Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPINPE0013(Other bio-peptides)

DFBP ID	DFBPINPE0013
Peptide sequence	IVG
Type	Native peptide
Peptide/Function name	HMG-CoA reductase inhibitor

Function-activity relationship

Main bioactivity	Inhibitor activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ile-Val-Gly

Single-letter amino acid

IVG

Peptide length

Peptide mass

Experimental mass	Theoretical mass
288 Da	287.36 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

2.7667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Plant
Organism/Source	Amaranth (Amaranthus cruentus)
Precursor protein	Amaranth protein
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.3: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.4: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.5: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A Source.6: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.7: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.8: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.9: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.10: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.11: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.12: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.13: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.14: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1 Source.15: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.16: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.17: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.18: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.19: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.20: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.21: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.22: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.23: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.24: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.25: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.26: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.27: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.28: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.29: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.30: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.31: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.32: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1 Source.33: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.34: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.35: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.36: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.37: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.38: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4 Source.39: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.40: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.41: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.42: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.43: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.44: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.45: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.46: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.47: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.48: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.49: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.50: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.51: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.52: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.53: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.54: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.55: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.56: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.57: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17 Source.58: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.59: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.60: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.61: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.62: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.63: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.64: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.65: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.66: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.67: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6 Source.68: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.69: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.70: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.71: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.72: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.73: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.74: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.75: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.76: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.77: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.78: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.79: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.80: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5 Source.81: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.82: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.83: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.84: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.85: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.86: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.87: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.88: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.89: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.90: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.91: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.92: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.93: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.94: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.95: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.96: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.97: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.98: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.99: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.100: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.101: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.102: DFBPPR1641 ---- Plant proteins ---- Enolase Source.103: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.104: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.105: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.106: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.107: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.108: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.109: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.110: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.111: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.112: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.113: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.114: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.115: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.116: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.117: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.118: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.119: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2 Source.120: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.121: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.122: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.123: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.124: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.125: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.126: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.127: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.128: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.129: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B Source.130: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.131: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.132: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.133: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.134: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.135: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.136: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A Source.137: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.138: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.139: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.140: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.141: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.142: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.143: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.144: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.145: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.146: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.147: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.148: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.149: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.150: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.151: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.152: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.153: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.154: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.155: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.156: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.157: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.158: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.159: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.160: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4 Source.161: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.162: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.163: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.164: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.165: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.166: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.167: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.168: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.169: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.170: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.171: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.172: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1 Source.173: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.174: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.175: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.176: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.177: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.178: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.179: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.180: DFBPPR2223 ---- Plant proteins ---- Urease Source.181: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.182: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.183: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.184: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.185: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.186: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.187: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.188: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.189: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.190: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.191: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.192: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.193: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.194: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.195: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.196: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c Source.197: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.198: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase Source.199: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.200: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic Source.201: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.202: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.203: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.204: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.205: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.206: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.207: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.208: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.209: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.210: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.211: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase Source.212: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.213: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.214: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9 Source.215: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.216: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic Source.217: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6 Source.218: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.219: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.220: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.221: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2 Source.222: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.223: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2 Source.224: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.225: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.226: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5 Source.227: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.228: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.229: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.230: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9 Source.231: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.232: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.233: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.234: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.235: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.236: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5 Source.237: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.238: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.239: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.240: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.241: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.242: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.243: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.244: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.245: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.246: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.247: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.248: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.249: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.250: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.251: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.252: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.253: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.254: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.255: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.256: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.257: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1 Source.258: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.259: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.260: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.261: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.262: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.263: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic Source.264: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.265: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.266: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.267: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.268: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.269: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.270: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.271: DFBPPR2987 ---- Plant proteins ---- 1-Cys peroxiredoxin B Source.272: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.273: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.274: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.275: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.276: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.277: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.278: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.279: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.280: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.281: DFBPPR3063 ---- Plant proteins ---- Profilin-A Source.282: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.283: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.284: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.285: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1 Source.286: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.287: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.288: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.289: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.290: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.291: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.292: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.293: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.294: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.295: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.296: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.297: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.298: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.299: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.300: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.301: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.302: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.303: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4 Source.304: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial Source.305: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.306: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.307: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.308: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS Source.309: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.310: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.311: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.312: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.313: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.314: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a Source.315: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3 Source.316: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1 Source.317: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial Source.318: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.319: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.320: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4 Source.321: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.322: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.323: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.324: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.325: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.326: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.327: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.328: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.329: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.330: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.331: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.332: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.333: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.334: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1 Source.335: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.336: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.337: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.338: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.339: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.340: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.341: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.342: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.343: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.344: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10 Source.345: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2 Source.346: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.347: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.348: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8 Source.349: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.350: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.351: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.352: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.353: DFBPPR3582 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7c Source.354: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.355: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.356: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.357: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b Source.358: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.359: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.360: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.361: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.362: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2 Source.363: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e Source.364: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a Source.365: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.366: DFBPPR3654 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7a Source.367: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.368: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3 Source.369: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.370: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41 Source.371: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.372: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d Source.373: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.374: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.375: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.376: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30 Source.377: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51 Source.378: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.379: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7 Source.380: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B Source.381: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein Source.382: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog Source.383: DFBPPR3826 ---- Plant proteins ---- Profilin LP04 Source.384: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.385: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.386: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8 Source.387: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.388: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.389: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.390: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.391: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.392: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.393: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.394: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.395: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b Source.396: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.397: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.398: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic Source.399: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.400: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2 Source.401: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2 Source.402: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.403: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1 Source.404: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.405: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.406: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.407: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.408: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.409: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.410: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.411: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75 Source.412: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.413: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.414: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.415: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.416: DFBPPR4199 ---- Plant proteins ---- Protein transport protein Sec61 subunit gamma Source.417: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.418: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.419: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.420: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.421: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.422: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.423: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2 Source.424: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.425: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.426: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.427: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1 Source.428: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.429: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.430: DFBPPR4364 ---- Plant proteins ---- Two-component response regulator ORR42 Source.431: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.432: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.433: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1 Source.434: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.435: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.436: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.437: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.438: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.439: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.440: DFBPPR4422 ---- Plant proteins ---- Thioredoxin-like protein CXXS1 Source.441: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.442: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.443: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.444: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.445: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.446: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2 Source.447: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.448: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.449: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.450: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15 Source.451: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.452: DFBPPR4599 ---- Plant proteins ---- 60S ribosomal protein L37a-1 Source.453: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.454: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.455: DFBPPR4612 ---- Plant proteins ---- 60S ribosomal protein L37a-2 Source.456: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.457: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.458: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.459: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.460: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.461: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.462: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.463: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.464: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.465: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800 Source.466: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42 Source.467: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10 Source.468: DFBPPR4898 ---- Plant proteins ---- Serine racemase Source.469: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.470: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.471: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.472: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.473: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.474: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1 Source.475: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.476: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.477: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.478: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.479: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.480: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase Source.481: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.482: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.483: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.484: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.485: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.486: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.487: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein Source.488: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.489: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.490: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.491: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.492: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.493: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.494: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.495: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.496: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.497: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.498: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.499: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.500: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.501: DFBPPR5185 ---- Plant proteins ---- Actin-1 Source.502: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.503: DFBPPR5196 ---- Plant proteins ---- Arginase Source.504: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.505: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.506: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.507: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.508: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.509: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.510: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.511: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.512: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic Source.513: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein Source.514: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.515: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.516: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.517: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.518: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.519: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.520: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.521: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.522: DFBPPR5385 ---- Plant proteins ---- Profilin-5 Source.523: DFBPPR5401 ---- Plant proteins ---- Profilin-1 Source.524: DFBPPR5407 ---- Plant proteins ---- Profilin-2 Source.525: DFBPPR5410 ---- Plant proteins ---- Profilin-4 Source.526: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.527: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.528: DFBPPR5417 ---- Plant proteins ---- Profilin-3 Source.529: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1 Source.530: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.531: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.532: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.533: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.534: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.535: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.536: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.537: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.538: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.539: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.540: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.541: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1 Source.542: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.543: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.544: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic Source.545: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1 Source.546: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic Source.547: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.548: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.549: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2 Source.550: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.551: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.552: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.553: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.554: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.555: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.556: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.557: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.558: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.559: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.560: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.561: DFBPPR5689 ---- Plant proteins ---- Profilin-9 Source.562: DFBPPR5690 ---- Plant proteins ---- Profilin-7 Source.563: DFBPPR5691 ---- Plant proteins ---- Profilin-10 Source.564: DFBPPR5692 ---- Plant proteins ---- Profilin-6 Source.565: DFBPPR5693 ---- Plant proteins ---- Profilin-11 Source.566: DFBPPR5694 ---- Plant proteins ---- Profilin-8 Source.567: DFBPPR5697 ---- Plant proteins ---- Profilin-12 Source.568: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.569: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.570: DFBPPR5722 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.571: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.572: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3 Source.573: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.574: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.575: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.576: DFBPPR5772 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.577: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.578: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.579: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.580: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a Source.581: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.582: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.583: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic Source.584: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2 Source.585: DFBPPR5841 ---- Plant proteins ---- Actin-1 Source.586: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.587: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4 Source.588: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.589: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16 Source.590: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.591: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic Source.592: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.593: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.594: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic Source.595: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2 Source.596: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.597: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2 Source.598: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.599: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.600: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.601: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.602: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.603: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.604: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.605: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.606: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.607: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.608: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1 Source.609: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.610: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.611: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.612: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.613: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49 Source.614: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.615: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.616: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.617: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.618: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.619: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.620: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.621: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.622: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.623: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.624: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.625: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.626: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.627: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.628: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4 Source.629: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3 Source.630: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.631: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.632: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.633: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.634: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.635: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.636: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.637: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.638: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.639: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.640: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.641: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.642: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.643: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.644: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49 Source.645: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.646: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.647: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.648: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176 Source.649: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.650: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.651: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.652: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.653: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.654: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.655: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.656: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.657: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.658: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.659: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.660: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.661: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.662: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.663: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.664: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.665: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.666: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.667: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.668: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.669: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.670: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.671: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.672: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.673: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.674: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.675: DFBPPR6998 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX1/CMX3 Source.676: DFBPPR7000 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX2 Source.677: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.678: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.679: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.680: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.681: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.682: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.683: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.684: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.685: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.686: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.687: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.688: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.689: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.690: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.691: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.692: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.693: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3 Source.694: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.695: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.696: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.697: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2 Source.698: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2 Source.699: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.700: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24 Source.701: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7 Source.702: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.703: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a Source.704: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.705: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.706: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.707: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2 Source.708: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic Source.709: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.710: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.711: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.712: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25 Source.713: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.714: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.715: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.716: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.717: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.718: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.719: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.720: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.721: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.722: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.723: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.724: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.725: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.726: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.727: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase Source.728: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.729: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.730: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.731: DFBPPR8369 ---- Plant proteins ---- Thioredoxin H-type Source.732: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.733: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase Source.734: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.735: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.736: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.737: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.738: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7 Source.739: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.740: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.741: DFBPPR8512 ---- Milk proteins ---- Lysozyme C, milk isozyme Source.742: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.743: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.744: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.745: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.746: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.747: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.748: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.749: DFBPPR16002 ---- Animal proteins ---- Podoplanin Source.750: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.751: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.752: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.753: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.754: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.755: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.756: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.757: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.758: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.759: DFBPPR16094 ---- Animal proteins ---- Mastin Source.760: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.761: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.762: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.763: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.764: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.765: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule Source.766: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.767: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.768: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.769: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.770: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.771: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.772: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.773: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.774: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.775: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.776: DFBPPR16234 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma Source.777: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.778: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.779: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.780: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.781: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.782: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.783: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.784: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.785: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.786: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.787: DFBPPR16336 ---- Animal proteins ---- Colipase Source.788: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.789: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.790: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5 Source.791: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.792: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.793: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.794: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin Source.795: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin Source.796: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.797: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.798: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.799: DFBPPR16468 ---- Animal proteins ---- Sodium channel subunit beta-2 Source.800: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin Source.801: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor Source.802: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3 Source.803: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.804: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.805: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.806: DFBPPR16595 ---- Animal proteins ---- Annexin A4 Source.807: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.808: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.809: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.810: DFBPPR16691 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.811: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.812: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.813: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.814: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.815: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.816: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.817: DFBPPR16796 ---- Animal proteins ---- Major prion protein Source.818: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.819: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.820: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.821: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.822: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.823: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.824: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.825: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.826: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.827: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin Source.828: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.829: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.830: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.831: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.832: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.833: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.834: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.835: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.836: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.837: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.838: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.839: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.840: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.841: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1 Source.842: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.843: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.844: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.845: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.846: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.847: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.848: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.849: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.850: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2 Source.851: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.852: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.853: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.854: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog Source.855: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.856: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.857: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.858: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.859: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.860: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.861: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.862: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.863: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.864: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.865: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.866: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.867: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.868: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.869: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.870: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.871: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.872: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.873: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.874: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.875: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha Source.876: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.877: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.878: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.879: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)] Source.880: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.881: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.882: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.883: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.884: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b Source.885: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.886: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.887: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.888: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5 Source.889: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.890: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.891: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.892: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.893: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.894: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1 Source.895: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial Source.896: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.897: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.898: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.899: DFBPPR17647 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1 Source.900: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.901: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.902: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10 Source.903: DFBPPR17763 ---- Animal proteins ---- Dynein light chain 1, cytoplasmic Source.904: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.905: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.906: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.907: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.908: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.909: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60 Source.910: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.911: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.912: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.913: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.914: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.915: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.916: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.917: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.918: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P Source.919: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.920: DFBPPR17970 ---- Animal proteins ---- Profilin-2 Source.921: DFBPPR17978 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.922: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.923: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.924: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.925: DFBPPR18031 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 2 Source.926: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.927: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor Source.928: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.929: DFBPPR18091 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.930: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.931: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.932: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.933: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.934: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.935: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase Source.936: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.937: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain Source.938: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.939: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin Source.940: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.941: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5 Source.942: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.943: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.944: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.945: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4 Source.946: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.947: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3 Source.948: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.949: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.950: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.951: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.952: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.953: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.954: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.955: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.956: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.957: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.958: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.959: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.960: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.961: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1 Source.962: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.963: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.964: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.965: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.966: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.967: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.968: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.969: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.970: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.971: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.972: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.973: DFBPPR18519 ---- Animal proteins ---- Ras-related protein Rab-21 Source.974: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.975: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.976: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.977: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF Source.978: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.979: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.980: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.981: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.982: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.983: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.984: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.985: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.986: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.987: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.988: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.989: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.990: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.991: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.992: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.993: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.994: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.995: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.996: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.997: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.998: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.999: DFBPPR18920 ---- Animal proteins ---- Profilin-1 Source.1000: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b Source.1001: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.1002: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1003: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.1004: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein Source.1005: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.1006: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.1007: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.1008: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.1009: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.1010: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.1011: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2 Source.1012: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.1013: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1014: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.1015: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit Source.1016: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8 Source.1017: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1018: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.1019: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17 Source.1020: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1021: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.1022: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.1023: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.1024: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.1025: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.1026: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3 Source.1027: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.1028: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.1029: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1030: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.1031: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit Source.1032: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.1033: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1034: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.1035: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.1036: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.1037: DFBPPR19312 ---- Animal proteins ---- Copine-1 Source.1038: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.1039: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4 Source.1040: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.1041: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.1042: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.1043: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.1044: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.1045: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific Source.1046: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1 Source.1047: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein Source.1048: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.1049: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1050: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.1051: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.1052: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1053: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5 Source.1054: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1055: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.1056: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1057: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.1058: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1 Source.1059: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1060: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.1061: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1062: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1063: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.1064: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.1065: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.1066: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1067: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.1068: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2 Source.1069: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1070: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1071: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.1072: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3 Source.1073: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.1074: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.1075: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1076: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A Source.1077: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.1078: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.1079: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.1080: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.1081: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.1082: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1083: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.1084: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.1085: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3 Source.1086: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.1087: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.1088: DFBPPR20013 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma Source.1089: DFBPPR20022 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.1090: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4 Source.1091: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1092: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1093: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.1094: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.1095: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.1096: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.1097: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.1098: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1099: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.1100: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1101: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2 Source.1102: DFBPPR20231 ---- Animal proteins ---- Dynein light chain 2, cytoplasmic Source.1103: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53 Source.1104: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.1105: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3 Source.1106: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.1107: DFBPPR20296 ---- Animal proteins ---- Claudin-18 Source.1108: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B Source.1109: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.1110: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.1111: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.1112: DFBPPR20374 ---- Animal proteins ---- 5'-deoxynucleotidase HDDC2 Source.1113: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1114: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1115: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.1116: DFBPPR20401 ---- Animal proteins ---- Bystin Source.1117: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.1118: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.1119: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.1120: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7 Source.1121: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.1122: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8 Source.1123: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.1124: DFBPPR20518 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5 Source.1125: DFBPPR20522 ---- Animal proteins ---- Serine palmitoyltransferase small subunit A Source.1126: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36 Source.1127: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.1128: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1129: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.1130: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1 Source.1131: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74 Source.1132: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.1133: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.1134: DFBPPR20657 ---- Animal proteins ---- Anaphase-promoting complex subunit CDC26 Source.1135: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B Source.1136: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial Source.1137: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12 Source.1138: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.1139: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.1140: DFBPPR20772 ---- Animal proteins ---- Ragulator complex protein LAMTOR5 Source.1141: DFBPPR20775 ---- Animal proteins ---- Colipase Source.1142: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.1143: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1144: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148 Source.1145: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3 Source.1146: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.1147: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.1148: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.1149: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1150: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.1151: DFBPPR20955 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm5 Source.1152: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.1153: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1154: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A Source.1155: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B Source.1156: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.1157: DFBPPR21048 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma Source.1158: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.1159: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1 Source.1160: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22 Source.1161: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.1162: DFBPPR21117 ---- Animal proteins ---- Spindlin-2 Source.1163: DFBPPR21123 ---- Animal proteins ---- 39S ribosomal protein L14, mitochondrial Source.1164: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.1165: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.1166: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3 Source.1167: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22 Source.1168: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.1169: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A Source.1170: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.1171: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog Source.1172: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.1173: DFBPPR21293 ---- Animal proteins ---- IST1 homolog Source.1174: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.1175: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4 Source.1176: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha Source.1177: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1178: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4 Source.1179: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.1180: DFBPPR21424 ---- Animal proteins ---- Chromosome transmission fidelity protein 8 homolog Source.1181: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2 Source.1182: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1183: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.1184: DFBPPR21513 ---- Animal proteins ---- Profilin-3 Source.1185: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor Source.1186: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.1187: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.1188: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma Source.1189: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2 Source.1190: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.1191: DFBPPR21627 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 gamma Source.1192: DFBPPR21684 ---- Animal proteins ---- Stannin Source.1193: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.1194: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.1195: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.1196: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2 Source.1197: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.1198: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.1199: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.1200: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.1201: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7 Source.1202: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1 Source.1203: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.1204: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1 Source.1205: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.1206: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog Source.1207: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.1208: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.1209: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.1210: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.1211: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.1212: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3 Source.1213: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37 Source.1214: DFBPPR22061 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial Source.1215: DFBPPR22062 ---- Animal proteins ---- Protein FAM72A Source.1216: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.1217: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.1218: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.1219: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.1220: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.1221: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.1222: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.1223: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.1224: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2 Source.1225: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182 Source.1226: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.1227: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.1228: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.1229: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1230: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.1231: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.1232: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.1233: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.1234: DFBPPR22336 ---- Animal proteins ---- 60S ribosomal protein L37a Source.1235: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.1236: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.1237: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2 Source.1238: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein Source.1239: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.1240: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.1241: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.1242: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.1243: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.1244: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1 Source.1245: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234 Source.1246: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.1247: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1 Source.1248: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36 Source.1249: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.1250: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1251: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.1252: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1253: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.1254: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.1255: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.1256: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.1257: DFBPPR8607 ---- Animal proteins ---- Prolactin Source.1258: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase Source.1259: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.1260: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.1261: DFBPPR8642 ---- Animal proteins ---- Major prion protein Source.1262: DFBPPR8655 ---- Animal proteins ---- Azurocidin Source.1263: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.1264: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.1265: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.1266: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1267: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.1268: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1269: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.1270: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1271: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1272: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1273: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1274: DFBPPR8787 ---- Animal proteins ---- Cathepsin D Source.1275: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1276: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.1277: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.1278: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.1279: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.1280: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.1281: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.1282: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1283: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.1284: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.1285: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.1286: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.1287: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1288: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.1289: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.1290: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.1291: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1292: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1293: DFBPPR9052 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.1294: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.1295: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5 Source.1296: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1297: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1298: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.1299: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1300: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.1301: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1302: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.1303: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.1304: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.1305: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.1306: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1307: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.1308: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.1309: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.1310: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1311: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1312: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.1313: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.1314: DFBPPR9212 ---- Animal proteins ---- Dihydrofolate reductase Source.1315: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII Source.1316: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1317: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.1318: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor Source.1319: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1320: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.1321: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.1322: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4 Source.1323: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.1324: DFBPPR9404 ---- Animal proteins ---- Tryptase Source.1325: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.1326: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.1327: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.1328: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1329: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor Source.1330: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1331: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.1332: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.1333: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain Source.1334: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.1335: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.1336: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1337: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.1338: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.1339: DFBPPR9629 ---- Animal proteins ---- Antibacterial peptide PMAP-36 Source.1340: DFBPPR9657 ---- Animal proteins ---- Ragulator complex protein LAMTOR5 Source.1341: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1342: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.1343: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.1344: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.1345: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1 Source.1346: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.1347: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain Source.1348: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain Source.1349: DFBPPR9741 ---- Animal proteins ---- Syndecan-4 Source.1350: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.1351: DFBPPR9792 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1352: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1353: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.1354: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C Source.1355: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.1356: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.1357: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1358: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.1359: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.1360: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1361: DFBPPR10082 ---- Animal proteins ---- Pinopsin Source.1362: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.1363: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1364: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.1365: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.1366: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1367: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.1368: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.1369: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.1370: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.1371: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.1372: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein Source.1373: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.1374: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1375: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.1376: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.1377: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.1378: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.1379: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.1380: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.1381: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.1382: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.1383: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.1384: DFBPPR10268 ---- Animal proteins ---- CD166 antigen Source.1385: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.1386: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1387: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.1388: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1389: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.1390: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.1391: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.1392: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1393: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.1394: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1395: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.1396: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.1397: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.1398: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1399: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1400: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.1401: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1402: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1403: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1404: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1405: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.1406: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.1407: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c Source.1408: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.1409: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.1410: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.1411: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1412: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1413: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.1414: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.1415: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.1416: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1417: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.1418: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.1419: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.1420: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.1421: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.1422: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.1423: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.1424: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.1425: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.1426: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1427: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.1428: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1429: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.1430: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.1431: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1432: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.1433: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.1434: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1435: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.1436: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.1437: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.1438: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.1439: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1440: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.1441: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1442: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.1443: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.1444: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.1445: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.1446: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.1447: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.1448: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.1449: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.1450: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.1451: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.1452: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.1453: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12 Source.1454: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.1455: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.1456: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.1457: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.1458: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.1459: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.1460: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.1461: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.1462: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.1463: DFBPPR11043 ---- Animal proteins ---- Centromere protein H Source.1464: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.1465: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.1466: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1467: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.1468: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.1469: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.1470: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1471: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.1472: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1473: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.1474: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1475: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3 Source.1476: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1 Source.1477: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29 Source.1478: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.1479: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.1480: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.1481: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1482: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.1483: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38 Source.1484: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.1485: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.1486: DFBPPR11248 ---- Animal proteins ---- Myelin protein P0 Source.1487: DFBPPR11256 ---- Animal proteins ---- Neuroblastoma suppressor of tumorigenicity 1 Source.1488: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1 Source.1489: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.1490: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.1491: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.1492: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1493: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.1494: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.1495: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.1496: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.1497: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1498: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1499: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.1500: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1501: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.1502: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.1503: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD Source.1504: DFBPPR11441 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.1505: DFBPPR11442 ---- Animal proteins ---- 60S ribosomal protein L37a Source.1506: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.1507: DFBPPR11484 ---- Animal proteins ---- Prolactin Source.1508: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.1509: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32 Source.1510: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.1511: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.1512: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1513: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.1514: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.1515: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A Source.1516: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1517: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.1518: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.1519: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.1520: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.1521: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.1522: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.1523: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.1524: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4 Source.1525: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.1526: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z Source.1527: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.1528: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.1529: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.1530: DFBPPR11856 ---- Animal proteins ---- Spindlin-W Source.1531: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.1532: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.1533: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor Source.1534: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.1535: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B Source.1536: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.1537: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.1538: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.1539: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.1540: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.1541: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.1542: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.1543: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.1544: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.1545: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.1546: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.1547: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93 Source.1548: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1549: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.1550: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.1551: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180 Source.1552: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin Source.1553: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.1554: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1555: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.1556: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.1557: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.1558: DFBPPR12278 ---- Animal proteins ---- Major prion protein Source.1559: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.1560: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.1561: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.1562: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.1563: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1564: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1565: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1566: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.1567: DFBPPR12358 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1 Source.1568: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.1569: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.1570: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.1571: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.1572: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase Source.1573: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.1574: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.1575: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.1576: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1577: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1578: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.1579: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.1580: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1581: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.1582: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1583: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.1584: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.1585: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.1586: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.1587: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.1588: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.1589: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.1590: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.1591: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.1592: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.1593: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.1594: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.1595: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1596: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.1597: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.1598: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.1599: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1600: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.1601: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1602: DFBPPR12561 ---- Animal proteins ---- Dynein light chain 1, cytoplasmic Source.1603: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1604: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1605: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.1606: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.1607: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.1608: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.1609: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.1610: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1611: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1612: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Source.1613: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1614: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1615: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.1616: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.1617: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.1618: DFBPPR12772 ---- Animal proteins ---- Colipase Source.1619: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.1620: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.1621: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.1622: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.1623: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.1624: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.1625: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.1626: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.1627: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.1628: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn] Source.1629: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.1630: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.1631: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase Source.1632: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.1633: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.1634: DFBPPR12969 ---- Animal proteins ---- Prolactin Source.1635: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.1636: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.1637: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1638: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.1639: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4 Source.1640: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1641: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.1642: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.1643: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1644: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.1645: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.1646: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.1647: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1648: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.1649: DFBPPR13257 ---- Animal proteins ---- Prolactin Source.1650: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.1651: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.1652: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1653: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.1654: DFBPPR13297 ---- Animal proteins ---- Plasminogen Source.1655: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.1656: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.1657: DFBPPR13367 ---- Animal proteins ---- Neutrophil elastase 2B Source.1658: DFBPPR13378 ---- Animal proteins ---- Neutrophil elastase 2A Source.1659: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1660: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22 Source.1661: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.1662: DFBPPR13433 ---- Animal proteins ---- Major prion protein Source.1663: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1664: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P Source.1665: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.1666: DFBPPR13530 ---- Animal proteins ---- Major prion protein Source.1667: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.1668: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1669: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein Source.1670: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.1671: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1672: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.1673: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1674: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.1675: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.1676: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1677: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1678: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1679: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1680: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1681: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1682: DFBPPR13786 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma Source.1683: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor Source.1684: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5 Source.1685: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.1686: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.1687: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3 Source.1688: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.1689: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9 Source.1690: DFBPPR13877 ---- Animal proteins ---- Sialin Source.1691: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.1692: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1693: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.1694: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.1695: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.1696: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.1697: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1698: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1699: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1700: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1701: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.1702: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta Source.1703: DFBPPR14090 ---- Marine protein ---- Trypsin-3 Source.1704: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.1705: DFBPPR14118 ---- Marine protein ---- Trypsin-2 Source.1706: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.1707: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.1708: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.1709: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.1710: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor Source.1711: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.1712: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2 Source.1713: DFBPPR14211 ---- Marine protein ---- WASH complex subunit 3 Source.1714: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase Source.1715: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.1716: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit Source.1717: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1718: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.1719: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.1720: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase Source.1721: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.1722: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.1723: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.1724: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.1725: DFBPPR14436 ---- Marine protein ---- 50S ribosomal protein L11, chloroplastic Source.1726: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic Source.1727: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic Source.1728: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic Source.1729: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.1730: DFBPPR14515 ---- Marine protein ---- Uncharacterized protein ycf40 Source.1731: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2 Source.1732: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.1733: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.1734: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2 Source.1735: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.1736: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.1737: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4 Source.1738: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.1739: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18 Source.1740: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.1741: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.1742: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit Source.1743: DFBPPR14770 ---- Marine protein ---- Lectin L6 Source.1744: DFBPPR14783 ---- Marine protein ---- Enolase Source.1745: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1746: DFBPPR14873 ---- Marine protein ---- Somatolactin Source.1747: DFBPPR14881 ---- Microorganism protein ---- Decapping and exoribonuclease protein 1 Source.1748: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.1749: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.1750: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.1751: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.1752: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.1753: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.1754: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.1755: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.1756: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.1757: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8 Source.1758: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.1759: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.1760: DFBPPR14935 ---- Microorganism protein ---- Actin Source.1761: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.1762: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.1763: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.1764: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.1765: DFBPPR14977 ---- Microorganism protein ---- Superoxide dismutase [Cu-Zn] Source.1766: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase Source.1767: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.1768: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.1769: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.1770: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase Source.1771: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.1772: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.1773: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.1774: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.1775: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase Source.1776: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.1777: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5 Source.1778: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.1779: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.1780: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.1781: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.1782: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1 Source.1783: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase Source.1784: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.1785: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A Source.1786: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic Source.1787: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase Source.1788: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.1789: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.1790: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2 Source.1791: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.1792: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.1793: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial Source.1794: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.1795: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2 Source.1796: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2 Source.1797: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase Source.1798: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.1799: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.1800: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.1801: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.1802: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.1803: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1 Source.1804: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.1805: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1806: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.1807: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.1808: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.1809: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4 Source.1810: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.1811: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.1812: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial Source.1813: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.1814: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1 Source.1815: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.1816: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.1817: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.1818: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.1819: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11 Source.1820: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.1821: DFBPPR15511 ---- Microorganism protein ---- 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase Source.1822: DFBPPR15520 ---- Microorganism protein ---- Protein YAE1 Source.1823: DFBPPR15523 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 3, mitochondrial Source.1824: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.1825: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial Source.1826: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.1827: DFBPPR15620 ---- Microorganism protein ---- Autophagy-related protein 23 Source.1828: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.1829: DFBPPR15638 ---- Microorganism protein ---- ATP-dependent kinase YFH7 Source.1830: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.1831: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6 Source.1832: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.1833: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4 Source.1834: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1 Source.1835: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial Source.1836: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.1837: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase Source.1838: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.1839: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.1840: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.1841: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.1842: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase Source.1843: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase Source.1844: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.1845: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component Source.1846: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.1847: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.1848: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase Source.1849: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.1850: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.1851: DFBPPR15864 ---- Microorganism protein ---- Hydrophobin-3 Source.1852: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.1853: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.1854: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.1855: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.1856: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1857: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic Source.1858: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic Source.1859: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.1860: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.1861: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1862: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1863: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.1864: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.1865: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.1866: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.1867: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.1868: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.1869: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.1870: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.1871: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.1872: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.1873: DFBPPR7844 ---- Plant protein ---- Actin-1 Source.1874: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.1875: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.1876: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1 Source.1877: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.1878: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2 Source.1879: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.1880: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.1881: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a Source.1882: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1883: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.1884: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4 Source.1885: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.1886: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1887: DFBPPR8029 ---- Plant protein ---- Vignain Source.1888: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.1889: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.1890: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1891: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.1892: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1893: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1894: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.1895: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1896: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.1897: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1898: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1899: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin Source.1900: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.1901: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.1902: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.1903: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1 Source.1904: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2 Source.1905: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.1906: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.1907: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1908: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.1909: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1910: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1911: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.1912: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.1913: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.1914: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog Source.1915: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Other bioactive activity	The ability to inhibit the activity of 3-hydroxy-3-methyl-glutaryl-CoA reductase (HMG-CoA reductase, EC 1.1.1.34) was determined, and researchers found that the sequence IVG significantly inhibited this enzyme, suggesting a possible hypocholesterolemic effect.
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 107).
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	The amaranth protein isolate was hydrolyzed with a multi-enzyme system consisting of trypsin (5.16 mg), α-chymotrypsin (13.76 mg) and peptidase (1.28 mg).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

3-hydroxy-3-methyl-glutaryl-CoA reductase (HMG-CoA reductase) is a key enzyme in cholesterol biosynthesis.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Soares RA, Mendonça S, de Castro LÍ, Menezes AC, Arêas JA. Major peptides from amaranth (Amaranthus cruentus) protein inhibit HMG-CoA reductase activity. Int J Mol Sci. 2015 Feb 16;16(2):4150-60. PMID: 25690031 DOI: 10.3390/ijms16024150
Other literature(s)	N.D
PubDate	2015