E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPDPIV0106(DPP IV-inhibitory peptide)
DFBP ID DFBPDPIV0106
Peptide sequence IPM
Type Native peptide
Peptide/Function name DPP-IV inhibitory peptide, Anti-diabetic peptide
Function-activity relationship
Main bioactivity DPP-IV inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Ile-Pro-Met
Single-letter amino acid IPM
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 359.48 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 1.6000 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Milk protein
Precursor protein Lactoferrin
Residue position

f(127-129, 469-471)

Precursor protein(s) search
Source.1: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.2: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.3: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.4: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.5: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.6: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.7: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.8: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.9: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.10: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.11: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.12: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.13: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.14: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.15: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.16: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.17: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.18: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.19: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.20: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.21: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.22: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.23: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.24: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.25: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.26: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.27: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.28: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.29: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.30: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.31: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.32: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.33: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.34: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.35: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.36: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.37: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.38: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.39: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.40: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.41: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.42: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.43: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.44: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.45: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.46: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.47: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.48: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.49: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.50: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.51: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.52: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.53: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.54: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.55: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.56: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.57: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.58: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.59: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.60: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.61: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.62: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.63: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.64: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.65: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.66: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.67: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.68: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.69: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.70: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1
Source.71: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.72: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.73: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.74: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.75: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.76: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.77: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.78: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.79: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.80: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.81: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.82: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.83: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.84: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.85: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.86: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.87: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.88: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.89: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.90: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.91: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.92: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.93: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.94: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.95: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.96: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1
Source.97: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.98: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.99: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.100: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.101: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.102: DFBPPR3873 ---- Plant proteins ---- Putative glutaredoxin-C14
Source.103: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.104: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.105: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.106: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.107: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.108: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.109: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.110: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.111: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.112: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.113: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.114: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.115: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.116: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.117: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.118: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.119: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.120: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.121: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.122: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.123: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.124: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.125: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.126: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.127: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.128: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.129: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.130: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.131: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.132: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.133: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.134: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.135: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.136: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.137: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.138: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.139: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.140: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.141: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.142: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.143: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.144: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.145: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.146: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.147: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.148: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.149: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.150: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.151: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.152: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.153: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.154: DFBPPR6923 ---- Plant proteins ---- Avenin-like a1
Source.155: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.156: DFBPPR6961 ---- Plant proteins ---- Avenin-like a2
Source.157: DFBPPR6964 ---- Plant proteins ---- Avenin-like a3
Source.158: DFBPPR6971 ---- Plant proteins ---- Avenin-like a7
Source.159: DFBPPR6973 ---- Plant proteins ---- Avenin-like a6
Source.160: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4
Source.161: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.162: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.163: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.164: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.165: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.166: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.167: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.168: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.169: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.170: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.171: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.172: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.173: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.174: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.175: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.176: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.177: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1
Source.178: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.179: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.180: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.181: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.182: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.183: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.184: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.185: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.186: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.187: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.188: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.189: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.190: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.191: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.192: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.193: DFBPPR16037 ---- Animal proteins ---- Caveolin-1
Source.194: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.195: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.196: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.197: DFBPPR16143 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase
Source.198: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.199: DFBPPR16179 ---- Animal proteins ---- C-C motif chemokine 8
Source.200: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.201: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.202: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.203: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.204: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.205: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.206: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.207: DFBPPR16721 ---- Animal proteins ---- Testin
Source.208: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.209: DFBPPR16927 ---- Animal proteins ---- Caveolin-1
Source.210: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.211: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.212: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.213: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.214: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.215: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.216: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.217: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.218: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.219: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.220: DFBPPR17490 ---- Animal proteins ---- TIR domain-containing adapter molecule 2
Source.221: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.222: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.223: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.224: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.225: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.226: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.227: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.228: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.229: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.230: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.231: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.232: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain
Source.233: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.234: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1
Source.235: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.236: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.237: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.238: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.239: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41
Source.240: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.241: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.242: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.243: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.244: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.245: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.246: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.247: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.248: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.249: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.250: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.251: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.252: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF
Source.253: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.254: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.255: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.256: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.257: DFBPPR18619 ---- Animal proteins ---- Ras-related protein Rab-7b
Source.258: DFBPPR18779 ---- Animal proteins ---- Mucin-15
Source.259: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.260: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.261: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.262: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.263: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.264: DFBPPR18936 ---- Animal proteins ---- S-methyl-5'-thioadenosine phosphorylase
Source.265: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.266: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial
Source.267: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.268: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.269: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.270: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial
Source.271: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.272: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.273: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.274: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.275: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.276: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.277: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.278: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.279: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.280: DFBPPR19992 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm3
Source.281: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.282: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.283: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.284: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.285: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.286: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.287: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial
Source.288: DFBPPR20635 ---- Animal proteins ---- Transcription elongation factor A protein 1
Source.289: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.290: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.291: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.292: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.293: DFBPPR21125 ---- Animal proteins ---- Male-enhanced antigen 1
Source.294: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4
Source.295: DFBPPR21272 ---- Animal proteins ---- Testin
Source.296: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.297: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.298: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.299: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.300: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.301: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.302: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.303: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.304: DFBPPR21954 ---- Animal proteins ---- Secreted seminal-vesicle Ly-6 protein 1
Source.305: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3
Source.306: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.307: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.308: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.309: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.310: DFBPPR22345 ---- Animal proteins ---- Small muscular protein
Source.311: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.312: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4
Source.313: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.314: DFBPPR22518 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 4-like 2
Source.315: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.316: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.317: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.318: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.319: DFBPPR8593 ---- Animal proteins ---- Caveolin-1
Source.320: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.321: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.322: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.323: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II
Source.324: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.325: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.326: DFBPPR8848 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase
Source.327: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.328: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.329: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.330: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.331: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.332: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.333: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.334: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.335: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.336: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.337: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.338: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.339: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.340: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.341: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.342: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.343: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2
Source.344: DFBPPR9814 ---- Animal proteins ---- Testin
Source.345: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.346: DFBPPR9865 ---- Animal proteins ---- Male-enhanced antigen 1
Source.347: DFBPPR9923 ---- Animal proteins ---- Small muscular protein
Source.348: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.349: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.350: DFBPPR10108 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase
Source.351: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.352: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.353: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.354: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.355: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.356: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.357: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.358: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.359: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.360: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.361: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.362: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.363: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.364: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.365: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.366: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.367: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.368: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.369: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.370: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.371: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.372: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.373: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.374: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.375: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.376: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.377: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.378: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.379: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.380: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.381: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.382: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.383: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.384: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.385: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.386: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.387: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.388: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.389: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.390: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.391: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.392: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.393: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.394: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.395: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7
Source.396: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.397: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.398: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.399: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.400: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.401: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.402: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.403: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.404: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.405: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.406: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.407: DFBPPR12065 ---- Animal proteins ---- Testin
Source.408: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.409: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.410: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.411: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.412: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.413: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.414: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.415: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.416: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.417: DFBPPR12397 ---- Animal proteins ---- Caveolin-1
Source.418: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.419: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.420: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.421: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.422: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.423: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.424: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.425: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.426: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.427: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.428: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.429: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.430: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.431: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.432: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.433: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.434: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.435: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.436: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.437: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.438: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.439: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.440: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.441: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.442: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.443: DFBPPR13092 ---- Animal proteins ---- Testin
Source.444: DFBPPR13173 ---- Animal proteins ---- Caveolin-1
Source.445: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.446: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.447: DFBPPR13379 ---- Animal proteins ---- Alpha-1-antiproteinase 1
Source.448: DFBPPR13409 ---- Animal proteins ---- Testin
Source.449: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.450: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.451: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.452: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.453: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.454: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.455: DFBPPR13689 ---- Animal proteins ---- Caveolin-1
Source.456: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.457: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.458: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.459: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.460: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.461: DFBPPR13918 ---- Animal proteins ---- Testin
Source.462: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.463: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2
Source.464: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.465: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.466: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.467: DFBPPR14096 ---- Marine protein ---- Serum amyloid P-component
Source.468: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.469: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.470: DFBPPR14228 ---- Marine protein ---- UPF0691 protein C9orf116 homolog
Source.471: DFBPPR14247 ---- Marine protein ---- Pro-MCH 2
Source.472: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.473: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.474: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.475: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.476: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.477: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.478: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.479: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.480: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.481: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.482: DFBPPR14684 ---- Marine protein ---- Pro-MCH 2
Source.483: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.484: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.485: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.486: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.487: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.488: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.489: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.490: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.491: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.492: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.493: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.494: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.495: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.496: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.497: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.498: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.499: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.500: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.501: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.502: DFBPPR15565 ---- Microorganism protein ---- 37S ribosomal protein S10, mitochondrial
Source.503: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.504: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11
Source.505: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.506: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.507: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.508: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.509: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial
Source.510: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.511: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.512: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.513: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.514: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.515: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.516: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.517: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.518: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.519: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
DPP IV-inhibitory activity

The peptide showed potent inhibitory activity against Dipeptidyl-peptidase IV (EC 3.4.14.5) with the IC50 value of 69.5 ± 8.7 μM, and its DPP-IV inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern. 


Specific target protein(s) Specific Target Protein(s):
Dipeptidyl peptidase 4
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

The peptide IPM was obtained from Thermo Fisher Scientific (Ulm, Germany).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Peptides present within the gastrointestinal tract of human may have promise for the development of natural DPP-IV inhibitors for the management of serum glucose.

Database cross-references
BIOPEP-UWM [D1] 9233
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Nongonierma AB, FitzGerald RJ. Structure activity relationship modelling of milk protein-derived peptides with dipeptidyl peptidase IV (DPP-IV) inhibitory activity. Peptides. 2016 May;79:1-7.
PMID: 26988873
Other literature(s) N.D
PubDate 2016
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214