E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPDPIV0159(DPP IV-inhibitory peptide)
DFBP ID DFBPDPIV0159
Peptide sequence IPI
Type Native peptide
Peptide/Function name DPP-IV inhibitory peptide, Anti-diabetic peptide, Diprotin A
Function-activity relationship
Main bioactivity DPP-IV inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Ile-Pro-Ile
Single-letter amino acid IPI
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 341.44 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 2.4667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine milk protein
Precursor protein κ-Casein
Residue position

f(26-28)

Precursor protein(s) search
Source.1: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.2: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.3: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.4: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.5: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.6: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.7: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.8: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.9: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.10: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.11: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.12: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.13: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.14: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.15: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B
Source.16: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.17: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.18: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.19: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic
Source.20: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.21: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.22: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.23: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.24: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.25: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.26: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.27: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.28: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic
Source.29: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.30: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.31: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.32: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.33: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.34: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.35: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.36: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.37: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.38: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.39: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.40: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic
Source.41: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.42: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.43: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.44: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.45: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.46: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.47: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.48: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.49: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.50: DFBPPR1751 ---- Plant proteins ---- Heat stress transcription factor A-4b
Source.51: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.52: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.53: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.54: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.55: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.56: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.57: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.58: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.59: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.60: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.61: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.62: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.63: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.64: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.65: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.66: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.67: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.68: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.69: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.70: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.71: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.72: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.73: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.74: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.75: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.76: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.77: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.78: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.79: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.80: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic
Source.81: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.82: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.83: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.84: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.85: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.86: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.87: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.88: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.89: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.90: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.91: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.92: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.93: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.94: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.95: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.96: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.97: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.98: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.99: DFBPPR2710 ---- Plant proteins ---- 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase, chloroplastic
Source.100: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.101: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.102: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.103: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.104: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.105: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.106: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.107: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.108: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.109: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.110: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.111: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.112: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.113: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.114: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.115: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.116: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase
Source.117: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.118: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.119: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.120: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.121: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.122: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.123: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.124: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.125: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.126: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.127: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.128: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.129: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.130: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.131: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.132: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.133: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.134: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.135: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.136: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.137: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.138: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.139: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.140: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.141: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.142: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.143: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.144: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.145: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.146: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.147: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.148: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.149: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.150: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.151: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.152: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.153: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.154: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18
Source.155: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.156: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.157: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.158: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.159: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.160: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.161: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic
Source.162: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.163: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.164: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.165: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.166: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.167: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.168: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.169: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.170: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.171: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.172: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.173: DFBPPR3733 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.174: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.175: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.176: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.177: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.178: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.179: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.180: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.181: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.182: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.183: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.184: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.185: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.186: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.187: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.188: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.189: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.190: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.191: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.192: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.193: DFBPPR4199 ---- Plant proteins ---- Protein transport protein Sec61 subunit gamma
Source.194: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.195: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.196: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.197: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.198: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.199: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.200: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.201: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.202: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.203: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.204: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.205: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.206: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.207: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.208: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18
Source.209: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.210: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.211: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.212: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.213: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.214: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.215: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.216: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.217: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.218: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.219: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.220: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.221: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.222: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.223: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.224: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.225: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.226: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.227: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase
Source.228: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.229: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.230: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.231: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.232: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.233: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.234: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.235: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.236: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.237: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.238: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.239: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.240: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.241: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.242: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.243: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.244: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog
Source.245: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.246: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.247: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.248: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.249: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.250: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.251: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.252: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.253: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.254: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.255: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.256: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.257: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.258: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit
Source.259: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.260: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.261: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.262: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.263: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.264: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.265: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.266: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.267: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.268: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.269: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.270: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.271: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.272: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.273: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.274: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.275: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.276: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.277: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.278: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.279: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.280: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.281: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.282: DFBPPR5968 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.283: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.284: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.285: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.286: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.287: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.288: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.289: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.290: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.291: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.292: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.293: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2
Source.294: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.295: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.296: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.297: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.298: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.299: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.300: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.301: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.302: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.303: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.304: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.305: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic
Source.306: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.307: DFBPPR6528 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.308: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.309: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.310: DFBPPR6576 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3
Source.311: DFBPPR6577 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3
Source.312: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.313: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.314: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.315: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.316: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.317: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.318: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.319: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.320: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.321: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase
Source.322: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.323: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.324: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.325: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.326: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.327: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.328: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.329: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.330: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1
Source.331: DFBPPR6891 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.332: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.333: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.334: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.335: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.336: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.337: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.338: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.339: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.340: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.341: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.342: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.343: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.344: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.345: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.346: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.347: DFBPPR7309 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.348: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.349: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.350: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.351: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.352: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.353: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.354: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.355: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.356: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.357: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.358: DFBPPR7551 ---- Plant proteins ---- Protein BP4A
Source.359: DFBPPR7552 ---- Plant proteins ---- Protein BP4C
Source.360: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.361: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.362: DFBPPR7619 ---- Milk proteins ---- Prolactin-inducible protein
Source.363: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.364: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.365: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.366: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.367: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.368: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.369: DFBPPR7673 ---- Milk proteins ---- Kappa-casein
Source.370: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.371: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.372: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.373: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.374: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.375: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.376: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.377: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.378: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.379: DFBPPR8474 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.380: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.381: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.382: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.383: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.384: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.385: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.386: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.387: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.388: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.389: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.390: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.391: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.392: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.393: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.394: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.395: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.396: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.397: DFBPPR16179 ---- Animal proteins ---- C-C motif chemokine 8
Source.398: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.399: DFBPPR16234 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma
Source.400: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.401: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.402: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.403: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.404: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.405: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.406: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.407: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.408: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.409: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.410: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.411: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.412: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.413: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.414: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.415: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.416: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.417: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.418: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain
Source.419: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.420: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.421: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.422: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.423: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.424: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.425: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.426: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.427: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.428: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.429: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.430: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.431: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.432: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.433: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.434: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.435: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6
Source.436: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.437: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.438: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.439: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.440: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.441: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.442: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.443: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.444: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.445: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.446: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.447: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.448: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.449: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.450: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.451: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.452: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.453: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.454: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.455: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.456: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.457: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.458: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.459: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.460: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.461: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.462: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.463: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.464: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.465: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.466: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.467: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.468: DFBPPR18136 ---- Animal proteins ---- Septin-8
Source.469: DFBPPR18137 ---- Animal proteins ---- Septin-8
Source.470: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.471: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.472: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.473: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.474: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.475: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein
Source.476: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.477: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.478: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.479: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.480: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.481: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.482: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.483: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.484: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.485: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.486: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.487: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.488: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.489: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb
Source.490: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.491: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.492: DFBPPR18524 ---- Animal proteins ---- Beta-defensin 5
Source.493: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.494: DFBPPR18543 ---- Animal proteins ---- Proproteinase E
Source.495: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.496: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.497: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.498: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.499: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.500: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein
Source.501: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.502: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.503: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.504: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.505: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.506: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.507: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.508: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.509: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.510: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.511: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.512: DFBPPR19080 ---- Animal proteins ---- Beta-defensin 11
Source.513: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.514: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.515: DFBPPR19174 ---- Animal proteins ---- Neuroendocrine secretory protein 55
Source.516: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.517: DFBPPR19200 ---- Animal proteins ---- Beta-defensin 12
Source.518: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.519: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.520: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.521: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.522: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.523: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.524: DFBPPR19346 ---- Animal proteins ---- Cylicin-1
Source.525: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.526: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.527: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.528: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4
Source.529: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.530: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.531: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.532: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.533: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.534: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.535: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.536: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.537: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.538: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.539: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.540: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.541: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.542: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1
Source.543: DFBPPR19869 ---- Animal proteins ---- Beta-defensin 13
Source.544: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.545: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase
Source.546: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.547: DFBPPR19915 ---- Animal proteins ---- Methylated-DNA--protein-cysteine methyltransferase
Source.548: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.549: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.550: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.551: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.552: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.553: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.554: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.555: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.556: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.557: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.558: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B
Source.559: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.560: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.561: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.562: DFBPPR20210 ---- Animal proteins ---- Exonuclease V
Source.563: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.564: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.565: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.566: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.567: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.568: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.569: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.570: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan
Source.571: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.572: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.573: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.574: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.575: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.576: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.577: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.578: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.579: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.580: DFBPPR20771 ---- Animal proteins ---- Dynein light chain roadblock-type 1
Source.581: DFBPPR20784 ---- Animal proteins ---- Dynein light chain roadblock-type 2
Source.582: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.583: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.584: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.585: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1
Source.586: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.587: DFBPPR20986 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC2
Source.588: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.589: DFBPPR21048 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma
Source.590: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.591: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.592: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.593: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.594: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.595: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4
Source.596: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36
Source.597: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma
Source.598: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.599: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.600: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.601: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.602: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.603: DFBPPR21575 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 6
Source.604: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.605: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.606: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.607: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.608: DFBPPR21675 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2B
Source.609: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.610: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.611: DFBPPR21743 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2A
Source.612: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.613: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6
Source.614: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1
Source.615: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.616: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.617: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.618: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.619: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.620: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.621: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.622: DFBPPR22067 ---- Animal proteins ---- Microfibril-associated glycoprotein 3
Source.623: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.624: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.625: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.626: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.627: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.628: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.629: DFBPPR22239 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.630: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.631: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.632: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.633: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.634: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.635: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.636: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.637: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.638: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.639: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.640: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.641: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1
Source.642: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.643: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.644: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.645: DFBPPR22632 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 1
Source.646: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.647: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.648: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.649: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.650: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.651: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.652: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.653: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.654: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.655: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.656: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.657: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.658: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.659: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.660: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.661: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.662: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.663: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.664: DFBPPR8825 ---- Animal proteins ---- Optineurin
Source.665: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.666: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.667: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.668: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.669: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.670: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.671: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.672: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.673: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.674: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.675: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.676: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.677: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.678: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain
Source.679: DFBPPR9404 ---- Animal proteins ---- Tryptase
Source.680: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.681: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.682: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.683: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.684: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.685: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.686: DFBPPR9526 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein
Source.687: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.688: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.689: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.690: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.691: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.692: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.693: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.694: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.695: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.696: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.697: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.698: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.699: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.700: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.701: DFBPPR9950 ---- Animal proteins ---- 20 kDa neutrophil cationic protein
Source.702: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.703: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.704: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.705: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.706: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.707: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.708: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.709: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.710: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.711: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.712: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.713: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.714: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.715: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.716: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.717: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.718: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.719: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.720: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.721: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.722: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.723: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.724: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.725: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.726: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.727: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.728: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.729: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.730: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.731: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.732: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain
Source.733: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.734: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.735: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.736: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.737: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.738: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.739: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.740: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.741: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.742: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.743: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.744: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.745: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.746: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.747: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.748: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.749: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5
Source.750: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.751: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.752: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.753: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.754: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.755: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.756: DFBPPR10700 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 2
Source.757: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.758: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.759: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.760: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.761: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.762: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.763: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.764: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.765: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.766: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.767: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.768: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.769: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.770: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.771: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.772: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.773: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.774: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.775: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.776: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.777: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.778: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.779: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.780: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.781: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.782: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.783: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.784: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.785: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.786: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.787: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.788: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.789: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.790: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.791: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.792: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.793: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.794: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.795: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.796: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.797: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.798: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.799: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.800: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.801: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.802: DFBPPR11896 ---- Animal proteins ---- Sentan
Source.803: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.804: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.805: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.806: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.807: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.808: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.809: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.810: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.811: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.812: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.813: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.814: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.815: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.816: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.817: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.818: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.819: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.820: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.821: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain
Source.822: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.823: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.824: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.825: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.826: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.827: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.828: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.829: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.830: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.831: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.832: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.833: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.834: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.835: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.836: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.837: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.838: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.839: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.840: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.841: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.842: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.843: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.844: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.845: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.846: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.847: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.848: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.849: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.850: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.851: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan
Source.852: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.853: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.854: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.855: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.856: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.857: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.858: DFBPPR13323 ---- Animal proteins ---- Myoglobin
Source.859: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.860: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.861: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.862: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.863: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.864: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.865: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.866: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.867: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.868: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.869: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.870: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.871: DFBPPR13778 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.872: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain
Source.873: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.874: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.875: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.876: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.877: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.878: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.879: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.880: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.881: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.882: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.883: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.884: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.885: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.886: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.887: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.888: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.889: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.890: DFBPPR14270 ---- Marine protein ---- Myoglobin
Source.891: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.892: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.893: DFBPPR14343 ---- Marine protein ---- Anthranilate synthase component 2
Source.894: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.895: DFBPPR14391 ---- Marine protein ---- Cytochrome b6-f complex subunit 5
Source.896: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.897: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.898: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1
Source.899: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28
Source.900: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.901: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.902: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.903: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23
Source.904: DFBPPR14534 ---- Marine protein ---- Uncharacterized protein ORF62
Source.905: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.906: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.907: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.908: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.909: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.910: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.911: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.912: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.913: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.914: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1
Source.915: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.916: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.917: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein
Source.918: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.919: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.920: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.921: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.922: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.923: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.924: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.925: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.926: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.927: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.928: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.929: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.930: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.931: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.932: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.933: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit
Source.934: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.935: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.936: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.937: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.938: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.939: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.940: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.941: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.942: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.943: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.944: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.945: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.946: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.947: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.948: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11
Source.949: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.950: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.951: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.952: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.953: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.954: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1
Source.955: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.956: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.957: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.958: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.959: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.960: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.961: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.962: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.963: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17
Source.964: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.965: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.966: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.967: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.968: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106
Source.969: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14
Source.970: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.971: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.972: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.973: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.974: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.975: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.976: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.977: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.978: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.979: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.980: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.981: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.982: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.983: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.984: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.985: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1
Source.986: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.987: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.988: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23
Source.989: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.990: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1
Source.991: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.992: DFBPPR15571 ---- Microorganism protein ---- Mating-type protein ALPHA2
Source.993: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.994: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.995: DFBPPR15620 ---- Microorganism protein ---- Autophagy-related protein 23
Source.996: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.997: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase
Source.998: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.999: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.1000: DFBPPR15674 ---- Microorganism protein ---- DNA polymerase epsilon subunit C
Source.1001: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial
Source.1002: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.1003: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.1004: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.1005: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.1006: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.1007: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.1008: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.1009: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.1010: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.1011: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.1012: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.1013: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.1014: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.1015: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.1016: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1017: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.1018: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.1019: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.1020: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1021: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1022: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.1023: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1024: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.1025: DFBPPR7882 ---- Plant protein ---- 30S ribosomal protein S19, chloroplastic
Source.1026: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.1027: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.1028: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.1029: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.1030: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.1031: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.1032: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.1033: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1034: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1035: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.1036: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.1037: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.1038: DFBPPR8225 ---- Plant protein ---- Non-specific lipid-transfer protein AP10
Source.1039: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.1040: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.1041: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.1042: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.1043: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1044: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1045: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1046: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.1047: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.1048: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.1049: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.1050: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.1051: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.1052: DFBPPR8330 ---- Plant protein ---- 30S ribosomal protein S19, chloroplastic
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
DPP IV-inhibitory activity

(1) The peptide showed potent inhibitory activity for Dipeptidyl-peptidase IV (EC 3.4.14.5) with the IC50 value of 3.4 ± 0.1 μM (p = 0.05), and its DPP-IV inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern [2].
(2) The IC50 value was 4.9 ± 0.2 μM [3].

Specific target protein(s) Specific Target Protein(s):
Dipeptidyl peptidase 4
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

In silico digestion of individual milk proteins was carried out with the peptide cutter program (ExPASy, 2011) using gastrointestinal enzymes (pepsin, trypsin and chymotrypsin).

Stability & Cytotoxicity
Peptide stability
Literature report:
Table 1 Concentration of milk protein-derived peptides inducing 50% inhibition (IC50) of dipeptidyl peptidase IV (DPP-IV) pre- (control) and post-hydrolysis of the milk protein-derived peptides with DPP-IV following incubation at 37 °C for 18 h at a low (1 U: 1 g peptide) and high (10 U: 1 g peptide) enzyme to substrate ratio (E:S).
Compound
DPP-IV IC50*
Control
Low E:S
High E:S
IPI (Diprotin A)
2.9 ± 0.2 a
3.3 ± 0.1 a
4.4 ± 0.3 b
* Values represent mean IC50 values ± confidence interval (P = 0.05), n = 3. Values with different superscript letters are significantly different (P < 0.05).
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The results presented herein are relevant to the management of type 2 diabetes with functional foods involving multi-target sites for DPP-IV inhibition in humans.

Database cross-references
BIOPEP-UWM [D1] 3167
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Nongonierma AB, FitzGerald RJ. Susceptibility of milk protein-derived peptides to dipeptidyl peptidase IV (DPP-IV) hydrolysis. Food Chem. 2014 Feb 15;145:845-52.
PMID: 24128555
Other literature(s)

[1] Nongonierma A B, Fitzgerald R J. An in silico model to predict the potential of dietary proteins as sources of dipeptidyl peptidase IV (DPP-IV) inhibitory peptides[J]. Food Chemistry, 2014, 165(20):489-498.
[2] Nongonierma A B, Fitzgerald R J. Structure activity relationship modelling of milk protein-derived peptides with dipeptidyl peptidase IV (DPP-IV) inhibitory activity[J]. Peptides, 2016, 79:1-7.
[3] Power O, Fernández A, Norris R, et al. Selective enrichment of bioactive properties during ultrafiltration of a tryptic digest of β-lactoglobulin[J]. Journal of Functional Foods, 2014, 9:38-47.

PubDate 2014
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214