39 Source.4289: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20 Source.4290: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.4291: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.4292: DFBPPR19995 ---- Animal proteins ---- 39S ribosomal protein L55, mitochondrial Source.4293: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.4294: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.4295: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1 Source.4296: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein Source.4297: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17 Source.4298: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.4299: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.4300: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.4301: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1 Source.4302: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12 Source.4303: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.4304: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.4305: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4 Source.4306: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9 Source.4307: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.4308: DFBPPR20036 ---- Animal proteins ---- Urocortin-3 Source.4309: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.4310: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase Source.4311: DFBPPR20045 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 2, mitochondrial Source.4312: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2 Source.4313: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.4314: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.4315: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1 Source.4316: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.4317: DFBPPR20060 ---- Animal proteins ---- Fibulin-5 Source.4318: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial Source.4319: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.4320: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4 Source.4321: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.4322: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.4323: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.4324: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47 Source.4325: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.4326: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.4327: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.4328: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.4329: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.4330: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.4331: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease Source.4332: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1 Source.4333: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2 Source.4334: DFBPPR20123 ---- Animal proteins ---- Securin Source.4335: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.4336: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.4337: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.4338: DFBPPR20145 ---- Animal proteins ---- Adipogenin Source.4339: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.4340: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.4341: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.4342: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.4343: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2 Source.4344: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.4345: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.4346: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.4347: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40 Source.4348: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98 Source.4349: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.4350: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4 Source.4351: DFBPPR20199 ---- Animal proteins ---- Claudin-7 Source.4352: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.4353: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.4354: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1 Source.4355: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.4356: DFBPPR20215 ---- Animal proteins ---- Caspase-3 Source.4357: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.4358: DFBPPR20224 ---- Animal proteins ---- Sclerostin Source.4359: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.4360: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.4361: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.4362: DFBPPR20235 ---- Animal proteins ---- Gamma-crystallin A Source.4363: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B Source.4364: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.4365: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan Source.4366: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2 Source.4367: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.4368: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1 Source.4369: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.4370: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.4371: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.4372: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.4373: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2 Source.4374: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.4375: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.4376: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.4377: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein Source.4378: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.4379: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.4380: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.4381: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.4382: DFBPPR20305 ---- Animal proteins ---- Nostrin Source.4383: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3 Source.4384: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV Source.4385: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.4386: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.4387: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.4388: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.4389: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial Source.4390: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.4391: DFBPPR20341 ---- Animal proteins ---- Peptide YY Source.4392: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1 Source.4393: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14 Source.4394: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.4395: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.4396: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.4397: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7 Source.4398: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.4399: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C Source.4400: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.4401: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1 Source.4402: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial Source.4403: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2 Source.4404: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.4405: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.4406: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.4407: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.4408: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.4409: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.4410: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.4411: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial Source.4412: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma Source.4413: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2 Source.4414: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.4415: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.4416: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.4417: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.4418: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.4419: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1 Source.4420: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5 Source.4421: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.4422: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.4423: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5 Source.4424: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.4425: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4 Source.4426: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.4427: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3 Source.4428: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2 Source.4429: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.4430: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP Source.4431: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.4432: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3 Source.4433: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.4434: DFBPPR20478 ---- Animal proteins ---- Macoilin Source.4435: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1 Source.4436: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2 Source.4437: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.4438: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.4439: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.4440: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.4441: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2 Source.4442: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial Source.4443: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.4444: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.4445: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.4446: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2 Source.4447: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.4448: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.4449: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36 Source.4450: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.4451: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.4452: DFBPPR20529 ---- Animal proteins ---- Transgelin Source.4453: DFBPPR20531 ---- Animal proteins ---- Myozenin-2 Source.4454: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.4455: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.4456: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.4457: DFBPPR20537 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 3 Source.4458: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16 Source.4459: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.4460: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial Source.4461: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.4462: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6 Source.4463: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.4464: DFBPPR20560 ---- Animal proteins ---- Draxin Source.4465: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.4466: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein Source.4467: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10 Source.4468: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.4469: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.4470: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.4471: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.4472: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.4473: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein Source.4474: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.4475: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.4476: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74 Source.4477: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi Source.4478: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.4479: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.4480: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.4481: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.4482: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.4483: DFBPPR20613 ---- Animal proteins ---- Gamma-crystallin D Source.4484: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.4485: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.4486: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.4487: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.4488: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2 Source.4489: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.4490: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47 Source.4491: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.4492: DFBPPR20638 ---- Animal proteins ---- DPH3 homolog Source.4493: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.4494: DFBPPR20647 ---- Animal proteins ---- Annexin A8 Source.4495: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa Source.4496: DFBPPR20656 ---- Animal proteins ---- Protein archease Source.4497: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.4498: DFBPPR20659 ---- Animal proteins ---- Cystinosin Source.4499: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.4500: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain Source.4501: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.4502: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial Source.4503: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.4504: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.4505: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.4506: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.4507: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.4508: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.4509: DFBPPR20690 ---- Animal proteins ---- Neurotrimin Source.4510: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.4511: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.4512: DFBPPR20699 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 31 Source.4513: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.4514: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like Source.4515: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.4516: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.4517: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.4518: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3 Source.4519: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase Source.4520: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain Source.4521: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase Source.4522: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.4523: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.4524: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6 Source.4525: DFBPPR20730 ---- Animal proteins ---- Gamma-crystallin F Source.4526: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.4527: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K Source.4528: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial Source.4529: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.4530: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.4531: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.4532: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf Source.4533: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.4534: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.4535: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.4536: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15 Source.4537: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.4538: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.4539: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13 Source.4540: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17 Source.4541: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial Source.4542: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.4543: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171 Source.4544: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.4545: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Source.4546: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2 Source.4547: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2 Source.4548: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.4549: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.4550: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2 Source.4551: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2 Source.4552: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.4553: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.4554: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial Source.4555: DFBPPR20828 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1 Source.4556: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog Source.4557: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2 Source.4558: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.4559: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2 Source.4560: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1 Source.4561: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.4562: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.4563: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.4564: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.4565: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.4566: DFBPPR20853 ---- Animal proteins ---- Hemopexin Source.4567: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.4568: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4 Source.4569: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5 Source.4570: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.4571: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1 Source.4572: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.4573: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2 Source.4574: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.4575: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237 Source.4576: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3 Source.4577: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1 Source.4578: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3 Source.4579: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.4580: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1 Source.4581: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.4582: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a Source.4583: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3 Source.4584: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.4585: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.4586: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3 Source.4587: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.4588: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.4589: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.4590: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1 Source.4591: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A Source.4592: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.4593: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A Source.4594: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4 Source.4595: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A Source.4596: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.4597: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B Source.4598: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9 Source.4599: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2 Source.4600: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1 Source.4601: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10 Source.4602: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog Source.4603: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.4604: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein Source.4605: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.4606: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1 Source.4607: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.4608: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.4609: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.4610: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.4611: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27 Source.4612: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial Source.4613: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821 Source.4614: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.4615: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B Source.4616: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.4617: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A Source.4618: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.4619: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.4620: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2 Source.4621: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor Source.4622: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.4623: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.4624: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.4625: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26 Source.4626: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.4627: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein Source.4628: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein Source.4629: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1 Source.4630: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.4631: DFBPPR21040 ---- Animal proteins ---- Neuritin Source.4632: DFBPPR21041 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein Source.4633: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.4634: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.4635: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.4636: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.4637: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.4638: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B Source.4639: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.4640: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.4641: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.4642: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.4643: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial Source.4644: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.4645: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.4646: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.4647: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.4648: DFBPPR21090 ---- Animal proteins ---- Developmental pluripotency-associated protein 3 Source.4649: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.4650: DFBPPR21092 ---- Animal proteins ---- Calponin-1 Source.4651: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148 Source.4652: DFBPPR21095 ---- Animal proteins ---- 28S ribosomal protein S33, mitochondrial Source.4653: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.4654: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.4655: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32 Source.4656: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin Source.4657: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial Source.4658: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.4659: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein Source.4660: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.4661: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.4662: DFBPPR21155 ---- Animal proteins ---- Cyclin-H Source.4663: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1 Source.4664: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.4665: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1 Source.4666: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4 Source.4667: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6 Source.4668: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.4669: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A Source.4670: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase Source.4671: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.4672: DFBPPR21187 ---- Animal proteins ---- Plasmolipin Source.4673: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22 Source.4674: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.4675: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1 Source.4676: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4 Source.4677: DFBPPR21197 ---- Animal proteins ---- Spindle and kinetochore-associated protein 2 Source.4678: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.4679: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1 Source.4680: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.4681: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1 Source.4682: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome Source.4683: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2 Source.4684: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.4685: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.4686: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.4687: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.4688: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.4689: DFBPPR21242 ---- Animal proteins ---- Tachykinin-3 Source.4690: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.4691: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial Source.4692: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.4693: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.4694: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.4695: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.4696: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B Source.4697: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.4698: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.4699: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.4700: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.4701: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen Source.4702: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.4703: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.4704: DFBPPR21293 ---- Animal proteins ---- IST1 homolog Source.4705: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.4706: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.4707: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.4708: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial Source.4709: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4 Source.4710: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H Source.4711: DFBPPR21323 ---- Animal proteins ---- Trefoil factor 3 Source.4712: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.4713: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4 Source.4714: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.4715: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9 Source.4716: DFBPPR21343 ---- Animal proteins ---- DNA polymerase delta subunit 4 Source.4717: DFBPPR21346 ---- Animal proteins ---- Ameloblastin Source.4718: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.4719: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3 Source.4720: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158 Source.4721: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.4722: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4 Source.4723: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.4724: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24 Source.4725: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18 Source.4726: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.4727: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.4728: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.4729: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.4730: DFBPPR21376 ---- Animal proteins ---- Calponin-3 Source.4731: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu Source.4732: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4 Source.4733: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.4734: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.4735: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.4736: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog Source.4737: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.4738: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.4739: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1 Source.4740: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5 Source.4741: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein Source.4742: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37 Source.4743: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.4744: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.4745: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like Source.4746: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1 Source.4747: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1 Source.4748: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.4749: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.4750: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform Source.4751: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.4752: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.4753: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5 Source.4754: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.4755: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2 Source.4756: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4 Source.4757: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1 Source.4758: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.4759: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.4760: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.4761: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein Source.4762: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.4763: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.4764: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8 Source.4765: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.4766: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.4767: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.4768: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.4769: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.4770: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1 Source.4771: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1 Source.4772: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8 Source.4773: DFBPPR21486 ---- Animal proteins ---- Caspase recruitment domain-containing protein 19 Source.4774: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.4775: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.4776: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like Source.4777: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3 Source.4778: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.4779: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.4780: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2 Source.4781: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.4782: DFBPPR21528 ---- Animal proteins ---- Vasculin Source.4783: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19 Source.4784: DFBPPR21535 ---- Animal proteins ---- Gastrotropin Source.4785: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.4786: DFBPPR21546 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 29 Source.4787: DFBPPR21548 ---- Animal proteins ---- Cornifelin Source.4788: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3 Source.4789: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma Source.4790: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c Source.4791: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.4792: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1 Source.4793: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.4794: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.4795: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.4796: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein Source.4797: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.4798: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein Source.4799: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2 Source.4800: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1 Source.4801: DFBPPR21586 ---- Animal proteins ---- Cyclin-C Source.4802: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.4803: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.4804: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.4805: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.4806: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.4807: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork Source.4808: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.4809: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.4810: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.4811: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.4812: DFBPPR21630 ---- Animal proteins ---- Maspardin Source.4813: DFBPPR21631 ---- Animal proteins ---- 39S ribosomal protein L49, mitochondrial Source.4814: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19 Source.4815: DFBPPR21640 ---- Animal proteins ---- 60S ribosomal protein L35 Source.4816: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein Source.4817: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44 Source.4818: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.4819: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1 Source.4820: DFBPPR21654 ---- Animal proteins ---- DET1- and DDB1-associated protein 1 Source.4821: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7 Source.4822: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.4823: DFBPPR21667 ---- Animal proteins ---- Four and a half LIM domains protein 5 Source.4824: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.4825: DFBPPR21683 ---- Animal proteins ---- Serine protease 23 Source.4826: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like Source.4827: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B Source.4828: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.4829: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.4830: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.4831: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.4832: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.4833: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial Source.4834: DFBPPR21728 ---- Animal proteins ---- Galectin-9 Source.4835: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.4836: DFBPPR21740 ---- Animal proteins ---- 60S ribosomal protein L36 Source.4837: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.4838: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.4839: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190 Source.4840: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein Source.4841: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.4842: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25 Source.4843: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.4844: DFBPPR21768 ---- Animal proteins ---- Tektin-4 Source.4845: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.4846: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.4847: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130 Source.4848: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2 Source.4849: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.4850: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.4851: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3 Source.4852: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10 Source.4853: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.4854: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.4855: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.4856: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24 Source.4857: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.4858: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11 Source.4859: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2 Source.4860: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.4861: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD Source.4862: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1 Source.4863: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.4864: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B Source.4865: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.4866: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2 Source.4867: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2 Source.4868: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS Source.4869: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.4870: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.4871: DFBPPR21878 ---- Animal proteins ---- Statherin Source.4872: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.4873: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.4874: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.4875: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial Source.4876: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1 Source.4877: DFBPPR21902 ---- Animal proteins ---- Centromere protein N Source.4878: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.4879: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2 Source.4880: DFBPPR21920 ---- Animal proteins ---- Protein DPCD Source.4881: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1 Source.4882: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.4883: DFBPPR21930 ---- Animal proteins ---- Protein Churchill Source.4884: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8 Source.4885: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2 Source.4886: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.4887: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.4888: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.4889: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.4890: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414 Source.4891: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7 Source.4892: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.4893: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.4894: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.4895: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.4896: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10 Source.4897: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1 Source.4898: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog Source.4899: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6 Source.4900: DFBPPR21978 ---- Animal proteins ---- Cx9C motif-containing protein 4 Source.4901: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.4902: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.4903: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1 Source.4904: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8 Source.4905: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like Source.4906: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1 Source.4907: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1 Source.4908: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.4909: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a Source.4910: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.4911: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E Source.4912: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4 Source.4913: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.4914: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.4915: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2 Source.4916: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.4917: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein Source.4918: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.4919: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2 Source.4920: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4 Source.4921: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.4922: DFBPPR22044 ---- Animal proteins ---- Transgelin-2 Source.4923: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B Source.4924: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.4925: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.4926: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog Source.4927: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ Source.4928: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.4929: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A Source.4930: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.4931: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like Source.4932: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.4933: DFBPPR22072 ---- Animal proteins ---- Brain protein I3 Source.4934: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4 Source.4935: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.4936: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.4937: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein Source.4938: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7 Source.4939: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor Source.4940: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.4941: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.4942: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41 Source.4943: DFBPPR22099 ---- Animal proteins ---- Beta-centractin Source.4944: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1 Source.4945: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1 Source.4946: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5 Source.4947: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.4948: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.4949: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog Source.4950: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein Source.4951: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.4952: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.4953: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.4954: DFBPPR22148 ---- Animal proteins ---- Hemogen Source.4955: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1 Source.4956: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.4957: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.4958: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog Source.4959: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1 Source.4960: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A Source.4961: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.4962: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182 Source.4963: DFBPPR22173 ---- Animal proteins ---- Electron transfer flavoprotein regulatory factor 1 Source.4964: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog Source.4965: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.4966: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.4967: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8 Source.4968: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5 Source.4969: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5 Source.4970: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein Source.4971: DFBPPR22200 ---- Animal proteins ---- Profilin-4 Source.4972: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.4973: DFBPPR22213 ---- Animal proteins ---- Protein TEX261 Source.4974: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B Source.4975: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.4976: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog Source.4977: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.4978: DFBPPR22218 ---- Animal proteins ---- Galectin-4 Source.4979: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9 Source.4980: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300 Source.4981: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.4982: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.4983: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.4984: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26 Source.4985: DFBPPR22246 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor Source.4986: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34 Source.4987: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.4988: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1 Source.4989: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog Source.4990: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial Source.4991: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1 Source.4992: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.4993: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.4994: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.4995: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.4996: DFBPPR22297 ---- Animal proteins ---- Histatherin Source.4997: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2 Source.4998: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16 Source.4999: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2 Source.5000: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.5001: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39 Source.5002: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.5003: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.5004: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A Source.5005: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.5006: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.5007: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80 Source.5008: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.5009: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.5010: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.5011: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.5012: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein Source.5013: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92 Source.5014: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39 Source.5015: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5 Source.5016: DFBPPR22392 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1A Source.5017: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10 Source.5018: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.5019: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3 Source.5020: DFBPPR22399 ---- Animal proteins ---- Transgelin-3 Source.5021: DFBPPR22402 ---- Animal proteins ---- Alternative prion protein Source.5022: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog Source.5023: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5 Source.5024: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.5025: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46 Source.5026: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.5027: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1 Source.5028: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B Source.5029: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2 Source.5030: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein Source.5031: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.5032: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein Source.5033: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13 Source.5034: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.5035: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog Source.5036: DFBPPR22479 ---- Animal proteins ---- Transcription elongation factor A protein-like 1 Source.5037: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.5038: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.5039: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.5040: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1 Source.5041: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.5042: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2 Source.5043: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2 Source.5044: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141 Source.5045: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42 Source.5046: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169 Source.5047: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C Source.5048: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.5049: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.5050: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.5051: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2 Source.5052: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.5053: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1 Source.5054: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18 Source.5055: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein Source.5056: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.5057: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.5058: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog Source.5059: DFBPPR22577 ---- Animal proteins ---- Uncharacterized protein C12orf31 homolog Source.5060: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1 Source.5061: DFBPPR22582 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein Source.5062: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2 Source.5063: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.5064: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53 Source.5065: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128 Source.5066: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71 Source.5067: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54 Source.5068: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog Source.5069: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.5070: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1 Source.5071: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30 Source.5072: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61 Source.5073: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4 Source.5074: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.5075: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog Source.5076: DFBPPR22650 ---- Animal proteins ---- Protein FAM183A Source.5077: DFBPPR22653 ---- Animal proteins ---- Coiled-coil domain-containing protein 152 Source.5078: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog Source.5079: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog Source.5080: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89 Source.5081: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9 Source.5082: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.5083: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog Source.5084: DFBPPR22682 ---- Animal proteins ---- Protein FAM216A Source.5085: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C Source.5086: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.5087: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1 Source.5088: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B Source.5089: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein Source.5090: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28 Source.5091: DFBPPR22710 ---- Animal proteins ---- RIIa domain-containing protein 1 Source.5092: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog Source.5093: DFBPPR22731 ---- Animal proteins ---- Uncharacterized protein C12orf54 homolog Source.5094: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog Source.5095: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog Source.5096: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog Source.5097: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog Source.5098: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog Source.5099: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.5100: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog Source.5101: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6 Source.5102: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.5103: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.5104: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.5105: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.5106: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.5107: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.5108: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3 Source.5109: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.5110: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.5111: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.5112: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.5113: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.5114: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.5115: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.5116: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase Source.5117: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.5118: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.5119: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.5120: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.5121: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.5122: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial Source.5123: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.5124: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.5125: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.5126: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.5127: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.5128: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.5129: DFBPPR8568 ---- Animal proteins ---- Vascular endothelial growth factor A Source.5130: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.5131: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.5132: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.5133: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1 Source.5134: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.5135: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.5136: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.5137: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.5138: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.5139: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.5140: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B Source.5141: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.5142: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.5143: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.5144: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.5145: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.5146: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.5147: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.5148: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.5149: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.5150: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.5151: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6 Source.5152: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.5153: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.5154: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.5155: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.5156: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.5157: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.5158: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.5159: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1 Source.5160: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.5161: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.5162: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1 Source.5163: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.5164: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.5165: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.5166: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.5167: DFBPPR8642 ---- Animal proteins ---- Major prion protein Source.5168: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.5169: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.5170: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.5171: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.5172: DFBPPR8649 ---- Animal proteins ---- Acrosin Source.5173: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.5174: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.5175: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog Source.5176: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta Source.5177: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.5178: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.5179: DFBPPR8668 ---- Animal proteins ---- Annexin A1 Source.5180: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.5181: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.5182: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.5183: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.5184: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.5185: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.5186: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.5187: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.5188: DFBPPR8694 ---- Animal proteins ---- Spastin Source.5189: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.5190: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.5191: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C Source.5192: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.5193: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein Source.5194: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53 Source.5195: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.5196: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.5197: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.5198: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6 Source.5199: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.5200: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.5201: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9 Source.5202: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.5203: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.5204: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.5205: DFBPPR8734 ---- Animal proteins ---- Clusterin Source.5206: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H Source.5207: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.5208: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.5209: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.5210: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1 Source.5211: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.5212: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.5213: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.5214: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.5215: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.5216: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.5217: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.5218: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin Source.5219: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.5220: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.5221: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.5222: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.5223: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.5224: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.5225: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.5226: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain Source.5227: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.5228: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.5229: DFBPPR8787 ---- Animal proteins ---- Cathepsin D Source.5230: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.5231: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.5232: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain Source.5233: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.5234: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin Source.5235: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.5236: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.5237: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II Source.5238: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase Source.5239: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.5240: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.5241: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.5242: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.5243: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.5244: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.5245: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.5246: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2 Source.5247: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase Source.5248: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.5249: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.5250: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.5251: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5 Source.5252: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1 Source.5253: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance Source.5254: DFBPPR8838 ---- Animal proteins ---- Cathepsin K Source.5255: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.5256: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1 Source.5257: DFBPPR8843 ---- Animal proteins ---- Pepsin A Source.5258: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.5259: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.5260: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog Source.5261: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.5262: DFBPPR8870 ---- Animal proteins ---- Ribonuclease K3 Source.5263: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.5264: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.5265: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.5266: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.5267: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.5268: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.5269: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.5270: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.5271: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.5272: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.5273: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.5274: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.5275: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.5276: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.5277: DFBPPR8926 ---- Animal proteins ---- Osteocalcin Source.5278: DFBPPR8927 ---- Animal proteins ---- Pro-neuropeptide Y Source.5279: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.5280: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta Source.5281: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.5282: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.5283: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B Source.5284: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.5285: DFBPPR8973 ---- Animal proteins ---- Caspase-3 Source.5286: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III Source.5287: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.5288: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.5289: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.5290: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.5291: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.5292: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.5293: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.5294: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta Source.5295: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3 Source.5296: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component Source.5297: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic Source.5298: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.5299: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.5300: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1 Source.5301: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.5302: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.5303: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.5304: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.5305: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.5306: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.5307: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.5308: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.5309: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2 Source.5310: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.5311: DFBPPR9055 ---- Animal proteins ---- Ameloblastin Source.5312: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain Source.5313: DFBPPR9061 ---- Animal proteins ---- Caspase-1 Source.5314: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.5315: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.5316: DFBPPR9069 ---- Animal proteins ---- E-selectin Source.5317: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4 Source.5318: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.5319: DFBPPR9073 ---- Animal proteins ---- Vitronectin Source.5320: DFBPPR9074 ---- Animal proteins ---- Trefoil factor 2 Source.5321: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.5322: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.5323: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.5324: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.5325: DFBPPR9093 ---- Animal proteins ---- Hemopexin Source.5326: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.5327: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.5328: DFBPPR9098 ---- Animal proteins ---- Gastrotropin Source.5329: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.5330: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.5331: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.5332: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.5333: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator Source.5334: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.5335: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.5336: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.5337: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.5338: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase Source.5339: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6 Source.5340: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.5341: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.5342: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.5343: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.5344: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.5345: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.5346: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1 Source.5347: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.5348: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.5349: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.5350: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.5351: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.5352: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.5353: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.5354: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.5355: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase Source.5356: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2 Source.5357: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta Source.5358: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.5359: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6 Source.5360: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.5361: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.5362: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.5363: DFBPPR9189 ---- Animal proteins ---- Follitropin subunit beta Source.5364: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Source.5365: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2 Source.5366: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein Source.5367: DFBPPR9198 ---- Animal proteins ---- Fibroblast growth factor 7 Source.5368: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.5369: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a Source.5370: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D Source.5371: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.5372: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain Source.5373: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.5374: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1 Source.5375: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.5376: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.5377: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.5378: DFBPPR9221 ---- Animal proteins ---- Catalase Source.5379: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.5380: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.5381: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.5382: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.5383: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10 Source.5384: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.5385: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta Source.5386: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B Source.5387: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29 Source.5388: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.5389: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin Source.5390: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.5391: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor Source.5392: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.5393: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.5394: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.5395: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase Source.5396: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.5397: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.5398: DFBPPR9266 ---- Animal proteins ---- Sorbitol dehydrogenase Source.5399: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.5400: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.5401: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.5402: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.5403: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.5404: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type Source.5405: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.5406: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.5407: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.5408: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.5409: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2 Source.5410: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27 Source.5411: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.5412: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.5413: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10 Source.5414: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2 Source.5415: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.5416: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4 Source.5417: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.5418: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase Source.5419: DFBPPR9304 ---- Animal proteins ---- Peroxiredoxin-2 Source.5420: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.5421: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.5422: DFBPPR9308 ---- Animal proteins ---- Aromatase 3 Source.5423: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.5424: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3 Source.5425: DFBPPR9314 ---- Animal proteins ---- Regucalcin Source.5426: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1 Source.5427: DFBPPR9318 ---- Animal proteins ---- Alpha-endosulfine Source.5428: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.5429: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.5430: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.5431: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha Source.5432: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.5433: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor Source.5434: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.5435: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.5436: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.5437: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.5438: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.5439: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin Source.5440: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.5441: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.5442: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.5443: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.5444: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.5445: DFBPPR9363 ---- Animal proteins ---- Moesin Source.5446: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.5447: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.5448: DFBPPR9367 ---- Animal proteins ---- Peptide YY Source.5449: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.5450: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.5451: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.5452: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.5453: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4 Source.5454: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.5455: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.5456: DFBPPR9404 ---- Animal proteins ---- Tryptase Source.5457: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.5458: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.5459: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.5460: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.5461: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.5462: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.5463: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.5464: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.5465: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.5466: DFBPPR9428 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.5467: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59 Source.5468: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59 Source.5469: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5 Source.5470: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.5471: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.5472: DFBPPR9445 ---- Animal proteins ---- Securin Source.5473: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.5474: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.5475: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.5476: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.5477: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.5478: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.5479: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.5480: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1 Source.5481: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type Source.5482: DFBPPR9484 ---- Animal proteins ---- Macoilin Source.5483: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.5484: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.5485: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.5486: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.5487: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.5488: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.5489: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.5490: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.5491: DFBPPR9523 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.5492: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.5493: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.5494: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.5495: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE Source.5496: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.5497: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.5498: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase Source.5499: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.5500: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2 Source.5501: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.5502: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.5503: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.5504: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C Source.5505: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.5506: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.5507: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.5508: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3 Source.5509: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.5510: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.5511: DFBPPR9588 ---- Animal proteins ---- ATP synthase protein 8 Source.5512: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2 Source.5513: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.5514: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor Source.5515: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.5516: DFBPPR9602 ---- Animal proteins ---- Gastrin-releasing peptide Source.5517: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.5518: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.5519: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor Source.5520: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.5521: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.5522: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.5523: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.5524: DFBPPR9630 ---- Animal proteins ---- Calponin-1 Source.5525: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.5526: DFBPPR9633 ---- Animal proteins ---- Claudin-17 Source.5527: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.5528: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase Source.5529: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.5530: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.5531: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.5532: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6 Source.5533: DFBPPR9662 ---- Animal proteins ---- 60S ribosomal protein L35 Source.5534: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.5535: DFBPPR9664 ---- Animal proteins ---- Perilipin-2 Source.5536: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1 Source.5537: DFBPPR9669 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.5538: DFBPPR9671 ---- Animal proteins ---- S-arrestin Source.5539: DFBPPR9673 ---- Animal proteins ---- Neurokinin-B Source.5540: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.5541: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.5542: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.5543: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1 Source.5544: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1 Source.5545: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.5546: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.5547: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39 Source.5548: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta Source.5549: DFBPPR9711 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B Source.5550: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.5551: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.5552: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain Source.5553: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.5554: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.5555: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.5556: DFBPPR9730 ---- Animal proteins ---- Urotensin-2 Source.5557: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7 Source.5558: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.5559: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.5560: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis Source.5561: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain Source.5562: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.5563: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.5564: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region Source.5565: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.5566: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide Source.5567: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.5568: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.5569: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.5570: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.5571: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1 Source.5572: DFBPPR9784 ---- Animal proteins ---- Translocator protein Source.5573: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32 Source.5574: DFBPPR9786 ---- Animal proteins ---- Adipogenin Source.5575: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.5576: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.5577: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.5578: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H Source.5579: DFBPPR9807 ---- Animal proteins ---- Galectin-4 Source.5580: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.5581: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.5582: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.5583: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.5584: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.5585: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1 Source.5586: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.5587: DFBPPR9843 ---- Animal proteins ---- P protein Source.5588: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.5589: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.5590: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.5591: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.5592: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.5593: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3 Source.5594: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.5595: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.5596: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.5597: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9 Source.5598: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3 Source.5599: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B Source.5600: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin Source.5601: DFBPPR9927 ---- Animal proteins ---- Protein BTG3 Source.5602: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.5603: DFBPPR9947 ---- Animal proteins ---- Hypothalamic tetradecapeptide Source.5604: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.5605: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.5606: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.5607: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.5608: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.5609: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor Source.5610: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.5611: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.5612: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2 Source.5613: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.5614: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.5615: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.5616: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput Source.5617: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.5618: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.5619: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.5620: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.5621: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.5622: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.5623: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.5624: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain Source.5625: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type Source.5626: DFBPPR10004 ---- Animal proteins ---- Spastin Source.5627: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.5628: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.5629: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.5630: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.5631: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.5632: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.5633: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides Source.5634: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.5635: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.5636: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.5637: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.5638: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.5639: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.5640: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.5641: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.5642: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.5643: DFBPPR10045 ---- Animal proteins ---- Albumin Source.5644: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.5645: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.5646: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.5647: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.5648: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a Source.5649: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.5650: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.5651: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.5652: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.5653: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6 Source.5654: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9 Source.5655: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog Source.5656: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.5657: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1 Source.5658: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.5659: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.5660: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.5661: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.5662: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2 Source.5663: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.5664: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.5665: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor Source.5666: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.5667: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1 Source.5668: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.5669: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.5670: DFBPPR10107 ---- Animal proteins ---- Ovomucoid Source.5671: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase Source.5672: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.5673: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.5674: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3 Source.5675: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.5676: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.5677: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.5678: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.5679: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.5680: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.5681: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8 Source.5682: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.5683: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.5684: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2 Source.5685: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.5686: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.5687: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.5688: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.5689: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.5690: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.5691: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.5692: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.5693: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5 Source.5694: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog Source.5695: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.5696: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.5697: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.5698: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1 Source.5699: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.5700: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.5701: DFBPPR10172 ---- Animal proteins ---- Basic helix-loop-helix transcription factor scleraxis Source.5702: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.5703: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.5704: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.5705: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3 Source.5706: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.5707: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.5708: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.5709: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.5710: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk Source.5711: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9 Source.5712: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.5713: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.5714: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.5715: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.5716: DFBPPR10205 ---- Animal proteins ---- Noelin Source.5717: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.5718: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.5719: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.5720: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4 Source.5721: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.5722: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.5723: DFBPPR10217 ---- Animal proteins ---- Follistatin Source.5724: DFBPPR10218 ---- Animal proteins ---- Occludin Source.5725: DFBPPR10220 ---- Animal proteins ---- Paxillin Source.5726: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance Source.5727: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha Source.5728: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.5729: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11 Source.5730: DFBPPR10228 ---- Animal proteins ---- Presenilin-2 Source.5731: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.5732: DFBPPR10231 ---- Animal proteins ---- Basigin Source.5733: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.5734: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.5735: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8 Source.5736: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.5737: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2 Source.5738: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B Source.5739: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1 Source.5740: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.5741: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.5742: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.5743: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.5744: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6 Source.5745: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.5746: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.5747: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.5748: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.5749: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.5750: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.5751: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.5752: DFBPPR10268 ---- Animal proteins ---- CD166 antigen Source.5753: DFBPPR10270 ---- Animal proteins ---- Agrin Source.5754: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.5755: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.5756: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.5757: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.5758: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.5759: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.5760: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.5761: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.5762: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.5763: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.5764: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.5765: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.5766: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.5767: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.5768: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog Source.5769: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2 Source.5770: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.5771: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.5772: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.5773: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.5774: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.5775: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.5776: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.5777: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.5778: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.5779: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1 Source.5780: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.5781: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1 Source.5782: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.5783: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7 Source.5784: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.5785: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein Source.5786: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.5787: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.5788: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2 Source.5789: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.5790: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.5791: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.5792: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK Source.5793: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.5794: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta Source.5795: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A Source.5796: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.5797: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.5798: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.5799: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.5800: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.5801: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.5802: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.5803: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24 Source.5804: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.5805: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.5806: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.5807: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.5808: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.5809: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.5810: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.5811: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.5812: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf Source.5813: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.5814: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.5815: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.5816: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.5817: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.5818: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.5819: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.5820: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.5821: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A Source.5822: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.5823: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.5824: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.5825: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.5826: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.5827: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10 Source.5828: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.5829: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.5830: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform Source.5831: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.5832: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16 Source.5833: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.5834: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.5835: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.5836: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.5837: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.5838: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.5839: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.5840: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.5841: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.5842: DFBPPR10459 ---- Animal proteins ---- Reelin Source.5843: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.5844: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.5845: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.5846: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.5847: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.5848: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.5849: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.5850: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.5851: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.5852: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.5853: DFBPPR10477 ---- Animal proteins ---- Aprataxin Source.5854: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.5855: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.5856: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.5857: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1 Source.5858: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.5859: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.5860: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.5861: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.5862: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.5863: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A Source.5864: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.5865: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.5866: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon Source.5867: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.5868: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.5869: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.5870: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3 Source.5871: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta Source.5872: DFBPPR10508 ---- Animal proteins ---- Septin-2 Source.5873: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.5874: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2 Source.5875: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.5876: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.5877: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.5878: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.5879: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.5880: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9 Source.5881: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.5882: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.5883: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase Source.5884: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.5885: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.5886: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase Source.5887: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.5888: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.5889: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type Source.5890: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1 Source.5891: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.5892: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.5893: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.5894: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.5895: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.5896: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.5897: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.5898: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.5899: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.5900: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.5901: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.5902: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.5903: DFBPPR10574 ---- Animal proteins ---- Stathmin-2 Source.5904: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.5905: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.5906: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.5907: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.5908: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin Source.5909: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.5910: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.5911: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.5912: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.5913: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.5914: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain Source.5915: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.5916: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.5917: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.5918: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.5919: DFBPPR10605 ---- Animal proteins ---- Elastin Source.5920: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.5921: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.5922: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.5923: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.5924: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.5925: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.5926: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX Source.5927: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.5928: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.5929: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.5930: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.5931: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.5932: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.5933: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.5934: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D Source.5935: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.5936: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.5937: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase Source.5938: DFBPPR10634 ---- Animal proteins ---- Procathepsin L Source.5939: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.5940: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.5941: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.5942: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.5943: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.5944: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.5945: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.5946: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.5947: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.5948: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.5949: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.5950: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.5951: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.5952: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.5953: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.5954: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.5955: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.5956: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.5957: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi Source.5958: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.5959: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3 Source.5960: DFBPPR10686 ---- Animal proteins ---- Collectin-11 Source.5961: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.5962: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.5963: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.5964: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.5965: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.5966: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.5967: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.5968: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.5969: DFBPPR10703 ---- Animal proteins ---- Tensin Source.5970: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.5971: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.5972: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.5973: DFBPPR10709 ---- Animal proteins ---- Docking protein 3 Source.5974: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.5975: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.5976: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9 Source.5977: DFBPPR10715 ---- Animal proteins ---- Lumican Source.5978: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.5979: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.5980: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog Source.5981: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.5982: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8 Source.5983: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.5984: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.5985: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.5986: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.5987: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.5988: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.5989: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.5990: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10 Source.5991: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.5992: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.5993: DFBPPR10747 ---- Animal proteins ---- Cathepsin B Source.5994: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.5995: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase Source.5996: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4 Source.5997: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.5998: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.5999: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.6000: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase Source.6001: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.6002: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.6003: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.6004: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.6005: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.6006: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.6007: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase Source.6008: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.6009: DFBPPR10794 ---- Animal proteins ---- Zyxin Source.6010: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.6011: DFBPPR10796 ---- Animal proteins ---- Protrudin Source.6012: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12 Source.6013: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.6014: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase Source.6015: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.6016: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.6017: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.6018: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.6019: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.6020: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.6021: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.6022: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.6023: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.6024: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.6025: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1 Source.6026: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.6027: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.6028: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1 Source.6029: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.6030: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.6031: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A Source.6032: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.6033: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.6034: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3 Source.6035: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.6036: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.6037: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein Source.6038: DFBPPR10865 ---- Animal proteins ---- Transgelin Source.6039: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.6040: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.6041: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2 Source.6042: DFBPPR10873 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-2 Source.6043: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.6044: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.6045: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3 Source.6046: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.6047: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain Source.6048: DFBPPR10882 ---- Animal proteins ---- Noggin Source.6049: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.6050: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.6051: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.6052: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.6053: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.6054: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.6055: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.6056: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.6057: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.6058: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.6059: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.6060: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2 Source.6061: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12 Source.6062: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.6063: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.6064: DFBPPR10919 ---- Animal proteins ---- Ski oncogene Source.6065: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.6066: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2 Source.6067: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.6068: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.6069: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.6070: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.6071: DFBPPR10934 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.6072: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.6073: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.6074: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.6075: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1 Source.6076: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.6077: DFBPPR10945 ---- Animal proteins ---- Prosaposin Source.6078: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.6079: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.6080: DFBPPR10954 ---- Animal proteins ---- Protein max Source.6081: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2 Source.6082: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho Source.6083: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.6084: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type Source.6085: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1 Source.6086: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C Source.6087: DFBPPR10964 ---- Animal proteins ---- Protein artemis Source.6088: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.6089: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2 Source.6090: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog Source.6091: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain Source.6092: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.6093: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein Source.6094: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C Source.6095: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.6096: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.6097: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.6098: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.6099: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.6100: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.6101: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.6102: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.6103: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.6104: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.6105: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.6106: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG Source.6107: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.6108: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.6109: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.6110: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor Source.6111: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.6112: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu Source.6113: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2 Source.6114: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.6115: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.6116: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.6117: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.6118: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.6119: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.6120: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.6121: DFBPPR11048 ---- Animal proteins ---- Calcitonin Source.6122: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.6123: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.6124: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.6125: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.6126: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A Source.6127: DFBPPR11060 ---- Animal proteins ---- Netrin-3 Source.6128: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.6129: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.6130: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.6131: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2 Source.6132: DFBPPR11070 ---- Animal proteins ---- Protein sprouty homolog 1 Source.6133: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1 Source.6134: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein Source.6135: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.6136: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.6137: DFBPPR11077 ---- Animal proteins ---- Tyrosinase Source.6138: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.6139: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.6140: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.6141: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.6142: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.6143: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1 Source.6144: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.6145: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.6146: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.6147: DFBPPR11091 ---- Animal proteins ---- Pro-neuropeptide Y Source.6148: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.6149: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.6150: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.6151: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1 Source.6152: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein Source.6153: DFBPPR11112 ---- Animal proteins ---- Protein quaking Source.6154: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.6155: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.6156: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.6157: DFBPPR11118 ---- Animal proteins ---- Filensin Source.6158: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5 Source.6159: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.6160: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.6161: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.6162: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.6163: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.6164: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.6165: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.6166: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7 Source.6167: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.6168: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain Source.6169: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.6170: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.6171: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog Source.6172: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain Source.6173: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.6174: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1 Source.6175: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3 Source.6176: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.6177: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.6178: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta Source.6179: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.6180: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.6181: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.6182: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b Source.6183: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1 Source.6184: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29 Source.6185: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase Source.6186: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.6187: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1 Source.6188: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22 Source.6189: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.6190: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.6191: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.6192: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.6193: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.6194: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1 Source.6195: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.6196: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.6197: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.6198: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.6199: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1 Source.6200: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1 Source.6201: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.6202: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone Source.6203: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.6204: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.6205: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.6206: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38 Source.6207: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2 Source.6208: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.6209: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.6210: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.6211: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.6212: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.6213: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A Source.6214: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.6215: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.6216: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1 Source.6217: DFBPPR11244 ---- Animal proteins ---- Frizzled-6 Source.6218: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.6219: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3 Source.6220: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.6221: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.6222: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3 Source.6223: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.6224: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.6225: DFBPPR11269 ---- Animal proteins ---- Anosmin-1 Source.6226: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.6227: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.6228: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.6229: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.6230: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.6231: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4 Source.6232: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein Source.6233: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.6234: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.6235: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.6236: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.6237: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4 Source.6238: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.6239: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.6240: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.6241: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.6242: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.6243: DFBPPR11301 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19 Source.6244: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.6245: DFBPPR11306 ---- Animal proteins ---- Transcription factor 15 Source.6246: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta Source.6247: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.6248: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1 Source.6249: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3 Source.6250: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.6251: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2 Source.6252: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4 Source.6253: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.6254: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15 Source.6255: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8 Source.6256: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1 Source.6257: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.6258: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2 Source.6259: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.6260: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4 Source.6261: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1 Source.6262: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.6263: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1 Source.6264: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.6265: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.6266: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.6267: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1 Source.6268: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.6269: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR Source.6270: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4 Source.6271: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2 Source.6272: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.6273: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29 Source.6274: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.6275: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.6276: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6 Source.6277: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.6278: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.6279: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.6280: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.6281: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.6282: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7 Source.6283: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.6284: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.6285: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.6286: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.6287: DFBPPR11397 ---- Animal proteins ---- Frizzled-3 Source.6288: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.6289: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.6290: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.6291: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.6292: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4 Source.6293: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.6294: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD Source.6295: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.6296: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.6297: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.6298: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.6299: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.6300: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20 Source.6301: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1 Source.6302: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.6303: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6 Source.6304: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.6305: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.6306: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2 Source.6307: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1 Source.6308: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2 Source.6309: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.6310: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46 Source.6311: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.6312: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.6313: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase Source.6314: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.6315: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.6316: DFBPPR11478 ---- Animal proteins ---- Gastrin-releasing peptide Source.6317: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.6318: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1 Source.6319: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1 Source.6320: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10 Source.6321: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.6322: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.6323: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein Source.6324: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4 Source.6325: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2 Source.6326: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1 Source.6327: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.6328: DFBPPR11510 ---- Animal proteins ---- Gonadoliberin-2 Source.6329: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.6330: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.6331: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A Source.6332: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide Source.6333: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.6334: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.6335: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29 Source.6336: DFBPPR11529 ---- Animal proteins ---- Alpha-endosulfine Source.6337: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.6338: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.6339: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.6340: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.6341: DFBPPR11537 ---- Animal proteins ---- Regulator of G-protein signaling 20 Source.6342: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.6343: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.6344: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.6345: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.6346: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.6347: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.6348: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.6349: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg Source.6350: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein Source.6351: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8 Source.6352: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.6353: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.6354: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein Source.6355: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622 Source.6356: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.6357: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.6358: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.6359: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.6360: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.6361: DFBPPR11597 ---- Animal proteins ---- Trypsin inhibitor ClTI-1 Source.6362: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.6363: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.6364: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.6365: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.6366: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.6367: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog Source.6368: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.6369: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.6370: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.6371: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3 Source.6372: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.6373: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.6374: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.6375: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59 Source.6376: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2 Source.6377: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.6378: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.6379: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.6380: DFBPPR11635 ---- Animal proteins ---- Cochlin Source.6381: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.6382: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4 Source.6383: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.6384: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.6385: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.6386: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2 Source.6387: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.6388: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.6389: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.6390: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.6391: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10 Source.6392: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.6393: DFBPPR11660 ---- Animal proteins ---- Cathepsin K Source.6394: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.6395: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein Source.6396: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2 Source.6397: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.6398: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.6399: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.6400: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.6401: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.6402: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain Source.6403: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4 Source.6404: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.6405: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2 Source.6406: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit Source.6407: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.6408: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.6409: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.6410: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.6411: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1 Source.6412: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.6413: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.6414: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8 Source.6415: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.6416: DFBPPR11725 ---- Animal proteins ---- D-dopachrome decarboxylase Source.6417: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.6418: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi Source.6419: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.6420: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61 Source.6421: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.6422: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.6423: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.6424: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1 Source.6425: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.6426: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.6427: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.6428: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38 Source.6429: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.6430: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6 Source.6431: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.6432: DFBPPR11765 ---- Animal proteins ---- Peptide YY-like Source.6433: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1 Source.6434: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein Source.6435: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.6436: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.6437: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4 Source.6438: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.6439: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.6440: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2 Source.6441: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.6442: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.6443: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2 Source.6444: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5 Source.6445: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22 Source.6446: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3 Source.6447: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5 Source.6448: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17 Source.6449: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.6450: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.6451: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.6452: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27 Source.6453: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.6454: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.6455: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.6456: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.6457: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.6458: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.6459: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36 Source.6460: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.6461: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.6462: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.6463: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.6464: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1 Source.6465: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.6466: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.6467: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.6468: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.6469: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.6470: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3 Source.6471: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog Source.6472: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.6473: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.6474: DFBPPR11874 ---- Animal proteins ---- Serum response factor Source.6475: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C Source.6476: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.6477: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.6478: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.6479: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.6480: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like Source.6481: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant Source.6482: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3 Source.6483: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN Source.6484: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.6485: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein Source.6486: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.6487: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B Source.6488: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.6489: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13 Source.6490: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.6491: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.6492: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.6493: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.6494: DFBPPR11924 ---- Animal proteins ---- Centromere protein P Source.6495: DFBPPR11928 ---- Animal proteins ---- Cyclin-C Source.6496: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor Source.6497: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20 Source.6498: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.6499: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2 Source.6500: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7 Source.6501: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1 Source.6502: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.6503: DFBPPR11945 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1 Source.6504: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.6505: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.6506: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.6507: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.6508: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.6509: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.6510: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1 Source.6511: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.6512: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein Source.6513: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.6514: DFBPPR11964 ---- Animal proteins ---- Protein LLP homolog Source.6515: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.6516: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.6517: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.6518: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4 Source.6519: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.6520: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.6521: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.6522: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.6523: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.6524: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog Source.6525: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.6526: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2 Source.6527: DFBPPR11995 ---- Animal proteins ---- Protein orai-2 Source.6528: DFBPPR11996 ---- Animal proteins ---- Homeobox protein Hox-A6 Source.6529: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.6530: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.6531: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.6532: DFBPPR12011 ---- Animal proteins ---- Protein Churchill Source.6533: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.6534: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein Source.6535: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.6536: DFBPPR12023 ---- Animal proteins ---- 60S ribosomal protein L35 Source.6537: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.6538: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.6539: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.6540: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208 Source.6541: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.6542: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2 Source.6543: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.6544: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.6545: DFBPPR12041 ---- Animal proteins ---- Paladin Source.6546: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.6547: DFBPPR12049 ---- Animal proteins ---- 60S ribosomal protein L36 Source.6548: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.6549: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.6550: DFBPPR12057 ---- Animal proteins ---- Fatty acid-binding protein, smooth muscle Source.6551: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.6552: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.6553: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC Source.6554: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.6555: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.6556: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4 Source.6557: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.6558: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.6559: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.6560: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5 Source.6561: DFBPPR12086 ---- Animal proteins ---- DET1- and DDB1-associated protein 1 Source.6562: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121 Source.6563: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.6564: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial Source.6565: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.6566: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.6567: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2 Source.6568: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2 Source.6569: DFBPPR12106 ---- Animal proteins ---- Ig lambda chain C region Source.6570: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.6571: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.6572: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1 Source.6573: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.6574: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.6575: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.6576: DFBPPR12127 ---- Animal proteins ---- SRY-related protein CH3 Source.6577: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.6578: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2 Source.6579: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.6580: DFBPPR12140 ---- Animal proteins ---- Centromere protein N Source.6581: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A Source.6582: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog Source.6583: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3 Source.6584: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.6585: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.6586: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.6587: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.6588: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.6589: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.6590: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.6591: DFBPPR12178 ---- Animal proteins ---- SRY-related protein CH32 Source.6592: DFBPPR12179 ---- Animal proteins ---- SRY-related protein CH31 Source.6593: DFBPPR12182 ---- Animal proteins ---- SRY-related protein CH1 Source.6594: DFBPPR12183 ---- Animal proteins ---- SRY-related protein CH4 Source.6595: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein Source.6596: DFBPPR12185 ---- Animal proteins ---- SRY-related protein CH2 Source.6597: DFBPPR12186 ---- Animal proteins ---- SRY-related protein CH7 Source.6598: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.6599: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B Source.6600: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3 Source.6601: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.6602: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.6603: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.6604: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.6605: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.6606: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.6607: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50 Source.6608: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog Source.6609: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.6610: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.6611: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.6612: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog Source.6613: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.6614: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog Source.6615: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.6616: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.6617: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.6618: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.6619: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.6620: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2 Source.6621: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor Source.6622: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.6623: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.6624: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1 Source.6625: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.6626: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.6627: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.6628: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.6629: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.6630: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.6631: DFBPPR12278 ---- Animal proteins ---- Major prion protein Source.6632: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.6633: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.6634: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.6635: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.6636: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.6637: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.6638: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Source.6639: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.6640: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.6641: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.6642: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.6643: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.6644: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.6645: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.6646: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.6647: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.6648: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.6649: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.6650: DFBPPR12308 ---- Animal proteins ---- Phospholipase A2, membrane associated Source.6651: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.6652: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.6653: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.6654: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.6655: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.6656: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5 Source.6657: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.6658: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type Source.6659: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.6660: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.6661: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.6662: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.6663: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.6664: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2 Source.6665: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.6666: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.6667: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.6668: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.6669: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.6670: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.6671: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.6672: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.6673: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.6674: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.6675: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.6676: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.6677: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.6678: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.6679: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.6680: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.6681: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.6682: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.6683: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase Source.6684: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.6685: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.6686: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.6687: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.6688: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.6689: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.6690: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.6691: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.6692: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.6693: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.6694: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4 Source.6695: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.6696: DFBPPR12408 ---- Animal proteins ---- Vitronectin Source.6697: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.6698: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.6699: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.6700: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2 Source.6701: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.6702: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.6703: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.6704: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.6705: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3 Source.6706: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.6707: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.6708: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.6709: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.6710: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.6711: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2 Source.6712: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.6713: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.6714: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.6715: DFBPPR12439 ---- Animal proteins ---- Tissue factor Source.6716: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.6717: DFBPPR12441 ---- Animal proteins ---- Triadin Source.6718: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.6719: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1 Source.6720: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2 Source.6721: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.6722: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.6723: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.6724: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.6725: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.6726: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.6727: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.6728: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.6729: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.6730: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1 Source.6731: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.6732: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.6733: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.6734: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.6735: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.6736: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.6737: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.6738: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.6739: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.6740: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.6741: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta Source.6742: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.6743: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.6744: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.6745: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.6746: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.6747: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.6748: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.6749: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.6750: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.6751: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.6752: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.6753: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3 Source.6754: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1 Source.6755: DFBPPR12507 ---- Animal proteins ---- Cathepsin K Source.6756: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.6757: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.6758: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.6759: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.6760: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.6761: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.6762: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.6763: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.6764: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.6765: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Source.6766: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.6767: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.6768: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.6769: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.6770: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.6771: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.6772: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.6773: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.6774: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.6775: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.6776: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.6777: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type Source.6778: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.6779: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1 Source.6780: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.6781: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.6782: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.6783: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11 Source.6784: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.6785: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.6786: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.6787: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.6788: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1 Source.6789: DFBPPR12591 ---- Animal proteins ---- Annexin A11 Source.6790: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.6791: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B Source.6792: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.6793: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20 Source.6794: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.6795: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.6796: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.6797: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.6798: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.6799: DFBPPR12602 ---- Animal proteins ---- Osteopontin Source.6800: DFBPPR12603 ---- Animal proteins ---- Osteopontin Source.6801: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.6802: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.6803: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.6804: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.6805: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4 Source.6806: DFBPPR12626 ---- Animal proteins ---- E-selectin Source.6807: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.6808: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain Source.6809: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.6810: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5 Source.6811: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.6812: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.6813: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.6814: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.6815: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.6816: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.6817: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase Source.6818: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.6819: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.6820: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.6821: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.6822: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.6823: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin Source.6824: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.6825: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.6826: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.6827: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Source.6828: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8 Source.6829: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.6830: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.6831: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.6832: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.6833: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.6834: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.6835: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1 Source.6836: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1 Source.6837: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.6838: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln Source.6839: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3 Source.6840: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.6841: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4 Source.6842: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.6843: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta Source.6844: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Source.6845: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.6846: DFBPPR12767 ---- Animal proteins ---- Follitropin subunit beta Source.6847: DFBPPR12768 ---- Animal proteins ---- Pepsin-3 Source.6848: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.6849: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.6850: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.6851: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.6852: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.6853: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.6854: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.6855: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.6856: DFBPPR12790 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 4 Source.6857: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.6858: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.6859: DFBPPR12796 ---- Animal proteins ---- Caspase-3 Source.6860: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10 Source.6861: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein Source.6862: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.6863: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6 Source.6864: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2 Source.6865: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.6866: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.6867: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.6868: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma Source.6869: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.6870: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.6871: DFBPPR12817 ---- Animal proteins ---- Cathepsin E Source.6872: DFBPPR12821 ---- Animal proteins ---- Gastricsin Source.6873: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.6874: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain Source.6875: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.6876: DFBPPR12836 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Source.6877: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor Source.6878: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.6879: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.6880: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.6881: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.6882: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.6883: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.6884: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein Source.6885: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.6886: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin Source.6887: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.6888: DFBPPR12878 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Source.6889: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.6890: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.6891: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.6892: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase Source.6893: DFBPPR12890 ---- Animal proteins ---- ATP synthase protein 8 Source.6894: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.6895: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D Source.6896: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.6897: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.6898: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.6899: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.6900: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2 Source.6901: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.6902: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.6903: DFBPPR12915 ---- Animal proteins ---- Small proline-rich protein 3 Source.6904: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.6905: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.6906: DFBPPR12930 ---- Animal proteins ---- Kappa-casein Source.6907: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.6908: DFBPPR12933 ---- Animal proteins ---- Peptide YY Source.6909: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.6910: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.6911: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.6912: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.6913: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.6914: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.6915: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.6916: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2 Source.6917: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.6918: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain Source.6919: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.6920: DFBPPR12971 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase Source.6921: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.6922: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.6923: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.6924: DFBPPR12984 ---- Animal proteins ---- Prolactin-inducible protein homolog Source.6925: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.6926: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.6927: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.6928: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.6929: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.6930: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.6931: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.6932: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.6933: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.6934: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.6935: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.6936: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A Source.6937: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.6938: DFBPPR13018 ---- Animal proteins ---- Neuropeptide Y Source.6939: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.6940: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1 Source.6941: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.6942: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A Source.6943: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S Source.6944: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.6945: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5 Source.6946: DFBPPR13040 ---- Animal proteins ---- Pancreatic hormone Source.6947: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.6948: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.6949: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.6950: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5 Source.6951: DFBPPR13067 ---- Animal proteins ---- Beta-casein Source.6952: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2 Source.6953: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.6954: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.6955: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog Source.6956: DFBPPR13090 ---- Animal proteins ---- Annexin A8 Source.6957: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.6958: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form Source.6959: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region Source.6960: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain Source.6961: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.6962: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region Source.6963: DFBPPR13120 ---- Animal proteins ---- Ig lambda chain C region Source.6964: DFBPPR13135 ---- Animal proteins ---- Ig kappa-b4 chain C region Source.6965: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein Source.6966: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.6967: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.6968: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.6969: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53 Source.6970: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.6971: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.6972: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.6973: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor Source.6974: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.6975: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.6976: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.6977: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.6978: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.6979: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.6980: DFBPPR13174 ---- Animal proteins ---- Clusterin Source.6981: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.6982: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase Source.6983: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.6984: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II Source.6985: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A Source.6986: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.6987: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.6988: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.6989: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.6990: DFBPPR13207 ---- Animal proteins ---- Vascular endothelial growth factor A Source.6991: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23 Source.6992: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.6993: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase Source.6994: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.6995: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.6996: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.6997: DFBPPR13223 ---- Animal proteins ---- Caspase-1 Source.6998: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.6999: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.7000: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.7001: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.7002: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.7003: DFBPPR13232 ---- Animal proteins ---- Osteocalcin Source.7004: DFBPPR13233 ---- Animal proteins ---- Fibronectin Source.7005: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain Source.7006: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein Source.7007: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.7008: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.7009: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta Source.7010: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2 Source.7011: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic Source.7012: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta Source.7013: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.7014: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.7015: DFBPPR13262 ---- Animal proteins ---- Gastrin Source.7016: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.7017: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.7018: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.7019: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.7020: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8 Source.7021: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.7022: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.7023: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.7024: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.7025: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.7026: DFBPPR13300 ---- Animal proteins ---- Sex-determining region Y protein Source.7027: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta Source.7028: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.7029: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta Source.7030: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.7031: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.7032: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.7033: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.7034: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.7035: DFBPPR13329 ---- Animal proteins ---- Follitropin subunit beta Source.7036: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.7037: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.7038: DFBPPR13339 ---- Animal proteins ---- Runt-related transcription factor 2 Source.7039: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.7040: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta Source.7041: DFBPPR13352 ---- Animal proteins ---- ATP synthase protein 8 Source.7042: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.7043: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.7044: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A Source.7045: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.7046: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.7047: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.7048: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein Source.7049: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.7050: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.7051: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.7052: DFBPPR13389 ---- Animal proteins ---- Phosducin Source.7053: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.7054: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1 Source.7055: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.7056: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.7057: DFBPPR13407 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 1 Source.7058: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog Source.7059: DFBPPR13418 ---- Animal proteins ---- 40S ribosomal protein S4 Source.7060: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.7061: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.7062: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.7063: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.7064: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.7065: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic Source.7066: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.7067: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.7068: DFBPPR13433 ---- Animal proteins ---- Major prion protein Source.7069: DFBPPR13434 ---- Animal proteins ---- Aromatase Source.7070: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.7071: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8 Source.7072: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A Source.7073: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.7074: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.7075: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.7076: DFBPPR13448 ---- Animal proteins ---- Osteocalcin Source.7077: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.7078: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.7079: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3 Source.7080: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.7081: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.7082: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.7083: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein Source.7084: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.7085: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1 Source.7086: DFBPPR13477 ---- Animal proteins ---- Prolactin Source.7087: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta Source.7088: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3 Source.7089: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.7090: DFBPPR13485 ---- Animal proteins ---- Hemoglobin subunit zeta Source.7091: DFBPPR13487 ---- Animal proteins ---- Cathelicidin-3.4 Source.7092: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.7093: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a Source.7094: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1 Source.7095: DFBPPR13497 ---- Animal proteins ---- Plasminogen Source.7096: DFBPPR13501 ---- Animal proteins ---- Follitropin subunit beta Source.7097: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.7098: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9 Source.7099: DFBPPR13523 ---- Animal proteins ---- Keratin-associated protein 15-1 Source.7100: DFBPPR13530 ---- Animal proteins ---- Major prion protein Source.7101: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin Source.7102: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.7103: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.7104: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.7105: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.7106: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.7107: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase Source.7108: DFBPPR13545 ---- Animal proteins ---- Prolactin Source.7109: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.7110: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.7111: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein Source.7112: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.7113: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.7114: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.7115: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.7116: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1 Source.7117: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.7118: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.7119: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.7120: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.7121: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.7122: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.7123: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein Source.7124: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53 Source.7125: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.7126: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1 Source.7127: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.7128: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.7129: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.7130: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.7131: DFBPPR13602 ---- Animal proteins ---- Acrosin Source.7132: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.7133: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.7134: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic Source.7135: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.7136: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.7137: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.7138: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.7139: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II Source.7140: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.7141: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta Source.7142: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.7143: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.7144: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta Source.7145: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.7146: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.7147: DFBPPR13631 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.7148: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.7149: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.7150: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6 Source.7151: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8 Source.7152: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.7153: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6 Source.7154: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2 Source.7155: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.7156: DFBPPR13646 ---- Animal proteins ---- Procathepsin L Source.7157: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.7158: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain Source.7159: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.7160: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.7161: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.7162: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.7163: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.7164: DFBPPR13688 ---- Animal proteins ---- Keratin-associated protein 3-1 Source.7165: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.7166: DFBPPR13692 ---- Animal proteins ---- Pro-neuropeptide Y Source.7167: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.7168: DFBPPR13696 ---- Animal proteins ---- Cathepsin D Source.7169: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1 Source.7170: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.7171: DFBPPR13704 ---- Animal proteins ---- Osteopontin Source.7172: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta Source.7173: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.7174: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.7175: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d Source.7176: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1 Source.7177: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.7178: DFBPPR13738 ---- Animal proteins ---- Vascular endothelial growth factor A Source.7179: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.7180: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase Source.7181: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.7182: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.7183: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.7184: DFBPPR13755 ---- Animal proteins ---- Aromatase Source.7185: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.7186: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.7187: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9 Source.7188: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.7189: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.7190: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.7191: DFBPPR13789 ---- Animal proteins ---- Tryptase-2 Source.7192: DFBPPR13790 ---- Animal proteins ---- Follitropin subunit beta Source.7193: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.7194: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4 Source.7195: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone Source.7196: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.7197: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2 Source.7198: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.7199: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1 Source.7200: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.7201: DFBPPR13826 ---- Animal proteins ---- Translocator protein Source.7202: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.7203: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.7204: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10 Source.7205: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein Source.7206: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.7207: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1 Source.7208: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta Source.7209: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor Source.7210: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor Source.7211: DFBPPR13876 ---- Animal proteins ---- Follistatin Source.7212: DFBPPR13877 ---- Animal proteins ---- Sialin Source.7213: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.7214: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.7215: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.7216: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.7217: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.7218: DFBPPR13893 ---- Animal proteins ---- Calponin-1 Source.7219: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.7220: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.7221: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.7222: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3 Source.7223: DFBPPR13914 ---- Animal proteins ---- Homeobox protein Hox-C6 Source.7224: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease Source.7225: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon Source.7226: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.7227: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.7228: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.7229: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.7230: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.7231: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1 Source.7232: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2 Source.7233: DFBPPR13985 ---- Animal proteins ---- Gonadotropin subunit beta-2 Source.7234: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha Source.7235: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.7236: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B Source.7237: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.7238: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.7239: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog Source.7240: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.7241: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.7242: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1 Source.7243: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a Source.7244: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2 Source.7245: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1 Source.7246: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.7247: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1 Source.7248: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2 Source.7249: DFBPPR14024 ---- Animal proteins ---- Gamma-crystallin S Source.7250: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.7251: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.7252: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial Source.7253: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos Source.7254: DFBPPR14054 ---- Animal proteins ---- Pro-neuropeptide Y Source.7255: DFBPPR14071 ---- Marine protein ---- Somatotropin Source.7256: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1 Source.7257: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.7258: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.7259: DFBPPR14081 ---- Marine protein ---- Beta-enolase Source.7260: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha Source.7261: DFBPPR14090 ---- Marine protein ---- Trypsin-3 Source.7262: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.7263: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha Source.7264: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.7265: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.7266: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.7267: DFBPPR14118 ---- Marine protein ---- Trypsin-2 Source.7268: DFBPPR14120 ---- Marine protein ---- Thyrotropin subunit beta Source.7269: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.7270: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.7271: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase Source.7272: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.7273: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.7274: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.7275: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.7276: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein Source.7277: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.7278: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.7279: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.7280: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.7281: DFBPPR14166 ---- Marine protein ---- Draxin-A Source.7282: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.7283: DFBPPR14175 ---- Marine protein ---- Draxin-B Source.7284: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine Source.7285: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4 Source.7286: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.7287: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein Source.7288: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.7289: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a Source.7290: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2 Source.7291: DFBPPR14213 ---- Marine protein ---- Electron transfer flavoprotein regulatory factor 1 Source.7292: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.7293: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.7294: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1 Source.7295: DFBPPR14227 ---- Marine protein ---- LYR motif-containing protein 4B Source.7296: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog Source.7297: DFBPPR14231 ---- Marine protein ---- Somatotropin Source.7298: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain Source.7299: DFBPPR14235 ---- Marine protein ---- Calcitonin-1 Source.7300: DFBPPR14236 ---- Marine protein ---- Gonadotropin subunit beta-2 Source.7301: DFBPPR14238 ---- Marine protein ---- Insulin Source.7302: DFBPPR14240 ---- Marine protein ---- Otolin-1 Source.7303: DFBPPR14243 ---- Marine protein ---- Glycoprotein hormones alpha chain 2 Source.7304: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1 Source.7305: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.7306: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain Source.7307: DFBPPR14265 ---- Marine protein ---- Gonadotropin subunit beta-2 Source.7308: DFBPPR14266 ---- Marine protein ---- Gonadotropin subunit beta-1 Source.7309: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial Source.7310: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.7311: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein Source.7312: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.7313: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.7314: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.7315: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.7316: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG Source.7317: DFBPPR14309 ---- Marine protein ---- 50S ribosomal protein L21, chloroplastic Source.7318: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.7319: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region Source.7320: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase Source.7321: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.7322: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit Source.7323: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.7324: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain Source.7325: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.7326: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.7327: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.7328: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.7329: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.7330: DFBPPR14357 ---- Marine protein ---- Ferredoxin Source.7331: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.7332: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.7333: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42 Source.7334: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.7335: DFBPPR14367 ---- Marine protein ---- Cytochrome f Source.7336: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.7337: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.7338: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta Source.7339: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.7340: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha Source.7341: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.7342: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase Source.7343: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.7344: DFBPPR14392 ---- Marine protein ---- Prenyl transferase Source.7345: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.7346: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic Source.7347: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha Source.7348: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain Source.7349: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.7350: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.7351: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.7352: DFBPPR14431 ---- Marine protein ---- 50S ribosomal protein L31, chloroplastic Source.7353: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic Source.7354: DFBPPR14444 ---- Marine protein ---- 50S ribosomal protein L23, chloroplastic Source.7355: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.7356: DFBPPR14485 ---- Marine protein ---- Uncharacterized N-acetyltransferase ycf52 Source.7357: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46 Source.7358: DFBPPR14506 ---- Marine protein ---- Photosystem I reaction center subunit IV Source.7359: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.7360: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.7361: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.7362: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53 Source.7363: DFBPPR14519 ---- Marine protein ---- Uncharacterized protein ycf21 Source.7364: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56 Source.7365: DFBPPR14530 ---- Marine protein ---- Uncharacterized protein ycf34 Source.7366: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.7367: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2 Source.7368: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.7369: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.7370: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.7371: DFBPPR14541 ---- Marine protein ---- Somatotropin-1 Source.7372: DFBPPR14542 ---- Marine protein ---- Somatotropin-2 Source.7373: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A Source.7374: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.7375: DFBPPR14547 ---- Marine protein ---- Interleukin-6 Source.7376: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.7377: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2 Source.7378: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor Source.7379: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.7380: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta Source.7381: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.7382: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific Source.7383: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.7384: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53 Source.7385: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.7386: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1 Source.7387: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.7388: DFBPPR14581 ---- Marine protein ---- Interferon alpha/beta receptor 2 Source.7389: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4 Source.7390: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros Source.7391: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta Source.7392: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.7393: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1 Source.7394: DFBPPR14592 ---- Marine protein ---- Intelectin Source.7395: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.7396: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.7397: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1 Source.7398: DFBPPR14608 ---- Marine protein ---- Polysialoglycoprotein Source.7399: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing] Source.7400: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha Source.7401: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.7402: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.7403: DFBPPR14625 ---- Marine protein ---- Somatostatin-2 Source.7404: DFBPPR14628 ---- Marine protein ---- C-type natriuretic peptide 1 Source.7405: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.7406: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.7407: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin Source.7408: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.7409: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.7410: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.7411: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.7412: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.7413: DFBPPR14660 ---- Marine protein ---- Otolin-1 Source.7414: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2 Source.7415: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc Source.7416: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.7417: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.7418: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.7419: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.7420: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.7421: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2 Source.7422: DFBPPR14695 ---- Marine protein ---- C-type natriuretic peptide 2 Source.7423: DFBPPR14700 ---- Marine protein ---- Neuropeptide Y Source.7424: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.7425: DFBPPR14704 ---- Marine protein ---- Selenoprotein F Source.7426: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.7427: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4 Source.7428: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.7429: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog Source.7430: DFBPPR14730 ---- Marine protein ---- Peptide YY-like Source.7431: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.7432: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.7433: DFBPPR14768 ---- Marine protein ---- Tachylectin-2 Source.7434: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.7435: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.7436: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain Source.7437: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain Source.7438: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain Source.7439: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain Source.7440: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain Source.7441: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.7442: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.7443: DFBPPR14799 ---- Marine protein ---- Arginine kinase Source.7444: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit Source.7445: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.7446: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase Source.7447: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit Source.7448: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit Source.7449: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1 Source.7450: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.7451: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.7452: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1 Source.7453: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3 Source.7454: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2 Source.7455: DFBPPR14839 ---- Marine protein ---- Hemocyanin subunit 2 Source.7456: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.7457: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form Source.7458: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.7459: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta Source.7460: DFBPPR14861 ---- Marine protein ---- Cytochrome b Source.7461: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233 Source.7462: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta Source.7463: DFBPPR14867 ---- Marine protein ---- Gonadotropin subunit beta-2 Source.7464: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.7465: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain Source.7466: DFBPPR14873 ---- Marine protein ---- Somatolactin Source.7467: DFBPPR14875 ---- Marine protein ---- Probable pancreatic secretory proteinase inhibitor Source.7468: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.7469: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2 Source.7470: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.7471: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.7472: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit Source.7473: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit Source.7474: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.7475: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.7476: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.7477: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.7478: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.7479: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.7480: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.7481: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.7482: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.7483: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.7484: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.7485: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.7486: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4 Source.7487: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit Source.7488: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.7489: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.7490: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.7491: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.7492: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.7493: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.7494: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.7495: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18 Source.7496: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.7497: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.7498: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.7499: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.7500: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.7501: DFBPPR14935 ---- Microorganism protein ---- Actin Source.7502: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.7503: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.7504: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB Source.7505: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.7506: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.7507: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial Source.7508: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.7509: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase Source.7510: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.7511: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1 Source.7512: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.7513: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.7514: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2 Source.7515: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.7516: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.7517: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.7518: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.7519: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.7520: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19 Source.7521: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like Source.7522: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1 Source.7523: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.7524: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.7525: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.7526: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.7527: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.7528: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.7529: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.7530: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1 Source.7531: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.7532: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.7533: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.7534: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.7535: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6 Source.7536: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.7537: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.7538: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.7539: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.7540: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.7541: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.7542: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.7543: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.7544: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1 Source.7545: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.7546: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2 Source.7547: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.7548: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.7549: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.7550: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.7551: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.7552: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.7553: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5 Source.7554: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.7555: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.7556: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.7557: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit Source.7558: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10 Source.7559: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.7560: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.7561: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.7562: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1 Source.7563: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9 Source.7564: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.7565: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.7566: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.7567: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.7568: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12 Source.7569: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.7570: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.7571: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase Source.7572: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase Source.7573: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1 Source.7574: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3 Source.7575: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13 Source.7576: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.7577: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.7578: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.7579: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6 Source.7580: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.7581: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5 Source.7582: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.7583: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.7584: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.7585: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.7586: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.7587: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1 Source.7588: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase Source.7589: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.7590: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.7591: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22 Source.7592: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.7593: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.7594: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.7595: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.7596: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.7597: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.7598: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.7599: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D Source.7600: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.7601: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.7602: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81 Source.7603: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.7604: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.7605: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2 Source.7606: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain Source.7607: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.7608: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase Source.7609: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.7610: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1 Source.7611: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.7612: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.7613: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.7614: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase Source.7615: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.7616: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3 Source.7617: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1 Source.7618: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.7619: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.7620: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase Source.7621: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.7622: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.7623: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1 Source.7624: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1 Source.7625: DFBPPR15222 ---- Microorganism protein ---- DASH complex subunit ASK1 Source.7626: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8 Source.7627: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4 Source.7628: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.7629: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5 Source.7630: DFBPPR15237 ---- Microorganism protein ---- U6 snRNA-associated Sm-like protein LSm6 Source.7631: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B Source.7632: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.7633: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.7634: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor Source.7635: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.7636: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.7637: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase Source.7638: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4 Source.7639: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.7640: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3 Source.7641: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.7642: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.7643: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase Source.7644: DFBPPR15276 ---- Microorganism protein ---- Guanine nucleotide-binding protein subunit gamma Source.7645: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.7646: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.7647: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.7648: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12 Source.7649: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.7650: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2 Source.7651: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase Source.7652: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7 Source.7653: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14 Source.7654: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.7655: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.7656: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.7657: DFBPPR15316 ---- Microorganism protein ---- Protein URE2 Source.7658: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5 Source.7659: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor Source.7660: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.7661: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial Source.7662: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10 Source.7663: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10 Source.7664: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.7665: DFBPPR15328 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 31 Source.7666: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2 Source.7667: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3 Source.7668: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18 Source.7669: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.7670: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.7671: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.7672: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.7673: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.7674: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.7675: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.7676: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog Source.7677: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.7678: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase Source.7679: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5 Source.7680: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.7681: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.7682: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2 Source.7683: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80 Source.7684: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.7685: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.7686: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.7687: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.7688: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.7689: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.7690: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.7691: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.7692: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.7693: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2 Source.7694: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4 Source.7695: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.7696: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82 Source.7697: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial Source.7698: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3 Source.7699: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101 Source.7700: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.7701: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.7702: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.7703: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1 Source.7704: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.7705: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.7706: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1 Source.7707: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24 Source.7708: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.7709: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.7710: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1 Source.7711: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.7712: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.7713: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.7714: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.7715: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.7716: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.7717: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.7718: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1 Source.7719: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.7720: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.7721: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.7722: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32 Source.7723: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11 Source.7724: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.7725: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.7726: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101 Source.7727: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1 Source.7728: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.7729: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5 Source.7730: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.7731: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase Source.7732: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3 Source.7733: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.7734: DFBPPR15543 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 7 Source.7735: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6 Source.7736: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.7737: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.7738: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14 Source.7739: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.7740: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.7741: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.7742: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.7743: DFBPPR15576 ---- Microorganism protein ---- Cytochrome c oxidase-assembly factor COX23, mitochondrial Source.7744: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7 Source.7745: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3 Source.7746: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.7747: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28 Source.7748: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.7749: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.7750: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1 Source.7751: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.7752: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.7753: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.7754: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.7755: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.7756: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1 Source.7757: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7 Source.7758: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.7759: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.7760: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11 Source.7761: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial Source.7762: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2 Source.7763: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.7764: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25 Source.7765: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.7766: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit Source.7767: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.7768: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.7769: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase Source.7770: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.7771: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6 Source.7772: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.7773: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8 Source.7774: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.7775: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1 Source.7776: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.7777: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial Source.7778: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.7779: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.7780: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1 Source.7781: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.7782: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.7783: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23 Source.7784: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial Source.7785: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial Source.7786: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.7787: DFBPPR15718 ---- Microorganism protein ---- RF4 protein Source.7788: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.7789: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1 Source.7790: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial Source.7791: DFBPPR15725 ---- Microorganism protein ---- Protein DML1 Source.7792: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.7793: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.7794: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.7795: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24 Source.7796: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1 Source.7797: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1 Source.7798: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6 Source.7799: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.7800: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial Source.7801: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5 Source.7802: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.7803: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1 Source.7804: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4 Source.7805: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.7806: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.7807: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9 Source.7808: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1 Source.7809: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.7810: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32 Source.7811: DFBPPR15794 ---- Microorganism protein ---- Uncharacterized protein KLLA0E17732g Source.7812: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase Source.7813: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.7814: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase Source.7815: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase Source.7816: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.7817: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.7818: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.7819: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.7820: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.7821: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase Source.7822: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.7823: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase Source.7824: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.7825: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase Source.7826: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.7827: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT Source.7828: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.7829: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.7830: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.7831: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.7832: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2 Source.7833: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.7834: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3 Source.7835: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.7836: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase Source.7837: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.7838: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.7839: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.7840: DFBPPR15856 ---- Microorganism protein ---- Laccase-2 Source.7841: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.7842: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.7843: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein Source.7844: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.7845: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2 Source.7846: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.7847: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase Source.7848: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.7849: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase Source.7850: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.7851: DFBPPR15889 ---- Marine protein ---- Ferredoxin Source.7852: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1 Source.7853: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.7854: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.7855: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.7856: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2 Source.7857: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.7858: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.7859: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.7860: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog Source.7861: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.7862: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.7863: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.7864: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.7865: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.7866: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.7867: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.7868: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.7869: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.7870: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.7871: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.7872: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.7873: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.7874: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein Source.7875: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.7876: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.7877: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.7878: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase Source.7879: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.7880: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.7881: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.7882: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.7883: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.7884: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.7885: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.7886: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.7887: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.7888: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.7889: DFBPPR7810 ---- Plant protein ---- Cytochrome f Source.7890: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.7891: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.7892: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.7893: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.7894: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.7895: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.7896: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta Source.7897: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.7898: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2 Source.7899: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1 Source.7900: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.7901: DFBPPR7832 ---- Plant protein ---- Extensin Source.7902: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.7903: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.7904: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.7905: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.7906: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.7907: DFBPPR7844 ---- Plant protein ---- Actin-1 Source.7908: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.7909: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.7910: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.7911: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1 Source.7912: DFBPPR7856 ---- Plant protein ---- Maturase K Source.7913: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.7914: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic Source.7915: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.7916: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1 Source.7917: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1 Source.7918: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.7919: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1 Source.7920: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.7921: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.7922: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.7923: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.7924: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.7925: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.7926: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.7927: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.7928: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.7929: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.7930: DFBPPR7949 ---- Plant protein ---- Cytochrome f Source.7931: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.7932: DFBPPR7954 ---- Plant protein ---- Favin Source.7933: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1 Source.7934: DFBPPR7960 ---- Plant protein ---- Vicilin Source.7935: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.7936: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4 Source.7937: DFBPPR7973 ---- Plant protein ---- Maturase K Source.7938: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.7939: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.7940: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.7941: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.7942: DFBPPR7997 ---- Plant protein ---- Cytochrome b559 subunit beta Source.7943: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.7944: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.7945: DFBPPR8007 ---- Plant protein ---- Maturase K Source.7946: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase Source.7947: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2 Source.7948: DFBPPR8029 ---- Plant protein ---- Vignain Source.7949: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.7950: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.7951: DFBPPR8035 ---- Plant protein ---- Endochitinase Source.7952: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.7953: DFBPPR8037 ---- Plant protein ---- Arcelin-1 Source.7954: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.7955: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.7956: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.7957: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.7958: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.7959: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1 Source.7960: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.7961: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.7962: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.7963: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein Source.7964: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.7965: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin Source.7966: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic Source.7967: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B Source.7968: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.7969: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.7970: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3 Source.7971: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4 Source.7972: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.7973: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.7974: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3 Source.7975: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.7976: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform Source.7977: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.7978: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.7979: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1 Source.7980: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.7981: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.7982: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.7983: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2 Source.7984: DFBPPR8091 ---- Plant protein ---- Cytochrome f Source.7985: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1 Source.7986: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin Source.7987: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.7988: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.7989: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.7990: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.7991: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.7992: DFBPPR8114 ---- Plant protein ---- Arcelin-2 Source.7993: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.7994: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.7995: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1 Source.7996: DFBPPR8144 ---- Plant protein ---- Maturase K Source.7997: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.7998: DFBPPR8156 ---- Plant protein ---- Nodulin-30 Source.7999: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.8000: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin Source.8001: DFBPPR8183 ---- Plant protein ---- 26 kDa cell wall protein Source.8002: DFBPPR8185 ---- Plant protein ---- Uncharacterized basic polypeptide Source.8003: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.8004: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.8005: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase Source.8006: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.8007: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.8008: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.8009: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein Source.8010: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.8011: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase Source.8012: DFBPPR8235 ---- Plant protein ---- Catalase Source.8013: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.8014: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.8015: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.8016: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.8017: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.8018: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.8019: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.8020: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3 Source.8021: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.8022: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.8023: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.8024: DFBPPR8259 ---- Plant protein ---- Cytochrome f Source.8025: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.8026: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.8027: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.8028: DFBPPR8270 ---- Plant protein ---- Cytochrome b559 subunit beta Source.8029: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.8030: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.8031: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase Source.8032: DFBPPR8296 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.8033: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.8034: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K Source.8035: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.8036: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.8037: DFBPPR8314 ---- Plant protein ---- Maturase K Source.8038: DFBPPR8323 ---- Plant protein ---- Cytochrome P450 Source.8039: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1 Source.8040: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3 Source.8041: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a Source.8042: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research Inductive analysis	Link 1: DFBPDPIV0140----Bovine milk proteins----β-Casein, α_s1-Casein, ...

Biological/Functional activity & target protein

DPP IV-inhibitory activity

(1) Inhibitor of human Dipeptidyl Peptidase IV (EC 3.4.14.5). Tyr-Pro exhibited inhibitory effect to some degree, as shown in Table 1.
(2) The dipeptides Tyr–Pro showed hDPPIV inhibitory effects (inhibition ratio, >50%) ^[5].
(3) The peptide showed low inhibitory activity against Dipeptidyl-peptidase IV (EC 3.4.14.5) with the IC₅₀ value of 658.1 μM, and its DPP-IV inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern ^[6].

Table 1 IC₅₀ (mM) values of synthetic peptides against DPP-IV activity
Peptides	IC₅₀ (mM)	Relative
Diprotin A (Ile-Pro-Ile) ^[3]	0.21 ± 0.01	0.5
Ile-Pro	0.41 ± 0.07	1.0
Met-Pro	0.87 ± 0.01	2.1
Val-Pro	0.88 ± 0.09	2.1
Arg-Pro	2.24 ± 0.29	5.5
Thr-Pro	2.37 ± 0.60	5.8
Leu-Pro	2.37 ± 0.17	5.8
Lys-Pro	2.54 ± 0.88	6.2
His-Pro	2.82 ± 0.58	6.9
Tyr-Pro	3.17 ± 0.44	7.7
Phe-Pro	3.63 ± 0.51	8.9
Trp-Pro	4.53 ± 0.33	11.0
Pro-Pro	5.86 ± 0.55	14.3
Ser-Pro	5.98 ± 0.42	14.6
Ala-Pro	7.95 ± 0.38	19.4
Gly-Pro	No inhibition	－
Pro-Ile	No inhibition	－

Specific target protein(s)

Specific Target Protein(s):
Dipeptidyl peptidase 4

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	No enzyme

Stability & Cytotoxicity

Peptide stability

Literature report:	The peptide was unstable for gastrointestinal enzymes (cleavaged by pepsin) ^[6].
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

(1) Although the peptide is a synthetic peptide, its IC₅₀ value has been determined (it has inhibitory activity against DPP-IV) and may be present in other food-borne proteins, so the peptide is included here.
(2) The peptide was found in milk proteins^{[D1, 1]}.
(3) The results presented herein are relevant to the management of type 2 diabetes with functional foods involving multi-target sites for DPP-IV inhibition in humans ^[4].

Database cross-references

DFBP

[D1]	DFBPACEI0348, DFBPACEI1315, DFBPACEI1540, DFBPACEI1901
[D2]	DFBPANHY0869, DFBPANHY0886
[D3]	DFBPANOX0681
[D4]	DFBPALGL0021
[D5]	DFBPOPIO0147
[D6]	DFBPMUFU0106

BIOPEP-UWM

[D7]

3666, 8521, 9548

APD

[D8]

BioPepDB

[D9]

MBPDB

[D10]

Reference(s)

Primary literature	Hatanaka T, Inoue Y, Arima J, Kumagai Y, Usuki H, Kawakami K, Kimura M, Mukaihara T. Production of dipeptidyl peptidase IV inhibitory peptides from defatted rice bran. Food Chem. 2012 Sep 15;134(2):797-802. PMID: 23107693 DOI: 10.1016/j.foodchem.2012.02.183
Other literature(s)	[1] Nongonierma A B, Fitzgerald R J. Inhibition of dipeptidyl peptidase IV (DPP-IV) by proline containing casein-derived peptides[J]. Journal of Functional Foods, 2013, 5(4):1909-1917. [2] Rosa A P B D L, Montoya A B, Martínez-Cuevas P, et al. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: Antihypertensive role of amaranth peptides[J]. Nitric Oxide, 2010, 23(2):106-111. [3] Umezawa H, Aoyagi T, Ogawa K, et al. Diprotins A and B, inhibitors of dipeptidyl aminopeptidase IV, produced by bacteria[J]. Journal of Antibiotics, 1984, 37(4):422. [4] Nongonierma A B, Fitzgerald R J. Susceptibility of milk protein-derived peptides to dipeptidyl peptidase IV (DPP-IV) hydrolysis[J]. Food Chemistry, 2014, 145(145C):845-852. [5] Bella A M , Erickson R H , Kim Y S . Rat intestinal brush border membrane dipeptidyl-aminopeptidase IV: kinetic properties and substrate specificities of the purified enzyme[J]. Archives of Biochemistry & Biophysics, 1982, 218(1):156-162. [6] Nongonierma A B, Fitzgerald R J. Inhibition of dipeptidyl peptidase IV (DPP-IV) by proline containing casein-derived peptides[J]. Journal of Functional Foods, 2013, 5(4):1909-1917. [7] Nongonierma A B, Fitzgerald R J. Structure activity relationship modelling of milk protein-derived peptides with dipeptidyl peptidase IV (DPP-IV) inhibitory activity[J]. Peptides, 2016, 79:1-7.
PubDate	2012