Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPDPIV0159(DPP IV-inhibitory peptide)

DFBP ID	DFBPDPIV0159
Peptide sequence	IPI
Type	Native peptide
Peptide/Function name	DPP-IV inhibitory peptide, Anti-diabetic peptide, Diprotin A

Function-activity relationship

Main bioactivity	DPP-IV inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ile-Pro-Ile

Single-letter amino acid

IPI

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	341.44 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

2.4667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine milk protein
Precursor protein	κ-Casein
Residue position	f(26-28)
Precursor protein(s) search	Source.1: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.2: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.3: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.4: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12 Source.5: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.6: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.7: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.8: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.9: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.10: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.11: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.12: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.13: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.14: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.15: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.16: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.17: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.18: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.19: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic Source.20: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.21: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.22: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.23: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.24: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.25: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.26: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.27: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.28: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic Source.29: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.30: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.31: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.32: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.33: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.34: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.35: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.36: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.37: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.38: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.39: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.40: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic Source.41: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.42: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.43: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.44: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.45: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.46: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.47: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a Source.48: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.49: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic Source.50: DFBPPR1751 ---- Plant proteins ---- Heat stress transcription factor A-4b Source.51: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.52: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.53: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.54: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.55: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.56: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.57: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8 Source.58: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.59: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.60: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.61: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.62: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.63: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.64: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12 Source.65: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.66: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.67: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4 Source.68: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.69: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.70: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.71: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.72: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.73: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.74: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.75: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.76: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6 Source.77: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.78: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.79: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.80: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic Source.81: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.82: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.83: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.84: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.85: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.86: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.87: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.88: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.89: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.90: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.91: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.92: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic Source.93: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5 Source.94: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5 Source.95: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.96: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.97: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.98: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.99: DFBPPR2710 ---- Plant proteins ---- 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase, chloroplastic Source.100: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.101: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.102: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.103: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.104: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.105: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.106: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.107: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.108: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.109: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.110: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.111: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.112: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.113: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.114: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.115: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.116: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase Source.117: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.118: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.119: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.120: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein Source.121: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.122: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.123: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.124: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.125: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A Source.126: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic Source.127: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.128: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1 Source.129: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.130: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3 Source.131: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.132: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.133: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.134: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.135: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.136: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.137: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.138: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.139: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.140: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.141: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.142: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.143: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.144: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.145: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.146: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.147: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.148: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.149: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.150: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13 Source.151: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3 Source.152: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.153: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.154: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.155: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.156: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.157: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.158: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.159: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11 Source.160: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.161: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic Source.162: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.163: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.164: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2 Source.165: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3 Source.166: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.167: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.168: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.169: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.170: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.171: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.172: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.173: DFBPPR3733 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.174: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.175: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.176: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E Source.177: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.178: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.179: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.180: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.181: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b Source.182: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.183: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.184: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.185: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.186: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.187: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.188: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8 Source.189: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6 Source.190: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.191: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.192: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.193: DFBPPR4199 ---- Plant proteins ---- Protein transport protein Sec61 subunit gamma Source.194: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.195: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.196: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.197: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.198: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.199: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.200: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.201: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.202: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4 Source.203: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.204: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.205: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.206: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700 Source.207: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.208: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18 Source.209: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.210: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.211: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.212: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.213: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.214: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.215: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080 Source.216: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100 Source.217: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.218: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.219: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase Source.220: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.221: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.222: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.223: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.224: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.225: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.226: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.227: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase Source.228: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.229: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.230: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.231: DFBPPR5196 ---- Plant proteins ---- Arginase Source.232: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.233: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.234: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.235: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.236: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.237: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.238: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.239: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.240: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.241: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.242: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.243: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.244: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog Source.245: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.246: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.247: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.248: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.249: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.250: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.251: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.252: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.253: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.254: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.255: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.256: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.257: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic Source.258: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit Source.259: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.260: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.261: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.262: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.263: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.264: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.265: DFBPPR5652 ---- Plant proteins ---- Expansin-B10 Source.266: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.267: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.268: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.269: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.270: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4 Source.271: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.272: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.273: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.274: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.275: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.276: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.277: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.278: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.279: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.280: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.281: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.282: DFBPPR5968 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.283: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.284: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.285: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9 Source.286: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.287: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.288: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.289: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7 Source.290: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.291: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.292: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.293: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2 Source.294: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.295: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.296: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.297: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.298: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.299: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.300: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.301: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.302: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.303: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.304: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.305: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic Source.306: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.307: DFBPPR6528 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.308: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase Source.309: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.310: DFBPPR6576 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3 Source.311: DFBPPR6577 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3 Source.312: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.313: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.314: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.315: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase Source.316: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.317: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.318: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.319: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.320: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.321: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase Source.322: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.323: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.324: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.325: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.326: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.327: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.328: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.329: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.330: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1 Source.331: DFBPPR6891 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.332: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I Source.333: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.334: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.335: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.336: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.337: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.338: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.339: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.340: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.341: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.342: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.343: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.344: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.345: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.346: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.347: DFBPPR7309 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.348: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.349: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic Source.350: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.351: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.352: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.353: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.354: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.355: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.356: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.357: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.358: DFBPPR7551 ---- Plant proteins ---- Protein BP4A Source.359: DFBPPR7552 ---- Plant proteins ---- Protein BP4C Source.360: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.361: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.362: DFBPPR7619 ---- Milk proteins ---- Prolactin-inducible protein Source.363: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.364: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.365: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.366: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.367: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.368: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.369: DFBPPR7673 ---- Milk proteins ---- Kappa-casein Source.370: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.371: DFBPPR7695 ---- Milk proteins ---- Kappa-casein Source.372: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.373: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.374: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.375: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.376: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.377: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.378: DFBPPR8471 ---- Plant proteins ---- Beta-amylase Source.379: DFBPPR8474 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.380: DFBPPR8492 ---- Milk proteins ---- Kappa-casein Source.381: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.382: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A Source.383: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.384: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.385: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.386: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.387: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.388: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.389: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.390: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.391: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.392: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.393: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.394: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C Source.395: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.396: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.397: DFBPPR16179 ---- Animal proteins ---- C-C motif chemokine 8 Source.398: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.399: DFBPPR16234 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma Source.400: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.401: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.402: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.403: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.404: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.405: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.406: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.407: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.408: DFBPPR16594 ---- Animal proteins ---- Macoilin Source.409: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.410: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.411: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.412: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.413: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.414: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.415: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.416: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.417: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1 Source.418: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain Source.419: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.420: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.421: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.422: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.423: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.424: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.425: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.426: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.427: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.428: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.429: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.430: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.431: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.432: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.433: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.434: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.435: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6 Source.436: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.437: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.438: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.439: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.440: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.441: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.442: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.443: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.444: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.445: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.446: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.447: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.448: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.449: DFBPPR17787 ---- Animal proteins ---- Septin-6 Source.450: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.451: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.452: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.453: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.454: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.455: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.456: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.457: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT Source.458: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.459: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.460: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.461: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.462: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.463: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.464: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Source.465: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3 Source.466: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.467: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.468: DFBPPR18136 ---- Animal proteins ---- Septin-8 Source.469: DFBPPR18137 ---- Animal proteins ---- Septin-8 Source.470: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.471: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.472: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.473: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.474: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6 Source.475: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.476: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.477: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.478: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.479: DFBPPR18335 ---- Animal proteins ---- Septin-11 Source.480: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.481: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.482: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.483: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.484: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.485: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.486: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.487: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.488: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.489: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb Source.490: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.491: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.492: DFBPPR18524 ---- Animal proteins ---- Beta-defensin 5 Source.493: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.494: DFBPPR18543 ---- Animal proteins ---- Proproteinase E Source.495: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.496: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.497: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.498: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Source.499: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.500: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein Source.501: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.502: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.503: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.504: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.505: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.506: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.507: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.508: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.509: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.510: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.511: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.512: DFBPPR19080 ---- Animal proteins ---- Beta-defensin 11 Source.513: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2 Source.514: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.515: DFBPPR19174 ---- Animal proteins ---- Neuroendocrine secretory protein 55 Source.516: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.517: DFBPPR19200 ---- Animal proteins ---- Beta-defensin 12 Source.518: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7 Source.519: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.520: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.521: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial Source.522: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.523: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.524: DFBPPR19346 ---- Animal proteins ---- Cylicin-1 Source.525: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.526: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2 Source.527: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.528: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4 Source.529: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.530: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.531: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.532: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.533: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.534: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.535: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase Source.536: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.537: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.538: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.539: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.540: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.541: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial Source.542: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1 Source.543: DFBPPR19869 ---- Animal proteins ---- Beta-defensin 13 Source.544: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A Source.545: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase Source.546: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27 Source.547: DFBPPR19915 ---- Animal proteins ---- Methylated-DNA--protein-cysteine methyltransferase Source.548: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.549: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.550: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.551: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.552: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.553: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein Source.554: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12 Source.555: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.556: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.557: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.558: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B Source.559: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.560: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.561: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.562: DFBPPR20210 ---- Animal proteins ---- Exonuclease V Source.563: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.564: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.565: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.566: DFBPPR20350 ---- Animal proteins ---- Pinin Source.567: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1 Source.568: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial Source.569: DFBPPR20478 ---- Animal proteins ---- Macoilin Source.570: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan Source.571: DFBPPR20531 ---- Animal proteins ---- Myozenin-2 Source.572: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.573: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.574: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.575: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein Source.576: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52 Source.577: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.578: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.579: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.580: DFBPPR20771 ---- Animal proteins ---- Dynein light chain roadblock-type 1 Source.581: DFBPPR20784 ---- Animal proteins ---- Dynein light chain roadblock-type 2 Source.582: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171 Source.583: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.584: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.585: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1 Source.586: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.587: DFBPPR20986 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC2 Source.588: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2 Source.589: DFBPPR21048 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma Source.590: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.591: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.592: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2 Source.593: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.594: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16 Source.595: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4 Source.596: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36 Source.597: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma Source.598: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog Source.599: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.600: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4 Source.601: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.602: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3 Source.603: DFBPPR21575 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 6 Source.604: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein Source.605: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2 Source.606: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.607: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6 Source.608: DFBPPR21675 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2B Source.609: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.610: DFBPPR21712 ---- Animal proteins ---- Serpin E3 Source.611: DFBPPR21743 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2A Source.612: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.613: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6 Source.614: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1 Source.615: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.616: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.617: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.618: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.619: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10 Source.620: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3 Source.621: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.622: DFBPPR22067 ---- Animal proteins ---- Microfibril-associated glycoprotein 3 Source.623: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.624: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.625: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.626: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.627: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.628: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.629: DFBPPR22239 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.630: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40 Source.631: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.632: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.633: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2 Source.634: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.635: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like Source.636: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4 Source.637: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39 Source.638: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.639: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3 Source.640: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.641: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1 Source.642: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.643: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251 Source.644: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128 Source.645: DFBPPR22632 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 1 Source.646: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16 Source.647: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog Source.648: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.649: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.650: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.651: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.652: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1 Source.653: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.654: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.655: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.656: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.657: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.658: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.659: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.660: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.661: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.662: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.663: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.664: DFBPPR8825 ---- Animal proteins ---- Optineurin Source.665: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.666: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.667: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.668: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.669: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.670: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.671: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1 Source.672: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.673: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.674: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.675: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin Source.676: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.677: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.678: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain Source.679: DFBPPR9404 ---- Animal proteins ---- Tryptase Source.680: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.681: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1 Source.682: DFBPPR9484 ---- Animal proteins ---- Macoilin Source.683: DFBPPR9495 ---- Animal proteins ---- Complement factor B Source.684: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.685: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.686: DFBPPR9526 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein Source.687: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.688: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.689: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.690: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.691: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.692: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.693: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.694: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.695: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.696: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.697: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.698: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.699: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.700: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251 Source.701: DFBPPR9950 ---- Animal proteins ---- 20 kDa neutrophil cationic protein Source.702: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin Source.703: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.704: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.705: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.706: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2 Source.707: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.708: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.709: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.710: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.711: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.712: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.713: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.714: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase Source.715: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.716: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.717: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.718: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.719: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.720: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.721: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.722: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.723: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.724: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.725: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.726: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.727: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.728: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.729: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.730: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.731: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.732: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain Source.733: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.734: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.735: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.736: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.737: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.738: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.739: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.740: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.741: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.742: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.743: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.744: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.745: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.746: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.747: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.748: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.749: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5 Source.750: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.751: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.752: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.753: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3 Source.754: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.755: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.756: DFBPPR10700 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 2 Source.757: DFBPPR10715 ---- Animal proteins ---- Lumican Source.758: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.759: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.760: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6 Source.761: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.762: DFBPPR10882 ---- Animal proteins ---- Noggin Source.763: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.764: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.765: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.766: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.767: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.768: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.769: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A Source.770: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein Source.771: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.772: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.773: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.774: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.775: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.776: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.777: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4 Source.778: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.779: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6 Source.780: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.781: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.782: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.783: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.784: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.785: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.786: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.787: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.788: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.789: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.790: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.791: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.792: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1 Source.793: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.794: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.795: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.796: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.797: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.798: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.799: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.800: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.801: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.802: DFBPPR11896 ---- Animal proteins ---- Sentan Source.803: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2 Source.804: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.805: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.806: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.807: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.808: DFBPPR12041 ---- Animal proteins ---- Paladin Source.809: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.810: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.811: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.812: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251 Source.813: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.814: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.815: DFBPPR12251 ---- Animal proteins ---- Serotransferrin Source.816: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.817: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.818: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Source.819: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.820: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.821: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain Source.822: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.823: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.824: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.825: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.826: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.827: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.828: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.829: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1 Source.830: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.831: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.832: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.833: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.834: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.835: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.836: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.837: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.838: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.839: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.840: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.841: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.842: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.843: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15 Source.844: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.845: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B Source.846: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.847: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.848: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.849: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.850: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3 Source.851: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan Source.852: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.853: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.854: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.855: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B Source.856: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.857: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.858: DFBPPR13323 ---- Animal proteins ---- Myoglobin Source.859: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.860: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.861: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.862: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1 Source.863: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.864: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.865: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.866: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.867: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.868: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.869: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.870: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A Source.871: DFBPPR13778 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.872: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain Source.873: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.874: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.875: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.876: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.877: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.878: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.879: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.880: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.881: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.882: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.883: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.884: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1 Source.885: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2 Source.886: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran Source.887: DFBPPR14118 ---- Marine protein ---- Trypsin-2 Source.888: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.889: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.890: DFBPPR14270 ---- Marine protein ---- Myoglobin Source.891: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.892: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.893: DFBPPR14343 ---- Marine protein ---- Anthranilate synthase component 2 Source.894: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.895: DFBPPR14391 ---- Marine protein ---- Cytochrome b6-f complex subunit 5 Source.896: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.897: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.898: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1 Source.899: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28 Source.900: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic Source.901: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.902: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43 Source.903: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23 Source.904: DFBPPR14534 ---- Marine protein ---- Uncharacterized protein ORF62 Source.905: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.906: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.907: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.908: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.909: DFBPPR14592 ---- Marine protein ---- Intelectin Source.910: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.911: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.912: DFBPPR14660 ---- Marine protein ---- Otolin-1 Source.913: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B Source.914: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1 Source.915: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.916: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.917: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein Source.918: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.919: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.920: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233 Source.921: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.922: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.923: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.924: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.925: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.926: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.927: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.928: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.929: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.930: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.931: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.932: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.933: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit Source.934: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.935: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.936: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.937: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.938: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.939: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.940: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1 Source.941: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.942: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.943: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5 Source.944: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.945: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.946: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1 Source.947: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.948: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11 Source.949: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.950: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.951: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.952: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.953: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase Source.954: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1 Source.955: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase Source.956: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.957: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.958: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.959: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.960: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.961: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C Source.962: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.963: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.964: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.965: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial Source.966: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.967: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase Source.968: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106 Source.969: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14 Source.970: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.971: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.972: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1 Source.973: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.974: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.975: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.976: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1 Source.977: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.978: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.979: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3 Source.980: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.981: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.982: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.983: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.984: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.985: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1 Source.986: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.987: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.988: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23 Source.989: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.990: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1 Source.991: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.992: DFBPPR15571 ---- Microorganism protein ---- Mating-type protein ALPHA2 Source.993: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.994: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.995: DFBPPR15620 ---- Microorganism protein ---- Autophagy-related protein 23 Source.996: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.997: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.998: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.999: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.1000: DFBPPR15674 ---- Microorganism protein ---- DNA polymerase epsilon subunit C Source.1001: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial Source.1002: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.1003: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2 Source.1004: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.1005: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5 Source.1006: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4 Source.1007: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.1008: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.1009: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT Source.1010: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.1011: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.1012: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.1013: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.1014: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.1015: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.1016: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.1017: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.1018: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.1019: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.1020: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1021: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.1022: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.1023: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.1024: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.1025: DFBPPR7882 ---- Plant protein ---- 30S ribosomal protein S19, chloroplastic Source.1026: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.1027: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.1028: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4 Source.1029: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.1030: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.1031: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3 Source.1032: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.1033: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1034: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.1035: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.1036: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.1037: DFBPPR8144 ---- Plant protein ---- Maturase K Source.1038: DFBPPR8225 ---- Plant protein ---- Non-specific lipid-transfer protein AP10 Source.1039: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.1040: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.1041: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.1042: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.1043: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1044: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1045: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.1046: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.1047: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.1048: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.1049: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.1050: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3 Source.1051: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.1052: DFBPPR8330 ---- Plant protein ---- 30S ribosomal protein S19, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

DPP IV-inhibitory activity	(1) The peptide showed potent inhibitory activity for Dipeptidyl-peptidase IV (EC 3.4.14.5) with the IC₅₀ value of 3.4 ± 0.1 μM (p = 0.05), and its DPP-IV inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern ^[2]. (2) The IC₅₀ value was 4.9 ± 0.2 μM ^[3].
Specific target protein(s)	Specific Target Protein(s): Dipeptidyl peptidase 4

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	In silico digestion of individual milk proteins was carried out with the peptide cutter program (ExPASy, 2011) using gastrointestinal enzymes (pepsin, trypsin and chymotrypsin).

Stability & Cytotoxicity

Peptide stability

Literature report:

Table 1 Concentration of milk protein-derived peptides inducing 50% inhibition (IC₅₀) of dipeptidyl peptidase IV (DPP-IV) pre- (control) and post-hydrolysis of the milk protein-derived peptides with DPP-IV following incubation at 37 °C for 18 h at a low (1 U: 1 g peptide) and high (10 U: 1 g peptide) enzyme to substrate ratio (E:S).
Compound	DPP-IV IC₅₀^*
	Control	Low E:S	High E:S
IPI (Diprotin A)	2.9 ± 0.2 ^a	3.3 ± 0.1 ^a	4.4 ± 0.3 ^b
^* Values represent mean IC₅₀ values ± confidence interval (P = 0.05), n = 3. Values with different superscript letters are significantly different (P < 0.05).

EHP-Tool:

Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The results presented herein are relevant to the management of type 2 diabetes with functional foods involving multi-target sites for DPP-IV inhibition in humans.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Nongonierma AB, FitzGerald RJ. Susceptibility of milk protein-derived peptides to dipeptidyl peptidase IV (DPP-IV) hydrolysis. Food Chem. 2014 Feb 15;145:845-52. PMID: 24128555 DOI: 10.1016/j.foodchem.2013.08.097
Other literature(s)	[1] Nongonierma A B, Fitzgerald R J. An in silico model to predict the potential of dietary proteins as sources of dipeptidyl peptidase IV (DPP-IV) inhibitory peptides[J]. Food Chemistry, 2014, 165(20):489-498. [2] Nongonierma A B, Fitzgerald R J. Structure activity relationship modelling of milk protein-derived peptides with dipeptidyl peptidase IV (DPP-IV) inhibitory activity[J]. Peptides, 2016, 79:1-7. [3] Power O, Fernández A, Norris R, et al. Selective enrichment of bioactive properties during ultrafiltration of a tryptic digest of β-lactoglobulin[J]. Journal of Functional Foods, 2014, 9:38-47.
PubDate	2014