E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPDPIV0024(DPP IV-inhibitory peptide)
DFBP ID DFBPDPIV0024
Peptide sequence GPA
Type Native peptide
Peptide/Function name DPP IV-inhibitory peptide, Anti-diabetic peptide
Function-activity relationship
Main bioactivity DPP-IV inhibitory activity
Otheir bioactivity ACE-inhibitory activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Gly-Pro-Ala
Single-letter amino acid GPA
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 243.26 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY -0.0667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Canola (Brassica napus, Rape)
Precursor protein Cruciferin
Residue position

f(476-478)

Precursor protein(s) search
Source.1: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.2: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.3: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.4: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.5: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.6: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.7: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.8: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.9: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.10: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.11: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.12: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.13: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.14: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.15: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.16: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.17: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.18: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.19: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.20: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.21: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.22: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.23: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.24: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.25: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.26: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.27: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.28: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.29: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.30: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.31: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.32: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.33: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.34: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.35: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.36: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.37: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.38: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.39: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.40: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50
Source.41: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.42: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.43: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.44: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.45: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.46: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.47: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.48: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.49: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.50: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1
Source.51: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.52: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.53: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.54: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.55: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.56: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.57: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.58: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.59: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.60: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.61: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.62: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.63: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.64: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.65: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.66: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.67: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.68: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.69: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.70: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.71: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.72: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.73: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.74: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.75: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.76: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.77: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic
Source.78: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.79: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.80: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.81: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.82: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.83: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.84: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.85: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.86: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.87: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.88: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.89: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.90: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.91: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.92: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.93: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.94: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.95: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.96: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.97: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.98: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.99: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal
Source.100: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.101: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.102: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.103: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.104: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.105: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.106: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.107: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.108: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.109: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.110: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.111: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.112: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.113: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.114: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.115: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.116: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.117: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.118: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.119: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.120: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.121: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.122: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.123: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.124: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.125: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.126: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.127: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.128: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.129: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.130: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.131: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.132: DFBPPR1803 ---- Plant proteins ---- Chitinase 5
Source.133: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.134: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.135: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.136: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.137: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.138: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.139: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.140: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.141: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.142: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.143: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.144: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.145: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.146: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.147: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.148: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.149: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.150: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.151: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.152: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic
Source.153: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.154: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.155: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.156: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.157: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.158: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.159: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.160: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.161: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.162: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.163: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.164: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.165: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.166: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.167: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.168: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.169: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.170: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.171: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.172: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1
Source.173: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.174: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.175: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.176: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.177: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.178: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.179: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.180: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.181: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.182: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.183: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.184: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.185: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.186: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.187: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.188: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4
Source.189: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.190: DFBPPR2216 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 1
Source.191: DFBPPR2223 ---- Plant proteins ---- Urease
Source.192: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.193: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.194: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.195: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.196: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.197: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.198: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.199: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.200: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.201: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.202: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.203: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.204: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.205: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.206: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.207: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.208: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.209: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.210: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.211: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.212: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.213: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.214: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.215: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.216: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.217: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.218: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.219: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b
Source.220: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.221: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.222: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.223: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.224: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.225: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.226: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.227: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9
Source.228: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.229: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.230: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19
Source.231: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.232: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.233: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.234: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein
Source.235: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.236: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.237: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.238: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.239: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.240: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.241: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.242: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.243: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.244: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.245: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.246: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.247: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.248: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.249: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.250: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.251: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.252: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.253: DFBPPR2818 ---- Plant proteins ---- Replication protein A 14 kDa subunit
Source.254: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.255: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.256: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.257: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.258: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.259: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1
Source.260: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.261: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.262: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.263: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.264: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.265: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.266: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1
Source.267: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.268: DFBPPR2939 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 5
Source.269: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.270: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.271: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.272: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.273: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.274: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.275: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.276: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.277: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.278: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.279: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.280: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.281: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.282: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.283: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.284: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.285: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.286: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.287: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.288: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.289: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.290: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.291: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.292: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8
Source.293: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.294: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.295: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.296: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.297: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.298: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.299: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.300: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.301: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.302: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.303: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.304: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.305: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.306: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.307: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.308: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.309: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.310: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.311: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21
Source.312: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.313: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.314: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.315: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.316: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.317: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.318: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.319: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18
Source.320: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.321: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.322: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.323: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.324: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.325: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.326: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.327: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.328: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3
Source.329: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.330: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.331: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19
Source.332: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.333: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.334: DFBPPR3525 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.335: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.336: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.337: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.338: DFBPPR3578 ---- Plant proteins ---- Glutaredoxin-C13
Source.339: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.340: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.341: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.342: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic
Source.343: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.344: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.345: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic
Source.346: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.347: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.348: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.349: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.350: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.351: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.352: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.353: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.354: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.355: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.356: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.357: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.358: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.359: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.360: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.361: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.362: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.363: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55
Source.364: DFBPPR3791 ---- Plant proteins ---- Putative glutaredoxin-C12
Source.365: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.366: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.367: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.368: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.369: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.370: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.371: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.372: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.373: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.374: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.375: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.376: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.377: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11
Source.378: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.379: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.380: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.381: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.382: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.383: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.384: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.385: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.386: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.387: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19
Source.388: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.389: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.390: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.391: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.392: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.393: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.394: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.395: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.396: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.397: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.398: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.399: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.400: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.401: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.402: DFBPPR4068 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 6
Source.403: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.404: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.405: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.406: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.407: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.408: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.409: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.410: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.411: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.412: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.413: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.414: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.415: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.416: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.417: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4
Source.418: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.419: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.420: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.421: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.422: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.423: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.424: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.425: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.426: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.427: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.428: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.429: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.430: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.431: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.432: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.433: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.434: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.435: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.436: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.437: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7
Source.438: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.439: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.440: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.441: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.442: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.443: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.444: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.445: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.446: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.447: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.448: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.449: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.450: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.451: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.452: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.453: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.454: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.455: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.456: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.457: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.458: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.459: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.460: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.461: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.462: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.463: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.464: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.465: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.466: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.467: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.468: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.469: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.470: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.471: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.472: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.473: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.474: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.475: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.476: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.477: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.478: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.479: DFBPPR4713 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 14
Source.480: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800
Source.481: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.482: DFBPPR4738 ---- Plant proteins ---- Putative yippee-like protein Os10g0369500
Source.483: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.484: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.485: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.486: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.487: DFBPPR4776 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 3
Source.488: DFBPPR4783 ---- Plant proteins ---- Putative ripening-related protein 7
Source.489: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100
Source.490: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850
Source.491: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.492: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1
Source.493: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.494: DFBPPR4854 ---- Plant proteins ---- Putative ripening-related protein 6
Source.495: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.496: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.497: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.498: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.499: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.500: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.501: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.502: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.503: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.504: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.505: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.506: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.507: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.508: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.509: DFBPPR4943 ---- Plant proteins ---- Transcription repressor OFP8
Source.510: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.511: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.512: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.513: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.514: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.515: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.516: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.517: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.518: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A
Source.519: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.520: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.521: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.522: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.523: DFBPPR5108 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.524: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.525: DFBPPR5134 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.526: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.527: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.528: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.529: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.530: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.531: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.532: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.533: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B
Source.534: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.535: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.536: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.537: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.538: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.539: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.540: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.541: DFBPPR5402 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.542: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.543: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.544: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.545: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.546: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.547: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.548: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.549: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.550: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.551: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.552: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.553: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.554: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.555: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.556: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.557: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1
Source.558: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.559: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.560: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.561: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.562: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.563: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.564: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.565: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.566: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.567: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.568: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.569: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.570: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.571: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.572: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.573: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.574: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.575: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.576: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.577: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.578: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.579: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.580: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.581: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2
Source.582: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.583: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.584: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.585: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.586: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.587: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.588: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.589: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.590: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.591: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.592: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.593: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.594: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.595: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.596: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.597: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.598: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.599: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.600: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.601: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.602: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.603: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.604: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.605: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.606: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.607: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.608: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.609: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.610: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.611: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.612: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.613: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.614: DFBPPR6049 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 2
Source.615: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.616: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14
Source.617: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.618: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5
Source.619: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.620: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.621: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.622: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.623: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.624: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.625: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.626: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.627: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.628: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.629: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.630: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.631: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.632: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.633: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.634: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.635: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.636: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.637: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.638: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.639: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.640: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.641: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.642: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.643: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.644: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.645: DFBPPR6502 ---- Plant proteins ---- Early light-induced protein, chloroplastic
Source.646: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.647: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.648: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.649: DFBPPR6575 ---- Plant proteins ---- Metallothionein-like protein 1
Source.650: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1
Source.651: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.652: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.653: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.654: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.655: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2
Source.656: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.657: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.658: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.659: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.660: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.661: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.662: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.663: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.664: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.665: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.666: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.667: DFBPPR6999 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor II-4
Source.668: DFBPPR7004 ---- Plant proteins ---- Uncharacterized 16 kDa protein in middle repetitive insertion sequence WIS1
Source.669: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.670: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.671: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.672: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.673: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.674: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.675: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.676: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.677: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.678: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.679: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.680: DFBPPR7047 ---- Plant proteins ---- Hordoindoline-A
Source.681: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.682: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.683: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.684: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.685: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.686: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2
Source.687: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.688: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.689: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.690: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.691: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.692: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.693: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.694: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.695: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.696: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.697: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.698: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.699: DFBPPR7172 ---- Plant proteins ---- Barwin
Source.700: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.701: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.702: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.703: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.704: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.705: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.706: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.707: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.708: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.709: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.710: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.711: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.712: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.713: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.714: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.715: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.716: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.717: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.718: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.719: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.720: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.721: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.722: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2
Source.723: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.724: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.725: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.726: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.727: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.728: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.729: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C
Source.730: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.731: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.732: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.733: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.734: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.735: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.736: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.737: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.738: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.739: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.740: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.741: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.742: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.743: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.744: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.745: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.746: DFBPPR16024 ---- Animal proteins ---- Podocalyxin
Source.747: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.748: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.749: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.750: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.751: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.752: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.753: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.754: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.755: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.756: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.757: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.758: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.759: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.760: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.761: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.762: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.763: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.764: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.765: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.766: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.767: DFBPPR16159 ---- Animal proteins ---- Apolipoprotein C-I
Source.768: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.769: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.770: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.771: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.772: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.773: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.774: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.775: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.776: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.777: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.778: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.779: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.780: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.781: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.782: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.783: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.784: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.785: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.786: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.787: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.788: DFBPPR16307 ---- Animal proteins ---- DNA-binding protein inhibitor ID-3
Source.789: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.790: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.791: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.792: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.793: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.794: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.795: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.796: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.797: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.798: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.799: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.800: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.801: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.802: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.803: DFBPPR16520 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.804: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.805: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.806: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.807: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.808: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.809: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.810: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.811: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan
Source.812: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.813: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.814: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.815: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.816: DFBPPR16628 ---- Animal proteins ---- Neuroglobin
Source.817: DFBPPR16635 ---- Animal proteins ---- Corticoliberin
Source.818: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.819: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.820: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.821: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.822: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.823: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.824: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.825: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.826: DFBPPR16746 ---- Animal proteins ---- Tektin-1
Source.827: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.828: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.829: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.830: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.831: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.832: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.833: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.834: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.835: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.836: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.837: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.838: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.839: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.840: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.841: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.842: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.843: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.844: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.845: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.846: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.847: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.848: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.849: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.850: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.851: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.852: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.853: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.854: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.855: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.856: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.857: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.858: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.859: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.860: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.861: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.862: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.863: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.864: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.865: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.866: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.867: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.868: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.869: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.870: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.871: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.872: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.873: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.874: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.875: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.876: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.877: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.878: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.879: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.880: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.881: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.882: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.883: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.884: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.885: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.886: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.887: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.888: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.889: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.890: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.891: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.892: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.893: DFBPPR17423 ---- Animal proteins ---- Furin
Source.894: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.895: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.896: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.897: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.898: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.899: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.900: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.901: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.902: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.903: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.904: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.905: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.906: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.907: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.908: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.909: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.910: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.911: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.912: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B
Source.913: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.914: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.915: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.916: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.917: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.918: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.919: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.920: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.921: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3
Source.922: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.923: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.924: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.925: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.926: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1
Source.927: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.928: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.929: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.930: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.931: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.932: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.933: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.934: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B
Source.935: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.936: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.937: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.938: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.939: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.940: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.941: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.942: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.943: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.944: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.945: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.946: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.947: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.948: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.949: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.950: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.951: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.952: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.953: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.954: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.955: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1
Source.956: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A
Source.957: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.958: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.959: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.960: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.961: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.962: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain
Source.963: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.964: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S
Source.965: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.966: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.967: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1
Source.968: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.969: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.970: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.971: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.972: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.973: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.974: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.975: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.976: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.977: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.978: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.979: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.980: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.981: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.982: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.983: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.984: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.985: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.986: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1
Source.987: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.988: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.989: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.990: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.991: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.992: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha
Source.993: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.994: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.995: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.996: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.997: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.998: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.999: DFBPPR18396 ---- Animal proteins ---- Corticoliberin
Source.1000: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.1001: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.1002: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.1003: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.1004: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.1005: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.1006: DFBPPR18441 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1007: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1008: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.1009: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.1010: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.1011: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.1012: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.1013: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.1014: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1015: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.1016: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.1017: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1018: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.1019: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.1020: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.1021: DFBPPR18563 ---- Animal proteins ---- Collectin-43
Source.1022: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1
Source.1023: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1024: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1025: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.1026: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1027: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1028: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1029: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1030: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1031: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26
Source.1032: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.1033: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.1034: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.1035: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1036: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.1037: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.1038: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.1039: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1040: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114
Source.1041: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.1042: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.1043: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.1044: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.1045: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1046: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.1047: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.1048: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.1049: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.1050: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1051: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15
Source.1052: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.1053: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.1054: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.1055: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.1056: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.1057: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1058: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1059: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.1060: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.1061: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.1062: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.1063: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1064: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.1065: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1066: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1067: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.1068: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.1069: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.1070: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.1071: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.1072: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.1073: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.1074: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.1075: DFBPPR19025 ---- Animal proteins ---- Cytochrome c oxidase subunit 8A, mitochondrial
Source.1076: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.1077: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.1078: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.1079: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1080: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.1081: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.1082: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.1083: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.1084: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.1085: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.1086: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.1087: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.1088: DFBPPR19082 ---- Animal proteins ---- Protein SCO2 homolog, mitochondrial
Source.1089: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1090: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.1091: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.1092: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.1093: DFBPPR19131 ---- Animal proteins ---- Nectin-4
Source.1094: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2
Source.1095: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.1096: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.1097: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.1098: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.1099: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.1100: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.1101: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1102: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.1103: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.1104: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.1105: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.1106: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1107: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.1108: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.1109: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.1110: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1111: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.1112: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.1113: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.1114: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.1115: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1116: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.1117: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.1118: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.1119: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.1120: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1
Source.1121: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.1122: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.1123: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3
Source.1124: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.1125: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.1126: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.1127: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.1128: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.1129: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.1130: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.1131: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.1132: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1133: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.1134: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.1135: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.1136: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.1137: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.1138: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1139: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.1140: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.1141: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.1142: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.1143: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.1144: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.1145: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial
Source.1146: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.1147: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.1148: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.1149: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1150: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1151: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1152: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1
Source.1153: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.1154: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.1155: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.1156: DFBPPR19642 ---- Animal proteins ---- Agouti-related protein
Source.1157: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.1158: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2
Source.1159: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.1160: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1161: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E
Source.1162: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.1163: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.1164: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1165: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein
Source.1166: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.1167: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.1168: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.1169: DFBPPR19745 ---- Animal proteins ---- Collectin-46
Source.1170: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.1171: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.1172: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.1173: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4
Source.1174: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.1175: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.1176: DFBPPR19783 ---- Animal proteins ---- Syndecan-1
Source.1177: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.1178: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.1179: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.1180: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1181: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B
Source.1182: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.1183: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.1184: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1185: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.1186: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.1187: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.1188: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.1189: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1190: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.1191: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.1192: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.1193: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.1194: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.1195: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.1196: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.1197: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1198: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.1199: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.1200: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.1201: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.1202: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.1203: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1204: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.1205: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.1206: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.1207: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1208: DFBPPR20067 ---- Animal proteins ---- Glutaredoxin-2, mitochondrial
Source.1209: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.1210: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.1211: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.1212: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1213: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.1214: DFBPPR20143 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.1215: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.1216: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.1217: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.1218: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.1219: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein
Source.1220: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1221: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.1222: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.1223: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.1224: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.1225: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.1226: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.1227: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.1228: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.1229: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.1230: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.1231: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.1232: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.1233: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.1234: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.1235: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan
Source.1236: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.1237: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.1238: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.1239: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.1240: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.1241: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1242: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.1243: DFBPPR20396 ---- Animal proteins ---- Claudin-5
Source.1244: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.1245: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1246: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1247: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.1248: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.1249: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1250: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF
Source.1251: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial
Source.1252: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.1253: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator
Source.1254: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.1255: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.1256: DFBPPR20497 ---- Animal proteins ---- Serine/Arginine-related protein 53
Source.1257: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.1258: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.1259: DFBPPR20506 ---- Animal proteins ---- Akirin-2
Source.1260: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.1261: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.1262: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.1263: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.1264: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.1265: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.1266: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1267: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.1268: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.1269: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.1270: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.1271: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.1272: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.1273: DFBPPR20669 ---- Animal proteins ---- D site-binding protein
Source.1274: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.1275: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1276: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.1277: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1278: DFBPPR20726 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.1279: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.1280: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.1281: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.1282: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.1283: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.1284: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.1285: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.1286: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial
Source.1287: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1288: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.1289: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.1290: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.1291: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5
Source.1292: DFBPPR20877 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD5
Source.1293: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.1294: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.1295: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.1296: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1297: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.1298: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1299: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.1300: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.1301: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.1302: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.1303: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.1304: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.1305: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.1306: DFBPPR20984 ---- Animal proteins ---- Neuroglobin
Source.1307: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.1308: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.1309: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.1310: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.1311: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.1312: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.1313: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.1314: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1315: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.1316: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.1317: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.1318: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.1319: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.1320: DFBPPR21125 ---- Animal proteins ---- Male-enhanced antigen 1
Source.1321: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.1322: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.1323: DFBPPR21185 ---- Animal proteins ---- Lymphocyte antigen 6H
Source.1324: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1325: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.1326: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.1327: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.1328: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6
Source.1329: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.1330: DFBPPR21296 ---- Animal proteins ---- Parathymosin
Source.1331: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D
Source.1332: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.1333: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.1334: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3
Source.1335: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1336: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.1337: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.1338: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.1339: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.1340: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1341: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.1342: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.1343: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.1344: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.1345: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.1346: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.1347: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.1348: DFBPPR21416 ---- Animal proteins ---- 39S ribosomal protein L32, mitochondrial
Source.1349: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.1350: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.1351: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2
Source.1352: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.1353: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.1354: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.1355: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.1356: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1
Source.1357: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.1358: DFBPPR21545 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1
Source.1359: DFBPPR21546 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 29
Source.1360: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.1361: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.1362: DFBPPR21578 ---- Animal proteins ---- Calcium-binding protein 5
Source.1363: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1364: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.1365: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1366: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.1367: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.1368: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A
Source.1369: DFBPPR21687 ---- Animal proteins ---- Ropporin-1-like protein
Source.1370: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.1371: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2
Source.1372: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1373: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2
Source.1374: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.1375: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1376: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.1377: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6
Source.1378: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.1379: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.1380: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.1381: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.1382: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.1383: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.1384: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.1385: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2
Source.1386: DFBPPR21840 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.1387: DFBPPR21843 ---- Animal proteins ---- Tektin-1
Source.1388: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2
Source.1389: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.1390: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.1391: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1
Source.1392: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.1393: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.1394: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1395: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.1396: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.1397: DFBPPR21948 ---- Animal proteins ---- Selenoprotein F
Source.1398: DFBPPR21964 ---- Animal proteins ---- Protein yippee-like 3
Source.1399: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.1400: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.1401: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.1402: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.1403: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.1404: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18
Source.1405: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.1406: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.1407: DFBPPR22099 ---- Animal proteins ---- Beta-centractin
Source.1408: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.1409: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.1410: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.1411: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.1412: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3
Source.1413: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.1414: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.1415: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.1416: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.1417: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.1418: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.1419: DFBPPR22199 ---- Animal proteins ---- SCAN domain-containing protein 1
Source.1420: DFBPPR22208 ---- Animal proteins ---- Protein yippee-like 2
Source.1421: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.1422: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.1423: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1424: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.1425: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2
Source.1426: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.1427: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.1428: DFBPPR22293 ---- Animal proteins ---- Nutritionally-regulated adipose and cardiac-enriched protein homolog
Source.1429: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.1430: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.1431: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.1432: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.1433: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.1434: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.1435: DFBPPR22345 ---- Animal proteins ---- Small muscular protein
Source.1436: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1437: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.1438: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247
Source.1439: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86
Source.1440: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.1441: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.1442: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1
Source.1443: DFBPPR22402 ---- Animal proteins ---- Alternative prion protein
Source.1444: DFBPPR22403 ---- Animal proteins ---- Heat shock protein beta-9
Source.1445: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.1446: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.1447: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.1448: DFBPPR22429 ---- Animal proteins ---- Coiled-coil domain-containing protein 107
Source.1449: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.1450: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.1451: DFBPPR22459 ---- Animal proteins ---- SCP2 sterol-binding domain-containing protein 1
Source.1452: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.1453: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1
Source.1454: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.1455: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.1456: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1
Source.1457: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1
Source.1458: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C
Source.1459: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.1460: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B
Source.1461: DFBPPR22555 ---- Animal proteins ---- Bcl-2-like protein 15
Source.1462: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.1463: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.1464: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.1465: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog
Source.1466: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.1467: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A
Source.1468: DFBPPR22599 ---- Animal proteins ---- Tetratricopeptide repeat protein 9C
Source.1469: DFBPPR22601 ---- Animal proteins ---- Leukocyte receptor cluster member 1 homolog
Source.1470: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.1471: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.1472: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.1473: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61
Source.1474: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.1475: DFBPPR22640 ---- Animal proteins ---- Placenta-specific gene 8 protein
Source.1476: DFBPPR22655 ---- Animal proteins ---- Coiled-coil domain-containing protein 190
Source.1477: DFBPPR22659 ---- Animal proteins ---- Testis-expressed protein 35
Source.1478: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.1479: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.1480: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1
Source.1481: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog
Source.1482: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.1483: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.1484: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog
Source.1485: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.1486: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog
Source.1487: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1488: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.1489: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1490: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1491: DFBPPR8611 ---- Animal proteins ---- Basic proline-rich protein
Source.1492: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1493: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1494: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.1495: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1496: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.1497: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.1498: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.1499: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.1500: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1501: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.1502: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1503: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1504: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.1505: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1506: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.1507: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1508: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.1509: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1510: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1511: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.1512: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.1513: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1514: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.1515: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.1516: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.1517: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1518: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.1519: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1520: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.1521: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1522: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1523: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.1524: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1525: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.1526: DFBPPR9018 ---- Animal proteins ---- Transthyretin
Source.1527: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.1528: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1529: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.1530: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.1531: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.1532: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.1533: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.1534: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.1535: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1536: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.1537: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.1538: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.1539: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.1540: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.1541: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D
Source.1542: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.1543: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.1544: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1545: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.1546: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.1547: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.1548: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.1549: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.1550: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1551: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.1552: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.1553: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1554: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.1555: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.1556: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1557: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.1558: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.1559: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1560: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.1561: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.1562: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.1563: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.1564: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1565: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1566: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1567: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1568: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.1569: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1570: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.1571: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.1572: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.1573: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.1574: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta
Source.1575: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1576: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.1577: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1578: DFBPPR9597 ---- Animal proteins ---- Insulin-like 3
Source.1579: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1580: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.1581: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.1582: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.1583: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1584: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.1585: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1586: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.1587: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta
Source.1588: DFBPPR9678 ---- Animal proteins ---- Neuropeptide W
Source.1589: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1590: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.1591: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.1592: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.1593: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B
Source.1594: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.1595: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1596: DFBPPR9786 ---- Animal proteins ---- Adipogenin
Source.1597: DFBPPR9795 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5
Source.1598: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.1599: DFBPPR9865 ---- Animal proteins ---- Male-enhanced antigen 1
Source.1600: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2
Source.1601: DFBPPR9878 ---- Animal proteins ---- Selenoprotein F
Source.1602: DFBPPR9923 ---- Animal proteins ---- Small muscular protein
Source.1603: DFBPPR9939 ---- Animal proteins ---- Tctex1 domain-containing protein 4
Source.1604: DFBPPR9950 ---- Animal proteins ---- 20 kDa neutrophil cationic protein
Source.1605: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.1606: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1607: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.1608: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.1609: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.1610: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.1611: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.1612: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.1613: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1614: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.1615: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1616: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.1617: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.1618: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1619: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.1620: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1621: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.1622: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1623: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.1624: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.1625: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1626: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.1627: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1628: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.1629: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.1630: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.1631: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1632: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2
Source.1633: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1634: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.1635: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1636: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.1637: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.1638: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.1639: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.1640: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.1641: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.1642: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.1643: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1644: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.1645: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.1646: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.1647: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk
Source.1648: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.1649: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.1650: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.1651: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.1652: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.1653: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.1654: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.1655: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1656: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.1657: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1658: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1659: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1660: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.1661: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1662: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1663: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.1664: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.1665: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.1666: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.1667: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1668: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.1669: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.1670: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.1671: DFBPPR10509 ---- Animal proteins ---- Calponin-1
Source.1672: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.1673: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.1674: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.1675: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.1676: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.1677: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.1678: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.1679: DFBPPR10537 ---- Animal proteins ---- Neuromodulin
Source.1680: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1681: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.1682: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1683: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.1684: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B
Source.1685: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1686: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.1687: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.1688: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1689: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1690: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1691: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.1692: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1693: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1694: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.1695: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.1696: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.1697: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.1698: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.1699: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.1700: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1701: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.1702: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1703: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1704: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1705: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.1706: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.1707: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.1708: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain
Source.1709: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.1710: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.1711: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.1712: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.1713: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.1714: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.1715: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.1716: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.1717: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.1718: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1719: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1720: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.1721: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.1722: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1723: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate
Source.1724: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.1725: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.1726: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.1727: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.1728: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.1729: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.1730: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.1731: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.1732: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.1733: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.1734: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1735: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.1736: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.1737: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1738: DFBPPR11099 ---- Animal proteins ---- Acylphosphatase-1
Source.1739: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.1740: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.1741: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.1742: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1
Source.1743: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.1744: DFBPPR11146 ---- Animal proteins ---- Formin
Source.1745: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.1746: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.1747: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.1748: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.1749: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.1750: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.1751: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1752: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.1753: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.1754: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.1755: DFBPPR11282 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.1756: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.1757: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.1758: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.1759: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.1760: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.1761: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.1762: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.1763: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.1764: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1765: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.1766: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.1767: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.1768: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.1769: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.1770: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1771: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.1772: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.1773: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1774: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2
Source.1775: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.1776: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.1777: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.1778: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.1779: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.1780: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166
Source.1781: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.1782: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1783: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.1784: DFBPPR11549 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.1785: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.1786: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.1787: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4
Source.1788: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.1789: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1790: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.1791: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.1792: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.1793: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.1794: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.1795: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1796: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.1797: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1798: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.1799: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.1800: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.1801: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.1802: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.1803: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.1804: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.1805: DFBPPR11806 ---- Animal proteins ---- Homeobox protein Hox-B6
Source.1806: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1
Source.1807: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.1808: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.1809: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.1810: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1811: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.1812: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1813: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.1814: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.1815: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.1816: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.1817: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1818: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.1819: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.1820: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.1821: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.1822: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.1823: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.1824: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.1825: DFBPPR12043 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 5
Source.1826: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.1827: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.1828: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.1829: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.1830: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.1831: DFBPPR12137 ---- Animal proteins ---- Homeobox protein CHOX-7
Source.1832: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.1833: DFBPPR12177 ---- Animal proteins ---- Beta-keratin-related protein
Source.1834: DFBPPR12213 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.1835: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.1836: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.1837: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.1838: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1839: DFBPPR12236 ---- Animal proteins ---- Protein FAM133
Source.1840: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.1841: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1842: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.1843: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.1844: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.1845: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.1846: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1847: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1848: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.1849: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1850: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1851: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.1852: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.1853: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.1854: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1855: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1856: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.1857: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.1858: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.1859: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1860: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1861: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.1862: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.1863: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.1864: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.1865: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.1866: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.1867: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1868: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.1869: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.1870: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.1871: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14
Source.1872: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1873: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1874: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.1875: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1876: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.1877: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1878: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.1879: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1880: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.1881: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.1882: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1883: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase
Source.1884: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.1885: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1886: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1887: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.1888: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.1889: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.1890: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.1891: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.1892: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.1893: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.1894: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.1895: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.1896: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.1897: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.1898: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.1899: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1900: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.1901: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1902: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.1903: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.1904: DFBPPR12848 ---- Animal proteins ---- Sarcoplasmic reticulum histidine-rich calcium-binding protein
Source.1905: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.1906: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.1907: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1908: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn]
Source.1909: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.1910: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.1911: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1912: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.1913: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1914: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.1915: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1916: DFBPPR13033 ---- Animal proteins ---- Neuroglobin
Source.1917: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10
Source.1918: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.1919: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1920: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.1921: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.1922: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1923: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1924: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1925: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.1926: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.1927: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.1928: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1929: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.1930: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1931: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.1932: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1933: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.1934: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1935: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.1936: DFBPPR13450 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.1937: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1938: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1939: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1940: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.1941: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.1942: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1943: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.1944: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1945: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.1946: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.1947: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1948: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.1949: DFBPPR13654 ---- Animal proteins ---- Corticoliberin
Source.1950: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1951: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.1952: DFBPPR13688 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.1953: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.1954: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.1955: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.1956: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.1957: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.1958: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.1959: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.1960: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.1961: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.1962: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1963: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.1964: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.1965: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.1966: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1967: DFBPPR13887 ---- Animal proteins ---- Keratin-associated protein 3-2
Source.1968: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1969: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.1970: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein
Source.1971: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein
Source.1972: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.1973: DFBPPR13930 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.1974: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1975: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1976: DFBPPR13958 ---- Animal proteins ---- Homeobox protein Hox-D3
Source.1977: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.1978: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin
Source.1979: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.1980: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.1981: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.1982: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.1983: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.1984: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.1985: DFBPPR14298 ---- Marine protein ---- Acetolactate synthase small subunit
Source.1986: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.1987: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.1988: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.1989: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit
Source.1990: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha
Source.1991: DFBPPR14436 ---- Marine protein ---- 50S ribosomal protein L11, chloroplastic
Source.1992: DFBPPR14451 ---- Marine protein ---- Protein PsbN
Source.1993: DFBPPR14480 ---- Marine protein ---- Photosystem II reaction center protein Ycf12
Source.1994: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.1995: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.1996: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.1997: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.1998: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.1999: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.2000: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.2001: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4
Source.2002: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.2003: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.2004: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.2005: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.2006: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.2007: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.2008: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.2009: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.2010: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.2011: DFBPPR14675 ---- Marine protein ---- Glucagon-2
Source.2012: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.2013: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.2014: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.2015: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.2016: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.2017: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.2018: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.2019: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.2020: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.2021: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.2022: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.2023: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.2024: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.2025: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2026: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.2027: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.2028: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.2029: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.2030: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.2031: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial
Source.2032: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.2033: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase
Source.2034: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.2035: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.2036: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.2037: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.2038: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.2039: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.2040: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.2041: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.2042: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.2043: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.2044: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.2045: DFBPPR15474 ---- Microorganism protein ---- GPN-loop GTPase 3
Source.2046: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.2047: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3
Source.2048: DFBPPR15522 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 3
Source.2049: DFBPPR15537 ---- Microorganism protein ---- mRNA 3'-end-processing protein YTH1
Source.2050: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.2051: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.2052: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.2053: DFBPPR15649 ---- Microorganism protein ---- Protein TAR1
Source.2054: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.2055: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.2056: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2
Source.2057: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.2058: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.2059: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.2060: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.2061: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.2062: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.2063: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.2064: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2065: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.2066: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2067: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.2068: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.2069: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.2070: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.2071: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.2072: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.2073: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.2074: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.2075: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.2076: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.2077: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.2078: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.2079: DFBPPR7979 ---- Plant protein ---- Metallothionein-like protein 1B
Source.2080: DFBPPR7980 ---- Plant protein ---- Metallothionein-like protein 1A
Source.2081: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.2082: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.2083: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.2084: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.2085: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.2086: DFBPPR8080 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2087: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2088: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.2089: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin
Source.2090: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.2091: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2092: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.2093: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2094: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.2095: DFBPPR8234 ---- Plant protein ---- Anther-specific protein SF18
Source.2096: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
DPP IV-inhibitory activity

The peptide showed potent inhibitory activity for Dipeptidyl-peptidase IV (EC 3.4.14.5) with a low Km value of 0.31 mM.

Table 1 Kinetic parameters of dipeptidyl-aminopeptidase IV with peptide
Substrate
S0 (mM)
Km (mM)
V (μmol × 10-6 s-1)
E0a (μmol × 10-6)Kcat (s-1)
Kcat/Km (s-1 mM-1)
Gly-L-Pro-L-Ala
0.2-2.5
0.31
9.6
0.208
46.2
272
a Molecular weight of the enzyme = 230000.
Specific target protein(s) Specific Target Protein(s):
Dipeptidyl peptidase 4
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

Synthesis peptide

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPACEI0443
[D2] DFBPMUFU0424
BIOPEP-UWM [D3] 3342, 8522
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Bella, A.M., Erickson, R.H., Kim, Y.S. Rat intestinal brush border membrane dipeptidyl-aminopeptidase IV: Kinetic properties and substrate specificities of the purified enzyme. Archives of Biochemistry and Biophysics. 1982, 218, 156-62.
Other literature(s)

[1] ACE inhibitory peptides. in: Nutraceutical proteins and peptides in health and disease. Mine Y., Shahidi F. (Eds.), CRC Taylor & Francis Group, Boca Raton, London, New York, 269-315.
[2] Lacroix I M E, Li-Chan E C Y. Evaluation of the potential of dietary proteins as precursors of dipeptidyl peptidase (DPP)-IV inhibitors by an in silico, approach[J]. Journal of Functional Foods, 2012, 4(2):403-422.

PubDate 1982
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214