E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPDPIV0209(DPP IV-inhibitory peptide)
DFBP ID DFBPDPIV0209
Peptide sequence MM
Type Native peptide
Peptide/Function name DPP-IV inhibitory peptide, Anti-diabetic peptide
Function-activity relationship
Main bioactivity DPP-IV inhibitory activity
Otheir bioactivity ACE-inhibitory activity [D1], Antioxidative activity [D2], Multifunctional activity [D3]
Calculated physicochemical properties
Three-letter amino acid Met-Met
Single-letter amino acid MM
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 280.40 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 1.9000 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Library
Organism/Source Dipeptide Library
Precursor protein Synthesis peptide
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.2: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.3: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.4: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5
Source.5: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.6: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.7: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.8: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.9: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.10: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.11: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.12: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.13: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.14: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.15: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.16: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.17: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.18: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.19: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.20: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.21: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.22: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.23: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.24: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.25: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.26: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.27: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.28: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.29: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.30: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.31: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.32: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.33: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.34: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.35: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.36: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.37: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.38: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.39: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.40: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.41: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.42: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.43: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.44: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.45: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.46: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.47: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.48: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.49: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.50: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.51: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.52: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.53: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.54: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.55: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.56: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.57: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.58: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.59: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.60: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.61: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.62: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.63: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.64: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.65: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.66: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.67: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.68: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.69: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.70: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.71: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.72: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.73: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.74: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.75: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.76: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.77: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.78: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.79: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.80: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.81: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.82: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.83: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.84: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.85: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.86: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.87: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.88: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.89: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.90: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.91: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.92: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.93: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.94: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17
Source.95: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.96: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.97: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.98: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.99: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.100: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.101: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.102: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.103: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.104: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.105: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.106: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.107: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.108: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.109: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.110: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.111: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.112: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.113: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.114: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.115: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.116: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.117: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic
Source.118: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.119: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.120: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.121: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.122: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.123: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.124: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.125: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.126: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.127: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.128: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.129: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.130: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.131: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.132: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.133: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.134: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.135: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.136: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.137: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.138: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.139: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.140: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.141: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.142: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.143: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.144: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.145: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.146: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.147: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.148: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.149: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.150: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.151: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.152: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.153: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.154: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.155: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.156: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.157: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.158: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.159: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.160: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.161: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.162: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.163: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.164: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.165: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.166: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.167: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.168: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156
Source.169: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.170: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.171: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.172: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.173: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.174: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.175: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.176: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.177: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.178: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.179: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.180: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.181: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.182: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.183: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.184: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.185: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.186: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.187: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.188: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.189: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.190: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.191: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.192: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.193: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.194: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.195: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.196: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.197: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.198: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.199: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.200: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.201: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.202: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.203: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.204: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.205: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.206: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.207: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.208: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.209: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.210: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.211: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.212: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.213: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.214: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.215: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.216: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.217: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.218: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.219: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.220: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic
Source.221: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.222: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.223: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.224: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.225: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.226: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.227: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.228: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.229: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.230: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.231: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.232: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.233: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.234: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.235: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.236: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.237: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.238: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.239: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.240: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.241: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.242: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.243: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.244: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.245: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4
Source.246: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.247: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.248: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.249: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.250: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.251: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.252: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.253: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.254: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.255: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.256: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.257: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.258: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.259: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.260: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.261: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.262: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.263: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.264: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.265: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.266: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.267: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.268: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.269: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.270: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.271: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.272: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.273: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.274: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.275: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.276: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.277: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.278: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.279: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.280: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.281: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.282: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.283: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.284: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.285: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.286: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.287: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.288: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.289: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.290: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.291: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.292: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.293: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.294: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.295: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.296: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.297: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.298: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.299: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.300: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.301: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.302: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.303: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.304: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.305: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.306: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.307: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.308: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.309: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.310: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.311: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.312: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.313: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.314: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.315: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.316: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.317: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.318: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.319: DFBPPR1991 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic
Source.320: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.321: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.322: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.323: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.324: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.325: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.326: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.327: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.328: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.329: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.330: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.331: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.332: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.333: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.334: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.335: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.336: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.337: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.338: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.339: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.340: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.341: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.342: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.343: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.344: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.345: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.346: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2
Source.347: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.348: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.349: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.350: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.351: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.352: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.353: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.354: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.355: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.356: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5
Source.357: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.358: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.359: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.360: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.361: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.362: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.363: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.364: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.365: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.366: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.367: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.368: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.369: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.370: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.371: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.372: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.373: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.374: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.375: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.376: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.377: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.378: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.379: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.380: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.381: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.382: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.383: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.384: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.385: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.386: DFBPPR2223 ---- Plant proteins ---- Urease
Source.387: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.388: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.389: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.390: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.391: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.392: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.393: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.394: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.395: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.396: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.397: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.398: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.399: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.400: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.401: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.402: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.403: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.404: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.405: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.406: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.407: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.408: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.409: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.410: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.411: DFBPPR2305 ---- Plant proteins ---- Actin-depolymerizing factor 4
Source.412: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.413: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.414: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.415: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic
Source.416: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.417: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.418: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.419: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.420: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.421: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.422: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.423: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.424: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.425: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.426: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.427: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.428: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.429: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.430: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.431: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.432: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.433: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.434: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.435: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.436: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.437: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.438: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.439: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.440: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.441: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.442: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.443: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.444: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.445: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.446: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.447: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.448: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.449: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.450: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26
Source.451: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.452: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.453: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.454: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.455: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.456: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.457: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.458: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.459: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.460: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.461: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.462: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.463: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.464: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.465: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.466: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.467: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.468: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.469: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.470: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.471: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.472: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1
Source.473: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.474: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.475: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.476: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.477: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.478: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.479: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.480: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.481: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.482: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.483: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.484: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.485: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.486: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.487: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.488: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.489: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.490: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.491: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.492: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.493: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.494: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.495: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2
Source.496: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.497: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.498: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.499: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.500: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500
Source.501: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.502: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.503: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.504: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.505: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.506: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.507: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.508: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.509: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.510: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.511: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.512: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.513: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.514: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.515: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.516: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.517: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.518: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.519: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.520: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.521: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.522: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.523: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.524: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.525: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.526: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.527: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.528: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.529: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.530: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.531: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.532: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.533: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.534: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.535: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.536: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.537: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.538: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.539: DFBPPR2908 ---- Plant proteins ---- Auxin-responsive protein IAA8
Source.540: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.541: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.542: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28
Source.543: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.544: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.545: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.546: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.547: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.548: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.549: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23
Source.550: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2
Source.551: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.552: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.553: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.554: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.555: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.556: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.557: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.558: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.559: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.560: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.561: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.562: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.563: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.564: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.565: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.566: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.567: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.568: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.569: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.570: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.571: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.572: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.573: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.574: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.575: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.576: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.577: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.578: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.579: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.580: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.581: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.582: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.583: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.584: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.585: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.586: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.587: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.588: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.589: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.590: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.591: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.592: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.593: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.594: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.595: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.596: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.597: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.598: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.599: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.600: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.601: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.602: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.603: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.604: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.605: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.606: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.607: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.608: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.609: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.610: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.611: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.612: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.613: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.614: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.615: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1
Source.616: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.617: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.618: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.619: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.620: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.621: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.622: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.623: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.624: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.625: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.626: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.627: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.628: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.629: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.630: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.631: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.632: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.633: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.634: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.635: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.636: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.637: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.638: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.639: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase
Source.640: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.641: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.642: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.643: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.644: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.645: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.646: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.647: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.648: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.649: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.650: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.651: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.652: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.653: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.654: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.655: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.656: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.657: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.658: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.659: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.660: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4
Source.661: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.662: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.663: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.664: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.665: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.666: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.667: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.668: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.669: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.670: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.671: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.672: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.673: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.674: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.675: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.676: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.677: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.678: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.679: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.680: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.681: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.682: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.683: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.684: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.685: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5
Source.686: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.687: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.688: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.689: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.690: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.691: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.692: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.693: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.694: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.695: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.696: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.697: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.698: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.699: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.700: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.701: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.702: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.703: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.704: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.705: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.706: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.707: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.708: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.709: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.710: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.711: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.712: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.713: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.714: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.715: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.716: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.717: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.718: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.719: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.720: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.721: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.722: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.723: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2
Source.724: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.725: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.726: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.727: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.728: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.729: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.730: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.731: DFBPPR3923 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic
Source.732: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.733: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.734: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.735: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.736: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.737: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.738: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.739: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.740: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.741: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.742: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.743: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.744: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.745: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.746: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.747: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.748: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.749: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.750: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.751: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.752: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.753: DFBPPR4030 ---- Plant proteins ---- Cytochrome b5
Source.754: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.755: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.756: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.757: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.758: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.759: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.760: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.761: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.762: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.763: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.764: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.765: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.766: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.767: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.768: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.769: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.770: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.771: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.772: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.773: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.774: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4
Source.775: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.776: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.777: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.778: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.779: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.780: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.781: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.782: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.783: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.784: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.785: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.786: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.787: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.788: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.789: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.790: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.791: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.792: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.793: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.794: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.795: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3
Source.796: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.797: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.798: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.799: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.800: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.801: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.802: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.803: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.804: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.805: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.806: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.807: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.808: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.809: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.810: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.811: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.812: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.813: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.814: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.815: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.816: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.817: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.818: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.819: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20
Source.820: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.821: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.822: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.823: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.824: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.825: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.826: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.827: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic
Source.828: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.829: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.830: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.831: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.832: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.833: DFBPPR4376 ---- Plant proteins ---- Probable calcium-binding protein CML13
Source.834: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.835: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.836: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14
Source.837: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.838: DFBPPR4400 ---- Plant proteins ---- Putative calmodulin-like protein 6
Source.839: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.840: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.841: DFBPPR4407 ---- Plant proteins ---- Mini zinc finger protein 4
Source.842: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.843: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.844: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.845: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII
Source.846: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.847: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.848: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.849: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.850: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.851: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.852: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.853: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.854: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.855: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.856: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28
Source.857: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.858: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.859: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.860: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.861: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.862: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.863: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.864: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.865: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.866: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.867: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.868: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.869: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.870: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.871: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.872: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.873: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.874: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.875: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.876: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.877: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26
Source.878: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.879: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.880: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.881: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.882: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.883: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.884: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.885: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.886: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.887: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.888: DFBPPR4562 ---- Plant proteins ---- Mini zinc finger protein 2
Source.889: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1
Source.890: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.891: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10
Source.892: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.893: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.894: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.895: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12
Source.896: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.897: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.898: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.899: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.900: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.901: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.902: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.903: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.904: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.905: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.906: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.907: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.908: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1
Source.909: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.910: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.911: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.912: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.913: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.914: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.915: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.916: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.917: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.918: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.919: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.920: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.921: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.922: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.923: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.924: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.925: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.926: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.927: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.928: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.929: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H
Source.930: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.931: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.932: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.933: DFBPPR4819 ---- Plant proteins ---- B3 domain-containing protein Os08g0324300
Source.934: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.935: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.936: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.937: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.938: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.939: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.940: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.941: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.942: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.943: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.944: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900
Source.945: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.946: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.947: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.948: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.949: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.950: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.951: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.952: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.953: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.954: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.955: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.956: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.957: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.958: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.959: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.960: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.961: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.962: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.963: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.964: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.965: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.966: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.967: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.968: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.969: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.970: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.971: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.972: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.973: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.974: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.975: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.976: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.977: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.978: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.979: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.980: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.981: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.982: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.983: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.984: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.985: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.986: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.987: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.988: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.989: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.990: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.991: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.992: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.993: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.994: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.995: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.996: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.997: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.998: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.999: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1000: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1001: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.1002: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1003: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1004: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1005: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.1006: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.1007: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1008: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.1009: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.1010: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1011: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1012: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1013: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.1014: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1015: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1016: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1017: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1018: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.1019: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.1020: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.1021: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1022: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1023: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.1024: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.1025: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.1026: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.1027: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.1028: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1029: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.1030: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1031: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.1032: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.1033: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein
Source.1034: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.1035: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2
Source.1036: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1037: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.1038: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1039: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.1040: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1041: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1042: DFBPPR5295 ---- Plant proteins ---- Early nodulin-55-1
Source.1043: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.1044: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.1045: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1046: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.1047: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1048: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1049: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1050: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1051: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1052: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.1053: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1054: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1055: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1056: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1057: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1058: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1059: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1060: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.1061: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.1062: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1063: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1064: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.1065: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1066: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1067: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1068: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1069: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1070: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1071: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1072: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1073: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1074: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1075: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1076: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.1077: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1078: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.1079: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1080: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1081: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1082: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1083: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.1084: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1085: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.1086: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1087: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.1088: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.1089: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.1090: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1091: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.1092: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1093: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.1094: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.1095: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1096: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.1097: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1098: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1099: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1100: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1101: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.1102: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1103: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1104: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.1105: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1106: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1107: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1108: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.1109: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1110: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.1111: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1112: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1113: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.1114: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1115: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1116: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1117: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.1118: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1119: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.1120: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1121: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.1122: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1123: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.1124: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1125: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.1126: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1127: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1128: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1129: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1130: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1131: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.1132: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1133: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.1134: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1135: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1136: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.1137: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.1138: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1139: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.1140: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3
Source.1141: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1142: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.1143: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.1144: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.1145: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1146: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.1147: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.1148: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1149: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1150: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1151: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.1152: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.1153: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1154: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1155: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1156: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.1157: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.1158: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1159: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1160: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.1161: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1
Source.1162: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.1163: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1164: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1165: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1166: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1167: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1168: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1169: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1170: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1171: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1172: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.1173: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1174: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1175: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase
Source.1176: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1177: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.1178: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1179: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.1180: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.1181: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.1182: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1183: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.1184: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1185: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1
Source.1186: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.1187: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1188: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.1189: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.1190: DFBPPR6075 ---- Plant proteins ---- MFS18 protein
Source.1191: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5
Source.1192: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.1193: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1194: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.1195: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.1196: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1197: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.1198: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2
Source.1199: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.1200: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3
Source.1201: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1202: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1203: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.1204: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1205: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.1206: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.1207: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1208: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1209: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1210: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.1211: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1212: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.1213: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.1214: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1215: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1216: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.1217: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1218: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.1219: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1220: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1221: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1222: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.1223: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1224: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1225: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.1226: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1227: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1228: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1229: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1230: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1231: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1232: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1233: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.1234: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.1235: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.1236: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1237: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.1238: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.1239: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1240: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1241: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72
Source.1242: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.1243: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.1244: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.1245: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.1246: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.1247: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.1248: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.1249: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.1250: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.1251: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1252: DFBPPR6494 ---- Plant proteins ---- 50S ribosomal protein L1, chloroplastic
Source.1253: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1254: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1255: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4
Source.1256: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.1257: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1258: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1259: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1260: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.1261: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1262: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1
Source.1263: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2
Source.1264: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.1265: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1266: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1267: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1268: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G
Source.1269: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.1270: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.1271: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.1272: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.1273: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.1274: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1275: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.1276: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.1277: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1278: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1279: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1280: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1281: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1282: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3
Source.1283: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1284: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1285: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.1286: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1287: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.1288: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1289: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.1290: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1291: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.1292: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.1293: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.1294: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1295: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1296: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.1297: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1298: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1299: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1300: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1301: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1302: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.1303: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1304: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.1305: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1306: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.1307: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.1308: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.1309: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.1310: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.1311: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1312: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1313: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1314: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.1315: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1316: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.1317: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1318: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1319: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.1320: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.1321: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1322: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1323: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1324: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1325: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1326: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.1327: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.1328: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.1329: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1330: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.1331: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1332: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1333: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1334: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.1335: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1336: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1337: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.1338: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.1339: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1340: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1341: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein
Source.1342: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.1343: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1344: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.1345: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.1346: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1347: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.1348: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.1349: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.1350: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.1351: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.1352: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.1353: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1354: DFBPPR7310 ---- Plant proteins ---- ABA-inducible protein PHV A1
Source.1355: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.1356: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.1357: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.1358: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1359: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.1360: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.1361: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.1362: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1363: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1364: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.1365: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1366: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.1367: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.1368: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1369: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.1370: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.1371: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1372: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1373: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.1374: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.1375: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase
Source.1376: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.1377: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.1378: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.1379: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.1380: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1381: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1382: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.1383: DFBPPR7504 ---- Plant proteins ---- 10 kDa chaperonin
Source.1384: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1385: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.1386: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1387: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1
Source.1388: DFBPPR7543 ---- Plant proteins ---- Polcalcin Bra n 2
Source.1389: DFBPPR7551 ---- Plant proteins ---- Protein BP4A
Source.1390: DFBPPR7552 ---- Plant proteins ---- Protein BP4C
Source.1391: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.1392: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1393: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.1394: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.1395: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1396: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.1397: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.1398: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1399: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1400: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1401: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.1402: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.1403: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.1404: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.1405: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1406: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.1407: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin
Source.1408: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.1409: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin
Source.1410: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.1411: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.1412: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.1413: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin
Source.1414: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.1415: DFBPPR7702 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.1416: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.1417: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin
Source.1418: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.1419: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.1420: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1421: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.1422: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1423: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1424: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.1425: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1426: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1427: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.1428: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.1429: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.1430: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.1431: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.1432: DFBPPR8357 ---- Plant proteins ---- 2S albumin
Source.1433: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.1434: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.1435: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1436: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1437: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.1438: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.1439: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.1440: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.1441: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.1442: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1443: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1
Source.1444: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1445: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1446: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.1447: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.1448: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.1449: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.1450: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.1451: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin
Source.1452: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.1453: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1454: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1
Source.1455: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1456: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.1457: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1458: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2
Source.1459: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1460: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor
Source.1461: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.1462: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.1463: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.1464: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.1465: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1466: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.1467: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1468: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1469: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.1470: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1471: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.1472: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.1473: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.1474: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1475: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.1476: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.1477: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1478: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.1479: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1480: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1481: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1482: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1483: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.1484: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1485: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1486: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.1487: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1488: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.1489: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.1490: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.1491: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1492: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.1493: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1494: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1495: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.1496: DFBPPR16072 ---- Animal proteins ---- Clusterin
Source.1497: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.1498: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1499: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.1500: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1501: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.1502: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1503: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.1504: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.1505: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.1506: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1507: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.1508: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.1509: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.1510: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1511: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.1512: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule
Source.1513: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.1514: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1515: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.1516: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1517: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1518: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.1519: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.1520: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1521: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone
Source.1522: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1523: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.1524: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1525: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.1526: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.1527: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1528: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1529: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1530: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1531: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1532: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1533: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1534: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1535: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.1536: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1537: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.1538: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.1539: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1540: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.1541: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1542: DFBPPR16273 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.1543: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.1544: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.1545: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.1546: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1547: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.1548: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.1549: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.1550: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.1551: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.1552: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.1553: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.1554: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.1555: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1556: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1557: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.1558: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.1559: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.1560: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1561: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.1562: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.1563: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.1564: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.1565: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1566: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1567: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1568: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.1569: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.1570: DFBPPR16486 ---- Animal proteins ---- Natriuretic peptides B
Source.1571: DFBPPR16487 ---- Animal proteins ---- Claudin-2
Source.1572: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1573: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.1574: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.1575: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.1576: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1577: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.1578: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.1579: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1580: DFBPPR16520 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.1581: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1582: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.1583: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.1584: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1585: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.1586: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1587: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.1588: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1589: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1590: DFBPPR16566 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.1591: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1592: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1593: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1594: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.1595: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1596: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.1597: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1598: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.1599: DFBPPR16593 ---- Animal proteins ---- Calcyphosin
Source.1600: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.1601: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.1602: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.1603: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4
Source.1604: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1605: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.1606: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1607: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.1608: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.1609: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.1610: DFBPPR16661 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.1611: DFBPPR16678 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A
Source.1612: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.1613: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.1614: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.1615: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.1616: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1617: DFBPPR16721 ---- Animal proteins ---- Testin
Source.1618: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1619: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.1620: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.1621: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.1622: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.1623: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.1624: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1625: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1626: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.1627: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.1628: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.1629: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.1630: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1631: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.1632: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.1633: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.1634: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.1635: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.1636: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.1637: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.1638: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.1639: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.1640: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1641: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.1642: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1643: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.1644: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.1645: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.1646: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.1647: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1648: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.1649: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1650: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.1651: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.1652: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.1653: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.1654: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.1655: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.1656: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.1657: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.1658: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1659: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.1660: DFBPPR16993 ---- Animal proteins ---- Protein S100-A10
Source.1661: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.1662: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.1663: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1664: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.1665: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1666: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.1667: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.1668: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1669: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.1670: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1671: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1672: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1673: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.1674: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.1675: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1676: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.1677: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.1678: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.1679: DFBPPR17113 ---- Animal proteins ---- Calcineurin B homologous protein 1
Source.1680: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1681: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.1682: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.1683: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1684: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.1685: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.1686: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.1687: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.1688: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1
Source.1689: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.1690: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1691: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.1692: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.1693: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1694: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1695: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.1696: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1697: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1698: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.1699: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.1700: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.1701: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.1702: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.1703: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.1704: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.1705: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.1706: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1707: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.1708: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1709: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1710: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.1711: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1712: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.1713: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.1714: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.1715: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.1716: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.1717: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.1718: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1719: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.1720: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.1721: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.1722: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.1723: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1724: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.1725: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.1726: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.1727: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.1728: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1729: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.1730: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1731: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.1732: DFBPPR17433 ---- Animal proteins ---- Caveolin-3
Source.1733: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1734: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1735: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1736: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.1737: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1738: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1739: DFBPPR17452 ---- Animal proteins ---- CD81 antigen
Source.1740: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.1741: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)]
Source.1742: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.1743: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.1744: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.1745: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.1746: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.1747: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1748: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.1749: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.1750: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.1751: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.1752: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.1753: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.1754: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.1755: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase
Source.1756: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.1757: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.1758: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.1759: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1760: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.1761: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.1762: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1763: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.1764: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.1765: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.1766: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.1767: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1768: DFBPPR17568 ---- Animal proteins ---- Interferon tau-2
Source.1769: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1770: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.1771: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.1772: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.1773: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.1774: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.1775: DFBPPR17594 ---- Animal proteins ---- E-selectin
Source.1776: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1777: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.1778: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.1779: DFBPPR17637 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.1780: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1781: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.1782: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.1783: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1784: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.1785: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.1786: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.1787: DFBPPR17749 ---- Animal proteins ---- CD9 antigen
Source.1788: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.1789: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.1790: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.1791: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.1792: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.1793: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.1794: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.1795: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.1796: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1797: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1798: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.1799: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1800: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1801: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.1802: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.1803: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.1804: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.1805: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.1806: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.1807: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.1808: DFBPPR17858 ---- Animal proteins ---- Calsenilin
Source.1809: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.1810: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.1811: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1812: DFBPPR17877 ---- Animal proteins ---- Syntaxin-7
Source.1813: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1
Source.1814: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.1815: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1816: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.1817: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.1818: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1819: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1820: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.1821: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.1822: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.1823: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.1824: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.1825: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.1826: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.1827: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1828: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.1829: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1830: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.1831: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.1832: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1833: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.1834: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.1835: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.1836: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.1837: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.1838: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.1839: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.1840: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1841: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.1842: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.1843: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.1844: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.1845: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1846: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.1847: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.1848: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.1849: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.1850: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.1851: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B
Source.1852: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.1853: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.1854: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1855: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2
Source.1856: DFBPPR18039 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.1857: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1858: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.1859: DFBPPR18054 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 9
Source.1860: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.1861: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.1862: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.1863: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.1864: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.1865: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.1866: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.1867: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1868: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1869: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.1870: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1871: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.1872: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.1873: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1874: DFBPPR18106 ---- Animal proteins ---- Natriuretic peptides B
Source.1875: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.1876: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1877: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1878: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1879: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.1880: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.1881: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1882: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1883: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B
Source.1884: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.1885: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1886: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.1887: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.1888: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.1889: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.1890: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.1891: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.1892: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.1893: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.1894: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.1895: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial
Source.1896: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.1897: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.1898: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1899: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1900: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.1901: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.1902: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.1903: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.1904: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.1905: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.1906: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.1907: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.1908: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1909: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.1910: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1911: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1912: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1913: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.1914: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.1915: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.1916: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.1917: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1918: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.1919: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.1920: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1921: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.1922: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.1923: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1924: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.1925: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.1926: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3
Source.1927: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.1928: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.1929: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5
Source.1930: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.1931: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1
Source.1932: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.1933: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.1934: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.1935: DFBPPR18558 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.1936: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.1937: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.1938: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1939: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1940: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6
Source.1941: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.1942: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.1943: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.1944: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1945: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1946: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.1947: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1948: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1949: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.1950: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.1951: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.1952: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.1953: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.1954: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.1955: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1956: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.1957: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.1958: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.1959: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.1960: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.1961: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.1962: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.1963: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.1964: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1965: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.1966: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1967: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.1968: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.1969: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.1970: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1971: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.1972: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.1973: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone
Source.1974: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.1975: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.1976: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.1977: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2
Source.1978: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.1979: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1980: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1981: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.1982: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.1983: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.1984: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.1985: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.1986: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.1987: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.1988: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.1989: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1990: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1991: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1992: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.1993: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1994: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.1995: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.1996: DFBPPR18855 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.1997: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1998: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.1999: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.2000: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.2001: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.2002: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.2003: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.2004: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.2005: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.2006: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2007: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.2008: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.2009: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2010: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.2011: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.2012: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2013: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.2014: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.2015: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.2016: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.2017: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.2018: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.2019: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.2020: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.2021: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.2022: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.2023: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1
Source.2024: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.2025: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2026: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.2027: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2028: DFBPPR19045 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.2029: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.2030: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.2031: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.2032: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.2033: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.2034: DFBPPR19078 ---- Animal proteins ---- Cystatin-B
Source.2035: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2036: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.2037: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.2038: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.2039: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.2040: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.2041: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.2042: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.2043: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.2044: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.2045: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2
Source.2046: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.2047: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.2048: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.2049: DFBPPR19148 ---- Animal proteins ---- Ribonuclease 4
Source.2050: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.2051: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.2052: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.2053: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2054: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain
Source.2055: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.2056: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.2057: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2058: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.2059: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1
Source.2060: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.2061: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha
Source.2062: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.2063: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2064: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.2065: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.2066: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.2067: DFBPPR19280 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF183
Source.2068: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.2069: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.2070: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.2071: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.2072: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.2073: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.2074: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.2075: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.2076: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.2077: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.2078: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.2079: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.2080: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2081: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.2082: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3
Source.2083: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.2084: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.2085: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel
Source.2086: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.2087: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.2088: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.2089: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.2090: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.2091: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.2092: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.2093: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.2094: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.2095: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.2096: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.2097: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.2098: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.2099: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2100: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.2101: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.2102: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.2103: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.2104: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.2105: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.2106: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.2107: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.2108: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2109: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.2110: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.2111: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.2112: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.2113: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.2114: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2115: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24
Source.2116: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.2117: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.2118: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.2119: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.2120: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.2121: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2122: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.2123: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.2124: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.2125: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.2126: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.2127: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.2128: DFBPPR19590 ---- Animal proteins ---- Norrin
Source.2129: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.2130: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2131: DFBPPR19610 ---- Animal proteins ---- RING finger protein 11
Source.2132: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2133: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.2134: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.2135: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.2136: DFBPPR19640 ---- Animal proteins ---- Prolargin
Source.2137: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.2138: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2139: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.2140: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.2141: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.2142: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.2143: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.2144: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.2145: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2146: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7
Source.2147: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.2148: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.2149: DFBPPR19707 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.2150: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.2151: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.2152: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.2153: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.2154: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.2155: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.2156: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.2157: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.2158: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.2159: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.2160: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2161: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.2162: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2163: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.2164: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.2165: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.2166: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4
Source.2167: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.2168: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.2169: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.2170: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2171: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.2172: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.2173: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.2174: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.2175: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1
Source.2176: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.2177: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2178: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B
Source.2179: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.2180: DFBPPR19894 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.2181: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.2182: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2183: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.2184: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2185: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.2186: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2187: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.2188: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.2189: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.2190: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.2191: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.2192: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5
Source.2193: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.2194: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.2195: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2196: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.2197: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.2198: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.2199: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2200: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.2201: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.2202: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.2203: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.2204: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.2205: DFBPPR20030 ---- Animal proteins ---- Calumenin
Source.2206: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.2207: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.2208: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.2209: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.2210: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.2211: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.2212: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.2213: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2214: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2215: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.2216: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2217: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.2218: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1
Source.2219: DFBPPR20127 ---- Animal proteins ---- Protein BTG1
Source.2220: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.2221: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.2222: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.2223: DFBPPR20143 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.2224: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.2225: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.2226: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.2227: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.2228: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.2229: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.2230: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.2231: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.2232: DFBPPR20198 ---- Animal proteins ---- Calcium-binding protein 2
Source.2233: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.2234: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.2235: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.2236: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein
Source.2237: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.2238: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.2239: DFBPPR20225 ---- Animal proteins ---- Claudin-2
Source.2240: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.2241: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2242: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1
Source.2243: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.2244: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2245: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2246: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.2247: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.2248: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.2249: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2250: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.2251: DFBPPR20292 ---- Animal proteins ---- Caltrin
Source.2252: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3
Source.2253: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.2254: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.2255: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.2256: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.2257: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2258: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.2259: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.2260: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.2261: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.2262: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1
Source.2263: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.2264: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2
Source.2265: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog
Source.2266: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.2267: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.2268: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.2269: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2270: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.2271: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.2272: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.2273: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.2274: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.2275: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.2276: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.2277: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.2278: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.2279: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.2280: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.2281: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.2282: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2
Source.2283: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.2284: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.2285: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.2286: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.2287: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2288: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.2289: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.2290: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.2291: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.2292: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.2293: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.2294: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.2295: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.2296: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.2297: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2298: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.2299: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2300: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.2301: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2302: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.2303: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.2304: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.2305: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.2306: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2307: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.2308: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.2309: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.2310: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.2311: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.2312: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.2313: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.2314: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.2315: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.2316: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.2317: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.2318: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.2319: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.2320: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.2321: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.2322: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.2323: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.2324: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.2325: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.2326: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.2327: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.2328: DFBPPR20787 ---- Animal proteins ---- UBX domain-containing protein 8
Source.2329: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.2330: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2331: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.2332: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4
Source.2333: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.2334: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.2335: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.2336: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.2337: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.2338: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.2339: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.2340: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.2341: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein
Source.2342: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.2343: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.2344: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.2345: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10
Source.2346: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.2347: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.2348: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.2349: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2350: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2351: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.2352: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4
Source.2353: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.2354: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.2355: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.2356: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.2357: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.2358: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.2359: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.2360: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.2361: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.2362: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.2363: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.2364: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.2365: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.2366: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.2367: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.2368: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.2369: DFBPPR21081 ---- Animal proteins ---- Uteroglobin
Source.2370: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.2371: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.2372: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.2373: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.2374: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3
Source.2375: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein
Source.2376: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3
Source.2377: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.2378: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17
Source.2379: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.2380: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.2381: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2382: DFBPPR21145 ---- Animal proteins ---- Transcription elongation factor SPT4
Source.2383: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.2384: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.2385: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.2386: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.2387: DFBPPR21188 ---- Animal proteins ---- High mobility group protein B4
Source.2388: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.2389: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.2390: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog
Source.2391: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A
Source.2392: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.2393: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.2394: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.2395: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein
Source.2396: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36
Source.2397: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.2398: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.2399: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.2400: DFBPPR21272 ---- Animal proteins ---- Testin
Source.2401: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2402: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.2403: DFBPPR21281 ---- Animal proteins ---- 28S ribosomal protein S36, mitochondrial
Source.2404: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.2405: DFBPPR21285 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.2406: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.2407: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.2408: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58
Source.2409: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.2410: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.2411: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.2412: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.2413: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.2414: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.2415: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.2416: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.2417: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.2418: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.2419: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.2420: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.2421: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.2422: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2423: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.2424: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.2425: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.2426: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.2427: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.2428: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.2429: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.2430: DFBPPR21428 ---- Animal proteins ---- Protein LBH
Source.2431: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.2432: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.2433: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.2434: DFBPPR21453 ---- Animal proteins ---- Centrosomal protein of 19 kDa
Source.2435: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.2436: DFBPPR21463 ---- Animal proteins ---- Protein BEX2
Source.2437: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2438: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.2439: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.2440: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.2441: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35
Source.2442: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2
Source.2443: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.2444: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.2445: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.2446: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2
Source.2447: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.2448: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.2449: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.2450: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.2451: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40
Source.2452: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.2453: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.2454: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.2455: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.2456: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2
Source.2457: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.2458: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.2459: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.2460: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.2461: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.2462: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.2463: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2464: DFBPPR21578 ---- Animal proteins ---- Calcium-binding protein 5
Source.2465: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2466: DFBPPR21590 ---- Animal proteins ---- Rhombotin-1
Source.2467: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.2468: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.2469: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.2470: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.2471: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.2472: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.2473: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.2474: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2475: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.2476: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2
Source.2477: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11
Source.2478: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18
Source.2479: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.2480: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.2481: DFBPPR21703 ---- Animal proteins ---- RRP15-like protein
Source.2482: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.2483: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.2484: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.2485: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.2486: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A
Source.2487: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.2488: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.2489: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.2490: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.2491: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.2492: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.2493: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.2494: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.2495: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.2496: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.2497: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.2498: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.2499: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.2500: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.2501: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.2502: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.2503: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.2504: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.2505: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2
Source.2506: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.2507: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.2508: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.2509: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.2510: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.2511: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39
Source.2512: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.2513: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.2514: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.2515: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.2516: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8
Source.2517: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.2518: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.2519: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.2520: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.2521: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.2522: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2523: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein
Source.2524: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.2525: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.2526: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.2527: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.2528: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2529: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.2530: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2531: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.2532: DFBPPR22083 ---- Animal proteins ---- 40S ribosomal protein S15a
Source.2533: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.2534: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.2535: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.2536: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.2537: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.2538: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.2539: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2540: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2541: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.2542: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.2543: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.2544: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.2545: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.2546: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.2547: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.2548: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.2549: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14
Source.2550: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.2551: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.2552: DFBPPR22212 ---- Animal proteins ---- Protein Asterix
Source.2553: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.2554: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.2555: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog
Source.2556: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein
Source.2557: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.2558: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7
Source.2559: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.2560: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.2561: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.2562: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.2563: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.2564: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247
Source.2565: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.2566: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.2567: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.2568: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.2569: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.2570: DFBPPR22410 ---- Animal proteins ---- Small acidic protein
Source.2571: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1
Source.2572: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog
Source.2573: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18
Source.2574: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.2575: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.2576: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.2577: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.2578: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.2579: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.2580: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.2581: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.2582: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.2583: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.2584: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.2585: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.2586: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23
Source.2587: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog
Source.2588: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein
Source.2589: DFBPPR22564 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma
Source.2590: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.2591: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog
Source.2592: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.2593: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267
Source.2594: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.2595: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.2596: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.2597: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.2598: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.2599: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.2600: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.2601: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.2602: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.2603: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.2604: DFBPPR22683 ---- Animal proteins ---- LYR motif-containing protein 2
Source.2605: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83
Source.2606: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.2607: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.2608: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog
Source.2609: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog
Source.2610: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.2611: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.2612: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.2613: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.2614: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.2615: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.2616: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.2617: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.2618: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.2619: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.2620: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.2621: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.2622: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.2623: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.2624: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.2625: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.2626: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.2627: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.2628: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2629: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2630: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2631: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.2632: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.2633: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2634: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.2635: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.2636: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.2637: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.2638: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.2639: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.2640: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.2641: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2642: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.2643: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.2644: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.2645: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2646: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.2647: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.2648: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2649: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.2650: DFBPPR8698 ---- Animal proteins ---- Prorelaxin
Source.2651: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.2652: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.2653: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2654: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.2655: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.2656: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.2657: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.2658: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.2659: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.2660: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.2661: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.2662: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.2663: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2664: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.2665: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2666: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.2667: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.2668: DFBPPR8759 ---- Animal proteins ---- Caveolin-3
Source.2669: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.2670: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1
Source.2671: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2672: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2673: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.2674: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2675: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone
Source.2676: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.2677: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.2678: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.2679: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.2680: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.2681: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.2682: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.2683: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.2684: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.2685: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.2686: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2687: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2688: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.2689: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.2690: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.2691: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.2692: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.2693: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.2694: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2695: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.2696: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.2697: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.2698: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.2699: DFBPPR9056 ---- Animal proteins ---- Protein S100-A11
Source.2700: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.2701: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.2702: DFBPPR9072 ---- Animal proteins ---- CD9 antigen
Source.2703: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2704: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2705: DFBPPR9091 ---- Animal proteins ---- Antileukoproteinase
Source.2706: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.2707: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.2708: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2709: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.2710: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2711: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2712: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2713: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.2714: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2715: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.2716: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.2717: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.2718: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2719: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.2720: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2721: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2722: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.2723: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.2724: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.2725: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.2726: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.2727: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.2728: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.2729: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.2730: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.2731: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.2732: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.2733: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.2734: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4
Source.2735: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.2736: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2737: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.2738: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2739: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.2740: DFBPPR9285 ---- Animal proteins ---- Saposin-B-Val
Source.2741: DFBPPR9292 ---- Animal proteins ---- Protein S100-A10
Source.2742: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.2743: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.2744: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.2745: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.2746: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.2747: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3
Source.2748: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.2749: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2750: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.2751: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.2752: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2753: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.2754: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.2755: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2756: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2757: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.2758: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.2759: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.2760: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.2761: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.2762: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.2763: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.2764: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.2765: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.2766: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.2767: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.2768: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.2769: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.2770: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2771: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.2772: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.2773: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2774: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.2775: DFBPPR9455 ---- Animal proteins ---- Cystatin-B
Source.2776: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.2777: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2778: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.2779: DFBPPR9487 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.2780: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.2781: DFBPPR9505 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.2782: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.2783: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.2784: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.2785: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.2786: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.2787: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.2788: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2789: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.2790: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.2791: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.2792: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.2793: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2794: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2795: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.2796: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin
Source.2797: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.2798: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.2799: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.2800: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2801: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.2802: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2803: DFBPPR9652 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.2804: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.2805: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.2806: DFBPPR9668 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.2807: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.2808: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2809: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial
Source.2810: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.2811: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2812: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.2813: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.2814: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.2815: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2816: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.2817: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2818: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2819: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.2820: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2
Source.2821: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2822: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.2823: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.2824: DFBPPR9814 ---- Animal proteins ---- Testin
Source.2825: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.2826: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2827: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.2828: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.2829: DFBPPR9843 ---- Animal proteins ---- P protein
Source.2830: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.2831: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.2832: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1
Source.2833: DFBPPR9891 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.2834: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.2835: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2836: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.2837: DFBPPR9911 ---- Animal proteins ---- Protein Asterix
Source.2838: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.2839: DFBPPR9922 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma
Source.2840: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2841: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.2842: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.2843: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.2844: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.2845: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.2846: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.2847: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.2848: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.2849: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2850: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.2851: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.2852: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6
Source.2853: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2854: DFBPPR10031 ---- Animal proteins ---- Calcineurin B homologous protein 1
Source.2855: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.2856: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.2857: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.2858: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.2859: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.2860: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.2861: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2862: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2863: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.2864: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.2865: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.2866: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.2867: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.2868: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.2869: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2870: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.2871: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.2872: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.2873: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.2874: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.2875: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.2876: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2877: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.2878: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.2879: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.2880: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.2881: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.2882: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2883: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.2884: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.2885: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.2886: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.2887: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.2888: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.2889: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.2890: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.2891: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.2892: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.2893: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.2894: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2895: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1
Source.2896: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.2897: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.2898: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.2899: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.2900: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.2901: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.2902: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.2903: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.2904: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.2905: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.2906: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain
Source.2907: DFBPPR10250 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.2908: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.2909: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.2910: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.2911: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.2912: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.2913: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2914: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.2915: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.2916: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.2917: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.2918: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.2919: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2920: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.2921: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.2922: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.2923: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.2924: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.2925: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2926: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.2927: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.2928: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.2929: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.2930: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.2931: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2932: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.2933: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.2934: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.2935: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.2936: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.2937: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.2938: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.2939: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2940: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2941: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2942: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.2943: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.2944: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.2945: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.2946: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.2947: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2948: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.2949: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone
Source.2950: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.2951: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.2952: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2953: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.2954: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.2955: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.2956: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.2957: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.2958: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.2959: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.2960: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.2961: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.2962: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.2963: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.2964: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.2965: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.2966: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.2967: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.2968: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.2969: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.2970: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.2971: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.2972: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.2973: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.2974: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.2975: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.2976: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.2977: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.2978: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.2979: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.2980: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2981: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.2982: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.2983: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.2984: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2985: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.2986: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.2987: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.2988: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.2989: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.2990: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.2991: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.2992: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.2993: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2994: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.2995: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.2996: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.2997: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.2998: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.2999: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.3000: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.3001: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.3002: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.3003: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.3004: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.3005: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.3006: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3007: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.3008: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.3009: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.3010: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.3011: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.3012: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.3013: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3014: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3015: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.3016: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.3017: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3018: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.3019: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.3020: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.3021: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3022: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3023: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.3024: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.3025: DFBPPR10758 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.3026: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.3027: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein
Source.3028: DFBPPR10779 ---- Animal proteins ---- Natriuretic peptides A
Source.3029: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.3030: DFBPPR10787 ---- Animal proteins ---- Angiogenin
Source.3031: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.3032: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.3033: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.3034: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3035: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.3036: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3037: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.3038: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3039: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.3040: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.3041: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.3042: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.3043: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.3044: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.3045: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.3046: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.3047: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.3048: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.3049: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.3050: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.3051: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.3052: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.3053: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.3054: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.3055: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.3056: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.3057: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.3058: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.3059: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.3060: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.3061: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.3062: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.3063: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.3064: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.3065: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3066: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.3067: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.3068: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3069: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.3070: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.3071: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.3072: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.3073: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.3074: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.3075: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.3076: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.3077: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.3078: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.3079: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog
Source.3080: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.3081: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.3082: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.3083: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.3084: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.3085: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3086: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3087: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.3088: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.3089: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.3090: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.3091: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.3092: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.3093: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.3094: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.3095: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.3096: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.3097: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.3098: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.3099: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3100: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.3101: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.3102: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.3103: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.3104: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3105: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.3106: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.3107: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.3108: DFBPPR11185 ---- Animal proteins ---- Adenosine deaminase 2
Source.3109: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.3110: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.3111: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.3112: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.3113: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3114: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.3115: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.3116: DFBPPR11209 ---- Animal proteins ---- Protein S100-A11
Source.3117: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.3118: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.3119: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.3120: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.3121: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.3122: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.3123: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.3124: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.3125: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.3126: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.3127: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.3128: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.3129: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3130: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.3131: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3132: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.3133: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.3134: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.3135: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.3136: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.3137: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.3138: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.3139: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.3140: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.3141: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.3142: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.3143: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.3144: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.3145: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.3146: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.3147: DFBPPR11397 ---- Animal proteins ---- Frizzled-3
Source.3148: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.3149: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.3150: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.3151: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.3152: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.3153: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.3154: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.3155: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.3156: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.3157: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.3158: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.3159: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.3160: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.3161: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.3162: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.3163: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a
Source.3164: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.3165: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.3166: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.3167: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.3168: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.3169: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.3170: DFBPPR11498 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.3171: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.3172: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.3173: DFBPPR11508 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2
Source.3174: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.3175: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3176: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3177: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.3178: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.3179: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.3180: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform
Source.3181: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.3182: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.3183: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.3184: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.3185: DFBPPR11549 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.3186: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.3187: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.3188: DFBPPR11554 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3189: DFBPPR11557 ---- Animal proteins ---- Regulator of G-protein signaling 17
Source.3190: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC
Source.3191: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.3192: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.3193: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.3194: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.3195: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.3196: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.3197: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.3198: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.3199: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.3200: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.3201: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3202: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.3203: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3204: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.3205: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.3206: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.3207: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.3208: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3209: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3210: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.3211: DFBPPR11657 ---- Animal proteins ---- Protein BTG1
Source.3212: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.3213: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.3214: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.3215: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.3216: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.3217: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.3218: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.3219: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.3220: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.3221: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.3222: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.3223: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.3224: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.3225: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.3226: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.3227: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.3228: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.3229: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.3230: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.3231: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1
Source.3232: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.3233: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.3234: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3
Source.3235: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.3236: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.3237: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.3238: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.3239: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.3240: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.3241: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62
Source.3242: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.3243: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.3244: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.3245: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.3246: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.3247: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.3248: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.3249: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.3250: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.3251: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.3252: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.3253: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.3254: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.3255: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.3256: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1
Source.3257: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.3258: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.3259: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.3260: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.3261: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.3262: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.3263: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.3264: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.3265: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.3266: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.3267: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1
Source.3268: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.3269: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.3270: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.3271: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.3272: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.3273: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.3274: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.3275: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3276: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3
Source.3277: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.3278: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.3279: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.3280: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.3281: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.3282: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.3283: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.3284: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.3285: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.3286: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.3287: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.3288: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.3289: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.3290: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.3291: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.3292: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.3293: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.3294: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.3295: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.3296: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.3297: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.3298: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.3299: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.3300: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.3301: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.3302: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.3303: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.3304: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.3305: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.3306: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.3307: DFBPPR12065 ---- Animal proteins ---- Testin
Source.3308: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.3309: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.3310: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.3311: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.3312: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.3313: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.3314: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.3315: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.3316: DFBPPR12112 ---- Animal proteins ---- Protein LBH
Source.3317: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.3318: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.3319: DFBPPR12118 ---- Animal proteins ---- Protein EURL
Source.3320: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.3321: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.3322: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3323: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.3324: DFBPPR12133 ---- Animal proteins ---- Protein Asterix
Source.3325: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.3326: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.3327: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.3328: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.3329: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.3330: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin
Source.3331: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.3332: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.3333: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.3334: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.3335: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.3336: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.3337: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.3338: DFBPPR12203 ---- Animal proteins ---- Small acidic protein
Source.3339: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.3340: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.3341: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.3342: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.3343: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.3344: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.3345: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.3346: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3347: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.3348: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.3349: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.3350: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.3351: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.3352: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3353: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.3354: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.3355: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.3356: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.3357: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3358: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.3359: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.3360: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3361: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.3362: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3363: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.3364: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.3365: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.3366: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.3367: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.3368: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.3369: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.3370: DFBPPR12333 ---- Animal proteins ---- Angiogenin
Source.3371: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3372: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3373: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.3374: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3375: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.3376: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3377: DFBPPR12350 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.3378: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3379: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3380: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.3381: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.3382: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.3383: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.3384: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.3385: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3386: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.3387: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.3388: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.3389: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3390: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.3391: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.3392: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.3393: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3394: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.3395: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.3396: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.3397: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.3398: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.3399: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.3400: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.3401: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.3402: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.3403: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.3404: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.3405: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3406: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.3407: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.3408: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3409: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.3410: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.3411: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.3412: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.3413: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.3414: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.3415: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3416: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.3417: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3418: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.3419: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin
Source.3420: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.3421: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.3422: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.3423: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.3424: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.3425: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3426: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3427: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.3428: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.3429: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.3430: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.3431: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.3432: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3433: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3434: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.3435: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase
Source.3436: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.3437: DFBPPR12611 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A
Source.3438: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.3439: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.3440: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.3441: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.3442: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.3443: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.3444: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3445: DFBPPR12680 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.3446: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.3447: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.3448: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.3449: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.3450: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2
Source.3451: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.3452: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3453: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.3454: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.3455: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.3456: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.3457: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.3458: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.3459: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.3460: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3461: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.3462: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.3463: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.3464: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.3465: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.3466: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.3467: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.3468: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.3469: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.3470: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3471: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase
Source.3472: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3473: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.3474: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.3475: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.3476: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.3477: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.3478: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.3479: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.3480: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.3481: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.3482: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.3483: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3484: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.3485: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3486: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3487: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.3488: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.3489: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.3490: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3491: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.3492: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.3493: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.3494: DFBPPR13003 ---- Animal proteins ---- Calcyphosin
Source.3495: DFBPPR13004 ---- Animal proteins ---- Protein S100-A10
Source.3496: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3497: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3498: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3499: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.3500: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.3501: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.3502: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.3503: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3504: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.3505: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1
Source.3506: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10
Source.3507: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.3508: DFBPPR13092 ---- Animal proteins ---- Testin
Source.3509: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.3510: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3511: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3512: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3513: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.3514: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3515: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.3516: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.3517: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.3518: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3519: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.3520: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.3521: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.3522: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.3523: DFBPPR13209 ---- Animal proteins ---- Parathyroid hormone
Source.3524: DFBPPR13210 ---- Animal proteins ---- Angiogenin
Source.3525: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3526: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.3527: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3528: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.3529: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3530: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.3531: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.3532: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.3533: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3534: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2
Source.3535: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.3536: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3537: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.3538: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.3539: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3540: DFBPPR13330 ---- Animal proteins ---- Uterocalin
Source.3541: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.3542: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3543: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3544: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.3545: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3546: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3547: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3548: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3549: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3550: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.3551: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.3552: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3553: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3554: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3555: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3556: DFBPPR13409 ---- Animal proteins ---- Testin
Source.3557: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3558: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.3559: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3560: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3561: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.3562: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.3563: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.3564: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.3565: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.3566: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3567: DFBPPR13464 ---- Animal proteins ---- Interferon tau
Source.3568: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3569: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.3570: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3571: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.3572: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.3573: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.3574: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.3575: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3576: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3577: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3578: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.3579: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.3580: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3581: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.3582: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3583: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.3584: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3585: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.3586: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3587: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.3588: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3589: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3590: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.3591: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.3592: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3593: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.3594: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3595: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.3596: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3597: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.3598: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3599: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.3600: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.3601: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2
Source.3602: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.3603: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.3604: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6
Source.3605: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11
Source.3606: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.3607: DFBPPR13667 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.3608: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.3609: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3
Source.3610: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.3611: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.3612: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1
Source.3613: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.3614: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.3615: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10
Source.3616: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.3617: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5
Source.3618: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9
Source.3619: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8
Source.3620: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7
Source.3621: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4
Source.3622: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.3623: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.3624: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.3625: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.3626: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3627: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.3628: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel
Source.3629: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.3630: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.3631: DFBPPR13832 ---- Animal proteins ---- Cystatin-B
Source.3632: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3633: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3634: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3635: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.3636: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3637: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.3638: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3639: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3640: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.3641: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.3642: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.3643: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3644: DFBPPR13899 ---- Animal proteins ---- Natriuretic peptides B
Source.3645: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.3646: DFBPPR13912 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3647: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.3648: DFBPPR13918 ---- Animal proteins ---- Testin
Source.3649: DFBPPR13920 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.3650: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.3651: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.3652: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3653: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3654: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.3655: DFBPPR13991 ---- Animal proteins ---- Osteocalcin
Source.3656: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.3657: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.3658: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.3659: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.3660: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.3661: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.3662: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1
Source.3663: DFBPPR14029 ---- Animal proteins ---- Gamma-crystallin M1
Source.3664: DFBPPR14030 ---- Animal proteins ---- Prepro-urotensin II-gamma
Source.3665: DFBPPR14031 ---- Animal proteins ---- Prepro-urotensin II-alpha
Source.3666: DFBPPR14035 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3667: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3668: DFBPPR14043 ---- Animal proteins ---- Prolactin
Source.3669: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.3670: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3671: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2
Source.3672: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog
Source.3673: DFBPPR14072 ---- Marine protein ---- Prolactin
Source.3674: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.3675: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3676: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.3677: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.3678: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.3679: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.3680: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.3681: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.3682: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A
Source.3683: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.3684: DFBPPR14132 ---- Marine protein ---- Calumenin-A
Source.3685: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H
Source.3686: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.3687: DFBPPR14152 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3688: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3
Source.3689: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.3690: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12
Source.3691: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.3692: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.3693: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.3694: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.3695: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.3696: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.3697: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.3698: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.3699: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.3700: DFBPPR14221 ---- Marine protein ---- LYR motif-containing protein 2
Source.3701: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.3702: DFBPPR14232 ---- Marine protein ---- Prolactin-2
Source.3703: DFBPPR14233 ---- Marine protein ---- Prolactin-1
Source.3704: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.3705: DFBPPR14238 ---- Marine protein ---- Insulin
Source.3706: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.3707: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.3708: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.3709: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.3710: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.3711: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.3712: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.3713: DFBPPR14301 ---- Marine protein ---- ATP synthase subunit b', chloroplastic
Source.3714: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.3715: DFBPPR14315 ---- Marine protein ---- Protein CfxQ homolog
Source.3716: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.3717: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3718: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.3719: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.3720: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.3721: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.3722: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.3723: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.3724: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.3725: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.3726: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.3727: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.3728: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.3729: DFBPPR14456 ---- Marine protein ---- Uncharacterized protein ycf17
Source.3730: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.3731: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic
Source.3732: DFBPPR14476 ---- Marine protein ---- Protein CfxQ homolog
Source.3733: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.3734: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.3735: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.3736: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.3737: DFBPPR14556 ---- Marine protein ---- Interleukin-1 beta
Source.3738: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3739: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.3740: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.3741: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3742: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.3743: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.3744: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.3745: DFBPPR14578 ---- Marine protein ---- Prolactin
Source.3746: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.3747: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.3748: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.3749: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.3750: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.3751: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.3752: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.3753: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.3754: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3755: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.3756: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.3757: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.3758: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1
Source.3759: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.3760: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.3761: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.3762: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.3763: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.3764: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.3765: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.3766: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.3767: DFBPPR14659 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3768: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2
Source.3769: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.3770: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.3771: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3
Source.3772: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64
Source.3773: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.3774: DFBPPR14731 ---- Marine protein ---- Cytochrome c oxidase polypeptide VIIc
Source.3775: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B
Source.3776: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.3777: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.3778: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2
Source.3779: DFBPPR14763 ---- Marine protein ---- Tachyplesin-1
Source.3780: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.3781: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.3782: DFBPPR14766 ---- Marine protein ---- Tachyplesin-2
Source.3783: DFBPPR14775 ---- Marine protein ---- Troponin C
Source.3784: DFBPPR14787 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform A
Source.3785: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.3786: DFBPPR14805 ---- Marine protein ---- Probable molt-inhibiting hormone
Source.3787: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.3788: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.3789: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.3790: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.3791: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1
Source.3792: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B
Source.3793: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A
Source.3794: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3795: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.3796: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.3797: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.3798: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.3799: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.3800: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.3801: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.3802: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.3803: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.3804: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.3805: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.3806: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.3807: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.3808: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.3809: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.3810: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.3811: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.3812: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.3813: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.3814: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.3815: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.3816: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.3817: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.3818: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.3819: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.3820: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.3821: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.3822: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.3823: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.3824: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.3825: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.3826: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.3827: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.3828: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.3829: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.3830: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.3831: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.3832: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.3833: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.3834: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.3835: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.3836: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.3837: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.3838: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.3839: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.3840: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.3841: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.3842: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.3843: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28
Source.3844: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.3845: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.3846: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.3847: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.3848: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.3849: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.3850: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3851: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.3852: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.3853: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.3854: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.3855: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.3856: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.3857: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.3858: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.3859: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.3860: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase
Source.3861: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.3862: DFBPPR15200 ---- Microorganism protein ---- Protein SPT3
Source.3863: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.3864: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.3865: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.3866: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.3867: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.3868: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.3869: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.3870: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.3871: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.3872: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.3873: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.3874: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.3875: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.3876: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.3877: DFBPPR15307 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 21
Source.3878: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.3879: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.3880: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.3881: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.3882: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.3883: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.3884: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.3885: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.3886: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.3887: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.3888: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.3889: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.3890: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.3891: DFBPPR15366 ---- Microorganism protein ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.3892: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.3893: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.3894: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.3895: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.3896: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.3897: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.3898: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.3899: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.3900: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.3901: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.3902: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9
Source.3903: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.3904: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.3905: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.3906: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.3907: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.3908: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.3909: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.3910: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1
Source.3911: DFBPPR15517 ---- Microorganism protein ---- rRNA biogenesis protein RRP36
Source.3912: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.3913: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.3914: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.3915: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.3916: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.3917: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.3918: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1
Source.3919: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.3920: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.3921: DFBPPR15579 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit CNL1
Source.3922: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.3923: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.3924: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.3925: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.3926: DFBPPR15596 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLS1
Source.3927: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.3928: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1
Source.3929: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.3930: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.3931: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.3932: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.3933: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11
Source.3934: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3
Source.3935: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.3936: DFBPPR15648 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 2
Source.3937: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.3938: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.3939: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.3940: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.3941: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.3942: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.3943: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.3944: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.3945: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.3946: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.3947: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.3948: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.3949: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.3950: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.3951: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.3952: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.3953: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component
Source.3954: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.3955: DFBPPR15802 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurQ
Source.3956: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.3957: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.3958: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.3959: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.3960: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.3961: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.3962: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.3963: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.3964: DFBPPR15845 ---- Microorganism protein ---- Calmodulin
Source.3965: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.3966: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.3967: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.3968: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.3969: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.3970: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.3971: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.3972: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.3973: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.3974: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.3975: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.3976: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.3977: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.3978: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.3979: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.3980: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.3981: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.3982: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.3983: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3984: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.3985: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.3986: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.3987: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase
Source.3988: DFBPPR7832 ---- Plant protein ---- Extensin
Source.3989: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.3990: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.3991: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.3992: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.3993: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.3994: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.3995: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.3996: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.3997: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.3998: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4
Source.3999: DFBPPR7869 ---- Plant protein ---- Alpha-amylase inhibitor 5
Source.4000: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4001: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.4002: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a
Source.4003: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4004: DFBPPR7986 ---- Plant protein ---- Uncharacterized mitochondrial protein ORF154
Source.4005: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4006: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.4007: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.4008: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.4009: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1
Source.4010: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.4011: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.4012: DFBPPR8049 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor 2
Source.4013: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.4014: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.4015: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.4016: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.4017: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.4018: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.4019: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.4020: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4021: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4022: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.4023: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.4024: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.4025: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.4026: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.4027: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4028: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.4029: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.4030: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.4031: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4032: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.4033: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.4034: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.4035: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.4036: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.4037: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.4038: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.4039: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4040: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.4041: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4042: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.4043: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.4044: DFBPPR8284 ---- Plant protein ---- Calmodulin
Source.4045: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.4046: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.4047: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4048: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein
Source.4049: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein
Source.4050: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
DPP IV-inhibitory activity

The peptide showed potent inhibitory activity against Dipeptidyl-peptidase IV (EC 3.4.14.5) with the IC50 value of 0.093 ± 0.004 mM.

Specific target protein(s) Specific Target Protein(s):
Dipeptidyl peptidase 4
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools No prediction can be made about the peptide bitterness. prediction
SMILES N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCSC)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

Synthesis peptide

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPACEI1781
[D2] DFBPANOX0727
[D3] DFBPMUFU0525
BIOPEP-UWM [D4] 8833, 9085, 9086
APD [D5] -
BioPepDB [D6] -
MBPDB [D7] -
Reference(s)
Primary literature Lan VT, Ito K, Ohno M, Motoyama T, Ito S, Kawarasaki Y. Analyzing a dipeptide library to identify human dipeptidyl peptidase IV inhibitor. Food Chem. 2015 May 15;175:66-73.
PMID: 25577052
Other literature(s) N.D
PubDate 2015
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214