Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPINPE0012(Other bio-peptides)

DFBP ID	DFBPINPE0012
Peptide sequence	GGV
Type	Native peptide
Peptide/Function name	HMG-CoA reductase inhibitor

Function-activity relationship

Main bioactivity	Inhibitor activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Gly-Gly-Val

Single-letter amino acid

GGV

Peptide length

Peptide mass

Experimental mass	Theoretical mass
232 Da	231.26 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.1333^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Plant
Organism/Source	Amaranth (Amaranthus cruentus)
Precursor protein	Amaranth protein
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.2: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.3: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.4: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.5: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.6: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.7: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.8: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.9: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.10: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.11: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.12: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.13: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.14: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.15: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.16: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.17: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.18: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.19: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.20: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.21: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.22: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.23: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.24: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.25: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.26: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.27: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12 Source.28: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.29: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.30: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.31: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.32: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.33: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.34: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.35: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.36: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.37: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.38: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.39: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.40: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.41: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.42: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.43: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.44: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.45: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.46: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.47: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.48: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.49: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.50: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.51: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.52: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.53: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.54: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.55: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.56: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.57: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.58: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.59: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12 Source.60: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.61: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.62: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.63: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.64: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.65: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.66: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.67: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24 Source.68: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE Source.69: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.70: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.71: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.72: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.73: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.74: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.75: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.76: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3 Source.77: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.78: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic Source.79: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.80: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.81: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13 Source.82: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.83: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.84: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13 Source.85: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.86: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.87: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.88: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.89: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23 Source.90: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.91: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.92: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.93: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.94: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.95: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2 Source.96: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic Source.97: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.98: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic Source.99: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.100: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.101: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.102: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a Source.103: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.104: DFBPPR1292 ---- Plant proteins ---- Chitinase 3 Source.105: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1 Source.106: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.107: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.108: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.109: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.110: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.111: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.112: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.113: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1 Source.114: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.115: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.116: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.117: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1 Source.118: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.119: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5 Source.120: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.121: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.122: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.123: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.124: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.125: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.126: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.127: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.128: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.129: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.130: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.131: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.132: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic Source.133: DFBPPR1412 ---- Plant proteins ---- Histone H3.3 Source.134: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.135: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.136: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.137: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.138: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.139: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.140: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.141: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.142: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.143: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.144: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.145: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1 Source.146: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.147: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.148: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.149: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.150: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.151: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.152: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.153: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.154: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.155: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.156: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.157: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.158: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.159: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.160: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.161: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.162: DFBPPR1497 ---- Plant proteins ---- Chitinase 1 Source.163: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.164: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.165: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.166: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.167: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.168: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.169: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.170: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.171: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.172: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.173: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.174: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.175: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.176: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.177: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.178: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.179: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.180: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33 Source.181: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.182: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.183: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.184: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.185: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.186: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.187: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.188: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.189: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.190: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.191: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a Source.192: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.193: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.194: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.195: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.196: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.197: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.198: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.199: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.200: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.201: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.202: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.203: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.204: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.205: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.206: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.207: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.208: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.209: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.210: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.211: DFBPPR1696 ---- Plant proteins ---- Phytosulfokines 2 Source.212: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.213: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.214: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.215: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.216: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.217: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.218: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.219: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.220: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP Source.221: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic Source.222: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.223: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.224: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.225: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.226: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.227: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.228: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.229: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.230: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.231: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.232: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1 Source.233: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.234: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.235: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.236: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.237: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.238: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.239: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.240: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.241: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.242: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.243: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.244: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.245: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.246: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.247: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B Source.248: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.249: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2 Source.250: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.251: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.252: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.253: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.254: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.255: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.256: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A Source.257: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.258: DFBPPR1940 ---- Plant proteins ---- Histone H3.2 Source.259: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA Source.260: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.261: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.262: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B Source.263: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.264: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.265: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.266: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.267: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.268: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4 Source.269: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.270: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.271: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.272: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.273: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.274: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.275: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.276: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5 Source.277: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.278: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.279: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.280: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.281: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.282: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.283: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.284: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.285: DFBPPR2063 ---- Plant proteins ---- Non-specific lipid-transfer protein C6 Source.286: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.287: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.288: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2 Source.289: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1 Source.290: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.291: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.292: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.293: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.294: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.295: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.296: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.297: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.298: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4 Source.299: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1 Source.300: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.301: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.302: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.303: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1 Source.304: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.305: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.306: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.307: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A Source.308: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.309: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.310: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.311: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1 Source.312: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.313: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.314: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.315: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.316: DFBPPR2206 ---- Plant proteins ---- Leucine-rich repeat protein 1 Source.317: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.318: DFBPPR2230 ---- Plant proteins ---- Proteasome subunit alpha type-2 Source.319: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.320: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6 Source.321: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.322: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76 Source.323: DFBPPR2244 ---- Plant proteins ---- Expansin-A6 Source.324: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.325: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.326: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.327: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.328: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.329: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3 Source.330: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.331: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.332: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3 Source.333: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.334: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.335: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.336: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.337: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.338: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.339: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.340: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.341: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.342: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.343: DFBPPR2352 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-4 Source.344: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.345: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.346: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1 Source.347: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.348: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.349: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein Source.350: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.351: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.352: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.353: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.354: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.355: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.356: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic Source.357: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.358: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.359: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.360: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.361: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.362: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34 Source.363: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial Source.364: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.365: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.366: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.367: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.368: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.369: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.370: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.371: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic Source.372: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.373: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.374: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.375: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.376: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.377: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.378: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.379: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.380: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.381: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.382: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.383: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a Source.384: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.385: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.386: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.387: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.388: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.389: DFBPPR2595 ---- Plant proteins ---- Expansin-B7 Source.390: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.391: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2 Source.392: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.393: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E Source.394: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.395: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.396: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.397: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.398: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.399: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2 Source.400: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.401: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.402: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.403: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2 Source.404: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.405: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.406: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.407: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.408: DFBPPR2681 ---- Plant proteins ---- Probable histone H2A.6 Source.409: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.410: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.411: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16 Source.412: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.413: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72 Source.414: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.415: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal Source.416: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.417: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.418: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2 Source.419: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.420: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.421: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.422: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9 Source.423: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8 Source.424: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.425: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.426: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.427: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.428: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.429: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.430: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.431: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.432: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.433: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.434: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.435: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.436: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.437: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.438: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.439: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1 Source.440: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.441: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.442: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.443: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.444: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.445: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.446: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.447: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.448: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.449: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.450: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2 Source.451: DFBPPR2910 ---- Plant proteins ---- Expansin-B5 Source.452: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.453: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3 Source.454: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.455: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.456: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4 Source.457: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.458: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.459: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.460: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.461: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.462: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.463: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.464: DFBPPR2952 ---- Plant proteins ---- Expansin-A17 Source.465: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.466: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1 Source.467: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.468: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.469: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.470: DFBPPR2964 ---- Plant proteins ---- Expansin-A14 Source.471: DFBPPR2966 ---- Plant proteins ---- Probable histone H2A.5 Source.472: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.473: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.474: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.475: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.476: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.477: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.478: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.479: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20 Source.480: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13 Source.481: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.482: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.483: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.484: DFBPPR3015 ---- Plant proteins ---- Expansin-A13 Source.485: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.486: DFBPPR3017 ---- Plant proteins ---- Expansin-A12 Source.487: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.488: DFBPPR3027 ---- Plant proteins ---- Expansin-A31 Source.489: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.490: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.491: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.492: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.493: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.494: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.495: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.496: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8 Source.497: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.498: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.499: DFBPPR3072 ---- Plant proteins ---- Probable histone H2A.4 Source.500: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.501: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.502: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.503: DFBPPR3102 ---- Plant proteins ---- Expansin-B18 Source.504: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.505: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.506: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.507: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.508: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.509: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.510: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.511: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.512: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.513: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.514: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.515: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4 Source.516: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.517: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5 Source.518: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.519: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.520: DFBPPR3170 ---- Plant proteins ---- Probable histone H2A.2 Source.521: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.522: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.523: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.524: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59 Source.525: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.526: DFBPPR3206 ---- Plant proteins ---- Expansin-B15 Source.527: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.528: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.529: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.530: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.531: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.532: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.533: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.534: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.535: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.536: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.537: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.538: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.539: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.540: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.541: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.542: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7 Source.543: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.544: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS Source.545: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.546: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.547: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.548: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.549: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1 Source.550: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.551: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.552: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.553: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35 Source.554: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3 Source.555: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.556: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.557: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.558: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.559: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1 Source.560: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.561: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.562: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.563: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.564: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.565: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.566: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.567: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.568: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.569: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.570: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1 Source.571: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.572: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.573: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.574: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.575: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2 Source.576: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1 Source.577: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.578: DFBPPR3413 ---- Plant proteins ---- Probable histone H2AXa Source.579: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5 Source.580: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.581: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11 Source.582: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.583: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3 Source.584: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.585: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.586: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.587: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.588: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3 Source.589: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.590: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C Source.591: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12 Source.592: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.593: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.594: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1 Source.595: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.596: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.597: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9 Source.598: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.599: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.600: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.601: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.602: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.603: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6 Source.604: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1 Source.605: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.606: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.607: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.608: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.609: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.610: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.611: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.612: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45 Source.613: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.614: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.615: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.616: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5 Source.617: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.618: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.619: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.620: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2 Source.621: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.622: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10 Source.623: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.624: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.625: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7 Source.626: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.627: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.628: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.629: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.630: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1 Source.631: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7 Source.632: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.633: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.634: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.635: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.636: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4 Source.637: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.638: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2 Source.639: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.640: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.641: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.642: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.643: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.644: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.645: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.646: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.647: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.648: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.649: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2 Source.650: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.651: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.652: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.653: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic Source.654: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.655: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28 Source.656: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1 Source.657: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12 Source.658: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38 Source.659: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2 Source.660: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2 Source.661: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.662: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial Source.663: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77 Source.664: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1 Source.665: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.666: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.667: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein Source.668: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.669: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.670: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.671: DFBPPR3828 ---- Plant proteins ---- Probable histone H2A variant 1 Source.672: DFBPPR3830 ---- Plant proteins ---- Probable histone H2A variant 3 Source.673: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35 Source.674: DFBPPR3835 ---- Plant proteins ---- Probable histone H2A variant 2 Source.675: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.676: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.677: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.678: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.679: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.680: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.681: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.682: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11 Source.683: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.684: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.685: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.686: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9 Source.687: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.688: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.689: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.690: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.691: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.692: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.693: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.694: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.695: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.696: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.697: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.698: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.699: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2 Source.700: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.701: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.702: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.703: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.704: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.705: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.706: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.707: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7 Source.708: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7 Source.709: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.710: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.711: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.712: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11 Source.713: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3 Source.714: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.715: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1 Source.716: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.717: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27 Source.718: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58 Source.719: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.720: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta Source.721: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.722: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25 Source.723: DFBPPR4060 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.724: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4 Source.725: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.726: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.727: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.728: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3 Source.729: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.730: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.731: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.732: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.733: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.734: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.735: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.736: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.737: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.738: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.739: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.740: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.741: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.742: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.743: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.744: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.745: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.746: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.747: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.748: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P Source.749: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.750: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.751: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.752: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.753: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.754: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.755: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.756: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.757: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2 Source.758: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.759: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.760: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.761: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400 Source.762: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.763: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial Source.764: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.765: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.766: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.767: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.768: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8 Source.769: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1 Source.770: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.771: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5 Source.772: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.773: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.774: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25 Source.775: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.776: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.777: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.778: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.779: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.780: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.781: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.782: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.783: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.784: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.785: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2 Source.786: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.787: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.788: DFBPPR4417 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 3 Source.789: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1 Source.790: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.791: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.792: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein Source.793: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.794: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.795: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1 Source.796: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1 Source.797: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2 Source.798: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.799: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.800: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.801: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.802: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.803: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.804: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.805: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2 Source.806: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.807: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.808: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.809: DFBPPR4490 ---- Plant proteins ---- Succinate dehydrogenase subunit 8A, mitochondrial Source.810: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.811: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2 Source.812: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein Source.813: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.814: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.815: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.816: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.817: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1 Source.818: DFBPPR4530 ---- Plant proteins ---- Water stress-inducible protein Rab21 Source.819: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.820: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.821: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.822: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.823: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.824: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.825: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.826: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.827: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.828: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3 Source.829: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.830: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12 Source.831: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9 Source.832: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.833: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.834: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.835: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.836: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.837: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.838: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein Source.839: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2 Source.840: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.841: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1 Source.842: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2 Source.843: DFBPPR4713 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 14 Source.844: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5 Source.845: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4 Source.846: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.847: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14 Source.848: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400 Source.849: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.850: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3 Source.851: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic Source.852: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.853: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.854: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.855: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1 Source.856: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.857: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6 Source.858: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700 Source.859: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.860: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2 Source.861: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.862: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5 Source.863: DFBPPR4854 ---- Plant proteins ---- Putative ripening-related protein 6 Source.864: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.865: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.866: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.867: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.868: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.869: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.870: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.871: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.872: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic Source.873: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.874: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.875: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.876: DFBPPR4949 ---- Plant proteins ---- Probable histone H2AXb Source.877: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.878: DFBPPR4973 ---- Plant proteins ---- Glycinin G2 Source.879: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.880: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1 Source.881: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1 Source.882: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.883: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.884: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.885: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.886: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.887: DFBPPR5031 ---- Plant proteins ---- Histone H4 Source.888: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.889: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.890: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.891: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2 Source.892: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.893: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.894: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.895: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.896: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.897: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.898: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.899: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.900: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.901: DFBPPR5150 ---- Plant proteins ---- Profilin-2 Source.902: DFBPPR5154 ---- Plant proteins ---- Profilin-1 Source.903: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.904: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.905: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.906: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial Source.907: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.908: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.909: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.910: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.911: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.912: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.913: DFBPPR5287 ---- Plant proteins ---- Nodulin-24 Source.914: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.915: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1 Source.916: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2 Source.917: DFBPPR5316 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.918: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1 Source.919: DFBPPR5354 ---- Plant proteins ---- Protein P21 Source.920: DFBPPR5359 ---- Plant proteins ---- 60S ribosomal protein L41 Source.921: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1 Source.922: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.923: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.924: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.925: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.926: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.927: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.928: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.929: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.930: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.931: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.932: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.933: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.934: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.935: DFBPPR5449 ---- Plant proteins ---- Histone H4 Source.936: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.937: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.938: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.939: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.940: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.941: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.942: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.943: DFBPPR5489 ---- Plant proteins ---- Histone H3.2 Source.944: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.945: DFBPPR5499 ---- Plant proteins ---- Dehydrin DHN1 Source.946: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme Source.947: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.948: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.949: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein Source.950: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.951: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.952: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.953: DFBPPR5535 ---- Plant proteins ---- Histone H4.3 Source.954: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.955: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.956: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.957: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic Source.958: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.959: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.960: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic Source.961: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.962: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.963: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1 Source.964: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.965: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.966: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.967: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A Source.968: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.969: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.970: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3 Source.971: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.972: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.973: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.974: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9 Source.975: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.976: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.977: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.978: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.979: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.980: DFBPPR5661 ---- Plant proteins ---- Albumin b-32 Source.981: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.982: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.983: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.984: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.985: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.986: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein Source.987: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.988: DFBPPR5706 ---- Plant proteins ---- Glutelin-2 Source.989: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.990: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.991: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4 Source.992: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.993: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.994: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.995: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1 Source.996: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.997: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.998: DFBPPR5807 ---- Plant proteins ---- Histone H2A Source.999: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1000: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic Source.1001: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.1002: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1003: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.1004: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3 Source.1005: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1006: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5 Source.1007: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.1008: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1009: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1010: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.1011: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1012: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.1013: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1014: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein Source.1015: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1016: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3 Source.1017: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1018: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein Source.1019: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.1020: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.1021: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.1022: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7 Source.1023: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor Source.1024: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.1025: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.1026: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1 Source.1027: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1 Source.1028: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.1029: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A Source.1030: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17 Source.1031: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.1032: DFBPPR6168 ---- Plant proteins ---- Late embryogenesis abundant protein, group 3 Source.1033: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1034: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1035: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.1036: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34 Source.1037: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.1038: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1039: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.1040: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.1041: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein Source.1042: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.1043: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.1044: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.1045: DFBPPR6258 ---- Plant proteins ---- Histone H3.2 Source.1046: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.1047: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1 Source.1048: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein Source.1049: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.1050: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.1051: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.1052: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.1053: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.1054: DFBPPR6308 ---- Plant proteins ---- Histone H4 Source.1055: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.1056: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2 Source.1057: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.1058: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.1059: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.1060: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1 Source.1061: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1062: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.1063: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1064: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1065: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.1066: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2 Source.1067: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1068: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.1069: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1070: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.1071: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1072: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.1073: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.1074: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.1075: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.1076: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.1077: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.1078: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like Source.1079: DFBPPR6502 ---- Plant proteins ---- Early light-induced protein, chloroplastic Source.1080: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A Source.1081: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6 Source.1082: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.1083: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.1084: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1085: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase Source.1086: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49 Source.1087: DFBPPR6548 ---- Plant proteins ---- Dehydrin DHN1 Source.1088: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1089: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1090: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34 Source.1091: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176 Source.1092: DFBPPR6620 ---- Plant proteins ---- Dehydrin DHN2 Source.1093: DFBPPR6621 ---- Plant proteins ---- Dehydrin DHN3 Source.1094: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.1095: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.1096: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase Source.1097: DFBPPR6652 ---- Plant proteins ---- Histone H2A.1 Source.1098: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.1099: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.1100: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.1101: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10 Source.1102: DFBPPR6686 ---- Plant proteins ---- Histone H3.2 Source.1103: DFBPPR6688 ---- Plant proteins ---- Histone H4 variant TH011 Source.1104: DFBPPR6690 ---- Plant proteins ---- Histone H2A.2.2 Source.1105: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1 Source.1106: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1 Source.1107: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7 Source.1108: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein Source.1109: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1110: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa Source.1111: DFBPPR6728 ---- Plant proteins ---- Protein H2A.5 Source.1112: DFBPPR6729 ---- Plant proteins ---- Protein H2A.6 Source.1113: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.1114: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.1115: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4 Source.1116: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1117: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1118: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.1119: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1120: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1121: DFBPPR6784 ---- Plant proteins ---- Histone H4 variant TH091 Source.1122: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1123: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic Source.1124: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1125: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1126: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.1127: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1 Source.1128: DFBPPR6948 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.1129: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.1130: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.1131: DFBPPR7056 ---- Plant proteins ---- Cysteine proteinase inhibitor Source.1132: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1133: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1134: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.1135: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2 Source.1136: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1137: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.1138: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1 Source.1139: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.1140: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1141: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.1142: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.1143: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic Source.1144: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.1145: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1146: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1147: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1148: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.1149: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1150: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1151: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1152: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase Source.1153: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.1154: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.1155: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic Source.1156: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic Source.1157: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.1158: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3 Source.1159: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4 Source.1160: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C Source.1161: DFBPPR7307 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.1162: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R Source.1163: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.1164: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.1165: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.1166: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.1167: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.1168: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.1169: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1170: DFBPPR7448 ---- Plant proteins ---- Histone H3.2 Source.1171: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2 Source.1172: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1173: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1174: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1175: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1176: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.1177: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.1178: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.1179: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.1180: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.1181: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.1182: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.1183: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.1184: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1185: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.1186: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.1187: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1188: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6 Source.1189: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.1190: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.1191: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12 Source.1192: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin Source.1193: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin Source.1194: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin Source.1195: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1196: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1197: DFBPPR7737 ---- Plant proteins ---- Endochitinase Source.1198: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.1199: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1200: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.1201: DFBPPR8377 ---- Plant proteins ---- Profilin Source.1202: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2 Source.1203: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102 Source.1204: DFBPPR8408 ---- Plant proteins ---- Profilin Source.1205: DFBPPR8424 ---- Plant proteins ---- Oleosin H1 Source.1206: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.1207: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1208: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1209: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1210: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.1211: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6 Source.1212: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5 Source.1213: DFBPPR8443 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1214: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A Source.1215: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1216: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1217: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin Source.1218: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.1219: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.1220: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.1221: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1222: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3 Source.1223: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1224: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.1225: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1226: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.1227: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1228: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.1229: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.1230: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor Source.1231: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1232: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.1233: DFBPPR16006 ---- Animal proteins ---- Leptin Source.1234: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV Source.1235: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.1236: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1237: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.1238: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.1239: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1240: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1241: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1242: DFBPPR16067 ---- Animal proteins ---- CD40 ligand Source.1243: DFBPPR16079 ---- Animal proteins ---- Ras-related protein Rab-10 Source.1244: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A Source.1245: DFBPPR16093 ---- Animal proteins ---- Menin Source.1246: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.1247: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1248: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.1249: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1250: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.1251: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.1252: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.1253: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1254: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.1255: DFBPPR16196 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1256: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.1257: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1258: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1259: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type Source.1260: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1261: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.1262: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.1263: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.1264: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.1265: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.1266: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1267: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1268: DFBPPR16378 ---- Animal proteins ---- Arginine esterase Source.1269: DFBPPR16439 ---- Animal proteins ---- Lutropin subunit beta Source.1270: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.1271: DFBPPR16487 ---- Animal proteins ---- Claudin-2 Source.1272: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.1273: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.1274: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.1275: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.1276: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator Source.1277: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1278: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.1279: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1280: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1281: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1282: DFBPPR16580 ---- Animal proteins ---- Fibrinogen alpha chain Source.1283: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.1284: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.1285: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial Source.1286: DFBPPR16645 ---- Animal proteins ---- Putative protein SCAMPER Source.1287: DFBPPR16655 ---- Animal proteins ---- Somatostatin Source.1288: DFBPPR16677 ---- Animal proteins ---- Copper transport protein ATOX1 Source.1289: DFBPPR16700 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A2, mitochondrial Source.1290: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1291: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.1292: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.1293: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.1294: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1295: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.1296: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1297: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1298: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1299: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain Source.1300: DFBPPR16852 ---- Animal proteins ---- Cytochrome b Source.1301: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor Source.1302: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.1303: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.1304: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.1305: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1306: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.1307: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.1308: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1309: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1310: DFBPPR16939 ---- Animal proteins ---- Histone H3.3 Source.1311: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A Source.1312: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1313: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.1314: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1315: DFBPPR16974 ---- Animal proteins ---- Natriuretic peptides A Source.1316: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.1317: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.1318: DFBPPR16985 ---- Animal proteins ---- Filensin Source.1319: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1320: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.1321: DFBPPR17000 ---- Animal proteins ---- Vimentin Source.1322: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17 Source.1323: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.1324: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.1325: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1326: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1327: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.1328: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1329: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1330: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.1331: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1332: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.1333: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1334: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1335: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1336: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.1337: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1 Source.1338: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1339: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.1340: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta Source.1341: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1342: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1343: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.1344: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.1345: DFBPPR17196 ---- Animal proteins ---- Histone H4 Source.1346: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.1347: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.1348: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1349: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.1350: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.1351: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.1352: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.1353: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1354: DFBPPR17334 ---- Animal proteins ---- Prohibitin Source.1355: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1356: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.1357: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.1358: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.1359: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.1360: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1361: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.1362: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.1363: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1364: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1365: DFBPPR17423 ---- Animal proteins ---- Furin Source.1366: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.1367: DFBPPR17452 ---- Animal proteins ---- CD81 antigen Source.1368: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.1369: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1370: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1371: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.1372: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.1373: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.1374: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.1375: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.1376: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.1377: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1378: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1 Source.1379: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.1380: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1381: DFBPPR17538 ---- Animal proteins ---- Septin-7 Source.1382: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.1383: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.1384: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog Source.1385: DFBPPR17556 ---- Animal proteins ---- Histone H2A type 1 Source.1386: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1 Source.1387: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.1388: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1389: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.1390: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1391: DFBPPR17581 ---- Animal proteins ---- Histone H3.1 Source.1392: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.1393: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.1394: DFBPPR17626 ---- Animal proteins ---- Elastin Source.1395: DFBPPR17629 ---- Animal proteins ---- Thiamine-triphosphatase Source.1396: DFBPPR17630 ---- Animal proteins ---- Thiamine-triphosphatase Source.1397: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.1398: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1399: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1400: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1401: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.1402: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.1403: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.1404: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.1405: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1406: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3 Source.1407: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1408: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.1409: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1410: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1411: DFBPPR17809 ---- Animal proteins ---- Polyubiquitin-C Source.1412: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b Source.1413: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.1414: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.1415: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.1416: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase Source.1417: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1418: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.1419: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1420: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.1421: DFBPPR17879 ---- Animal proteins ---- Menin Source.1422: DFBPPR17883 ---- Animal proteins ---- Sialidase-1 Source.1423: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.1424: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1425: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.1426: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.1427: DFBPPR17912 ---- Animal proteins ---- Histone H3.2 Source.1428: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.1429: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.1430: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.1431: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1432: DFBPPR17928 ---- Animal proteins ---- CD40 ligand Source.1433: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1434: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT Source.1435: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.1436: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1437: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.1438: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9 Source.1439: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1440: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.1441: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.1442: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.1443: DFBPPR17970 ---- Animal proteins ---- Profilin-2 Source.1444: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.1445: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.1446: DFBPPR17978 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.1447: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.1448: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1449: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.1450: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.1451: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.1452: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1453: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.1454: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.1455: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.1456: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.1457: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1458: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.1459: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.1460: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1461: DFBPPR18071 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte Source.1462: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.1463: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor Source.1464: DFBPPR18100 ---- Animal proteins ---- Derlin-1 Source.1465: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1466: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.1467: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1468: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.1469: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1 Source.1470: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.1471: DFBPPR18142 ---- Animal proteins ---- Protein CASC3 Source.1472: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.1473: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.1474: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.1475: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25 Source.1476: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.1477: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.1478: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B Source.1479: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.1480: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.1481: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1482: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.1483: DFBPPR18262 ---- Animal proteins ---- Claudin-1 Source.1484: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.1485: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1 Source.1486: DFBPPR18285 ---- Animal proteins ---- ADP-ribose glycohydrolase OARD1 Source.1487: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.1488: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta Source.1489: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1490: DFBPPR18302 ---- Animal proteins ---- Histone H2A.Z Source.1491: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.1492: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1 Source.1493: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.1494: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q Source.1495: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase Source.1496: DFBPPR18358 ---- Animal proteins ---- Lymphatic vessel endothelial hyaluronic acid receptor 1 Source.1497: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.1498: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.1499: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase Source.1500: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5 Source.1501: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.1502: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.1503: DFBPPR18400 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1504: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1505: DFBPPR18425 ---- Animal proteins ---- Histone H2A type 2-C Source.1506: DFBPPR18433 ---- Animal proteins ---- Basigin Source.1507: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H Source.1508: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12 Source.1509: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.1510: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2 Source.1511: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.1512: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.1513: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.1514: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1 Source.1515: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.1516: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.1517: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.1518: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.1519: DFBPPR18563 ---- Animal proteins ---- Collectin-43 Source.1520: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1521: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.1522: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1523: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6 Source.1524: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor Source.1525: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.1526: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4 Source.1527: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.1528: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1529: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1530: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3 Source.1531: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.1532: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type Source.1533: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.1534: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.1535: DFBPPR18698 ---- Animal proteins ---- ATPase GET3 Source.1536: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.1537: DFBPPR18713 ---- Animal proteins ---- Arginase-1 Source.1538: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.1539: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1540: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.1541: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.1542: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1543: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.1544: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3 Source.1545: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.1546: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E Source.1547: DFBPPR18778 ---- Animal proteins ---- Erlin-2 Source.1548: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C Source.1549: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.1550: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2 Source.1551: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.1552: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.1553: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.1554: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type Source.1555: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.1556: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1557: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.1558: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.1559: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1560: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1 Source.1561: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1562: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.1563: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.1564: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.1565: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.1566: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.1567: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.1568: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.1569: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1570: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.1571: DFBPPR18942 ---- Animal proteins ---- Four and a half LIM domains protein 2 Source.1572: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1573: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.1574: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7 Source.1575: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.1576: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.1577: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.1578: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.1579: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1 Source.1580: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.1581: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.1582: DFBPPR19003 ---- Animal proteins ---- Protein lin-7 homolog A Source.1583: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.1584: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19 Source.1585: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.1586: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1587: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1588: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.1589: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic Source.1590: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1591: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1592: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta Source.1593: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.1594: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha Source.1595: DFBPPR19080 ---- Animal proteins ---- Beta-defensin 11 Source.1596: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3 Source.1597: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13 Source.1598: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.1599: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.1600: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.1601: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1 Source.1602: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.1603: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.1604: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein Source.1605: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone Source.1606: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1607: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.1608: DFBPPR19200 ---- Animal proteins ---- Beta-defensin 12 Source.1609: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169 Source.1610: DFBPPR19206 ---- Animal proteins ---- Protein chibby homolog 1 Source.1611: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.1612: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1613: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.1614: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.1615: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.1616: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.1617: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1618: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220 Source.1619: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.1620: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.1621: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.1622: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.1623: DFBPPR19343 ---- Animal proteins ---- Interferon alpha-inducible protein 6 Source.1624: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.1625: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.1626: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5 Source.1627: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.1628: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1629: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.1630: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1 Source.1631: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein Source.1632: DFBPPR19417 ---- Animal proteins ---- L-xylulose reductase Source.1633: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor Source.1634: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.1635: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71 Source.1636: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.1637: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.1638: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2 Source.1639: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1640: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.1641: DFBPPR19484 ---- Animal proteins ---- Protein lin-7 homolog B Source.1642: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.1643: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1644: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.1645: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.1646: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase Source.1647: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.1648: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial Source.1649: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1 Source.1650: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1 Source.1651: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.1652: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.1653: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.1654: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1655: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.1656: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1657: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.1658: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.1659: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.1660: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.1661: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.1662: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1663: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1664: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.1665: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.1666: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.1667: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.1668: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1669: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial Source.1670: DFBPPR19664 ---- Animal proteins ---- Protein OS-9 Source.1671: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.1672: DFBPPR19668 ---- Animal proteins ---- Calicin Source.1673: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1674: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein Source.1675: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.1676: DFBPPR19678 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 5 Source.1677: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.1678: DFBPPR19703 ---- Animal proteins ---- Claudin-10 Source.1679: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17 Source.1680: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1681: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2 Source.1682: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.1683: DFBPPR19737 ---- Animal proteins ---- Proteasome subunit alpha type-5 Source.1684: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein Source.1685: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.1686: DFBPPR19758 ---- Animal proteins ---- MICOS complex subunit MIC25 Source.1687: DFBPPR19759 ---- Animal proteins ---- Histone H2A.J Source.1688: DFBPPR19783 ---- Animal proteins ---- Syndecan-1 Source.1689: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.1690: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1691: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4 Source.1692: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3 Source.1693: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1 Source.1694: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1695: DFBPPR19822 ---- Animal proteins ---- Neuropeptide B Source.1696: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.1697: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.1698: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.1699: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.1700: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial Source.1701: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.1702: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1703: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC Source.1704: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.1705: DFBPPR19869 ---- Animal proteins ---- Beta-defensin 13 Source.1706: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.1707: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.1708: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.1709: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1 Source.1710: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1711: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.1712: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial Source.1713: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1 Source.1714: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78 Source.1715: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.1716: DFBPPR19949 ---- Animal proteins ---- Syndecan-2 Source.1717: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein Source.1718: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.1719: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.1720: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein Source.1721: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.1722: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.1723: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4 Source.1724: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.1725: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.1726: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.1727: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1728: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2 Source.1729: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.1730: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.1731: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.1732: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1733: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.1734: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.1735: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.1736: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1737: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.1738: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1739: DFBPPR20225 ---- Animal proteins ---- Claudin-2 Source.1740: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.1741: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial Source.1742: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3 Source.1743: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A Source.1744: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.1745: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.1746: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2 Source.1747: DFBPPR20296 ---- Animal proteins ---- Claudin-18 Source.1748: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.1749: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B Source.1750: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.1751: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.1752: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1753: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1 Source.1754: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.1755: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1756: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.1757: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4 Source.1758: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1759: DFBPPR20417 ---- Animal proteins ---- Histone H2A.V Source.1760: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog Source.1761: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase Source.1762: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.1763: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1764: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1 Source.1765: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.1766: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.1767: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.1768: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.1769: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog Source.1770: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Source.1771: DFBPPR20566 ---- Animal proteins ---- RecQ-mediated genome instability protein 2 Source.1772: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.1773: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.1774: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1775: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.1776: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase Source.1777: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.1778: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5 Source.1779: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.1780: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial Source.1781: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91 Source.1782: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.1783: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.1784: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.1785: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.1786: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase Source.1787: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6 Source.1788: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33 Source.1789: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.1790: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15 Source.1791: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3 Source.1792: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.1793: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148 Source.1794: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1 Source.1795: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.1796: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.1797: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2 Source.1798: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A Source.1799: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3 Source.1800: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1801: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor Source.1802: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.1803: DFBPPR20913 ---- Animal proteins ---- Somatostatin Source.1804: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.1805: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.1806: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17 Source.1807: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.1808: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1809: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2 Source.1810: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821 Source.1811: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor Source.1812: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.1813: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.1814: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.1815: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.1816: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.1817: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.1818: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.1819: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III Source.1820: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.1821: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B Source.1822: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor Source.1823: DFBPPR21174 ---- Animal proteins ---- Copper transport protein ATOX1 Source.1824: DFBPPR21177 ---- Animal proteins ---- Ran guanine nucleotide release factor Source.1825: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24 Source.1826: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog Source.1827: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1 Source.1828: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1 Source.1829: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.1830: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2 Source.1831: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.1832: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial Source.1833: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6 Source.1834: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.1835: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial Source.1836: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.1837: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115 Source.1838: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1839: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.1840: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.1841: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.1842: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4 Source.1843: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.1844: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.1845: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.1846: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.1847: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.1848: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2 Source.1849: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A Source.1850: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.1851: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.1852: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1 Source.1853: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3 Source.1854: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1 Source.1855: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.1856: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.1857: DFBPPR21535 ---- Animal proteins ---- Gastrotropin Source.1858: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.1859: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1 Source.1860: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.1861: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial Source.1862: DFBPPR21668 ---- Animal proteins ---- Putative deoxyribonuclease TATDN1 Source.1863: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2 Source.1864: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.1865: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.1866: DFBPPR21717 ---- Animal proteins ---- Transmembrane protein 134 Source.1867: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.1868: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.1869: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.1870: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1 Source.1871: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1872: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.1873: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3 Source.1874: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B Source.1875: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A Source.1876: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3 Source.1877: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B Source.1878: DFBPPR21869 ---- Animal proteins ---- Centromere protein O Source.1879: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor Source.1880: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.1881: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2 Source.1882: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2 Source.1883: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2 Source.1884: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB Source.1885: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.1886: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.1887: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.1888: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.1889: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1890: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1 Source.1891: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81 Source.1892: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12 Source.1893: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.1894: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1 Source.1895: DFBPPR22033 ---- Animal proteins ---- FXYD domain-containing ion transport regulator 7 Source.1896: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.1897: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.1898: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.1899: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.1900: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.1901: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog Source.1902: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1 Source.1903: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.1904: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B Source.1905: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2 Source.1906: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.1907: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2 Source.1908: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein Source.1909: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1910: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5 Source.1911: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17 Source.1912: DFBPPR22286 ---- Animal proteins ---- Oxidoreductase NAD-binding domain-containing protein 1 Source.1913: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B Source.1914: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31 Source.1915: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.1916: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1 Source.1917: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.1918: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.1919: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog Source.1920: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.1921: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.1922: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein Source.1923: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.1924: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46 Source.1925: DFBPPR22427 ---- Animal proteins ---- Coiled-coil domain-containing protein 58 Source.1926: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.1927: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog Source.1928: DFBPPR22436 ---- Animal proteins ---- Transmembrane protein 263 Source.1929: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.1930: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.1931: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog Source.1932: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.1933: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1 Source.1934: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog Source.1935: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog Source.1936: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog Source.1937: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125 Source.1938: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.1939: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164 Source.1940: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253 Source.1941: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B Source.1942: DFBPPR22639 ---- Animal proteins ---- UPF0235 protein C15orf40 homolog Source.1943: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog Source.1944: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.1945: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.1946: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog Source.1947: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1 Source.1948: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog Source.1949: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog Source.1950: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog Source.1951: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.1952: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1953: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.1954: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.1955: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.1956: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1957: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.1958: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.1959: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.1960: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.1961: DFBPPR8588 ---- Animal proteins ---- Leptin Source.1962: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.1963: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.1964: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1965: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1966: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.1967: DFBPPR8666 ---- Animal proteins ---- Histone H3.3 Source.1968: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.1969: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1970: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.1971: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor Source.1972: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1973: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1974: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1975: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.1976: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.1977: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.1978: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase Source.1979: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.1980: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.1981: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.1982: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.1983: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1984: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1985: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.1986: DFBPPR8793 ---- Animal proteins ---- Histone H4 Source.1987: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1988: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1989: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.1990: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.1991: DFBPPR8851 ---- Animal proteins ---- Vimentin Source.1992: DFBPPR8852 ---- Animal proteins ---- Vimentin Source.1993: DFBPPR8854 ---- Animal proteins ---- Vimentin Source.1994: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1995: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein Source.1996: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.1997: DFBPPR8897 ---- Animal proteins ---- Cytochrome b Source.1998: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.1999: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.2000: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.2001: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1 Source.2002: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.2003: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.2004: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.2005: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1 Source.2006: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.2007: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.2008: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.2009: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.2010: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3 Source.2011: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.2012: DFBPPR9065 ---- Animal proteins ---- GTPase NRas Source.2013: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.2014: DFBPPR9069 ---- Animal proteins ---- E-selectin Source.2015: DFBPPR9089 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2016: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.2017: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.2018: DFBPPR9098 ---- Animal proteins ---- Gastrotropin Source.2019: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.2020: DFBPPR9108 ---- Animal proteins ---- Somatostatin Source.2021: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2022: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.2023: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2024: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.2025: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.2026: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.2027: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2 Source.2028: DFBPPR9194 ---- Animal proteins ---- Arginase-1 Source.2029: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.2030: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.2031: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.2032: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2033: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.2034: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2035: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1 Source.2036: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C Source.2037: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2 Source.2038: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.2039: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.2040: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.2041: DFBPPR9254 ---- Animal proteins ---- Complement factor D Source.2042: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.2043: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.2044: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.2045: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.2046: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.2047: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.2048: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2049: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2050: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2051: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.2052: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.2053: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.2054: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.2055: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2056: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.2057: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.2058: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.2059: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type Source.2060: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.2061: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.2062: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3 Source.2063: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2064: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.2065: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.2066: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.2067: DFBPPR9532 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.2068: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.2069: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.2070: DFBPPR9598 ---- Animal proteins ---- Spermatid nuclear transition protein 4 Source.2071: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.2072: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2073: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.2074: DFBPPR9641 ---- Animal proteins ---- 60S ribosomal protein L22 Source.2075: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.2076: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1 Source.2077: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.2078: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2079: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.2080: DFBPPR9707 ---- Animal proteins ---- Interleukin-7 Source.2081: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2082: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.2083: DFBPPR9749 ---- Animal proteins ---- Guanylin Source.2084: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.2085: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.2086: DFBPPR9780 ---- Animal proteins ---- Small ubiquitin-related modifier 4 Source.2087: DFBPPR9784 ---- Animal proteins ---- Translocator protein Source.2088: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8 Source.2089: DFBPPR9830 ---- Animal proteins ---- Fibrinogen alpha chain Source.2090: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.2091: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.2092: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.2093: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A Source.2094: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2095: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17 Source.2096: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.2097: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31 Source.2098: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin Source.2099: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2100: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.2101: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.2102: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127 Source.2103: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.2104: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.2105: DFBPPR9960 ---- Animal proteins ---- Histone H3.2 Source.2106: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2107: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.2108: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.2109: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.2110: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type Source.2111: DFBPPR10005 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2112: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.2113: DFBPPR10044 ---- Animal proteins ---- Histone H4 Source.2114: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.2115: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.2116: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.2117: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.2118: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2119: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.2120: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.2121: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.2122: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2123: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.2124: DFBPPR10097 ---- Animal proteins ---- Ras-related protein Rab-10 Source.2125: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.2126: DFBPPR10130 ---- Animal proteins ---- Histone H3.3 Source.2127: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2128: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.2129: DFBPPR10139 ---- Animal proteins ---- Cytochrome b Source.2130: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.2131: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.2132: DFBPPR10157 ---- Animal proteins ---- CD40 ligand Source.2133: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.2134: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.2135: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.2136: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.2137: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk Source.2138: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.2139: DFBPPR10218 ---- Animal proteins ---- Occludin Source.2140: DFBPPR10226 ---- Animal proteins ---- GTPase HRas Source.2141: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1 Source.2142: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1 Source.2143: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.2144: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2145: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.2146: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2 Source.2147: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.2148: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.2149: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.2150: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.2151: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor Source.2152: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.2153: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2154: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.2155: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.2156: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.2157: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2158: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2159: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2160: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.2161: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2162: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.2163: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.2164: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2165: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.2166: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1 Source.2167: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.2168: DFBPPR10459 ---- Animal proteins ---- Reelin Source.2169: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.2170: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.2171: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.2172: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.2173: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.2174: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.2175: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.2176: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon Source.2177: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3 Source.2178: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.2179: DFBPPR10514 ---- Animal proteins ---- Histone H2A.V Source.2180: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2 Source.2181: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.2182: DFBPPR10517 ---- Animal proteins ---- Histone H2A-IV Source.2183: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.2184: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2185: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.2186: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type Source.2187: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2188: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.2189: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.2190: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.2191: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2192: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin Source.2193: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2194: DFBPPR10605 ---- Animal proteins ---- Elastin Source.2195: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.2196: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.2197: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2198: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.2199: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2200: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.2201: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53 Source.2202: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5 Source.2203: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.2204: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.2205: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.2206: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.2207: DFBPPR10683 ---- Animal proteins ---- Histone H4 type VIII Source.2208: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.2209: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.2210: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.2211: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2212: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein Source.2213: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.2214: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.2215: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.2216: DFBPPR10760 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.2217: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.2218: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.2219: DFBPPR10780 ---- Animal proteins ---- Caspase-2 Source.2220: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.2221: DFBPPR10793 ---- Animal proteins ---- Histone H2A-III Source.2222: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.2223: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.2224: DFBPPR10828 ---- Animal proteins ---- Histone H2A.Z Source.2225: DFBPPR10837 ---- Animal proteins ---- GTPase NRas Source.2226: DFBPPR10838 ---- Animal proteins ---- Protein lin-28 homolog A Source.2227: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.2228: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.2229: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.2230: DFBPPR10886 ---- Animal proteins ---- Histone H2A.J Source.2231: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.2232: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2 Source.2233: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.2234: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2 Source.2235: DFBPPR10970 ---- Animal proteins ---- Prohibitin Source.2236: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.2237: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.2238: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.2239: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.2240: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.2241: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.2242: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.2243: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.2244: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.2245: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.2246: DFBPPR11057 ---- Animal proteins ---- Calcitonin gene-related peptide Source.2247: DFBPPR11060 ---- Animal proteins ---- Netrin-3 Source.2248: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.2249: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.2250: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.2251: DFBPPR11092 ---- Animal proteins ---- Ataxin-3 Source.2252: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.2253: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.2254: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.2255: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b Source.2256: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.2257: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.2258: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.2259: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1 Source.2260: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.2261: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.2262: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.2263: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.2264: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1 Source.2265: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.2266: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.2267: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.2268: DFBPPR11237 ---- Animal proteins ---- Fibroblast growth factor 3 Source.2269: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3 Source.2270: DFBPPR11248 ---- Animal proteins ---- Myelin protein P0 Source.2271: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.2272: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B Source.2273: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.2274: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2 Source.2275: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.2276: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.2277: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.2278: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2 Source.2279: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.2280: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.2281: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.2282: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.2283: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2284: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.2285: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.2286: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.2287: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.2288: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.2289: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.2290: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.2291: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.2292: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.2293: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.2294: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2 Source.2295: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC Source.2296: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.2297: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein Source.2298: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.2299: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.2300: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.2301: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.2302: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.2303: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.2304: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.2305: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.2306: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2307: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.2308: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.2309: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.2310: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2311: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.2312: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.2313: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4 Source.2314: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.2315: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.2316: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.2317: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2318: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.2319: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.2320: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.2321: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.2322: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.2323: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3 Source.2324: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.2325: DFBPPR11874 ---- Animal proteins ---- Serum response factor Source.2326: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.2327: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.2328: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.2329: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.2330: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.2331: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.2332: DFBPPR11962 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.2333: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.2334: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.2335: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal Source.2336: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.2337: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.2338: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.2339: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.2340: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.2341: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.2342: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.2343: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.2344: DFBPPR12103 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.2345: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2346: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.2347: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial Source.2348: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.2349: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.2350: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2351: DFBPPR12158 ---- Animal proteins ---- Protein CDV3 homolog Source.2352: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1 Source.2353: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.2354: DFBPPR12197 ---- Animal proteins ---- Transmembrane protein 263 Source.2355: DFBPPR12209 ---- Animal proteins ---- 60S ribosomal protein L22 Source.2356: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.2357: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.2358: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.2359: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10 Source.2360: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.2361: DFBPPR12245 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog Source.2362: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A Source.2363: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.2364: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor Source.2365: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.2366: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.2367: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2368: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2369: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.2370: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.2371: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.2372: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2373: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.2374: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.2375: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.2376: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.2377: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.2378: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.2379: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.2380: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.2381: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2382: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.2383: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2384: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Source.2385: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.2386: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2387: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.2388: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.2389: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2390: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.2391: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.2392: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2393: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.2394: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.2395: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.2396: DFBPPR12532 ---- Animal proteins ---- Amyloid-beta A4 protein Source.2397: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.2398: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2399: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.2400: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.2401: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.2402: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type Source.2403: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.2404: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1 Source.2405: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.2406: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2407: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase Source.2408: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.2409: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2410: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2411: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2412: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2413: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.2414: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.2415: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.2416: DFBPPR12728 ---- Animal proteins ---- Cytochrome b Source.2417: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2418: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2419: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.2420: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.2421: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.2422: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.2423: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.2424: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.2425: DFBPPR12817 ---- Animal proteins ---- Cathepsin E Source.2426: DFBPPR12821 ---- Animal proteins ---- Gastricsin Source.2427: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2428: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.2429: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.2430: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2431: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2432: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.2433: DFBPPR12857 ---- Animal proteins ---- Arginase-1 Source.2434: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.2435: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein Source.2436: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.2437: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.2438: DFBPPR12924 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.2439: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial Source.2440: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.2441: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.2442: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase Source.2443: DFBPPR12939 ---- Animal proteins ---- Gastrotropin Source.2444: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.2445: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.2446: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein Source.2447: DFBPPR12974 ---- Animal proteins ---- Serum amyloid A-3 protein Source.2448: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.2449: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.2450: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2451: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.2452: DFBPPR13055 ---- Animal proteins ---- Serum amyloid A-2 protein Source.2453: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5 Source.2454: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2455: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2456: DFBPPR13156 ---- Animal proteins ---- Leptin Source.2457: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor Source.2458: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2459: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.2460: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.2461: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.2462: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.2463: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2464: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.2465: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta Source.2466: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.2467: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2468: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2 Source.2469: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2470: DFBPPR13297 ---- Animal proteins ---- Plasminogen Source.2471: DFBPPR13305 ---- Animal proteins ---- Cytochrome b Source.2472: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.2473: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.2474: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2475: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.2476: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.2477: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2 Source.2478: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein Source.2479: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2480: DFBPPR13400 ---- Animal proteins ---- Fibrinogen alpha chain Source.2481: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2482: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor Source.2483: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase Source.2484: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.2485: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2486: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.2487: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.2488: DFBPPR13515 ---- Animal proteins ---- Fibrinogen alpha chain Source.2489: DFBPPR13516 ---- Animal proteins ---- Keratin-associated protein 11-1 Source.2490: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.2491: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.2492: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor Source.2493: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.2494: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.2495: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.2496: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2497: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.2498: DFBPPR13602 ---- Animal proteins ---- Acrosin Source.2499: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.2500: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.2501: DFBPPR13635 ---- Animal proteins ---- Amyloid-beta A4 protein Source.2502: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha Source.2503: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2504: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic Source.2505: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2506: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.2507: DFBPPR13686 ---- Animal proteins ---- Vimentin Source.2508: DFBPPR13696 ---- Animal proteins ---- Cathepsin D Source.2509: DFBPPR13708 ---- Animal proteins ---- Renin Source.2510: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.2511: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein Source.2512: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C Source.2513: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor Source.2514: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.2515: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4 Source.2516: DFBPPR13805 ---- Animal proteins ---- Serum amyloid A protein Source.2517: DFBPPR13809 ---- Animal proteins ---- Histone H2A.Z Source.2518: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5 Source.2519: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2520: DFBPPR13876 ---- Animal proteins ---- Follistatin Source.2521: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2522: DFBPPR13888 ---- Animal proteins ---- Calcitonin gene-related peptide Source.2523: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2524: DFBPPR13895 ---- Animal proteins ---- Elastin Source.2525: DFBPPR13896 ---- Animal proteins ---- Somatostatin Source.2526: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.2527: DFBPPR13922 ---- Animal proteins ---- Fibrinogen alpha chain Source.2528: DFBPPR13938 ---- Animal proteins ---- Copper transport protein ATOX1 Source.2529: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2530: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.2531: DFBPPR14002 ---- Animal proteins ---- Cytochrome b Source.2532: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.2533: DFBPPR14007 ---- Animal proteins ---- Cystatin Source.2534: DFBPPR14010 ---- Animal proteins ---- GTPase KRas Source.2535: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b Source.2536: DFBPPR14030 ---- Animal proteins ---- Prepro-urotensin II-gamma Source.2537: DFBPPR14031 ---- Animal proteins ---- Prepro-urotensin II-alpha Source.2538: DFBPPR14038 ---- Animal proteins ---- UI Source.2539: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B Source.2540: DFBPPR14046 ---- Animal proteins ---- Myoglobin Source.2541: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha Source.2542: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.2543: DFBPPR14100 ---- Marine protein ---- Cytochrome b Source.2544: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.2545: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9 Source.2546: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146 Source.2547: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A Source.2548: DFBPPR14112 ---- Marine protein ---- Proteasome subunit beta type-6-A like protein Source.2549: DFBPPR14114 ---- Marine protein ---- Proteasome subunit beta type-6-B like protein Source.2550: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.2551: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3 Source.2552: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.2553: DFBPPR14173 ---- Marine protein ---- Homeobox protein Hox-A5 Source.2554: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.2555: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor Source.2556: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.2557: DFBPPR14241 ---- Marine protein ---- Cystatin Source.2558: DFBPPR14242 ---- Marine protein ---- Cytochrome b Source.2559: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.2560: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2561: DFBPPR14315 ---- Marine protein ---- Protein CfxQ homolog Source.2562: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2563: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein Source.2564: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.2565: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.2566: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.2567: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.2568: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.2569: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.2570: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2571: DFBPPR14373 ---- Marine protein ---- Cytochrome b6 Source.2572: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.2573: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.2574: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.2575: DFBPPR14400 ---- Marine protein ---- Heme oxygenase Source.2576: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic Source.2577: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.2578: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.2579: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1 Source.2580: DFBPPR14476 ---- Marine protein ---- Protein CfxQ homolog Source.2581: DFBPPR14537 ---- Marine protein ---- Histone H2A Source.2582: DFBPPR14551 ---- Marine protein ---- Histone H4 Source.2583: DFBPPR14560 ---- Marine protein ---- Histone H3.2 Source.2584: DFBPPR14590 ---- Marine protein ---- Cytochrome b Source.2585: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2586: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9 Source.2587: DFBPPR14608 ---- Marine protein ---- Polysialoglycoprotein Source.2588: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.2589: DFBPPR14613 ---- Marine protein ---- Histone H2A.Z Source.2590: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.2591: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.2592: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.2593: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.2594: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.2595: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3 Source.2596: DFBPPR14698 ---- Marine protein ---- Cystatin Source.2597: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.2598: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A Source.2599: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1 Source.2600: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.2601: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.2602: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2603: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.2604: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.2605: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.2606: DFBPPR14861 ---- Marine protein ---- Cytochrome b Source.2607: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.2608: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.2609: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.2610: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.2611: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.2612: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit Source.2613: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.2614: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.2615: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4 Source.2616: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3 Source.2617: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.2618: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2619: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.2620: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.2621: DFBPPR14929 ---- Microorganism protein ---- Histone H2A Source.2622: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.2623: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.2624: DFBPPR14944 ---- Microorganism protein ---- Histone H3 Source.2625: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma Source.2626: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.2627: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.2628: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.2629: DFBPPR14978 ---- Microorganism protein ---- Histone H2A.Z Source.2630: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase Source.2631: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.2632: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2633: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.2634: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.2635: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.2636: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.2637: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.2638: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.2639: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.2640: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.2641: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.2642: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1 Source.2643: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2 Source.2644: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.2645: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.2646: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.2647: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.2648: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.2649: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35 Source.2650: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.2651: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.2652: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.2653: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.2654: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60 Source.2655: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.2656: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.2657: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone Source.2658: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase Source.2659: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.2660: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.2661: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3 Source.2662: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3 Source.2663: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1 Source.2664: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.2665: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.2666: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.2667: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22 Source.2668: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial Source.2669: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.2670: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.2671: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.2672: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5 Source.2673: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25 Source.2674: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2675: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.2676: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.2677: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.2678: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5 Source.2679: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.2680: DFBPPR15668 ---- Microorganism protein ---- 40S ribosomal protein S28 Source.2681: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.2682: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.2683: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.2684: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.2685: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1 Source.2686: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase Source.2687: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR Source.2688: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.2689: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.2690: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.2691: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.2692: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.2693: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase Source.2694: DFBPPR15850 ---- Microorganism protein ---- Histone H2A Source.2695: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.2696: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.2697: DFBPPR15859 ---- Microorganism protein ---- Histone H4 Source.2698: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein Source.2699: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.2700: DFBPPR15889 ---- Marine protein ---- Ferredoxin Source.2701: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1 Source.2702: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.2703: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.2704: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.2705: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.2706: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.2707: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic Source.2708: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic Source.2709: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2710: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.2711: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2712: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.2713: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2714: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.2715: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3 Source.2716: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1 Source.2717: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1 Source.2718: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1 Source.2719: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2 Source.2720: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.2721: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.2722: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.2723: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic Source.2724: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.2725: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1 Source.2726: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.2727: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.2728: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.2729: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.2730: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.2731: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.2732: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2733: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.2734: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.2735: DFBPPR8095 ---- Plant protein ---- Profilin-1 Source.2736: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2737: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2738: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2739: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1 Source.2740: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.2741: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.2742: DFBPPR8149 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic Source.2743: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.2744: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.2745: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.2746: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.2747: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2748: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2749: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.2750: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.2751: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2752: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3 Source.2753: DFBPPR8323 ---- Plant protein ---- Cytochrome P450 Source.2754: DFBPPR8327 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic Source.2755: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Other bioactive activity	The ability to inhibit the activity of 3-hydroxy-3-methyl-glutaryl-CoA reductase (HMG-CoA reductase, EC 1.1.1.34) was determined, and researchers found that the sequence GGV significantly inhibited this enzyme, suggesting a possible hypocholesterolemic effect.
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 107).
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

NCC(=O)NCC(=O)N[C@@]([H])(C(C)C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	The amaranth protein isolate was hydrolyzed with a multi-enzyme system consisting of trypsin (5.16 mg), α-chymotrypsin (13.76 mg) and peptidase (1.28 mg).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

3-hydroxy-3-methyl-glutaryl-CoA reductase (HMG-CoA reductase) is a key enzyme in cholesterol biosynthesis.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Soares RA, Mendonça S, de Castro LÍ, Menezes AC, Arêas JA. Major peptides from amaranth (Amaranthus cruentus) protein inhibit HMG-CoA reductase activity. Int J Mol Sci. 2015 Feb 16;16(2):4150-60. PMID: 25690031 DOI: 10.3390/ijms16024150
Other literature(s)	N.D
PubDate	2015