Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPSTPE0014(Stimulating peptide)

DFBP ID	DFBPSTPE0014
Peptide sequence	IV
Type	Native peptide
Peptide/Function name	Stimulating peptide

Function-activity relationship

Main bioactivity	Stimulating activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ile-Val

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	230.30 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

4.3500^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Whey proteins
Precursor protein	β-Lactalbumin, β-Lactoglobulin
Residue position	f(60-61), f(2-3)
Precursor protein(s) search	Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin Source.3: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin Source.4: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit Source.5: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin Source.6: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein Source.7: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.8: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.9: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.10: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.11: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.12: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.13: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.14: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.15: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A Source.16: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.17: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.18: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.19: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.20: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.21: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.22: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.23: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.24: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.25: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic Source.26: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.27: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic Source.28: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2 Source.29: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A Source.30: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.31: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5 Source.32: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.33: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.34: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.35: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.36: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.37: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.38: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.39: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5 Source.40: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.41: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.42: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.43: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.44: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.45: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.46: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.47: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.48: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.49: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1 Source.50: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.51: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6 Source.52: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.53: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.54: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.55: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.56: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1 Source.57: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.58: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.59: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.60: DFBPPR0886 ---- Plant proteins ---- Abscisic acid receptor PYL5 Source.61: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.62: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.63: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.64: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.65: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.66: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1 Source.67: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.68: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.69: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1 Source.70: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1 Source.71: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.72: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.73: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2 Source.74: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.75: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.76: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.77: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.78: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.79: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.80: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.81: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1 Source.82: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.83: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6 Source.84: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.85: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.86: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.87: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.88: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.89: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial Source.90: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.91: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.92: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8 Source.93: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.94: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1 Source.95: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.96: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.97: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase Source.98: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.99: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.100: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3 Source.101: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10 Source.102: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.103: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.104: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.105: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7 Source.106: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A Source.107: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.108: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.109: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.110: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.111: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.112: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.113: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26 Source.114: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3 Source.115: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.116: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.117: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.118: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.119: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9 Source.120: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.121: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.122: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.123: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.124: DFBPPR0971 ---- Plant proteins ---- Protein STAR1 Source.125: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.126: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7 Source.127: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.128: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic Source.129: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.130: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.131: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.132: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.133: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.134: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.135: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.136: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6 Source.137: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50 Source.138: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.139: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.140: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.141: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.142: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic Source.143: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.144: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.145: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.146: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase Source.147: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1 Source.148: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.149: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.150: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.151: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.152: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9 Source.153: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.154: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.155: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.156: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.157: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.158: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.159: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.160: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.161: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.162: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.163: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.164: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.165: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.166: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic Source.167: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3 Source.168: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1 Source.169: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4 Source.170: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A Source.171: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.172: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.173: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.174: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.175: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.176: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.177: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1 Source.178: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.179: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.180: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.181: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.182: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.183: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1 Source.184: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.185: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.186: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10 Source.187: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.188: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.189: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.190: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.191: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.192: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.193: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4 Source.194: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79 Source.195: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.196: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.197: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2 Source.198: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24 Source.199: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.200: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.201: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.202: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.203: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.204: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24 Source.205: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5 Source.206: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46 Source.207: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.208: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.209: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.210: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13 Source.211: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic Source.212: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.213: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.214: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.215: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.216: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7 Source.217: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.218: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.219: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.220: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.221: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic Source.222: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1 Source.223: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.224: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.225: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3 Source.226: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.227: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.228: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.229: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.230: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4 Source.231: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.232: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.233: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.234: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.235: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.236: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.237: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B Source.238: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.239: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog Source.240: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.241: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.242: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.243: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog Source.244: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.245: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13 Source.246: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4 Source.247: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.248: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A Source.249: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.250: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.251: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6 Source.252: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A Source.253: DFBPPR1154 ---- Plant proteins ---- MADS-box transcription factor 22 Source.254: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.255: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.256: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.257: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1 Source.258: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.259: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.260: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.261: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic Source.262: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.263: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.264: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.265: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.266: DFBPPR1176 ---- Plant proteins ---- Chitinase 12 Source.267: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.268: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic Source.269: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic Source.270: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.271: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.272: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18 Source.273: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.274: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3 Source.275: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.276: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA Source.277: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.278: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.279: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.280: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase Source.281: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.282: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4 Source.283: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic Source.284: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19 Source.285: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.286: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial Source.287: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.288: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.289: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50 Source.290: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.291: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.292: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.293: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.294: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.295: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.296: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.297: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24 Source.298: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.299: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.300: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.301: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic Source.302: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic Source.303: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.304: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.305: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.306: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.307: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.308: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic Source.309: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.310: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.311: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23 Source.312: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15 Source.313: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.314: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.315: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.316: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3 Source.317: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.318: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.319: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a Source.320: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.321: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.322: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.323: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.324: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.325: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.326: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.327: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.328: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.329: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic Source.330: DFBPPR1297 ---- Plant proteins ---- Peroxygenase Source.331: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.332: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b Source.333: DFBPPR1301 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.334: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.335: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22 Source.336: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.337: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.338: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.339: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B Source.340: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1 Source.341: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.342: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.343: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.344: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.345: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17 Source.346: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.347: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.348: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.349: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.350: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.351: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.352: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d Source.353: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.354: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic Source.355: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B Source.356: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.357: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.358: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12 Source.359: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.360: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.361: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.362: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1 Source.363: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.364: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.365: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.366: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.367: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.368: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.369: DFBPPR1352 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn] 1 Source.370: DFBPPR1353 ---- Plant proteins ---- Transcription factor UDT1 Source.371: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.372: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47 Source.373: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic Source.374: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.375: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic Source.376: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.377: DFBPPR1363 ---- Plant proteins ---- Protein YELLOW LEAF 1, choloroplastic Source.378: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.379: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A Source.380: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.381: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1 Source.382: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.383: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.384: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.385: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic Source.386: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.387: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.388: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2 Source.389: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.390: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.391: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.392: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2 Source.393: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.394: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.395: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.396: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.397: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.398: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6 Source.399: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.400: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.401: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.402: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.403: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.404: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.405: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.406: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic Source.407: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.408: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.409: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.410: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.411: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.412: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.413: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.414: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7 Source.415: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.416: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A Source.417: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.418: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.419: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.420: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.421: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.422: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.423: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.424: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.425: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L Source.426: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.427: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3 Source.428: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.429: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.430: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29 Source.431: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14 Source.432: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.433: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3 Source.434: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.435: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.436: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.437: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.438: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.439: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.440: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.441: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8 Source.442: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.443: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.444: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.445: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.446: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.447: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.448: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.449: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c Source.450: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.451: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.452: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.453: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1 Source.454: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.455: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.456: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.457: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.458: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.459: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.460: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.461: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.462: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.463: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.464: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3 Source.465: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.466: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.467: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.468: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.469: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.470: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.471: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.472: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.473: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4 Source.474: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.475: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.476: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.477: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.478: DFBPPR1497 ---- Plant proteins ---- Chitinase 1 Source.479: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.480: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.481: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.482: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.483: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.484: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5 Source.485: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.486: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.487: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.488: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.489: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.490: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.491: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3 Source.492: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.493: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.494: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.495: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.496: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.497: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.498: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.499: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.500: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.501: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.502: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.503: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.504: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.505: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.506: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.507: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.508: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8 Source.509: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal Source.510: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.511: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.512: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.513: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.514: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.515: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5 Source.516: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.517: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.518: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.519: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2 Source.520: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.521: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.522: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.523: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51 Source.524: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.525: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.526: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3 Source.527: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.528: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.529: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.530: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.531: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.532: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9 Source.533: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.534: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.535: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.536: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.537: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2 Source.538: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic Source.539: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.540: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.541: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.542: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.543: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.544: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.545: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.546: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.547: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.548: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic Source.549: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.550: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.551: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.552: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.553: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.554: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.555: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.556: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.557: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.558: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.559: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.560: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7 Source.561: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a Source.562: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.563: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic Source.564: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.565: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.566: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.567: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.568: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.569: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.570: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.571: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.572: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.573: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.574: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.575: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.576: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.577: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2 Source.578: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.579: DFBPPR1641 ---- Plant proteins ---- Enolase Source.580: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.581: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.582: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.583: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3 Source.584: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.585: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog Source.586: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.587: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C Source.588: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C Source.589: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.590: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19 Source.591: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.592: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.593: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.594: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.595: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.596: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.597: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.598: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.599: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.600: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.601: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.602: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.603: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.604: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.605: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.606: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.607: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.608: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.609: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.610: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.611: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.612: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3 Source.613: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.614: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062 Source.615: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic Source.616: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.617: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.618: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.619: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.620: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1 Source.621: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2 Source.622: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1 Source.623: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B Source.624: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.625: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.626: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.627: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.628: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2 Source.629: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.630: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.631: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.632: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.633: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.634: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.635: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.636: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.637: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.638: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.639: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2 Source.640: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1 Source.641: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3 Source.642: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.643: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.644: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.645: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2 Source.646: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.647: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic Source.648: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic Source.649: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.650: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.651: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic Source.652: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.653: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.654: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.655: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.656: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.657: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.658: DFBPPR1751 ---- Plant proteins ---- Heat stress transcription factor A-4b Source.659: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2 Source.660: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.661: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094 Source.662: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.663: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57 Source.664: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.665: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.666: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.667: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1 Source.668: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.669: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.670: DFBPPR1768 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase RZFP34 Source.671: DFBPPR1769 ---- Plant proteins ---- Two-component response regulator ORR3 Source.672: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2 Source.673: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B Source.674: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.675: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.676: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.677: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.678: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.679: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.680: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.681: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A Source.682: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.683: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.684: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.685: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.686: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.687: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.688: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20 Source.689: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.690: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.691: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.692: DFBPPR1798 ---- Plant proteins ---- UMP-CMP kinase 2 Source.693: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.694: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.695: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.696: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.697: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1 Source.698: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.699: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.700: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.701: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2 Source.702: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.703: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic Source.704: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1 Source.705: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.706: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3 Source.707: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.708: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.709: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1 Source.710: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.711: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1 Source.712: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.713: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.714: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5 Source.715: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.716: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.717: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.718: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.719: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2 Source.720: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.721: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.722: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.723: DFBPPR1847 ---- Plant proteins ---- Amidase 1 Source.724: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.725: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.726: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.727: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.728: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.729: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.730: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.731: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.732: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.733: DFBPPR1863 ---- Plant proteins ---- Chitinase 6 Source.734: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.735: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.736: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.737: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.738: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.739: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.740: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.741: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.742: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.743: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.744: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B Source.745: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4 Source.746: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.747: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.748: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.749: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.750: DFBPPR1887 ---- Plant proteins ---- Probable glutathione S-transferase DHAR2, chloroplastic Source.751: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.752: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.753: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.754: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.755: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.756: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.757: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.758: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.759: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1 Source.760: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.761: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.762: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.763: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.764: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.765: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1 Source.766: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2 Source.767: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6 Source.768: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.769: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.770: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.771: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21 Source.772: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.773: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.774: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.775: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10 Source.776: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.777: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.778: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.779: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A Source.780: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.781: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2 Source.782: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1 Source.783: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic Source.784: DFBPPR1932 ---- Plant proteins ---- Inactive casein kinase II subunit alpha-2 Source.785: DFBPPR1933 ---- Plant proteins ---- MADS-box transcription factor 2 Source.786: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.787: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.788: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.789: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.790: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2 Source.791: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4 Source.792: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.793: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.794: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.795: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.796: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.797: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.798: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17 Source.799: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4 Source.800: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.801: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.802: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.803: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.804: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.805: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.806: DFBPPR1962 ---- Plant proteins ---- Expansin-A2 Source.807: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.808: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.809: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.810: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.811: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.812: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1 Source.813: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.814: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.815: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.816: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.817: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.818: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2 Source.819: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.820: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.821: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16 Source.822: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2 Source.823: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.824: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB Source.825: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B Source.826: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.827: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.828: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.829: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b Source.830: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.831: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.832: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.833: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.834: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.835: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.836: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33 Source.837: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.838: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.839: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.840: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.841: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.842: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic Source.843: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain Source.844: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.845: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.846: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.847: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.848: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.849: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1 Source.850: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.851: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.852: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.853: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.854: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1 Source.855: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.856: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.857: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.858: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1 Source.859: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.860: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial Source.861: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.862: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.863: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.864: DFBPPR2045 ---- Plant proteins ---- Expansin-A5 Source.865: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11 Source.866: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.867: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase Source.868: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.869: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.870: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.871: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5 Source.872: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.873: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.874: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.875: DFBPPR2063 ---- Plant proteins ---- Non-specific lipid-transfer protein C6 Source.876: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.877: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.878: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.879: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.880: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.881: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.882: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.883: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.884: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.885: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.886: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.887: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.888: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.889: DFBPPR2085 ---- Plant proteins ---- Protein LOL5 Source.890: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.891: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.892: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.893: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.894: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.895: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.896: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.897: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.898: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.899: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.900: DFBPPR2101 ---- Plant proteins ---- Cupincin Source.901: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.902: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.903: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.904: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.905: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.906: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4 Source.907: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1 Source.908: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.909: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial Source.910: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.911: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1 Source.912: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.913: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2 Source.914: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.915: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.916: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD Source.917: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.918: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2 Source.919: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57 Source.920: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic Source.921: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.922: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.923: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.924: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.925: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.926: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.927: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.928: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.929: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1 Source.930: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.931: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.932: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.933: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.934: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.935: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23 Source.936: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.937: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3 Source.938: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.939: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.940: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.941: DFBPPR2157 ---- Plant proteins ---- Expansin-B6 Source.942: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.943: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.944: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.945: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.946: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.947: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2 Source.948: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.949: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.950: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.951: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.952: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.953: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.954: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.955: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.956: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.957: DFBPPR2175 ---- Plant proteins ---- Expansin-A16 Source.958: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11 Source.959: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2 Source.960: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C Source.961: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.962: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.963: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1 Source.964: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1 Source.965: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.966: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.967: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.968: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.969: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.970: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1 Source.971: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.972: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1 Source.973: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.974: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.975: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.976: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.977: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.978: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2 Source.979: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.980: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.981: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16 Source.982: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32 Source.983: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.984: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13 Source.985: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.986: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4 Source.987: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.988: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.989: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.990: DFBPPR2220 ---- Plant proteins ---- Expansin-A7 Source.991: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.992: DFBPPR2223 ---- Plant proteins ---- Urease Source.993: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9 Source.994: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.995: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.996: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1 Source.997: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.998: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain Source.999: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.1000: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.1001: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha Source.1002: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.1003: DFBPPR2241 ---- Plant proteins ---- Nitrogen regulatory protein P-II homolog Source.1004: DFBPPR2242 ---- Plant proteins ---- Expansin-A3 Source.1005: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76 Source.1006: DFBPPR2244 ---- Plant proteins ---- Expansin-A6 Source.1007: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.1008: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.1009: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1 Source.1010: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.1011: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.1012: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.1013: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21 Source.1014: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.1015: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.1016: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.1017: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.1018: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.1019: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6 Source.1020: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.1021: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.1022: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.1023: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2 Source.1024: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog Source.1025: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.1026: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.1027: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2 Source.1028: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.1029: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.1030: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.1031: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.1032: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic Source.1033: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.1034: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.1035: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.1036: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.1037: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS Source.1038: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.1039: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.1040: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.1041: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3 Source.1042: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1043: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.1044: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.1045: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B Source.1046: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.1047: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4 Source.1048: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.1049: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2 Source.1050: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.1051: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10 Source.1052: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1053: DFBPPR2305 ---- Plant proteins ---- Actin-depolymerizing factor 4 Source.1054: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b Source.1055: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.1056: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3 Source.1057: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5 Source.1058: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.1059: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.1060: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.1061: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1062: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.1063: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.1064: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.1065: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.1066: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.1067: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.1068: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3 Source.1069: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.1070: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.1071: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4 Source.1072: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.1073: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.1074: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.1075: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400 Source.1076: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.1077: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8 Source.1078: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.1079: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.1080: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.1081: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.1082: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.1083: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.1084: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.1085: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6 Source.1086: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.1087: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.1088: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.1089: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.1090: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.1091: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.1092: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.1093: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5 Source.1094: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.1095: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.1096: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.1097: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.1098: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6 Source.1099: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.1100: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.1101: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.1102: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.1103: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.1104: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.1105: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100 Source.1106: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10 Source.1107: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic Source.1108: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.1109: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.1110: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase Source.1111: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5 Source.1112: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A Source.1113: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6 Source.1114: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.1115: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1116: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089 Source.1117: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6 Source.1118: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.1119: DFBPPR2408 ---- Plant proteins ---- Cytochrome f Source.1120: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3 Source.1121: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.1122: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.1123: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.1124: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.1125: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.1126: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.1127: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.1128: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.1129: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.1130: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.1131: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13 Source.1132: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.1133: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.1134: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic Source.1135: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.1136: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73 Source.1137: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.1138: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.1139: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2 Source.1140: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.1141: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c Source.1142: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain Source.1143: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1144: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9 Source.1145: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.1146: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.1147: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.1148: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.1149: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.1150: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial Source.1151: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56 Source.1152: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.1153: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.1154: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.1155: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.1156: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1 Source.1157: DFBPPR2462 ---- Plant proteins ---- Arabinogalactan peptide 1 Source.1158: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.1159: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.1160: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26 Source.1161: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.1162: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.1163: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.1164: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1165: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase Source.1166: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.1167: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.1168: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.1169: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.1170: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.1171: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.1172: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.1173: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2 Source.1174: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.1175: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.1176: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic Source.1177: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.1178: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1179: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic Source.1180: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.1181: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4 Source.1182: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20 Source.1183: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.1184: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10 Source.1185: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.1186: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.1187: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic Source.1188: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.1189: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.1190: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1191: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25 Source.1192: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.1193: DFBPPR2516 ---- Plant proteins ---- Expansin-B16 Source.1194: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.1195: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.1196: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.1197: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.1198: DFBPPR2526 ---- Plant proteins ---- Chitinase 10 Source.1199: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24 Source.1200: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.1201: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.1202: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.1203: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.1204: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1205: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.1206: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.1207: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase Source.1208: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.1209: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.1210: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.1211: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.1212: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1213: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1 Source.1214: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.1215: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic Source.1216: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a Source.1217: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.1218: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.1219: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.1220: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.1221: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.1222: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.1223: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.1224: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27 Source.1225: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.1226: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.1227: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase Source.1228: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.1229: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.1230: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.1231: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.1232: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20 Source.1233: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.1234: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.1235: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.1236: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9 Source.1237: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.1238: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.1239: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic Source.1240: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.1241: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6 Source.1242: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1 Source.1243: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic Source.1244: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1 Source.1245: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.1246: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.1247: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a Source.1248: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.1249: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1 Source.1250: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.1251: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.1252: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A Source.1253: DFBPPR2595 ---- Plant proteins ---- Expansin-B7 Source.1254: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.1255: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.1256: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.1257: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5 Source.1258: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.1259: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2 Source.1260: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.1261: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2 Source.1262: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.1263: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.1264: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E Source.1265: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.1266: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.1267: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57 Source.1268: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.1269: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2 Source.1270: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.1271: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.1272: DFBPPR2622 ---- Plant proteins ---- Monothiol glutaredoxin-S4, mitochondrial Source.1273: DFBPPR2624 ---- Plant proteins ---- Transcription initiation factor IIA subunit 2 Source.1274: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1 Source.1275: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a Source.1276: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.1277: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34 Source.1278: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.1279: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.1280: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.1281: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2 Source.1282: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.1283: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.1284: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.1285: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2 Source.1286: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3 Source.1287: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2 Source.1288: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.1289: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic Source.1290: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.1291: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.1292: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.1293: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.1294: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.1295: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5 Source.1296: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3 Source.1297: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.1298: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.1299: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.1300: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.1301: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.1302: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2 Source.1303: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.1304: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.1305: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.1306: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic Source.1307: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.1308: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1 Source.1309: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.1310: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.1311: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.1312: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.1313: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.1314: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.1315: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.1316: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.1317: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27 Source.1318: DFBPPR2699 ---- Plant proteins ---- Expansin-A8 Source.1319: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.1320: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.1321: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72 Source.1322: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.1323: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9 Source.1324: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1 Source.1325: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b Source.1326: DFBPPR2710 ---- Plant proteins ---- 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase, chloroplastic Source.1327: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2 Source.1328: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.1329: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.1330: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.1331: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.1332: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.1333: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.1334: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.1335: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.1336: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.1337: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1 Source.1338: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.1339: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.1340: DFBPPR2728 ---- Plant proteins ---- Autophagy-related protein 8B Source.1341: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.1342: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.1343: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.1344: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C Source.1345: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A Source.1346: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5 Source.1347: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500 Source.1348: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.1349: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.1350: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.1351: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.1352: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6 Source.1353: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.1354: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.1355: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5 Source.1356: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.1357: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3 Source.1358: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.1359: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.1360: DFBPPR2758 ---- Plant proteins ---- Expansin-B17 Source.1361: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.1362: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.1363: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.1364: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.1365: DFBPPR2764 ---- Plant proteins ---- MADS-box transcription factor 30 Source.1366: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.1367: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.1368: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.1369: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic Source.1370: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.1371: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1372: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.1373: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.1374: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.1375: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A Source.1376: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.1377: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.1378: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.1379: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase Source.1380: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.1381: DFBPPR2791 ---- Plant proteins ---- Calcineurin B-like protein 7 Source.1382: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.1383: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.1384: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.1385: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.1386: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.1387: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12 Source.1388: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.1389: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.1390: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5 Source.1391: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.1392: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2 Source.1393: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.1394: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.1395: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1396: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.1397: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.1398: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1 Source.1399: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic Source.1400: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.1401: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.1402: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1 Source.1403: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.1404: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1 Source.1405: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3 Source.1406: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.1407: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.1408: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.1409: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4 Source.1410: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.1411: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.1412: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.1413: DFBPPR2836 ---- Plant proteins ---- Two-component response regulator ORR12 Source.1414: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.1415: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.1416: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.1417: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.1418: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.1419: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.1420: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.1421: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic Source.1422: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1423: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3 Source.1424: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.1425: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.1426: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.1427: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131 Source.1428: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3 Source.1429: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1 Source.1430: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like Source.1431: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.1432: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX Source.1433: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.1434: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.1435: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.1436: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2 Source.1437: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.1438: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.1439: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B Source.1440: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.1441: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.1442: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.1443: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.1444: DFBPPR2883 ---- Plant proteins ---- Expansin-B9 Source.1445: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.1446: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1447: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.1448: DFBPPR2889 ---- Plant proteins ---- Monothiol glutaredoxin-S1, mitochondrial Source.1449: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6 Source.1450: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.1451: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c Source.1452: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.1453: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7 Source.1454: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1 Source.1455: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.1456: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.1457: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.1458: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1459: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.1460: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d Source.1461: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.1462: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.1463: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.1464: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5 Source.1465: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3 Source.1466: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.1467: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7 Source.1468: DFBPPR2925 ---- Plant proteins ---- Two-component response regulator ORR13 Source.1469: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.1470: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4 Source.1471: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4 Source.1472: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14 Source.1473: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.1474: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.1475: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.1476: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1 Source.1477: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.1478: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.1479: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.1480: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8 Source.1481: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.1482: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic Source.1483: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5 Source.1484: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.1485: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic Source.1486: DFBPPR2952 ---- Plant proteins ---- Expansin-A17 Source.1487: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1 Source.1488: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1489: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.1490: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.1491: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.1492: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.1493: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.1494: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.1495: DFBPPR2964 ---- Plant proteins ---- Expansin-A14 Source.1496: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.1497: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7 Source.1498: DFBPPR2970 ---- Plant proteins ---- Germin-like protein 1-2 Source.1499: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.1500: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.1501: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.1502: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.1503: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic Source.1504: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic Source.1505: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.1506: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.1507: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic Source.1508: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.1509: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5 Source.1510: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.1511: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic Source.1512: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.1513: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.1514: DFBPPR2987 ---- Plant proteins ---- 1-Cys peroxiredoxin B Source.1515: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.1516: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1 Source.1517: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog Source.1518: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5 Source.1519: DFBPPR2994 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.1520: DFBPPR2995 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.1521: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.1522: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.1523: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.1524: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.1525: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a Source.1526: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.1527: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase Source.1528: DFBPPR3007 ---- Plant proteins ---- Thioredoxin H2-2 Source.1529: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.1530: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.1531: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.1532: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3 Source.1533: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.1534: DFBPPR3017 ---- Plant proteins ---- Expansin-A12 Source.1535: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c Source.1536: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic Source.1537: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.1538: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26 Source.1539: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.1540: DFBPPR3027 ---- Plant proteins ---- Expansin-A31 Source.1541: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.1542: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.1543: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.1544: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.1545: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.1546: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.1547: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.1548: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.1549: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.1550: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase Source.1551: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.1552: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.1553: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10 Source.1554: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.1555: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2 Source.1556: DFBPPR3052 ---- Plant proteins ---- MADS-box transcription factor 31 Source.1557: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8 Source.1558: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.1559: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6 Source.1560: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.1561: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.1562: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A Source.1563: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.1564: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.1565: DFBPPR3063 ---- Plant proteins ---- Profilin-A Source.1566: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.1567: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.1568: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.1569: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic Source.1570: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial Source.1571: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.1572: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.1573: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.1574: DFBPPR3075 ---- Plant proteins ---- Thiamine pyrophosphokinase 2 Source.1575: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1 Source.1576: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.1577: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3 Source.1578: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.1579: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.1580: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.1581: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.1582: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3 Source.1583: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.1584: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.1585: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34 Source.1586: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.1587: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.1588: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.1589: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.1590: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.1591: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.1592: DFBPPR3095 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 4 Source.1593: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.1594: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.1595: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.1596: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.1597: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.1598: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4 Source.1599: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3 Source.1600: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.1601: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.1602: DFBPPR3108 ---- Plant proteins ---- Thioredoxin H4-2 Source.1603: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.1604: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5 Source.1605: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1 Source.1606: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1 Source.1607: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.1608: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.1609: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.1610: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.1611: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.1612: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.1613: DFBPPR3124 ---- Plant proteins ---- Two-component response regulator ORR8 Source.1614: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.1615: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.1616: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1617: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.1618: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.1619: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6 Source.1620: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.1621: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.1622: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.1623: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.1624: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.1625: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.1626: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.1627: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.1628: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.1629: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6 Source.1630: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.1631: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.1632: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.1633: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8 Source.1634: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.1635: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.1636: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.1637: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7 Source.1638: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.1639: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.1640: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.1641: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.1642: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5 Source.1643: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1644: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.1645: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.1646: DFBPPR3170 ---- Plant proteins ---- Probable histone H2A.2 Source.1647: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase Source.1648: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.1649: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.1650: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.1651: DFBPPR3176 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.1652: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48 Source.1653: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.1654: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.1655: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.1656: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10 Source.1657: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.1658: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.1659: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.1660: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.1661: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.1662: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.1663: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.1664: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.1665: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.1666: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.1667: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.1668: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.1669: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.1670: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.1671: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.1672: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.1673: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.1674: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.1675: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.1676: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.1677: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.1678: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.1679: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4 Source.1680: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.1681: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial Source.1682: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.1683: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain Source.1684: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.1685: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7 Source.1686: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.1687: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.1688: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.1689: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.1690: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.1691: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.1692: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.1693: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.1694: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2 Source.1695: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1 Source.1696: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21 Source.1697: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.1698: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.1699: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7 Source.1700: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.1701: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16 Source.1702: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.1703: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS Source.1704: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70 Source.1705: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.1706: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.1707: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.1708: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1 Source.1709: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2 Source.1710: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3 Source.1711: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1 Source.1712: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D Source.1713: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase Source.1714: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic Source.1715: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.1716: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.1717: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.1718: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.1719: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP Source.1720: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.1721: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase Source.1722: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.1723: DFBPPR3276 ---- Plant proteins ---- MADS-box transcription factor 27 Source.1724: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3 Source.1725: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial Source.1726: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b Source.1727: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.1728: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta Source.1729: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400 Source.1730: DFBPPR3286 ---- Plant proteins ---- Expansin-A32 Source.1731: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.1732: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2 Source.1733: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.1734: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1 Source.1735: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3 Source.1736: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.1737: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.1738: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.1739: DFBPPR3302 ---- Plant proteins ---- Expansin-A21 Source.1740: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2 Source.1741: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.1742: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a Source.1743: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.1744: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1 Source.1745: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1 Source.1746: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a Source.1747: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5 Source.1748: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7 Source.1749: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.1750: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.1751: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.1752: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7 Source.1753: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3 Source.1754: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1 Source.1755: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30 Source.1756: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.1757: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10 Source.1758: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial Source.1759: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5 Source.1760: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11 Source.1761: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.1762: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a Source.1763: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.1764: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.1765: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4 Source.1766: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1 Source.1767: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.1768: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.1769: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic Source.1770: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.1771: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B Source.1772: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4 Source.1773: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.1774: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.1775: DFBPPR3361 ---- Plant proteins ---- Ras-related protein RIC1 Source.1776: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.1777: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.1778: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic Source.1779: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.1780: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.1781: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.1782: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.1783: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.1784: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.1785: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.1786: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.1787: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.1788: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.1789: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.1790: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.1791: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.1792: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.1793: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.1794: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.1795: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.1796: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.1797: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.1798: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.1799: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.1800: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2 Source.1801: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.1802: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.1803: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.1804: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.1805: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2 Source.1806: DFBPPR3413 ---- Plant proteins ---- Probable histone H2AXa Source.1807: DFBPPR3415 ---- Plant proteins ---- Expansin-A33 Source.1808: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.1809: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.1810: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.1811: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.1812: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase Source.1813: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.1814: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.1815: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.1816: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1 Source.1817: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.1818: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.1819: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.1820: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.1821: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.1822: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein Source.1823: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.1824: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.1825: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1826: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1 Source.1827: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.1828: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.1829: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.1830: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C Source.1831: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.1832: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.1833: DFBPPR3452 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit K Source.1834: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44 Source.1835: DFBPPR3456 ---- Plant proteins ---- Maturase K Source.1836: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1837: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.1838: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17 Source.1839: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog Source.1840: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.1841: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.1842: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1 Source.1843: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A Source.1844: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73 Source.1845: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.1846: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.1847: DFBPPR3471 ---- Plant proteins ---- Monothiol glutaredoxin-S6 Source.1848: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.1849: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.1850: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.1851: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1 Source.1852: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.1853: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.1854: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.1855: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.1856: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.1857: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20 Source.1858: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32 Source.1859: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.1860: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4 Source.1861: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6 Source.1862: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.1863: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.1864: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.1865: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.1866: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.1867: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog Source.1868: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.1869: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1 Source.1870: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.1871: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.1872: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.1873: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic Source.1874: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1 Source.1875: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.1876: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1 Source.1877: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.1878: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2 Source.1879: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10 Source.1880: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.1881: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.1882: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic Source.1883: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.1884: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2 Source.1885: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.1886: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.1887: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2 Source.1888: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.1889: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.1890: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3 Source.1891: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2 Source.1892: DFBPPR3551 ---- Plant proteins ---- Salt stress-induced protein Source.1893: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8 Source.1894: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3 Source.1895: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.1896: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic Source.1897: DFBPPR3557 ---- Plant proteins ---- NRR repressor homolog 3 Source.1898: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.1899: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.1900: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.1901: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.1902: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.1903: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K Source.1904: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.1905: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.1906: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58 Source.1907: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.1908: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.1909: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.1910: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.1911: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.1912: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.1913: DFBPPR3582 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7c Source.1914: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.1915: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.1916: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.1917: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.1918: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3 Source.1919: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2 Source.1920: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1921: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial Source.1922: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.1923: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1 Source.1924: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1 Source.1925: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.1926: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.1927: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.1928: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.1929: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.1930: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7 Source.1931: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.1932: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1 Source.1933: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.1934: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.1935: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D Source.1936: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b Source.1937: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.1938: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.1939: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.1940: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.1941: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.1942: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.1943: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial Source.1944: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1 Source.1945: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.1946: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.1947: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.1948: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.1949: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.1950: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.1951: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.1952: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2 Source.1953: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.1954: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e Source.1955: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a Source.1956: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.1957: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.1958: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.1959: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.1960: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3 Source.1961: DFBPPR3654 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7a Source.1962: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.1963: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.1964: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.1965: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.1966: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5 Source.1967: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3 Source.1968: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.1969: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10 Source.1970: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5 Source.1971: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic Source.1972: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.1973: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41 Source.1974: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.1975: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.1976: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.1977: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.1978: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.1979: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.1980: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.1981: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.1982: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.1983: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.1984: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.1985: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic Source.1986: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41 Source.1987: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67 Source.1988: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.1989: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d Source.1990: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.1991: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7 Source.1992: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.1993: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.1994: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.1995: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.1996: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2 Source.1997: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2 Source.1998: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.1999: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.2000: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.2001: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4 Source.2002: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3 Source.2003: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.2004: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.2005: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1 Source.2006: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.2007: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.2008: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.2009: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.2010: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.2011: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic Source.2012: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8 Source.2013: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1 Source.2014: DFBPPR3733 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.2015: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.2016: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.2017: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3 Source.2018: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28 Source.2019: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.2020: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.2021: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.2022: DFBPPR3743 ---- Plant proteins ---- Putative auxin-responsive protein IAA28 Source.2023: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.2024: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.2025: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12 Source.2026: DFBPPR3749 ---- Plant proteins ---- MADS-box transcription factor 25 Source.2027: DFBPPR3750 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.2028: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.2029: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7 Source.2030: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30 Source.2031: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.2032: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12 Source.2033: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.2034: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.2035: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.2036: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1 Source.2037: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8 Source.2038: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.2039: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51 Source.2040: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9 Source.2041: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.2042: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.2043: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4 Source.2044: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38 Source.2045: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2 Source.2046: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.2047: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.2048: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55 Source.2049: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.2050: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.2051: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1 Source.2052: DFBPPR3793 ---- Plant proteins ---- Coatomer subunit zeta-2 Source.2053: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase Source.2054: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1 Source.2055: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7 Source.2056: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42 Source.2057: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1 Source.2058: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.2059: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.2060: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.2061: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B Source.2062: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.2063: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.2064: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein Source.2065: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.2066: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.2067: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.2068: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.2069: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.2070: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.2071: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.2072: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.2073: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.2074: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.2075: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog Source.2076: DFBPPR3826 ---- Plant proteins ---- Profilin LP04 Source.2077: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.2078: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12 Source.2079: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35 Source.2080: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.2081: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.2082: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.2083: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.2084: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.2085: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39 Source.2086: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.2087: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54 Source.2088: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.2089: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78 Source.2090: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73 Source.2091: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8 Source.2092: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic Source.2093: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.2094: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.2095: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.2096: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.2097: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62 Source.2098: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.2099: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.2100: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic Source.2101: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.2102: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1 Source.2103: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.2104: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.2105: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.2106: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.2107: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.2108: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2 Source.2109: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10 Source.2110: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.2111: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31 Source.2112: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.2113: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.2114: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.2115: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.2116: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.2117: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.2118: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.2119: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.2120: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3 Source.2121: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.2122: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.2123: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.2124: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.2125: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.2126: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4 Source.2127: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.2128: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.2129: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.2130: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2 Source.2131: DFBPPR3914 ---- Plant proteins ---- Derlin-2 Source.2132: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b Source.2133: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.2134: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1 Source.2135: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9 Source.2136: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.2137: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13 Source.2138: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.2139: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.2140: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.2141: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.2142: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.2143: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14 Source.2144: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.2145: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein Source.2146: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.2147: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7 Source.2148: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.2149: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.2150: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.2151: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic Source.2152: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3 Source.2153: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1 Source.2154: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.2155: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.2156: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1 Source.2157: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial Source.2158: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.2159: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.2160: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic Source.2161: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.2162: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.2163: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19 Source.2164: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.2165: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.2166: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4 Source.2167: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.2168: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2 Source.2169: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1 Source.2170: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.2171: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.2172: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.2173: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.2174: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7 Source.2175: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2 Source.2176: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.2177: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.2178: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.2179: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2 Source.2180: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.2181: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.2182: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.2183: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.2184: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.2185: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.2186: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.2187: DFBPPR4004 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.2188: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.2189: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.2190: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.2191: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.2192: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.2193: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3 Source.2194: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.2195: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.2196: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.2197: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1 Source.2198: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.2199: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.2200: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.2201: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.2202: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27 Source.2203: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.2204: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G Source.2205: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.2206: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.2207: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6 Source.2208: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.2209: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.2210: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.2211: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.2212: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.2213: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25 Source.2214: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11 Source.2215: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.2216: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.2217: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2218: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog Source.2219: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.2220: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.2221: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.2222: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4 Source.2223: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.2224: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.2225: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.2226: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.2227: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.2228: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.2229: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.2230: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.2231: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.2232: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.2233: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.2234: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.2235: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D Source.2236: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.2237: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29 Source.2238: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.2239: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.2240: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.2241: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.2242: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.2243: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.2244: DFBPPR4101 ---- Plant proteins ---- Succinate dehydrogenase subunit 7, mitochondrial Source.2245: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.2246: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.2247: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2 Source.2248: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.2249: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43 Source.2250: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.2251: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.2252: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4 Source.2253: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.2254: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.2255: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2 Source.2256: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2 Source.2257: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75 Source.2258: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5 Source.2259: DFBPPR4128 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 2 Source.2260: DFBPPR4129 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 1 Source.2261: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.2262: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.2263: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.2264: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7 Source.2265: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.2266: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.2267: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.2268: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.2269: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2 Source.2270: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.2271: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.2272: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.2273: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.2274: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.2275: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.2276: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.2277: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6 Source.2278: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.2279: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.2280: DFBPPR4164 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 1 Source.2281: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.2282: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3 Source.2283: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.2284: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.2285: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3 Source.2286: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.2287: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I Source.2288: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.2289: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.2290: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.2291: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.2292: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3 Source.2293: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.2294: DFBPPR4199 ---- Plant proteins ---- Protein transport protein Sec61 subunit gamma Source.2295: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.2296: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.2297: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27 Source.2298: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.2299: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.2300: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.2301: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.2302: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.2303: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.2304: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.2305: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.2306: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.2307: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.2308: DFBPPR4223 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim13 Source.2309: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.2310: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A Source.2311: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2 Source.2312: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.2313: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.2314: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4 Source.2315: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.2316: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.2317: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.2318: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.2319: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H Source.2320: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.2321: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.2322: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.2323: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.2324: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2 Source.2325: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.2326: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.2327: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.2328: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.2329: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2 Source.2330: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.2331: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.2332: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.2333: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.2334: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400 Source.2335: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3 Source.2336: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.2337: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6 Source.2338: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.2339: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.2340: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.2341: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.2342: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B Source.2343: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1 Source.2344: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.2345: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.2346: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.2347: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.2348: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.2349: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.2350: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.2351: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.2352: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4 Source.2353: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.2354: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.2355: DFBPPR4297 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.2356: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.2357: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.2358: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.2359: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1 Source.2360: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28 Source.2361: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.2362: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.2363: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.2364: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.2365: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.2366: DFBPPR4320 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.2367: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1 Source.2368: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.2369: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.2370: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.2371: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.2372: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.2373: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5 Source.2374: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.2375: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5 Source.2376: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2 Source.2377: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic Source.2378: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.2379: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.2380: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.2381: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.2382: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25 Source.2383: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.2384: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.2385: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.2386: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.2387: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.2388: DFBPPR4364 ---- Plant proteins ---- Two-component response regulator ORR42 Source.2389: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.2390: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12 Source.2391: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.2392: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.2393: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.2394: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.2395: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.2396: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.2397: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.2398: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1 Source.2399: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.2400: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.2401: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.2402: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.2403: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.2404: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.2405: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.2406: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.2407: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.2408: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.2409: DFBPPR4400 ---- Plant proteins ---- Putative calmodulin-like protein 6 Source.2410: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.2411: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25 Source.2412: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.2413: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.2414: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5 Source.2415: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.2416: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4 Source.2417: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.2418: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.2419: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.2420: DFBPPR4420 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 1 Source.2421: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.2422: DFBPPR4422 ---- Plant proteins ---- Thioredoxin-like protein CXXS1 Source.2423: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.2424: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.2425: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.2426: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.2427: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9 Source.2428: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.2429: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.2430: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog Source.2431: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.2432: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.2433: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.2434: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.2435: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1 Source.2436: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.2437: DFBPPR4440 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic Source.2438: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.2439: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.2440: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.2441: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.2442: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2 Source.2443: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.2444: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.2445: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic Source.2446: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.2447: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.2448: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13 Source.2449: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.2450: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.2451: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.2452: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.2453: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.2454: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2 Source.2455: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15 Source.2456: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.2457: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.2458: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.2459: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.2460: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.2461: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.2462: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30 Source.2463: DFBPPR4483 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 11 Source.2464: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.2465: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4 Source.2466: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1 Source.2467: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1 Source.2468: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.2469: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.2470: DFBPPR4491 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.2471: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.2472: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.2473: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial Source.2474: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.2475: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.2476: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.2477: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.2478: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.2479: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.2480: DFBPPR4514 ---- Plant proteins ---- Actin-depolymerizing factor 10 Source.2481: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.2482: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.2483: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3 Source.2484: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.2485: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.2486: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.2487: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.2488: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.2489: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.2490: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.2491: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.2492: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.2493: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.2494: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14 Source.2495: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7 Source.2496: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.2497: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.2498: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.2499: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.2500: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase Source.2501: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.2502: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.2503: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.2504: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.2505: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F Source.2506: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15 Source.2507: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1 Source.2508: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1 Source.2509: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.2510: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5 Source.2511: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.2512: DFBPPR4572 ---- Plant proteins ---- DNA-binding protein S1FA1 Source.2513: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1 Source.2514: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2 Source.2515: DFBPPR4576 ---- Plant proteins ---- Probable calcium-binding protein CML7 Source.2516: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.2517: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3 Source.2518: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.2519: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.2520: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.2521: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.2522: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.2523: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.2524: DFBPPR4599 ---- Plant proteins ---- 60S ribosomal protein L37a-1 Source.2525: DFBPPR4600 ---- Plant proteins ---- Probable U3 small nucleolar RNA-associated protein 11 Source.2526: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.2527: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.2528: DFBPPR4606 ---- Plant proteins ---- ACT domain-containing protein DS12, chloroplastic Source.2529: DFBPPR4607 ---- Plant proteins ---- Protein LOL2 Source.2530: DFBPPR4608 ---- Plant proteins ---- Metallothionein-like protein 3A Source.2531: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16 Source.2532: DFBPPR4610 ---- Plant proteins ---- Protein LOL3 Source.2533: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.2534: DFBPPR4612 ---- Plant proteins ---- 60S ribosomal protein L37a-2 Source.2535: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.2536: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic Source.2537: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3 Source.2538: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.2539: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3 Source.2540: DFBPPR4619 ---- Plant proteins ---- Actin-depolymerizing factor 9 Source.2541: DFBPPR4621 ---- Plant proteins ---- Actin-depolymerizing factor 6 Source.2542: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.2543: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19 Source.2544: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11 Source.2545: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.2546: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43 Source.2547: DFBPPR4636 ---- Plant proteins ---- Putative actin-depolymerizing factor 8 Source.2548: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3 Source.2549: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.2550: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.2551: DFBPPR4642 ---- Plant proteins ---- Actin-depolymerizing factor 1 Source.2552: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.2553: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.2554: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.2555: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1 Source.2556: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.2557: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.2558: DFBPPR4659 ---- Plant proteins ---- Metallothionein-like protein 3B Source.2559: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.2560: DFBPPR4663 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 6 Source.2561: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4 Source.2562: DFBPPR4669 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 8 Source.2563: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1 Source.2564: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3 Source.2565: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100 Source.2566: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.2567: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.2568: DFBPPR4683 ---- Plant proteins ---- DNA-binding protein S1FA2 Source.2569: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17 Source.2570: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D Source.2571: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.2572: DFBPPR4690 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 44 Source.2573: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.2574: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68 Source.2575: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.2576: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2 Source.2577: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.2578: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8 Source.2579: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26 Source.2580: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.2581: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.2582: DFBPPR4713 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 14 Source.2583: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800 Source.2584: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11 Source.2585: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18 Source.2586: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.2587: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.2588: DFBPPR4726 ---- Plant proteins ---- 40S ribosomal protein S10-2 Source.2589: DFBPPR4728 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 12 Source.2590: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic Source.2591: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.2592: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.2593: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.2594: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.2595: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.2596: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9 Source.2597: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic Source.2598: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.2599: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.2600: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2 Source.2601: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8 Source.2602: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.2603: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13 Source.2604: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A Source.2605: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.2606: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1 Source.2607: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100 Source.2608: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.2609: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.2610: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3 Source.2611: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4 Source.2612: DFBPPR4783 ---- Plant proteins ---- Putative ripening-related protein 7 Source.2613: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900 Source.2614: DFBPPR4786 ---- Plant proteins ---- B3 domain-containing protein Os12g0592300 Source.2615: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1 Source.2616: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.2617: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2 Source.2618: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.2619: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100 Source.2620: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100 Source.2621: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6 Source.2622: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.2623: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.2624: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1 Source.2625: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.2626: DFBPPR4815 ---- Plant proteins ---- 40S ribosomal protein S10-1 Source.2627: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.2628: DFBPPR4819 ---- Plant proteins ---- B3 domain-containing protein Os08g0324300 Source.2629: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000 Source.2630: DFBPPR4821 ---- Plant proteins ---- Protein SPIRAL1-like 4 Source.2631: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.2632: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2 Source.2633: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.2634: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a Source.2635: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000 Source.2636: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36 Source.2637: DFBPPR4832 ---- Plant proteins ---- Protein GOS9 Source.2638: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.2639: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.2640: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2 Source.2641: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3 Source.2642: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400 Source.2643: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.2644: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800 Source.2645: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5 Source.2646: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080 Source.2647: DFBPPR4854 ---- Plant proteins ---- Putative ripening-related protein 6 Source.2648: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500 Source.2649: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.2650: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.2651: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090 Source.2652: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300 Source.2653: DFBPPR4864 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0625400 Source.2654: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.2655: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42 Source.2656: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100 Source.2657: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820 Source.2658: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.2659: DFBPPR4871 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0242900 Source.2660: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1 Source.2661: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.2662: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10 Source.2663: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58 Source.2664: DFBPPR4881 ---- Plant proteins ---- Costars family protein Source.2665: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.2666: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.2667: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.2668: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.2669: DFBPPR4896 ---- Plant proteins ---- Thioredoxin H1 Source.2670: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1 Source.2671: DFBPPR4898 ---- Plant proteins ---- Serine racemase Source.2672: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF Source.2673: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.2674: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.2675: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.2676: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2 Source.2677: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase Source.2678: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.2679: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.2680: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.2681: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.2682: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.2683: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.2684: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.2685: DFBPPR4915 ---- Plant proteins ---- Chitinase 2 Source.2686: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.2687: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1 Source.2688: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.2689: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1 Source.2690: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A Source.2691: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.2692: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic Source.2693: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.2694: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.2695: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1 Source.2696: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6 Source.2697: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4 Source.2698: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.2699: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.2700: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30 Source.2701: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.2702: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70 Source.2703: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.2704: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.2705: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.2706: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1 Source.2707: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic Source.2708: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.2709: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.2710: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.2711: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.2712: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G Source.2713: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d Source.2714: DFBPPR4949 ---- Plant proteins ---- Probable histone H2AXb Source.2715: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23 Source.2716: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.2717: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.2718: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.2719: DFBPPR4963 ---- Plant proteins ---- Soybean toxin 17 kDa chain Source.2720: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.2721: DFBPPR4966 ---- Plant proteins ---- Glycinin G5 Source.2722: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.2723: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.2724: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.2725: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.2726: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase Source.2727: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.2728: DFBPPR4973 ---- Plant proteins ---- Glycinin G2 Source.2729: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.2730: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.2731: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.2732: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.2733: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase Source.2734: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1 Source.2735: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1 Source.2736: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1 Source.2737: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1 Source.2738: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.2739: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.2740: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.2741: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.2742: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.2743: DFBPPR4992 ---- Plant proteins ---- Glycinin G3 Source.2744: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1 Source.2745: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.2746: DFBPPR4995 ---- Plant proteins ---- Glycinin G4 Source.2747: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.2748: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.2749: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.2750: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.2751: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase Source.2752: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.2753: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.2754: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.2755: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.2756: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.2757: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.2758: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.2759: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.2760: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.2761: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.2762: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin Source.2763: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.2764: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.2765: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.2766: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.2767: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.2768: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.2769: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB Source.2770: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase Source.2771: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase Source.2772: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.2773: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.2774: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.2775: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.2776: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.2777: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.2778: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.2779: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D Source.2780: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.2781: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1 Source.2782: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.2783: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.2784: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.2785: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.2786: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.2787: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.2788: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2 Source.2789: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.2790: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein Source.2791: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.2792: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog Source.2793: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.2794: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.2795: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic Source.2796: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2797: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.2798: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.2799: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.2800: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic Source.2801: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2802: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.2803: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.2804: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2 Source.2805: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.2806: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.2807: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1 Source.2808: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.2809: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.2810: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.2811: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.2812: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.2813: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.2814: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.2815: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase Source.2816: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3 Source.2817: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.2818: DFBPPR5094 ---- Plant proteins ---- Protein PROPEP914 Source.2819: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic Source.2820: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.2821: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.2822: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1 Source.2823: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.2824: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.2825: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.2826: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.2827: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial Source.2828: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A Source.2829: DFBPPR5111 ---- Plant proteins ---- Lectin Source.2830: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.2831: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.2832: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.2833: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.2834: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.2835: DFBPPR5124 ---- Plant proteins ---- Nodulin-26 Source.2836: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10 Source.2837: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.2838: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.2839: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2 Source.2840: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha Source.2841: DFBPPR5134 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.2842: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6 Source.2843: DFBPPR5137 ---- Plant proteins ---- Cytochrome f Source.2844: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.2845: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.2846: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2 Source.2847: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase Source.2848: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.2849: DFBPPR5144 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-A Source.2850: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.2851: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2 Source.2852: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.2853: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.2854: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.2855: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.2856: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.2857: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.2858: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.2859: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.2860: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.2861: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.2862: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.2863: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.2864: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein Source.2865: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2866: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.2867: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.2868: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6 Source.2869: DFBPPR5179 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.2870: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic Source.2871: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1 Source.2872: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1 Source.2873: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.2874: DFBPPR5185 ---- Plant proteins ---- Actin-1 Source.2875: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.2876: DFBPPR5187 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.2877: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A Source.2878: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.2879: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.2880: DFBPPR5196 ---- Plant proteins ---- Arginase Source.2881: DFBPPR5197 ---- Plant proteins ---- Nodulin-21 Source.2882: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.2883: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.2884: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.2885: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.2886: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.2887: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.2888: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.2889: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial Source.2890: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.2891: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.2892: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.2893: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9 Source.2894: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.2895: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.2896: DFBPPR5219 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.2897: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic Source.2898: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.2899: DFBPPR5222 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.2900: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein Source.2901: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.2902: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.2903: DFBPPR5226 ---- Plant proteins ---- Chalcone--flavonone isomerase 1 Source.2904: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.2905: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.2906: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.2907: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.2908: DFBPPR5233 ---- Plant proteins ---- Ras-related protein Rab7 Source.2909: DFBPPR5235 ---- Plant proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.2910: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.2911: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.2912: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.2913: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1 Source.2914: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2 Source.2915: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic Source.2916: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2 Source.2917: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.2918: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic Source.2919: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic Source.2920: DFBPPR5253 ---- Plant proteins ---- CASP-like protein 7 Source.2921: DFBPPR5254 ---- Plant proteins ---- Chalcone--flavonone isomerase 3 Source.2922: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.2923: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic Source.2924: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.2925: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.2926: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.2927: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3 Source.2928: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.2929: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase Source.2930: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.2931: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.2932: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.2933: DFBPPR5272 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.2934: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.2935: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9 Source.2936: DFBPPR5276 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.2937: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.2938: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA Source.2939: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.2940: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6 Source.2941: DFBPPR5281 ---- Plant proteins ---- Photosystem II reaction center protein K Source.2942: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.2943: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.2944: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.2945: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1 Source.2946: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.2947: DFBPPR5289 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic Source.2948: DFBPPR5290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.2949: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic Source.2950: DFBPPR5293 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.2951: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.2952: DFBPPR5297 ---- Plant proteins ---- Protein PROPEP890 Source.2953: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.2954: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.2955: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.2956: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1 Source.2957: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein Source.2958: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1 Source.2959: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1 Source.2960: DFBPPR5314 ---- Plant proteins ---- Hydrophobic seed protein Source.2961: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2 Source.2962: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.2963: DFBPPR5320 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.2964: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.2965: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6 Source.2966: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.2967: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1 Source.2968: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51 Source.2969: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.2970: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1 Source.2971: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.2972: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.2973: DFBPPR5342 ---- Plant proteins ---- Nodulin-44 Source.2974: DFBPPR5343 ---- Plant proteins ---- 50S ribosomal protein L33, chloroplastic Source.2975: DFBPPR5344 ---- Plant proteins ---- Nodulin-16 Source.2976: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1 Source.2977: DFBPPR5346 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.2978: DFBPPR5347 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.2979: DFBPPR5348 ---- Plant proteins ---- 50S ribosomal protein L36, chloroplastic Source.2980: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein Source.2981: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11 Source.2982: DFBPPR5355 ---- Plant proteins ---- Early nodulin-93 Source.2983: DFBPPR5356 ---- Plant proteins ---- Nodulin-23 Source.2984: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B Source.2985: DFBPPR5363 ---- Plant proteins ---- Auxin-induced protein 10A5 Source.2986: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.2987: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.2988: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.2989: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.2990: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1 Source.2991: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.2992: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.2993: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.2994: DFBPPR5385 ---- Plant proteins ---- Profilin-5 Source.2995: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.2996: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.2997: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.2998: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4 Source.2999: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.3000: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1 Source.3001: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.3002: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.3003: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.3004: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.3005: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.3006: DFBPPR5401 ---- Plant proteins ---- Profilin-1 Source.3007: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.3008: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.3009: DFBPPR5407 ---- Plant proteins ---- Profilin-2 Source.3010: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.3011: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.3012: DFBPPR5410 ---- Plant proteins ---- Profilin-4 Source.3013: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.3014: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.3015: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.3016: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.3017: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.3018: DFBPPR5417 ---- Plant proteins ---- Profilin-3 Source.3019: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1 Source.3020: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.3021: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.3022: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.3023: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.3024: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.3025: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.3026: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.3027: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.3028: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.3029: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.3030: DFBPPR5432 ---- Plant proteins ---- Expansin-B1 Source.3031: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1 Source.3032: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase Source.3033: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.3034: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.3035: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1 Source.3036: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1 Source.3037: DFBPPR5443 ---- Plant proteins ---- Protein BUNDLE SHEATH DEFECTIVE 2, chloroplastic Source.3038: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog Source.3039: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.3040: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.3041: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.3042: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.3043: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.3044: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1 Source.3045: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha Source.3046: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.3047: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.3048: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2 Source.3049: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.3050: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.3051: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.3052: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.3053: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5 Source.3054: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic Source.3055: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.3056: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.3057: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic Source.3058: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3059: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.3060: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.3061: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.3062: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.3063: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.3064: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.3065: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.3066: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.3067: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic Source.3068: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.3069: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.3070: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.3071: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic Source.3072: DFBPPR5492 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit Source.3073: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.3074: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.3075: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.3076: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66 Source.3077: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.3078: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.3079: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain Source.3080: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.3081: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.3082: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme Source.3083: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.3084: DFBPPR5508 ---- Plant proteins ---- Expansin-B9 Source.3085: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3086: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.3087: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.3088: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein Source.3089: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain Source.3090: DFBPPR5515 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase, microsomal Source.3091: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.3092: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.3093: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase Source.3094: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.3095: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.3096: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.3097: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.3098: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase Source.3099: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1 Source.3100: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3101: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase Source.3102: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.3103: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3104: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.3105: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain Source.3106: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain Source.3107: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.3108: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.3109: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.3110: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic Source.3111: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.3112: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase Source.3113: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.3114: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A Source.3115: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.3116: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1 Source.3117: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.3118: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic Source.3119: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10 Source.3120: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.3121: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic Source.3122: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.3123: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3124: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.3125: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.3126: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.3127: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1 Source.3128: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.3129: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.3130: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.3131: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.3132: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.3133: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.3134: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.3135: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3136: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1 Source.3137: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1 Source.3138: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.3139: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3140: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.3141: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6 Source.3142: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.3143: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.3144: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.3145: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3 Source.3146: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.3147: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.3148: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.3149: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.3150: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3151: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase Source.3152: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.3153: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.3154: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.3155: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.3156: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.3157: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.3158: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.3159: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9 Source.3160: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6 Source.3161: DFBPPR5627 ---- Plant proteins ---- Expansin-B11 Source.3162: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.3163: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2 Source.3164: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.3165: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.3166: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.3167: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.3168: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.3169: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.3170: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.3171: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.3172: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.3173: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.3174: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.3175: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.3176: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.3177: DFBPPR5652 ---- Plant proteins ---- Expansin-B10 Source.3178: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.3179: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5 Source.3180: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.3181: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1 Source.3182: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.3183: DFBPPR5661 ---- Plant proteins ---- Albumin b-32 Source.3184: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.3185: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.3186: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.3187: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.3188: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3189: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.3190: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.3191: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein Source.3192: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3 Source.3193: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.3194: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.3195: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.3196: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.3197: DFBPPR5689 ---- Plant proteins ---- Profilin-9 Source.3198: DFBPPR5690 ---- Plant proteins ---- Profilin-7 Source.3199: DFBPPR5691 ---- Plant proteins ---- Profilin-10 Source.3200: DFBPPR5692 ---- Plant proteins ---- Profilin-6 Source.3201: DFBPPR5693 ---- Plant proteins ---- Profilin-11 Source.3202: DFBPPR5694 ---- Plant proteins ---- Profilin-8 Source.3203: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.3204: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3205: DFBPPR5697 ---- Plant proteins ---- Profilin-12 Source.3206: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.3207: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.3208: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5 Source.3209: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.3210: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1 Source.3211: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase Source.3212: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.3213: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4 Source.3214: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1 Source.3215: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.3216: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3217: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5 Source.3218: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2 Source.3219: DFBPPR5722 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.3220: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.3221: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.3222: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.3223: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3 Source.3224: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.3225: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.3226: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1 Source.3227: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.3228: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23 Source.3229: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3230: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1 Source.3231: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2 Source.3232: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.3233: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1 Source.3234: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.3235: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.3236: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.3237: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.3238: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.3239: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1 Source.3240: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.3241: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.3242: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.3243: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.3244: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.3245: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1 Source.3246: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3247: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2 Source.3248: DFBPPR5772 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.3249: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.3250: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.3251: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.3252: DFBPPR5781 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR3 Source.3253: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.3254: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3255: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.3256: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.3257: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.3258: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.3259: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.3260: DFBPPR5794 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2 Source.3261: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1 Source.3262: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3263: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.3264: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.3265: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic Source.3266: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.3267: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.3268: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase Source.3269: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.3270: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a Source.3271: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.3272: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.3273: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3274: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.3275: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic Source.3276: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1 Source.3277: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic Source.3278: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha Source.3279: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2 Source.3280: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.3281: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.3282: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.3283: DFBPPR5828 ---- Plant proteins ---- Cytochrome f Source.3284: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.3285: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.3286: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.3287: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.3288: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.3289: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.3290: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A Source.3291: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3292: DFBPPR5839 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic Source.3293: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19 Source.3294: DFBPPR5841 ---- Plant proteins ---- Actin-1 Source.3295: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.3296: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.3297: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3 Source.3298: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.3299: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic Source.3300: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.3301: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.3302: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4 Source.3303: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.3304: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.3305: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.3306: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3307: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.3308: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.3309: DFBPPR5864 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.3310: DFBPPR5865 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.3311: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5 Source.3312: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16 Source.3313: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1 Source.3314: DFBPPR5872 ---- Plant proteins ---- 50S ribosomal protein L29, chloroplastic Source.3315: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3316: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.3317: DFBPPR5875 ---- Plant proteins ---- Actin-depolymerizing factor 3 Source.3318: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor Source.3319: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.3320: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic Source.3321: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.3322: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3323: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.3324: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1 Source.3325: DFBPPR5892 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.3326: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic Source.3327: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.3328: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.3329: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.3330: DFBPPR5898 ---- Plant proteins ---- ATP synthase protein MI25 Source.3331: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1 Source.3332: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3333: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.3334: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase Source.3335: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.3336: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3337: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.3338: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3 Source.3339: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.3340: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.3341: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.3342: DFBPPR5919 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.3343: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1 Source.3344: DFBPPR5921 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3345: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.3346: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein Source.3347: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2 Source.3348: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1 Source.3349: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.3350: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3351: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic Source.3352: DFBPPR5942 ---- Plant proteins ---- GTP-binding protein YPTM2 Source.3353: DFBPPR5944 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.3354: DFBPPR5946 ---- Plant proteins ---- Maturase K Source.3355: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2 Source.3356: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.3357: DFBPPR5954 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.3358: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.3359: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2 Source.3360: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.3361: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.3362: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein Source.3363: DFBPPR5968 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.3364: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.3365: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.3366: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6 Source.3367: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.3368: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.3369: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1 Source.3370: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.3371: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.3372: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.3373: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38 Source.3374: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.3375: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.3376: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1 Source.3377: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2 Source.3378: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1 Source.3379: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2 Source.3380: DFBPPR6007 ---- Plant proteins ---- Photosystem II reaction center protein K Source.3381: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.3382: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1 Source.3383: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9 Source.3384: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.3385: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.3386: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.3387: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.3388: DFBPPR6021 ---- Plant proteins ---- Actin-depolymerizing factor 2 Source.3389: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3390: DFBPPR6024 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.3391: DFBPPR6026 ---- Plant proteins ---- Actin-depolymerizing factor 1 Source.3392: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2 Source.3393: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.3394: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.3395: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2 Source.3396: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.3397: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4 Source.3398: DFBPPR6046 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3399: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1 Source.3400: DFBPPR6052 ---- Plant proteins ---- Cystatin-1 Source.3401: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.3402: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.3403: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.3404: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3405: DFBPPR6066 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.3406: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.3407: DFBPPR6070 ---- Plant proteins ---- 40S ribosomal protein S8 Source.3408: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3409: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2 Source.3410: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.3411: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1 Source.3412: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1 Source.3413: DFBPPR6091 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic Source.3414: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10 Source.3415: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1 Source.3416: DFBPPR6099 ---- Plant proteins ---- CASP-like protein 16 Source.3417: DFBPPR6103 ---- Plant proteins ---- 60S ribosomal protein L10 Source.3418: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.3419: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.3420: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4 Source.3421: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3422: DFBPPR6117 ---- Plant proteins ---- Putative uncharacterized protein ycf15 Source.3423: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.3424: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11 Source.3425: DFBPPR6121 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.3426: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.3427: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3 Source.3428: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A Source.3429: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.3430: DFBPPR6128 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3431: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13 Source.3432: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49 Source.3433: DFBPPR6136 ---- Plant proteins ---- Cell number regulator 11 Source.3434: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73 Source.3435: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6 Source.3436: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17 Source.3437: DFBPPR6151 ---- Plant proteins ---- Uncharacterized protein ycf68 Source.3438: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8 Source.3439: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7 Source.3440: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1 Source.3441: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.3442: DFBPPR6158 ---- Plant proteins ---- 60S ribosomal protein L32 Source.3443: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2 Source.3444: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4 Source.3445: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.3446: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3 Source.3447: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B Source.3448: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid Source.3449: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A Source.3450: DFBPPR6181 ---- Plant proteins ---- Unknown protein from spot 154 of 2D-PAGE of etiolated coleoptile Source.3451: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.3452: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.3453: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.3454: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.3455: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.3456: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.3457: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34 Source.3458: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.3459: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1 Source.3460: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.3461: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.3462: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1 Source.3463: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic Source.3464: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.3465: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.3466: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.3467: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1 Source.3468: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.3469: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.3470: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3471: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.3472: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.3473: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.3474: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.3475: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.3476: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.3477: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.3478: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic Source.3479: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.3480: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.3481: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.3482: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.3483: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.3484: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.3485: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.3486: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.3487: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.3488: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.3489: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.3490: DFBPPR6262 ---- Plant proteins ---- Nodule lectin Source.3491: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.3492: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.3493: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.3494: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic Source.3495: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1 Source.3496: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3497: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1 Source.3498: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic Source.3499: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.3500: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3501: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.3502: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3503: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2 Source.3504: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.3505: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta Source.3506: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.3507: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.3508: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.3509: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.3510: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3511: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.3512: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog Source.3513: DFBPPR6303 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic Source.3514: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.3515: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3516: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3517: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.3518: DFBPPR6310 ---- Plant proteins ---- Catalase Source.3519: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.3520: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.3521: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.3522: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.3523: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic Source.3524: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic Source.3525: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.3526: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.3527: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.3528: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH Source.3529: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2 Source.3530: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.3531: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F Source.3532: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.3533: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.3534: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.3535: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.3536: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.3537: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing] Source.3538: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing] Source.3539: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.3540: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3541: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5 Source.3542: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.3543: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.3544: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.3545: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic Source.3546: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.3547: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.3548: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.3549: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.3550: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.3551: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.3552: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.3553: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1 Source.3554: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3555: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.3556: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.3557: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.3558: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.3559: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.3560: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.3561: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D Source.3562: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C Source.3563: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.3564: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3565: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.3566: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic Source.3567: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.3568: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4 Source.3569: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.3570: DFBPPR6392 ---- Plant proteins ---- Cytochrome f Source.3571: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.3572: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.3573: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3 Source.3574: DFBPPR6397 ---- Plant proteins ---- Photosystem II reaction center protein K Source.3575: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3576: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.3577: DFBPPR6401 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3578: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.3579: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.3580: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase Source.3581: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.3582: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase Source.3583: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.3584: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3585: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.3586: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.3587: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.3588: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.3589: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.3590: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.3591: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.3592: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.3593: DFBPPR6421 ---- Plant proteins ---- 50S ribosomal protein L24, chloroplastic Source.3594: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3595: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3596: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.3597: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.3598: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.3599: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1 Source.3600: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic Source.3601: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.3602: DFBPPR6430 ---- Plant proteins ---- Legumin J Source.3603: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.3604: DFBPPR6433 ---- Plant proteins ---- Histone H1 Source.3605: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.3606: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A Source.3607: DFBPPR6440 ---- Plant proteins ---- Cell division control protein 2 homolog 2 Source.3608: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.3609: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206 Source.3610: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.3611: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.3612: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.3613: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.3614: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.3615: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.3616: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.3617: DFBPPR6453 ---- Plant proteins ---- Convicilin Source.3618: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.3619: DFBPPR6455 ---- Plant proteins ---- Legumin K Source.3620: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.3621: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase Source.3622: DFBPPR6458 ---- Plant proteins ---- Convicilin Source.3623: DFBPPR6459 ---- Plant proteins ---- Legumin B Source.3624: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.3625: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.3626: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3627: DFBPPR6464 ---- Plant proteins ---- 50S ribosomal protein 5, chloroplastic Source.3628: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.3629: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.3630: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1 Source.3631: DFBPPR6470 ---- Plant proteins ---- Vicilin Source.3632: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.3633: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein Source.3634: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.3635: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.3636: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic Source.3637: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.3638: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic Source.3639: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1 Source.3640: DFBPPR6483 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.3641: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic Source.3642: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2 Source.3643: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1 Source.3644: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.3645: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E Source.3646: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.3647: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5 Source.3648: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic Source.3649: DFBPPR6499 ---- Plant proteins ---- Provicilin Source.3650: DFBPPR6500 ---- Plant proteins ---- Defensin-like protein 39 Source.3651: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.3652: DFBPPR6507 ---- Plant proteins ---- Ribosomal protein S10, mitochondrial Source.3653: DFBPPR6510 ---- Plant proteins ---- 50S ribosomal protein 6, chloroplastic Source.3654: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.3655: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3656: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.3657: DFBPPR6520 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.3658: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase Source.3659: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3660: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.3661: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.3662: DFBPPR6527 ---- Plant proteins ---- Photosystem II reaction center protein Z Source.3663: DFBPPR6529 ---- Plant proteins ---- Photosystem II reaction center protein J Source.3664: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase Source.3665: DFBPPR6532 ---- Plant proteins ---- 22.7 kDa class IV heat shock protein Source.3666: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.3667: DFBPPR6537 ---- Plant proteins ---- Protein PsbN Source.3668: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3669: DFBPPR6539 ---- Plant proteins ---- Defensin-like protein 230 Source.3670: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin Source.3671: DFBPPR6541 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.3672: DFBPPR6542 ---- Plant proteins ---- Maturase K Source.3673: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49 Source.3674: DFBPPR6549 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.3675: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.3676: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.3677: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.3678: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3679: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3680: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.3681: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.3682: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27 Source.3683: DFBPPR6561 ---- Plant proteins ---- Blue copper protein Source.3684: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.3685: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.3686: DFBPPR6574 ---- Plant proteins ---- Probable 60S ribosomal protein L14 Source.3687: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4 Source.3688: DFBPPR6584 ---- Plant proteins ---- Organ-specific protein S2 Source.3689: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34 Source.3690: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176 Source.3691: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3692: DFBPPR6619 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic Source.3693: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3694: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.3695: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.3696: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.3697: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.3698: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.3699: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1 Source.3700: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.3701: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.3702: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.3703: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.3704: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D Source.3705: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.3706: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.3707: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase Source.3708: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.3709: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.3710: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8 Source.3711: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase Source.3712: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic Source.3713: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A Source.3714: DFBPPR6656 ---- Plant proteins ---- Catalase Source.3715: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.3716: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.3717: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.3718: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.3719: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.3720: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.3721: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.3722: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.3723: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.3724: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.3725: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19 Source.3726: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8 Source.3727: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.3728: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.3729: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B Source.3730: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A Source.3731: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.3732: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5 Source.3733: DFBPPR6684 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor WSCI Source.3734: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10 Source.3735: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.3736: DFBPPR6690 ---- Plant proteins ---- Histone H2A.2.2 Source.3737: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1 Source.3738: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.3739: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.3740: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1 Source.3741: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.3742: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3743: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase Source.3744: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2 Source.3745: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.3746: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain Source.3747: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2 Source.3748: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.3749: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1 Source.3750: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7 Source.3751: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.3752: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase Source.3753: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.3754: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.3755: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B Source.3756: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3757: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase Source.3758: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.3759: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase Source.3760: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.3761: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3762: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.3763: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase Source.3764: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D Source.3765: DFBPPR6745 ---- Plant proteins ---- Purothionin A-1 Source.3766: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.3767: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.3768: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic Source.3769: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4 Source.3770: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.3771: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase Source.3772: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.3773: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.3774: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.3775: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.3776: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3777: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.3778: DFBPPR6774 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.3779: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6 Source.3780: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.3781: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.3782: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3783: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.3784: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.3785: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3786: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.3787: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7 Source.3788: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha Source.3789: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta Source.3790: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.3791: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.3792: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.3793: DFBPPR6805 ---- Plant proteins ---- Cytochrome f Source.3794: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.3795: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3796: DFBPPR6808 ---- Plant proteins ---- Profilin-2 Source.3797: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.3798: DFBPPR6810 ---- Plant proteins ---- Profilin-1 Source.3799: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.3800: DFBPPR6813 ---- Plant proteins ---- Profilin-3 Source.3801: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.3802: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3803: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.3804: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.3805: DFBPPR6832 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.3806: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.3807: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.3808: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.3809: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase Source.3810: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.3811: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3812: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3813: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.3814: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.3815: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1 Source.3816: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta Source.3817: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3818: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.3819: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.3820: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1 Source.3821: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A Source.3822: DFBPPR6864 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.3823: DFBPPR6866 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.3824: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.3825: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3826: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.3827: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.3828: DFBPPR6879 ---- Plant proteins ---- Type-5 thionin Source.3829: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.3830: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.3831: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.3832: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212 Source.3833: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3834: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1 Source.3835: DFBPPR6891 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.3836: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial Source.3837: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.3838: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.3839: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.3840: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K Source.3841: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.3842: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.3843: DFBPPR6920 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.3844: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.3845: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin Source.3846: DFBPPR6931 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP Source.3847: DFBPPR6932 ---- Plant proteins ---- ATP synthase protein MI25 Source.3848: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215 Source.3849: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II Source.3850: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV Source.3851: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V Source.3852: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III Source.3853: DFBPPR6941 ---- Plant proteins ---- Alpha/beta-gliadin A-I Source.3854: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin Source.3855: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5 Source.3856: DFBPPR6949 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.3857: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.3858: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.3859: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.3860: DFBPPR6958 ---- Plant proteins ---- Photosystem I assembly protein Ycf3 Source.3861: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.3862: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B Source.3863: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6 Source.3864: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin Source.3865: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7 Source.3866: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I Source.3867: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.3868: DFBPPR6977 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.3869: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.3870: DFBPPR6981 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic Source.3871: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4 Source.3872: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.3873: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10 Source.3874: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9 Source.3875: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8 Source.3876: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3 Source.3877: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2 Source.3878: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3 Source.3879: DFBPPR6998 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX1/CMX3 Source.3880: DFBPPR7000 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX2 Source.3881: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.3882: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.3883: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1 Source.3884: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.3885: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.3886: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.3887: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.3888: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.3889: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.3890: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.3891: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.3892: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.3893: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic Source.3894: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1 Source.3895: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.3896: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.3897: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2 Source.3898: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.3899: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.3900: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.3901: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.3902: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.3903: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.3904: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.3905: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase Source.3906: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1 Source.3907: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.3908: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.3909: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.3910: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain Source.3911: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.3912: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain Source.3913: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3914: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.3915: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.3916: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase Source.3917: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase Source.3918: DFBPPR7076 ---- Plant proteins ---- Acyl carrier protein 1, chloroplastic Source.3919: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.3920: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.3921: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.3922: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.3923: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2 Source.3924: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.3925: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.3926: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.3927: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.3928: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.3929: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.3930: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.3931: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2 Source.3932: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1 Source.3933: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.3934: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3 Source.3935: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4 Source.3936: DFBPPR7098 ---- Plant proteins ---- Acyl carrier protein 2, chloroplastic Source.3937: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain Source.3938: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.3939: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.3940: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.3941: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.3942: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.3943: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.3944: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.3945: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3946: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6 Source.3947: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.3948: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.3949: DFBPPR7114 ---- Plant proteins ---- Acyl carrier protein 3, chloroplastic Source.3950: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.3951: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.3952: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.3953: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1 Source.3954: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3955: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic Source.3956: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2 Source.3957: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1 Source.3958: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2 Source.3959: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.3960: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.3961: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A Source.3962: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3 Source.3963: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.3964: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.3965: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B Source.3966: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A Source.3967: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B Source.3968: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.3969: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.3970: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.3971: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.3972: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.3973: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.3974: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.3975: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.3976: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.3977: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.3978: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.3979: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3 Source.3980: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase Source.3981: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic Source.3982: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2 Source.3983: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.3984: DFBPPR7172 ---- Plant proteins ---- Barwin Source.3985: DFBPPR7175 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2A Source.3986: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta' Source.3987: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha Source.3988: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.3989: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.3990: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.3991: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.3992: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic Source.3993: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.3994: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.3995: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.3996: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.3997: DFBPPR7194 ---- Plant proteins ---- Cytochrome f Source.3998: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.3999: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1 Source.4000: DFBPPR7198 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.4001: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3 Source.4002: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.4003: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.4004: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.4005: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain Source.4006: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.4007: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic Source.4008: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.4009: DFBPPR7209 ---- Plant proteins ---- Photosystem I reaction center subunit psaK, chloroplastic Source.4010: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.4011: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.4012: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.4013: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.4014: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K Source.4015: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.4016: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.4017: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.4018: DFBPPR7227 ---- Plant proteins ---- Non-specific lipid-transfer protein 4.2 Source.4019: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.4020: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.4021: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2 Source.4022: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2 Source.4023: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5 Source.4024: DFBPPR7245 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8 Source.4025: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase Source.4026: DFBPPR7250 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.4027: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.4028: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic Source.4029: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3 Source.4030: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.4031: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic Source.4032: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic Source.4033: DFBPPR7277 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2B Source.4034: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein Source.4035: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.4036: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.4037: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic Source.4038: DFBPPR7292 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.4039: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C Source.4040: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.4041: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3 Source.4042: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.4043: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.4044: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.4045: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.4046: DFBPPR7309 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.4047: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.4048: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.4049: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1 Source.4050: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.4051: DFBPPR7317 ---- Plant proteins ---- Horcolin Source.4052: DFBPPR7318 ---- Plant proteins ---- B3-hordein Source.4053: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein Source.4054: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.4055: DFBPPR7321 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.4056: DFBPPR7322 ---- Plant proteins ---- Metallothionein-like protein 1 Source.4057: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.4058: DFBPPR7329 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic Source.4059: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24 Source.4060: DFBPPR7340 ---- Plant proteins ---- 40S ribosomal protein S12 Source.4061: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7 Source.4062: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.4063: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.4064: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.4065: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic Source.4066: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.4067: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1 Source.4068: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor Source.4069: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20 Source.4070: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase Source.4071: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4 Source.4072: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.4073: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.4074: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.4075: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.4076: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.4077: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.4078: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4 Source.4079: DFBPPR7417 ---- Plant proteins ---- Cruciferin Source.4080: DFBPPR7419 ---- Plant proteins ---- Cytochrome b Source.4081: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a Source.4082: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic Source.4083: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic Source.4084: DFBPPR7426 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.4085: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.4086: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.4087: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.4088: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.4089: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.4090: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.4091: DFBPPR7435 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.4092: DFBPPR7436 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.4093: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.4094: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.4095: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2 Source.4096: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1 Source.4097: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1 Source.4098: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2 Source.4099: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.4100: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.4101: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.4102: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase Source.4103: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.4104: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.4105: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.4106: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.4107: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta Source.4108: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.4109: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2 Source.4110: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.4111: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2 Source.4112: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.4113: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic Source.4114: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.4115: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.4116: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.4117: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.4118: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.4119: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.4120: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.4121: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.4122: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25 Source.4123: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic Source.4124: DFBPPR7482 ---- Plant proteins ---- Napin Source.4125: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V Source.4126: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.4127: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.4128: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44 Source.4129: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.4130: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.4131: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.4132: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.4133: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.4134: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.4135: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.4136: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1 Source.4137: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.4138: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2 Source.4139: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.4140: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2 Source.4141: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS Source.4142: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.4143: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15 Source.4144: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.4145: DFBPPR7520 ---- Plant proteins ---- 40S ribosomal protein S15a Source.4146: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A Source.4147: DFBPPR7522 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.4148: DFBPPR7523 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.4149: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.4150: DFBPPR7525 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.4151: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.4152: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C Source.4153: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.4154: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.4155: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.4156: DFBPPR7540 ---- Plant proteins ---- Ribosomal protein S14, mitochondrial Source.4157: DFBPPR7542 ---- Plant proteins ---- 60S ribosomal protein L5, mitochondrial Source.4158: DFBPPR7545 ---- Plant proteins ---- 60S ribosomal protein L15 Source.4159: DFBPPR7546 ---- Plant proteins ---- 60S ribosomal protein L13-1 Source.4160: DFBPPR7547 ---- Plant proteins ---- 60S ribosomal protein L13-2 Source.4161: DFBPPR7550 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein Source.4162: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.4163: DFBPPR7597 ---- Milk proteins ---- Alpha-lactalbumin Source.4164: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.4165: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.4166: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.4167: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.4168: DFBPPR7609 ---- Milk proteins ---- Lysozyme C Source.4169: DFBPPR7611 ---- Milk proteins ---- Clusterin Source.4170: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.4171: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.4172: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.4173: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase Source.4174: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.4175: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.4176: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.4177: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4 Source.4178: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.4179: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain Source.4180: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.4181: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.4182: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain Source.4183: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein Source.4184: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.4185: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.4186: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.4187: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.4188: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator Source.4189: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.4190: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.4191: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.4192: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.4193: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.4194: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.4195: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.4196: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.4197: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4198: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12 Source.4199: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A Source.4200: DFBPPR7657 ---- Milk proteins ---- Chymosin Source.4201: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein Source.4202: DFBPPR7668 ---- Milk proteins ---- Beta-casein Source.4203: DFBPPR7670 ---- Milk proteins ---- Alpha-lactalbumin B/C Source.4204: DFBPPR7671 ---- Milk proteins ---- Alpha-lactalbumin A Source.4205: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1 Source.4206: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.4207: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin Source.4208: DFBPPR7676 ---- Milk proteins ---- Kappa-casein Source.4209: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A Source.4210: DFBPPR7678 ---- Milk proteins ---- Whey acidic protein Source.4211: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein Source.4212: DFBPPR7681 ---- Milk proteins ---- Beta-casein Source.4213: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.4214: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin Source.4215: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.4216: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin Source.4217: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.4218: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein Source.4219: DFBPPR7691 ---- Milk proteins ---- Albumin Source.4220: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4221: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.4222: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin Source.4223: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B Source.4224: DFBPPR7699 ---- Milk proteins ---- Chymosin Source.4225: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein Source.4226: DFBPPR7706 ---- Milk proteins ---- Beta-casein Source.4227: DFBPPR7708 ---- Milk proteins ---- Late lactation protein B, LLP-B Source.4228: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin Source.4229: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.4230: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.4231: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin Source.4232: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.4233: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.4234: DFBPPR7718 ---- Milk proteins ---- Beta-casein Source.4235: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.4236: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.4237: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1 Source.4238: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.4239: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.4240: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.4241: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.4242: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4243: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.4244: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain Source.4245: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase Source.4246: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2 Source.4247: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1 Source.4248: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.4249: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.4250: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.4251: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.4252: DFBPPR7744 ---- Plant proteins ---- Maturase K Source.4253: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.4254: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.4255: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.4256: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.4257: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase Source.4258: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33 Source.4259: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.4260: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.4261: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.4262: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.4263: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.4264: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.4265: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.4266: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.4267: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.4268: DFBPPR8209 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.4269: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.4270: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1 Source.4271: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.4272: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3 Source.4273: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.4274: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.4275: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain Source.4276: DFBPPR8369 ---- Plant proteins ---- Thioredoxin H-type Source.4277: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.4278: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.4279: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4280: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase Source.4281: DFBPPR8377 ---- Plant proteins ---- Profilin Source.4282: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2 Source.4283: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2 Source.4284: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101 Source.4285: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102 Source.4286: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.4287: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.4288: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.4289: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103 Source.4290: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.4291: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.4292: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B Source.4293: DFBPPR8408 ---- Plant proteins ---- Profilin Source.4294: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17 Source.4295: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101 Source.4296: DFBPPR8412 ---- Plant proteins ---- Oleosin Ara h 10.0102 Source.4297: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3 Source.4298: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.4299: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic Source.4300: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein Source.4301: DFBPPR8420 ---- Plant proteins ---- Peroxygenase Source.4302: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B Source.4303: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.4304: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1 Source.4305: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.4306: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.4307: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.4308: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.4309: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.4310: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.4311: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5 Source.4312: DFBPPR8445 ---- Plant proteins ---- Maturase K Source.4313: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase Source.4314: DFBPPR8448 ---- Plant proteins ---- Maturase K Source.4315: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A Source.4316: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.4317: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.4318: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.4319: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.4320: DFBPPR8458 ---- Plant proteins ---- Catalase Source.4321: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase Source.4322: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.4323: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.4324: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.4325: DFBPPR8468 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.4326: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.4327: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.4328: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K Source.4329: DFBPPR8474 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic Source.4330: DFBPPR8478 ---- Plant proteins ---- 50S ribosomal protein L12-1, chloroplastic Source.4331: DFBPPR8479 ---- Plant proteins ---- 50S ribosomal protein L12-2, chloroplastic Source.4332: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7 Source.4333: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.4334: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.4335: DFBPPR8487 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1 Source.4336: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.4337: DFBPPR8489 ---- Milk proteins ---- Beta-casein Source.4338: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin Source.4339: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.4340: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein Source.4341: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1 Source.4342: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.4343: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.4344: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin Source.4345: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.4346: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.4347: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.4348: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.4349: DFBPPR8505 ---- Milk proteins ---- Chymosin Source.4350: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.4351: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.4352: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2 Source.4353: DFBPPR8512 ---- Milk proteins ---- Lysozyme C, milk isozyme Source.4354: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.4355: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor Source.4356: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.4357: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.4358: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.4359: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase Source.4360: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.4361: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.4362: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.4363: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.4364: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.4365: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.4366: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.4367: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.4368: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.4369: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.4370: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.4371: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.4372: DFBPPR15953 ---- Animal proteins ---- Occludin Source.4373: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.4374: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.4375: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.4376: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase Source.4377: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.4378: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.4379: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.4380: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1 Source.4381: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.4382: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.4383: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.4384: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.4385: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.4386: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.4387: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.4388: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.4389: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.4390: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha Source.4391: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta Source.4392: DFBPPR15982 ---- Animal proteins ---- Triadin Source.4393: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.4394: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor Source.4395: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.4396: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.4397: DFBPPR15992 ---- Animal proteins ---- Phospholemman Source.4398: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.4399: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.4400: DFBPPR15995 ---- Animal proteins ---- Ras-related protein Rab-5A Source.4401: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.4402: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.4403: DFBPPR15998 ---- Animal proteins ---- Ras-related protein Rab-11A Source.4404: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase Source.4405: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.4406: DFBPPR16001 ---- Animal proteins ---- Battenin Source.4407: DFBPPR16002 ---- Animal proteins ---- Podoplanin Source.4408: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.4409: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.4410: DFBPPR16006 ---- Animal proteins ---- Leptin Source.4411: DFBPPR16007 ---- Animal proteins ---- Myocilin Source.4412: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.4413: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.4414: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.4415: DFBPPR16011 ---- Animal proteins ---- Interferon gamma Source.4416: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.4417: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.4418: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.4419: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.4420: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.4421: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.4422: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.4423: DFBPPR16020 ---- Animal proteins ---- Cardiac phospholamban Source.4424: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36 Source.4425: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.4426: DFBPPR16024 ---- Animal proteins ---- Podocalyxin Source.4427: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.4428: DFBPPR16026 ---- Animal proteins ---- Ras-related protein Rab-1A Source.4429: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.4430: DFBPPR16028 ---- Animal proteins ---- Presenilin-1 Source.4431: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.4432: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.4433: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Source.4434: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.4435: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.4436: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.4437: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.4438: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.4439: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.4440: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.4441: DFBPPR16046 ---- Animal proteins ---- C-C motif chemokine 3 Source.4442: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.4443: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.4444: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.4445: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.4446: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4447: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.4448: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.4449: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase Source.4450: DFBPPR16057 ---- Animal proteins ---- Interleukin-8 Source.4451: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.4452: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.4453: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type Source.4454: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor Source.4455: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.4456: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.4457: DFBPPR16065 ---- Animal proteins ---- Caspase-3 Source.4458: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX Source.4459: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.4460: DFBPPR16071 ---- Animal proteins ---- CD44 antigen Source.4461: DFBPPR16073 ---- Animal proteins ---- Endothelin-1 Source.4462: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2 Source.4463: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.4464: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.4465: DFBPPR16078 ---- Animal proteins ---- Ras-related protein Rab-27A Source.4466: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.4467: DFBPPR16083 ---- Animal proteins ---- Annexin A13 Source.4468: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.4469: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.4470: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.4471: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.4472: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.4473: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.4474: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.4475: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.4476: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.4477: DFBPPR16093 ---- Animal proteins ---- Menin Source.4478: DFBPPR16094 ---- Animal proteins ---- Mastin Source.4479: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.4480: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.4481: DFBPPR16098 ---- Animal proteins ---- Fibroblast growth factor 7 Source.4482: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.4483: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B Source.4484: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.4485: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3 Source.4486: DFBPPR16103 ---- Animal proteins ---- Laforin Source.4487: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.4488: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.4489: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.4490: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.4491: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.4492: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein Source.4493: DFBPPR16110 ---- Animal proteins ---- Pro-glucagon Source.4494: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.4495: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.4496: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.4497: DFBPPR16116 ---- Animal proteins ---- Kit ligand Source.4498: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.4499: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.4500: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C Source.4501: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.4502: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66 Source.4503: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.4504: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor Source.4505: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.4506: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.4507: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.4508: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.4509: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.4510: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C Source.4511: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.4512: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.4513: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein Source.4514: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.4515: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule Source.4516: DFBPPR16138 ---- Animal proteins ---- Claudin-3 Source.4517: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.4518: DFBPPR16142 ---- Animal proteins ---- Procathepsin L Source.4519: DFBPPR16143 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase Source.4520: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.4521: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.4522: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.4523: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.4524: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.4525: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.4526: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4527: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.4528: DFBPPR16156 ---- Animal proteins ---- Ras-related protein Rab-22A Source.4529: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.4530: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.4531: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.4532: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2 Source.4533: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.4534: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.4535: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.4536: DFBPPR16168 ---- Animal proteins ---- Annexin A2 Source.4537: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.4538: DFBPPR16170 ---- Animal proteins ---- Inversin Source.4539: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.4540: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.4541: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.4542: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.4543: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase Source.4544: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.4545: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone Source.4546: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.4547: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.4548: DFBPPR16190 ---- Animal proteins ---- Aprataxin Source.4549: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.4550: DFBPPR16194 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.4551: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.4552: DFBPPR16196 ---- Animal proteins ---- Amyloid-beta A4 protein Source.4553: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4554: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.4555: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.4556: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.4557: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.4558: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.4559: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.4560: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.4561: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.4562: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.4563: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I Source.4564: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.4565: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.4566: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.4567: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.4568: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.4569: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.4570: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.4571: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.4572: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.4573: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein Source.4574: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.4575: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.4576: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.4577: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.4578: DFBPPR16234 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma Source.4579: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.4580: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.4581: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.4582: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.4583: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.4584: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.4585: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.4586: DFBPPR16247 ---- Animal proteins ---- Recoverin Source.4587: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.4588: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.4589: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.4590: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15 Source.4591: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.4592: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.4593: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.4594: DFBPPR16258 ---- Animal proteins ---- Decorin Source.4595: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.4596: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha Source.4597: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.4598: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.4599: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.4600: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.4601: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.4602: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.4603: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.4604: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta Source.4605: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.4606: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.4607: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.4608: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.4609: DFBPPR16285 ---- Animal proteins ---- Chymase Source.4610: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.4611: DFBPPR16287 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator Source.4612: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.4613: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21 Source.4614: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.4615: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.4616: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2 Source.4617: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.4618: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.4619: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor Source.4620: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.4621: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.4622: DFBPPR16305 ---- Animal proteins ---- Phosducin Source.4623: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25 Source.4624: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.4625: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.4626: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.4627: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C Source.4628: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.4629: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.4630: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.4631: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.4632: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.4633: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.4634: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.4635: DFBPPR16325 ---- Animal proteins ---- Peripherin-2 Source.4636: DFBPPR16328 ---- Animal proteins ---- Fibroblast growth factor 8 Source.4637: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.4638: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.4639: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.4640: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.4641: DFBPPR16336 ---- Animal proteins ---- Colipase Source.4642: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.4643: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.4644: DFBPPR16341 ---- Animal proteins ---- Calmegin Source.4645: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.4646: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.4647: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype Source.4648: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5 Source.4649: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.4650: DFBPPR16368 ---- Animal proteins ---- Tyrosinase Source.4651: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.4652: DFBPPR16435 ---- Animal proteins ---- S-arrestin Source.4653: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.4654: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.4655: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.4656: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.4657: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.4658: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.4659: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.4660: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin Source.4661: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin Source.4662: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.4663: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor Source.4664: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.4665: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.4666: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.4667: DFBPPR16462 ---- Animal proteins ---- Pantetheinase Source.4668: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.4669: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.4670: DFBPPR16468 ---- Animal proteins ---- Sodium channel subunit beta-2 Source.4671: DFBPPR16474 ---- Animal proteins ---- Pinin Source.4672: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase Source.4673: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2 Source.4674: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2 Source.4675: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.4676: DFBPPR16487 ---- Animal proteins ---- Claudin-2 Source.4677: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.4678: DFBPPR16490 ---- Animal proteins ---- Translocon-associated protein subunit beta Source.4679: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.4680: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.4681: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.4682: DFBPPR16501 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.4683: DFBPPR16505 ---- Animal proteins ---- Agouti-signaling protein Source.4684: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.4685: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin Source.4686: DFBPPR16508 ---- Animal proteins ---- Protein crumbs homolog 3 Source.4687: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor Source.4688: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.4689: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.4690: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor Source.4691: DFBPPR16517 ---- Animal proteins ---- Cholinesterase Source.4692: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator Source.4693: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.4694: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.4695: DFBPPR16526 ---- Animal proteins ---- Insulin Source.4696: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.4697: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.4698: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a Source.4699: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.4700: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3 Source.4701: DFBPPR16534 ---- Animal proteins ---- Myoglobin Source.4702: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.4703: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.4704: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.4705: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.4706: DFBPPR16544 ---- Animal proteins ---- Interleukin-21 Source.4707: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83 Source.4708: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.4709: DFBPPR16549 ---- Animal proteins ---- Interleukin-1 alpha Source.4710: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.4711: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.4712: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3 Source.4713: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.4714: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.4715: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.4716: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.4717: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.4718: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1 Source.4719: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2 Source.4720: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.4721: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.4722: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.4723: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.4724: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a Source.4725: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.4726: DFBPPR16580 ---- Animal proteins ---- Fibrinogen alpha chain Source.4727: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.4728: DFBPPR16582 ---- Animal proteins ---- Pepsin A Source.4729: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.4730: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20 Source.4731: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c Source.4732: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.4733: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S Source.4734: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.4735: DFBPPR16595 ---- Animal proteins ---- Annexin A4 Source.4736: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A Source.4737: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9 Source.4738: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B Source.4739: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.4740: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.4741: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1 Source.4742: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain Source.4743: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.4744: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.4745: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4 Source.4746: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.4747: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1 Source.4748: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.4749: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1 Source.4750: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.4751: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.4752: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.4753: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.4754: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.4755: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6 Source.4756: DFBPPR16638 ---- Animal proteins ---- Synapsin-1 Source.4757: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H Source.4758: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.4759: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.4760: DFBPPR16649 ---- Animal proteins ---- 60S ribosomal protein L27 Source.4761: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.4762: DFBPPR16655 ---- Animal proteins ---- Somatostatin Source.4763: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4 Source.4764: DFBPPR16657 ---- Animal proteins ---- Fibrinogen beta chain Source.4765: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.4766: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.4767: DFBPPR16667 ---- Animal proteins ---- 60S ribosomal protein L12 Source.4768: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22 Source.4769: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.4770: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1 Source.4771: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2 Source.4772: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.4773: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3 Source.4774: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.4775: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.4776: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT Source.4777: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4 Source.4778: DFBPPR16691 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.4779: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein Source.4780: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator Source.4781: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor Source.4782: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3 Source.4783: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.4784: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.4785: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.4786: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.4787: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.4788: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252 Source.4789: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.4790: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO Source.4791: DFBPPR16730 ---- Animal proteins ---- RING finger protein 141 Source.4792: DFBPPR16734 ---- Animal proteins ---- 40S ribosomal protein S11 Source.4793: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.4794: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.4795: DFBPPR16739 ---- Animal proteins ---- Lengsin Source.4796: DFBPPR16740 ---- Animal proteins ---- 60S ribosomal protein L36a Source.4797: DFBPPR16743 ---- Animal proteins ---- 60S ribosomal protein L32 Source.4798: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM Source.4799: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.4800: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23 Source.4801: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.4802: DFBPPR16755 ---- Animal proteins ---- Glyoxalase domain-containing protein 5 Source.4803: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region Source.4804: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.4805: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.4806: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.4807: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.4808: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.4809: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.4810: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.4811: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.4812: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase Source.4813: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.4814: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta Source.4815: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.4816: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.4817: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.4818: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.4819: DFBPPR16796 ---- Animal proteins ---- Major prion protein Source.4820: DFBPPR16797 ---- Animal proteins ---- Albumin Source.4821: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.4822: DFBPPR16800 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.4823: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.4824: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.4825: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.4826: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease Source.4827: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.4828: DFBPPR16810 ---- Animal proteins ---- Cathepsin B Source.4829: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.4830: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic Source.4831: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.4832: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.4833: DFBPPR16816 ---- Animal proteins ---- Decorin Source.4834: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.4835: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.4836: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.4837: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II Source.4838: DFBPPR16825 ---- Animal proteins ---- Myelin basic protein Source.4839: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.4840: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.4841: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.4842: DFBPPR16835 ---- Animal proteins ---- Insulin Source.4843: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.4844: DFBPPR16837 ---- Animal proteins ---- Interferon gamma Source.4845: DFBPPR16838 ---- Animal proteins ---- Leptin Source.4846: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.4847: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.4848: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.4849: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.4850: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain Source.4851: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.4852: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.4853: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.4854: DFBPPR16852 ---- Animal proteins ---- Cytochrome b Source.4855: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.4856: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.4857: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.4858: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.4859: DFBPPR16864 ---- Animal proteins ---- Protein AMBP Source.4860: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.4861: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.4862: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I Source.4863: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.4864: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.4865: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.4866: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin Source.4867: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.4868: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.4869: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.4870: DFBPPR16877 ---- Animal proteins ---- Peptidoglycan recognition protein 1 Source.4871: DFBPPR16879 ---- Animal proteins ---- Inhibin beta A chain Source.4872: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Source.4873: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 Source.4874: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.4875: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.4876: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.4877: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C Source.4878: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.4879: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial Source.4880: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.4881: DFBPPR16893 ---- Animal proteins ---- Annexin A4 Source.4882: DFBPPR16894 ---- Animal proteins ---- Procathepsin L Source.4883: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.4884: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1 Source.4885: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.4886: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein Source.4887: DFBPPR16902 ---- Animal proteins ---- Interleukin-8 Source.4888: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.4889: DFBPPR16907 ---- Animal proteins ---- Acyl carrier protein, mitochondrial Source.4890: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.4891: DFBPPR16909 ---- Animal proteins ---- Calreticulin Source.4892: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.4893: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.4894: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.4895: DFBPPR16918 ---- Animal proteins ---- Spastin Source.4896: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.4897: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.4898: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.4899: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.4900: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.4901: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.4902: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.4903: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor Source.4904: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.4905: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.4906: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease Source.4907: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.4908: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.4909: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.4910: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.4911: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.4912: DFBPPR16946 ---- Animal proteins ---- Recoverin Source.4913: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.4914: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.4915: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.4916: DFBPPR16952 ---- Animal proteins ---- Annexin A2 Source.4917: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.4918: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin Source.4919: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.4920: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.4921: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.4922: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.4923: DFBPPR16961 ---- Animal proteins ---- C-X-C motif chemokine 6 Source.4924: DFBPPR16962 ---- Animal proteins ---- Interleukin-18 Source.4925: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.4926: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.4927: DFBPPR16965 ---- Animal proteins ---- Adseverin Source.4928: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.4929: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta Source.4930: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.4931: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.4932: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8 Source.4933: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.4934: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1 Source.4935: DFBPPR16981 ---- Animal proteins ---- Clusterin Source.4936: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.4937: DFBPPR16985 ---- Animal proteins ---- Filensin Source.4938: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.4939: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.4940: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.4941: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.4942: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5 Source.4943: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.4944: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.4945: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1 Source.4946: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.4947: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.4948: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.4949: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.4950: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17 Source.4951: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau Source.4952: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.4953: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.4954: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.4955: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.4956: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.4957: DFBPPR17013 ---- Animal proteins ---- Presenilin-1 Source.4958: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.4959: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.4960: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase Source.4961: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.4962: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10 Source.4963: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.4964: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.4965: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor Source.4966: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.4967: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain Source.4968: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.4969: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2 Source.4970: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.4971: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.4972: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog Source.4973: DFBPPR17037 ---- Animal proteins ---- Annexin A1 Source.4974: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.4975: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.4976: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.4977: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.4978: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.4979: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.4980: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta Source.4981: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.4982: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.4983: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.4984: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin Source.4985: DFBPPR17055 ---- Animal proteins ---- Phospholipase A2, membrane associated Source.4986: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.4987: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1 Source.4988: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.4989: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.4990: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5 Source.4991: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic Source.4992: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.4993: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.4994: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.4995: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1 Source.4996: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.4997: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168 Source.4998: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.4999: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.5000: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.5001: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.5002: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.5003: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.5004: DFBPPR17082 ---- Animal proteins ---- Calbindin Source.5005: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1 Source.5006: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.5007: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.5008: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.5009: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.5010: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.5011: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.5012: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.5013: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.5014: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.5015: DFBPPR17101 ---- Animal proteins ---- Annexin A5 Source.5016: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.5017: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.5018: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.5019: DFBPPR17107 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma Source.5020: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.5021: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.5022: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2 Source.5023: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.5024: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.5025: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.5026: DFBPPR17115 ---- Animal proteins ---- CD44 antigen Source.5027: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.5028: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.5029: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2 Source.5030: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.5031: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.5032: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.5033: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Source.5034: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.5035: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.5036: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog Source.5037: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1 Source.5038: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.5039: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.5040: DFBPPR17133 ---- Animal proteins ---- Pro-glucagon Source.5041: DFBPPR17134 ---- Animal proteins ---- Pro-glucagon Source.5042: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.5043: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.5044: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.5045: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2 Source.5046: DFBPPR17140 ---- Animal proteins ---- Adiponectin Source.5047: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.5048: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.5049: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.5050: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.5051: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.5052: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.5053: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.5054: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.5055: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.5056: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.5057: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.5058: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.5059: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1 Source.5060: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1 Source.5061: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.5062: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein Source.5063: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.5064: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.5065: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.5066: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6 Source.5067: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.5068: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.5069: DFBPPR17192 ---- Animal proteins ---- Kit ligand Source.5070: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha Source.5071: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.5072: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.5073: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.5074: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.5075: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.5076: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.5077: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.5078: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.5079: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.5080: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.5081: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.5082: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial Source.5083: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.5084: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1 Source.5085: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.5086: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.5087: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B Source.5088: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.5089: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.5090: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3 Source.5091: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase Source.5092: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.5093: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein Source.5094: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.5095: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.5096: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.5097: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7 Source.5098: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.5099: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.5100: DFBPPR17286 ---- Animal proteins ---- Septin-2 Source.5101: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.5102: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.5103: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.5104: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.5105: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2 Source.5106: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B Source.5107: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.5108: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.5109: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.5110: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2 Source.5111: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.5112: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.5113: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.5114: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha Source.5115: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.5116: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.5117: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.5118: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1 Source.5119: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.5120: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.5121: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.5122: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta Source.5123: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.5124: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.5125: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.5126: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase Source.5127: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.5128: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.5129: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.5130: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II Source.5131: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.5132: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.5133: DFBPPR17328 ---- Animal proteins ---- Ras-related protein Rab-5A Source.5134: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.5135: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.5136: DFBPPR17334 ---- Animal proteins ---- Prohibitin Source.5137: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type Source.5138: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.5139: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.5140: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.5141: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.5142: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B Source.5143: DFBPPR17343 ---- Animal proteins ---- Receptor of activated protein C kinase 1 Source.5144: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.5145: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1 Source.5146: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.5147: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.5148: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.5149: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2 Source.5150: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.5151: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.5152: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.5153: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.5154: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.5155: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.5156: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H Source.5157: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.5158: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.5159: DFBPPR17369 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6 Source.5160: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.5161: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.5162: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6 Source.5163: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.5164: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.5165: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2 Source.5166: DFBPPR17379 ---- Animal proteins ---- Dematin Source.5167: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.5168: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5 Source.5169: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.5170: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2 Source.5171: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.5172: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2 Source.5173: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.5174: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.5175: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4 Source.5176: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.5177: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.5178: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.5179: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD Source.5180: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.5181: DFBPPR17398 ---- Animal proteins ---- DNA-binding protein inhibitor ID-2 Source.5182: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C Source.5183: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1 Source.5184: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.5185: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.5186: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.5187: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.5188: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.5189: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.5190: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1 Source.5191: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1 Source.5192: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.5193: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha Source.5194: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial Source.5195: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.5196: DFBPPR17423 ---- Animal proteins ---- Furin Source.5197: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.5198: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.5199: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.5200: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.5201: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.5202: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.5203: DFBPPR17433 ---- Animal proteins ---- Caveolin-3 Source.5204: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5 Source.5205: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein Source.5206: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.5207: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1 Source.5208: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.5209: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.5210: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.5211: DFBPPR17441 ---- Animal proteins ---- DnaJ homolog subfamily C member 5 Source.5212: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.5213: DFBPPR17443 ---- Animal proteins ---- Beclin-1 Source.5214: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.5215: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.5216: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.5217: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein Source.5218: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3 Source.5219: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.5220: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.5221: DFBPPR17452 ---- Animal proteins ---- CD81 antigen Source.5222: DFBPPR17453 ---- Animal proteins ---- Calcium and integrin-binding protein 1 Source.5223: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase Source.5224: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.5225: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)] Source.5226: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.5227: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.5228: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.5229: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.5230: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.5231: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.5232: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.5233: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.5234: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.5235: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.5236: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.5237: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.5238: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.5239: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.5240: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.5241: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.5242: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.5243: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.5244: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.5245: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.5246: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.5247: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.5248: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.5249: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha Source.5250: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.5251: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.5252: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A Source.5253: DFBPPR17504 ---- Animal proteins ---- Duodenase-1 Source.5254: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.5255: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD Source.5256: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.5257: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b Source.5258: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.5259: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.5260: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.5261: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.5262: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.5263: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1 Source.5264: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5 Source.5265: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.5266: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1 Source.5267: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.5268: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.5269: DFBPPR17528 ---- Animal proteins ---- Phospholemman Source.5270: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.5271: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.5272: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E Source.5273: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.5274: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.5275: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.5276: DFBPPR17538 ---- Animal proteins ---- Septin-7 Source.5277: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.5278: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.5279: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.5280: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1 Source.5281: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5 Source.5282: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.5283: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.5284: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1 Source.5285: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog Source.5286: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.5287: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1 Source.5288: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.5289: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.5290: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1 Source.5291: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.5292: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.5293: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.5294: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta Source.5295: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.5296: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.5297: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.5298: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1 Source.5299: DFBPPR17583 ---- Animal proteins ---- Cathelicidin-1 Source.5300: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.5301: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial Source.5302: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2 Source.5303: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.5304: DFBPPR17592 ---- Animal proteins ---- Claudin-3 Source.5305: DFBPPR17593 ---- Animal proteins ---- Claudin-3 Source.5306: DFBPPR17594 ---- Animal proteins ---- E-selectin Source.5307: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.5308: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial Source.5309: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.5310: DFBPPR17599 ---- Animal proteins ---- Tissue factor Source.5311: DFBPPR17600 ---- Animal proteins ---- Tissue factor Source.5312: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.5313: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.5314: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH) Source.5315: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.5316: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7 Source.5317: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.5318: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.5319: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.5320: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.5321: DFBPPR17619 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.5322: DFBPPR17620 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.5323: DFBPPR17629 ---- Animal proteins ---- Thiamine-triphosphatase Source.5324: DFBPPR17630 ---- Animal proteins ---- Thiamine-triphosphatase Source.5325: DFBPPR17633 ---- Animal proteins ---- Lysozyme C Source.5326: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.5327: DFBPPR17637 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial Source.5328: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.5329: DFBPPR17646 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 8, mitochondrial Source.5330: DFBPPR17647 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1 Source.5331: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12 Source.5332: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.5333: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.5334: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.5335: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta Source.5336: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2 Source.5337: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.5338: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.5339: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.5340: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16 Source.5341: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase Source.5342: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.5343: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.5344: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.5345: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.5346: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.5347: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.5348: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.5349: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.5350: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.5351: DFBPPR17740 ---- Animal proteins ---- Fatty acid-binding protein, heart Source.5352: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.5353: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.5354: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.5355: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.5356: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.5357: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.5358: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta Source.5359: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10 Source.5360: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.5361: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1 Source.5362: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.5363: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.5364: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4 Source.5365: DFBPPR17763 ---- Animal proteins ---- Dynein light chain 1, cytoplasmic Source.5366: DFBPPR17765 ---- Animal proteins ---- Ras-related protein Rab-27B Source.5367: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.5368: DFBPPR17769 ---- Animal proteins ---- Polycomb complex protein BMI-1 Source.5369: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein Source.5370: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.5371: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein Source.5372: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3 Source.5373: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.5374: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.5375: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.5376: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1 Source.5377: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3 Source.5378: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.5379: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.5380: DFBPPR17787 ---- Animal proteins ---- Septin-6 Source.5381: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.5382: DFBPPR17790 ---- Animal proteins ---- Interleukin-15 Source.5383: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.5384: DFBPPR17793 ---- Animal proteins ---- Interleukin-17A Source.5385: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.5386: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.5387: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.5388: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.5389: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.5390: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.5391: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.5392: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.5393: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60 Source.5394: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2 Source.5395: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1 Source.5396: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.5397: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.5398: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA Source.5399: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2 Source.5400: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.5401: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.5402: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.5403: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.5404: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.5405: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.5406: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.5407: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.5408: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.5409: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.5410: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6 Source.5411: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3 Source.5412: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.5413: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13 Source.5414: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.5415: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1 Source.5416: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.5417: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.5418: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.5419: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.5420: DFBPPR17856 ---- Animal proteins ---- Selenoprotein S Source.5421: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.5422: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.5423: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.5424: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.5425: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.5426: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase Source.5427: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.5428: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.5429: DFBPPR17871 ---- Animal proteins ---- Ras-related protein Rab-11B Source.5430: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.5431: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.5432: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.5433: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.5434: DFBPPR17879 ---- Animal proteins ---- Menin Source.5435: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1 Source.5436: DFBPPR17883 ---- Animal proteins ---- Sialidase-1 Source.5437: DFBPPR17884 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase Source.5438: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.5439: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.5440: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.5441: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.5442: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.5443: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.5444: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.5445: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.5446: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.5447: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.5448: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.5449: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.5450: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.5451: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.5452: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein Source.5453: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.5454: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.5455: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.5456: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.5457: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126 Source.5458: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.5459: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial Source.5460: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.5461: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.5462: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.5463: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P Source.5464: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.5465: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2 Source.5466: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.5467: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.5468: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.5469: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.5470: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.5471: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.5472: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.5473: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38 Source.5474: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.5475: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.5476: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.5477: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 Source.5478: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.5479: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.5480: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.5481: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.5482: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.5483: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase Source.5484: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.5485: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.5486: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4 Source.5487: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.5488: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.5489: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1 Source.5490: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.5491: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase Source.5492: DFBPPR17970 ---- Animal proteins ---- Profilin-2 Source.5493: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.5494: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.5495: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.5496: DFBPPR17974 ---- Animal proteins ---- Mimecan Source.5497: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.5498: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.5499: DFBPPR17978 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.5500: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.5501: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.5502: DFBPPR17981 ---- Animal proteins ---- Retinol-binding protein 4 Source.5503: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.5504: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.5505: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.5506: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.5507: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.5508: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein Source.5509: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2 Source.5510: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.5511: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.5512: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.5513: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.5514: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.5515: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.5516: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.5517: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.5518: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.5519: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17 Source.5520: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.5521: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.5522: DFBPPR18011 ---- Animal proteins ---- Afamin Source.5523: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.5524: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.5525: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.5526: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.5527: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.5528: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.5529: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.5530: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.5531: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase Source.5532: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.5533: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta Source.5534: DFBPPR18031 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 2 Source.5535: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2 Source.5536: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.5537: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Source.5538: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.5539: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3 Source.5540: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.5541: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.5542: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1 Source.5543: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial Source.5544: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1 Source.5545: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a Source.5546: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.5547: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.5548: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A Source.5549: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.5550: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2 Source.5551: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.5552: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.5553: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.5554: DFBPPR18071 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte Source.5555: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.5556: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.5557: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.5558: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8 Source.5559: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.5560: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta Source.5561: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.5562: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.5563: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1 Source.5564: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.5565: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.5566: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.5567: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor Source.5568: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta Source.5569: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.5570: DFBPPR18091 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.5571: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4 Source.5572: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.5573: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.5574: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.5575: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.5576: DFBPPR18100 ---- Animal proteins ---- Derlin-1 Source.5577: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.5578: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.5579: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.5580: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.5581: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.5582: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.5583: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1 Source.5584: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4 Source.5585: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.5586: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.5587: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.5588: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.5589: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.5590: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.5591: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.5592: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.5593: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1 Source.5594: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase Source.5595: DFBPPR18136 ---- Animal proteins ---- Septin-8 Source.5596: DFBPPR18137 ---- Animal proteins ---- Septin-8 Source.5597: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.5598: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C Source.5599: DFBPPR18142 ---- Animal proteins ---- Protein CASC3 Source.5600: DFBPPR18146 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 9 Source.5601: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain Source.5602: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.5603: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.5604: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.5605: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.5606: DFBPPR18157 ---- Animal proteins ---- Hematopoietic cell signal transducer Source.5607: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII Source.5608: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.5609: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.5610: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.5611: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.5612: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.5613: DFBPPR18168 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 W Source.5614: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B Source.5615: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin Source.5616: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.5617: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.5618: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.5619: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.5620: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2 Source.5621: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.5622: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.5623: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5 Source.5624: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.5625: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.5626: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.5627: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.5628: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein Source.5629: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.5630: DFBPPR18211 ---- Animal proteins ---- Phosducin Source.5631: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta Source.5632: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.5633: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.5634: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6 Source.5635: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37 Source.5636: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.5637: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.5638: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.5639: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B Source.5640: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.5641: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4 Source.5642: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.5643: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B Source.5644: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.5645: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.5646: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.5647: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3 Source.5648: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.5649: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.5650: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.5651: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a Source.5652: DFBPPR18247 ---- Animal proteins ---- Interferon regulatory factor 1 Source.5653: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase Source.5654: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.5655: DFBPPR18254 ---- Animal proteins ---- C-type lectin domain family 6 member A Source.5656: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.5657: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.5658: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.5659: DFBPPR18262 ---- Animal proteins ---- Claudin-1 Source.5660: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta Source.5661: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.5662: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.5663: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.5664: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.5665: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein Source.5666: DFBPPR18271 ---- Animal proteins ---- Lysozyme C-2 Source.5667: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1 Source.5668: DFBPPR18274 ---- Animal proteins ---- Histone deacetylase 8 Source.5669: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial Source.5670: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.5671: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.5672: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial Source.5673: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.5674: DFBPPR18284 ---- Animal proteins ---- ATP synthase subunit epsilon, mitochondrial Source.5675: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.5676: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10 Source.5677: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.5678: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.5679: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2 Source.5680: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.5681: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta Source.5682: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase Source.5683: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.5684: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.5685: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1 Source.5686: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.5687: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.5688: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.5689: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.5690: DFBPPR18307 ---- Animal proteins ---- Claudin-4 Source.5691: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.5692: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain Source.5693: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.5694: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.5695: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.5696: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.5697: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.5698: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial Source.5699: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.5700: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.5701: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase Source.5702: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.5703: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.5704: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.5705: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.5706: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.5707: DFBPPR18335 ---- Animal proteins ---- Septin-11 Source.5708: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.5709: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.5710: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.5711: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.5712: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.5713: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.5714: DFBPPR18354 ---- Animal proteins ---- Charged multivesicular body protein 2b Source.5715: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q Source.5716: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.5717: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase Source.5718: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.5719: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.5720: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.5721: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.5722: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Source.5723: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.5724: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.5725: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.5726: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.5727: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1 Source.5728: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5 Source.5729: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.5730: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.5731: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.5732: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.5733: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.5734: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.5735: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.5736: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.5737: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.5738: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.5739: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.5740: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43 Source.5741: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.5742: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.5743: DFBPPR18394 ---- Animal proteins ---- Histone H1.1 Source.5744: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase Source.5745: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.5746: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6 Source.5747: DFBPPR18400 ---- Animal proteins ---- Amyloid-beta A4 protein Source.5748: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.5749: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.5750: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10 Source.5751: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.5752: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain Source.5753: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.5754: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6 Source.5755: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.5756: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14 Source.5757: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.5758: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.5759: DFBPPR18427 ---- Animal proteins ---- Cystatin-C Source.5760: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16 Source.5761: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.5762: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1 Source.5763: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.5764: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.5765: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12 Source.5766: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.5767: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.5768: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.5769: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.5770: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2 Source.5771: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.5772: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.5773: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4 Source.5774: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.5775: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1 Source.5776: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.5777: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.5778: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.5779: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.5780: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.5781: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1 Source.5782: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.5783: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.5784: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.5785: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component Source.5786: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.5787: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.5788: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.5789: DFBPPR18489 ---- Animal proteins ---- Beta-2-microglobulin Source.5790: DFBPPR18490 ---- Animal proteins ---- N-terminal Xaa-Pro-Lys N-methyltransferase 1 Source.5791: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.5792: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.5793: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.5794: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.5795: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase Source.5796: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6 Source.5797: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.5798: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.5799: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5 Source.5800: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.5801: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.5802: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.5803: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5 Source.5804: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.5805: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.5806: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor Source.5807: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit Source.5808: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1 Source.5809: DFBPPR18519 ---- Animal proteins ---- Ras-related protein Rab-21 Source.5810: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain Source.5811: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.5812: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin Source.5813: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain Source.5814: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain Source.5815: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.5816: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.5817: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.5818: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.5819: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1 Source.5820: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.5821: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1 Source.5822: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1 Source.5823: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.5824: DFBPPR18546 ---- Animal proteins ---- Cardiac phospholamban Source.5825: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu Source.5826: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.5827: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.5828: DFBPPR18552 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 8 Source.5829: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.5830: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.5831: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.5832: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.5833: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF Source.5834: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.5835: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.5836: DFBPPR18563 ---- Animal proteins ---- Collectin-43 Source.5837: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.5838: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.5839: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1 Source.5840: DFBPPR18573 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.5841: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5 Source.5842: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S Source.5843: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.5844: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.5845: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.5846: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.5847: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.5848: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1 Source.5849: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.5850: DFBPPR18589 ---- Animal proteins ---- Interleukin-13 Source.5851: DFBPPR18590 ---- Animal proteins ---- Retinol-binding protein 1 Source.5852: DFBPPR18591 ---- Animal proteins ---- ATP synthase membrane subunit DAPIT, mitochondrial Source.5853: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase Source.5854: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.5855: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.5856: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.5857: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B Source.5858: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.5859: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3 Source.5860: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.5861: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.5862: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.5863: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26 Source.5864: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.5865: DFBPPR18609 ---- Animal proteins ---- ERO1-like protein alpha Source.5866: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.5867: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.5868: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial Source.5869: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.5870: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha Source.5871: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.5872: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.5873: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.5874: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561 Source.5875: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.5876: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase Source.5877: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.5878: DFBPPR18632 ---- Animal proteins ---- Syntaxin-4 Source.5879: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.5880: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.5881: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB Source.5882: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.5883: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.5884: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.5885: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.5886: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.5887: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.5888: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2 Source.5889: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21 Source.5890: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.5891: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.5892: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.5893: DFBPPR18698 ---- Animal proteins ---- ATPase GET3 Source.5894: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.5895: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1 Source.5896: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.5897: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase Source.5898: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.5899: DFBPPR18713 ---- Animal proteins ---- Arginase-1 Source.5900: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5 Source.5901: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.5902: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.5903: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5 Source.5904: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.5905: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.5906: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2 Source.5907: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor Source.5908: DFBPPR18727 ---- Animal proteins ---- Interleukin-2 Source.5909: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.5910: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.5911: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.5912: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.5913: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.5914: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3 Source.5915: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.5916: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.5917: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II Source.5918: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor Source.5919: DFBPPR18746 ---- Animal proteins ---- Anamorsin Source.5920: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1 Source.5921: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A Source.5922: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.5923: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase Source.5924: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.5925: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.5926: DFBPPR18756 ---- Animal proteins ---- Eukaryotic translation initiation factor 4E Source.5927: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.5928: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.5929: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.5930: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.5931: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.5932: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E Source.5933: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.5934: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.5935: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.5936: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1 Source.5937: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.5938: DFBPPR18778 ---- Animal proteins ---- Erlin-2 Source.5939: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.5940: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone Source.5941: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A Source.5942: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.5943: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.5944: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU Source.5945: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.5946: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.5947: DFBPPR18791 ---- Animal proteins ---- Small nuclear ribonucleoprotein Sm D2 Source.5948: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C Source.5949: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.5950: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.5951: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A Source.5952: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.5953: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.5954: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.5955: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2 Source.5956: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.5957: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha Source.5958: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.5959: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.5960: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.5961: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.5962: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.5963: DFBPPR18812 ---- Animal proteins ---- Vesicle-associated membrane protein 3 Source.5964: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.5965: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1 Source.5966: DFBPPR18815 ---- Animal proteins ---- Pantetheinase Source.5967: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.5968: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.5969: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.5970: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.5971: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.5972: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase Source.5973: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.5974: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2 Source.5975: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog Source.5976: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.5977: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.5978: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2 Source.5979: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor Source.5980: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.5981: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.5982: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.5983: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein Source.5984: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3 Source.5985: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.5986: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.5987: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.5988: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase Source.5989: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.5990: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase Source.5991: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7 Source.5992: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.5993: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.5994: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.5995: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.5996: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.5997: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.5998: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.5999: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.6000: DFBPPR18873 ---- Animal proteins ---- Proteasome subunit beta type-3 Source.6001: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1 Source.6002: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.6003: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.6004: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.6005: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1 Source.6006: DFBPPR18883 ---- Animal proteins ---- Lysozyme C, tracheal isozyme Source.6007: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.6008: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.6009: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.6010: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.6011: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.6012: DFBPPR18893 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM20 homolog Source.6013: DFBPPR18895 ---- Animal proteins ---- Lysozyme C-1 Source.6014: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.6015: DFBPPR18899 ---- Animal proteins ---- Cofilin-2 Source.6016: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.6017: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.6018: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.6019: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.6020: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.6021: DFBPPR18908 ---- Animal proteins ---- Proteasome subunit alpha type-6 Source.6022: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase Source.6023: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.6024: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.6025: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.6026: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.6027: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.6028: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5 Source.6029: DFBPPR18920 ---- Animal proteins ---- Profilin-1 Source.6030: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b Source.6031: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.6032: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.6033: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.6034: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.6035: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.6036: DFBPPR18936 ---- Animal proteins ---- S-methyl-5'-thioadenosine phosphorylase Source.6037: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.6038: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial Source.6039: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13 Source.6040: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.6041: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.6042: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.6043: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.6044: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.6045: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1 Source.6046: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.6047: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3 Source.6048: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8 Source.6049: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.6050: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.6051: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.6052: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.6053: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A Source.6054: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.6055: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7 Source.6056: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1 Source.6057: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog Source.6058: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog Source.6059: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1 Source.6060: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.6061: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.6062: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein Source.6063: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.6064: DFBPPR18972 ---- Animal proteins ---- Lysozyme-like protein 6 Source.6065: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb Source.6066: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.6067: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS Source.6068: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3 Source.6069: DFBPPR18977 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 1 Source.6070: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.6071: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.6072: DFBPPR18980 ---- Animal proteins ---- Ras-related protein Rab-11A Source.6073: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.6074: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.6075: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.6076: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.6077: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.6078: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.6079: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Source.6080: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6 Source.6081: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.6082: DFBPPR18995 ---- Animal proteins ---- Tektin-3 Source.6083: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.6084: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.6085: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.6086: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.6087: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic Source.6088: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.6089: DFBPPR19011 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF138 Source.6090: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D Source.6091: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1 Source.6092: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.6093: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial Source.6094: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.6095: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.6096: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.6097: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.6098: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.6099: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.6100: DFBPPR19032 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.6101: DFBPPR19034 ---- Animal proteins ---- Sialomucin core protein 24 Source.6102: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.6103: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.6104: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.6105: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A Source.6106: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.6107: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.6108: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Source.6109: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.6110: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.6111: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.6112: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.6113: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.6114: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.6115: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial Source.6116: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.6117: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.6118: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.6119: DFBPPR19066 ---- Animal proteins ---- Agouti-signaling protein Source.6120: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.6121: DFBPPR19071 ---- Animal proteins ---- Collectrin Source.6122: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9 Source.6123: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.6124: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.6125: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2 Source.6126: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.6127: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.6128: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3 Source.6129: DFBPPR19082 ---- Animal proteins ---- Protein SCO2 homolog, mitochondrial Source.6130: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1 Source.6131: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.6132: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1 Source.6133: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.6134: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13 Source.6135: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.6136: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.6137: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.6138: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9 Source.6139: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.6140: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1 Source.6141: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.6142: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.6143: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3 Source.6144: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.6145: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.6146: DFBPPR19118 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1 Source.6147: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.6148: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.6149: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.6150: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.6151: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.6152: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit Source.6153: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.6154: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.6155: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.6156: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8 Source.6157: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11 Source.6158: DFBPPR19145 ---- Animal proteins ---- Pepsin A Source.6159: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.6160: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.6161: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.6162: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.6163: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator Source.6164: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein Source.6165: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain Source.6166: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.6167: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.6168: DFBPPR19170 ---- Animal proteins ---- Isoaspartyl peptidase/L-asparaginase Source.6169: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2 Source.6170: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.6171: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin Source.6172: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16 Source.6173: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17 Source.6174: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3 Source.6175: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33 Source.6176: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.6177: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.6178: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.6179: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4 Source.6180: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.6181: DFBPPR19192 ---- Animal proteins ---- Neudesin Source.6182: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.6183: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2 Source.6184: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.6185: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein Source.6186: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A Source.6187: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.6188: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.6189: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639 Source.6190: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2 Source.6191: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7 Source.6192: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169 Source.6193: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.6194: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2 Source.6195: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.6196: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2 Source.6197: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.6198: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.6199: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3 Source.6200: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.6201: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4 Source.6202: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.6203: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.6204: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.6205: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.6206: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.6207: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.6208: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.6209: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase Source.6210: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.6211: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog Source.6212: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit Source.6213: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.6214: DFBPPR19247 ---- Animal proteins ---- Calmegin Source.6215: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.6216: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.6217: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.6218: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B Source.6219: DFBPPR19253 ---- Animal proteins ---- Limbin Source.6220: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.6221: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.6222: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.6223: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6 Source.6224: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2 Source.6225: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial Source.6226: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2 Source.6227: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.6228: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.6229: DFBPPR19278 ---- Animal proteins ---- R-spondin-3 Source.6230: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.6231: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.6232: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.6233: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.6234: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.6235: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.6236: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5 Source.6237: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.6238: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.6239: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.6240: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.6241: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.6242: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.6243: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.6244: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3 Source.6245: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.6246: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.6247: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1 Source.6248: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.6249: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.6250: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.6251: DFBPPR19312 ---- Animal proteins ---- Copine-1 Source.6252: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1 Source.6253: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.6254: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.6255: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial Source.6256: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial Source.6257: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.6258: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.6259: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.6260: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.6261: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4 Source.6262: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.6263: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.6264: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.6265: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.6266: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.6267: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.6268: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel Source.6269: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9 Source.6270: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.6271: DFBPPR19346 ---- Animal proteins ---- Cylicin-1 Source.6272: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.6273: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1 Source.6274: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.6275: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.6276: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.6277: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.6278: DFBPPR19359 ---- Animal proteins ---- Spartin Source.6279: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14 Source.6280: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5 Source.6281: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1 Source.6282: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3 Source.6283: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.6284: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.6285: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.6286: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel Source.6287: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1 Source.6288: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.6289: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.6290: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A Source.6291: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1 Source.6292: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific Source.6293: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.6294: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5 Source.6295: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.6296: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3 Source.6297: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.6298: DFBPPR19385 ---- Animal proteins ---- Cathelicidin-5 Source.6299: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2 Source.6300: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.6301: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1 Source.6302: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C Source.6303: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3 Source.6304: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein Source.6305: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.6306: DFBPPR19400 ---- Animal proteins ---- Serine/arginine-rich splicing factor 6 Source.6307: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20 Source.6308: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b Source.6309: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.6310: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2 Source.6311: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.6312: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.6313: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.6314: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.6315: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.6316: DFBPPR19417 ---- Animal proteins ---- L-xylulose reductase Source.6317: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22 Source.6318: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1 Source.6319: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19 Source.6320: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.6321: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase Source.6322: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1 Source.6323: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.6324: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial Source.6325: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.6326: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor Source.6327: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59 Source.6328: DFBPPR19438 ---- Animal proteins ---- Protein Mis18-alpha Source.6329: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.6330: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2 Source.6331: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G Source.6332: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.6333: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3 Source.6334: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.6335: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.6336: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.6337: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.6338: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.6339: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.6340: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase Source.6341: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.6342: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2 Source.6343: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.6344: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.6345: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.6346: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.6347: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.6348: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.6349: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.6350: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.6351: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.6352: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.6353: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.6354: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5 Source.6355: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase Source.6356: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3 Source.6357: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1 Source.6358: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.6359: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.6360: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73 Source.6361: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG Source.6362: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.6363: DFBPPR19508 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 2 Source.6364: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase Source.6365: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.6366: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.6367: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase Source.6368: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.6369: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L Source.6370: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.6371: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.6372: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta Source.6373: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2 Source.6374: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.6375: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1 Source.6376: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.6377: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.6378: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase Source.6379: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.6380: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.6381: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.6382: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.6383: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial Source.6384: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.6385: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4 Source.6386: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1 Source.6387: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.6388: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2 Source.6389: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.6390: DFBPPR19555 ---- Animal proteins ---- cAMP-regulated phosphoprotein 21 Source.6391: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.6392: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9 Source.6393: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.6394: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.6395: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K Source.6396: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4 Source.6397: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.6398: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.6399: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.6400: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.6401: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.6402: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.6403: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.6404: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.6405: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.6406: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.6407: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.6408: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.6409: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.6410: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1 Source.6411: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C Source.6412: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.6413: DFBPPR19592 ---- Animal proteins ---- Ras-related protein Rab-18 Source.6414: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.6415: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.6416: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.6417: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C Source.6418: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein Source.6419: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.6420: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1 Source.6421: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.6422: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.6423: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.6424: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.6425: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5 Source.6426: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.6427: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.6428: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog Source.6429: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.6430: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.6431: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.6432: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.6433: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.6434: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.6435: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein Source.6436: DFBPPR19640 ---- Animal proteins ---- Prolargin Source.6437: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.6438: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.6439: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4 Source.6440: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.6441: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.6442: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B Source.6443: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.6444: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.6445: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.6446: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter Source.6447: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial Source.6448: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.6449: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.6450: DFBPPR19664 ---- Animal proteins ---- Protein OS-9 Source.6451: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2 Source.6452: DFBPPR19668 ---- Animal proteins ---- Calicin Source.6453: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.6454: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.6455: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein Source.6456: DFBPPR19674 ---- Animal proteins ---- Nuclear transport factor 2 Source.6457: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.6458: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.6459: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.6460: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2 Source.6461: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.6462: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.6463: DFBPPR19686 ---- Animal proteins ---- Spindle and kinetochore-associated protein 1 Source.6464: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.6465: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.6466: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4 Source.6467: DFBPPR19696 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.6468: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.6469: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.6470: DFBPPR19703 ---- Animal proteins ---- Claudin-10 Source.6471: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29 Source.6472: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.6473: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.6474: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.6475: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17 Source.6476: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2 Source.6477: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1 Source.6478: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase Source.6479: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.6480: DFBPPR19720 ---- Animal proteins ---- RILP-like protein 2 Source.6481: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4 Source.6482: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3 Source.6483: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2 Source.6484: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B Source.6485: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.6486: DFBPPR19731 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.6487: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.6488: DFBPPR19737 ---- Animal proteins ---- Proteasome subunit alpha type-5 Source.6489: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5 Source.6490: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1 Source.6491: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.6492: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2 Source.6493: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase Source.6494: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23 Source.6495: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.6496: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.6497: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.6498: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.6499: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1 Source.6500: DFBPPR19756 ---- Animal proteins ---- Ras-related protein Rab-1B Source.6501: DFBPPR19761 ---- Animal proteins ---- N-chimaerin Source.6502: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor Source.6503: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.6504: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.6505: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.6506: DFBPPR19767 ---- Animal proteins ---- F-box/LRR-repeat protein 15 Source.6507: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4 Source.6508: DFBPPR19769 ---- Animal proteins ---- Septin-14 Source.6509: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.6510: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.6511: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.6512: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.6513: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.6514: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.6515: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein Source.6516: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.6517: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.6518: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2 Source.6519: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.6520: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.6521: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3 Source.6522: DFBPPR19798 ---- Animal proteins ---- Uricase Source.6523: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1 Source.6524: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3 Source.6525: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2 Source.6526: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.6527: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Source.6528: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.6529: DFBPPR19806 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial Source.6530: DFBPPR19807 ---- Animal proteins ---- Spermine synthase Source.6531: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4 Source.6532: DFBPPR19810 ---- Animal proteins ---- Seipin Source.6533: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.6534: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Source.6535: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1 Source.6536: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.6537: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.6538: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6 Source.6539: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.6540: DFBPPR19820 ---- Animal proteins ---- Septin-10 Source.6541: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.6542: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.6543: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.6544: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.6545: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.6546: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.6547: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.6548: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.6549: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.6550: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30 Source.6551: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4 Source.6552: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.6553: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial Source.6554: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.6555: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein Source.6556: DFBPPR19846 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8B Source.6557: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C Source.6558: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial Source.6559: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a Source.6560: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1 Source.6561: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.6562: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC Source.6563: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.6564: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1 Source.6565: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A Source.6566: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.6567: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.6568: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.6569: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.6570: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.6571: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1 Source.6572: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.6573: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8 Source.6574: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A Source.6575: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14 Source.6576: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.6577: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.6578: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1 Source.6579: DFBPPR19886 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4A Source.6580: DFBPPR19892 ---- Animal proteins ---- D(1B) dopamine receptor Source.6581: DFBPPR19895 ---- Animal proteins ---- 39S ribosomal protein L24, mitochondrial Source.6582: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60 Source.6583: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial Source.6584: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.6585: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic Source.6586: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.6587: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30 Source.6588: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.6589: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase Source.6590: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.6591: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.6592: DFBPPR19909 ---- Animal proteins ---- Probable C->U-editing enzyme APOBEC-2 Source.6593: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.6594: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1 Source.6595: DFBPPR19914 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2 Source.6596: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.6597: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.6598: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.6599: DFBPPR19921 ---- Animal proteins ---- Histone deacetylase complex subunit SAP18 Source.6600: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain Source.6601: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.6602: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.6603: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase Source.6604: DFBPPR19928 ---- Animal proteins ---- Interferon beta-1 Source.6605: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6 Source.6606: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial Source.6607: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.6608: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform Source.6609: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78 Source.6610: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.6611: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2 Source.6612: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80 Source.6613: DFBPPR19944 ---- Animal proteins ---- Histone H1.0 Source.6614: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.6615: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.6616: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2 Source.6617: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1 Source.6618: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.6619: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.6620: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.6621: DFBPPR19956 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.6622: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B Source.6623: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24 Source.6624: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.6625: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.6626: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein Source.6627: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.6628: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial Source.6629: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4 Source.6630: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.6631: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.6632: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.6633: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor Source.6634: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.6635: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.6636: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.6637: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1 Source.6638: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39 Source.6639: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2 Source.6640: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.6641: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.6642: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3 Source.6643: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3 Source.6644: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.6645: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.6646: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C Source.6647: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase Source.6648: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2 Source.6649: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein Source.6650: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.6651: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.6652: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.6653: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.6654: DFBPPR20013 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma Source.6655: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.6656: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.6657: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase Source.6658: DFBPPR20019 ---- Animal proteins ---- 28S ribosomal protein S16, mitochondrial Source.6659: DFBPPR20022 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.6660: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.6661: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7 Source.6662: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.6663: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.6664: DFBPPR20030 ---- Animal proteins ---- Calumenin Source.6665: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4 Source.6666: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.6667: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9 Source.6668: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.6669: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.6670: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase Source.6671: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1 Source.6672: DFBPPR20044 ---- Animal proteins ---- Secernin-1 Source.6673: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.6674: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.6675: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.6676: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.6677: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.6678: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.6679: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1 Source.6680: DFBPPR20057 ---- Animal proteins ---- AP-3 complex subunit sigma-1 Source.6681: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.6682: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical] Source.6683: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.6684: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.6685: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.6686: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2 Source.6687: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.6688: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.6689: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.6690: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.6691: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47 Source.6692: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.6693: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.6694: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.6695: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.6696: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.6697: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.6698: DFBPPR20102 ---- Animal proteins ---- Cylicin-2 Source.6699: DFBPPR20103 ---- Animal proteins ---- Protein MAL2 Source.6700: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease Source.6701: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1 Source.6702: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial Source.6703: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.6704: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1 Source.6705: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2 Source.6706: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.6707: DFBPPR20125 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 2 Source.6708: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase Source.6709: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.6710: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.6711: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.6712: DFBPPR20144 ---- Animal proteins ---- Destrin Source.6713: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1 Source.6714: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.6715: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.6716: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.6717: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9 Source.6718: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein Source.6719: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog Source.6720: DFBPPR20163 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6f Source.6721: DFBPPR20165 ---- Animal proteins ---- Lysozyme C, intestinal isozyme Source.6722: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.6723: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2 Source.6724: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.6725: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.6726: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.6727: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase Source.6728: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.6729: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.6730: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.6731: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.6732: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98 Source.6733: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein Source.6734: DFBPPR20189 ---- Animal proteins ---- Protein disulfide isomerase CRELD2 Source.6735: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.6736: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.6737: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.6738: DFBPPR20199 ---- Animal proteins ---- Claudin-7 Source.6739: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.6740: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7 Source.6741: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.6742: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial Source.6743: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.6744: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein Source.6745: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B Source.6746: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9 Source.6747: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.6748: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2 Source.6749: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12 Source.6750: DFBPPR20225 ---- Animal proteins ---- Claudin-2 Source.6751: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.6752: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.6753: DFBPPR20231 ---- Animal proteins ---- Dynein light chain 2, cytoplasmic Source.6754: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.6755: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.6756: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.6757: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B Source.6758: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein Source.6759: DFBPPR20242 ---- Animal proteins ---- Coactosin-like protein Source.6760: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.6761: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28 Source.6762: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30 Source.6763: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A Source.6764: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53 Source.6765: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2 Source.6766: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1 Source.6767: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial Source.6768: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54 Source.6769: DFBPPR20264 ---- Animal proteins ---- AP-3 complex subunit sigma-2 Source.6770: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7 Source.6771: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.6772: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3 Source.6773: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.6774: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.6775: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.6776: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6 Source.6777: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4 Source.6778: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.6779: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2 Source.6780: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.6781: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1 Source.6782: DFBPPR20295 ---- Animal proteins ---- Protein dpy-30 homolog Source.6783: DFBPPR20296 ---- Animal proteins ---- Claudin-18 Source.6784: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.6785: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.6786: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.6787: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.6788: DFBPPR20304 ---- Animal proteins ---- Nuclear envelope phosphatase-regulatory subunit 1 Source.6789: DFBPPR20305 ---- Animal proteins ---- Nostrin Source.6790: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.6791: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.6792: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.6793: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B Source.6794: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9 Source.6795: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3 Source.6796: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial Source.6797: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV Source.6798: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.6799: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2 Source.6800: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.6801: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.6802: DFBPPR20328 ---- Animal proteins ---- 40S ribosomal protein S23 Source.6803: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.6804: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.6805: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase Source.6806: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.6807: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.6808: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.6809: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial Source.6810: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1 Source.6811: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.6812: DFBPPR20342 ---- Animal proteins ---- Nucleosome assembly protein 1-like 4 Source.6813: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2 Source.6814: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14 Source.6815: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.6816: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.6817: DFBPPR20350 ---- Animal proteins ---- Pinin Source.6818: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.6819: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.6820: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2 Source.6821: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase Source.6822: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.6823: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.6824: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase Source.6825: DFBPPR20363 ---- Animal proteins ---- F-box/LRR-repeat protein 2 Source.6826: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3 Source.6827: DFBPPR20365 ---- Animal proteins ---- Interleukin-21 Source.6828: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.6829: DFBPPR20371 ---- Animal proteins ---- Vesicle-associated membrane protein 4 Source.6830: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2 Source.6831: DFBPPR20374 ---- Animal proteins ---- 5'-deoxynucleotidase HDDC2 Source.6832: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56 Source.6833: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.6834: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha Source.6835: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog Source.6836: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.6837: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.6838: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a Source.6839: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.6840: DFBPPR20391 ---- Animal proteins ---- Fibronectin type III domain-containing protein 4 Source.6841: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.6842: DFBPPR20396 ---- Animal proteins ---- Claudin-5 Source.6843: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.6844: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.6845: DFBPPR20401 ---- Animal proteins ---- Bystin Source.6846: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.6847: DFBPPR20404 ---- Animal proteins ---- Protein tilB homolog Source.6848: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.6849: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2 Source.6850: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.6851: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9 Source.6852: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.6853: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.6854: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.6855: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61 Source.6856: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial Source.6857: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170 Source.6858: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.6859: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase Source.6860: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog Source.6861: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog Source.6862: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.6863: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1 Source.6864: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1 Source.6865: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5 Source.6866: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.6867: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7 Source.6868: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5 Source.6869: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.6870: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5 Source.6871: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.6872: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1 Source.6873: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3 Source.6874: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.6875: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.6876: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF Source.6877: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.6878: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8 Source.6879: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.6880: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.6881: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C Source.6882: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.6883: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38 Source.6884: DFBPPR20467 ---- Animal proteins ---- Tetranectin Source.6885: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial Source.6886: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.6887: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3 Source.6888: DFBPPR20476 ---- Animal proteins ---- Translocon-associated protein subunit beta Source.6889: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.6890: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29 Source.6891: DFBPPR20481 ---- Animal proteins ---- Ropporin-1 Source.6892: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase Source.6893: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein Source.6894: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.6895: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial Source.6896: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan Source.6897: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog Source.6898: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.6899: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.6900: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.6901: DFBPPR20518 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5 Source.6902: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2 Source.6903: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.6904: DFBPPR20522 ---- Animal proteins ---- Serine palmitoyltransferase small subunit A Source.6905: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36 Source.6906: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.6907: DFBPPR20528 ---- Animal proteins ---- Thiamin pyrophosphokinase 1 Source.6908: DFBPPR20529 ---- Animal proteins ---- Transgelin Source.6909: DFBPPR20531 ---- Animal proteins ---- Myozenin-2 Source.6910: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.6911: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.6912: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.6913: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.6914: DFBPPR20536 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.6915: DFBPPR20538 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.6916: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1 Source.6917: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2 Source.6918: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.6919: DFBPPR20546 ---- Animal proteins ---- Odorant-binding protein Source.6920: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6 Source.6921: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1 Source.6922: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.6923: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.6924: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.6925: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4 Source.6926: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.6927: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.6928: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.6929: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.6930: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein Source.6931: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10 Source.6932: DFBPPR20570 ---- Animal proteins ---- Intraflagellar transport protein 22 homolog Source.6933: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.6934: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.6935: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.6936: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201 Source.6937: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.6938: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.6939: DFBPPR20580 ---- Animal proteins ---- BET1-like protein Source.6940: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1 Source.6941: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein Source.6942: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.6943: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74 Source.6944: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi Source.6945: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.6946: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.6947: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.6948: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.6949: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.6950: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1 Source.6951: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog Source.6952: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.6953: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.6954: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.6955: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.6956: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase Source.6957: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.6958: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.6959: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13 Source.6960: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.6961: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.6962: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2 Source.6963: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5 Source.6964: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.6965: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5 Source.6966: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.6967: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C Source.6968: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.6969: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.6970: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.6971: DFBPPR20640 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 8 Source.6972: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.6973: DFBPPR20643 ---- Animal proteins ---- Fibrinogen-like protein 1 Source.6974: DFBPPR20647 ---- Animal proteins ---- Annexin A8 Source.6975: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91 Source.6976: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A Source.6977: DFBPPR20657 ---- Animal proteins ---- Anaphase-promoting complex subunit CDC26 Source.6978: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.6979: DFBPPR20659 ---- Animal proteins ---- Cystinosin Source.6980: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3 Source.6981: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.6982: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain Source.6983: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein Source.6984: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2 Source.6985: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.6986: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial Source.6987: DFBPPR20668 ---- Animal proteins ---- BLOC-1-related complex subunit 5 Source.6988: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.6989: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45 Source.6990: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.6991: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease Source.6992: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.6993: DFBPPR20677 ---- Animal proteins ---- EEF1A lysine methyltransferase 1 Source.6994: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.6995: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.6996: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B Source.6997: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.6998: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial Source.6999: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial Source.7000: DFBPPR20690 ---- Animal proteins ---- Neurotrimin Source.7001: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12 Source.7002: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.7003: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.7004: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.7005: DFBPPR20703 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 3 homolog, mitochondrial Source.7006: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.7007: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta Source.7008: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like Source.7009: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial Source.7010: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.7011: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase Source.7012: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.7013: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3 Source.7014: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain Source.7015: DFBPPR20721 ---- Animal proteins ---- Myomesin-1 Source.7016: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial Source.7017: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase Source.7018: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.7019: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.7020: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.7021: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.7022: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.7023: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6 Source.7024: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.7025: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.7026: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B Source.7027: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B Source.7028: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.7029: DFBPPR20750 ---- Animal proteins ---- 40S ribosomal protein S8 Source.7030: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.7031: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33 Source.7032: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.7033: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.7034: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9 Source.7035: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45 Source.7036: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.7037: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14 Source.7038: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein Source.7039: DFBPPR20765 ---- Animal proteins ---- Non-muscle caldesmon Source.7040: DFBPPR20767 ---- Animal proteins ---- GTP cyclohydrolase 1 feedback regulatory protein Source.7041: DFBPPR20768 ---- Animal proteins ---- Lysozyme-like protein 1 Source.7042: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.7043: DFBPPR20771 ---- Animal proteins ---- Dynein light chain roadblock-type 1 Source.7044: DFBPPR20772 ---- Animal proteins ---- Ragulator complex protein LAMTOR5 Source.7045: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.7046: DFBPPR20774 ---- Animal proteins ---- Ankyrin repeat family A protein 2 Source.7047: DFBPPR20775 ---- Animal proteins ---- Colipase Source.7048: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.7049: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15 Source.7050: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.7051: DFBPPR20780 ---- Animal proteins ---- Retinol-binding protein 5 Source.7052: DFBPPR20784 ---- Animal proteins ---- Dynein light chain roadblock-type 2 Source.7053: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6 Source.7054: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.7055: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17 Source.7056: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.7057: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.7058: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.7059: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171 Source.7060: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.7061: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Source.7062: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.7063: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1 Source.7064: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2 Source.7065: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148 Source.7066: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2 Source.7067: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.7068: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.7069: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial Source.7070: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1 Source.7071: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3 Source.7072: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT Source.7073: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2 Source.7074: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.7075: DFBPPR20824 ---- Animal proteins ---- CD151 antigen Source.7076: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial Source.7077: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.7078: DFBPPR20828 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1 Source.7079: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6 Source.7080: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12 Source.7081: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.7082: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.7083: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.7084: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2 Source.7085: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.7086: DFBPPR20841 ---- Animal proteins ---- Translationally-controlled tumor protein Source.7087: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1 Source.7088: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9 Source.7089: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.7090: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.7091: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.7092: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.7093: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase Source.7094: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.7095: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase Source.7096: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.7097: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5 Source.7098: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1 Source.7099: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2 Source.7100: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5 Source.7101: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta Source.7102: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2 Source.7103: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C Source.7104: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1 Source.7105: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1 Source.7106: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.7107: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A Source.7108: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237 Source.7109: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta Source.7110: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.7111: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1 Source.7112: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2 Source.7113: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.7114: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.7115: DFBPPR20898 ---- Animal proteins ---- Transaldolase Source.7116: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12 Source.7117: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog Source.7118: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143 Source.7119: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.7120: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor Source.7121: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27 Source.7122: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2 Source.7123: DFBPPR20911 ---- Animal proteins ---- 40S ribosomal protein S20 Source.7124: DFBPPR20913 ---- Animal proteins ---- Somatostatin Source.7125: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.7126: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.7127: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.7128: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.7129: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.7130: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.7131: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4 Source.7132: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1 Source.7133: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14 Source.7134: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A Source.7135: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial Source.7136: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18 Source.7137: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.7138: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4 Source.7139: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1 Source.7140: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.7141: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A Source.7142: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.7143: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1 Source.7144: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.7145: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9 Source.7146: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2 Source.7147: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1 Source.7148: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial Source.7149: DFBPPR20955 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm5 Source.7150: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10 Source.7151: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17 Source.7152: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.7153: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.7154: DFBPPR20969 ---- Animal proteins ---- Sperm acrosome-associated protein 5 Source.7155: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor Source.7156: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1 Source.7157: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3 Source.7158: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial Source.7159: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit Source.7160: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.7161: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.7162: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.7163: DFBPPR20990 ---- Animal proteins ---- 60S ribosomal protein L12 Source.7164: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2 Source.7165: DFBPPR20992 ---- Animal proteins ---- 60S ribosomal protein L27 Source.7166: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.7167: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1 Source.7168: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2 Source.7169: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.7170: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B Source.7171: DFBPPR21003 ---- Animal proteins ---- Protein BCAP Source.7172: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.7173: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2 Source.7174: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor Source.7175: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.7176: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.7177: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A Source.7178: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.7179: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21 Source.7180: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5 Source.7181: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein Source.7182: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.7183: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B Source.7184: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Source.7185: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.7186: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.7187: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.7188: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.7189: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.7190: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.7191: DFBPPR21048 ---- Animal proteins ---- Protein transport protein Sec61 subunit gamma Source.7192: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.7193: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.7194: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B Source.7195: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.7196: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.7197: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1 Source.7198: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter Source.7199: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.7200: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.7201: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5 Source.7202: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma Source.7203: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.7204: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial Source.7205: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog Source.7206: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.7207: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.7208: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.7209: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A Source.7210: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22 Source.7211: DFBPPR21081 ---- Animal proteins ---- Uteroglobin Source.7212: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7 Source.7213: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.7214: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.7215: DFBPPR21087 ---- Animal proteins ---- Claudin-11 Source.7216: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.7217: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148 Source.7218: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.7219: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.7220: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.7221: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.7222: DFBPPR21106 ---- Animal proteins ---- 40S ribosomal protein S10 Source.7223: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.7224: DFBPPR21111 ---- Animal proteins ---- Zinc finger protein-like 1 Source.7225: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7 Source.7226: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein Source.7227: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5 Source.7228: DFBPPR21117 ---- Animal proteins ---- Spindlin-2 Source.7229: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3 Source.7230: DFBPPR21123 ---- Animal proteins ---- 39S ribosomal protein L14, mitochondrial Source.7231: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17 Source.7232: DFBPPR21133 ---- Animal proteins ---- Polycomb group RING finger protein 3 Source.7233: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.7234: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2 Source.7235: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.7236: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.7237: DFBPPR21143 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog Source.7238: DFBPPR21144 ---- Animal proteins ---- Repressor of RNA polymerase III transcription MAF1 homolog Source.7239: DFBPPR21145 ---- Animal proteins ---- Transcription elongation factor SPT4 Source.7240: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.7241: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.7242: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.7243: DFBPPR21155 ---- Animal proteins ---- Cyclin-H Source.7244: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4 Source.7245: DFBPPR21160 ---- Animal proteins ---- Prefoldin subunit 3 Source.7246: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6 Source.7247: DFBPPR21167 ---- Animal proteins ---- Islet amyloid polypeptide Source.7248: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.7249: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2 Source.7250: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A Source.7251: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.7252: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52 Source.7253: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3 Source.7254: DFBPPR21177 ---- Animal proteins ---- Ran guanine nucleotide release factor Source.7255: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.7256: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173 Source.7257: DFBPPR21183 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1 Source.7258: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2 Source.7259: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22 Source.7260: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.7261: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.7262: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4 Source.7263: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.7264: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.7265: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2 Source.7266: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1 Source.7267: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A Source.7268: DFBPPR21207 ---- Animal proteins ---- Ragulator complex protein LAMTOR3 Source.7269: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.7270: DFBPPR21209 ---- Animal proteins ---- 40S ribosomal protein S6 Source.7271: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome Source.7272: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4 Source.7273: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog Source.7274: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.7275: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1 Source.7276: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29 Source.7277: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1 Source.7278: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.7279: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.7280: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.7281: DFBPPR21229 ---- Animal proteins ---- Neurexophilin-2 Source.7282: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.7283: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4 Source.7284: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.7285: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein Source.7286: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase Source.7287: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1 Source.7288: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.7289: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.7290: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial Source.7291: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3 Source.7292: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8 Source.7293: DFBPPR21254 ---- Animal proteins ---- Zinc finger protein 567 Source.7294: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.7295: DFBPPR21260 ---- Animal proteins ---- 40S ribosomal protein S21 Source.7296: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.7297: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.7298: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.7299: DFBPPR21267 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22 Source.7300: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog Source.7301: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4 Source.7302: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21 Source.7303: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.7304: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.7305: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11 Source.7306: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.7307: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.7308: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.7309: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.7310: DFBPPR21288 ---- Animal proteins ---- Polycomb group RING finger protein 1 Source.7311: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.7312: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.7313: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58 Source.7314: DFBPPR21293 ---- Animal proteins ---- IST1 homolog Source.7315: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.7316: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b Source.7317: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial Source.7318: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.7319: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.7320: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.7321: DFBPPR21302 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC9 Source.7322: DFBPPR21303 ---- Animal proteins ---- Palmdelphin Source.7323: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4 Source.7324: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.7325: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.7326: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.7327: DFBPPR21312 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 B Source.7328: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184 Source.7329: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.7330: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner Source.7331: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha Source.7332: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma Source.7333: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.7334: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34 Source.7335: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.7336: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3 Source.7337: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.7338: DFBPPR21336 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.7339: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.7340: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.7341: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C Source.7342: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204 Source.7343: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.7344: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.7345: DFBPPR21351 ---- Animal proteins ---- Protein kish-A Source.7346: DFBPPR21353 ---- Animal proteins ---- Zinc finger protein OZF Source.7347: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3 Source.7348: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.7349: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.7350: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1 Source.7351: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158 Source.7352: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.7353: DFBPPR21363 ---- Animal proteins ---- Pleckstrin homology-like domain family A member 2 Source.7354: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.7355: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.7356: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog Source.7357: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.7358: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.7359: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.7360: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.7361: DFBPPR21380 ---- Animal proteins ---- AP-4 complex subunit sigma-1 Source.7362: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4 Source.7363: DFBPPR21383 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 2A Source.7364: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.7365: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.7366: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.7367: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4 Source.7368: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.7369: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.7370: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.7371: DFBPPR21394 ---- Animal proteins ---- Elongin-C Source.7372: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.7373: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2 Source.7374: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1 Source.7375: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37 Source.7376: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.7377: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like Source.7378: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.7379: DFBPPR21415 ---- Animal proteins ---- Leucine-rich repeat-containing protein 39 Source.7380: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.7381: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1 Source.7382: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.7383: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.7384: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.7385: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84 Source.7386: DFBPPR21424 ---- Animal proteins ---- Chromosome transmission fidelity protein 8 homolog Source.7387: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3 Source.7388: DFBPPR21427 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 2 Source.7389: DFBPPR21428 ---- Animal proteins ---- Protein LBH Source.7390: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1 Source.7391: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A Source.7392: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.7393: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A Source.7394: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207 Source.7395: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8 Source.7396: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.7397: DFBPPR21448 ---- Animal proteins ---- Protein N-lysine methyltransferase METTL21A Source.7398: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2 Source.7399: DFBPPR21452 ---- Animal proteins ---- Spermatogenic leucine zipper protein 1 Source.7400: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.7401: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2 Source.7402: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A Source.7403: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.7404: DFBPPR21465 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD Source.7405: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.7406: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.7407: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.7408: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.7409: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.7410: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.7411: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.7412: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8 Source.7413: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1 Source.7414: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1 Source.7415: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8 Source.7416: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.7417: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.7418: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.7419: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.7420: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.7421: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3 Source.7422: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.7423: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3 Source.7424: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40 Source.7425: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1 Source.7426: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1 Source.7427: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.7428: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.7429: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B Source.7430: DFBPPR21513 ---- Animal proteins ---- Profilin-3 Source.7431: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2 Source.7432: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1 Source.7433: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.7434: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase Source.7435: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.7436: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor Source.7437: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2 Source.7438: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.7439: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225 Source.7440: DFBPPR21535 ---- Animal proteins ---- Gastrotropin Source.7441: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.7442: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.7443: DFBPPR21540 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.7444: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A Source.7445: DFBPPR21544 ---- Animal proteins ---- General transcription factor IIE subunit 2 Source.7446: DFBPPR21547 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.7447: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.7448: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4 Source.7449: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.7450: DFBPPR21556 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit gamma Source.7451: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55 Source.7452: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39 Source.7453: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.7454: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1 Source.7455: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.7456: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B Source.7457: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2 Source.7458: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.7459: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.7460: DFBPPR21586 ---- Animal proteins ---- Cyclin-C Source.7461: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.7462: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.7463: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.7464: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.7465: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.7466: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3 Source.7467: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.7468: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.7469: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1 Source.7470: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.7471: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.7472: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.7473: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.7474: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1 Source.7475: DFBPPR21627 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 gamma Source.7476: DFBPPR21628 ---- Animal proteins ---- G patch domain-containing protein 11 Source.7477: DFBPPR21629 ---- Animal proteins ---- Annexin A3 Source.7478: DFBPPR21630 ---- Animal proteins ---- Maspardin Source.7479: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14 Source.7480: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1 Source.7481: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4 Source.7482: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44 Source.7483: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6 Source.7484: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.7485: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.7486: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6 Source.7487: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1 Source.7488: DFBPPR21654 ---- Animal proteins ---- DET1- and DDB1-associated protein 1 Source.7489: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7 Source.7490: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.7491: DFBPPR21657 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 3 Source.7492: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial Source.7493: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1 Source.7494: DFBPPR21663 ---- Animal proteins ---- Trafficking protein particle complex subunit 6B Source.7495: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.7496: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.7497: DFBPPR21669 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 3 Source.7498: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2 Source.7499: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4 Source.7500: DFBPPR21675 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2B Source.7501: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A Source.7502: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.7503: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26 Source.7504: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A Source.7505: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog Source.7506: DFBPPR21684 ---- Animal proteins ---- Stannin Source.7507: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.7508: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18 Source.7509: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1 Source.7510: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.7511: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator Source.7512: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208 Source.7513: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.7514: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2 Source.7515: DFBPPR21704 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 5 Source.7516: DFBPPR21706 ---- Animal proteins ---- Small membrane A-kinase anchor protein Source.7517: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog Source.7518: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.7519: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.7520: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.7521: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.7522: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1 Source.7523: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.7524: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.7525: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2 Source.7526: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A Source.7527: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.7528: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7 Source.7529: DFBPPR21738 ---- Animal proteins ---- Bcl-2-related protein A1 Source.7530: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.7531: DFBPPR21743 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2A Source.7532: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.7533: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.7534: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS Source.7535: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.7536: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.7537: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2 Source.7538: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein Source.7539: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.7540: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6 Source.7541: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25 Source.7542: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12 Source.7543: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.7544: DFBPPR21768 ---- Animal proteins ---- Tektin-4 Source.7545: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6 Source.7546: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130 Source.7547: DFBPPR21777 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 10 Source.7548: DFBPPR21780 ---- Animal proteins ---- 40S ribosomal protein S11 Source.7549: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.7550: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2 Source.7551: DFBPPR21785 ---- Animal proteins ---- Spermatogenesis-associated protein 19, mitochondrial Source.7552: DFBPPR21789 ---- Animal proteins ---- Protein kish-B Source.7553: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.7554: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.7555: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial Source.7556: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.7557: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10 Source.7558: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B Source.7559: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1 Source.7560: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.7561: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.7562: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2 Source.7563: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.7564: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11 Source.7565: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.7566: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7 Source.7567: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1 Source.7568: DFBPPR21826 ---- Animal proteins ---- RING finger protein 141 Source.7569: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier Source.7570: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3 Source.7571: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B Source.7572: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.7573: DFBPPR21843 ---- Animal proteins ---- Tektin-1 Source.7574: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1 Source.7575: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.7576: DFBPPR21855 ---- Animal proteins ---- Proline-rich nuclear receptor coactivator 2 Source.7577: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2 Source.7578: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3 Source.7579: DFBPPR21866 ---- Animal proteins ---- c-Myc-binding protein Source.7580: DFBPPR21867 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5 Source.7581: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.7582: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.7583: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.7584: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.7585: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.7586: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1 Source.7587: DFBPPR21882 ---- Animal proteins ---- Insulin-like peptide INSL6 Source.7588: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39 Source.7589: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.7590: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2 Source.7591: DFBPPR21887 ---- Animal proteins ---- Cyclin-G1 Source.7592: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6 Source.7593: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.7594: DFBPPR21899 ---- Animal proteins ---- Gametocyte-specific factor 1 Source.7595: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1 Source.7596: DFBPPR21902 ---- Animal proteins ---- Centromere protein N Source.7597: DFBPPR21904 ---- Animal proteins ---- Protein TBATA Source.7598: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2 Source.7599: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.7600: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11 Source.7601: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.7602: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1 Source.7603: DFBPPR21912 ---- Animal proteins ---- Death-associated protein 1 Source.7604: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2 Source.7605: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13 Source.7606: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13 Source.7607: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2 Source.7608: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4 Source.7609: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog Source.7610: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.7611: DFBPPR21930 ---- Animal proteins ---- Protein Churchill Source.7612: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.7613: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.7614: DFBPPR21938 ---- Animal proteins ---- Protein RER1 Source.7615: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.7616: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.7617: DFBPPR21942 ---- Animal proteins ---- Neurexophilin-1 Source.7618: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.7619: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414 Source.7620: DFBPPR21947 ---- Animal proteins ---- rRNA-processing protein UTP23 homolog Source.7621: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.7622: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.7623: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1 Source.7624: DFBPPR21954 ---- Animal proteins ---- Secreted seminal-vesicle Ly-6 protein 1 Source.7625: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.7626: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.7627: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.7628: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.7629: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.7630: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog Source.7631: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial Source.7632: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28 Source.7633: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1 Source.7634: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5 Source.7635: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.7636: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.7637: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog Source.7638: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.7639: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.7640: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1 Source.7641: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8 Source.7642: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.7643: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Source.7644: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1 Source.7645: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3 Source.7646: DFBPPR22000 ---- Animal proteins ---- Protein LDOC1 Source.7647: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.7648: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81 Source.7649: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.7650: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1 Source.7651: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E Source.7652: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.7653: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.7654: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.7655: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein Source.7656: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.7657: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.7658: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1 Source.7659: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2 Source.7660: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1 Source.7661: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7 Source.7662: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.7663: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.7664: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3 Source.7665: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12 Source.7666: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C Source.7667: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37 Source.7668: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B Source.7669: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.7670: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.7671: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.7672: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3 Source.7673: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.7674: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.7675: DFBPPR22059 ---- Animal proteins ---- Immediate early response 3-interacting protein 1 Source.7676: DFBPPR22061 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial Source.7677: DFBPPR22062 ---- Animal proteins ---- Protein FAM72A Source.7678: DFBPPR22068 ---- Animal proteins ---- Protein GPR108 Source.7679: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.7680: DFBPPR22071 ---- Animal proteins ---- Neuromedin-S Source.7681: DFBPPR22072 ---- Animal proteins ---- Brain protein I3 Source.7682: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B Source.7683: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6 Source.7684: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial Source.7685: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4 Source.7686: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.7687: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.7688: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein Source.7689: DFBPPR22083 ---- Animal proteins ---- 40S ribosomal protein S15a Source.7690: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49 Source.7691: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.7692: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1 Source.7693: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.7694: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.7695: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.7696: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B Source.7697: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog Source.7698: DFBPPR22100 ---- Animal proteins ---- Centromere protein M Source.7699: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.7700: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.7701: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1 Source.7702: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial Source.7703: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1 Source.7704: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.7705: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1 Source.7706: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.7707: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.7708: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.7709: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein Source.7710: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.7711: DFBPPR22130 ---- Animal proteins ---- 60S ribosomal protein L9 Source.7712: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2 Source.7713: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a Source.7714: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.7715: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B Source.7716: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2 Source.7717: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.7718: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.7719: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2 Source.7720: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.7721: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.7722: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.7723: DFBPPR22148 ---- Animal proteins ---- Hemogen Source.7724: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.7725: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.7726: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.7727: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1 Source.7728: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1 Source.7729: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24 Source.7730: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.7731: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2 Source.7732: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106 Source.7733: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.7734: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182 Source.7735: DFBPPR22174 ---- Animal proteins ---- Ribonuclease kappa Source.7736: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.7737: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog Source.7738: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.7739: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.7740: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.7741: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8 Source.7742: DFBPPR22184 ---- Animal proteins ---- 60S ribosomal protein L32 Source.7743: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2 Source.7744: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.7745: DFBPPR22190 ---- Animal proteins ---- Protein NKG7 Source.7746: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5 Source.7747: DFBPPR22193 ---- Animal proteins ---- CapZ-interacting protein Source.7748: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein Source.7749: DFBPPR22199 ---- Animal proteins ---- SCAN domain-containing protein 1 Source.7750: DFBPPR22200 ---- Animal proteins ---- Profilin-4 Source.7751: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.7752: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1 Source.7753: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147 Source.7754: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein Source.7755: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B Source.7756: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.7757: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog Source.7758: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.7759: DFBPPR22218 ---- Animal proteins ---- Galectin-4 Source.7760: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.7761: DFBPPR22220 ---- Animal proteins ---- Secretoglobin family 1D member Source.7762: DFBPPR22221 ---- Animal proteins ---- Ubiquitin-like protein 5 Source.7763: DFBPPR22223 ---- Animal proteins ---- Calretinin Source.7764: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8 Source.7765: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22 Source.7766: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.7767: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A Source.7768: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.7769: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300 Source.7770: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.7771: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.7772: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5 Source.7773: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.7774: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.7775: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.7776: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog Source.7777: DFBPPR22249 ---- Animal proteins ---- CXXC motif containing zinc binding protein Source.7778: DFBPPR22251 ---- Animal proteins ---- SUZ domain-containing protein 1 Source.7779: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1 Source.7780: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.7781: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2 Source.7782: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5 Source.7783: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.7784: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18 Source.7785: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial Source.7786: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17 Source.7787: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B Source.7788: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40 Source.7789: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.7790: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a Source.7791: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.7792: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2 Source.7793: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222 Source.7794: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1 Source.7795: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2 Source.7796: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.7797: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2 Source.7798: DFBPPR22303 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 4 Source.7799: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.7800: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1 Source.7801: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1 Source.7802: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein Source.7803: DFBPPR22315 ---- Animal proteins ---- Probable cystatin-15 Source.7804: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218 Source.7805: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B Source.7806: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1 Source.7807: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.7808: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70 Source.7809: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7 Source.7810: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.7811: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3 Source.7812: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.7813: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1 Source.7814: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.7815: DFBPPR22336 ---- Animal proteins ---- 60S ribosomal protein L37a Source.7816: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16 Source.7817: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.7818: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A Source.7819: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.7820: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog Source.7821: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63 Source.7822: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11 Source.7823: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.7824: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.7825: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein Source.7826: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.7827: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.7828: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like Source.7829: DFBPPR22361 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.7830: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23 Source.7831: DFBPPR22367 ---- Animal proteins ---- 60S ribosomal protein L22-like 1 Source.7832: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.7833: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.7834: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92 Source.7835: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like Source.7836: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86 Source.7837: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B Source.7838: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5 Source.7839: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.7840: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A Source.7841: DFBPPR22391 ---- Animal proteins ---- Transmembrane protein 88B Source.7842: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2 Source.7843: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein Source.7844: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.7845: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474 Source.7846: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.7847: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog Source.7848: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.7849: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5 Source.7850: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog Source.7851: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46 Source.7852: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog Source.7853: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.7854: DFBPPR22426 ---- Animal proteins ---- Single-pass membrane and coiled-coil domain-containing protein 4 Source.7855: DFBPPR22427 ---- Animal proteins ---- Coiled-coil domain-containing protein 58 Source.7856: DFBPPR22430 ---- Animal proteins ---- UPF0561 protein C2orf68 homolog Source.7857: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog Source.7858: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1 Source.7859: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.7860: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18 Source.7861: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3 Source.7862: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2 Source.7863: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.7864: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B Source.7865: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9 Source.7866: DFBPPR22450 ---- Animal proteins ---- Leucine-rich single-pass membrane protein 1 Source.7867: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2 Source.7868: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2 Source.7869: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein Source.7870: DFBPPR22461 ---- Animal proteins ---- Ashwin Source.7871: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2 Source.7872: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13 Source.7873: DFBPPR22467 ---- Animal proteins ---- Coiled-coil domain-containing protein 42 Source.7874: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137 Source.7875: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.7876: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.7877: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog Source.7878: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3 Source.7879: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.7880: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A Source.7881: DFBPPR22483 ---- Animal proteins ---- 60S ribosomal protein L36a Source.7882: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144 Source.7883: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5 Source.7884: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.7885: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1 Source.7886: DFBPPR22498 ---- Animal proteins ---- Protein NATD1 Source.7887: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.7888: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.7889: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2 Source.7890: DFBPPR22507 ---- Animal proteins ---- Secernin-3 Source.7891: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1 Source.7892: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2 Source.7893: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C Source.7894: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234 Source.7895: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.7896: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248 Source.7897: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.7898: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126 Source.7899: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42 Source.7900: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.7901: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8 Source.7902: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29 Source.7903: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169 Source.7904: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.7905: DFBPPR22532 ---- Animal proteins ---- Cilia- and flagella-associated protein 299 Source.7906: DFBPPR22536 ---- Animal proteins ---- Suprabasin Source.7907: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.7908: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53 Source.7909: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18 Source.7910: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25 Source.7911: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.7912: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2 Source.7913: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.7914: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1 Source.7915: DFBPPR22555 ---- Animal proteins ---- Bcl-2-like protein 15 Source.7916: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog Source.7917: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein Source.7918: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1 Source.7919: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.7920: DFBPPR22575 ---- Animal proteins ---- UPF0687 protein C20orf27 homolog Source.7921: DFBPPR22579 ---- Animal proteins ---- Proline-rich protein 15-like protein Source.7922: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1 Source.7923: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171 Source.7924: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267 Source.7925: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog Source.7926: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.7927: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.7928: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.7929: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254 Source.7930: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128 Source.7931: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36 Source.7932: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.7933: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B Source.7934: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog Source.7935: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72 Source.7936: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253 Source.7937: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30 Source.7938: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175 Source.7939: DFBPPR22640 ---- Animal proteins ---- Placenta-specific gene 8 protein Source.7940: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4 Source.7941: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.7942: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.7943: DFBPPR22646 ---- Animal proteins ---- Coiled-coil domain-containing protein 184 Source.7944: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5 Source.7945: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1 Source.7946: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.7947: DFBPPR22660 ---- Animal proteins ---- Leydig cell tumor 10 kDa protein homolog Source.7948: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.7949: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog Source.7950: DFBPPR22666 ---- Animal proteins ---- Uncharacterized protein C12orf50 homolog Source.7951: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog Source.7952: DFBPPR22668 ---- Animal proteins ---- Protein FAM243 Source.7953: DFBPPR22669 ---- Animal proteins ---- Uncharacterized protein C5orf46 homolog Source.7954: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89 Source.7955: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.7956: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein Source.7957: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.7958: DFBPPR22687 ---- Animal proteins ---- Putative UPF0730 protein encoded by LINC00643 homolog Source.7959: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.7960: DFBPPR22695 ---- Animal proteins ---- MORN repeat-containing protein 5 Source.7961: DFBPPR22703 ---- Animal proteins ---- Arrestin domain-containing protein 5 Source.7962: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28 Source.7963: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog Source.7964: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1 Source.7965: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2 Source.7966: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D Source.7967: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog Source.7968: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.7969: DFBPPR22729 ---- Animal proteins ---- UPF0538 protein C2orf76 homolog Source.7970: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1 Source.7971: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog Source.7972: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog Source.7973: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog Source.7974: DFBPPR22747 ---- Animal proteins ---- Uncharacterized protein C1orf100 homolog Source.7975: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog Source.7976: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog Source.7977: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog Source.7978: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.7979: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.7980: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.7981: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.7982: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.7983: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.7984: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.7985: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.7986: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.7987: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.7988: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.7989: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.7990: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.7991: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.7992: DFBPPR8546 ---- Animal proteins ---- Insulin Source.7993: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.7994: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase Source.7995: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.7996: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.7997: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.7998: DFBPPR8553 ---- Animal proteins ---- Protein AMBP Source.7999: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.8000: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.8001: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.8002: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.8003: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.8004: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial Source.8005: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.8006: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.8007: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.8008: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.8009: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.8010: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.8011: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.8012: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.8013: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.8014: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.8015: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.8016: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.8017: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.8018: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.8019: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1 Source.8020: DFBPPR8582 ---- Animal proteins ---- Interferon gamma Source.8021: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.8022: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.8023: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B Source.8024: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.8025: DFBPPR8588 ---- Animal proteins ---- Leptin Source.8026: DFBPPR8589 ---- Animal proteins ---- Pro-glucagon Source.8027: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase Source.8028: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.8029: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.8030: DFBPPR8595 ---- Animal proteins ---- Annexin A4 Source.8031: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.8032: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.8033: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.8034: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.8035: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein Source.8036: DFBPPR8607 ---- Animal proteins ---- Prolactin Source.8037: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.8038: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.8039: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.8040: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.8041: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase Source.8042: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.8043: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.8044: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.8045: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.8046: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.8047: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1 Source.8048: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.8049: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.8050: DFBPPR8628 ---- Animal proteins ---- Inhibin beta A chain Source.8051: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1 Source.8052: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.8053: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase Source.8054: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.8055: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.8056: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C Source.8057: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.8058: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.8059: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.8060: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.8061: DFBPPR8642 ---- Animal proteins ---- Major prion protein Source.8062: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.8063: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.8064: DFBPPR8647 ---- Animal proteins ---- Beclin-1 Source.8065: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.8066: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor Source.8067: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.8068: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.8069: DFBPPR8654 ---- Animal proteins ---- DNA-binding protein inhibitor ID-2 Source.8070: DFBPPR8655 ---- Animal proteins ---- Azurocidin Source.8071: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A Source.8072: DFBPPR8657 ---- Animal proteins ---- Annexin A2 Source.8073: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta Source.8074: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.8075: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.8076: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.8077: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.8078: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.8079: DFBPPR8673 ---- Animal proteins ---- Calreticulin Source.8080: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.8081: DFBPPR8675 ---- Animal proteins ---- Receptor of activated protein C kinase 1 Source.8082: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.8083: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.8084: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.8085: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.8086: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.8087: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.8088: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.8089: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.8090: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.8091: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.8092: DFBPPR8694 ---- Animal proteins ---- Spastin Source.8093: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.8094: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.8095: DFBPPR8697 ---- Animal proteins ---- Ras-related protein Rab-11A Source.8096: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.8097: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C Source.8098: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.8099: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.8100: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.8101: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.8102: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.8103: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.8104: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.8105: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.8106: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6 Source.8107: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.8108: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.8109: DFBPPR8718 ---- Animal proteins ---- Ras-related protein Rab-27A Source.8110: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha Source.8111: DFBPPR8722 ---- Animal proteins ---- Ras-related protein Rab-5A Source.8112: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.8113: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.8114: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.8115: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.8116: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.8117: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H Source.8118: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.8119: DFBPPR8738 ---- Animal proteins ---- Interleukin-8 Source.8120: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.8121: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.8122: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.8123: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.8124: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.8125: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.8126: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.8127: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.8128: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.8129: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.8130: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.8131: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin Source.8132: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein Source.8133: DFBPPR8759 ---- Animal proteins ---- Caveolin-3 Source.8134: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.8135: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.8136: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.8137: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1 Source.8138: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.8139: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.8140: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.8141: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.8142: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.8143: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.8144: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.8145: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.8146: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.8147: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.8148: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain Source.8149: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.8150: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3 Source.8151: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.8152: DFBPPR8787 ---- Animal proteins ---- Cathepsin D Source.8153: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.8154: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.8155: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain Source.8156: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.8157: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.8158: DFBPPR8796 ---- Animal proteins ---- UMP-CMP kinase Source.8159: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta Source.8160: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.8161: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone Source.8162: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.8163: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase Source.8164: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II Source.8165: DFBPPR8803 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte Source.8166: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase Source.8167: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.8168: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.8169: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S Source.8170: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.8171: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase Source.8172: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.8173: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.8174: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.8175: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA Source.8176: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain Source.8177: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.8178: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.8179: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.8180: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.8181: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.8182: DFBPPR8825 ---- Animal proteins ---- Optineurin Source.8183: DFBPPR8826 ---- Animal proteins ---- Phospholemman Source.8184: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase Source.8185: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.8186: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.8187: DFBPPR8831 ---- Animal proteins ---- Interferon regulatory factor 1 Source.8188: DFBPPR8836 ---- Animal proteins ---- Myogenin Source.8189: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance Source.8190: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.8191: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.8192: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.8193: DFBPPR8843 ---- Animal proteins ---- Pepsin A Source.8194: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.8195: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.8196: DFBPPR8848 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase Source.8197: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.8198: DFBPPR8866 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma Source.8199: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.8200: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2 Source.8201: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1 Source.8202: DFBPPR8870 ---- Animal proteins ---- Ribonuclease K3 Source.8203: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8204: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8205: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A Source.8206: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.8207: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.8208: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B Source.8209: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.8210: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.8211: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.8212: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.8213: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.8214: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.8215: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.8216: DFBPPR8906 ---- Animal proteins ---- Sialidase-1 Source.8217: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.8218: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A Source.8219: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.8220: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.8221: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.8222: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.8223: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.8224: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.8225: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.8226: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.8227: DFBPPR8939 ---- Animal proteins ---- Kit ligand Source.8228: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta Source.8229: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.8230: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.8231: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha Source.8232: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha Source.8233: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.8234: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha Source.8235: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.8236: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.8237: DFBPPR8973 ---- Animal proteins ---- Caspase-3 Source.8238: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.8239: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.8240: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.8241: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.8242: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.8243: DFBPPR8983 ---- Animal proteins ---- Receptor activity-modifying protein 1 Source.8244: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.8245: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.8246: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta Source.8247: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.8248: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain Source.8249: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain Source.8250: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component Source.8251: DFBPPR9005 ---- Animal proteins ---- Protein amnionless Source.8252: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic Source.8253: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.8254: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.8255: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.8256: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.8257: DFBPPR9013 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.8258: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.8259: DFBPPR9015 ---- Animal proteins ---- Serotransferrin Source.8260: DFBPPR9017 ---- Animal proteins ---- Mannose-binding protein C Source.8261: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1 Source.8262: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.8263: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.8264: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.8265: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.8266: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.8267: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.8268: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.8269: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.8270: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.8271: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.8272: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.8273: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.8274: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.8275: DFBPPR9044 ---- Animal proteins ---- Albumin Source.8276: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.8277: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2 Source.8278: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B Source.8279: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.8280: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4 Source.8281: DFBPPR9052 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B Source.8282: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.8283: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf Source.8284: DFBPPR9061 ---- Animal proteins ---- Caspase-1 Source.8285: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.8286: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.8287: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.8288: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.8289: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.8290: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.8291: DFBPPR9081 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.8292: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.8293: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.8294: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.8295: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.8296: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.8297: DFBPPR9091 ---- Animal proteins ---- Antileukoproteinase Source.8298: DFBPPR9093 ---- Animal proteins ---- Hemopexin Source.8299: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5 Source.8300: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.8301: DFBPPR9098 ---- Animal proteins ---- Gastrotropin Source.8302: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.8303: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.8304: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.8305: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.8306: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator Source.8307: DFBPPR9108 ---- Animal proteins ---- Somatostatin Source.8308: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I Source.8309: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.8310: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.8311: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.8312: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.8313: DFBPPR9116 ---- Animal proteins ---- Cathepsin B Source.8314: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.8315: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.8316: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.8317: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.8318: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.8319: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.8320: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.8321: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.8322: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.8323: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.8324: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.8325: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.8326: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.8327: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.8328: DFBPPR9143 ---- Animal proteins ---- NKG2-D type II integral membrane protein Source.8329: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II Source.8330: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.8331: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.8332: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.8333: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.8334: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.8335: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.8336: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.8337: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.8338: DFBPPR9159 ---- Animal proteins ---- Hematopoietic cell signal transducer Source.8339: DFBPPR9160 ---- Animal proteins ---- Acylphosphatase-1 Source.8340: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.8341: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.8342: DFBPPR9166 ---- Animal proteins ---- Uricase Source.8343: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.8344: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.8345: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.8346: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase Source.8347: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta Source.8348: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6 Source.8349: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.8350: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.8351: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.8352: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain Source.8353: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2 Source.8354: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.8355: DFBPPR9194 ---- Animal proteins ---- Arginase-1 Source.8356: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein Source.8357: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.8358: DFBPPR9198 ---- Animal proteins ---- Fibroblast growth factor 7 Source.8359: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23 Source.8360: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.8361: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.8362: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a Source.8363: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.8364: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein Source.8365: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain Source.8366: DFBPPR9210 ---- Animal proteins ---- 40S ribosomal protein S23 Source.8367: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.8368: DFBPPR9212 ---- Animal proteins ---- Dihydrofolate reductase Source.8369: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1 Source.8370: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.8371: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase Source.8372: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.8373: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.8374: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII Source.8375: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.8376: DFBPPR9223 ---- Animal proteins ---- Protransforming growth factor alpha Source.8377: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.8378: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.8379: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.8380: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.8381: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.8382: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C Source.8383: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.8384: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.8385: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.8386: DFBPPR9247 ---- Animal proteins ---- Alveolar macrophage chemotactic factor 2 Source.8387: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.8388: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin Source.8389: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.8390: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor Source.8391: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.8392: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.8393: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.8394: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.8395: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.8396: DFBPPR9265 ---- Animal proteins ---- Pantetheinase Source.8397: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.8398: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.8399: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.8400: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.8401: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.8402: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.8403: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.8404: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.8405: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.8406: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.8407: DFBPPR9287 ---- Animal proteins ---- 60S ribosomal protein L27 Source.8408: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.8409: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel Source.8410: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.8411: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4 Source.8412: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.8413: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase Source.8414: DFBPPR9302 ---- Animal proteins ---- Agouti-signaling protein Source.8415: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.8416: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.8417: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1 Source.8418: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.8419: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.8420: DFBPPR9312 ---- Animal proteins ---- 40S ribosomal protein S21 Source.8421: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3 Source.8422: DFBPPR9319 ---- Animal proteins ---- Myelin basic protein Source.8423: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.8424: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.8425: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.8426: DFBPPR9328 ---- Animal proteins ---- Cofilin-2 Source.8427: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3 Source.8428: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.8429: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor Source.8430: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.8431: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.8432: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.8433: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.8434: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin Source.8435: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.8436: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.8437: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B Source.8438: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.8439: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor Source.8440: DFBPPR9356 ---- Animal proteins ---- Odorant-binding protein Source.8441: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.8442: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.8443: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.8444: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.8445: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.8446: DFBPPR9366 ---- Animal proteins ---- Decorin Source.8447: DFBPPR9368 ---- Animal proteins ---- Myosin-11 Source.8448: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.8449: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.8450: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.8451: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.8452: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.8453: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.8454: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase Source.8455: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.8456: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon Source.8457: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.8458: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4 Source.8459: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.8460: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.8461: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.8462: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b Source.8463: DFBPPR9397 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.8464: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.8465: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34 Source.8466: DFBPPR9404 ---- Animal proteins ---- Tryptase Source.8467: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase Source.8468: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase Source.8469: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase Source.8470: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.8471: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.8472: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.8473: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin Source.8474: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.8475: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase Source.8476: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.8477: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.8478: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.8479: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59 Source.8480: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59 Source.8481: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5 Source.8482: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.8483: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.8484: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.8485: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.8486: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.8487: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7 Source.8488: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1 Source.8489: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.8490: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1 Source.8491: DFBPPR9485 ---- Animal proteins ---- Destrin Source.8492: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.8493: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14 Source.8494: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.8495: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor Source.8496: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.8497: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.8498: DFBPPR9505 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial Source.8499: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.8500: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.8501: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.8502: DFBPPR9511 ---- Animal proteins ---- Cholinesterase Source.8503: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3 Source.8504: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.8505: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.8506: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain Source.8507: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a Source.8508: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a Source.8509: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.8510: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.8511: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.8512: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE Source.8513: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein Source.8514: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor Source.8515: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial Source.8516: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.8517: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.8518: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.8519: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase Source.8520: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.8521: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E Source.8522: DFBPPR9547 ---- Animal proteins ---- Ras-related protein Rab-1B Source.8523: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha Source.8524: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.8525: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.8526: DFBPPR9555 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.8527: DFBPPR9556 ---- Animal proteins ---- N(4)-(Beta-N-acetylglucosaminyl)-L-asparaginase Source.8528: DFBPPR9561 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.8529: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.8530: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1 Source.8531: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.8532: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3 Source.8533: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1 Source.8534: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.8535: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26 Source.8536: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.8537: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.8538: DFBPPR9581 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.8539: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.8540: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.8541: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.8542: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor Source.8543: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.8544: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.8545: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.8546: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.8547: DFBPPR9608 ---- Animal proteins ---- Interleukin-21 Source.8548: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.8549: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.8550: DFBPPR9612 ---- Animal proteins ---- 40S ribosomal protein S20 Source.8551: DFBPPR9615 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit Source.8552: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.8553: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.8554: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11 Source.8555: DFBPPR9624 ---- Animal proteins ---- Cadherin-3 Source.8556: DFBPPR9626 ---- Animal proteins ---- Adenylyl cyclase-associated protein 1 Source.8557: DFBPPR9629 ---- Animal proteins ---- Antibacterial peptide PMAP-36 Source.8558: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.8559: DFBPPR9633 ---- Animal proteins ---- Claudin-17 Source.8560: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.8561: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase Source.8562: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein Source.8563: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.8564: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog Source.8565: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.8566: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1 Source.8567: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.8568: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.8569: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6 Source.8570: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.8571: DFBPPR9657 ---- Animal proteins ---- Ragulator complex protein LAMTOR5 Source.8572: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5 Source.8573: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.8574: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.8575: DFBPPR9665 ---- Animal proteins ---- 60S ribosomal protein L21 Source.8576: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1 Source.8577: DFBPPR9669 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.8578: DFBPPR9675 ---- Animal proteins ---- Cystatin-A5 Source.8579: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.8580: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.8581: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.8582: DFBPPR9686 ---- Animal proteins ---- Fatty acid-binding protein, heart Source.8583: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1 Source.8584: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4 Source.8585: DFBPPR9690 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.8586: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.8587: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.8588: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.8589: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor Source.8590: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1 Source.8591: DFBPPR9700 ---- Animal proteins ---- Galectin-1 Source.8592: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39 Source.8593: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.8594: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta Source.8595: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.8596: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1 Source.8597: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.8598: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27 Source.8599: DFBPPR9716 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1 Source.8600: DFBPPR9717 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.8601: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain Source.8602: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.8603: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.8604: DFBPPR9733 ---- Animal proteins ---- Interleukin-17A Source.8605: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2 Source.8606: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain Source.8607: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.8608: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7 Source.8609: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.8610: DFBPPR9741 ---- Animal proteins ---- Syndecan-4 Source.8611: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis Source.8612: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.8613: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog Source.8614: DFBPPR9753 ---- Animal proteins ---- Syntaxin-binding protein 2 Source.8615: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region Source.8616: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.8617: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide Source.8618: DFBPPR9759 ---- Animal proteins ---- Palmdelphin Source.8619: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.8620: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform Source.8621: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.8622: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1 Source.8623: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A Source.8624: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5 Source.8625: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a Source.8626: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.8627: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.8628: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.8629: DFBPPR9779 ---- Animal proteins ---- Beta-2-microglobulin Source.8630: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15 Source.8631: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8 Source.8632: DFBPPR9786 ---- Animal proteins ---- Adipogenin Source.8633: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2 Source.8634: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.8635: DFBPPR9792 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.8636: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3 Source.8637: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.8638: DFBPPR9797 ---- Animal proteins ---- Neuromedin-U-25 Source.8639: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.8640: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.8641: DFBPPR9805 ---- Animal proteins ---- Fatty acid-binding protein, intestinal Source.8642: DFBPPR9807 ---- Animal proteins ---- Galectin-4 Source.8643: DFBPPR9815 ---- Animal proteins ---- Eukaryotic translation initiation factor 1b Source.8644: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.8645: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.8646: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.8647: DFBPPR9824 ---- Animal proteins ---- 60S ribosomal protein L32 Source.8648: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1 Source.8649: DFBPPR9829 ---- Animal proteins ---- Translationally-controlled tumor protein Source.8650: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.8651: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.8652: DFBPPR9835 ---- Animal proteins ---- 60S ribosomal protein L36a Source.8653: DFBPPR9843 ---- Animal proteins ---- P protein Source.8654: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.8655: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.8656: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C Source.8657: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.8658: DFBPPR9862 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.8659: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.8660: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A Source.8661: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.8662: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2 Source.8663: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.8664: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.8665: DFBPPR9875 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.8666: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.8667: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.8668: DFBPPR9887 ---- Animal proteins ---- Cystatin-A8 Source.8669: DFBPPR9891 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.8670: DFBPPR9892 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog Source.8671: DFBPPR9903 ---- Animal proteins ---- Cyclin-G1 Source.8672: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9 Source.8673: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B Source.8674: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2 Source.8675: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1 Source.8676: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.8677: DFBPPR9924 ---- Animal proteins ---- Neuronal protein NP-190 Source.8678: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin Source.8679: DFBPPR9927 ---- Animal proteins ---- Protein BTG3 Source.8680: DFBPPR9928 ---- Animal proteins ---- Galectin-2 Source.8681: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.8682: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1 Source.8683: DFBPPR9950 ---- Animal proteins ---- 20 kDa neutrophil cationic protein Source.8684: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.8685: DFBPPR9953 ---- Animal proteins ---- Gallinacin-1 alpha Source.8686: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.8687: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.8688: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.8689: DFBPPR9959 ---- Animal proteins ---- Interferon gamma Source.8690: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.8691: DFBPPR9965 ---- Animal proteins ---- Lysozyme C Source.8692: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.8693: DFBPPR9969 ---- Animal proteins ---- Pro-glucagon Source.8694: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor Source.8695: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40 Source.8696: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.8697: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin Source.8698: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3 Source.8699: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2 Source.8700: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.8701: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.8702: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.8703: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput Source.8704: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.8705: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.8706: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I Source.8707: DFBPPR9992 ---- Animal proteins ---- Receptor of activated protein C kinase 1 Source.8708: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.8709: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.8710: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.8711: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.8712: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.8713: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2 Source.8714: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain Source.8715: DFBPPR10004 ---- Animal proteins ---- Spastin Source.8716: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.8717: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1 Source.8718: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.8719: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.8720: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16 Source.8721: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.8722: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13 Source.8723: DFBPPR10017 ---- Animal proteins ---- Interleukin-8 Source.8724: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.8725: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein Source.8726: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7 Source.8727: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.8728: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.8729: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.8730: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.8731: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B Source.8732: DFBPPR10030 ---- Animal proteins ---- Calbindin Source.8733: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.8734: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.8735: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.8736: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.8737: DFBPPR10037 ---- Animal proteins ---- Leptin Source.8738: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.8739: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.8740: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.8741: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.8742: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.8743: DFBPPR10045 ---- Animal proteins ---- Albumin Source.8744: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.8745: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.8746: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.8747: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.8748: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.8749: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.8750: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.8751: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.8752: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.8753: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7 Source.8754: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.8755: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1 Source.8756: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.8757: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.8758: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.8759: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.8760: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.8761: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.8762: DFBPPR10082 ---- Animal proteins ---- Pinopsin Source.8763: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.8764: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.8765: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.8766: DFBPPR10088 ---- Animal proteins ---- Ras-related protein Rab-11A Source.8767: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.8768: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog Source.8769: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.8770: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4 Source.8771: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.8772: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.8773: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.8774: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1 Source.8775: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.8776: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.8777: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.8778: DFBPPR10108 ---- Animal proteins ---- Hypoxanthine-guanine phosphoribosyltransferase Source.8779: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2 Source.8780: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase Source.8781: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.8782: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.8783: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.8784: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.8785: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.8786: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.8787: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.8788: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.8789: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.8790: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.8791: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase Source.8792: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.8793: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.8794: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.8795: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein Source.8796: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.8797: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.8798: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.8799: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5 Source.8800: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.8801: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.8802: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.8803: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.8804: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.8805: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.8806: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.8807: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.8808: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5 Source.8809: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog Source.8810: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.8811: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.8812: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.8813: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II Source.8814: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.8815: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.8816: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1 Source.8817: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.8818: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.8819: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.8820: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.8821: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.8822: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.8823: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.8824: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20 Source.8825: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.8826: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.8827: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.8828: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.8829: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.8830: DFBPPR10187 ---- Animal proteins ---- Myogenin Source.8831: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.8832: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2 Source.8833: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.8834: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk Source.8835: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.8836: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.8837: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.8838: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.8839: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.8840: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.8841: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.8842: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1 Source.8843: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.8844: DFBPPR10205 ---- Animal proteins ---- Noelin Source.8845: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.8846: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.8847: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.8848: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.8849: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4 Source.8850: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.8851: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.8852: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.8853: DFBPPR10218 ---- Animal proteins ---- Occludin Source.8854: DFBPPR10219 ---- Animal proteins ---- Presenilin-1 Source.8855: DFBPPR10222 ---- Animal proteins ---- Podocalyxin Source.8856: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha Source.8857: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.8858: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11 Source.8859: DFBPPR10228 ---- Animal proteins ---- Presenilin-2 Source.8860: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.8861: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.8862: DFBPPR10231 ---- Animal proteins ---- Basigin Source.8863: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.8864: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.8865: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8 Source.8866: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1 Source.8867: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2 Source.8868: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.8869: DFBPPR10240 ---- Animal proteins ---- Cerberus Source.8870: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.8871: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.8872: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain Source.8873: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.8874: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1 Source.8875: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1 Source.8876: DFBPPR10250 ---- Animal proteins ---- Macrophage migration inhibitory factor Source.8877: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.8878: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.8879: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.8880: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.8881: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6 Source.8882: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein Source.8883: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.8884: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.8885: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2 Source.8886: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.8887: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1 Source.8888: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.8889: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.8890: DFBPPR10268 ---- Animal proteins ---- CD166 antigen Source.8891: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1 Source.8892: DFBPPR10270 ---- Animal proteins ---- Agrin Source.8893: DFBPPR10271 ---- Animal proteins ---- Cadherin-7 Source.8894: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.8895: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.8896: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.8897: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B Source.8898: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk Source.8899: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.8900: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.8901: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.8902: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.8903: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.8904: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.8905: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.8906: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.8907: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.8908: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.8909: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.8910: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.8911: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.8912: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.8913: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog Source.8914: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.8915: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.8916: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.8917: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.8918: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12 Source.8919: DFBPPR10306 ---- Animal proteins ---- D-erythrulose reductase Source.8920: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.8921: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.8922: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.8923: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.8924: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.8925: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.8926: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.8927: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.8928: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1 Source.8929: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.8930: DFBPPR10320 ---- Animal proteins ---- Insulin Source.8931: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.8932: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor Source.8933: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.8934: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.8935: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3 Source.8936: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.8937: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.8938: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.8939: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.8940: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.8941: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.8942: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.8943: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.8944: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.8945: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.8946: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK Source.8947: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2 Source.8948: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.8949: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.8950: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta Source.8951: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.8952: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.8953: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.8954: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.8955: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.8956: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.8957: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha Source.8958: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1 Source.8959: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.8960: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.8961: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.8962: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.8963: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.8964: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.8965: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.8966: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.8967: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.8968: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.8969: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2 Source.8970: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.8971: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.8972: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.8973: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.8974: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3 Source.8975: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.8976: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.8977: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.8978: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.8979: DFBPPR10403 ---- Animal proteins ---- UMP-CMP kinase Source.8980: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.8981: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.8982: DFBPPR10408 ---- Animal proteins ---- Beta-galactoside-binding lectin Source.8983: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.8984: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.8985: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.8986: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.8987: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A Source.8988: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.8989: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.8990: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.8991: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.8992: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.8993: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.8994: DFBPPR10428 ---- Animal proteins ---- Polycomb complex protein BMI-1 Source.8995: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.8996: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.8997: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.8998: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.8999: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone Source.9000: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.9001: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.9002: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.9003: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.9004: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.9005: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c Source.9006: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.9007: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.9008: DFBPPR10453 ---- Animal proteins ---- Neurotrophin-3 Source.9009: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.9010: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.9011: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.9012: DFBPPR10459 ---- Animal proteins ---- Reelin Source.9013: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.9014: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.9015: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1 Source.9016: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.9017: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.9018: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase Source.9019: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.9020: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.9021: DFBPPR10473 ---- Animal proteins ---- Gallinacin-1 Source.9022: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.9023: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.9024: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.9025: DFBPPR10477 ---- Animal proteins ---- Aprataxin Source.9026: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.9027: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.9028: DFBPPR10480 ---- Animal proteins ---- Cathepsin D Source.9029: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.9030: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.9031: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.9032: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.9033: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2 Source.9034: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.9035: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.9036: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.9037: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.9038: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.9039: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.9040: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.9041: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.9042: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.9043: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.9044: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.9045: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3 Source.9046: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2 Source.9047: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta Source.9048: DFBPPR10508 ---- Animal proteins ---- Septin-2 Source.9049: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.9050: DFBPPR10513 ---- Animal proteins ---- Parafibromin Source.9051: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.9052: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.9053: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.9054: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.9055: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.9056: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9 Source.9057: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.9058: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta Source.9059: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2 Source.9060: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1 Source.9061: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.9062: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.9063: DFBPPR10531 ---- Animal proteins ---- Serpin H1 Source.9064: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase Source.9065: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.9066: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.9067: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain Source.9068: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.9069: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.9070: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.9071: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3 Source.9072: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.9073: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.9074: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.9075: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.9076: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.9077: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.9078: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.9079: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.9080: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.9081: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.9082: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.9083: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.9084: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.9085: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.9086: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase Source.9087: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.9088: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b Source.9089: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.9090: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase Source.9091: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.9092: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6 Source.9093: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin Source.9094: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase Source.9095: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.9096: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.9097: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.9098: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.9099: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.9100: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain Source.9101: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.9102: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.9103: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.9104: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.9105: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic Source.9106: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.9107: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.9108: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.9109: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.9110: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.9111: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX Source.9112: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.9113: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.9114: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.9115: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.9116: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.9117: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.9118: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin Source.9119: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.9120: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA Source.9121: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.9122: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.9123: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.9124: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.9125: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.9126: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.9127: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase Source.9128: DFBPPR10634 ---- Animal proteins ---- Procathepsin L Source.9129: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.9130: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.9131: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein Source.9132: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3 Source.9133: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.9134: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.9135: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase Source.9136: DFBPPR10647 ---- Animal proteins ---- Gallinacin-4 Source.9137: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.9138: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.9139: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.9140: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.9141: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.9142: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.9143: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1 Source.9144: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.9145: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.9146: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.9147: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.9148: DFBPPR10660 ---- Animal proteins ---- Tsukushin Source.9149: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.9150: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.9151: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig Source.9152: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1 Source.9153: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.9154: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.9155: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.9156: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.9157: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.9158: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.9159: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.9160: DFBPPR10674 ---- Animal proteins ---- Myelin basic protein Source.9161: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.9162: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.9163: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin Source.9164: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.9165: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.9166: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.9167: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.9168: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.9169: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.9170: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2 Source.9171: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.9172: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.9173: DFBPPR10700 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 2 Source.9174: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.9175: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.9176: DFBPPR10703 ---- Animal proteins ---- Tensin Source.9177: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.9178: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.9179: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.9180: DFBPPR10709 ---- Animal proteins ---- Docking protein 3 Source.9181: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.9182: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.9183: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9 Source.9184: DFBPPR10715 ---- Animal proteins ---- Lumican Source.9185: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.9186: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform Source.9187: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog Source.9188: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.9189: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8 Source.9190: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.9191: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.9192: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.9193: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.9194: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.9195: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.9196: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1 Source.9197: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.9198: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.9199: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.9200: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.9201: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1 Source.9202: DFBPPR10747 ---- Animal proteins ---- Cathepsin B Source.9203: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.9204: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.9205: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.9206: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.9207: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.9208: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.9209: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase Source.9210: DFBPPR10760 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.9211: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A Source.9212: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.9213: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6 Source.9214: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.9215: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5 Source.9216: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.9217: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase Source.9218: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.9219: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1 Source.9220: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.9221: DFBPPR10780 ---- Animal proteins ---- Caspase-2 Source.9222: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain Source.9223: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b Source.9224: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.9225: DFBPPR10785 ---- Animal proteins ---- Cytochrome b5 Source.9226: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2 Source.9227: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.9228: DFBPPR10794 ---- Animal proteins ---- Zyxin Source.9229: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.9230: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase Source.9231: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase Source.9232: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.9233: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.9234: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.9235: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.9236: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.9237: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.9238: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.9239: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.9240: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.9241: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10 Source.9242: DFBPPR10816 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1 Source.9243: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.9244: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.9245: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.9246: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain Source.9247: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.9248: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.9249: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.9250: DFBPPR10826 ---- Animal proteins ---- Cofilin-2 Source.9251: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.9252: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa Source.9253: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1 Source.9254: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.9255: DFBPPR10837 ---- Animal proteins ---- GTPase NRas Source.9256: DFBPPR10841 ---- Animal proteins ---- Gallinacin-13 Source.9257: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5 Source.9258: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.9259: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5 Source.9260: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1 Source.9261: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.9262: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.9263: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A Source.9264: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.9265: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.9266: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.9267: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.9268: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.9269: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.9270: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.9271: DFBPPR10865 ---- Animal proteins ---- Transgelin Source.9272: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.9273: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.9274: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11 Source.9275: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2 Source.9276: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.9277: DFBPPR10873 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-2 Source.9278: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme Source.9279: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.9280: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.9281: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.9282: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain Source.9283: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.9284: DFBPPR10885 ---- Animal proteins ---- Pepsin A Source.9285: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.9286: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.9287: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5 Source.9288: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.9289: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.9290: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.9291: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.9292: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.9293: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.9294: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform Source.9295: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.9296: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152 Source.9297: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.9298: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12 Source.9299: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.9300: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.9301: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.9302: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.9303: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.9304: DFBPPR10920 ---- Animal proteins ---- Troponin T, fast skeletal muscle isoforms Source.9305: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.9306: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3 Source.9307: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B Source.9308: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.9309: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.9310: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.9311: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase Source.9312: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.9313: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.9314: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.9315: DFBPPR10934 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.9316: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.9317: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.9318: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.9319: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos Source.9320: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.9321: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.9322: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.9323: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.9324: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.9325: DFBPPR10945 ---- Animal proteins ---- Prosaposin Source.9326: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.9327: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.9328: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.9329: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.9330: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.9331: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.9332: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2 Source.9333: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho Source.9334: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.9335: DFBPPR10964 ---- Animal proteins ---- Protein artemis Source.9336: DFBPPR10966 ---- Animal proteins ---- Nuclear cap-binding protein subunit 2 Source.9337: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.9338: DFBPPR10970 ---- Animal proteins ---- Prohibitin Source.9339: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.9340: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.9341: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog Source.9342: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.9343: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.9344: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain Source.9345: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.9346: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.9347: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.9348: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C Source.9349: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.9350: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20 Source.9351: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.9352: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.9353: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.9354: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.9355: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.9356: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.9357: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.9358: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D Source.9359: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.9360: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.9361: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1 Source.9362: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain Source.9363: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.9364: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein Source.9365: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.9366: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.9367: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase Source.9368: DFBPPR11007 ---- Animal proteins ---- Anamorsin Source.9369: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.9370: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.9371: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1 Source.9372: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.9373: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.9374: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.9375: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2 Source.9376: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.9377: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor Source.9378: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein Source.9379: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.9380: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu Source.9381: DFBPPR11027 ---- Animal proteins ---- Ras-related protein Rab-18 Source.9382: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein Source.9383: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.9384: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.9385: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.9386: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.9387: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.9388: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.9389: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.9390: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.9391: DFBPPR11043 ---- Animal proteins ---- Centromere protein H Source.9392: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.9393: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.9394: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.9395: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.9396: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.9397: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.9398: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic Source.9399: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.9400: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A Source.9401: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.9402: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2 Source.9403: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein Source.9404: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.9405: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha Source.9406: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.9407: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.9408: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.9409: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.9410: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.9411: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.9412: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1 Source.9413: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.9414: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.9415: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.9416: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.9417: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.9418: DFBPPR11095 ---- Animal proteins ---- Ras-related protein Rab-33B Source.9419: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.9420: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.9421: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS Source.9422: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5 Source.9423: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.9424: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.9425: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial Source.9426: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase Source.9427: DFBPPR11112 ---- Animal proteins ---- Protein quaking Source.9428: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.9429: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.9430: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.9431: DFBPPR11118 ---- Animal proteins ---- Filensin Source.9432: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.9433: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.9434: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.9435: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.9436: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.9437: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.9438: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.9439: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.9440: DFBPPR11133 ---- Animal proteins ---- Transcription factor MafG Source.9441: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3 Source.9442: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.9443: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.9444: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3 Source.9445: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain Source.9446: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B Source.9447: DFBPPR11146 ---- Animal proteins ---- Formin Source.9448: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.9449: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.9450: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog Source.9451: DFBPPR11151 ---- Animal proteins ---- SPARC Source.9452: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.9453: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain Source.9454: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.9455: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3 Source.9456: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.9457: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta Source.9458: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.9459: DFBPPR11169 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase Source.9460: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.9461: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta Source.9462: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.9463: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.9464: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3 Source.9465: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1 Source.9466: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1 Source.9467: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1 Source.9468: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29 Source.9469: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase Source.9470: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.9471: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22 Source.9472: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.9473: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.9474: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.9475: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.9476: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.9477: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.9478: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.9479: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.9480: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.9481: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.9482: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.9483: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.9484: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.9485: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1 Source.9486: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.9487: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF Source.9488: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1 Source.9489: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein Source.9490: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.9491: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.9492: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1 Source.9493: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.9494: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.9495: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38 Source.9496: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2 Source.9497: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.9498: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.9499: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.9500: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.9501: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.9502: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.9503: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.9504: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase Source.9505: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A Source.9506: DFBPPR11237 ---- Animal proteins ---- Fibroblast growth factor 3 Source.9507: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.9508: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.9509: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1 Source.9510: DFBPPR11244 ---- Animal proteins ---- Frizzled-6 Source.9511: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.9512: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.9513: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3 Source.9514: DFBPPR11248 ---- Animal proteins ---- Myelin protein P0 Source.9515: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.9516: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.9517: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.9518: DFBPPR11253 ---- Animal proteins ---- Peripherin-2 Source.9519: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4 Source.9520: DFBPPR11256 ---- Animal proteins ---- Neuroblastoma suppressor of tumorigenicity 1 Source.9521: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.9522: DFBPPR11260 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8A Source.9523: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1 Source.9524: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7 Source.9525: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B Source.9526: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.9527: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B Source.9528: DFBPPR11269 ---- Animal proteins ---- Anosmin-1 Source.9529: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.9530: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.9531: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.9532: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.9533: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.9534: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.9535: DFBPPR11282 ---- Animal proteins ---- Ras-related protein Rab-5C Source.9536: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.9537: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein Source.9538: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.9539: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.9540: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.9541: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.9542: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.9543: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.9544: DFBPPR11294 ---- Animal proteins ---- Frizzled-8 Source.9545: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.9546: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.9547: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.9548: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.9549: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.9550: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.9551: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.9552: DFBPPR11312 ---- Animal proteins ---- Transcription factor MafK Source.9553: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.9554: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.9555: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2 Source.9556: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.9557: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.9558: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8 Source.9559: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1 Source.9560: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.9561: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.9562: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1 Source.9563: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.9564: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.9565: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.9566: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2 Source.9567: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.9568: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.9569: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9 Source.9570: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2 Source.9571: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.9572: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.9573: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.9574: DFBPPR11355 ---- Animal proteins ---- Collectin-10 Source.9575: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.9576: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.9577: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2 Source.9578: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.9579: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.9580: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2 Source.9581: DFBPPR11373 ---- Animal proteins ---- Decorin Source.9582: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.9583: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1 Source.9584: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B Source.9585: DFBPPR11378 ---- Animal proteins ---- Cardiac phospholamban Source.9586: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2 Source.9587: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.9588: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.9589: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.9590: DFBPPR11387 ---- Animal proteins ---- Amphiphysin Source.9591: DFBPPR11388 ---- Animal proteins ---- Matrilin-3 Source.9592: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7 Source.9593: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.9594: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.9595: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.9596: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4 Source.9597: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1 Source.9598: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.9599: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.9600: DFBPPR11403 ---- Animal proteins ---- Destrin Source.9601: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.9602: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.9603: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.9604: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.9605: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.9606: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.9607: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.9608: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD Source.9609: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.9610: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.9611: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.9612: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.9613: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.9614: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.9615: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20 Source.9616: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.9617: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.9618: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6 Source.9619: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3 Source.9620: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.9621: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.9622: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II Source.9623: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.9624: DFBPPR11441 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B Source.9625: DFBPPR11442 ---- Animal proteins ---- 60S ribosomal protein L37a Source.9626: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform Source.9627: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.9628: DFBPPR11447 ---- Animal proteins ---- Translationally-controlled tumor protein homolog Source.9629: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7 Source.9630: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2 Source.9631: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1 Source.9632: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2 Source.9633: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.9634: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46 Source.9635: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.9636: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40 Source.9637: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.9638: DFBPPR11467 ---- Animal proteins ---- Synembryn-A Source.9639: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha Source.9640: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.9641: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.9642: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.9643: DFBPPR11475 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-B Source.9644: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.9645: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.9646: DFBPPR11484 ---- Animal proteins ---- Prolactin Source.9647: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.9648: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1 Source.9649: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1 Source.9650: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.9651: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10 Source.9652: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L Source.9653: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.9654: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.9655: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X Source.9656: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial Source.9657: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b Source.9658: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog Source.9659: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.9660: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A Source.9661: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.9662: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.9663: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.9664: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.9665: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.9666: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.9667: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.9668: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.9669: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.9670: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.9671: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.9672: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.9673: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein Source.9674: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.9675: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.9676: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg Source.9677: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4 Source.9678: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.9679: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32 Source.9680: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.9681: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.9682: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.9683: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6 Source.9684: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.9685: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.9686: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.9687: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.9688: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.9689: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.9690: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.9691: DFBPPR11600 ---- Animal proteins ---- Hyccin Source.9692: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.9693: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.9694: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.9695: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.9696: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog Source.9697: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13 Source.9698: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.9699: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.9700: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein Source.9701: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.9702: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.9703: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3 Source.9704: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.9705: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.9706: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.9707: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.9708: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59 Source.9709: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2 Source.9710: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.9711: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.9712: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.9713: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.9714: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.9715: DFBPPR11635 ---- Animal proteins ---- Cochlin Source.9716: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4 Source.9717: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon Source.9718: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.9719: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A Source.9720: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.9721: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.9722: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.9723: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.9724: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.9725: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37 Source.9726: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.9727: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.9728: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.9729: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.9730: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein Source.9731: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog Source.9732: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2 Source.9733: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.9734: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.9735: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.9736: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13 Source.9737: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.9738: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.9739: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1 Source.9740: DFBPPR11685 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22 Source.9741: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain Source.9742: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4 Source.9743: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.9744: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7 Source.9745: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit Source.9746: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit Source.9747: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.9748: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27 Source.9749: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.9750: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.9751: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.9752: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.9753: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.9754: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.9755: DFBPPR11713 ---- Animal proteins ---- Charged multivesicular body protein 2b Source.9756: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.9757: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.9758: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.9759: DFBPPR11719 ---- Animal proteins ---- Protein RER1 Source.9760: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.9761: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.9762: DFBPPR11725 ---- Animal proteins ---- D-dopachrome decarboxylase Source.9763: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7 Source.9764: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.9765: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21 Source.9766: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.9767: DFBPPR11738 ---- Animal proteins ---- Ensconsin Source.9768: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.9769: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.9770: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.9771: DFBPPR11746 ---- Animal proteins ---- EEF1A lysine methyltransferase 1 Source.9772: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.9773: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.9774: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.9775: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta Source.9776: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1 Source.9777: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.9778: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.9779: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6 Source.9780: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.9781: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B Source.9782: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.9783: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.9784: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.9785: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.9786: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.9787: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5 Source.9788: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.9789: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2 Source.9790: DFBPPR11789 ---- Animal proteins ---- NF-kappa-B inhibitor-interacting Ras-like protein 2 Source.9791: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5 Source.9792: DFBPPR11792 ---- Animal proteins ---- Selenoprotein W Source.9793: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4 Source.9794: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.9795: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.9796: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1 Source.9797: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.9798: DFBPPR11813 ---- Animal proteins ---- 60S ribosomal protein L27 Source.9799: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.9800: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.9801: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.9802: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.9803: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.9804: DFBPPR11822 ---- Animal proteins ---- Inversin Source.9805: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13 Source.9806: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.9807: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog Source.9808: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.9809: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z Source.9810: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.9811: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.9812: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.9813: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein Source.9814: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A Source.9815: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3 Source.9816: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.9817: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1 Source.9818: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.9819: DFBPPR11847 ---- Animal proteins ---- Borealin-2 Source.9820: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.9821: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.9822: DFBPPR11851 ---- Animal proteins ---- Borealin Source.9823: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.9824: DFBPPR11856 ---- Animal proteins ---- Spindlin-W Source.9825: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.9826: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82 Source.9827: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.9828: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.9829: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3 Source.9830: DFBPPR11863 ---- Animal proteins ---- Purpurin Source.9831: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.9832: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2 Source.9833: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5 Source.9834: DFBPPR11869 ---- Animal proteins ---- BH3-interacting domain death agonist Source.9835: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.9836: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1 Source.9837: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.9838: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61 Source.9839: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C Source.9840: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.9841: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like Source.9842: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A Source.9843: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.9844: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.9845: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.9846: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.9847: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.9848: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant Source.9849: DFBPPR11894 ---- Animal proteins ---- Centromere protein K Source.9850: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3 Source.9851: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.9852: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.9853: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9 Source.9854: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.9855: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.9856: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein Source.9857: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.9858: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.9859: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.9860: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.9861: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.9862: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.9863: DFBPPR11924 ---- Animal proteins ---- Centromere protein P Source.9864: DFBPPR11928 ---- Animal proteins ---- Cyclin-C Source.9865: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD Source.9866: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor Source.9867: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta Source.9868: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle Source.9869: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2 Source.9870: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7 Source.9871: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.9872: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.9873: DFBPPR11945 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1 Source.9874: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.9875: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.9876: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.9877: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.9878: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.9879: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B Source.9880: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.9881: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein Source.9882: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.9883: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.9884: DFBPPR11966 ---- Animal proteins ---- Protein CREG1 Source.9885: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.9886: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.9887: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.9888: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4 Source.9889: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.9890: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.9891: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.9892: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.9893: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.9894: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.9895: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.9896: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7 Source.9897: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.9898: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog Source.9899: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1 Source.9900: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1 Source.9901: DFBPPR11996 ---- Animal proteins ---- Homeobox protein Hox-A6 Source.9902: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.9903: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.9904: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.9905: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.9906: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2 Source.9907: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.9908: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.9909: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal Source.9910: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.9911: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein Source.9912: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.9913: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.9914: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.9915: DFBPPR12024 ---- Animal proteins ---- 40S ribosomal protein S6 Source.9916: DFBPPR12025 ---- Animal proteins ---- Transmembrane protein 18 Source.9917: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.9918: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.9919: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.9920: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2 Source.9921: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.9922: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein Source.9923: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.9924: DFBPPR12036 ---- Animal proteins ---- BLOC-1-related complex subunit 5 Source.9925: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.9926: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2 Source.9927: DFBPPR12041 ---- Animal proteins ---- Paladin Source.9928: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial Source.9929: DFBPPR12047 ---- Animal proteins ---- Ragulator complex protein LAMTOR3 Source.9930: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24 Source.9931: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.9932: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.9933: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.9934: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.9935: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.9936: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.9937: DFBPPR12061 ---- Animal proteins ---- Otoraplin Source.9938: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.9939: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.9940: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.9941: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.9942: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.9943: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.9944: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129 Source.9945: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.9946: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2 Source.9947: DFBPPR12086 ---- Animal proteins ---- DET1- and DDB1-associated protein 1 Source.9948: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121 Source.9949: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.9950: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.9951: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial Source.9952: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.9953: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4 Source.9954: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.9955: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.9956: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.9957: DFBPPR12103 ---- Animal proteins ---- FUN14 domain-containing protein 1 Source.9958: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2 Source.9959: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.9960: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.9961: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.9962: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1 Source.9963: DFBPPR12112 ---- Animal proteins ---- Protein LBH Source.9964: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.9965: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21 Source.9966: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.9967: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1 Source.9968: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.9969: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.9970: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1 Source.9971: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8 Source.9972: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.9973: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.9974: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial Source.9975: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.9976: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial Source.9977: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93 Source.9978: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.9979: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2 Source.9980: DFBPPR12137 ---- Animal proteins ---- Homeobox protein CHOX-7 Source.9981: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.9982: DFBPPR12140 ---- Animal proteins ---- Centromere protein N Source.9983: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.9984: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like Source.9985: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.9986: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3 Source.9987: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.9988: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.9989: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.9990: DFBPPR12158 ---- Animal proteins ---- Protein CDV3 homolog Source.9991: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.9992: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B Source.9993: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.9994: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog Source.9995: DFBPPR12168 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.9996: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.9997: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3 Source.9998: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog Source.9999: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.10000: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme Source.10001: DFBPPR12181 ---- Animal proteins ---- Small integral membrane protein 15 Source.10002: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.10003: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1 Source.10004: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1 Source.10005: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B Source.10006: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10 Source.10007: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.10008: DFBPPR12198 ---- Animal proteins ---- RING finger protein 141 Source.10009: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Source.10010: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1 Source.10011: DFBPPR12202 ---- Animal proteins ---- Protein chibby homolog 2 Source.10012: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.10013: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1 Source.10014: DFBPPR12208 ---- Animal proteins ---- Protein FAM76A Source.10015: DFBPPR12210 ---- Animal proteins ---- Protein NATD1 Source.10016: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180 Source.10017: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3 Source.10018: DFBPPR12213 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1 Source.10019: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.10020: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.10021: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.10022: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43 Source.10023: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7 Source.10024: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.10025: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6 Source.10026: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.10027: DFBPPR12232 ---- Animal proteins ---- SUZ domain-containing protein 1 Source.10028: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.10029: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.10030: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.10031: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.10032: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog Source.10033: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.10034: DFBPPR12244 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1 Source.10035: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A Source.10036: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.10037: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.10038: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.10039: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.10040: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.10041: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.10042: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1 Source.10043: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.10044: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2 Source.10045: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin Source.10046: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.10047: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1 Source.10048: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.10049: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.10050: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.10051: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.10052: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1 Source.10053: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.10054: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.10055: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.10056: DFBPPR12274 ---- Animal proteins ---- Cardiac phospholamban Source.10057: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.10058: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.10059: DFBPPR12278 ---- Animal proteins ---- Major prion protein Source.10060: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.10061: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1 Source.10062: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.10063: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.10064: DFBPPR12283 ---- Animal proteins ---- Interleukin-8 Source.10065: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.10066: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.10067: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.10068: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Source.10069: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.10070: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.10071: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.10072: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.10073: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.10074: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3 Source.10075: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.10076: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.10077: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.10078: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.10079: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.10080: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.10081: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.10082: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A Source.10083: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.10084: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.10085: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.10086: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.10087: DFBPPR12314 ---- Animal proteins ---- Annexin A1 Source.10088: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.10089: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.10090: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.10091: DFBPPR12318 ---- Animal proteins ---- Endothelin-1 Source.10092: DFBPPR12319 ---- Animal proteins ---- Calreticulin Source.10093: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.10094: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.10095: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5 Source.10096: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.10097: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.10098: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.10099: DFBPPR12333 ---- Animal proteins ---- Angiogenin Source.10100: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.10101: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.10102: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.10103: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.10104: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.10105: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2 Source.10106: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.10107: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.10108: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.10109: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.10110: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.10111: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.10112: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.10113: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.10114: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.10115: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.10116: DFBPPR12358 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1 Source.10117: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.10118: DFBPPR12361 ---- Animal proteins ---- Ras-related protein Rab-11A Source.10119: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.10120: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.10121: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a Source.10122: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.10123: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10 Source.10124: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2 Source.10125: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.10126: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2 Source.10127: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.10128: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.10129: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.10130: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.10131: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.10132: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.10133: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase Source.10134: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.10135: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.10136: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.10137: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.10138: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C Source.10139: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.10140: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.10141: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.10142: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.10143: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.10144: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.10145: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.10146: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Source.10147: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.10148: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.10149: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein Source.10150: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4 Source.10151: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.10152: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha Source.10153: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.10154: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4 Source.10155: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.10156: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.10157: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.10158: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2 Source.10159: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.10160: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.10161: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.10162: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.10163: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.10164: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.10165: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3 Source.10166: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.10167: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.10168: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.10169: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.10170: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A Source.10171: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.10172: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.10173: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.10174: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.10175: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2 Source.10176: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.10177: DFBPPR12436 ---- Animal proteins ---- Cytochrome b5 Source.10178: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.10179: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.10180: DFBPPR12439 ---- Animal proteins ---- Tissue factor Source.10181: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.10182: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.10183: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.10184: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2 Source.10185: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.10186: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.10187: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.10188: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.10189: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.10190: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.10191: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.10192: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.10193: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.10194: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1 Source.10195: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.10196: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.10197: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.10198: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.10199: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.10200: DFBPPR12463 ---- Animal proteins ---- Interleukin-15 Source.10201: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.10202: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.10203: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.10204: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.10205: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.10206: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.10207: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.10208: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta Source.10209: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.10210: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.10211: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.10212: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.10213: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.10214: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.10215: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.10216: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.10217: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.10218: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.10219: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.10220: DFBPPR12490 ---- Animal proteins ---- Uteroglobin Source.10221: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.10222: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.10223: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.10224: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.10225: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.10226: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.10227: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.10228: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.10229: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3 Source.10230: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1 Source.10231: DFBPPR12508 ---- Animal proteins ---- Interleukin-2 Source.10232: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.10233: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A Source.10234: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4 Source.10235: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.10236: DFBPPR12519 ---- Animal proteins ---- Eukaryotic translation initiation factor 5A-1 Source.10237: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin Source.10238: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.10239: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.10240: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10241: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.10242: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.10243: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.10244: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.10245: DFBPPR12532 ---- Animal proteins ---- Amyloid-beta A4 protein Source.10246: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.10247: DFBPPR12536 ---- Animal proteins ---- Albumin Source.10248: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase Source.10249: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.10250: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.10251: DFBPPR12542 ---- Animal proteins ---- Decorin Source.10252: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.10253: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.10254: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.10255: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.10256: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.10257: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.10258: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10259: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.10260: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.10261: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.10262: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2 Source.10263: DFBPPR12560 ---- Animal proteins ---- Calumenin Source.10264: DFBPPR12561 ---- Animal proteins ---- Dynein light chain 1, cytoplasmic Source.10265: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.10266: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1 Source.10267: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.10268: DFBPPR12566 ---- Animal proteins ---- Eukaryotic translation initiation factor 4E Source.10269: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.10270: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.10271: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.10272: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.10273: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.10274: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11 Source.10275: DFBPPR12575 ---- Animal proteins ---- CD63 antigen Source.10276: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.10277: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.10278: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.10279: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.10280: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase Source.10281: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.10282: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1 Source.10283: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.10284: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B Source.10285: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20 Source.10286: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.10287: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.10288: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.10289: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.10290: DFBPPR12607 ---- Animal proteins ---- Basigin Source.10291: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.10292: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14 Source.10293: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.10294: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.10295: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.10296: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.10297: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.10298: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.10299: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2 Source.10300: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4 Source.10301: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase Source.10302: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.10303: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I Source.10304: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.10305: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide Source.10306: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain Source.10307: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.10308: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.10309: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5 Source.10310: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.10311: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.10312: DFBPPR12662 ---- Animal proteins ---- Interferon gamma Source.10313: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.10314: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.10315: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor Source.10316: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.10317: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.10318: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.10319: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10320: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10321: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.10322: DFBPPR12710 ---- Animal proteins ---- Endoplasmin Source.10323: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.10324: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.10325: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.10326: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Source.10327: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.10328: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8 Source.10329: DFBPPR12725 ---- Animal proteins ---- Uricase Source.10330: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.10331: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.10332: DFBPPR12728 ---- Animal proteins ---- Cytochrome b Source.10333: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.10334: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.10335: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.10336: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.10337: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.10338: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.10339: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.10340: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.10341: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.10342: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1 Source.10343: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1 Source.10344: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25 Source.10345: DFBPPR12747 ---- Animal proteins ---- Myelin basic protein Source.10346: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1 Source.10347: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.10348: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.10349: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3 Source.10350: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.10351: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4 Source.10352: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.10353: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.10354: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.10355: DFBPPR12768 ---- Animal proteins ---- Pepsin-3 Source.10356: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.10357: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.10358: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.10359: DFBPPR12772 ---- Animal proteins ---- Colipase Source.10360: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.10361: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial Source.10362: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10363: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.10364: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.10365: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain Source.10366: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2 Source.10367: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.10368: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.10369: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.10370: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.10371: DFBPPR12790 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 4 Source.10372: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.10373: DFBPPR12796 ---- Animal proteins ---- Caspase-3 Source.10374: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10 Source.10375: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein Source.10376: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor Source.10377: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6 Source.10378: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.10379: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2 Source.10380: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.10381: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.10382: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.10383: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.10384: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.10385: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2 Source.10386: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma Source.10387: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.10388: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter Source.10389: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.10390: DFBPPR12817 ---- Animal proteins ---- Cathepsin E Source.10391: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.10392: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2 Source.10393: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B Source.10394: DFBPPR12821 ---- Animal proteins ---- Gastricsin Source.10395: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.10396: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I Source.10397: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4 Source.10398: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc Source.10399: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase Source.10400: DFBPPR12832 ---- Animal proteins ---- Secretin receptor Source.10401: DFBPPR12833 ---- Animal proteins ---- Cullin-5 Source.10402: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor Source.10403: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.10404: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10405: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.10406: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.10407: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1 Source.10408: DFBPPR12844 ---- Animal proteins ---- Protein S100-A6 Source.10409: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain Source.10410: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.10411: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.10412: DFBPPR12853 ---- Animal proteins ---- Insulin Source.10413: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.10414: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.10415: DFBPPR12857 ---- Animal proteins ---- Arginase-1 Source.10416: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.10417: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.10418: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11 Source.10419: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein Source.10420: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.10421: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.10422: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.10423: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain Source.10424: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin Source.10425: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.10426: DFBPPR12876 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.10427: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.10428: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1 Source.10429: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.10430: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn] Source.10431: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase Source.10432: DFBPPR12890 ---- Animal proteins ---- ATP synthase protein 8 Source.10433: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.10434: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80 Source.10435: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.10436: DFBPPR12899 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein Source.10437: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.10438: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.10439: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.10440: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.10441: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a Source.10442: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2 Source.10443: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6 Source.10444: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.10445: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.10446: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.10447: DFBPPR12915 ---- Animal proteins ---- Small proline-rich protein 3 Source.10448: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon Source.10449: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2 Source.10450: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.10451: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.10452: DFBPPR12924 ---- Animal proteins ---- Adenylate kinase isoenzyme 6 Source.10453: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.10454: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.10455: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.10456: DFBPPR12930 ---- Animal proteins ---- Kappa-casein Source.10457: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.10458: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.10459: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase Source.10460: DFBPPR12939 ---- Animal proteins ---- Gastrotropin Source.10461: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.10462: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.10463: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.10464: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.10465: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.10466: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.10467: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.10468: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.10469: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.10470: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.10471: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12 Source.10472: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2 Source.10473: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3 Source.10474: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.10475: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3 Source.10476: DFBPPR12967 ---- Animal proteins ---- Beta-sarcoglycan Source.10477: DFBPPR12969 ---- Animal proteins ---- Prolactin Source.10478: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.10479: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.10480: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.10481: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.10482: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.10483: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.10484: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.10485: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.10486: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.10487: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.10488: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.10489: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.10490: DFBPPR13000 ---- Animal proteins ---- Cystatin-C Source.10491: DFBPPR13003 ---- Animal proteins ---- Calcyphosin Source.10492: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.10493: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.10494: DFBPPR13007 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 2 Source.10495: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10496: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.10497: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A Source.10498: DFBPPR13013 ---- Animal proteins ---- Odorant-binding protein 1 Source.10499: DFBPPR13017 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.10500: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform Source.10501: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.10502: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.10503: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.10504: DFBPPR13025 ---- Animal proteins ---- Translationally-controlled tumor protein Source.10505: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.10506: DFBPPR13029 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5 Source.10507: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A Source.10508: DFBPPR13034 ---- Animal proteins ---- Sarcospan Source.10509: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S Source.10510: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.10511: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5 Source.10512: DFBPPR13043 ---- Animal proteins ---- Whey acidic protein Source.10513: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein Source.10514: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial Source.10515: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.10516: DFBPPR13067 ---- Animal proteins ---- Beta-casein Source.10517: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain Source.10518: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.10519: DFBPPR13074 ---- Animal proteins ---- Islet amyloid polypeptide Source.10520: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.10521: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1 Source.10522: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.10523: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog Source.10524: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207 Source.10525: DFBPPR13090 ---- Animal proteins ---- Annexin A8 Source.10526: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10527: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.10528: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.10529: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2 Source.10530: DFBPPR13111 ---- Animal proteins ---- Immunoglobulin J chain Source.10531: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10532: DFBPPR13117 ---- Animal proteins ---- Ig kappa-b4 chain C region Source.10533: DFBPPR13122 ---- Animal proteins ---- Ig kappa-b9 chain C region Source.10534: DFBPPR13123 ---- Animal proteins ---- Ig kappa-b5 chain C region Source.10535: DFBPPR13126 ---- Animal proteins ---- Ig kappa chain V region 3368 Source.10536: DFBPPR13128 ---- Animal proteins ---- Ig kappa chain V region 4135 Source.10537: DFBPPR13129 ---- Animal proteins ---- Ig kappa chain V region 3374 Source.10538: DFBPPR13130 ---- Animal proteins ---- Ig kappa chain V region AH80-5 Source.10539: DFBPPR13131 ---- Animal proteins ---- Ig kappa chain V region K29-213 Source.10540: DFBPPR13132 ---- Animal proteins ---- Ig kappa chain V region 3315 Source.10541: DFBPPR13133 ---- Animal proteins ---- Ig kappa chain V region K16-167 Source.10542: DFBPPR13135 ---- Animal proteins ---- Ig kappa-b4 chain C region Source.10543: DFBPPR13136 ---- Animal proteins ---- Ig kappa chain V region XP-1 Source.10544: DFBPPR13139 ---- Animal proteins ---- Ig kappa chain b5 variant C region Source.10545: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4 Source.10546: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.10547: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.10548: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.10549: DFBPPR13146 ---- Animal proteins ---- Interferon gamma Source.10550: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.10551: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.10552: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.10553: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.10554: DFBPPR13156 ---- Animal proteins ---- Leptin Source.10555: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain Source.10556: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.10557: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.10558: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.10559: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1 Source.10560: DFBPPR13166 ---- Animal proteins ---- CD44 antigen Source.10561: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.10562: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.10563: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.10564: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.10565: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase Source.10566: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.10567: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase Source.10568: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10569: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.10570: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.10571: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II Source.10572: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.10573: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.10574: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A Source.10575: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.10576: DFBPPR13188 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.10577: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.10578: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.10579: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.10580: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.10581: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11 Source.10582: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.10583: DFBPPR13195 ---- Animal proteins ---- Albumin Source.10584: DFBPPR13201 ---- Animal proteins ---- Major allergen Equ c 1 Source.10585: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.10586: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.10587: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.10588: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.10589: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23 Source.10590: DFBPPR13209 ---- Animal proteins ---- Parathyroid hormone Source.10591: DFBPPR13210 ---- Animal proteins ---- Angiogenin Source.10592: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.10593: DFBPPR13219 ---- Animal proteins ---- Kit ligand Source.10594: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.10595: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.10596: DFBPPR13224 ---- Animal proteins ---- Prorelaxin Source.10597: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.10598: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.10599: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10600: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.10601: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.10602: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10603: DFBPPR13233 ---- Animal proteins ---- Fibronectin Source.10604: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein Source.10605: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.10606: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2 Source.10607: DFBPPR13240 ---- Animal proteins ---- Decorin Source.10608: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.10609: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B Source.10610: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.10611: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.10612: DFBPPR13252 ---- Animal proteins ---- Ferritin light chain Source.10613: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic Source.10614: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.10615: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta Source.10616: DFBPPR13257 ---- Animal proteins ---- Prolactin Source.10617: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.10618: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.10619: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.10620: DFBPPR13264 ---- Animal proteins ---- Vitamin K-dependent protein C Source.10621: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E Source.10622: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.10623: DFBPPR13267 ---- Animal proteins ---- Interferon beta Source.10624: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.10625: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.10626: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.10627: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.10628: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.10629: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10630: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.10631: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.10632: DFBPPR13284 ---- Animal proteins ---- Interleukin-8 Source.10633: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.10634: DFBPPR13286 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor Source.10635: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.10636: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.10637: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.10638: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.10639: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein Source.10640: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2 Source.10641: DFBPPR13296 ---- Animal proteins ---- Complement component C9 Source.10642: DFBPPR13297 ---- Animal proteins ---- Plasminogen Source.10643: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1 Source.10644: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha Source.10645: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10646: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta Source.10647: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.10648: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.10649: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I Source.10650: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.10651: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.10652: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10653: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.10654: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1 Source.10655: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.10656: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2 Source.10657: DFBPPR13330 ---- Animal proteins ---- Uterocalin Source.10658: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3 Source.10659: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4 Source.10660: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.10661: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.10662: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.10663: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.10664: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a Source.10665: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.10666: DFBPPR13343 ---- Animal proteins ---- Interferon omega-1 Source.10667: DFBPPR13344 ---- Animal proteins ---- Interferon omega-2 Source.10668: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10669: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta Source.10670: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3 Source.10671: DFBPPR13352 ---- Animal proteins ---- ATP synthase protein 8 Source.10672: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.10673: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10674: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.10675: DFBPPR13367 ---- Animal proteins ---- Neutrophil elastase 2B Source.10676: DFBPPR13370 ---- Animal proteins ---- Interleukin-2 Source.10677: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.10678: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4 Source.10679: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein Source.10680: DFBPPR13378 ---- Animal proteins ---- Neutrophil elastase 2A Source.10681: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.10682: DFBPPR13383 ---- Animal proteins ---- Insulin Source.10683: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.10684: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10685: DFBPPR13389 ---- Animal proteins ---- Phosducin Source.10686: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2 Source.10687: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.10688: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.10689: DFBPPR13399 ---- Animal proteins ---- Beta-2-microglobulin Source.10690: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22 Source.10691: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10692: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10693: DFBPPR13422 ---- Animal proteins ---- Interferon gamma Source.10694: DFBPPR13424 ---- Animal proteins ---- Leptin Source.10695: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.10696: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.10697: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10698: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic Source.10699: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.10700: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.10701: DFBPPR13433 ---- Animal proteins ---- Major prion protein Source.10702: DFBPPR13434 ---- Animal proteins ---- Aromatase Source.10703: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147 Source.10704: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.10705: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.10706: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau Source.10707: DFBPPR13443 ---- Animal proteins ---- Kit ligand Source.10708: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10709: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.10710: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I Source.10711: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.10712: DFBPPR13452 ---- Animal proteins ---- Interleukin-6 Source.10713: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.10714: DFBPPR13454 ---- Animal proteins ---- Vitamin K-dependent protein C Source.10715: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P Source.10716: DFBPPR13456 ---- Animal proteins ---- Galectin-1 Source.10717: DFBPPR13459 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.10718: DFBPPR13464 ---- Animal proteins ---- Interferon tau Source.10719: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.10720: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.10721: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10722: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein Source.10723: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1 Source.10724: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.10725: DFBPPR13478 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor Source.10726: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta Source.10727: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.10728: DFBPPR13485 ---- Animal proteins ---- Hemoglobin subunit zeta Source.10729: DFBPPR13488 ---- Animal proteins ---- Lysozyme C-2 Source.10730: DFBPPR13489 ---- Animal proteins ---- Lysozyme C-1 Source.10731: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.10732: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10733: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.10734: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.10735: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.10736: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9 Source.10737: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10738: DFBPPR13512 ---- Animal proteins ---- Interleukin-2 Source.10739: DFBPPR13514 ---- Animal proteins ---- Insulin Source.10740: DFBPPR13520 ---- Animal proteins ---- 60S ribosomal protein L21 Source.10741: DFBPPR13526 ---- Animal proteins ---- Pregnancy-associated glycoprotein 62 Source.10742: DFBPPR13530 ---- Animal proteins ---- Major prion protein Source.10743: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.10744: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.10745: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.10746: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.10747: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.10748: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.10749: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1 Source.10750: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.10751: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.10752: DFBPPR13552 ---- Animal proteins ---- Inhibin beta A chain Source.10753: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.10754: DFBPPR13554 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.10755: DFBPPR13557 ---- Animal proteins ---- Interferon gamma Source.10756: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.10757: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1 Source.10758: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.10759: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1 Source.10760: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.10761: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.10762: DFBPPR13566 ---- Animal proteins ---- Calcium and integrin-binding protein 1 Source.10763: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4 Source.10764: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.10765: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein Source.10766: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.10767: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase Source.10768: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.10769: DFBPPR13577 ---- Animal proteins ---- Interleukin-6 Source.10770: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.10771: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.10772: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.10773: DFBPPR13584 ---- Animal proteins ---- Calpain-3 Source.10774: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.10775: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1 Source.10776: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase Source.10777: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.10778: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.10779: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10780: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.10781: DFBPPR13597 ---- Animal proteins ---- Leptin Source.10782: DFBPPR13598 ---- Animal proteins ---- Interleukin-8 Source.10783: DFBPPR13599 ---- Animal proteins ---- Beta-2-microglobulin Source.10784: DFBPPR13601 ---- Animal proteins ---- Cathepsin B Source.10785: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.10786: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.10787: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic Source.10788: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.10789: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.10790: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.10791: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II Source.10792: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.10793: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.10794: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.10795: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.10796: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.10797: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta Source.10798: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.10799: DFBPPR13625 ---- Animal proteins ---- Lysozyme C-1 Source.10800: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10801: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.10802: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.10803: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.10804: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2 Source.10805: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.10806: DFBPPR13635 ---- Animal proteins ---- Amyloid-beta A4 protein Source.10807: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.10808: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.10809: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6 Source.10810: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.10811: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6 Source.10812: DFBPPR13646 ---- Animal proteins ---- Procathepsin L Source.10813: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha Source.10814: DFBPPR13649 ---- Animal proteins ---- Phospholemman Source.10815: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11 Source.10816: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA Source.10817: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2 Source.10818: DFBPPR13665 ---- Animal proteins ---- Kit ligand Source.10819: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.10820: DFBPPR13672 ---- Animal proteins ---- Annexin A2 Source.10821: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I Source.10822: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.10823: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.10824: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.10825: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3 Source.10826: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.10827: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.10828: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.10829: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain Source.10830: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.10831: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.10832: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.10833: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1 Source.10834: DFBPPR13696 ---- Animal proteins ---- Cathepsin D Source.10835: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1 Source.10836: DFBPPR13698 ---- Animal proteins ---- Progonadoliberin-1 Source.10837: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.10838: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.10839: DFBPPR13702 ---- Animal proteins ---- Protransforming growth factor alpha Source.10840: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.10841: DFBPPR13705 ---- Animal proteins ---- Galectin-1 Source.10842: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase Source.10843: DFBPPR13707 ---- Animal proteins ---- Lysozyme C-3 Source.10844: DFBPPR13708 ---- Animal proteins ---- Renin Source.10845: DFBPPR13709 ---- Animal proteins ---- Pro-glucagon Source.10846: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta Source.10847: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX Source.10848: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.10849: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.10850: DFBPPR13716 ---- Animal proteins ---- Trichohyalin Source.10851: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d Source.10852: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10 Source.10853: DFBPPR13722 ---- Animal proteins ---- Insulin Source.10854: DFBPPR13725 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain Source.10855: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.10856: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.10857: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1 Source.10858: DFBPPR13735 ---- Animal proteins ---- Thyroid hormone receptor beta Source.10859: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.10860: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5 Source.10861: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9 Source.10862: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8 Source.10863: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7 Source.10864: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4 Source.10865: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.10866: DFBPPR13752 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.10867: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.10868: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.10869: DFBPPR13755 ---- Animal proteins ---- Aromatase Source.10870: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21 Source.10871: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.10872: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.10873: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.10874: DFBPPR13763 ---- Animal proteins ---- Interleukin-2 Source.10875: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A Source.10876: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.10877: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor Source.10878: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.10879: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10880: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.10881: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9 Source.10882: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit Source.10883: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor Source.10884: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C Source.10885: DFBPPR13777 ---- Animal proteins ---- Centromere protein C Source.10886: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.10887: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.10888: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.10889: DFBPPR13786 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma Source.10890: DFBPPR13788 ---- Animal proteins ---- Albumin Source.10891: DFBPPR13789 ---- Animal proteins ---- Tryptase-2 Source.10892: DFBPPR13791 ---- Animal proteins ---- Cholinesterase Source.10893: DFBPPR13793 ---- Animal proteins ---- Decorin Source.10894: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain Source.10895: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel Source.10896: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor Source.10897: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.10898: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24 Source.10899: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.10900: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.10901: DFBPPR13804 ---- Animal proteins ---- Calcium and integrin-binding family member 2 Source.10902: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.10903: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2 Source.10904: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.10905: DFBPPR13817 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.10906: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5 Source.10907: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.10908: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a Source.10909: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.10910: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.10911: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3 Source.10912: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3 Source.10913: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.10914: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein Source.10915: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1 Source.10916: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10917: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor Source.10918: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.10919: DFBPPR13850 ---- Animal proteins ---- Interleukin-15 Source.10920: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5 Source.10921: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.10922: DFBPPR13855 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor Source.10923: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.10924: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.10925: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.10926: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9 Source.10927: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor Source.10928: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor Source.10929: DFBPPR13877 ---- Animal proteins ---- Sialin Source.10930: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.10931: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.10932: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.10933: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3 Source.10934: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.10935: DFBPPR13890 ---- Animal proteins ---- Fibroblast growth factor 7 Source.10936: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.10937: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5 Source.10938: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.10939: DFBPPR13896 ---- Animal proteins ---- Somatostatin Source.10940: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.10941: DFBPPR13902 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.10942: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.10943: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.10944: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.10945: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.10946: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.10947: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter Source.10948: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.10949: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.10950: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.10951: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26 Source.10952: DFBPPR13953 ---- Animal proteins ---- Tetraspanin-9 Source.10953: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2 Source.10954: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.10955: DFBPPR13972 ---- Animal proteins ---- Pregnancy-associated glycoprotein 55 Source.10956: DFBPPR13979 ---- Animal proteins ---- Putative uncharacterized protein Z Source.10957: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1 Source.10958: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.10959: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.10960: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2 Source.10961: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha Source.10962: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.10963: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B Source.10964: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.10965: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.10966: DFBPPR13993 ---- Animal proteins ---- Insulin Source.10967: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.10968: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.10969: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.10970: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.10971: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.10972: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.10973: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.10974: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.10975: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase Source.10976: DFBPPR14007 ---- Animal proteins ---- Cystatin Source.10977: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.10978: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.10979: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.10980: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.10981: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.10982: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.10983: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.10984: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.10985: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form Source.10986: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form Source.10987: DFBPPR14056 ---- Animal proteins ---- Gamma-crystallin M3 Source.10988: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog Source.10989: DFBPPR14071 ---- Marine protein ---- Somatotropin Source.10990: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.10991: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.10992: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1 Source.10993: DFBPPR14078 ---- Marine protein ---- Histone H1 Source.10994: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.10995: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2 Source.10996: DFBPPR14083 ---- Marine protein ---- RING-box protein 1 Source.10997: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta Source.10998: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A Source.10999: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B Source.11000: DFBPPR14090 ---- Marine protein ---- Trypsin-3 Source.11001: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA Source.11002: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.11003: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.11004: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1 Source.11005: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.11006: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9 Source.11007: DFBPPR14104 ---- Marine protein ---- Anamorsin-A Source.11008: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran Source.11009: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha Source.11010: DFBPPR14108 ---- Marine protein ---- 6-pyruvoyl tetrahydrobiopterin synthase Source.11011: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A Source.11012: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.11013: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.11014: DFBPPR14118 ---- Marine protein ---- Trypsin-2 Source.11015: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin Source.11016: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.11017: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.11018: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.11019: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.11020: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase Source.11021: DFBPPR14132 ---- Marine protein ---- Calumenin-A Source.11022: DFBPPR14133 ---- Marine protein ---- Calumenin-B Source.11023: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.11024: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.11025: DFBPPR14139 ---- Marine protein ---- Thrombin Source.11026: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I Source.11027: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.11028: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H Source.11029: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a Source.11030: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.11031: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.11032: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.11033: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.11034: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.11035: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.11036: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog Source.11037: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.11038: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.11039: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase Source.11040: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6 Source.11041: DFBPPR14183 ---- Marine protein ---- Pleckstrin homology-like domain family A member 2 Source.11042: DFBPPR14186 ---- Marine protein ---- 60S ribosomal protein L18 Source.11043: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.11044: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor Source.11045: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein Source.11046: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.11047: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein Source.11048: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein Source.11049: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2 Source.11050: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a Source.11051: DFBPPR14211 ---- Marine protein ---- WASH complex subunit 3 Source.11052: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.11053: DFBPPR14220 ---- Marine protein ---- Coiled-coil domain-containing protein 58 Source.11054: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.11055: DFBPPR14225 ---- Marine protein ---- LYR motif-containing protein 1 Source.11056: DFBPPR14226 ---- Marine protein ---- LYR motif-containing protein 4A Source.11057: DFBPPR14227 ---- Marine protein ---- LYR motif-containing protein 4B Source.11058: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog Source.11059: DFBPPR14231 ---- Marine protein ---- Somatotropin Source.11060: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain Source.11061: DFBPPR14235 ---- Marine protein ---- Calcitonin-1 Source.11062: DFBPPR14238 ---- Marine protein ---- Insulin Source.11063: DFBPPR14239 ---- Marine protein ---- Gonadotropin subunit beta-1 Source.11064: DFBPPR14241 ---- Marine protein ---- Cystatin Source.11065: DFBPPR14245 ---- Marine protein ---- Pro-MCH 1 Source.11066: DFBPPR14247 ---- Marine protein ---- Pro-MCH 2 Source.11067: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3 Source.11068: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.11069: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a Source.11070: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial Source.11071: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain Source.11072: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.11073: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain Source.11074: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase Source.11075: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.11076: DFBPPR14295 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain Source.11077: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.11078: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.11079: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.11080: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG Source.11081: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.11082: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.11083: DFBPPR14308 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic Source.11084: DFBPPR14310 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.11085: DFBPPR14311 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic Source.11086: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA Source.11087: DFBPPR14313 ---- Marine protein ---- Photosystem I reaction center subunit PsaK Source.11088: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.11089: DFBPPR14317 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic Source.11090: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.11091: DFBPPR14319 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic Source.11092: DFBPPR14321 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic Source.11093: DFBPPR14322 ---- Marine protein ---- UPF0051 protein in atpA 3'region Source.11094: DFBPPR14323 ---- Marine protein ---- Uncharacterized protein ycf18 Source.11095: DFBPPR14324 ---- Marine protein ---- Uncharacterized protein ycf19 Source.11096: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain Source.11097: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase Source.11098: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.11099: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit Source.11100: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.11101: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.11102: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.11103: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain Source.11104: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.11105: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.11106: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein Source.11107: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.11108: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.11109: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.11110: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase Source.11111: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.11112: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.11113: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.11114: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase Source.11115: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3 Source.11116: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein Source.11117: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.11118: DFBPPR14354 ---- Marine protein ---- Cytochrome c-550 Source.11119: DFBPPR14355 ---- Marine protein ---- ATP synthase subunit c, chloroplastic Source.11120: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha Source.11121: DFBPPR14358 ---- Marine protein ---- Thiazole synthase Source.11122: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.11123: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.11124: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit Source.11125: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.11126: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42 Source.11127: DFBPPR14364 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain Source.11128: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.11129: DFBPPR14367 ---- Marine protein ---- Cytochrome f Source.11130: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.11131: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.11132: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha Source.11133: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.11134: DFBPPR14373 ---- Marine protein ---- Cytochrome b6 Source.11135: DFBPPR14376 ---- Marine protein ---- ATP synthase subunit b', chloroplastic Source.11136: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.11137: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase Source.11138: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha Source.11139: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic Source.11140: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.11141: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.11142: DFBPPR14385 ---- Marine protein ---- ATP synthase subunit b, chloroplastic Source.11143: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain Source.11144: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase Source.11145: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.11146: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.11147: DFBPPR14391 ---- Marine protein ---- Cytochrome b6-f complex subunit 5 Source.11148: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein Source.11149: DFBPPR14394 ---- Marine protein ---- Cytochrome b6-f complex subunit 7 Source.11150: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain Source.11151: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic Source.11152: DFBPPR14400 ---- Marine protein ---- Heme oxygenase Source.11153: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic Source.11154: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic Source.11155: DFBPPR14403 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG Source.11156: DFBPPR14405 ---- Marine protein ---- Uncharacterized monothiol glutaredoxin ycf64 Source.11157: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.11158: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain Source.11159: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.11160: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.11161: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic Source.11162: DFBPPR14418 ---- Marine protein ---- Acyl carrier protein Source.11163: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.11164: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.11165: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.11166: DFBPPR14424 ---- Marine protein ---- Nitrogen regulatory protein P-II Source.11167: DFBPPR14425 ---- Marine protein ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase Source.11168: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.11169: DFBPPR14432 ---- Marine protein ---- 30S ribosomal protein S17, chloroplastic Source.11170: DFBPPR14433 ---- Marine protein ---- 50S ribosomal protein L14, chloroplastic Source.11171: DFBPPR14435 ---- Marine protein ---- 50S ribosomal protein L24, chloroplastic Source.11172: DFBPPR14436 ---- Marine protein ---- 50S ribosomal protein L11, chloroplastic Source.11173: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic Source.11174: DFBPPR14439 ---- Marine protein ---- 50S ribosomal protein L5, chloroplastic Source.11175: DFBPPR14440 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic Source.11176: DFBPPR14441 ---- Marine protein ---- 30S ribosomal protein S8, chloroplastic Source.11177: DFBPPR14444 ---- Marine protein ---- 50S ribosomal protein L23, chloroplastic Source.11178: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.11179: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic Source.11180: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA Source.11181: DFBPPR14453 ---- Marine protein ---- Photosystem II reaction center X protein Source.11182: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1 Source.11183: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29 Source.11184: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic Source.11185: DFBPPR14459 ---- Marine protein ---- Photosystem II reaction center protein Z Source.11186: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic Source.11187: DFBPPR14462 ---- Marine protein ---- Chromophore lyase CpcS/CpeS homolog Source.11188: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic Source.11189: DFBPPR14466 ---- Marine protein ---- 30S ribosomal protein S11, chloroplastic Source.11190: DFBPPR14469 ---- Marine protein ---- 30S ribosomal protein S6, chloroplastic Source.11191: DFBPPR14470 ---- Marine protein ---- Photosystem I reaction center subunit PsaK Source.11192: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.11193: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic Source.11194: DFBPPR14479 ---- Marine protein ---- Photosystem I assembly protein Ycf4 Source.11195: DFBPPR14480 ---- Marine protein ---- Photosystem II reaction center protein Ycf12 Source.11196: DFBPPR14481 ---- Marine protein ---- 50S ribosomal protein L13, chloroplastic Source.11197: DFBPPR14485 ---- Marine protein ---- Uncharacterized N-acetyltransferase ycf52 Source.11198: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38 Source.11199: DFBPPR14488 ---- Marine protein ---- Putative cytochrome c-type biogenesis protein DbsD-like Source.11200: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28 Source.11201: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46 Source.11202: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic Source.11203: DFBPPR14497 ---- Marine protein ---- 50S ribosomal protein L33, chloroplastic Source.11204: DFBPPR14498 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic Source.11205: DFBPPR14499 ---- Marine protein ---- Photosystem I assembly protein Ycf3 Source.11206: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.11207: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.11208: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43 Source.11209: DFBPPR14509 ---- Marine protein ---- Uncharacterized protein ycf37 Source.11210: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.11211: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92 Source.11212: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.11213: DFBPPR14515 ---- Marine protein ---- Uncharacterized protein ycf40 Source.11214: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53 Source.11215: DFBPPR14519 ---- Marine protein ---- Uncharacterized protein ycf21 Source.11216: DFBPPR14522 ---- Marine protein ---- Uncharacterized protein ycf20 Source.11217: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35 Source.11218: DFBPPR14528 ---- Marine protein ---- Uracil phosphoribosyltransferase homolog Source.11219: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.11220: DFBPPR14533 ---- Marine protein ---- Uncharacterized protein ORF148 Source.11221: DFBPPR14534 ---- Marine protein ---- Uncharacterized protein ORF62 Source.11222: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2 Source.11223: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.11224: DFBPPR14541 ---- Marine protein ---- Somatotropin-1 Source.11225: DFBPPR14542 ---- Marine protein ---- Somatotropin-2 Source.11226: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.11227: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.11228: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.11229: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2 Source.11230: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.11231: DFBPPR14556 ---- Marine protein ---- Interleukin-1 beta Source.11232: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.11233: DFBPPR14559 ---- Marine protein ---- Histone H1 Source.11234: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11235: DFBPPR14562 ---- Marine protein ---- Ladderlectin Source.11236: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor Source.11237: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.11238: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1 Source.11239: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.11240: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.11241: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific Source.11242: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.11243: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.11244: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4 Source.11245: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53 Source.11246: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.11247: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.11248: DFBPPR14581 ---- Marine protein ---- Interferon alpha/beta receptor 2 Source.11249: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.11250: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I Source.11251: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4 Source.11252: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros Source.11253: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1 Source.11254: DFBPPR14592 ---- Marine protein ---- Intelectin Source.11255: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.11256: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.11257: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.11258: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein Source.11259: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a Source.11260: DFBPPR14604 ---- Marine protein ---- Anamorsin Source.11261: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.11262: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1 Source.11263: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9 Source.11264: DFBPPR14608 ---- Marine protein ---- Polysialoglycoprotein Source.11265: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing] Source.11266: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a Source.11267: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b Source.11268: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.11269: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha Source.11270: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.11271: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.11272: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1 Source.11273: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.11274: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.11275: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1 Source.11276: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18 Source.11277: DFBPPR14634 ---- Marine protein ---- Neuroglobin-2 Source.11278: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.11279: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.11280: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.11281: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2 Source.11282: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A Source.11283: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B Source.11284: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2 Source.11285: DFBPPR14656 ---- Marine protein ---- Neuroglobin-1 Source.11286: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.11287: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.11288: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2 Source.11289: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.11290: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.11291: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.11292: DFBPPR14674 ---- Marine protein ---- Glucagon-1 Source.11293: DFBPPR14675 ---- Marine protein ---- Glucagon-2 Source.11294: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor Source.11295: DFBPPR14680 ---- Marine protein ---- Steroidogenic acute regulatory protein, mitochondrial Source.11296: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C Source.11297: DFBPPR14684 ---- Marine protein ---- Pro-MCH 2 Source.11298: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1 Source.11299: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2 Source.11300: DFBPPR14698 ---- Marine protein ---- Cystatin Source.11301: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.11302: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.11303: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13 Source.11304: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.11305: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4 Source.11306: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.11307: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2 Source.11308: DFBPPR14726 ---- Marine protein ---- Cytochrome c oxidase subunit 5B liver, mitochondrial Source.11309: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog Source.11310: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein Source.11311: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3 Source.11312: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2 Source.11313: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1 Source.11314: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B Source.11315: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.11316: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1 Source.11317: DFBPPR14751 ---- Marine protein ---- Insulin Source.11318: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.11319: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.11320: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.11321: DFBPPR14755 ---- Marine protein ---- Techylectin-5A Source.11322: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit Source.11323: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.11324: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2 Source.11325: DFBPPR14762 ---- Marine protein ---- Coagulogen Source.11326: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3 Source.11327: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase Source.11328: DFBPPR14770 ---- Marine protein ---- Lectin L6 Source.11329: DFBPPR14771 ---- Marine protein ---- L-cystatin Source.11330: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.11331: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11332: DFBPPR14783 ---- Marine protein ---- Enolase Source.11333: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.11334: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.11335: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain Source.11336: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain Source.11337: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain Source.11338: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain Source.11339: DFBPPR14791 ---- Marine protein ---- Guanine nucleotide-binding protein G(i) subunit alpha Source.11340: DFBPPR14792 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform B Source.11341: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.11342: DFBPPR14797 ---- Marine protein ---- Gonad-inhibiting hormone Source.11343: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.11344: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.11345: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.11346: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1 Source.11347: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.11348: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit Source.11349: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1 Source.11350: DFBPPR14818 ---- Marine protein ---- Tropomyosin Source.11351: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Source.11352: DFBPPR14822 ---- Marine protein ---- Fibrinogen Source.11353: DFBPPR14843 ---- Marine protein ---- Cuticle protein AMP5 Source.11354: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form Source.11355: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha Source.11356: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.11357: DFBPPR14862 ---- Marine protein ---- Insulin Source.11358: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233 Source.11359: DFBPPR14864 ---- Marine protein ---- Hemoglobin anodic subunit beta Source.11360: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta Source.11361: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.11362: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.11363: DFBPPR14873 ---- Marine protein ---- Somatolactin Source.11364: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.11365: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.11366: DFBPPR14880 ---- Microorganism protein ---- Spindle assembly checkpoint kinase Source.11367: DFBPPR14881 ---- Microorganism protein ---- Decapping and exoribonuclease protein 1 Source.11368: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.11369: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit Source.11370: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system Source.11371: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit Source.11372: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.11373: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1 Source.11374: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.11375: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.11376: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.11377: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.11378: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.11379: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.11380: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.11381: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.11382: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase Source.11383: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit Source.11384: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.11385: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1 Source.11386: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.11387: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.11388: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.11389: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.11390: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.11391: DFBPPR14906 ---- Microorganism protein ---- Autophagy-related protein 8 Source.11392: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4 Source.11393: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1 Source.11394: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3 Source.11395: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit Source.11396: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.11397: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8 Source.11398: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.11399: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15 Source.11400: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.11401: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase Source.11402: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.11403: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.11404: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.11405: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.11406: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.11407: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.11408: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18 Source.11409: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.11410: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1 Source.11411: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.11412: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.11413: DFBPPR14935 ---- Microorganism protein ---- Actin Source.11414: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.11415: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase Source.11416: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.11417: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5 Source.11418: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB Source.11419: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1 Source.11420: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.11421: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.11422: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.11423: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32 Source.11424: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma Source.11425: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial Source.11426: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.11427: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.11428: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2 Source.11429: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.11430: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.11431: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.11432: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1 Source.11433: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2 Source.11434: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.11435: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.11436: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.11437: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.11438: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1 Source.11439: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.11440: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.11441: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.11442: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.11443: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.11444: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.11445: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19 Source.11446: DFBPPR14976 ---- Microorganism protein ---- Adenylate kinase Source.11447: DFBPPR14977 ---- Microorganism protein ---- Superoxide dismutase [Cu-Zn] Source.11448: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase Source.11449: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.11450: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.11451: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.11452: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.11453: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.11454: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.11455: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.11456: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit Source.11457: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1 Source.11458: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.11459: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1 Source.11460: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.11461: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial Source.11462: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.11463: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.11464: DFBPPR14998 ---- Microorganism protein ---- Galactokinase Source.11465: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.11466: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.11467: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6 Source.11468: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.11469: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.11470: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8 Source.11471: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase Source.11472: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1 Source.11473: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b Source.11474: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.11475: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1 Source.11476: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.11477: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.11478: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.11479: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.11480: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1 Source.11481: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.11482: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.11483: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.11484: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1 Source.11485: DFBPPR15026 ---- Microorganism protein ---- ATP synthase subunit 9, mitochondrial Source.11486: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5 Source.11487: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.11488: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.11489: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2 Source.11490: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.11491: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.11492: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.11493: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial Source.11494: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6 Source.11495: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2 Source.11496: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.11497: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5 Source.11498: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.11499: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.11500: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.11501: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.11502: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit Source.11503: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10 Source.11504: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.11505: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.11506: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21 Source.11507: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.11508: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1 Source.11509: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.11510: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52 Source.11511: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.11512: DFBPPR15060 ---- Microorganism protein ---- Transaldolase Source.11513: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.11514: DFBPPR15062 ---- Microorganism protein ---- Transcription and mRNA export factor SUS1 Source.11515: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase Source.11516: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1 Source.11517: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.11518: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.11519: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.11520: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.11521: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.11522: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.11523: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor Source.11524: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.11525: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.11526: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2 Source.11527: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.11528: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.11529: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3 Source.11530: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase Source.11531: DFBPPR15082 ---- Microorganism protein ---- Cytochrome c Source.11532: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase Source.11533: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase Source.11534: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1 Source.11535: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3 Source.11536: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13 Source.11537: DFBPPR15089 ---- Microorganism protein ---- F-actin-capping protein subunit beta Source.11538: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.11539: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial Source.11540: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.11541: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.11542: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.11543: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1 Source.11544: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase Source.11545: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.11546: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6 Source.11547: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.11548: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11 Source.11549: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5 Source.11550: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.11551: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B Source.11552: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.11553: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.11554: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.11555: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase Source.11556: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.11557: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase Source.11558: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.11559: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.11560: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.11561: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial Source.11562: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.11563: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.11564: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1 Source.11565: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase Source.11566: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.11567: DFBPPR15128 ---- Microorganism protein ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase Source.11568: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.11569: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.11570: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase Source.11571: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.11572: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22 Source.11573: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1 Source.11574: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.11575: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Source.11576: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A Source.11577: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.11578: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.11579: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.11580: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4 Source.11581: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial Source.11582: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase Source.11583: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic Source.11584: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.11585: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase Source.11586: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.11587: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase Source.11588: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81 Source.11589: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.11590: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3 Source.11591: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.11592: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.11593: DFBPPR15163 ---- Microorganism protein ---- Ubiquitin-related modifier 1 Source.11594: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2 Source.11595: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain Source.11596: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.11597: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase Source.11598: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1 Source.11599: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.11600: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.11601: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.11602: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1 Source.11603: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.11604: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.11605: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35 Source.11606: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.11607: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.11608: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.11609: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.11610: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.11611: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2 Source.11612: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase Source.11613: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.11614: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.11615: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I Source.11616: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase Source.11617: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.11618: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3 Source.11619: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.11620: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.11621: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha Source.11622: DFBPPR15200 ---- Microorganism protein ---- Protein SPT3 Source.11623: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.11624: DFBPPR15203 ---- Microorganism protein ---- Ubiquitin-like protein ATG12 Source.11625: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.11626: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase Source.11627: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase Source.11628: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.11629: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.11630: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1 Source.11631: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.11632: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.11633: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.11634: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.11635: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.11636: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1 Source.11637: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1 Source.11638: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial Source.11639: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.11640: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4 Source.11641: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.11642: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2 Source.11643: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4 Source.11644: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.11645: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20 Source.11646: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2 Source.11647: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5 Source.11648: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.11649: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B Source.11650: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.11651: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2 Source.11652: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19 Source.11653: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial Source.11654: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a Source.11655: DFBPPR15247 ---- Microorganism protein ---- Vacuolar-sorting protein SNF7 Source.11656: DFBPPR15248 ---- Microorganism protein ---- DASH complex subunit SPC34 Source.11657: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2 Source.11658: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38 Source.11659: DFBPPR15252 ---- Microorganism protein ---- Protein DSE2 Source.11660: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase Source.11661: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.11662: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.11663: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1 Source.11664: DFBPPR15258 ---- Microorganism protein ---- Invertase Source.11665: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.11666: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha Source.11667: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4 Source.11668: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1 Source.11669: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.11670: DFBPPR15267 ---- Microorganism protein ---- Cofilin Source.11671: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25 Source.11672: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.11673: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4 Source.11674: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.11675: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase Source.11676: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.11677: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70 Source.11678: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.11679: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.11680: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3 Source.11681: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.11682: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone Source.11683: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase Source.11684: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2 Source.11685: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.11686: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D Source.11687: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta Source.11688: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.11689: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.11690: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.11691: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.11692: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.11693: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase Source.11694: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106 Source.11695: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1 Source.11696: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.11697: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14 Source.11698: DFBPPR15307 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 21 Source.11699: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4 Source.11700: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.11701: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.11702: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.11703: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.11704: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.11705: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase Source.11706: DFBPPR15316 ---- Microorganism protein ---- Protein URE2 Source.11707: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5 Source.11708: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor Source.11709: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.11710: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.11711: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial Source.11712: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.11713: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.11714: DFBPPR15328 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 31 Source.11715: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2 Source.11716: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1 Source.11717: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter Source.11718: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter Source.11719: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3 Source.11720: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.11721: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1 Source.11722: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial Source.11723: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.11724: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1 Source.11725: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.11726: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.11727: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.11728: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase Source.11729: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase Source.11730: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.11731: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.11732: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.11733: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.11734: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.11735: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog Source.11736: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.11737: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase Source.11738: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5 Source.11739: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.11740: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.11741: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80 Source.11742: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.11743: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial Source.11744: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17 Source.11745: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.11746: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.11747: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.11748: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.11749: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.11750: DFBPPR15393 ---- Microorganism protein ---- Inner membrane assembly complex subunit 17 Source.11751: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.11752: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.11753: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.11754: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1 Source.11755: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41 Source.11756: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.11757: DFBPPR15402 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM8 Source.11758: DFBPPR15405 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM9 Source.11759: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.11760: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3 Source.11761: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2 Source.11762: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1 Source.11763: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71 Source.11764: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2 Source.11765: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4 Source.11766: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4 Source.11767: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1 Source.11768: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.11769: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.11770: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.11771: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82 Source.11772: DFBPPR15427 ---- Microorganism protein ---- RNA exonuclease 4 Source.11773: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.11774: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3 Source.11775: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3 Source.11776: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101 Source.11777: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1 Source.11778: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.11779: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase Source.11780: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.11781: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10 Source.11782: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.11783: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial Source.11784: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0 Source.11785: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1 Source.11786: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial Source.11787: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.11788: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial Source.11789: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1 Source.11790: DFBPPR15456 ---- Microorganism protein ---- RNA polymerase II holoenzyme cyclin-like subunit Source.11791: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter Source.11792: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.11793: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.11794: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121 Source.11795: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21 Source.11796: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.11797: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1 Source.11798: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1 Source.11799: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.11800: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.11801: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4 Source.11802: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.11803: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.11804: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.11805: DFBPPR15474 ---- Microorganism protein ---- GPN-loop GTPase 3 Source.11806: DFBPPR15476 ---- Microorganism protein ---- Mitochondrial inner membrane i-AAA protease complex subunit MGR1 Source.11807: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.11808: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.11809: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1 Source.11810: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.11811: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.11812: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1 Source.11813: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.11814: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.11815: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6 Source.11816: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.11817: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123 Source.11818: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.11819: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.11820: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.11821: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5 Source.11822: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.11823: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32 Source.11824: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11 Source.11825: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.11826: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.11827: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3 Source.11828: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.11829: DFBPPR15511 ---- Microorganism protein ---- 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase Source.11830: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.11831: DFBPPR15513 ---- Microorganism protein ---- Killer toxin subunit gamma Source.11832: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.11833: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14 Source.11834: DFBPPR15517 ---- Microorganism protein ---- rRNA biogenesis protein RRP36 Source.11835: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101 Source.11836: DFBPPR15520 ---- Microorganism protein ---- Protein YAE1 Source.11837: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1 Source.11838: DFBPPR15523 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 3, mitochondrial Source.11839: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10 Source.11840: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3 Source.11841: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.11842: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6 Source.11843: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.11844: DFBPPR15537 ---- Microorganism protein ---- mRNA 3'-end-processing protein YTH1 Source.11845: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.11846: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase Source.11847: DFBPPR15541 ---- Microorganism protein ---- F-actin-capping protein subunit alpha Source.11848: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.11849: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial Source.11850: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.11851: DFBPPR15547 ---- Microorganism protein ---- SWR1-complex protein 5 Source.11852: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25 Source.11853: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.11854: DFBPPR15551 ---- Microorganism protein ---- Mitochondrial morphogenesis protein SLD7 Source.11855: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14 Source.11856: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.11857: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110 Source.11858: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial Source.11859: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.11860: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.11861: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26 Source.11862: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.11863: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1 Source.11864: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.11865: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.11866: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein Source.11867: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1 Source.11868: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.11869: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381 Source.11870: DFBPPR15579 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit CNL1 Source.11871: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1 Source.11872: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.11873: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.11874: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.11875: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28 Source.11876: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4 Source.11877: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1 Source.11878: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.11879: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1 Source.11880: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27 Source.11881: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.11882: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial Source.11883: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.11884: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2 Source.11885: DFBPPR15601 ---- Microorganism protein ---- Ubiquitin-like modifier HUB1 Source.11886: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.11887: DFBPPR15606 ---- Microorganism protein ---- Assembly factor CBP4 Source.11888: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.11889: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2 Source.11890: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.11891: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.11892: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.11893: DFBPPR15614 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX16, mitochondrial Source.11894: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.11895: DFBPPR15617 ---- Microorganism protein ---- Cap-associated protein CAF20 Source.11896: DFBPPR15618 ---- Microorganism protein ---- Ribosome assembly protein 3 Source.11897: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.11898: DFBPPR15620 ---- Microorganism protein ---- Autophagy-related protein 23 Source.11899: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.11900: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.11901: DFBPPR15627 ---- Microorganism protein ---- Multiprotein-bridging factor 1 Source.11902: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11 Source.11903: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7 Source.11904: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.11905: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1 Source.11906: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11 Source.11907: DFBPPR15638 ---- Microorganism protein ---- ATP-dependent kinase YFH7 Source.11908: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16 Source.11909: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3 Source.11910: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5 Source.11911: DFBPPR15643 ---- Microorganism protein ---- Peroxisome assembly protein 22 Source.11912: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3 Source.11913: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial Source.11914: DFBPPR15646 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 36, mitochondrial Source.11915: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2 Source.11916: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3 Source.11917: DFBPPR15651 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 34, mitochondrial Source.11918: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22 Source.11919: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.11920: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18 Source.11921: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.11922: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1 Source.11923: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit Source.11924: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.11925: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.11926: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1 Source.11927: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42 Source.11928: DFBPPR15668 ---- Microorganism protein ---- 40S ribosomal protein S28 Source.11929: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase Source.11930: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.11931: DFBPPR15674 ---- Microorganism protein ---- DNA polymerase epsilon subunit C Source.11932: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1 Source.11933: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial Source.11934: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.11935: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6 Source.11936: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1 Source.11937: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21 Source.11938: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1 Source.11939: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.11940: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8 Source.11941: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2 Source.11942: DFBPPR15688 ---- Microorganism protein ---- Nuclear transport factor 2 Source.11943: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.11944: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3 Source.11945: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1 Source.11946: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4 Source.11947: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.11948: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial Source.11949: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1 Source.11950: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2 Source.11951: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.11952: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1 Source.11953: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.11954: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial Source.11955: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45 Source.11956: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1 Source.11957: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.11958: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.11959: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23 Source.11960: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4 Source.11961: DFBPPR15711 ---- Microorganism protein ---- SWR1-complex protein 7 Source.11962: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.11963: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial Source.11964: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial Source.11965: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial Source.11966: DFBPPR15716 ---- Microorganism protein ---- 40S ribosomal protein S22 Source.11967: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.11968: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2 Source.11969: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial Source.11970: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1 Source.11971: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial Source.11972: DFBPPR15725 ---- Microorganism protein ---- Protein DML1 Source.11973: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.11974: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.11975: DFBPPR15728 ---- Microorganism protein ---- DNA-binding protein TRF1 Source.11976: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.11977: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2 Source.11978: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial Source.11979: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2 Source.11980: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1 Source.11981: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.11982: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.11983: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19 Source.11984: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8 Source.11985: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5 Source.11986: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1 Source.11987: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog Source.11988: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial Source.11989: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1 Source.11990: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86 Source.11991: DFBPPR15758 ---- Microorganism protein ---- Required for respiratory growth protein 8, mitochondrial Source.11992: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.11993: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6 Source.11994: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial Source.11995: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.11996: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.11997: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial Source.11998: DFBPPR15772 ---- Microorganism protein ---- Topoisomerase I damage affected protein 2 Source.11999: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1 Source.12000: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6 Source.12001: DFBPPR15777 ---- Microorganism protein ---- FAS1 domain-containing protein KLLA0E16841g Source.12002: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.12003: DFBPPR15781 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 5 Source.12004: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.12005: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9 Source.12006: DFBPPR15785 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 7 Source.12007: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2 Source.12008: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.12009: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32 Source.12010: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase Source.12011: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase Source.12012: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase Source.12013: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.12014: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.12015: DFBPPR15803 ---- Microorganism protein ---- Galactokinase Source.12016: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase Source.12017: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.12018: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component Source.12019: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.12020: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component Source.12021: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.12022: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.12023: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.12024: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase Source.12025: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase Source.12026: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase Source.12027: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.12028: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component Source.12029: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.12030: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase Source.12031: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.12032: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain Source.12033: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase Source.12034: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase Source.12035: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.12036: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR Source.12037: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT Source.12038: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase Source.12039: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region Source.12040: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.12041: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.12042: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.12043: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.12044: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2 Source.12045: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin Source.12046: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.12047: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3 Source.12048: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase Source.12049: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.12050: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.12051: DFBPPR15850 ---- Microorganism protein ---- Histone H2A Source.12052: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.12053: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.12054: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.12055: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.12056: DFBPPR15856 ---- Microorganism protein ---- Laccase-2 Source.12057: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.12058: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase Source.12059: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.12060: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein Source.12061: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.12062: DFBPPR15864 ---- Microorganism protein ---- Hydrophobin-3 Source.12063: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.12064: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase Source.12065: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.12066: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase Source.12067: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.12068: DFBPPR15875 ---- Microorganism protein ---- Hydrophobin-B Source.12069: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.12070: DFBPPR15877 ---- Microorganism protein ---- 40S ribosomal protein S22 Source.12071: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase Source.12072: DFBPPR15880 ---- Microorganism protein ---- 40S ribosomal protein S13 Source.12073: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.12074: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.12075: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.12076: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase Source.12077: DFBPPR15886 ---- Microorganism protein ---- Capsid protein Source.12078: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1 Source.12079: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.12080: DFBPPR15889 ---- Marine protein ---- Ferredoxin Source.12081: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.12082: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1 Source.12083: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2 Source.12084: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.12085: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2 Source.12086: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.12087: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog Source.12088: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.12089: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.12090: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.12091: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.12092: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.12093: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.12094: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1 Source.12095: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.12096: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.12097: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.12098: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.12099: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.12100: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A Source.12101: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.12102: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.12103: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.12104: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B Source.12105: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.12106: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.12107: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.12108: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic Source.12109: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase Source.12110: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.12111: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic Source.12112: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.12113: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.12114: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.12115: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.12116: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.12117: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic Source.12118: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic Source.12119: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.12120: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.12121: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.12122: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.12123: DFBPPR7794 ---- Plant protein ---- Cytochrome b6 Source.12124: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.12125: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.12126: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.12127: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.12128: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.12129: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.12130: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.12131: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.12132: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.12133: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.12134: DFBPPR7810 ---- Plant protein ---- Cytochrome f Source.12135: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.12136: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1 Source.12137: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.12138: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.12139: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.12140: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.12141: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.12142: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.12143: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.12144: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.12145: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.12146: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.12147: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase Source.12148: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.12149: DFBPPR7833 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.12150: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2 Source.12151: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a Source.12152: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.12153: DFBPPR7837 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.12154: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.12155: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.12156: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.12157: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.12158: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.12159: DFBPPR7844 ---- Plant protein ---- Actin-1 Source.12160: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.12161: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2 Source.12162: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.12163: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.12164: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a Source.12165: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.12166: DFBPPR7856 ---- Plant protein ---- Maturase K Source.12167: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.12168: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1 Source.12169: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic Source.12170: DFBPPR7866 ---- Plant protein ---- Photosystem II reaction center protein K Source.12171: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.12172: DFBPPR7869 ---- Plant protein ---- Alpha-amylase inhibitor 5 Source.12173: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3 Source.12174: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4 Source.12175: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1 Source.12176: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.12177: DFBPPR7878 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.12178: DFBPPR7882 ---- Plant protein ---- 30S ribosomal protein S19, chloroplastic Source.12179: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1 Source.12180: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.12181: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1 Source.12182: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.12183: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2 Source.12184: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1 Source.12185: DFBPPR7904 ---- Plant protein ---- Photosystem I reaction center subunit VIII Source.12186: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.12187: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein Source.12188: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.12189: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1 Source.12190: DFBPPR7919 ---- Plant protein ---- 30S ribosomal protein S16, chloroplastic Source.12191: DFBPPR7920 ---- Plant protein ---- Photosystem I assembly protein Ycf3 Source.12192: DFBPPR7922 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic Source.12193: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2 Source.12194: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1 Source.12195: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.12196: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.12197: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.12198: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.12199: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.12200: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic Source.12201: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.12202: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic Source.12203: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.12204: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a Source.12205: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.12206: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.12207: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.12208: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.12209: DFBPPR7949 ---- Plant protein ---- Cytochrome f Source.12210: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.12211: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.12212: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.12213: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1 Source.12214: DFBPPR7956 ---- Plant protein ---- Legumin type B Source.12215: DFBPPR7957 ---- Plant protein ---- Legumin type B Source.12216: DFBPPR7958 ---- Plant protein ---- Legumin type B Source.12217: DFBPPR7960 ---- Plant protein ---- Vicilin Source.12218: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.12219: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4 Source.12220: DFBPPR7967 ---- Plant protein ---- Plastocyanin Source.12221: DFBPPR7973 ---- Plant protein ---- Maturase K Source.12222: DFBPPR7977 ---- Plant protein ---- Ribosomal protein S14, mitochondrial Source.12223: DFBPPR7978 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic Source.12224: DFBPPR7985 ---- Plant protein ---- Uncharacterized 9.9 kDa protein Source.12225: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.12226: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.12227: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.12228: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.12229: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic Source.12230: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.12231: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.12232: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.12233: DFBPPR8002 ---- Plant protein ---- Plastocyanin Source.12234: DFBPPR8007 ---- Plant protein ---- Maturase K Source.12235: DFBPPR8009 ---- Plant protein ---- CASP-like protein 5B1 Source.12236: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase Source.12237: DFBPPR8029 ---- Plant protein ---- Vignain Source.12238: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1 Source.12239: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1 Source.12240: DFBPPR8033 ---- Plant protein ---- Uricase-2 Source.12241: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.12242: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3 Source.12243: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.12244: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.12245: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.12246: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.12247: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.12248: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.12249: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.12250: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.12251: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.12252: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.12253: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.12254: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin Source.12255: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.12256: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.12257: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.12258: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.12259: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.12260: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic Source.12261: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3 Source.12262: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.12263: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.12264: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.12265: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.12266: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.12267: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.12268: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme Source.12269: DFBPPR8080 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.12270: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1 Source.12271: DFBPPR8082 ---- Plant protein ---- Plastocyanin Source.12272: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.12273: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.12274: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.12275: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.12276: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.12277: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.12278: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2 Source.12279: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.12280: DFBPPR8091 ---- Plant protein ---- Cytochrome f Source.12281: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.12282: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1 Source.12283: DFBPPR8095 ---- Plant protein ---- Profilin-1 Source.12284: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin Source.12285: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.12286: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.12287: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.12288: DFBPPR8101 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.12289: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.12290: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.12291: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.12292: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.12293: DFBPPR8107 ---- Plant protein ---- Stress-related protein Source.12294: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1 Source.12295: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.12296: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.12297: DFBPPR8112 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.12298: DFBPPR8115 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.12299: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.12300: DFBPPR8119 ---- Plant protein ---- Chalcone--flavonone isomerase Source.12301: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.12302: DFBPPR8122 ---- Plant protein ---- Arcelin-4 Source.12303: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.12304: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5 Source.12305: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.12306: DFBPPR8128 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.12307: DFBPPR8130 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.12308: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic Source.12309: DFBPPR8135 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.12310: DFBPPR8137 ---- Plant protein ---- 50S ribosomal protein L20, chloroplastic Source.12311: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.12312: DFBPPR8144 ---- Plant protein ---- Maturase K Source.12313: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.12314: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2 Source.12315: DFBPPR8151 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.12316: DFBPPR8153 ---- Plant protein ---- Thaumatin-like protein Source.12317: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.12318: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.12319: DFBPPR8156 ---- Plant protein ---- Nodulin-30 Source.12320: DFBPPR8159 ---- Plant protein ---- Chloroplast envelope membrane protein Source.12321: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.12322: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.12323: DFBPPR8163 ---- Plant protein ---- Photosystem I assembly protein Ycf3 Source.12324: DFBPPR8164 ---- Plant protein ---- 50S ribosomal protein L36, chloroplastic Source.12325: DFBPPR8170 ---- Plant protein ---- Putative alpha-amylase inhibitor Source.12326: DFBPPR8178 ---- Plant protein ---- 46 kDa cell wall protein Source.12327: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase Source.12328: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.12329: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1 Source.12330: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.12331: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase Source.12332: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.12333: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.12334: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.12335: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.12336: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.12337: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.12338: DFBPPR8225 ---- Plant protein ---- Non-specific lipid-transfer protein AP10 Source.12339: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.12340: DFBPPR8228 ---- Plant protein ---- Albumin-8 Source.12341: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.12342: DFBPPR8235 ---- Plant protein ---- Catalase Source.12343: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.12344: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.12345: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.12346: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.12347: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.12348: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.12349: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.12350: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.12351: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.12352: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.12353: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.12354: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.12355: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic Source.12356: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.12357: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.12358: DFBPPR8258 ---- Plant protein ---- Ribosomal protein S12, mitochondrial Source.12359: DFBPPR8259 ---- Plant protein ---- Cytochrome f Source.12360: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.12361: DFBPPR8262 ---- Plant protein ---- ATP-dependent zinc metalloprotease FTSH, chloroplastic Source.12362: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.12363: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.12364: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.12365: DFBPPR8271 ---- Plant protein ---- Cytochrome b6 Source.12366: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.12367: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.12368: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.12369: DFBPPR8278 ---- Plant protein ---- Cytochrome b6-f complex subunit 8 Source.12370: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase Source.12371: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.12372: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog Source.12373: DFBPPR8286 ---- Plant protein ---- Oleosin Source.12374: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5 Source.12375: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.12376: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein Source.12377: DFBPPR8292 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.12378: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase Source.12379: DFBPPR8296 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.12380: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.12381: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K Source.12382: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.12383: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.12384: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic Source.12385: DFBPPR8307 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic Source.12386: DFBPPR8309 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.12387: DFBPPR8314 ---- Plant protein ---- Maturase K Source.12388: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.12389: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1 Source.12390: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein Source.12391: DFBPPR8328 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.12392: DFBPPR8331 ---- Plant protein ---- Auxin-responsive protein SAUR50 Source.12393: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1 Source.12394: DFBPPR8334 ---- Plant protein ---- Photosystem I reaction center subunit VIII Source.12395: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.12396: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3 Source.12397: DFBPPR8343 ---- Plant protein ---- Chloroplast envelope membrane protein Source.12398: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.12399: DFBPPR8348 ---- Plant protein ---- 30S ribosomal protein S16, chloroplastic Source.12400: DFBPPR8349 ---- Plant protein ---- Photosystem I assembly protein Ycf3 Source.12401: DFBPPR8351 ---- Plant protein ---- 50S ribosomal protein L36, chloroplastic Source.12402: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Stimulating activity

Bioactive dipeptide IV stimulate glucose uptake in skeletal muscles via the PI3-kinase and aPKC pathways, resulting in increased skeletal muscle glycogen contents.

Table 1 Effect of branched-chain amino acid (BCAA)-containing dipeptides on the rate of 2-deoxyglucose uptake in L6 myotubes (nmol/10 min/well).
Control	1.21 ± 0.07
100 nM insulin (positive control)	2.12 ± 0.14^*
1 mM Ile-Val	1.80 ± 0.07^*
Values are means ± SE (n = 8). ^* p < 0.05 vs. control; Dunnett’s test.

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Hydrolysis of whey protein (Tatua Co-Operative Dairy Company Limited, Morrinsville, New Zealand) (50 g/L) was carried out by incubation for 6h at 50 ̊C with protease enzymes (1 : 100, enzyme-to-substrate ratio, w/w) from Bacillus subtilis and Aspergillus oryzae (Amano Enzyme Inc., Nagoya, Japan).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Morifuji M, Koga J, Kawanaka K, Higuchi M. Branched-chain amino acid-containing dipeptides, identified from whey protein hydrolysates, stimulate glucose uptake rate in L6 myotubes and isolated skeletal muscles. J Nutr Sci Vitaminol (Tokyo). 2009 Feb;55(1):81-6. PMID: 19352067 DOI: 10.3177/jnsv.55.81
Other literature(s)	N.D
PubDate	2009