Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPIMMU0087(Immunomodulatory peptide)

DFBP ID	DFBPIMMU0087
Peptide sequence	YGG
Type	Native peptide
Peptide/Function name	Immunomodulatory peptide

Function-activity relationship

Main bioactivity	Immunomodulatory activity
Otheir bioactivity	ACE-inhibitory activity ^[D1], Antioxidative activity ^[D2], Multifunctional activity ^[D3]

Calculated physicochemical properties

Three-letter amino acid

Tyr-Gly-Gly

Single-letter amino acid

YGG

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	295.30 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.92 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-0.7000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Bovine milk protien
Precursor protein	α-Lactalbumin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.2: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.3: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.4: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.5: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.6: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.7: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.8: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.9: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.10: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.11: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.12: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.13: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.14: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.15: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.16: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.17: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.18: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.19: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.20: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.21: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.22: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.23: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.24: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.25: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.26: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3 Source.27: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1 Source.28: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.29: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.30: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1 Source.31: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG Source.32: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.33: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.34: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.35: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.36: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.37: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.38: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.39: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1 Source.40: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.41: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.42: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.43: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.44: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8 Source.45: DFBPPR1297 ---- Plant proteins ---- Peroxygenase Source.46: DFBPPR1300 ---- Plant proteins ---- Protein G1 Source.47: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.48: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.49: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.50: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic Source.51: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.52: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.53: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.54: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.55: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.56: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.57: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L Source.58: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.59: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.60: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.61: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c Source.62: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2 Source.63: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.64: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.65: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.66: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.67: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16 Source.68: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.69: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.70: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.71: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.72: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.73: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.74: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5 Source.75: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.76: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.77: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.78: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9 Source.79: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.80: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.81: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.82: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.83: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.84: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.85: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.86: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.87: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.88: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.89: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.90: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.91: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.92: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.93: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.94: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.95: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.96: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.97: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.98: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.99: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.100: DFBPPR1803 ---- Plant proteins ---- Chitinase 5 Source.101: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.102: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1 Source.103: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.104: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.105: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2 Source.106: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.107: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.108: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.109: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8 Source.110: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.111: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.112: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2 Source.113: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.114: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.115: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.116: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.117: DFBPPR1962 ---- Plant proteins ---- Expansin-A2 Source.118: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.119: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.120: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.121: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.122: DFBPPR2045 ---- Plant proteins ---- Expansin-A5 Source.123: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.124: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.125: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.126: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.127: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.128: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.129: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.130: DFBPPR2157 ---- Plant proteins ---- Expansin-B6 Source.131: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.132: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.133: DFBPPR2175 ---- Plant proteins ---- Expansin-A16 Source.134: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.135: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.136: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.137: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.138: DFBPPR2242 ---- Plant proteins ---- Expansin-A3 Source.139: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76 Source.140: DFBPPR2244 ---- Plant proteins ---- Expansin-A6 Source.141: DFBPPR2245 ---- Plant proteins ---- Expansin-A26 Source.142: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.143: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.144: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.145: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.146: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.147: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.148: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b Source.149: DFBPPR2356 ---- Plant proteins ---- Ubiquitin-like protein-NEDD8-like protein RUB3 Source.150: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.151: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.152: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.153: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.154: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.155: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.156: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.157: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.158: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.159: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.160: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.161: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.162: DFBPPR2526 ---- Plant proteins ---- Chitinase 10 Source.163: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.164: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.165: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.166: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.167: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.168: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.169: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1 Source.170: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.171: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5 Source.172: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.173: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.174: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.175: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.176: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.177: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.178: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3 Source.179: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.180: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5 Source.181: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.182: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.183: DFBPPR2676 ---- Plant proteins ---- Expansin-A11 Source.184: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.185: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.186: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.187: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.188: DFBPPR2699 ---- Plant proteins ---- Expansin-A8 Source.189: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.190: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77 Source.191: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.192: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.193: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.194: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.195: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.196: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.197: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8 Source.198: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.199: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.200: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.201: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.202: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.203: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.204: DFBPPR2784 ---- Plant proteins ---- Chitinase 11 Source.205: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a Source.206: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.207: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.208: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33 Source.209: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.210: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS Source.211: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.212: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.213: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.214: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.215: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.216: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.217: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1 Source.218: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4 Source.219: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.220: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.221: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.222: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2 Source.223: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.224: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B Source.225: DFBPPR2880 ---- Plant proteins ---- Nuclear cap-binding protein subunit 2 Source.226: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.227: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.228: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.229: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.230: DFBPPR2910 ---- Plant proteins ---- Expansin-B5 Source.231: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.232: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.233: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.234: DFBPPR2948 ---- Plant proteins ---- Expansin-A25 Source.235: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.236: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.237: DFBPPR2964 ---- Plant proteins ---- Expansin-A14 Source.238: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.239: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.240: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.241: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.242: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.243: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4 Source.244: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3 Source.245: DFBPPR3015 ---- Plant proteins ---- Expansin-A13 Source.246: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.247: DFBPPR3017 ---- Plant proteins ---- Expansin-A12 Source.248: DFBPPR3027 ---- Plant proteins ---- Expansin-A31 Source.249: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.250: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.251: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.252: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.253: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.254: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10 Source.255: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.256: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6 Source.257: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.258: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.259: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.260: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.261: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.262: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.263: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.264: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.265: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6 Source.266: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.267: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3 Source.268: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.269: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.270: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.271: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5 Source.272: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.273: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27 Source.274: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.275: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.276: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic Source.277: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.278: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.279: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.280: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.281: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.282: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.283: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.284: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18 Source.285: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.286: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35 Source.287: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.288: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.289: DFBPPR3302 ---- Plant proteins ---- Expansin-A21 Source.290: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.291: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7 Source.292: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.293: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10 Source.294: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11 Source.295: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2 Source.296: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1 Source.297: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.298: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.299: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.300: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.301: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.302: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2 Source.303: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.304: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.305: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.306: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.307: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.308: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2 Source.309: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.310: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.311: DFBPPR3415 ---- Plant proteins ---- Expansin-A33 Source.312: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.313: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.314: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.315: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.316: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.317: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.318: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3 Source.319: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.320: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.321: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.322: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1 Source.323: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2 Source.324: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.325: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.326: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.327: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.328: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.329: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e Source.330: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.331: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.332: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.333: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin Source.334: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.335: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.336: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.337: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.338: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.339: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.340: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.341: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.342: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.343: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1 Source.344: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2 Source.345: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.346: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7 Source.347: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8 Source.348: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9 Source.349: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38 Source.350: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.351: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.352: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2 Source.353: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.354: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.355: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.356: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.357: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14 Source.358: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.359: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.360: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.361: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.362: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.363: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.364: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.365: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.366: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.367: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C Source.368: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.369: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.370: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.371: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.372: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.373: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1 Source.374: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4 Source.375: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2 Source.376: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49 Source.377: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.378: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.379: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40 Source.380: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.381: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1 Source.382: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.383: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.384: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.385: DFBPPR4218 ---- Plant proteins ---- Glycine-rich cell wall structural protein 2 Source.386: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.387: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.388: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.389: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.390: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.391: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.392: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.393: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.394: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.395: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.396: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.397: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.398: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.399: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.400: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.401: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.402: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.403: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme Source.404: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.405: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.406: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.407: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.408: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.409: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3 Source.410: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.411: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.412: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3 Source.413: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19 Source.414: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.415: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.416: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B Source.417: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C Source.418: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.419: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.420: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14 Source.421: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.422: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.423: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.424: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700 Source.425: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36 Source.426: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.427: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400 Source.428: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400 Source.429: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.430: DFBPPR4898 ---- Plant proteins ---- Serine racemase Source.431: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.432: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.433: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.434: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23 Source.435: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.436: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.437: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.438: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.439: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.440: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.441: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.442: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.443: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.444: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.445: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.446: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.447: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.448: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.449: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase Source.450: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.451: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.452: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.453: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.454: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.455: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.456: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.457: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.458: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II Source.459: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1 Source.460: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.461: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.462: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.463: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.464: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.465: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.466: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4 Source.467: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17 Source.468: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.469: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.470: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.471: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.472: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.473: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.474: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.475: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1 Source.476: DFBPPR5931 ---- Plant proteins ---- Glycine-rich RNA-binding, abscisic acid-inducible protein Source.477: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.478: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.479: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B Source.480: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.481: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.482: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.483: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.484: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7 Source.485: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.486: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.487: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.488: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5 Source.489: DFBPPR6135 ---- Plant proteins ---- Defensin-like protein 1 Source.490: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.491: DFBPPR6204 ---- Plant proteins ---- Unknown protein from spot 258 of 2D-PAGE of etiolated coleoptile Source.492: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.493: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.494: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.495: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.496: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.497: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.498: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.499: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.500: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.501: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.502: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.503: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1 Source.504: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.505: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.506: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.507: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.508: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4 Source.509: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2 Source.510: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.511: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.512: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.513: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1 Source.514: DFBPPR6548 ---- Plant proteins ---- Dehydrin DHN1 Source.515: DFBPPR6562 ---- Plant proteins ---- Dormancy-associated protein 2 Source.516: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34 Source.517: DFBPPR6620 ---- Plant proteins ---- Dehydrin DHN2 Source.518: DFBPPR6621 ---- Plant proteins ---- Dehydrin DHN3 Source.519: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.520: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.521: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.522: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.523: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.524: DFBPPR6642 ---- Plant proteins ---- Peroxidase Source.525: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.526: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.527: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.528: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.529: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase Source.530: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.531: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1 Source.532: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.533: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.534: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.535: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.536: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2 Source.537: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.538: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.539: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.540: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.541: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.542: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801 Source.543: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.544: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.545: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.546: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.547: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.548: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.549: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4 Source.550: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.551: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.552: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.553: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.554: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.555: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.556: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein Source.557: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.558: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.559: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.560: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.561: DFBPPR7417 ---- Plant proteins ---- Cruciferin Source.562: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.563: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.564: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.565: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.566: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4 Source.567: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.568: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1 Source.569: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.570: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.571: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2 Source.572: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.573: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.574: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.575: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.576: DFBPPR7504 ---- Plant proteins ---- 10 kDa chaperonin Source.577: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.578: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.579: DFBPPR7530 ---- Plant proteins ---- Glycine-rich RNA-binding protein 10 Source.580: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.581: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.582: DFBPPR7597 ---- Milk proteins ---- Alpha-lactalbumin Source.583: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.584: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.585: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.586: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.587: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.588: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin Source.589: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin Source.590: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin Source.591: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.592: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.593: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.594: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.595: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.596: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101 Source.597: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101 Source.598: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102 Source.599: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.600: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.601: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic Source.602: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.603: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.604: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin Source.605: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.606: DFBPPR15953 ---- Animal proteins ---- Occludin Source.607: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.608: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.609: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.610: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.611: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV Source.612: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.613: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor Source.614: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.615: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.616: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.617: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.618: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.619: DFBPPR16170 ---- Animal proteins ---- Inversin Source.620: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase Source.621: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.622: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.623: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.624: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha Source.625: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.626: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.627: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.628: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.629: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.630: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.631: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.632: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.633: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.634: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.635: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.636: DFBPPR16517 ---- Animal proteins ---- Cholinesterase Source.637: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.638: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.639: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.640: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.641: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9 Source.642: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.643: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.644: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.645: DFBPPR16740 ---- Animal proteins ---- 60S ribosomal protein L36a Source.646: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin Source.647: DFBPPR16804 ---- Animal proteins ---- Pancreatic trypsin inhibitor Source.648: DFBPPR16825 ---- Animal proteins ---- Myelin basic protein Source.649: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109 Source.650: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.651: DFBPPR16864 ---- Animal proteins ---- Protein AMBP Source.652: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.653: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.654: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.655: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.656: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.657: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.658: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A Source.659: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.660: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.661: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.662: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.663: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.664: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.665: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.666: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.667: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.668: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.669: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.670: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.671: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.672: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.673: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.674: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.675: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.676: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.677: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.678: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.679: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.680: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.681: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.682: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.683: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.684: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.685: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.686: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.687: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.688: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.689: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.690: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.691: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.692: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.693: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.694: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.695: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1 Source.696: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.697: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.698: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.699: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.700: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.701: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.702: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.703: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.704: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.705: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase Source.706: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.707: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.708: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.709: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.710: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.711: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.712: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.713: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.714: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.715: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.716: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.717: DFBPPR17849 ---- Animal proteins ---- Fibromodulin Source.718: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.719: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.720: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.721: DFBPPR17883 ---- Animal proteins ---- Sialidase-1 Source.722: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.723: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.724: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT Source.725: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome Source.726: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.727: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.728: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.729: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.730: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase Source.731: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.732: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial Source.733: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.734: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.735: DFBPPR18107 ---- Animal proteins ---- Lymphocyte antigen 96 Source.736: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.737: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.738: DFBPPR18142 ---- Animal proteins ---- Protein CASC3 Source.739: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.740: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.741: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.742: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.743: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.744: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase Source.745: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.746: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7 Source.747: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.748: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B Source.749: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.750: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.751: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.752: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.753: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.754: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.755: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1 Source.756: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.757: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1 Source.758: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor Source.759: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.760: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.761: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.762: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.763: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.764: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein Source.765: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.766: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.767: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.768: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.769: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase Source.770: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.771: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.772: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.773: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.774: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.775: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.776: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.777: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.778: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.779: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.780: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.781: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.782: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase Source.783: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.784: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10 Source.785: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.786: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.787: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.788: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.789: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.790: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.791: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic Source.792: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.793: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.794: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.795: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1 Source.796: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.797: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.798: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8 Source.799: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.800: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.801: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.802: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.803: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Source.804: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.805: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.806: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.807: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.808: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.809: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic Source.810: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.811: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.812: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.813: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.814: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2 Source.815: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J Source.816: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20 Source.817: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.818: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.819: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.820: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.821: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.822: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.823: DFBPPR19540 ---- Animal proteins ---- Beta-defensin 6 Source.824: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.825: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin Source.826: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein Source.827: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.828: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4 Source.829: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.830: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3 Source.831: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.832: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17 Source.833: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.834: DFBPPR19734 ---- Animal proteins ---- CDC42 small effector protein 2 Source.835: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.836: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.837: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.838: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.839: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.840: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.841: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.842: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.843: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.844: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.845: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase Source.846: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.847: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3 Source.848: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.849: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.850: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.851: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.852: DFBPPR20023 ---- Animal proteins ---- Cysteine and glycine-rich protein 2 Source.853: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.854: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.855: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.856: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.857: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.858: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.859: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.860: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.861: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.862: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2 Source.863: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2 Source.864: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.865: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.866: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9 Source.867: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14 Source.868: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1 Source.869: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7 Source.870: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.871: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial Source.872: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.873: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.874: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C Source.875: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase Source.876: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.877: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2 Source.878: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.879: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.880: DFBPPR20596 ---- Animal proteins ---- Colostrum trypsin inhibitor Source.881: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.882: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.883: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.884: DFBPPR20743 ---- Animal proteins ---- Myozenin-1 Source.885: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.886: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.887: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3 Source.888: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.889: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2 Source.890: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.891: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV Source.892: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.893: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A Source.894: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3 Source.895: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.896: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.897: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.898: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2 Source.899: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor Source.900: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.901: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.902: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.903: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III Source.904: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.905: DFBPPR21223 ---- Animal proteins ---- Serum basic protease inhibitor Source.906: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.907: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial Source.908: DFBPPR21394 ---- Animal proteins ---- Elongin-C Source.909: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.910: DFBPPR21494 ---- Animal proteins ---- Spleen trypsin inhibitor I Source.911: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.912: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.913: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.914: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6 Source.915: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.916: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.917: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19 Source.918: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB Source.919: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial Source.920: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.921: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein Source.922: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.923: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A Source.924: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.925: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.926: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11 Source.927: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14 Source.928: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.929: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34 Source.930: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.931: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein Source.932: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein Source.933: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.934: DFBPPR22483 ---- Animal proteins ---- 60S ribosomal protein L36a Source.935: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.936: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.937: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.938: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.939: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.940: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164 Source.941: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein Source.942: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.943: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B Source.944: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.945: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.946: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.947: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.948: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.949: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.950: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.951: DFBPPR8553 ---- Animal proteins ---- Protein AMBP Source.952: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.953: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.954: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.955: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.956: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.957: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.958: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.959: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.960: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.961: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.962: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.963: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.964: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin Source.965: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.966: DFBPPR8792 ---- Animal proteins ---- Plasminogen Source.967: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.968: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.969: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.970: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide Source.971: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.972: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.973: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.974: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.975: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.976: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B Source.977: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.978: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.979: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component Source.980: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.981: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.982: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.983: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.984: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.985: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3 Source.986: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.987: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.988: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.989: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2 Source.990: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.991: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.992: DFBPPR9319 ---- Animal proteins ---- Myelin basic protein Source.993: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.994: DFBPPR9346 ---- Animal proteins ---- Myozenin-1 Source.995: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.996: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.997: DFBPPR9511 ---- Animal proteins ---- Cholinesterase Source.998: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.999: DFBPPR9585 ---- Animal proteins ---- Uterine plasmin/trypsin inhibitor Source.1000: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2 Source.1001: DFBPPR9593 ---- Animal proteins ---- Selenoprotein K Source.1002: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.1003: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2 Source.1004: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein Source.1005: DFBPPR9652 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.1006: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1007: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.1008: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1009: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5 Source.1010: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.1011: DFBPPR9835 ---- Animal proteins ---- 60S ribosomal protein L36a Source.1012: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1013: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19 Source.1014: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.1015: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.1016: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.1017: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1018: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.1019: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.1020: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1021: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1022: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain Source.1023: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.1024: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.1025: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1026: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1027: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.1028: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.1029: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.1030: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.1031: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.1032: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20 Source.1033: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.1034: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.1035: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.1036: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85 Source.1037: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.1038: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.1039: DFBPPR10218 ---- Animal proteins ---- Occludin Source.1040: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.1041: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.1042: DFBPPR10270 ---- Animal proteins ---- Agrin Source.1043: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.1044: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.1045: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.1046: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.1047: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.1048: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.1049: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.1050: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.1051: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1052: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.1053: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.1054: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.1055: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.1056: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.1057: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.1058: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.1059: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.1060: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.1061: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.1062: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.1063: DFBPPR10605 ---- Animal proteins ---- Elastin Source.1064: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.1065: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX Source.1066: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin Source.1067: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1068: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1069: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5 Source.1070: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.1071: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.1072: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.1073: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.1074: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.1075: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.1076: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.1077: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.1078: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.1079: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.1080: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.1081: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.1082: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1 Source.1083: DFBPPR10919 ---- Animal proteins ---- Ski oncogene Source.1084: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2 Source.1085: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.1086: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.1087: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.1088: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.1089: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.1090: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.1091: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.1092: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.1093: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.1094: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.1095: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.1096: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.1097: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein Source.1098: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein Source.1099: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2 Source.1100: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1 Source.1101: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.1102: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.1103: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.1104: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.1105: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.1106: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.1107: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.1108: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.1109: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.1110: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15 Source.1111: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1112: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1113: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.1114: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.1115: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.1116: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.1117: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.1118: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.1119: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.1120: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9 Source.1121: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.1122: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J Source.1123: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.1124: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.1125: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein Source.1126: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1127: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13 Source.1128: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.1129: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.1130: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1131: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.1132: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.1133: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.1134: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.1135: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3 Source.1136: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.1137: DFBPPR11822 ---- Animal proteins ---- Inversin Source.1138: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.1139: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.1140: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.1141: DFBPPR11854 ---- Animal proteins ---- Claw keratin Source.1142: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.1143: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like Source.1144: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.1145: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1 Source.1146: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.1147: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2 Source.1148: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal Source.1149: DFBPPR12038 ---- Animal proteins ---- Scale keratin Source.1150: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.1151: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.1152: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.1153: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1154: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3 Source.1155: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.1156: DFBPPR12245 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.1157: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1158: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.1159: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase Source.1160: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.1161: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1162: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.1163: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1164: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1165: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.1166: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3 Source.1167: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.1168: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.1169: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.1170: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.1171: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.1172: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.1173: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.1174: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.1175: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.1176: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1177: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.1178: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.1179: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1180: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.1181: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.1182: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1183: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.1184: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.1185: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.1186: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.1187: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.1188: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.1189: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.1190: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.1191: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.1192: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.1193: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.1194: DFBPPR12747 ---- Animal proteins ---- Myelin basic protein Source.1195: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.1196: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.1197: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.1198: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.1199: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.1200: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.1201: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor Source.1202: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain Source.1203: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.1204: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.1205: DFBPPR13008 ---- Animal proteins ---- Keratin-associated protein 6-1 Source.1206: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1207: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1208: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1 Source.1209: DFBPPR13106 ---- Animal proteins ---- Ig kappa chain V region BS-1 Source.1210: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.1211: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1212: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.1213: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.1214: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.1215: DFBPPR13286 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor Source.1216: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.1217: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.1218: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.1219: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1220: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.1221: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3 Source.1222: DFBPPR13478 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor Source.1223: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.1224: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin Source.1225: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1226: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1227: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating Source.1228: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.1229: DFBPPR13716 ---- Animal proteins ---- Trichohyalin Source.1230: DFBPPR13791 ---- Animal proteins ---- Cholinesterase Source.1231: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1 Source.1232: DFBPPR13841 ---- Animal proteins ---- Keratin-associated protein 6-1 Source.1233: DFBPPR13855 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor Source.1234: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1235: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15 Source.1236: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1 Source.1237: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2 Source.1238: DFBPPR14020 ---- Animal proteins ---- Parvalbumin alpha Source.1239: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1 Source.1240: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.1241: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.1242: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein Source.1243: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.1244: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog Source.1245: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.1246: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein Source.1247: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin Source.1248: DFBPPR14261 ---- Marine protein ---- Beta-endorphin-2 Source.1249: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin Source.1250: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial Source.1251: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase Source.1252: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein Source.1253: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase Source.1254: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.1255: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.1256: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.1257: DFBPPR14500 ---- Marine protein ---- 50S ribosomal protein L27, chloroplastic Source.1258: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56 Source.1259: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A Source.1260: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B Source.1261: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.1262: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18 Source.1263: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A Source.1264: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13 Source.1265: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.1266: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.1267: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase Source.1268: DFBPPR14776 ---- Marine protein ---- Proteinase inhibitor Source.1269: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.1270: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.1271: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain Source.1272: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain Source.1273: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.1274: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.1275: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.1276: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.1277: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.1278: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1279: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.1280: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.1281: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.1282: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.1283: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.1284: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.1285: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.1286: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.1287: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.1288: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2 Source.1289: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase Source.1290: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.1291: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.1292: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.1293: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.1294: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.1295: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22 Source.1296: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.1297: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.1298: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.1299: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.1300: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.1301: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase Source.1302: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.1303: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.1304: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4 Source.1305: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase Source.1306: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.1307: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7 Source.1308: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.1309: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5 Source.1310: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3 Source.1311: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.1312: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.1313: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.1314: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.1315: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16 Source.1316: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.1317: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.1318: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.1319: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.1320: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1 Source.1321: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.1322: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8 Source.1323: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.1324: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5 Source.1325: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1 Source.1326: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.1327: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.1328: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.1329: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.1330: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.1331: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.1332: DFBPPR7832 ---- Plant protein ---- Extensin Source.1333: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1 Source.1334: DFBPPR7910 ---- Plant protein ---- Glycine-rich RNA-binding protein 2 Source.1335: DFBPPR7911 ---- Plant protein ---- Glycine-rich RNA-binding protein 1 Source.1336: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.1337: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.1338: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.1339: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.1340: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.1341: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.1342: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.1343: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.1344: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1 Source.1345: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.1346: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.1347: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Immunomodulatory activity	Tyr-Gly-Gly significantly enhanced (maximal 35%) the proliferation of human peripheral blood lymphocytes.
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	Bitter peptide according to BIOPEP database of sensory peptides and amino acids [1].
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)O

Preparation method

Mode of preparation	Synthesis
Enzyme(s)/starter culture	Synthesis peptide

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

DFBP

[D1]	DFBPACEI0644
[D2]	DFBPANOX0611
[D3]	DFBPMUFU0142

[D4]

[D5]

[D6]

[D7]

Reference(s)

Primary literature	Kayser, H., Meisel, H. Stimulation of human peripheral blood lymphocytes by bioactive peptides derived from bovine milk proteins. FEBS Letters. 1996, 383, 18-20. DOI: 10.1016/0014-5793(96)00207-4
Other literature(s)	[1] Shimizu M. Nutraceutical proteins and peptides in health and disease[J]. ACE Inhibitory Peptides, 2006:269-315.
PubDate	1996