| DFBP ID - DFBPHYCP0009(Hypocholesterolemic peptide) |
| DFBP ID |
DFBPHYCP0009 |
| Peptide sequence |
LPYPR |
| Type |
Native peptide |
| Peptide/Function name |
Hypocholesterolemic peptide |
|
| Function-activity relationship |
| Main bioactivity |
Hypocholesterolemic activity |
| Otheir bioactivity |
N.D |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Leu-Pro-Tyr-Pro-Arg |
| Single-letter amino acid |
LPYPR |
| Peptide length |
5 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| N.D |
644.76 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
9.82 c |
| IC50 |
N.D |
| pIC50 |
N.D |
| GRAVY |
-1.0400 c |
| Hydrophilic residue ratio |
60% c |
| Peptide calculator |
|
|
| Peptide source & Food-borne protein(s) search |
| Classification |
Plant |
| Organism/Source |
Soy protein |
| Precursor protein |
11S globulin-derived peptide |
| Residue position |
N.D |
|
Precursor protein(s) search
|
|
|
Link-research
|
There are no literature reports on the discovery of this sequence in other food-source proteins. |
|
| Biological/Functional activity & target protein |
| Hypocholesterolemic activity |
An in vitro test for measuring 3-hydroxy-3-methylglutaryl coenzyme A reductase (HMGR, EC 1.1.1.88) inhibition showed that the synthesized peptide LPYPR spossessed hypocholesterinemic properties. For LPYPR at 200 μM, the percent HMGR inhibition was 33.7%. |
| Specific target protein(s) |
Specific Target Protein(s): 3-hydroxy-3-methylglutaryl coenzyme A reductase |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Bitter taste prediction |
|
| SMILES |
N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Synthetic peptide
|
| Enzyme(s)/starter culture |
The peptide LPYPR was synthetic. |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Pak, V.V., Koo, M., Lee, N., Kim, M.S., Kwon, D.Y. Structure—Activity Relationships of the Peptide Ile-Ala-Val-Pro and Its Derivatives Revealed Using the Semi-Empirical AM1 Method. Chemistry of Natural Compounds. 2005, 41, 454-60.
|
| Other literature(s) |
N.D |
| PubDate |
2005 |
|