| DFBP ID - DFBPVARE0002(Vasorelaxation peptide) |
| DFBP ID |
DFBPVARE0002 |
| Peptide sequence |
GPNAV |
| Type |
Native peptide |
| Peptide/Function name |
Vasorelaxation peptide |
|
| Function-activity relationship |
| Main bioactivity |
Vasorelaxation activity |
| Otheir bioactivity |
ACE-inhibitory activity [D1], Multifunctional activity [D2] |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Gly-Pro-Asn-Ala-Val |
| Single-letter amino acid |
GPNAV |
| Peptide length |
5 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| 528.5 Da |
456.50 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
5.97 c |
| IC50 |
0.41 ± 0.05 μM |
| pIC50 |
0.387 |
| GRAVY |
0.1000 c |
| Hydrophilic residue ratio |
80% c |
| Peptide calculator |
|
|
| Peptide source & Food-borne protein(s) search |
| Classification |
Plant |
| Organism/Source |
Soybean |
| Precursor protein |
Meal protein |
| Residue position |
N.D |
|
Precursor protein(s) search
|
|
|
Link-research
|
There are no literature reports on the discovery of this sequence in other food-source proteins. |
|
| Biological/Functional activity & target protein |
| Vasorelaxation activity |
The synthetic peptide GPNAV exerted an endothelium-independent vasorelaxation action (EC50: 0.41 ± 0.05 μM, Value was means ± standard deviation (n = 3)), while a mixture of the corresponding amino acids (i.e., Gln, Cys, Pro, Ala, Asn, and Val) was used as a negative control and did not show vasodilation. So this data suggested that the peptide was a potent vasorelaxant.
Vasorelaxation action of GPNAV was also examined in the endothelium-denuded aortic rings. The absence of the endothelium layer was confirmed by no vascular response against 1.0 mM ACh. Vascular relaxation determined in the endothelium denuded aorta ring also observed a dose-dependent vasorelaxation, while there was no difference between the aorta ring with or without endothelium. According to this result, the endothelium is not involved in the underlying mechanism of soy peptide induced vasorelaxation.
|
| Specific target protein(s) |
N.D |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Non-bitter taste prediction |
|
| SMILES |
NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Fermentation and Enzymatic hydrolysis |
| Enzyme(s)/starter culture |
Soy meal was fermented with Bacillus subtilis from Douchi and then was
hydrolyzed by thermolysin, and the water extraction was then separated
into four fractions using ultrafiltration membranes. |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Wang Z, Cui Y, Liu P, Zhao Y, Wang L, Liu Y, Xie J. Small Peptides Isolated from Enzymatic Hydrolyzate of Fermented Soybean Meal Promote Endothelium-Independent Vasorelaxation and ACE Inhibition. J Agric Food Chem. 2017 Dec 20;65(50):10844-10850.
|
| Other literature(s) |
N.D |
| PubDate |
2017 |
|