E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0014(Multifunctional peptide)
DFBP ID DFBPMUFU0014
Peptide sequence YG
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 3
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0025 Milk protein α-Lactalbumin f(50-51), f(18-19)
DFBPACEI0605 Bovine whey protein κ-Casein

f(38-39)

DFBPACEI0606 Cod Cod protein hydrolysates N.D
DFBPACEI1341 Land snail (Helix aspersa) Hepatopancreas (by-product)

N.D

DFBPACEI1543 Dried bonito (Katsuobusi) Muscle protein

N.D

DFBPACEI1899 Amaranth seed proteins Amaranth glutelins

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0064 Land snail (Helix aspersa) Hepatopancreas (by-product)

N.D

Immunomodulatory peptides
DFBPID Organism Precursor protein Residue position
DFBPIMMU0035 Bovine Milk protien Not measured
Physical & computational properties
Three-letter amino acid Tyr-Gly
Single-letter amino acid YG
Peptide length 2
Theoretical mass 238.24 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
GRAVY -0.8500
Hydrophilic residue ratio 50%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0163 ---- Plant proteins ---- Monellin chain B
Source.3: DFBPPR0748 ---- Plant proteins ---- Agglutinin
Source.4: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.5: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.6: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.7: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1
Source.8: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.9: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.10: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.11: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.12: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.13: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.14: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.15: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.16: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.17: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.18: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.19: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.20: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.21: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.22: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.23: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.24: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.25: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.26: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.27: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.28: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.29: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.30: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.31: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.32: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.33: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.34: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.35: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.36: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.37: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.38: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.39: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.40: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.41: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.42: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.43: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.44: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.45: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.46: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.47: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.48: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1
Source.49: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2
Source.50: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.51: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.52: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.53: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.54: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.55: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.56: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.57: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.58: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.59: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.60: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.61: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.62: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.63: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.64: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.65: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.66: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.67: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.68: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.69: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase
Source.70: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.71: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.72: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.73: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.74: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.75: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.76: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.77: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.78: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.79: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.80: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.81: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.82: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.83: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.84: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.85: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.86: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.87: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.88: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.89: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.90: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.91: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.92: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.93: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.94: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.95: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.96: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.97: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.98: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.99: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.100: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.101: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.102: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.103: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.104: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.105: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.106: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.107: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.108: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.109: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.110: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.111: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.112: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.113: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.114: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.115: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.116: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.117: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.118: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.119: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.120: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.121: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.122: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.123: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.124: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.125: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.126: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.127: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.128: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.129: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.130: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.131: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.132: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.133: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.134: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.135: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.136: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.137: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.138: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.139: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.140: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.141: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.142: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.143: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.144: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.145: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.146: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2
Source.147: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.148: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.149: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.150: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.151: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.152: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.153: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.154: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.155: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.156: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.157: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.158: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.159: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.160: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.161: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.162: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic
Source.163: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.164: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.165: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.166: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.167: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.168: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.169: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.170: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.171: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.172: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.173: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.174: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.175: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.176: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.177: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.178: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.179: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.180: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.181: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.182: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.183: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.184: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.185: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog
Source.186: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.187: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.188: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog
Source.189: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.190: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.191: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.192: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.193: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.194: DFBPPR1150 ---- Plant proteins ---- Abscisic stress-ripening protein 5
Source.195: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.196: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A
Source.197: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.198: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.199: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.200: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.201: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.202: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.203: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.204: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.205: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.206: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.207: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.208: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.209: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.210: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.211: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.212: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.213: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.214: DFBPPR1183 ---- Plant proteins ---- MADS-box transcription factor 18
Source.215: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.216: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.217: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.218: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.219: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.220: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.221: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic
Source.222: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial
Source.223: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.224: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.225: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.226: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.227: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.228: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.229: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.230: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.231: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.232: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.233: DFBPPR1253 ---- Plant proteins ---- Phospholipase A2 homolog 3
Source.234: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.235: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.236: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.237: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.238: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.239: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.240: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.241: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.242: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.243: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.244: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.245: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.246: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.247: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.248: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.249: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.250: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.251: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.252: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.253: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.254: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.255: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.256: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.257: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.258: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.259: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.260: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.261: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.262: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.263: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.264: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.265: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.266: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.267: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.268: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.269: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.270: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.271: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.272: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.273: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.274: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.275: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.276: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.277: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.278: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic
Source.279: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.280: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.281: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.282: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.283: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.284: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.285: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.286: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.287: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.288: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.289: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.290: DFBPPR1351 ---- Plant proteins ---- Probable phospholipase A2 homolog 2
Source.291: DFBPPR1353 ---- Plant proteins ---- Transcription factor UDT1
Source.292: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.293: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.294: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.295: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic
Source.296: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.297: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.298: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.299: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.300: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.301: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.302: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.303: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.304: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.305: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.306: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.307: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.308: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.309: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.310: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.311: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.312: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.313: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.314: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.315: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.316: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.317: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.318: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.319: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.320: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.321: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.322: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.323: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.324: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.325: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.326: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.327: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.328: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.329: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.330: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.331: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.332: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.333: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.334: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.335: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.336: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.337: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.338: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.339: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.340: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.341: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.342: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.343: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.344: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.345: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.346: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.347: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.348: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.349: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.350: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.351: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.352: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.353: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.354: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.355: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.356: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.357: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.358: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.359: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.360: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.361: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.362: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.363: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.364: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.365: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.366: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.367: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.368: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.369: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.370: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.371: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.372: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.373: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.374: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.375: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.376: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.377: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.378: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.379: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.380: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.381: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.382: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.383: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.384: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.385: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.386: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.387: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.388: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.389: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.390: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.391: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.392: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.393: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.394: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.395: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.396: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.397: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.398: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.399: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.400: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.401: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.402: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.403: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.404: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.405: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.406: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.407: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.408: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.409: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.410: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.411: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.412: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.413: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.414: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.415: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.416: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.417: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.418: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.419: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.420: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.421: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.422: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.423: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.424: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.425: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.426: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.427: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.428: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.429: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.430: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.431: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.432: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.433: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.434: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.435: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.436: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.437: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.438: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.439: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.440: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.441: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.442: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.443: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.444: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.445: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.446: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.447: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.448: DFBPPR1580 ---- Plant proteins ---- Expansin-A4
Source.449: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.450: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.451: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.452: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8
Source.453: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.454: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.455: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.456: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.457: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.458: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.459: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.460: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.461: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.462: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.463: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.464: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.465: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.466: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.467: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.468: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.469: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase
Source.470: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.471: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.472: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.473: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29
Source.474: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.475: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.476: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.477: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.478: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.479: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.480: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.481: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.482: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.483: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.484: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.485: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.486: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.487: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.488: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.489: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.490: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.491: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.492: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.493: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.494: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.495: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.496: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.497: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.498: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.499: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.500: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.501: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.502: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.503: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.504: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.505: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.506: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.507: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.508: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.509: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.510: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.511: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.512: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.513: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.514: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.515: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.516: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.517: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.518: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.519: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.520: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.521: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.522: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.523: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.524: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.525: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.526: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.527: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.528: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.529: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.530: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.531: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.532: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3
Source.533: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.534: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.535: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.536: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.537: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.538: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.539: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.540: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.541: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.542: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.543: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.544: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.545: DFBPPR1751 ---- Plant proteins ---- Heat stress transcription factor A-4b
Source.546: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.547: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.548: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.549: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.550: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.551: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.552: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.553: DFBPPR1768 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase RZFP34
Source.554: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.555: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.556: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.557: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.558: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.559: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.560: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.561: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.562: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.563: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.564: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.565: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.566: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.567: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.568: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.569: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.570: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.571: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.572: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.573: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.574: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.575: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.576: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.577: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.578: DFBPPR1803 ---- Plant proteins ---- Chitinase 5
Source.579: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.580: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.581: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.582: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.583: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.584: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.585: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.586: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.587: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.588: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.589: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.590: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.591: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.592: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.593: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.594: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1
Source.595: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.596: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.597: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.598: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.599: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.600: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.601: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.602: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.603: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.604: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.605: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.606: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.607: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.608: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.609: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.610: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.611: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.612: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.613: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.614: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.615: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.616: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.617: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.618: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.619: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.620: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.621: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.622: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.623: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.624: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.625: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.626: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.627: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.628: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.629: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.630: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.631: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.632: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.633: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.634: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.635: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.636: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.637: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.638: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.639: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.640: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.641: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.642: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.643: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.644: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.645: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.646: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.647: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.648: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.649: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.650: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.651: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.652: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.653: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.654: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.655: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.656: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.657: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.658: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.659: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.660: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.661: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic
Source.662: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.663: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.664: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.665: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.666: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.667: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.668: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.669: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.670: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.671: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.672: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.673: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.674: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.675: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.676: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1
Source.677: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.678: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.679: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.680: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.681: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.682: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.683: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.684: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.685: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.686: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.687: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.688: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.689: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.690: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.691: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.692: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.693: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.694: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.695: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.696: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.697: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.698: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.699: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.700: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.701: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.702: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.703: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.704: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.705: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.706: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.707: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.708: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.709: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.710: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.711: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.712: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.713: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.714: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.715: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.716: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.717: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.718: DFBPPR2026 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.719: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.720: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.721: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.722: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.723: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.724: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.725: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.726: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.727: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.728: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.729: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.730: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.731: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.732: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.733: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.734: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.735: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.736: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.737: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.738: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.739: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.740: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.741: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.742: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.743: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.744: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.745: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.746: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.747: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.748: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.749: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.750: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.751: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.752: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.753: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.754: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.755: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.756: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.757: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.758: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.759: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.760: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.761: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.762: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.763: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.764: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.765: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.766: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.767: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.768: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.769: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.770: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.771: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.772: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.773: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.774: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.775: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.776: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.777: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.778: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.779: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.780: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.781: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.782: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.783: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.784: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.785: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.786: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.787: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.788: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.789: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.790: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.791: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.792: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.793: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.794: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.795: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.796: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.797: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.798: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.799: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.800: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.801: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.802: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.803: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.804: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.805: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.806: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.807: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.808: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.809: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.810: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.811: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.812: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.813: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.814: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.815: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.816: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.817: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.818: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.819: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.820: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.821: DFBPPR2176 ---- Plant proteins ---- Expansin-B11
Source.822: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.823: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.824: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.825: DFBPPR2184 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.826: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.827: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.828: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.829: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.830: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.831: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.832: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.833: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.834: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.835: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.836: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.837: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.838: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.839: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.840: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.841: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.842: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.843: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.844: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.845: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.846: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.847: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.848: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.849: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.850: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.851: DFBPPR2223 ---- Plant proteins ---- Urease
Source.852: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.853: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.854: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.855: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.856: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.857: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.858: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.859: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.860: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.861: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.862: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.863: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76
Source.864: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.865: DFBPPR2245 ---- Plant proteins ---- Expansin-A26
Source.866: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.867: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.868: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.869: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.870: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.871: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.872: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.873: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.874: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3
Source.875: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.876: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.877: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.878: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.879: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.880: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.881: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.882: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.883: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.884: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.885: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.886: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.887: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.888: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.889: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.890: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.891: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.892: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.893: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.894: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.895: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.896: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.897: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.898: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.899: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.900: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.901: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.902: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.903: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.904: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.905: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.906: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.907: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.908: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.909: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.910: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic
Source.911: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.912: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.913: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.914: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.915: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.916: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.917: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.918: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.919: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.920: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.921: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.922: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.923: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.924: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.925: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.926: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.927: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.928: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.929: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.930: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.931: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.932: DFBPPR2356 ---- Plant proteins ---- Ubiquitin-like protein-NEDD8-like protein RUB3
Source.933: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.934: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.935: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.936: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.937: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.938: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.939: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.940: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.941: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.942: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.943: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.944: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.945: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.946: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.947: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.948: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.949: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.950: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.951: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.952: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.953: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1
Source.954: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.955: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.956: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.957: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.958: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.959: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.960: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.961: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.962: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.963: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.964: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.965: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.966: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.967: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.968: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.969: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.970: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.971: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.972: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.973: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.974: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.975: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.976: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.977: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.978: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.979: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.980: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.981: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.982: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.983: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.984: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.985: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.986: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.987: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.988: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.989: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.990: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.991: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26
Source.992: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2
Source.993: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.994: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.995: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.996: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.997: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.998: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.999: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.1000: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.1001: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.1002: DFBPPR2491 ---- Plant proteins ---- Expansin-A10
Source.1003: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1004: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.1005: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.1006: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.1007: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.1008: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic
Source.1009: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1010: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.1011: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.1012: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9
Source.1013: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.1014: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.1015: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.1016: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.1017: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.1018: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.1019: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.1020: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1021: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.1022: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5
Source.1023: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.1024: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein
Source.1025: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.1026: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.1027: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.1028: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1029: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.1030: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.1031: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.1032: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.1033: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.1034: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.1035: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1036: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.1037: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1038: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.1039: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1040: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.1041: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.1042: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.1043: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.1044: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1045: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.1046: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.1047: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.1048: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.1049: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.1050: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.1051: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.1052: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.1053: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.1054: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.1055: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.1056: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1
Source.1057: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic
Source.1058: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.1059: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.1060: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.1061: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.1062: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.1063: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.1064: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.1065: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.1066: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.1067: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.1068: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.1069: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.1070: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.1071: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1
Source.1072: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.1073: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.1074: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1075: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.1076: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.1077: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.1078: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.1079: DFBPPR2614 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.1080: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.1081: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.1082: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.1083: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.1084: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.1085: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1086: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.1087: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.1088: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1089: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.1090: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.1091: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.1092: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.1093: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.1094: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.1095: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.1096: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.1097: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.1098: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3
Source.1099: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.1100: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.1101: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.1102: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.1103: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1104: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.1105: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.1106: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.1107: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.1108: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1
Source.1109: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.1110: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.1111: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.1112: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.1113: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.1114: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.1115: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.1116: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.1117: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.1118: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.1119: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.1120: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.1121: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.1122: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.1123: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.1124: DFBPPR2699 ---- Plant proteins ---- Expansin-A8
Source.1125: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.1126: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.1127: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.1128: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.1129: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.1130: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.1131: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.1132: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.1133: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.1134: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.1135: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.1136: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.1137: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.1138: DFBPPR2721 ---- Plant proteins ---- Expansin-A18
Source.1139: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.1140: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.1141: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.1142: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.1143: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.1144: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.1145: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1146: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.1147: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.1148: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.1149: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.1150: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.1151: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1152: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.1153: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.1154: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.1155: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.1156: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.1157: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.1158: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.1159: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.1160: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.1161: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.1162: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.1163: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.1164: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.1165: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.1166: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.1167: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.1168: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1169: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.1170: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.1171: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.1172: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.1173: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A
Source.1174: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.1175: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.1176: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.1177: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.1178: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1179: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.1180: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.1181: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.1182: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.1183: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1184: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.1185: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.1186: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.1187: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1188: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c
Source.1189: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS
Source.1190: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.1191: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.1192: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.1193: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.1194: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.1195: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.1196: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2
Source.1197: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.1198: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1199: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.1200: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.1201: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.1202: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.1203: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.1204: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.1205: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.1206: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.1207: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.1208: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.1209: DFBPPR2825 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.1210: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.1211: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.1212: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.1213: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.1214: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.1215: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.1216: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.1217: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.1218: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.1219: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.1220: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.1221: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.1222: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.1223: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.1224: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.1225: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.1226: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.1227: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.1228: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.1229: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1230: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3
Source.1231: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.1232: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.1233: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1234: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.1235: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.1236: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1237: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.1238: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.1239: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.1240: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.1241: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.1242: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.1243: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1244: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1245: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.1246: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B
Source.1247: DFBPPR2880 ---- Plant proteins ---- Nuclear cap-binding protein subunit 2
Source.1248: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.1249: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.1250: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.1251: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.1252: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.1253: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1254: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.1255: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.1256: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.1257: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.1258: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.1259: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.1260: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.1261: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.1262: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.1263: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.1264: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.1265: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.1266: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.1267: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.1268: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.1269: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.1270: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.1271: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.1272: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.1273: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.1274: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3
Source.1275: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.1276: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.1277: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.1278: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.1279: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.1280: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.1281: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.1282: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.1283: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.1284: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.1285: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.1286: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.1287: DFBPPR2939 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 5
Source.1288: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.1289: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.1290: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.1291: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.1292: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1293: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.1294: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.1295: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.1296: DFBPPR2952 ---- Plant proteins ---- Expansin-A17
Source.1297: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.1298: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1299: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.1300: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.1301: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.1302: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.1303: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.1304: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.1305: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1306: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.1307: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.1308: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.1309: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.1310: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.1311: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.1312: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.1313: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.1314: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.1315: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.1316: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.1317: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.1318: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.1319: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.1320: DFBPPR2994 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.1321: DFBPPR2995 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1
Source.1322: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.1323: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.1324: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.1325: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.1326: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.1327: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.1328: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.1329: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.1330: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.1331: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.1332: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4
Source.1333: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.1334: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.1335: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.1336: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.1337: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.1338: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.1339: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.1340: DFBPPR3021 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 1
Source.1341: DFBPPR3022 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 2
Source.1342: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.1343: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.1344: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.1345: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.1346: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1347: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1348: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.1349: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.1350: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.1351: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b
Source.1352: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.1353: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.1354: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1355: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.1356: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.1357: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36
Source.1358: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10
Source.1359: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1360: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.1361: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1362: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.1363: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.1364: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1
Source.1365: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.1366: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.1367: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1368: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.1369: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.1370: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1371: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.1372: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1373: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1374: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.1375: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1376: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1377: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1378: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.1379: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.1380: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.1381: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.1382: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1383: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.1384: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.1385: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1386: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.1387: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1388: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.1389: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.1390: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.1391: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1392: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.1393: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.1394: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.1395: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.1396: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.1397: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1398: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1399: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.1400: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.1401: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1402: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1403: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.1404: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1405: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1406: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.1407: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.1408: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.1409: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1410: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1411: DFBPPR3143 ---- Plant proteins ---- Protein OS-9 homolog
Source.1412: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.1413: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.1414: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.1415: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.1416: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1417: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.1418: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1419: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.1420: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1421: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.1422: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.1423: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1424: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.1425: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.1426: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.1427: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1428: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.1429: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1430: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.1431: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1432: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.1433: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.1434: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.1435: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.1436: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1437: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.1438: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1439: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.1440: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1441: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1442: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1443: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1444: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.1445: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.1446: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1447: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.1448: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1449: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.1450: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.1451: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1452: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.1453: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1454: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.1455: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.1456: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1457: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1458: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.1459: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1460: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.1461: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.1462: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1463: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1464: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.1465: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.1466: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.1467: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.1468: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.1469: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.1470: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1471: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.1472: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1473: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.1474: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.1475: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1476: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.1477: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1478: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1479: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1480: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.1481: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1482: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.1483: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.1484: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1485: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1486: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.1487: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.1488: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1489: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.1490: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.1491: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1492: DFBPPR3276 ---- Plant proteins ---- MADS-box transcription factor 27
Source.1493: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.1494: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1495: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1496: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta
Source.1497: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.1498: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1499: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.1500: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.1501: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.1502: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.1503: DFBPPR3296 ---- Plant proteins ---- MADS-box transcription factor 32
Source.1504: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.1505: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1506: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9
Source.1507: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.1508: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1509: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.1510: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.1511: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1512: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.1513: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.1514: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.1515: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.1516: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.1517: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1518: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.1519: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1520: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7
Source.1521: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.1522: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1523: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.1524: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.1525: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.1526: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.1527: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1528: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1529: DFBPPR3336 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.1530: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.1531: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.1532: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1533: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.1534: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.1535: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.1536: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.1537: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.1538: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.1539: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1540: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.1541: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.1542: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.1543: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1544: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B
Source.1545: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1546: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1547: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1548: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1549: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1550: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1551: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.1552: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1553: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.1554: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.1555: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1556: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.1557: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1558: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1559: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1560: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.1561: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.1562: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.1563: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1564: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.1565: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1566: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1567: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1568: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1569: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.1570: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.1571: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1572: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1573: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.1574: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1575: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1576: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.1577: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1578: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.1579: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1580: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1581: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1582: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1583: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1584: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1585: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.1586: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3
Source.1587: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.1588: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1589: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.1590: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.1591: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1592: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.1593: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.1594: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3
Source.1595: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1596: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1597: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1598: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.1599: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.1600: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1601: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.1602: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.1603: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.1604: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1605: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.1606: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.1607: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.1608: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.1609: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.1610: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3
Source.1611: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1612: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.1613: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1614: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8
Source.1615: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5
Source.1616: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1617: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1618: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.1619: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1620: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9
Source.1621: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1622: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.1623: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1624: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.1625: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.1626: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.1627: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1628: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1629: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.1630: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1631: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.1632: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.1633: DFBPPR3518 ---- Plant proteins ---- Thioredoxin-like 3-3
Source.1634: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.1635: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.1636: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.1637: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.1638: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.1639: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2
Source.1640: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1641: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1642: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1643: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1644: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1645: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.1646: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1647: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1648: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.1649: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.1650: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.1651: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.1652: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.1653: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1654: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.1655: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.1656: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1657: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1
Source.1658: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1659: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1660: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.1661: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1662: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.1663: DFBPPR3578 ---- Plant proteins ---- Glutaredoxin-C13
Source.1664: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1665: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1666: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1667: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1668: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.1669: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.1670: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1671: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1672: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.1673: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1674: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.1675: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1676: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e
Source.1677: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1678: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.1679: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1680: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1681: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1682: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.1683: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b
Source.1684: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.1685: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1686: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.1687: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1688: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.1689: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1690: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.1691: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1692: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1693: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.1694: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1695: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1696: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.1697: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2
Source.1698: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1699: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.1700: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1701: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e
Source.1702: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.1703: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1704: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1705: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1706: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin
Source.1707: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3
Source.1708: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1709: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1710: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1711: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.1712: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.1713: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1714: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.1715: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1716: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1717: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.1718: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.1719: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1720: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1721: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1722: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1723: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1724: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1725: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1726: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1727: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1728: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d
Source.1729: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1730: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.1731: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.1732: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.1733: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.1734: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.1735: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.1736: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.1737: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.1738: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.1739: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.1740: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.1741: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.1742: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.1743: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1744: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1745: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.1746: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1747: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.1748: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1
Source.1749: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1750: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.1751: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.1752: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.1753: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.1754: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.1755: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.1756: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1757: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.1758: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.1759: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1760: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1761: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.1762: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1763: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1764: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.1765: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.1766: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.1767: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.1768: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.1769: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.1770: DFBPPR3763 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.1771: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.1772: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.1773: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.1774: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1775: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.1776: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.1777: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.1778: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.1779: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1780: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.1781: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.1782: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.1783: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.1784: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.1785: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.1786: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.1787: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.1788: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.1789: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1790: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.1791: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1792: DFBPPR3791 ---- Plant proteins ---- Putative glutaredoxin-C12
Source.1793: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.1794: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.1795: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.1796: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7
Source.1797: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42
Source.1798: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.1799: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1800: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.1801: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.1802: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.1803: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.1804: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.1805: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1806: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.1807: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.1808: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1809: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.1810: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1811: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.1812: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.1813: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.1814: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.1815: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.1816: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.1817: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.1818: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.1819: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.1820: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.1821: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.1822: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.1823: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54
Source.1824: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.1825: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.1826: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1827: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1828: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.1829: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.1830: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.1831: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.1832: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.1833: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.1834: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.1835: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1836: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11
Source.1837: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1838: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.1839: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.1840: DFBPPR3882 ---- Plant proteins ---- Squamosa promoter-binding-like protein 7
Source.1841: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.1842: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.1843: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1844: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.1845: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.1846: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.1847: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1848: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.1849: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.1850: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.1851: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.1852: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.1853: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1854: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1855: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.1856: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.1857: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.1858: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.1859: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g
Source.1860: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.1861: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.1862: DFBPPR3923 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic
Source.1863: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1864: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1865: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.1866: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1867: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.1868: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.1869: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1870: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1871: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.1872: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1
Source.1873: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.1874: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.1875: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.1876: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial
Source.1877: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.1878: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.1879: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.1880: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1881: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1882: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.1883: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1884: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.1885: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1
Source.1886: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1887: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.1888: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.1889: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.1890: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.1891: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1892: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.1893: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1894: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1895: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.1896: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1897: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.1898: DFBPPR4004 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.1899: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1900: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.1901: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.1902: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.1903: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.1904: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1905: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.1906: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.1907: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f
Source.1908: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.1909: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.1910: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.1911: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.1912: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.1913: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1914: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27
Source.1915: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.1916: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1917: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.1918: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1919: DFBPPR4045 ---- Plant proteins ---- 60S ribosomal protein L11
Source.1920: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.1921: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.1922: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1923: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1924: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.1925: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.1926: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1927: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.1928: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.1929: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.1930: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.1931: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.1932: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1933: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1934: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1935: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.1936: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1937: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.1938: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1939: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1
Source.1940: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.1941: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1942: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1943: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.1944: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.1945: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.1946: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1947: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.1948: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.1949: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.1950: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1951: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.1952: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.1953: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.1954: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1955: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1956: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.1957: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1958: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1959: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.1960: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.1961: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1962: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1963: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1964: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1965: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.1966: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1967: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1968: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.1969: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1970: DFBPPR4169 ---- Plant proteins ---- Succinate dehydrogenase subunit 6, mitochondrial
Source.1971: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.1972: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4
Source.1973: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3
Source.1974: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1975: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.1976: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.1977: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1978: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.1979: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1980: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.1981: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1982: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1983: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1984: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.1985: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1986: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1987: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1988: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.1989: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1990: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1991: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.1992: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1993: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.1994: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.1995: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1996: DFBPPR4218 ---- Plant proteins ---- Glycine-rich cell wall structural protein 2
Source.1997: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1998: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.1999: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.2000: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.2001: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.2002: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.2003: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.2004: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.2005: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.2006: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.2007: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.2008: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.2009: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.2010: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.2011: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.2012: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.2013: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.2014: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5
Source.2015: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6
Source.2016: DFBPPR4255 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.2017: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.2018: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.2019: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.2020: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.2021: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.2022: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.2023: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.2024: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.2025: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.2026: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.2027: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.2028: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.2029: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.2030: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20
Source.2031: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3
Source.2032: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4
Source.2033: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.2034: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.2035: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.2036: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.2037: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.2038: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.2039: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.2040: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.2041: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.2042: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.2043: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.2044: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.2045: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.2046: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.2047: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.2048: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.2049: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.2050: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.2051: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.2052: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.2053: DFBPPR4339 ---- Plant proteins ---- Protein LHCP TRANSLOCATION DEFECT
Source.2054: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.2055: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.2056: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.2057: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.2058: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.2059: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.2060: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.2061: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.2062: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.2063: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.2064: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.2065: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.2066: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2067: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.2068: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.2069: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.2070: DFBPPR4376 ---- Plant proteins ---- Probable calcium-binding protein CML13
Source.2071: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.2072: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.2073: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.2074: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.2075: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.2076: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.2077: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.2078: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.2079: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.2080: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.2081: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.2082: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.2083: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.2084: DFBPPR4407 ---- Plant proteins ---- Mini zinc finger protein 4
Source.2085: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.2086: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.2087: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.2088: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.2089: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.2090: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.2091: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.2092: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.2093: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.2094: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.2095: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.2096: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.2097: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.2098: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.2099: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.2100: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.2101: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.2102: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.2103: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.2104: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.2105: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.2106: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.2107: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.2108: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.2109: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.2110: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.2111: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.2112: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.2113: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.2114: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.2115: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.2116: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.2117: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.2118: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.2119: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.2120: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.2121: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2122: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.2123: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.2124: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.2125: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.2126: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.2127: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.2128: DFBPPR4509 ---- Plant proteins ---- Putative glycine-rich cell wall structural protein 1
Source.2129: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.2130: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.2131: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.2132: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.2133: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.2134: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.2135: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.2136: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.2137: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.2138: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.2139: DFBPPR4530 ---- Plant proteins ---- Water stress-inducible protein Rab21
Source.2140: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.2141: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2
Source.2142: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.2143: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.2144: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.2145: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.2146: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.2147: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.2148: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.2149: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.2150: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.2151: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.2152: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.2153: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.2154: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.2155: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.2156: DFBPPR4562 ---- Plant proteins ---- Mini zinc finger protein 2
Source.2157: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.2158: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.2159: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.2160: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.2161: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.2162: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.2163: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.2164: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.2165: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.2166: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.2167: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.2168: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.2169: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.2170: DFBPPR4599 ---- Plant proteins ---- 60S ribosomal protein L37a-1
Source.2171: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.2172: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.2173: DFBPPR4607 ---- Plant proteins ---- Protein LOL2
Source.2174: DFBPPR4608 ---- Plant proteins ---- Metallothionein-like protein 3A
Source.2175: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.2176: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.2177: DFBPPR4612 ---- Plant proteins ---- 60S ribosomal protein L37a-2
Source.2178: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.2179: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.2180: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.2181: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.2182: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.2183: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19
Source.2184: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.2185: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.2186: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.2187: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2
Source.2188: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.2189: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.2190: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.2191: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.2192: DFBPPR4659 ---- Plant proteins ---- Metallothionein-like protein 3B
Source.2193: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.2194: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1
Source.2195: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.2196: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.2197: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.2198: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.2199: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.2200: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.2201: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial
Source.2202: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.2203: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D
Source.2204: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.2205: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.2206: DFBPPR4701 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 15
Source.2207: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.2208: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.2209: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.2210: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.2211: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.2212: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.2213: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.2214: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.2215: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.2216: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.2217: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400
Source.2218: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.2219: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.2220: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.2221: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.2222: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.2223: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.2224: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.2225: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.2226: DFBPPR4752 ---- Plant proteins ---- Uncharacterized protein ycf70
Source.2227: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.2228: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8
Source.2229: DFBPPR4759 ---- Plant proteins ---- 60S ribosomal protein L18a
Source.2230: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.2231: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.2232: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.2233: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.2234: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.2235: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.2236: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.2237: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.2238: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.2239: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.2240: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2241: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300
Source.2242: DFBPPR4793 ---- Plant proteins ---- B3 domain-containing protein LOC_Os02g10420
Source.2243: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.2244: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2
Source.2245: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.2246: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34
Source.2247: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.2248: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.2249: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.2250: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.2251: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.2252: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.2253: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.2254: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.2255: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000
Source.2256: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.2257: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.2258: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.2259: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.2260: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.2261: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.2262: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.2263: DFBPPR4838 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 4
Source.2264: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400
Source.2265: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.2266: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.2267: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.2268: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2269: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.2270: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.2271: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.2272: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.2273: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.2274: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.2275: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.2276: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.2277: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.2278: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.2279: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.2280: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.2281: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.2282: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.2283: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.2284: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.2285: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.2286: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.2287: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.2288: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.2289: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.2290: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.2291: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.2292: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.2293: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.2294: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.2295: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.2296: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.2297: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.2298: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.2299: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.2300: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2301: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.2302: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.2303: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.2304: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1
Source.2305: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.2306: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.2307: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.2308: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2309: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.2310: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.2311: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.2312: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.2313: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.2314: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.2315: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2316: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.2317: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.2318: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.2319: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.2320: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.2321: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2322: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.2323: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.2324: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2325: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.2326: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.2327: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.2328: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1
Source.2329: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.2330: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.2331: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.2332: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.2333: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2334: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2335: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.2336: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2337: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2338: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.2339: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.2340: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.2341: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.2342: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.2343: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2344: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2345: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.2346: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.2347: DFBPPR5031 ---- Plant proteins ---- Histone H4
Source.2348: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.2349: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.2350: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2351: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.2352: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2353: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.2354: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.2355: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.2356: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.2357: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2358: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.2359: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.2360: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.2361: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.2362: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.2363: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2364: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2365: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2366: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.2367: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.2368: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2369: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.2370: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.2371: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.2372: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.2373: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.2374: DFBPPR5079 ---- Plant proteins ---- Albumin-1
Source.2375: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.2376: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.2377: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.2378: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2379: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2380: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3
Source.2381: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2382: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.2383: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1
Source.2384: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2385: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.2386: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.2387: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A
Source.2388: DFBPPR5114 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.2389: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2390: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.2391: DFBPPR5121 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.2392: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2393: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.2394: DFBPPR5134 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2395: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.2396: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2397: DFBPPR5145 ---- Plant proteins ---- 22.0 kDa class IV heat shock protein
Source.2398: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.2399: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2400: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2401: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2402: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.2403: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.2404: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2405: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2
Source.2406: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2407: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2408: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2409: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.2410: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.2411: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2412: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2413: DFBPPR5178 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.2414: DFBPPR5179 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2415: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.2416: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.2417: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.2418: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.2419: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A
Source.2420: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2421: DFBPPR5193 ---- Plant proteins ---- HMG-Y-related protein B
Source.2422: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.2423: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.2424: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.2425: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2426: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.2427: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.2428: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.2429: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.2430: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.2431: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.2432: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.2433: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2434: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.2435: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.2436: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.2437: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.2438: DFBPPR5222 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.2439: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.2440: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.2441: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.2442: DFBPPR5226 ---- Plant proteins ---- Chalcone--flavonone isomerase 1
Source.2443: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2444: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2445: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.2446: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.2447: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2448: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2449: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic
Source.2450: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.2451: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.2452: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.2453: DFBPPR5249 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2454: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.2455: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic
Source.2456: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2457: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.2458: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.2459: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.2460: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.2461: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.2462: DFBPPR5274 ---- Plant proteins ---- Early nodulin-75
Source.2463: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.2464: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.2465: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.2466: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.2467: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6
Source.2468: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.2469: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.2470: DFBPPR5287 ---- Plant proteins ---- Nodulin-24
Source.2471: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2472: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2473: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.2474: DFBPPR5296 ---- Plant proteins ---- 18 kDa seed maturation protein
Source.2475: DFBPPR5300 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.2476: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.2477: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.2478: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.2479: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.2480: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.2481: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2482: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.2483: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.2484: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.2485: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.2486: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.2487: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3
Source.2488: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase
Source.2489: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1
Source.2490: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein
Source.2491: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.2492: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.2493: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.2494: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.2495: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.2496: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.2497: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.2498: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.2499: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.2500: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.2501: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2502: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.2503: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.2504: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.2505: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2506: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.2507: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.2508: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.2509: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.2510: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2511: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2512: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.2513: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.2514: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.2515: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.2516: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.2517: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.2518: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.2519: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.2520: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.2521: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.2522: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.2523: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.2524: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.2525: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.2526: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.2527: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.2528: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.2529: DFBPPR5449 ---- Plant proteins ---- Histone H4
Source.2530: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1
Source.2531: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha
Source.2532: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.2533: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.2534: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.2535: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2536: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.2537: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.2538: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.2539: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2540: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.2541: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.2542: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.2543: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2544: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.2545: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.2546: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.2547: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.2548: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2549: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.2550: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.2551: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.2552: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.2553: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.2554: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.2555: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.2556: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.2557: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.2558: DFBPPR5499 ---- Plant proteins ---- Dehydrin DHN1
Source.2559: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2560: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.2561: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.2562: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.2563: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.2564: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.2565: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2566: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.2567: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.2568: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2569: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.2570: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.2571: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.2572: DFBPPR5520 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.2573: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.2574: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.2575: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.2576: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.2577: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II
Source.2578: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2579: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2580: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.2581: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.2582: DFBPPR5535 ---- Plant proteins ---- Histone H4.3
Source.2583: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2584: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.2585: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.2586: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.2587: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.2588: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.2589: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.2590: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.2591: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.2592: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.2593: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.2594: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.2595: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.2596: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.2597: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2598: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.2599: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.2600: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.2601: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.2602: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.2603: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2604: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.2605: DFBPPR5587 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic
Source.2606: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.2607: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.2608: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.2609: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.2610: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.2611: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.2612: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.2613: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.2614: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.2615: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.2616: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.2617: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.2618: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.2619: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.2620: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2621: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.2622: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.2623: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.2624: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.2625: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.2626: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2627: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2628: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.2629: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.2630: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.2631: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.2632: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2633: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.2634: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3
Source.2635: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.2636: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.2637: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.2638: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1
Source.2639: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.2640: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.2641: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.2642: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.2643: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.2644: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2645: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2646: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.2647: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.2648: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2649: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.2650: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.2651: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.2652: DFBPPR5681 ---- Plant proteins ---- Single myb histone 4
Source.2653: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.2654: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.2655: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.2656: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.2657: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.2658: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2659: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.2660: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.2661: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.2662: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.2663: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2664: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2665: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.2666: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.2667: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.2668: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.2669: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.2670: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.2671: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.2672: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2673: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2674: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.2675: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.2676: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.2677: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.2678: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.2679: DFBPPR5722 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.2680: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3
Source.2681: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.2682: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.2683: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2684: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.2685: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.2686: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.2687: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.2688: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2689: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.2690: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.2691: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2692: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.2693: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2694: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.2695: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.2696: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.2697: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.2698: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2699: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.2700: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.2701: DFBPPR5751 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein 2-B
Source.2702: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2703: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.2704: DFBPPR5755 ---- Plant proteins ---- Protein Iojap, chloroplastic
Source.2705: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.2706: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2707: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.2708: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.2709: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.2710: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.2711: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2712: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2713: DFBPPR5772 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1
Source.2714: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.2715: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.2716: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.2717: DFBPPR5777 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.2718: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.2719: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.2720: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.2721: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2722: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.2723: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.2724: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase
Source.2725: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.2726: DFBPPR5794 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2
Source.2727: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1
Source.2728: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2729: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.2730: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.2731: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.2732: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2733: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.2734: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2735: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.2736: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.2737: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.2738: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.2739: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.2740: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.2741: DFBPPR5837 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.2742: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.2743: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.2744: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.2745: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.2746: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.2747: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.2748: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.2749: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.2750: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2751: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.2752: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.2753: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.2754: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.2755: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.2756: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2757: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.2758: DFBPPR5863 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2-C
Source.2759: DFBPPR5865 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.2760: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.2761: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.2762: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.2763: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.2764: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.2765: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2766: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2767: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.2768: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.2769: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.2770: DFBPPR5884 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.2771: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.2772: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.2773: DFBPPR5892 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.2774: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B
Source.2775: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2776: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.2777: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A
Source.2778: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.2779: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.2780: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.2781: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.2782: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3
Source.2783: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.2784: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.2785: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.2786: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.2787: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.2788: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.2789: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.2790: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.2791: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.2792: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein
Source.2793: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.2794: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2795: DFBPPR5931 ---- Plant proteins ---- Glycine-rich RNA-binding, abscisic acid-inducible protein
Source.2796: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.2797: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS
Source.2798: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.2799: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.2800: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.2801: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.2802: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.2803: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.2804: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.2805: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.2806: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2807: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.2808: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.2809: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.2810: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.2811: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein
Source.2812: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2813: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.2814: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2815: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.2816: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.2817: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.2818: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.2819: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.2820: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.2821: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.2822: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.2823: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2824: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2825: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2826: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.2827: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.2828: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.2829: DFBPPR6021 ---- Plant proteins ---- Actin-depolymerizing factor 2
Source.2830: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2831: DFBPPR6026 ---- Plant proteins ---- Actin-depolymerizing factor 1
Source.2832: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2833: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.2834: DFBPPR6038 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.2835: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.2836: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.2837: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1
Source.2838: DFBPPR6049 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 2
Source.2839: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.2840: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.2841: DFBPPR6070 ---- Plant proteins ---- 40S ribosomal protein S8
Source.2842: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2843: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.2844: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.2845: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.2846: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.2847: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.2848: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5
Source.2849: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.2850: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2851: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.2852: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.2853: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.2854: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.2855: DFBPPR6135 ---- Plant proteins ---- Defensin-like protein 1
Source.2856: DFBPPR6136 ---- Plant proteins ---- Cell number regulator 11
Source.2857: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.2858: DFBPPR6151 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.2859: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.2860: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.2861: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.2862: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.2863: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A
Source.2864: DFBPPR6187 ---- Plant proteins ---- Transposable element activator uncharacterized 12 kDa protein
Source.2865: DFBPPR6189 ---- Plant proteins ---- Unknown protein from spot 406 of 2D-PAGE of etiolated coleoptile
Source.2866: DFBPPR6204 ---- Plant proteins ---- Unknown protein from spot 258 of 2D-PAGE of etiolated coleoptile
Source.2867: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.2868: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.2869: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2870: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.2871: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.2872: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.2873: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.2874: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.2875: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2876: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.2877: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.2878: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.2879: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.2880: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.2881: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.2882: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.2883: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2884: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.2885: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.2886: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.2887: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2888: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.2889: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.2890: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2891: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.2892: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.2893: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.2894: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.2895: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.2896: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.2897: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.2898: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.2899: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.2900: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2901: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2902: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.2903: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.2904: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2905: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2906: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.2907: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2908: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2909: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2
Source.2910: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.2911: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta
Source.2912: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.2913: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.2914: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.2915: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.2916: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.2917: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.2918: DFBPPR6303 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.2919: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2920: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.2921: DFBPPR6308 ---- Plant proteins ---- Histone H4
Source.2922: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.2923: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.2924: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.2925: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.2926: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2927: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.2928: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2929: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2930: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.2931: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.2932: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F
Source.2933: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2934: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.2935: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2936: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.2937: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.2938: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.2939: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1
Source.2940: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.2941: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.2942: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2943: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.2944: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.2945: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.2946: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.2947: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.2948: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.2949: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.2950: DFBPPR6351 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.2951: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.2952: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.2953: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2954: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic
Source.2955: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2956: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.2957: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2958: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2959: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.2960: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2961: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2962: DFBPPR6372 ---- Plant proteins ---- Early nodulin-12A
Source.2963: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D
Source.2964: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.2965: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2966: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.2967: DFBPPR6384 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.2968: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2969: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.2970: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.2971: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.2972: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.2973: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2
Source.2974: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.2975: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2976: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.2977: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.2978: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.2979: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.2980: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.2981: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2982: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2983: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.2984: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.2985: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.2986: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.2987: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2988: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2989: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1
Source.2990: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.2991: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2992: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B
Source.2993: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A
Source.2994: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.2995: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.2996: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.2997: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.2998: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.2999: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.3000: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.3001: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.3002: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.3003: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.3004: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3005: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3006: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.3007: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.3008: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.3009: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.3010: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.3011: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.3012: DFBPPR6476 ---- Plant proteins ---- Endochitinase B
Source.3013: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.3014: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.3015: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.3016: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.3017: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.3018: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.3019: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E
Source.3020: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.3021: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.3022: DFBPPR6499 ---- Plant proteins ---- Provicilin
Source.3023: DFBPPR6501 ---- Plant proteins ---- Photosystem I reaction center subunit VI
Source.3024: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.3025: DFBPPR6511 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.3026: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic
Source.3027: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.3028: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.3029: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.3030: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.3031: DFBPPR6529 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.3032: DFBPPR6532 ---- Plant proteins ---- 22.7 kDa class IV heat shock protein
Source.3033: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.3034: DFBPPR6541 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3035: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.3036: DFBPPR6548 ---- Plant proteins ---- Dehydrin DHN1
Source.3037: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.3038: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.3039: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.3040: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3041: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3042: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.3043: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27
Source.3044: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.3045: DFBPPR6562 ---- Plant proteins ---- Dormancy-associated protein 2
Source.3046: DFBPPR6574 ---- Plant proteins ---- Probable 60S ribosomal protein L14
Source.3047: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4
Source.3048: DFBPPR6584 ---- Plant proteins ---- Organ-specific protein S2
Source.3049: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34
Source.3050: DFBPPR6587 ---- Plant proteins ---- Unknown protein from spot 103 of 2D-PAGE of thylakoid
Source.3051: DFBPPR6620 ---- Plant proteins ---- Dehydrin DHN2
Source.3052: DFBPPR6621 ---- Plant proteins ---- Dehydrin DHN3
Source.3053: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28
Source.3054: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3055: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.3056: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.3057: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.3058: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.3059: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.3060: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3061: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.3062: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1
Source.3063: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.3064: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3065: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3066: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.3067: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.3068: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.3069: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.3070: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.3071: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3072: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.3073: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1
Source.3074: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2
Source.3075: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3076: DFBPPR6661 ---- Plant proteins ---- Agglutinin isolectin 3
Source.3077: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.3078: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.3079: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.3080: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.3081: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.3082: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.3083: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3084: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.3085: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.3086: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.3087: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.3088: DFBPPR6688 ---- Plant proteins ---- Histone H4 variant TH011
Source.3089: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.3090: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.3091: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.3092: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3093: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G
Source.3094: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.3095: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.3096: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.3097: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2
Source.3098: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1
Source.3099: DFBPPR6708 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.3100: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.3101: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3102: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.3103: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.3104: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3105: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.3106: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.3107: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.3108: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.3109: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3110: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.3111: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.3112: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.3113: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3114: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.3115: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3116: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3117: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.3118: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.3119: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.3120: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.3121: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.3122: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.3123: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.3124: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.3125: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.3126: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.3127: DFBPPR6771 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.3128: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3129: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3130: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.3131: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.3132: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3133: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.3134: DFBPPR6784 ---- Plant proteins ---- Histone H4 variant TH091
Source.3135: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3136: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3137: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.3138: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.3139: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.3140: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.3141: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3142: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3143: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3144: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3145: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.3146: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.3147: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3148: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.3149: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3150: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.3151: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.3152: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.3153: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.3154: DFBPPR6828 ---- Plant proteins ---- Non-specific lipid-transfer protein 2P
Source.3155: DFBPPR6829 ---- Plant proteins ---- Cold-shock protein CS120
Source.3156: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3157: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3158: DFBPPR6832 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.3159: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.3160: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic
Source.3161: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.3162: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3163: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.3164: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3165: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3166: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.3167: DFBPPR6848 ---- Plant proteins ---- Cold shock protein CS66
Source.3168: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3169: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.3170: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3171: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.3172: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.3173: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3174: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3175: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.3176: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A
Source.3177: DFBPPR6866 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.3178: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3179: DFBPPR6869 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.3180: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3181: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.3182: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3183: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.3184: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.3185: DFBPPR6897 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.3186: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3187: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.3188: DFBPPR6923 ---- Plant proteins ---- Avenin-like a1
Source.3189: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.3190: DFBPPR6928 ---- Plant proteins ---- Avenin-like a5
Source.3191: DFBPPR6933 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.3192: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3193: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.3194: DFBPPR6955 ---- Plant proteins ---- Protein WIR1A
Source.3195: DFBPPR6957 ---- Plant proteins ---- Protein WIR1B
Source.3196: DFBPPR6961 ---- Plant proteins ---- Avenin-like a2
Source.3197: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.3198: DFBPPR6964 ---- Plant proteins ---- Avenin-like a3
Source.3199: DFBPPR6970 ---- Plant proteins ---- 40S ribosomal protein S29
Source.3200: DFBPPR6971 ---- Plant proteins ---- Avenin-like a7
Source.3201: DFBPPR6973 ---- Plant proteins ---- Avenin-like a6
Source.3202: DFBPPR6978 ---- Plant proteins ---- Cyclic phosphodiesterase
Source.3203: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4
Source.3204: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.3205: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.3206: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.3207: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3208: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3209: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.3210: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.3211: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3212: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.3213: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3214: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.3215: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.3216: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.3217: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.3218: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.3219: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe
Source.3220: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.3221: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.3222: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3223: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.3224: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.3225: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.3226: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.3227: DFBPPR7047 ---- Plant proteins ---- Hordoindoline-A
Source.3228: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3229: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.3230: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3231: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.3232: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3233: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.3234: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3235: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801
Source.3236: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.3237: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3238: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3239: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.3240: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.3241: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.3242: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.3243: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3244: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3245: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.3246: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2
Source.3247: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.3248: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3249: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3250: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3251: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3252: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3253: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3254: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.3255: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.3256: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3257: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.3258: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.3259: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.3260: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.3261: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.3262: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3263: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.3264: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3265: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3266: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.3267: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3268: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.3269: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3270: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.3271: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.3272: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.3273: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.3274: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.3275: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.3276: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.3277: DFBPPR7134 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.3278: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.3279: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.3280: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.3281: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.3282: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.3283: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.3284: DFBPPR7152 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.3285: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.3286: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.3287: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.3288: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein
Source.3289: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.3290: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2
Source.3291: DFBPPR7167 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.3292: DFBPPR7168 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4
Source.3293: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.3294: DFBPPR7172 ---- Plant proteins ---- Barwin
Source.3295: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.3296: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.3297: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3298: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.3299: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.3300: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.3301: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3302: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.3303: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3304: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3305: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3306: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.3307: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.3308: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.3309: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3
Source.3310: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.3311: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.3312: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.3313: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.3314: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3315: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3316: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.3317: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.3318: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3319: DFBPPR7217 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.3320: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.3321: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3322: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3323: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.3324: DFBPPR7232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.3325: DFBPPR7236 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.3326: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.3327: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.3328: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.3329: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.3330: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3331: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.3332: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.3333: DFBPPR7250 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.3334: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.3335: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.3336: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic
Source.3337: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.3338: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3339: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3
Source.3340: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4
Source.3341: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.3342: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.3343: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.3344: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3345: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein
Source.3346: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.3347: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3348: DFBPPR7317 ---- Plant proteins ---- Horcolin
Source.3349: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1
Source.3350: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2
Source.3351: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2
Source.3352: DFBPPR7340 ---- Plant proteins ---- 40S ribosomal protein S12
Source.3353: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2
Source.3354: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.3355: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.3356: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.3357: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.3358: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.3359: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.3360: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.3361: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.3362: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.3363: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.3364: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.3365: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.3366: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.3367: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.3368: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase
Source.3369: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.3370: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.3371: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.3372: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.3373: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.3374: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.3375: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3376: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3377: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4
Source.3378: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.3379: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.3380: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.3381: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.3382: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.3383: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.3384: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.3385: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.3386: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase
Source.3387: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.3388: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2
Source.3389: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.3390: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.3391: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3392: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.3393: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3394: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.3395: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25
Source.3396: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.3397: DFBPPR7481 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.3398: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.3399: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.3400: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II
Source.3401: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.3402: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.3403: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.3404: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.3405: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.3406: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.3407: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.3408: DFBPPR7504 ---- Plant proteins ---- 10 kDa chaperonin
Source.3409: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.3410: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3411: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.3412: DFBPPR7517 ---- Plant proteins ---- Uncharacterized mitochondrial protein ORF138
Source.3413: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15
Source.3414: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.3415: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.3416: DFBPPR7530 ---- Plant proteins ---- Glycine-rich RNA-binding protein 10
Source.3417: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.3418: DFBPPR7534 ---- Plant proteins ---- Acyl-CoA-binding protein
Source.3419: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.3420: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.3421: DFBPPR7550 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.3422: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.3423: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.3424: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.3425: DFBPPR7597 ---- Milk proteins ---- Alpha-lactalbumin
Source.3426: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.3427: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.3428: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.3429: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.3430: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.3431: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.3432: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.3433: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.3434: DFBPPR7609 ---- Milk proteins ---- Lysozyme C
Source.3435: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.3436: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.3437: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.3438: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.3439: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.3440: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.3441: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.3442: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.3443: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.3444: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.3445: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.3446: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain
Source.3447: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.3448: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.3449: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.3450: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.3451: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.3452: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.3453: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.3454: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.3455: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.3456: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.3457: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.3458: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.3459: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.3460: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.3461: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.3462: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.3463: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.3464: DFBPPR7660 ---- Milk proteins ---- Alpha-lactalbumin
Source.3465: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.3466: DFBPPR7663 ---- Milk proteins ---- Kappa-casein
Source.3467: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.3468: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.3469: DFBPPR7670 ---- Milk proteins ---- Alpha-lactalbumin B/C
Source.3470: DFBPPR7671 ---- Milk proteins ---- Alpha-lactalbumin A
Source.3471: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin
Source.3472: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.3473: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.3474: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin
Source.3475: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.3476: DFBPPR7691 ---- Milk proteins ---- Albumin
Source.3477: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.3478: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.3479: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin
Source.3480: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.3481: DFBPPR7702 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.3482: DFBPPR7703 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.3483: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin
Source.3484: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.3485: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.3486: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.3487: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.3488: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.3489: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.3490: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.3491: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.3492: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3493: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.3494: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3495: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.3496: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.3497: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.3498: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.3499: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.3500: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.3501: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.3502: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3503: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.3504: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.3505: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.3506: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.3507: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3508: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain
Source.3509: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.3510: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3511: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.3512: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3513: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.3514: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.3515: DFBPPR8381 ---- Plant proteins ---- Conglutin-7
Source.3516: DFBPPR8384 ---- Plant proteins ---- Defensin 2
Source.3517: DFBPPR8386 ---- Plant proteins ---- Defensin 3
Source.3518: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101
Source.3519: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.3520: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.3521: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.3522: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.3523: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101
Source.3524: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102
Source.3525: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.3526: DFBPPR8406 ---- Plant proteins ---- Endochitinase 4
Source.3527: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.3528: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3
Source.3529: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.3530: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.3531: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.3532: DFBPPR8425 ---- Plant proteins ---- Oleosin L
Source.3533: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1
Source.3534: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3535: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.3536: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.3537: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.3538: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.3539: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.3540: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.3541: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C
Source.3542: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.3543: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.3544: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.3545: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3546: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.3547: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3548: DFBPPR8461 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.3549: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3550: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3551: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.3552: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.3553: DFBPPR8475 ---- Plant proteins ---- Photosystem II reaction center protein J
Source.3554: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.3555: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin
Source.3556: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.3557: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.3558: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.3559: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1
Source.3560: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.3561: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.3562: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.3563: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.3564: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.3565: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.3566: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.3567: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.3568: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.3569: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.3570: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.3571: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.3572: DFBPPR8512 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.3573: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3574: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.3575: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.3576: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.3577: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.3578: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.3579: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.3580: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.3581: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.3582: DFBPPR15938 ---- Animal proteins ---- Apolipoprotein A-II
Source.3583: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.3584: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.3585: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.3586: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.3587: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3588: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.3589: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3590: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.3591: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.3592: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.3593: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.3594: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.3595: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3596: DFBPPR15956 ---- Animal proteins ---- Phospholipase A2
Source.3597: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3598: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3599: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.3600: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.3601: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.3602: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.3603: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.3604: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3605: DFBPPR15969 ---- Animal proteins ---- Natriuretic peptides A
Source.3606: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.3607: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.3608: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.3609: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.3610: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.3611: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.3612: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.3613: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.3614: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.3615: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.3616: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.3617: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.3618: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.3619: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.3620: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.3621: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3622: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.3623: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3624: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3625: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.3626: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.3627: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3628: DFBPPR16013 ---- Animal proteins ---- Osteocalcin
Source.3629: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.3630: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3631: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.3632: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3633: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.3634: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.3635: DFBPPR16024 ---- Animal proteins ---- Podocalyxin
Source.3636: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.3637: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.3638: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3639: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3640: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.3641: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.3642: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.3643: DFBPPR16036 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.3644: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.3645: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.3646: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3647: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.3648: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.3649: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3650: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.3651: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.3652: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.3653: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.3654: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.3655: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.3656: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.3657: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3658: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.3659: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.3660: DFBPPR16073 ---- Animal proteins ---- Endothelin-1
Source.3661: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.3662: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.3663: DFBPPR16078 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.3664: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3665: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.3666: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.3667: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.3668: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.3669: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.3670: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.3671: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.3672: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.3673: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3674: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3
Source.3675: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3676: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.3677: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.3678: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3679: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3680: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.3681: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.3682: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.3683: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.3684: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.3685: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.3686: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.3687: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3688: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.3689: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.3690: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.3691: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.3692: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.3693: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3694: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.3695: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3696: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.3697: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101
Source.3698: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.3699: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.3700: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.3701: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.3702: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.3703: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.3704: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.3705: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3706: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.3707: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.3708: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.3709: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3710: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.3711: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.3712: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.3713: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.3714: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.3715: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.3716: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.3717: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.3718: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.3719: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.3720: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.3721: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.3722: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.3723: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.3724: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.3725: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.3726: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.3727: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.3728: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.3729: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3730: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.3731: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.3732: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3733: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3734: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3735: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I
Source.3736: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.3737: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.3738: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.3739: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3740: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.3741: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.3742: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.3743: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.3744: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.3745: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.3746: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.3747: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.3748: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.3749: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.3750: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.3751: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.3752: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3753: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.3754: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.3755: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.3756: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3757: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.3758: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.3759: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.3760: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3761: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.3762: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3763: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.3764: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.3765: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3766: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.3767: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone
Source.3768: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3769: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.3770: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3771: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.3772: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.3773: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3774: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.3775: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.3776: DFBPPR16285 ---- Animal proteins ---- Chymase
Source.3777: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.3778: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3779: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.3780: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.3781: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.3782: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3783: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3784: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3785: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.3786: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.3787: DFBPPR16305 ---- Animal proteins ---- Phosducin
Source.3788: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.3789: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3790: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.3791: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.3792: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.3793: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.3794: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.3795: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.3796: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.3797: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.3798: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.3799: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.3800: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.3801: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3802: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.3803: DFBPPR16336 ---- Animal proteins ---- Colipase
Source.3804: DFBPPR16338 ---- Animal proteins ---- Endothelin-2
Source.3805: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.3806: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.3807: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.3808: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3809: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.3810: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.3811: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.3812: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.3813: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3814: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.3815: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.3816: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.3817: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.3818: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.3819: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.3820: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin
Source.3821: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin
Source.3822: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.3823: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.3824: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.3825: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.3826: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.3827: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.3828: DFBPPR16469 ---- Animal proteins ---- Lysozyme C, milk isozyme
Source.3829: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.3830: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.3831: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.3832: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.3833: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.3834: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.3835: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.3836: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.3837: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3838: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.3839: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.3840: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.3841: DFBPPR16517 ---- Animal proteins ---- Cholinesterase
Source.3842: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.3843: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.3844: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.3845: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3846: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.3847: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.3848: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.3849: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.3850: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.3851: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.3852: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3853: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.3854: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.3855: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.3856: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3857: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3858: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.3859: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.3860: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.3861: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.3862: DFBPPR16565 ---- Animal proteins ---- Islet amyloid polypeptide
Source.3863: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3864: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan
Source.3865: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3866: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.3867: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3868: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.3869: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.3870: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.3871: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c
Source.3872: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.3873: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.3874: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.3875: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.3876: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9
Source.3877: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B
Source.3878: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.3879: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.3880: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.3881: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.3882: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3883: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.3884: DFBPPR16623 ---- Animal proteins ---- Lysozyme C, spleen isozyme
Source.3885: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3886: DFBPPR16627 ---- Animal proteins ---- 60S ribosomal protein L15
Source.3887: DFBPPR16628 ---- Animal proteins ---- Neuroglobin
Source.3888: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.3889: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3890: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.3891: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.3892: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.3893: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3894: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3895: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.3896: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.3897: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.3898: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.3899: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.3900: DFBPPR16673 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.3901: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.3902: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.3903: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.3904: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.3905: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.3906: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3907: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.3908: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.3909: DFBPPR16718 ---- Animal proteins ---- Zinc finger protein 331
Source.3910: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.3911: DFBPPR16727 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10
Source.3912: DFBPPR16731 ---- Animal proteins ---- Beta-defensin 110
Source.3913: DFBPPR16732 ---- Animal proteins ---- HORMA domain-containing protein 2
Source.3914: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.3915: DFBPPR16740 ---- Animal proteins ---- 60S ribosomal protein L36a
Source.3916: DFBPPR16743 ---- Animal proteins ---- 60S ribosomal protein L32
Source.3917: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3918: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.3919: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3920: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3921: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.3922: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.3923: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.3924: DFBPPR16770 ---- Animal proteins ---- Lysozyme C
Source.3925: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.3926: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.3927: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.3928: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3929: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.3930: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.3931: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.3932: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.3933: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.3934: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.3935: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.3936: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3937: DFBPPR16804 ---- Animal proteins ---- Pancreatic trypsin inhibitor
Source.3938: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3939: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.3940: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.3941: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.3942: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.3943: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3944: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.3945: DFBPPR16823 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.3946: DFBPPR16825 ---- Animal proteins ---- Myelin basic protein
Source.3947: DFBPPR16826 ---- Animal proteins ---- Phospholipase A2
Source.3948: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.3949: DFBPPR16829 ---- Animal proteins ---- Fibroblast growth factor 1
Source.3950: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.3951: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.3952: DFBPPR16837 ---- Animal proteins ---- Interferon gamma
Source.3953: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.3954: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3955: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3956: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3957: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.3958: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.3959: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.3960: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.3961: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.3962: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.3963: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial
Source.3964: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.3965: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.3966: DFBPPR16864 ---- Animal proteins ---- Protein AMBP
Source.3967: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3968: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I
Source.3969: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.3970: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.3971: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.3972: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.3973: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.3974: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.3975: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.3976: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3977: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3978: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3979: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.3980: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.3981: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.3982: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3983: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.3984: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.3985: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.3986: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.3987: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.3988: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3989: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3990: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.3991: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.3992: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3993: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.3994: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3995: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.3996: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.3997: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.3998: DFBPPR16928 ---- Animal proteins ---- Endothelin-1
Source.3999: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.4000: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A
Source.4001: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.4002: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.4003: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.4004: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.4005: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.4006: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.4007: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2
Source.4008: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.4009: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4010: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.4011: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.4012: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.4013: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.4014: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.4015: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4016: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.4017: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.4018: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.4019: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.4020: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.4021: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.4022: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.4023: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.4024: DFBPPR16974 ---- Animal proteins ---- Natriuretic peptides A
Source.4025: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.4026: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4027: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4028: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.4029: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.4030: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.4031: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.4032: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.4033: DFBPPR16988 ---- Animal proteins ---- Protachykinin-1
Source.4034: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.4035: DFBPPR16991 ---- Animal proteins ---- Osteocalcin
Source.4036: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.4037: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.4038: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.4039: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4040: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.4041: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.4042: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.4043: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.4044: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.4045: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.4046: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.4047: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.4048: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.4049: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4050: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.4051: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.4052: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4053: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.4054: DFBPPR17031 ---- Animal proteins ---- Aurora kinase A
Source.4055: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.4056: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4057: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.4058: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.4059: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.4060: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.4061: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.4062: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.4063: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4064: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.4065: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.4066: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.4067: DFBPPR17055 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.4068: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.4069: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.4070: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4071: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4072: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.4073: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.4074: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.4075: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.4076: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.4077: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.4078: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.4079: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.4080: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4081: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.4082: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.4083: DFBPPR17076 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.4084: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4085: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.4086: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.4087: DFBPPR17082 ---- Animal proteins ---- Calbindin
Source.4088: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.4089: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.4090: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.4091: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.4092: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.4093: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.4094: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.4095: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.4096: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4097: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.4098: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.4099: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.4100: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.4101: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4102: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4103: DFBPPR17107 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma
Source.4104: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4105: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4106: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.4107: DFBPPR17115 ---- Animal proteins ---- CD44 antigen
Source.4108: DFBPPR17116 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.4109: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.4110: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.4111: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.4112: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.4113: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.4114: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.4115: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4116: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.4117: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4118: DFBPPR17132 ---- Animal proteins ---- Apolipoprotein A-II
Source.4119: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.4120: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.4121: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.4122: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.4123: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4124: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.4125: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.4126: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.4127: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.4128: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4129: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.4130: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.4131: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4132: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.4133: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.4134: DFBPPR17196 ---- Animal proteins ---- Histone H4
Source.4135: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.4136: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.4137: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4138: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4139: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.4140: DFBPPR17245 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.4141: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.4142: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.4143: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.4144: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.4145: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.4146: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.4147: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.4148: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.4149: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.4150: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.4151: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4152: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.4153: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.4154: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.4155: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.4156: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.4157: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.4158: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.4159: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.4160: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.4161: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.4162: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.4163: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.4164: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.4165: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.4166: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.4167: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.4168: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.4169: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.4170: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.4171: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.4172: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.4173: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.4174: DFBPPR17319 ---- Animal proteins ---- Integrin beta-1-binding protein 1
Source.4175: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.4176: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.4177: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.4178: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.4179: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.4180: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.4181: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.4182: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.4183: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.4184: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.4185: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.4186: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.4187: DFBPPR17343 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.4188: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.4189: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.4190: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.4191: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.4192: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.4193: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.4194: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.4195: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.4196: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.4197: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.4198: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.4199: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.4200: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.4201: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.4202: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.4203: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.4204: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.4205: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.4206: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.4207: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.4208: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.4209: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.4210: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.4211: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.4212: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.4213: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.4214: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.4215: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2
Source.4216: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.4217: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.4218: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.4219: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.4220: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.4221: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.4222: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.4223: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.4224: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.4225: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.4226: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.4227: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.4228: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.4229: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.4230: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.4231: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.4232: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.4233: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.4234: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.4235: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.4236: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.4237: DFBPPR17420 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.4238: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.4239: DFBPPR17423 ---- Animal proteins ---- Furin
Source.4240: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.4241: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.4242: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.4243: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.4244: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.4245: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.4246: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.4247: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.4248: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.4249: DFBPPR17441 ---- Animal proteins ---- DnaJ homolog subfamily C member 5
Source.4250: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.4251: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.4252: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.4253: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.4254: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4255: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.4256: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4257: DFBPPR17452 ---- Animal proteins ---- CD81 antigen
Source.4258: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.4259: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)]
Source.4260: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.4261: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.4262: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.4263: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.4264: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.4265: DFBPPR17468 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.4266: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.4267: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.4268: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.4269: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.4270: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.4271: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.4272: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.4273: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.4274: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.4275: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.4276: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.4277: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.4278: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.4279: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.4280: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase
Source.4281: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.4282: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.4283: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.4284: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4285: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.4286: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.4287: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.4288: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.4289: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.4290: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.4291: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.4292: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.4293: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.4294: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.4295: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.4296: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3
Source.4297: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.4298: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.4299: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.4300: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.4301: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.4302: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.4303: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.4304: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.4305: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.4306: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.4307: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.4308: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.4309: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.4310: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.4311: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.4312: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.4313: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.4314: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.4315: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.4316: DFBPPR17580 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5
Source.4317: DFBPPR17584 ---- Animal proteins ---- Cytochrome c oxidase subunit 7B, mitochondrial
Source.4318: DFBPPR17586 ---- Animal proteins ---- Dermatopontin
Source.4319: DFBPPR17588 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.4320: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.4321: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4322: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.4323: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.4324: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.4325: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.4326: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.4327: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.4328: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.4329: DFBPPR17617 ---- Animal proteins ---- Protein S100-A9
Source.4330: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.4331: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.4332: DFBPPR17629 ---- Animal proteins ---- Thiamine-triphosphatase
Source.4333: DFBPPR17630 ---- Animal proteins ---- Thiamine-triphosphatase
Source.4334: DFBPPR17633 ---- Animal proteins ---- Lysozyme C
Source.4335: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.4336: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.4337: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.4338: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.4339: DFBPPR17663 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 4, mitochondrial
Source.4340: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.4341: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.4342: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.4343: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.4344: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.4345: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.4346: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.4347: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.4348: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.4349: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.4350: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.4351: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.4352: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.4353: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.4354: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4355: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.4356: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.4357: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0
Source.4358: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.4359: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.4360: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.4361: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.4362: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein
Source.4363: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.4364: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.4365: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.4366: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.4367: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4368: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.4369: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.4370: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.4371: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.4372: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.4373: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3
Source.4374: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.4375: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.4376: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.4377: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.4378: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.4379: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.4380: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.4381: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.4382: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.4383: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.4384: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.4385: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.4386: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.4387: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.4388: DFBPPR17816 ---- Animal proteins ---- Lumican
Source.4389: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2
Source.4390: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.4391: DFBPPR17820 ---- Animal proteins ---- Osteomodulin
Source.4392: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.4393: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.4394: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.4395: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.4396: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4397: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.4398: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.4399: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.4400: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.4401: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.4402: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3
Source.4403: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.4404: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.4405: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.4406: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.4407: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4408: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.4409: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.4410: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.4411: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.4412: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.4413: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.4414: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.4415: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.4416: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.4417: DFBPPR17856 ---- Animal proteins ---- Selenoprotein S
Source.4418: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.4419: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase
Source.4420: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.4421: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.4422: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.4423: DFBPPR17865 ---- Animal proteins ---- Protein phosphatase 1A
Source.4424: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.4425: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase
Source.4426: DFBPPR17868 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma
Source.4427: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.4428: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.4429: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.4430: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.4431: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.4432: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.4433: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.4434: DFBPPR17885 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 6
Source.4435: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.4436: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.4437: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.4438: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.4439: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9
Source.4440: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.4441: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.4442: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.4443: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.4444: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4445: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.4446: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.4447: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.4448: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.4449: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein
Source.4450: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.4451: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.4452: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial
Source.4453: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.4454: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.4455: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126
Source.4456: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.4457: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.4458: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.4459: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.4460: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.4461: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P
Source.4462: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.4463: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.4464: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.4465: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.4466: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.4467: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.4468: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.4469: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.4470: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.4471: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.4472: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.4473: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.4474: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9
Source.4475: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.4476: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.4477: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.4478: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.4479: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.4480: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.4481: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.4482: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.4483: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.4484: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.4485: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.4486: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.4487: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.4488: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.4489: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.4490: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.4491: DFBPPR17974 ---- Animal proteins ---- Mimecan
Source.4492: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.4493: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.4494: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.4495: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.4496: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.4497: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.4498: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.4499: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.4500: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.4501: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.4502: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.4503: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.4504: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.4505: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.4506: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.4507: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.4508: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.4509: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.4510: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.4511: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.4512: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.4513: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.4514: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.4515: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.4516: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.4517: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.4518: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.4519: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.4520: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.4521: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4522: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.4523: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain
Source.4524: DFBPPR18031 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 2
Source.4525: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2
Source.4526: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.4527: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.4528: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4529: DFBPPR18045 ---- Animal proteins ---- Nuclear cap-binding protein subunit 2
Source.4530: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.4531: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.4532: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4533: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.4534: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.4535: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.4536: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.4537: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.4538: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4539: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.4540: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.4541: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.4542: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4543: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.4544: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.4545: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.4546: DFBPPR18091 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.4547: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4548: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.4549: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.4550: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.4551: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.4552: DFBPPR18107 ---- Animal proteins ---- Lymphocyte antigen 96
Source.4553: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.4554: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.4555: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.4556: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.4557: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.4558: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.4559: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.4560: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.4561: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1
Source.4562: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.4563: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.4564: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.4565: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.4566: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.4567: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.4568: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.4569: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.4570: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.4571: DFBPPR18143 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 7
Source.4572: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.4573: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.4574: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.4575: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.4576: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.4577: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.4578: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.4579: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.4580: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.4581: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.4582: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P
Source.4583: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.4584: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B
Source.4585: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.4586: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.4587: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.4588: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.4589: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.4590: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.4591: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.4592: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.4593: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.4594: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.4595: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4596: DFBPPR18211 ---- Animal proteins ---- Phosducin
Source.4597: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta
Source.4598: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.4599: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.4600: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.4601: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.4602: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4603: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.4604: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B
Source.4605: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.4606: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.4607: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.4608: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.4609: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.4610: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.4611: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.4612: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.4613: DFBPPR18247 ---- Animal proteins ---- Interferon regulatory factor 1
Source.4614: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.4615: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.4616: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.4617: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41
Source.4618: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.4619: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.4620: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta
Source.4621: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.4622: DFBPPR18271 ---- Animal proteins ---- Lysozyme C-2
Source.4623: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.4624: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.4625: DFBPPR18274 ---- Animal proteins ---- Histone deacetylase 8
Source.4626: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.4627: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.4628: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.4629: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4630: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.4631: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.4632: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.4633: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.4634: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.4635: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.4636: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11
Source.4637: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.4638: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.4639: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.4640: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.4641: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.4642: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.4643: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.4644: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.4645: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.4646: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.4647: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.4648: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.4649: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial
Source.4650: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.4651: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.4652: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.4653: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.4654: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.4655: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.4656: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.4657: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.4658: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.4659: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4660: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.4661: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.4662: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.4663: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.4664: DFBPPR18358 ---- Animal proteins ---- Lymphatic vessel endothelial hyaluronic acid receptor 1
Source.4665: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.4666: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4667: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.4668: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.4669: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.4670: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.4671: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.4672: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.4673: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.4674: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.4675: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.4676: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.4677: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.4678: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4679: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4680: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.4681: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.4682: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.4683: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.4684: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.4685: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.4686: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.4687: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.4688: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.4689: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.4690: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.4691: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.4692: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.4693: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.4694: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.4695: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.4696: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.4697: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.4698: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.4699: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.4700: DFBPPR18434 ---- Animal proteins ---- Interferon beta-3
Source.4701: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.4702: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.4703: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.4704: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4705: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.4706: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.4707: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.4708: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.4709: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.4710: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.4711: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.4712: DFBPPR18460 ---- Animal proteins ---- ATP synthase-coupling factor 6, mitochondrial
Source.4713: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.4714: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.4715: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.4716: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.4717: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.4718: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.4719: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.4720: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.4721: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.4722: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.4723: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.4724: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.4725: DFBPPR18489 ---- Animal proteins ---- Beta-2-microglobulin
Source.4726: DFBPPR18490 ---- Animal proteins ---- N-terminal Xaa-Pro-Lys N-methyltransferase 1
Source.4727: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.4728: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.4729: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.4730: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial
Source.4731: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.4732: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.4733: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.4734: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.4735: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.4736: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C
Source.4737: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.4738: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.4739: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.4740: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.4741: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.4742: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4743: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.4744: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.4745: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.4746: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.4747: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.4748: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.4749: DFBPPR18544 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.4750: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4751: DFBPPR18552 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 8
Source.4752: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.4753: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.4754: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.4755: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.4756: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.4757: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22
Source.4758: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.4759: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal
Source.4760: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.4761: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1
Source.4762: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.4763: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.4764: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.4765: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.4766: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.4767: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1
Source.4768: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6
Source.4769: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.4770: DFBPPR18591 ---- Animal proteins ---- ATP synthase membrane subunit DAPIT, mitochondrial
Source.4771: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.4772: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor
Source.4773: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.4774: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.4775: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.4776: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.4777: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.4778: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.4779: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.4780: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.4781: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.4782: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.4783: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.4784: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.4785: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.4786: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.4787: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.4788: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.4789: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.4790: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.4791: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.4792: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2
Source.4793: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.4794: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.4795: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.4796: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.4797: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.4798: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.4799: DFBPPR18703 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.4800: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.4801: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.4802: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.4803: DFBPPR18713 ---- Animal proteins ---- Arginase-1
Source.4804: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.4805: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.4806: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.4807: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.4808: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.4809: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial
Source.4810: DFBPPR18732 ---- Animal proteins ---- RNA-binding protein 8A
Source.4811: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.4812: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.4813: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.4814: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.4815: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.4816: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein
Source.4817: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.4818: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A
Source.4819: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase
Source.4820: DFBPPR18752 ---- Animal proteins ---- Serine/arginine-rich splicing factor 3
Source.4821: DFBPPR18753 ---- Animal proteins ---- Endosome-associated-trafficking regulator 1
Source.4822: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.4823: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.4824: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.4825: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.4826: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.4827: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.4828: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.4829: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.4830: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.4831: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.4832: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.4833: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.4834: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.4835: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.4836: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.4837: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2
Source.4838: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.4839: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.4840: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.4841: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.4842: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.4843: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.4844: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.4845: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.4846: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.4847: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.4848: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.4849: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.4850: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.4851: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.4852: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.4853: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.4854: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.4855: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.4856: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.4857: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1
Source.4858: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.4859: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.4860: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.4861: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.4862: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.4863: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.4864: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.4865: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.4866: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.4867: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.4868: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15
Source.4869: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.4870: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.4871: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.4872: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.4873: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.4874: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.4875: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.4876: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.4877: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.4878: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.4879: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.4880: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta
Source.4881: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.4882: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.4883: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.4884: DFBPPR18873 ---- Animal proteins ---- Proteasome subunit beta type-3
Source.4885: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.4886: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.4887: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.4888: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.4889: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.4890: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.4891: DFBPPR18882 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.4892: DFBPPR18883 ---- Animal proteins ---- Lysozyme C, tracheal isozyme
Source.4893: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.4894: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.4895: DFBPPR18894 ---- Animal proteins ---- NEDD8-conjugating enzyme Ubc12
Source.4896: DFBPPR18895 ---- Animal proteins ---- Lysozyme C-1
Source.4897: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.4898: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.4899: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.4900: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.4901: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.4902: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.4903: DFBPPR18908 ---- Animal proteins ---- Proteasome subunit alpha type-6
Source.4904: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.4905: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.4906: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.4907: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.4908: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.4909: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.4910: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.4911: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.4912: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.4913: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.4914: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.4915: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.4916: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.4917: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.4918: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.4919: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.4920: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.4921: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.4922: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.4923: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.4924: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.4925: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.4926: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.4927: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.4928: DFBPPR18958 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.4929: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.4930: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.4931: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.4932: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.4933: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.4934: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.4935: DFBPPR18972 ---- Animal proteins ---- Lysozyme-like protein 6
Source.4936: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.4937: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.4938: DFBPPR18977 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 1
Source.4939: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.4940: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.4941: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.4942: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.4943: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.4944: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.4945: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.4946: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.4947: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.4948: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.4949: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.4950: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.4951: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.4952: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.4953: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.4954: DFBPPR19011 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF138
Source.4955: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.4956: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1
Source.4957: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.4958: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.4959: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.4960: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4961: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.4962: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.4963: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.4964: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.4965: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.4966: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.4967: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.4968: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.4969: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.4970: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.4971: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.4972: DFBPPR19051 ---- Animal proteins ---- Pro-neuropeptide Y
Source.4973: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.4974: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.4975: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.4976: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.4977: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme
Source.4978: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.4979: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.4980: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.4981: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.4982: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.4983: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.4984: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4985: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21
Source.4986: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.4987: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1
Source.4988: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.4989: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.4990: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.4991: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.4992: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.4993: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A
Source.4994: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.4995: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.4996: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.4997: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.4998: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.4999: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.5000: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.5001: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.5002: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.5003: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.5004: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.5005: DFBPPR19128 ---- Animal proteins ---- Spermadhesin-1
Source.5006: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.5007: DFBPPR19131 ---- Animal proteins ---- Nectin-4
Source.5008: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2
Source.5009: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.5010: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.5011: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.5012: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.5013: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.5014: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.5015: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.5016: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.5017: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein
Source.5018: DFBPPR19164 ---- Animal proteins ---- RNA-binding protein with serine-rich domain 1
Source.5019: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.5020: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma
Source.5021: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.5022: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.5023: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.5024: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.5025: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.5026: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.5027: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.5028: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.5029: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.5030: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.5031: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.5032: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein
Source.5033: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.5034: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.5035: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.5036: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.5037: DFBPPR19206 ---- Animal proteins ---- Protein chibby homolog 1
Source.5038: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.5039: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.5040: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.5041: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.5042: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.5043: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.5044: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.5045: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.5046: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.5047: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.5048: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.5049: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.5050: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.5051: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.5052: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.5053: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.5054: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.5055: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.5056: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.5057: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.5058: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.5059: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.5060: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.5061: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.5062: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.5063: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.5064: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.5065: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.5066: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.5067: DFBPPR19278 ---- Animal proteins ---- R-spondin-3
Source.5068: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.5069: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.5070: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.5071: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.5072: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.5073: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.5074: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.5075: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.5076: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.5077: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.5078: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220
Source.5079: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.5080: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.5081: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.5082: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.5083: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.5084: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.5085: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.5086: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.5087: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.5088: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.5089: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.5090: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9
Source.5091: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.5092: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.5093: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.5094: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.5095: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.5096: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.5097: DFBPPR19356 ---- Animal proteins ---- Protamine-2
Source.5098: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.5099: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.5100: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.5101: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.5102: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.5103: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.5104: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.5105: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.5106: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.5107: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.5108: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.5109: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.5110: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.5111: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.5112: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.5113: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.5114: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.5115: DFBPPR19385 ---- Animal proteins ---- Cathelicidin-5
Source.5116: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.5117: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.5118: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.5119: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.5120: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6
Source.5121: DFBPPR19400 ---- Animal proteins ---- Serine/arginine-rich splicing factor 6
Source.5122: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.5123: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.5124: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.5125: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.5126: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.5127: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.5128: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.5129: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.5130: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22
Source.5131: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.5132: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.5133: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.5134: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.5135: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.5136: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.5137: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.5138: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.5139: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.5140: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.5141: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.5142: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.5143: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.5144: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.5145: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.5146: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.5147: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.5148: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.5149: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.5150: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.5151: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.5152: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.5153: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.5154: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.5155: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.5156: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.5157: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1
Source.5158: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.5159: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.5160: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.5161: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.5162: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.5163: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.5164: DFBPPR19501 ---- Animal proteins ---- CD320 antigen
Source.5165: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.5166: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.5167: DFBPPR19508 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 2
Source.5168: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.5169: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.5170: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.5171: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase
Source.5172: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.5173: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.5174: DFBPPR19521 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12
Source.5175: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.5176: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.5177: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.5178: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.5179: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.5180: DFBPPR19539 ---- Animal proteins ---- MICOS complex subunit MIC19
Source.5181: DFBPPR19540 ---- Animal proteins ---- Beta-defensin 6
Source.5182: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.5183: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein
Source.5184: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.5185: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4
Source.5186: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.5187: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.5188: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.5189: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.5190: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.5191: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.5192: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.5193: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.5194: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.5195: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5196: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.5197: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.5198: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.5199: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.5200: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.5201: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.5202: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.5203: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.5204: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.5205: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.5206: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.5207: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.5208: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.5209: DFBPPR19602 ---- Animal proteins ---- Dynactin subunit 3
Source.5210: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C
Source.5211: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.5212: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.5213: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.5214: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.5215: DFBPPR19610 ---- Animal proteins ---- RING finger protein 11
Source.5216: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.5217: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.5218: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.5219: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.5220: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog
Source.5221: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.5222: DFBPPR19623 ---- Animal proteins ---- Spermadhesin Z13
Source.5223: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.5224: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.5225: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.5226: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.5227: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.5228: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.5229: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.5230: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.5231: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.5232: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.5233: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.5234: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.5235: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.5236: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.5237: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.5238: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.5239: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.5240: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.5241: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.5242: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.5243: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.5244: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.5245: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.5246: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.5247: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.5248: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.5249: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.5250: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.5251: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1
Source.5252: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.5253: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.5254: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.5255: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.5256: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.5257: DFBPPR19695 ---- Animal proteins ---- Protein UXT
Source.5258: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.5259: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.5260: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.5261: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.5262: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.5263: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.5264: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.5265: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3
Source.5266: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.5267: DFBPPR19734 ---- Animal proteins ---- CDC42 small effector protein 2
Source.5268: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.5269: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.5270: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.5271: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.5272: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.5273: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.5274: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.5275: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.5276: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor
Source.5277: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.5278: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.5279: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.5280: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.5281: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.5282: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.5283: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.5284: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.5285: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.5286: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.5287: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.5288: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein
Source.5289: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11
Source.5290: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.5291: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.5292: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.5293: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.5294: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.5295: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.5296: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.5297: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.5298: DFBPPR19798 ---- Animal proteins ---- Uricase
Source.5299: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.5300: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.5301: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.5302: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4
Source.5303: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.5304: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.5305: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.5306: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.5307: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.5308: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.5309: DFBPPR19820 ---- Animal proteins ---- Septin-10
Source.5310: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.5311: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.5312: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.5313: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.5314: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.5315: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.5316: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.5317: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.5318: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.5319: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.5320: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.5321: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.5322: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.5323: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.5324: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.5325: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.5326: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.5327: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.5328: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.5329: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.5330: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.5331: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.5332: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.5333: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.5334: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.5335: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.5336: DFBPPR19867 ---- Animal proteins ---- Protein sprouty homolog 1
Source.5337: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.5338: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.5339: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.5340: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.5341: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.5342: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.5343: DFBPPR19894 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.5344: DFBPPR19895 ---- Animal proteins ---- 39S ribosomal protein L24, mitochondrial
Source.5345: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.5346: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.5347: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.5348: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.5349: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.5350: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.5351: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.5352: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial
Source.5353: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.5354: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.5355: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.5356: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.5357: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.5358: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.5359: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.5360: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.5361: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6
Source.5362: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.5363: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.5364: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.5365: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.5366: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.5367: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.5368: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.5369: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.5370: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.5371: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.5372: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.5373: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.5374: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.5375: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.5376: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.5377: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.5378: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.5379: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.5380: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein
Source.5381: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.5382: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.5383: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.5384: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.5385: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.5386: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.5387: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.5388: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.5389: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.5390: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.5391: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.5392: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.5393: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.5394: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.5395: DFBPPR20023 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.5396: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.5397: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.5398: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.5399: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.5400: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.5401: DFBPPR20030 ---- Animal proteins ---- Calumenin
Source.5402: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.5403: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.5404: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.5405: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.5406: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.5407: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.5408: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.5409: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.5410: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.5411: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.5412: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.5413: DFBPPR20067 ---- Animal proteins ---- Glutaredoxin-2, mitochondrial
Source.5414: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.5415: DFBPPR20072 ---- Animal proteins ---- Adenine phosphoribosyltransferase
Source.5416: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.5417: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.5418: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.5419: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.5420: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.5421: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1
Source.5422: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.5423: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.5424: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.5425: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1
Source.5426: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.5427: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.5428: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.5429: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.5430: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.5431: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.5432: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1
Source.5433: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.5434: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.5435: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.5436: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.5437: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.5438: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.5439: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.5440: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.5441: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.5442: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.5443: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.5444: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.5445: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.5446: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.5447: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.5448: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.5449: DFBPPR20165 ---- Animal proteins ---- Lysozyme C, intestinal isozyme
Source.5450: DFBPPR20166 ---- Animal proteins ---- Programmed cell death protein 5
Source.5451: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.5452: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.5453: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.5454: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.5455: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.5456: DFBPPR20174 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm1
Source.5457: DFBPPR20175 ---- Animal proteins ---- Selenoprotein K
Source.5458: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein
Source.5459: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.5460: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.5461: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.5462: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.5463: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.5464: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein
Source.5465: DFBPPR20189 ---- Animal proteins ---- Protein disulfide isomerase CRELD2
Source.5466: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.5467: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.5468: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.5469: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.5470: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.5471: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.5472: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.5473: DFBPPR20210 ---- Animal proteins ---- Exonuclease V
Source.5474: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1
Source.5475: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.5476: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.5477: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.5478: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.5479: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.5480: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.5481: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.5482: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.5483: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.5484: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.5485: DFBPPR20235 ---- Animal proteins ---- Gamma-crystallin A
Source.5486: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.5487: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.5488: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B
Source.5489: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.5490: DFBPPR20241 ---- Animal proteins ---- Ras-related protein Rab-8B
Source.5491: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2
Source.5492: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.5493: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.5494: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.5495: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.5496: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28
Source.5497: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.5498: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.5499: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.5500: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.5501: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.5502: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.5503: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.5504: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4
Source.5505: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.5506: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.5507: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.5508: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.5509: DFBPPR20295 ---- Animal proteins ---- Protein dpy-30 homolog
Source.5510: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.5511: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.5512: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.5513: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan
Source.5514: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.5515: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3
Source.5516: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.5517: DFBPPR20312 ---- Animal proteins ---- 39S ribosomal protein L52, mitochondrial
Source.5518: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9
Source.5519: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.5520: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.5521: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.5522: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.5523: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.5524: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.5525: DFBPPR20325 ---- Animal proteins ---- 28S ribosomal protein S12, mitochondrial
Source.5526: DFBPPR20326 ---- Animal proteins ---- Survival of motor neuron-related-splicing factor 30
Source.5527: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.5528: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.5529: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.5530: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.5531: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.5532: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.5533: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1
Source.5534: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.5535: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial
Source.5536: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.5537: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.5538: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.5539: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.5540: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.5541: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.5542: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.5543: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.5544: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.5545: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.5546: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.5547: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.5548: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.5549: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.5550: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.5551: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.5552: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.5553: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.5554: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.5555: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2
Source.5556: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.5557: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.5558: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A
Source.5559: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.5560: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial
Source.5561: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.5562: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.5563: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.5564: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.5565: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.5566: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.5567: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.5568: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.5569: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.5570: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.5571: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.5572: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.5573: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.5574: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.5575: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.5576: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.5577: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.5578: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.5579: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.5580: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.5581: DFBPPR20474 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.5582: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.5583: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.5584: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.5585: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29
Source.5586: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.5587: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.5588: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.5589: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.5590: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.5591: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.5592: DFBPPR20497 ---- Animal proteins ---- Serine/Arginine-related protein 53
Source.5593: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.5594: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial
Source.5595: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.5596: DFBPPR20506 ---- Animal proteins ---- Akirin-2
Source.5597: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.5598: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein
Source.5599: DFBPPR20509 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 1
Source.5600: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.5601: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.5602: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.5603: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.5604: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.5605: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.5606: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.5607: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.5608: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.5609: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.5610: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.5611: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.5612: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.5613: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.5614: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.5615: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.5616: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.5617: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.5618: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.5619: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.5620: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.5621: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.5622: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.5623: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.5624: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201
Source.5625: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.5626: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.5627: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1
Source.5628: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.5629: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.5630: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.5631: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.5632: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74
Source.5633: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein
Source.5634: DFBPPR20596 ---- Animal proteins ---- Colostrum trypsin inhibitor
Source.5635: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.5636: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.5637: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.5638: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.5639: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.5640: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.5641: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.5642: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.5643: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.5644: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.5645: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.5646: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.5647: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.5648: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.5649: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.5650: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C
Source.5651: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47
Source.5652: DFBPPR20640 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 8
Source.5653: DFBPPR20645 ---- Animal proteins ---- Eukaryotic translation initiation factor 1
Source.5654: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.5655: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.5656: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.5657: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.5658: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.5659: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.5660: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.5661: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.5662: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.5663: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.5664: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45
Source.5665: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.5666: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.5667: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2
Source.5668: DFBPPR20677 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.5669: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.5670: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.5671: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.5672: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B
Source.5673: DFBPPR20683 ---- Animal proteins ---- Kinetochore protein Spc25
Source.5674: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.5675: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.5676: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.5677: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.5678: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.5679: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.5680: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.5681: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.5682: DFBPPR20703 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 3 homolog, mitochondrial
Source.5683: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.5684: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.5685: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.5686: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.5687: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.5688: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.5689: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.5690: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.5691: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.5692: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.5693: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.5694: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.5695: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.5696: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.5697: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.5698: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.5699: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.5700: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.5701: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.5702: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B
Source.5703: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B
Source.5704: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.5705: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.5706: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.5707: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.5708: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.5709: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.5710: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.5711: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.5712: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.5713: DFBPPR20766 ---- Animal proteins ---- Torsin-2A
Source.5714: DFBPPR20768 ---- Animal proteins ---- Lysozyme-like protein 1
Source.5715: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.5716: DFBPPR20775 ---- Animal proteins ---- Colipase
Source.5717: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.5718: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.5719: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.5720: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.5721: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3
Source.5722: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.5723: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.5724: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.5725: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.5726: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.5727: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.5728: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.5729: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.5730: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.5731: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.5732: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.5733: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.5734: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.5735: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.5736: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.5737: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV
Source.5738: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4
Source.5739: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.5740: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.5741: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.5742: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.5743: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.5744: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.5745: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.5746: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.5747: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.5748: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.5749: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase
Source.5750: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.5751: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.5752: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.5753: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.5754: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.5755: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.5756: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.5757: DFBPPR20877 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD5
Source.5758: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.5759: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.5760: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A
Source.5761: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.5762: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.5763: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.5764: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2
Source.5765: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.5766: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.5767: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.5768: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.5769: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.5770: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.5771: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.5772: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.5773: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.5774: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.5775: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.5776: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.5777: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.5778: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.5779: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.5780: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.5781: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.5782: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.5783: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.5784: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial
Source.5785: DFBPPR20960 ---- Animal proteins ---- Complexin-1
Source.5786: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog
Source.5787: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.5788: DFBPPR20964 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP2
Source.5789: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.5790: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.5791: DFBPPR20969 ---- Animal proteins ---- Sperm acrosome-associated protein 5
Source.5792: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor
Source.5793: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.5794: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit
Source.5795: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.5796: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.5797: DFBPPR20984 ---- Animal proteins ---- Neuroglobin
Source.5798: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.5799: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.5800: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.5801: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.5802: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.5803: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.5804: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.5805: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.5806: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.5807: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.5808: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.5809: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.5810: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.5811: DFBPPR21023 ---- Animal proteins ---- Ribosome biogenesis protein NSA2 homolog
Source.5812: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.5813: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.5814: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.5815: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.5816: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.5817: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.5818: DFBPPR21038 ---- Animal proteins ---- Sodium channel modifier 1
Source.5819: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.5820: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.5821: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28
Source.5822: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.5823: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.5824: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.5825: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.5826: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog
Source.5827: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.5828: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.5829: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.5830: DFBPPR21073 ---- Animal proteins ---- 39S ribosomal protein L17, mitochondrial
Source.5831: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.5832: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.5833: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.5834: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.5835: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.5836: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.5837: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.5838: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.5839: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.5840: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.5841: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.5842: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.5843: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.5844: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.5845: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.5846: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.5847: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.5848: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III
Source.5849: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.5850: DFBPPR21117 ---- Animal proteins ---- Spindlin-2
Source.5851: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.5852: DFBPPR21129 ---- Animal proteins ---- 60S ribosomal protein L15
Source.5853: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.5854: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.5855: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B
Source.5856: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.5857: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.5858: DFBPPR21139 ---- Animal proteins ---- Transcription elongation factor A protein 3
Source.5859: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.5860: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.5861: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.5862: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.5863: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1
Source.5864: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.5865: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3
Source.5866: DFBPPR21167 ---- Animal proteins ---- Islet amyloid polypeptide
Source.5867: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.5868: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.5869: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.5870: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.5871: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.5872: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.5873: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.5874: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.5875: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.5876: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.5877: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.5878: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.5879: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.5880: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.5881: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.5882: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1
Source.5883: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.5884: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.5885: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.5886: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.5887: DFBPPR21219 ---- Animal proteins ---- Zinc finger CCHC-type and RNA-binding motif-containing protein 1
Source.5888: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.5889: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.5890: DFBPPR21223 ---- Animal proteins ---- Serum basic protease inhibitor
Source.5891: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.5892: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.5893: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.5894: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.5895: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.5896: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.5897: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.5898: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.5899: DFBPPR21254 ---- Animal proteins ---- Zinc finger protein 567
Source.5900: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.5901: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.5902: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta
Source.5903: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.5904: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.5905: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.5906: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.5907: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.5908: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.5909: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.5910: DFBPPR21274 ---- Animal proteins ---- 39S ribosomal protein L48, mitochondrial
Source.5911: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5912: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.5913: DFBPPR21279 ---- Animal proteins ---- 40S ribosomal protein S29
Source.5914: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.5915: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.5916: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.5917: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.5918: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.5919: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.5920: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.5921: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial
Source.5922: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.5923: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.5924: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.5925: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.5926: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.5927: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.5928: DFBPPR21318 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.5929: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.5930: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.5931: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.5932: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.5933: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.5934: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.5935: DFBPPR21343 ---- Animal proteins ---- DNA polymerase delta subunit 4
Source.5936: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.5937: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.5938: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.5939: DFBPPR21353 ---- Animal proteins ---- Zinc finger protein OZF
Source.5940: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.5941: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.5942: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.5943: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.5944: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.5945: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.5946: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.5947: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2
Source.5948: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.5949: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.5950: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.5951: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.5952: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.5953: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.5954: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.5955: DFBPPR21394 ---- Animal proteins ---- Elongin-C
Source.5956: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial
Source.5957: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.5958: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.5959: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.5960: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.5961: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.5962: DFBPPR21424 ---- Animal proteins ---- Chromosome transmission fidelity protein 8 homolog
Source.5963: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3
Source.5964: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.5965: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.5966: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.5967: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.5968: DFBPPR21450 ---- Animal proteins ---- Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1
Source.5969: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.5970: DFBPPR21459 ---- Animal proteins ---- RELT-like protein 2
Source.5971: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.5972: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.5973: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A
Source.5974: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.5975: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.5976: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.5977: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.5978: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.5979: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.5980: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.5981: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.5982: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.5983: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.5984: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.5985: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.5986: DFBPPR21494 ---- Animal proteins ---- Spleen trypsin inhibitor I
Source.5987: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.5988: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.5989: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40
Source.5990: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.5991: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.5992: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.5993: DFBPPR21525 ---- Animal proteins ---- AN1-type zinc finger protein 6
Source.5994: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.5995: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.5996: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.5997: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.5998: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.5999: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.6000: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26
Source.6001: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55
Source.6002: DFBPPR21559 ---- Animal proteins ---- C-type lectin domain family 3 member A
Source.6003: DFBPPR21564 ---- Animal proteins ---- HORMA domain-containing protein 2
Source.6004: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.6005: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.6006: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.6007: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.6008: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.6009: DFBPPR21579 ---- Animal proteins ---- Protein phosphatase inhibitor 2
Source.6010: DFBPPR21581 ---- Animal proteins ---- T-cell leukemia translocation-altered gene protein homolog
Source.6011: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19
Source.6012: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.6013: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.6014: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.6015: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.6016: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.6017: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.6018: DFBPPR21600 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit H
Source.6019: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.6020: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.6021: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.6022: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.6023: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.6024: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.6025: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.6026: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.6027: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.6028: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein
Source.6029: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.6030: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.6031: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.6032: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26
Source.6033: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6
Source.6034: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.6035: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.6036: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.6037: DFBPPR21676 ---- Animal proteins ---- ER membrane protein complex subunit 6
Source.6038: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A
Source.6039: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog
Source.6040: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.6041: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.6042: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.6043: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.6044: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208
Source.6045: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.6046: DFBPPR21708 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.6047: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.6048: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.6049: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.6050: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.6051: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.6052: DFBPPR21723 ---- Animal proteins ---- OCIA domain-containing protein 1
Source.6053: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.6054: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.6055: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.6056: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.6057: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.6058: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.6059: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.6060: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.6061: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.6062: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.6063: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.6064: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.6065: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.6066: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.6067: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.6068: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.6069: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.6070: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.6071: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1
Source.6072: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.6073: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6
Source.6074: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.6075: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog
Source.6076: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.6077: DFBPPR21794 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 8
Source.6078: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.6079: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.6080: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.6081: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.6082: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6083: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.6084: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.6085: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.6086: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24
Source.6087: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.6088: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.6089: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.6090: DFBPPR21824 ---- Animal proteins ---- Transcription factor Spi-C
Source.6091: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.6092: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD
Source.6093: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.6094: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.6095: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.6096: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A
Source.6097: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.6098: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.6099: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.6100: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.6101: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.6102: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.6103: DFBPPR21867 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5
Source.6104: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.6105: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.6106: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19
Source.6107: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.6108: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.6109: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.6110: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.6111: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39
Source.6112: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.6113: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.6114: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.6115: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein
Source.6116: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.6117: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.6118: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11
Source.6119: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.6120: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1
Source.6121: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.6122: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.6123: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4
Source.6124: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB
Source.6125: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.6126: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.6127: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.6128: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.6129: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A
Source.6130: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.6131: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.6132: DFBPPR21947 ---- Animal proteins ---- rRNA-processing protein UTP23 homolog
Source.6133: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.6134: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.6135: DFBPPR21954 ---- Animal proteins ---- Secreted seminal-vesicle Ly-6 protein 1
Source.6136: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.6137: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3
Source.6138: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.6139: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.6140: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.6141: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.6142: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.6143: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.6144: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.6145: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6146: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.6147: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.6148: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.6149: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.6150: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.6151: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.6152: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.6153: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12
Source.6154: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein
Source.6155: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.6156: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.6157: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.6158: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.6159: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.6160: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.6161: DFBPPR22030 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 25 kDa protein
Source.6162: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.6163: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.6164: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.6165: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.6166: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.6167: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B
Source.6168: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.6169: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.6170: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.6171: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.6172: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.6173: DFBPPR22061 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial
Source.6174: DFBPPR22062 ---- Animal proteins ---- Protein FAM72A
Source.6175: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.6176: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.6177: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.6178: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.6179: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B
Source.6180: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.6181: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial
Source.6182: DFBPPR22081 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.6183: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.6184: DFBPPR22086 ---- Animal proteins ---- Trafficking protein particle complex subunit 1
Source.6185: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1
Source.6186: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.6187: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.6188: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.6189: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.6190: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B
Source.6191: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog
Source.6192: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.6193: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.6194: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.6195: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.6196: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.6197: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.6198: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.6199: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.6200: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.6201: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.6202: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.6203: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.6204: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.6205: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.6206: DFBPPR22133 ---- Animal proteins ---- MOB kinase activator 3C
Source.6207: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.6208: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B
Source.6209: DFBPPR22138 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 7
Source.6210: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.6211: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.6212: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.6213: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.6214: DFBPPR22150 ---- Animal proteins ---- Transmembrane protein 213
Source.6215: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.6216: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.6217: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.6218: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.6219: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.6220: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.6221: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.6222: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256
Source.6223: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14
Source.6224: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.6225: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.6226: DFBPPR22184 ---- Animal proteins ---- 60S ribosomal protein L32
Source.6227: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.6228: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.6229: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.6230: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.6231: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.6232: DFBPPR22201 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1
Source.6233: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.6234: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.6235: DFBPPR22206 ---- Animal proteins ---- Promotilin
Source.6236: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.6237: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein
Source.6238: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.6239: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.6240: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.6241: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.6242: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.6243: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.6244: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.6245: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog
Source.6246: DFBPPR22250 ---- Animal proteins ---- Tetratricopeptide repeat protein 23-like
Source.6247: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.6248: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.6249: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog
Source.6250: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.6251: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.6252: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.6253: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.6254: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.6255: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.6256: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.6257: DFBPPR22283 ---- Animal proteins ---- F-box only protein 8
Source.6258: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2
Source.6259: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.6260: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.6261: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.6262: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222
Source.6263: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.6264: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1
Source.6265: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.6266: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein
Source.6267: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.6268: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.6269: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein
Source.6270: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2
Source.6271: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.6272: DFBPPR22319 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.6273: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.6274: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.6275: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.6276: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.6277: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.6278: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.6279: DFBPPR22336 ---- Animal proteins ---- 60S ribosomal protein L37a
Source.6280: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.6281: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.6282: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.6283: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.6284: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.6285: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.6286: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.6287: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.6288: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.6289: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.6290: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.6291: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.6292: DFBPPR22374 ---- Animal proteins ---- Cysteine-rich protein 2
Source.6293: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.6294: DFBPPR22380 ---- Animal proteins ---- G patch domain-containing protein 4
Source.6295: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.6296: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.6297: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein
Source.6298: DFBPPR22399 ---- Animal proteins ---- Transgelin-3
Source.6299: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1
Source.6300: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474
Source.6301: DFBPPR22405 ---- Animal proteins ---- Uncharacterized protein CXorf66 homolog
Source.6302: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.6303: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.6304: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.6305: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.6306: DFBPPR22420 ---- Animal proteins ---- Small integral membrane protein 19
Source.6307: DFBPPR22424 ---- Animal proteins ---- Transmembrane protein 243
Source.6308: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1
Source.6309: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.6310: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.6311: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.6312: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.6313: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.6314: DFBPPR22443 ---- Animal proteins ---- Stromal cell-derived factor 2
Source.6315: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.6316: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.6317: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.6318: DFBPPR22462 ---- Animal proteins ---- Protein FAM76A
Source.6319: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.6320: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13
Source.6321: DFBPPR22467 ---- Animal proteins ---- Coiled-coil domain-containing protein 42
Source.6322: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.6323: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.6324: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.6325: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.6326: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.6327: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.6328: DFBPPR22483 ---- Animal proteins ---- 60S ribosomal protein L36a
Source.6329: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.6330: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.6331: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.6332: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.6333: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.6334: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog
Source.6335: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.6336: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2
Source.6337: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.6338: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.6339: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.6340: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.6341: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.6342: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.6343: DFBPPR22535 ---- Animal proteins ---- Protein FAM205C
Source.6344: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25
Source.6345: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.6346: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.6347: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.6348: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1
Source.6349: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.6350: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.6351: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.6352: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.6353: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.6354: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.6355: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.6356: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog
Source.6357: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1
Source.6358: DFBPPR22581 ---- Animal proteins ---- UPF0690 protein C1orf52 homolog
Source.6359: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.6360: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog
Source.6361: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.6362: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26
Source.6363: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.6364: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.6365: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.6366: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71
Source.6367: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.6368: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.6369: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1
Source.6370: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.6371: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.6372: DFBPPR22632 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 1
Source.6373: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30
Source.6374: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.6375: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.6376: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.6377: DFBPPR22640 ---- Animal proteins ---- Placenta-specific gene 8 protein
Source.6378: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.6379: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.6380: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.6381: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D
Source.6382: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.6383: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.6384: DFBPPR22662 ---- Animal proteins ---- Uncharacterized protein C11orf94 homolog
Source.6385: DFBPPR22663 ---- Animal proteins ---- Erythrodihydroneopterin triphosphate synthetase
Source.6386: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.6387: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog
Source.6388: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.6389: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.6390: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.6391: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.6392: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.6393: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.6394: DFBPPR22687 ---- Animal proteins ---- Putative UPF0730 protein encoded by LINC00643 homolog
Source.6395: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.6396: DFBPPR22695 ---- Animal proteins ---- MORN repeat-containing protein 5
Source.6397: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.6398: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.6399: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog
Source.6400: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog
Source.6401: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.6402: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.6403: DFBPPR22734 ---- Animal proteins ---- Uncharacterized protein C1orf226 homolog
Source.6404: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.6405: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.6406: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.6407: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.6408: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog
Source.6409: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.6410: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.6411: DFBPPR22755 ---- Animal proteins ---- Uncharacterized protein C11orf86 homolog
Source.6412: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog
Source.6413: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.6414: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.6415: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.6416: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6417: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.6418: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.6419: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.6420: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6421: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.6422: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.6423: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.6424: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.6425: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.6426: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.6427: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.6428: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.6429: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.6430: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.6431: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6432: DFBPPR8553 ---- Animal proteins ---- Protein AMBP
Source.6433: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.6434: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.6435: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6436: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.6437: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.6438: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.6439: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.6440: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.6441: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.6442: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.6443: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.6444: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.6445: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.6446: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.6447: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.6448: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.6449: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.6450: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.6451: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.6452: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.6453: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.6454: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.6455: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.6456: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.6457: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.6458: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.6459: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.6460: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.6461: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.6462: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.6463: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.6464: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.6465: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.6466: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6467: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.6468: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.6469: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.6470: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.6471: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.6472: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.6473: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.6474: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.6475: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.6476: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.6477: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.6478: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.6479: DFBPPR8643 ---- Animal proteins ---- Phospholipase A2, major isoenzyme
Source.6480: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.6481: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.6482: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.6483: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.6484: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.6485: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.6486: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.6487: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.6488: DFBPPR8659 ---- Animal proteins ---- Fibroblast growth factor 1
Source.6489: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.6490: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.6491: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.6492: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.6493: DFBPPR8670 ---- Animal proteins ---- Aurora kinase A
Source.6494: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.6495: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.6496: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.6497: DFBPPR8675 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.6498: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.6499: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.6500: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.6501: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.6502: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.6503: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.6504: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.6505: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.6506: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.6507: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.6508: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.6509: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.6510: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.6511: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.6512: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.6513: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.6514: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.6515: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.6516: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.6517: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.6518: DFBPPR8718 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.6519: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.6520: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.6521: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.6522: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.6523: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase
Source.6524: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A
Source.6525: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.6526: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.6527: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.6528: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6529: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.6530: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.6531: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.6532: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.6533: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.6534: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.6535: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.6536: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.6537: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.6538: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.6539: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.6540: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.6541: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.6542: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.6543: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.6544: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.6545: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.6546: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.6547: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.6548: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6549: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.6550: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.6551: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.6552: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.6553: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.6554: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.6555: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.6556: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.6557: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.6558: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.6559: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3
Source.6560: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6561: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.6562: DFBPPR8788 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.6563: DFBPPR8789 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.6564: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.6565: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.6566: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.6567: DFBPPR8793 ---- Animal proteins ---- Histone H4
Source.6568: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.6569: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.6570: DFBPPR8796 ---- Animal proteins ---- UMP-CMP kinase
Source.6571: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.6572: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.6573: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.6574: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.6575: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.6576: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S
Source.6577: DFBPPR8813 ---- Animal proteins ---- Apolipoprotein A-IV
Source.6578: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.6579: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.6580: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.6581: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.6582: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.6583: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.6584: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase
Source.6585: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.6586: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.6587: DFBPPR8831 ---- Animal proteins ---- Interferon regulatory factor 1
Source.6588: DFBPPR8832 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.6589: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.6590: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.6591: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.6592: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.6593: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.6594: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.6595: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.6596: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.6597: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.6598: DFBPPR8861 ---- Animal proteins ---- Colipase
Source.6599: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.6600: DFBPPR8865 ---- Animal proteins ---- Haptoglobin
Source.6601: DFBPPR8866 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma
Source.6602: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.6603: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.6604: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.6605: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.6606: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.6607: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.6608: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.6609: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.6610: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.6611: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.6612: DFBPPR8904 ---- Animal proteins ---- Osteopontin
Source.6613: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.6614: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.6615: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.6616: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.6617: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.6618: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.6619: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.6620: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.6621: DFBPPR8926 ---- Animal proteins ---- Osteocalcin
Source.6622: DFBPPR8927 ---- Animal proteins ---- Pro-neuropeptide Y
Source.6623: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.6624: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.6625: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.6626: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha
Source.6627: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha
Source.6628: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.6629: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.6630: DFBPPR8974 ---- Animal proteins ---- ADM5
Source.6631: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6632: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.6633: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.6634: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.6635: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.6636: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta
Source.6637: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.6638: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.6639: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.6640: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.6641: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.6642: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.6643: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.6644: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.6645: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.6646: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.6647: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.6648: DFBPPR9026 ---- Animal proteins ---- Progonadoliberin-1
Source.6649: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.6650: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.6651: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.6652: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.6653: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.6654: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.6655: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.6656: DFBPPR9045 ---- Animal proteins ---- Ferritin heavy chain
Source.6657: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.6658: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.6659: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.6660: DFBPPR9057 ---- Animal proteins ---- Phospholipase A2, minor isoenzyme
Source.6661: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.6662: DFBPPR9065 ---- Animal proteins ---- GTPase NRas
Source.6663: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.6664: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.6665: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.6666: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.6667: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.6668: DFBPPR9077 ---- Animal proteins ---- Lysozyme C-2
Source.6669: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.6670: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.6671: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.6672: DFBPPR9089 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.6673: DFBPPR9091 ---- Animal proteins ---- Antileukoproteinase
Source.6674: DFBPPR9092 ---- Animal proteins ---- Galanin peptides
Source.6675: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.6676: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.6677: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.6678: DFBPPR9099 ---- Animal proteins ---- Lysozyme C-3
Source.6679: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.6680: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.6681: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.6682: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.6683: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.6684: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I
Source.6685: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.6686: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.6687: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.6688: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.6689: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.6690: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.6691: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.6692: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.6693: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.6694: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.6695: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.6696: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.6697: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.6698: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.6699: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.6700: DFBPPR9143 ---- Animal proteins ---- NKG2-D type II integral membrane protein
Source.6701: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II
Source.6702: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.6703: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.6704: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.6705: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.6706: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.6707: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.6708: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.6709: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.6710: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.6711: DFBPPR9166 ---- Animal proteins ---- Uricase
Source.6712: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.6713: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.6714: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase
Source.6715: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.6716: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.6717: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3
Source.6718: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.6719: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.6720: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.6721: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.6722: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.6723: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.6724: DFBPPR9192 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.6725: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.6726: DFBPPR9194 ---- Animal proteins ---- Arginase-1
Source.6727: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.6728: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.6729: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.6730: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.6731: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.6732: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.6733: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.6734: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase
Source.6735: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.6736: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.6737: DFBPPR9218 ---- Animal proteins ---- POU domain, class 3, transcription factor 3
Source.6738: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.6739: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.6740: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6741: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.6742: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.6743: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.6744: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.6745: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.6746: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.6747: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.6748: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.6749: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.6750: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.6751: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.6752: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9
Source.6753: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.6754: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.6755: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.6756: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.6757: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.6758: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.6759: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4
Source.6760: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.6761: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.6762: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.6763: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.6764: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.6765: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.6766: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.6767: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.6768: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.6769: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.6770: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.6771: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.6772: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.6773: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.6774: DFBPPR9291 ---- Animal proteins ---- Lysozyme C-1
Source.6775: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2
Source.6776: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.6777: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.6778: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6779: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.6780: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.6781: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.6782: DFBPPR9304 ---- Animal proteins ---- Peroxiredoxin-2
Source.6783: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.6784: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.6785: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.6786: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.6787: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.6788: DFBPPR9319 ---- Animal proteins ---- Myelin basic protein
Source.6789: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.6790: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.6791: DFBPPR9324 ---- Animal proteins ---- Carbohydrate-binding protein AQN-3
Source.6792: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.6793: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.6794: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.6795: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.6796: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.6797: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6798: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.6799: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.6800: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.6801: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.6802: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.6803: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.6804: DFBPPR9359 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.6805: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.6806: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.6807: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.6808: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.6809: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.6810: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.6811: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.6812: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.6813: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.6814: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta
Source.6815: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.6816: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.6817: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6818: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.6819: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.6820: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.6821: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.6822: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.6823: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.6824: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11
Source.6825: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.6826: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.6827: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.6828: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.6829: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.6830: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6831: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6832: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6833: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.6834: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.6835: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.6836: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.6837: DFBPPR9428 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.6838: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.6839: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.6840: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.6841: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.6842: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.6843: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.6844: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4
Source.6845: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.6846: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.6847: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.6848: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.6849: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.6850: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.6851: DFBPPR9500 ---- Animal proteins ---- 40S ribosomal protein S29
Source.6852: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.6853: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.6854: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.6855: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.6856: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.6857: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.6858: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.6859: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.6860: DFBPPR9521 ---- Animal proteins ---- Endothelin-3
Source.6861: DFBPPR9526 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein
Source.6862: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.6863: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.6864: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.6865: DFBPPR9533 ---- Animal proteins ---- Protamine-2
Source.6866: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.6867: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.6868: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.6869: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.6870: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.6871: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.6872: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.6873: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.6874: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.6875: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.6876: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.6877: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.6878: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.6879: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.6880: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.6881: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.6882: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.6883: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.6884: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.6885: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.6886: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.6887: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.6888: DFBPPR9585 ---- Animal proteins ---- Uterine plasmin/trypsin inhibitor
Source.6889: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6890: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.6891: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.6892: DFBPPR9593 ---- Animal proteins ---- Selenoprotein K
Source.6893: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.6894: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.6895: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6896: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.6897: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor
Source.6898: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.6899: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.6900: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.6901: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.6902: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.6903: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.6904: DFBPPR9626 ---- Animal proteins ---- Adenylyl cyclase-associated protein 1
Source.6905: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.6906: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.6907: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.6908: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.6909: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.6910: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M
Source.6911: DFBPPR9647 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.6912: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.6913: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.6914: DFBPPR9652 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.6915: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1
Source.6916: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.6917: DFBPPR9668 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.6918: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.6919: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta
Source.6920: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.6921: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.6922: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.6923: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1
Source.6924: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.6925: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor
Source.6926: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.6927: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.6928: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.6929: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.6930: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.6931: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain
Source.6932: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6933: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.6934: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.6935: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain
Source.6936: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.6937: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.6938: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.6939: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2
Source.6940: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6941: DFBPPR9757 ---- Animal proteins ---- Neuroglobin
Source.6942: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.6943: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.6944: DFBPPR9765 ---- Animal proteins ---- Promotilin
Source.6945: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3
Source.6946: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.6947: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.6948: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.6949: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6950: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.6951: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.6952: DFBPPR9788 ---- Animal proteins ---- ATP synthase-coupling factor 6, mitochondrial
Source.6953: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.6954: DFBPPR9795 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5
Source.6955: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.6956: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3
Source.6957: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.6958: DFBPPR9815 ---- Animal proteins ---- Eukaryotic translation initiation factor 1b
Source.6959: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.6960: DFBPPR9819 ---- Animal proteins ---- 40S ribosomal protein S9
Source.6961: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.6962: DFBPPR9824 ---- Animal proteins ---- 60S ribosomal protein L32
Source.6963: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.6964: DFBPPR9835 ---- Animal proteins ---- 60S ribosomal protein L36a
Source.6965: DFBPPR9837 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.6966: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1
Source.6967: DFBPPR9843 ---- Animal proteins ---- P protein
Source.6968: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.6969: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.6970: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.6971: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.6972: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2
Source.6973: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A
Source.6974: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6975: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.6976: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.6977: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.6978: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.6979: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.6980: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.6981: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19
Source.6982: DFBPPR9905 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.6983: DFBPPR9907 ---- Animal proteins ---- Secreted seminal-vesicle Ly-6 protein 1
Source.6984: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3
Source.6985: DFBPPR9914 ---- Animal proteins ---- 60S ribosomal protein L15
Source.6986: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.6987: DFBPPR9932 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.6988: DFBPPR9933 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.6989: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.6990: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6991: DFBPPR9942 ---- Animal proteins ---- Proline-rich protein 3
Source.6992: DFBPPR9947 ---- Animal proteins ---- Hypothalamic tetradecapeptide
Source.6993: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.6994: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.6995: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.6996: DFBPPR9959 ---- Animal proteins ---- Interferon gamma
Source.6997: DFBPPR9961 ---- Animal proteins ---- Somatotropin
Source.6998: DFBPPR9965 ---- Animal proteins ---- Lysozyme C
Source.6999: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.7000: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.7001: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.7002: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.7003: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.7004: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.7005: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.7006: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.7007: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.7008: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.7009: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.7010: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.7011: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I
Source.7012: DFBPPR9992 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.7013: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.7014: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.7015: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.7016: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.7017: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.7018: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.7019: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.7020: DFBPPR10003 ---- Animal proteins ---- Progonadoliberin-1
Source.7021: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.7022: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.7023: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.7024: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.7025: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.7026: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.7027: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.7028: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.7029: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.7030: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.7031: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.7032: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.7033: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.7034: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.7035: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.7036: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.7037: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.7038: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.7039: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.7040: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.7041: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.7042: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.7043: DFBPPR10044 ---- Animal proteins ---- Histone H4
Source.7044: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.7045: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.7046: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.7047: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.7048: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.7049: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11
Source.7050: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.7051: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.7052: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.7053: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.7054: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.7055: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.7056: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.7057: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.7058: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7
Source.7059: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.7060: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.7061: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7062: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.7063: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.7064: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.7065: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.7066: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.7067: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.7068: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.7069: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.7070: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.7071: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.7072: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.7073: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.7074: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.7075: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.7076: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.7077: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.7078: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.7079: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.7080: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.7081: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.7082: DFBPPR10113 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.7083: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.7084: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.7085: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.7086: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.7087: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.7088: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.7089: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.7090: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.7091: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.7092: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.7093: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.7094: DFBPPR10129 ---- Animal proteins ---- Gremlin-1
Source.7095: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.7096: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.7097: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.7098: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.7099: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.7100: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.7101: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.7102: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.7103: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.7104: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.7105: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.7106: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.7107: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.7108: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.7109: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.7110: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.7111: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.7112: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.7113: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.7114: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.7115: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.7116: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.7117: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.7118: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.7119: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.7120: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.7121: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.7122: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.7123: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.7124: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.7125: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.7126: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.7127: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.7128: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.7129: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.7130: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.7131: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.7132: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.7133: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.7134: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.7135: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.7136: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.7137: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.7138: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.7139: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.7140: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.7141: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.7142: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.7143: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.7144: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.7145: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.7146: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.7147: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.7148: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.7149: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.7150: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.7151: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.7152: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.7153: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.7154: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.7155: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.7156: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.7157: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.7158: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.7159: DFBPPR10226 ---- Animal proteins ---- GTPase HRas
Source.7160: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.7161: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.7162: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.7163: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.7164: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.7165: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.7166: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.7167: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.7168: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.7169: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.7170: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.7171: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.7172: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1
Source.7173: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.7174: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein
Source.7175: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.7176: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.7177: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.7178: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.7179: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.7180: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.7181: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.7182: DFBPPR10264 ---- Animal proteins ---- Fibroblast growth factor 1
Source.7183: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.7184: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.7185: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.7186: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.7187: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.7188: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.7189: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.7190: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.7191: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.7192: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.7193: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.7194: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.7195: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.7196: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.7197: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.7198: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.7199: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.7200: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.7201: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.7202: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.7203: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.7204: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.7205: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.7206: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.7207: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.7208: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.7209: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.7210: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.7211: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.7212: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.7213: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.7214: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.7215: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.7216: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.7217: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.7218: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.7219: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.7220: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.7221: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.7222: DFBPPR10339 ---- Animal proteins ---- Osteocalcin
Source.7223: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.7224: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.7225: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.7226: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.7227: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.7228: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.7229: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.7230: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.7231: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.7232: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.7233: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.7234: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.7235: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.7236: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.7237: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.7238: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.7239: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.7240: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.7241: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.7242: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.7243: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.7244: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.7245: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.7246: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.7247: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.7248: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.7249: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.7250: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.7251: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.7252: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.7253: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.7254: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.7255: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.7256: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.7257: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.7258: DFBPPR10403 ---- Animal proteins ---- UMP-CMP kinase
Source.7259: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.7260: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.7261: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.7262: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.7263: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.7264: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.7265: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.7266: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.7267: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.7268: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.7269: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.7270: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.7271: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.7272: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.7273: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.7274: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.7275: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.7276: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.7277: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.7278: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.7279: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.7280: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.7281: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.7282: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.7283: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.7284: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.7285: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.7286: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.7287: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.7288: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.7289: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.7290: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.7291: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.7292: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.7293: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.7294: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.7295: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.7296: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7297: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.7298: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.7299: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.7300: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.7301: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.7302: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.7303: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.7304: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.7305: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.7306: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.7307: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.7308: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.7309: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.7310: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.7311: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1
Source.7312: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.7313: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.7314: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.7315: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.7316: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.7317: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.7318: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.7319: DFBPPR10509 ---- Animal proteins ---- Calponin-1
Source.7320: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.7321: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.7322: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.7323: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.7324: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.7325: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.7326: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.7327: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.7328: DFBPPR10530 ---- Animal proteins ---- Osteopontin
Source.7329: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.7330: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.7331: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.7332: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.7333: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.7334: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.7335: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.7336: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.7337: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.7338: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.7339: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1
Source.7340: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.7341: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.7342: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.7343: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.7344: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.7345: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.7346: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.7347: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.7348: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.7349: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.7350: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.7351: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.7352: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.7353: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.7354: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.7355: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.7356: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.7357: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.7358: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.7359: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.7360: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B
Source.7361: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.7362: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.7363: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.7364: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.7365: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.7366: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.7367: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.7368: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.7369: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.7370: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.7371: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.7372: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.7373: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.7374: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.7375: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.7376: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.7377: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.7378: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.7379: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.7380: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.7381: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.7382: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.7383: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.7384: DFBPPR10634 ---- Animal proteins ---- Procathepsin L
Source.7385: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.7386: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.7387: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.7388: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.7389: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.7390: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.7391: DFBPPR10643 ---- Animal proteins ---- Sclerostin domain-containing protein 1
Source.7392: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.7393: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.7394: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.7395: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.7396: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.7397: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.7398: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.7399: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.7400: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.7401: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.7402: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.7403: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.7404: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.7405: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.7406: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.7407: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.7408: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.7409: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.7410: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.7411: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.7412: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.7413: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.7414: DFBPPR10674 ---- Animal proteins ---- Myelin basic protein
Source.7415: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.7416: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.7417: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.7418: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.7419: DFBPPR10683 ---- Animal proteins ---- Histone H4 type VIII
Source.7420: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.7421: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.7422: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.7423: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.7424: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.7425: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.7426: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.7427: DFBPPR10700 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 2
Source.7428: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.7429: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.7430: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.7431: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.7432: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.7433: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.7434: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.7435: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.7436: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7437: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.7438: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.7439: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.7440: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.7441: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.7442: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.7443: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.7444: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.7445: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.7446: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.7447: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.7448: DFBPPR10740 ---- Animal proteins ---- Cryptic protein
Source.7449: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.7450: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.7451: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.7452: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.7453: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.7454: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.7455: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.7456: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.7457: DFBPPR10756 ---- Animal proteins ---- Ferritin heavy chain
Source.7458: DFBPPR10758 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.7459: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.7460: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.7461: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7462: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.7463: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.7464: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.7465: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.7466: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.7467: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C
Source.7468: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.7469: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.7470: DFBPPR10787 ---- Animal proteins ---- Angiogenin
Source.7471: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2
Source.7472: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.7473: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.7474: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.7475: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.7476: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.7477: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.7478: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.7479: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.7480: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.7481: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.7482: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2
Source.7483: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.7484: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.7485: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.7486: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.7487: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.7488: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.7489: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.7490: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.7491: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.7492: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.7493: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.7494: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.7495: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.7496: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.7497: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1
Source.7498: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.7499: DFBPPR10837 ---- Animal proteins ---- GTPase NRas
Source.7500: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.7501: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.7502: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.7503: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.7504: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.7505: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.7506: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.7507: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.7508: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.7509: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.7510: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.7511: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.7512: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.7513: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.7514: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.7515: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.7516: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.7517: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.7518: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.7519: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.7520: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.7521: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.7522: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.7523: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.7524: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.7525: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.7526: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.7527: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.7528: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.7529: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.7530: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.7531: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.7532: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.7533: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.7534: DFBPPR10898 ---- Animal proteins ---- Sperm histone
Source.7535: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.7536: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.7537: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2
Source.7538: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.7539: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.7540: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.7541: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.7542: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.7543: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.7544: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.7545: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.7546: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.7547: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.7548: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.7549: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.7550: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.7551: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.7552: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.7553: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.7554: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.7555: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.7556: DFBPPR10939 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.7557: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.7558: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.7559: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.7560: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.7561: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.7562: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.7563: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.7564: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.7565: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.7566: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.7567: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.7568: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.7569: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.7570: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.7571: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.7572: DFBPPR10966 ---- Animal proteins ---- Nuclear cap-binding protein subunit 2
Source.7573: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.7574: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.7575: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.7576: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.7577: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.7578: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.7579: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.7580: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.7581: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.7582: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.7583: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.7584: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.7585: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.7586: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.7587: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.7588: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.7589: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.7590: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.7591: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.7592: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.7593: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.7594: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.7595: DFBPPR11007 ---- Animal proteins ---- Anamorsin
Source.7596: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.7597: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.7598: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.7599: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1
Source.7600: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.7601: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.7602: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.7603: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.7604: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.7605: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.7606: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.7607: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.7608: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog
Source.7609: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.7610: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.7611: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.7612: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.7613: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.7614: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.7615: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.7616: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.7617: DFBPPR11048 ---- Animal proteins ---- Calcitonin
Source.7618: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.7619: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.7620: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.7621: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.7622: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.7623: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.7624: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.7625: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.7626: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.7627: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.7628: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.7629: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7630: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.7631: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.7632: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.7633: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.7634: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.7635: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.7636: DFBPPR11091 ---- Animal proteins ---- Pro-neuropeptide Y
Source.7637: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.7638: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.7639: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.7640: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.7641: DFBPPR11102 ---- Animal proteins ---- Interferon type A3
Source.7642: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.7643: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.7644: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.7645: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.7646: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.7647: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.7648: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.7649: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1
Source.7650: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7651: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.7652: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.7653: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.7654: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.7655: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.7656: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.7657: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.7658: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.7659: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.7660: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.7661: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.7662: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.7663: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3
Source.7664: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.7665: DFBPPR11146 ---- Animal proteins ---- Formin
Source.7666: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.7667: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.7668: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.7669: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.7670: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.7671: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.7672: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.7673: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.7674: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185
Source.7675: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.7676: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.7677: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.7678: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.7679: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.7680: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b
Source.7681: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.7682: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.7683: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.7684: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.7685: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.7686: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.7687: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.7688: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.7689: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.7690: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.7691: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.7692: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.7693: DFBPPR11205 ---- Animal proteins ---- Protein 4.1
Source.7694: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1
Source.7695: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.7696: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.7697: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.7698: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.7699: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.7700: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.7701: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.7702: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.7703: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.7704: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.7705: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.7706: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.7707: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.7708: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.7709: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.7710: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.7711: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.7712: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.7713: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.7714: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.7715: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.7716: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.7717: DFBPPR11248 ---- Animal proteins ---- Myelin protein P0
Source.7718: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.7719: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.7720: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.7721: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.7722: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.7723: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.7724: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.7725: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.7726: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.7727: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.7728: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.7729: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.7730: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.7731: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.7732: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.7733: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.7734: DFBPPR11283 ---- Animal proteins ---- Centromere protein U
Source.7735: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.7736: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.7737: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.7738: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.7739: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.7740: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.7741: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.7742: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.7743: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.7744: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.7745: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.7746: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta
Source.7747: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.7748: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.7749: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.7750: DFBPPR11305 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.7751: DFBPPR11306 ---- Animal proteins ---- Transcription factor 15
Source.7752: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.7753: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.7754: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.7755: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.7756: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.7757: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.7758: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.7759: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.7760: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.7761: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.7762: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.7763: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.7764: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.7765: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.7766: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.7767: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.7768: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.7769: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.7770: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.7771: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.7772: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.7773: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.7774: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.7775: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13
Source.7776: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.7777: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.7778: DFBPPR11354 ---- Animal proteins ---- Centromere protein O
Source.7779: DFBPPR11355 ---- Animal proteins ---- Collectin-10
Source.7780: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.7781: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.7782: DFBPPR11359 ---- Animal proteins ---- Mesogenin-1
Source.7783: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.7784: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.7785: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.7786: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.7787: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.7788: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.7789: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.7790: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.7791: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.7792: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.7793: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.7794: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.7795: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.7796: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.7797: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.7798: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.7799: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.7800: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.7801: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.7802: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.7803: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4
Source.7804: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.7805: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.7806: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3
Source.7807: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.7808: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.7809: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.7810: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.7811: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.7812: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.7813: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.7814: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.7815: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.7816: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.7817: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.7818: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.7819: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.7820: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3
Source.7821: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7822: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.7823: DFBPPR11442 ---- Animal proteins ---- 60S ribosomal protein L37a
Source.7824: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.7825: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.7826: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.7827: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.7828: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.7829: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.7830: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.7831: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.7832: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.7833: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.7834: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.7835: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.7836: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.7837: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.7838: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.7839: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.7840: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.7841: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.7842: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.7843: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.7844: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.7845: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.7846: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.7847: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.7848: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.7849: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.7850: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.7851: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.7852: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.7853: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.7854: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.7855: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.7856: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.7857: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.7858: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.7859: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12
Source.7860: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.7861: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.7862: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.7863: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.7864: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.7865: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.7866: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.7867: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.7868: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.7869: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.7870: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.7871: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.7872: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.7873: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.7874: DFBPPR11580 ---- Animal proteins ---- Cilia- and flagella-associated protein 20
Source.7875: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.7876: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.7877: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.7878: DFBPPR11599 ---- Animal proteins ---- Homeobox protein Hox-A9
Source.7879: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.7880: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.7881: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.7882: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.7883: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.7884: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.7885: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.7886: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.7887: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.7888: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.7889: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.7890: DFBPPR11618 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.7891: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.7892: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.7893: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.7894: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.7895: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.7896: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.7897: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.7898: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.7899: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.7900: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A
Source.7901: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.7902: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.7903: DFBPPR11652 ---- Animal proteins ---- Stathmin-3
Source.7904: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.7905: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.7906: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.7907: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.7908: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.7909: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.7910: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein
Source.7911: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein
Source.7912: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.7913: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.7914: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.7915: DFBPPR11672 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 3
Source.7916: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.7917: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.7918: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.7919: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.7920: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.7921: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.7922: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.7923: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.7924: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.7925: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.7926: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.7927: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.7928: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.7929: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.7930: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.7931: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.7932: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.7933: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.7934: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.7935: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8
Source.7936: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.7937: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.7938: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.7939: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.7940: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.7941: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.7942: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.7943: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.7944: DFBPPR11736 ---- Animal proteins ---- Ig lambda chain V-1 region
Source.7945: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.7946: DFBPPR11746 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.7947: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.7948: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.7949: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.7950: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.7951: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.7952: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta
Source.7953: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.7954: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.7955: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B
Source.7956: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.7957: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.7958: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.7959: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.7960: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.7961: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3
Source.7962: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.7963: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.7964: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.7965: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.7966: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.7967: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.7968: DFBPPR11782 ---- Animal proteins ---- Trafficking protein particle complex subunit 3
Source.7969: DFBPPR11789 ---- Animal proteins ---- NF-kappa-B inhibitor-interacting Ras-like protein 2
Source.7970: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.7971: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.7972: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17
Source.7973: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.7974: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.7975: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.7976: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.7977: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.7978: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.7979: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.7980: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13
Source.7981: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.7982: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.7983: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.7984: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.7985: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.7986: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B
Source.7987: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.7988: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.7989: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1
Source.7990: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.7991: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.7992: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.7993: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.7994: DFBPPR11854 ---- Animal proteins ---- Claw keratin
Source.7995: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.7996: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.7997: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.7998: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.7999: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.8000: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.8001: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.8002: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.8003: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein
Source.8004: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.8005: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.8006: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.8007: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.8008: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.8009: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.8010: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.8011: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.8012: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.8013: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.8014: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.8015: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.8016: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.8017: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.8018: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.8019: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.8020: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.8021: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.8022: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.8023: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.8024: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.8025: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.8026: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.8027: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.8028: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.8029: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.8030: DFBPPR11936 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.8031: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.8032: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.8033: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.8034: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.8035: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.8036: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.8037: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.8038: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.8039: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.8040: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.8041: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.8042: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.8043: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.8044: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.8045: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.8046: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.8047: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.8048: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.8049: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.8050: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.8051: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.8052: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.8053: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.8054: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.8055: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.8056: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.8057: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.8058: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1
Source.8059: DFBPPR11996 ---- Animal proteins ---- Homeobox protein Hox-A6
Source.8060: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.8061: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.8062: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.8063: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2
Source.8064: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.8065: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.8066: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.8067: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.8068: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.8069: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.8070: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog
Source.8071: DFBPPR12022 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.8072: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.8073: DFBPPR12027 ---- Animal proteins ---- Centromere protein L
Source.8074: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.8075: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.8076: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.8077: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.8078: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.8079: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.8080: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.8081: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.8082: DFBPPR12038 ---- Animal proteins ---- Scale keratin
Source.8083: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.8084: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.8085: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.8086: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.8087: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.8088: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.8089: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.8090: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.8091: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.8092: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.8093: DFBPPR12061 ---- Animal proteins ---- Otoraplin
Source.8094: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.8095: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.8096: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.8097: DFBPPR12077 ---- Animal proteins ---- Eukaryotic translation initiation factor 1
Source.8098: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.8099: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.8100: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.8101: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.8102: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.8103: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.8104: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.8105: DFBPPR12089 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.8106: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.8107: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.8108: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.8109: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.8110: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.8111: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.8112: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.8113: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.8114: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.8115: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.8116: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.8117: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.8118: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.8119: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.8120: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1
Source.8121: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.8122: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.8123: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.8124: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.8125: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.8126: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.8127: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.8128: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.8129: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.8130: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.8131: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.8132: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.8133: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.8134: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.8135: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.8136: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.8137: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.8138: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.8139: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.8140: DFBPPR12181 ---- Animal proteins ---- Small integral membrane protein 15
Source.8141: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.8142: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.8143: DFBPPR12196 ---- Animal proteins ---- 60S ribosomal protein L15
Source.8144: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.8145: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.8146: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.8147: DFBPPR12208 ---- Animal proteins ---- Protein FAM76A
Source.8148: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.8149: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.8150: DFBPPR12213 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.8151: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.8152: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.8153: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.8154: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.8155: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.8156: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.8157: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.8158: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.8159: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.8160: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.8161: DFBPPR12244 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1
Source.8162: DFBPPR12245 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog
Source.8163: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog
Source.8164: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.8165: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.8166: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.8167: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.8168: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.8169: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.8170: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.8171: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.8172: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.8173: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.8174: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.8175: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.8176: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.8177: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.8178: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.8179: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.8180: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.8181: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.8182: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.8183: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.8184: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.8185: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.8186: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.8187: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.8188: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.8189: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.8190: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.8191: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.8192: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.8193: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.8194: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.8195: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.8196: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8197: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.8198: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.8199: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.8200: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.8201: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.8202: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8203: DFBPPR12308 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.8204: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.8205: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.8206: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8207: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.8208: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.8209: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.8210: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.8211: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.8212: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.8213: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.8214: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.8215: DFBPPR12322 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.8216: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.8217: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.8218: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.8219: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.8220: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.8221: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.8222: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.8223: DFBPPR12333 ---- Animal proteins ---- Angiogenin
Source.8224: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.8225: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.8226: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.8227: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.8228: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.8229: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.8230: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.8231: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.8232: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.8233: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.8234: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.8235: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.8236: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.8237: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.8238: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.8239: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.8240: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a
Source.8241: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.8242: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.8243: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.8244: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.8245: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.8246: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1
Source.8247: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.8248: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.8249: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.8250: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.8251: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8252: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.8253: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.8254: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.8255: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.8256: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.8257: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.8258: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.8259: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.8260: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.8261: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.8262: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.8263: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.8264: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.8265: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.8266: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.8267: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.8268: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.8269: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.8270: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.8271: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8272: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.8273: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.8274: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.8275: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.8276: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.8277: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.8278: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.8279: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.8280: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.8281: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.8282: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.8283: DFBPPR12419 ---- Animal proteins ---- Phospholipase A2
Source.8284: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.8285: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.8286: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8287: DFBPPR12424 ---- Animal proteins ---- Protein phosphatase inhibitor 2
Source.8288: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.8289: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.8290: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.8291: DFBPPR12431 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2
Source.8292: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.8293: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2
Source.8294: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.8295: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.8296: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.8297: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.8298: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.8299: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8300: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.8301: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.8302: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.8303: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.8304: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.8305: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.8306: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.8307: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.8308: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.8309: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.8310: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.8311: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8312: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.8313: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.8314: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.8315: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.8316: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.8317: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.8318: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.8319: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.8320: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.8321: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.8322: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.8323: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.8324: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.8325: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A
Source.8326: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.8327: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8328: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.8329: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.8330: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.8331: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.8332: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.8333: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.8334: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.8335: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.8336: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.8337: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.8338: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.8339: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.8340: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.8341: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.8342: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.8343: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.8344: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.8345: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.8346: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin
Source.8347: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.8348: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.8349: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.8350: DFBPPR12530 ---- Animal proteins ---- Bisphosphoglycerate mutase
Source.8351: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.8352: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.8353: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.8354: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.8355: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.8356: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.8357: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.8358: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.8359: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.8360: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.8361: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.8362: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.8363: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.8364: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.8365: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.8366: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.8367: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.8368: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.8369: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.8370: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.8371: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.8372: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.8373: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.8374: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.8375: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.8376: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.8377: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.8378: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.8379: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.8380: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.8381: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.8382: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.8383: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.8384: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.8385: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.8386: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.8387: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.8388: DFBPPR12621 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8389: DFBPPR12622 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8390: DFBPPR12623 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8391: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.8392: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.8393: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.8394: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I
Source.8395: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.8396: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.8397: DFBPPR12642 ---- Animal proteins ---- Haptoglobin
Source.8398: DFBPPR12643 ---- Animal proteins ---- Haptoglobin
Source.8399: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.8400: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.8401: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.8402: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8403: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.8404: DFBPPR12662 ---- Animal proteins ---- Interferon gamma
Source.8405: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.8406: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8407: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.8408: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.8409: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.8410: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.8411: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.8412: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.8413: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.8414: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.8415: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.8416: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.8417: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.8418: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.8419: DFBPPR12725 ---- Animal proteins ---- Uricase
Source.8420: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.8421: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.8422: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.8423: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.8424: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.8425: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.8426: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8427: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.8428: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.8429: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.8430: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.8431: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.8432: DFBPPR12747 ---- Animal proteins ---- Myelin basic protein
Source.8433: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.8434: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.8435: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.8436: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.8437: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.8438: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.8439: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.8440: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.8441: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.8442: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.8443: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.8444: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.8445: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.8446: DFBPPR12770 ---- Animal proteins ---- Filamin-B
Source.8447: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.8448: DFBPPR12772 ---- Animal proteins ---- Colipase
Source.8449: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.8450: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8451: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.8452: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.8453: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.8454: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.8455: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.8456: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.8457: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.8458: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.8459: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.8460: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.8461: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.8462: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.8463: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.8464: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.8465: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.8466: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.8467: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.8468: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.8469: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.8470: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.8471: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.8472: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase
Source.8473: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.8474: DFBPPR12827 ---- Animal proteins ---- Matrix Gla protein
Source.8475: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.8476: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.8477: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8478: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.8479: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.8480: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.8481: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.8482: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.8483: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.8484: DFBPPR12848 ---- Animal proteins ---- Sarcoplasmic reticulum histidine-rich calcium-binding protein
Source.8485: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.8486: DFBPPR12857 ---- Animal proteins ---- Arginase-1
Source.8487: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.8488: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.8489: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta
Source.8490: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.8491: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.8492: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.8493: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.8494: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.8495: DFBPPR12878 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.8496: DFBPPR12879 ---- Animal proteins ---- Endothelin-2
Source.8497: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.8498: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.8499: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.8500: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.8501: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.8502: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.8503: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.8504: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.8505: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.8506: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.8507: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.8508: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30
Source.8509: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.8510: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.8511: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.8512: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.8513: DFBPPR12929 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.8514: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.8515: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.8516: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.8517: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.8518: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.8519: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.8520: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.8521: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.8522: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.8523: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.8524: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.8525: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.8526: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.8527: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.8528: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.8529: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.8530: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.8531: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.8532: DFBPPR12977 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.8533: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.8534: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.8535: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.8536: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A
Source.8537: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.8538: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.8539: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.8540: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.8541: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.8542: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8543: DFBPPR13008 ---- Animal proteins ---- Keratin-associated protein 6-1
Source.8544: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8545: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.8546: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.8547: DFBPPR13017 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.8548: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.8549: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.8550: DFBPPR13029 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5
Source.8551: DFBPPR13033 ---- Animal proteins ---- Neuroglobin
Source.8552: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.8553: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta
Source.8554: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.8555: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10
Source.8556: DFBPPR13058 ---- Animal proteins ---- Anion exchange transporter
Source.8557: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.8558: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.8559: DFBPPR13064 ---- Animal proteins ---- Metalloproteinase inhibitor 4
Source.8560: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.8561: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.8562: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.8563: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.8564: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.8565: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.8566: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1
Source.8567: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.8568: DFBPPR13106 ---- Animal proteins ---- Ig kappa chain V region BS-1
Source.8569: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.8570: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8571: DFBPPR13121 ---- Animal proteins ---- Ig heavy chain V-A2 region P-MU-3
Source.8572: DFBPPR13128 ---- Animal proteins ---- Ig kappa chain V region 4135
Source.8573: DFBPPR13142 ---- Animal proteins ---- Phospholipase A2
Source.8574: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.8575: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8576: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.8577: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.8578: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.8579: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.8580: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.8581: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.8582: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8583: DFBPPR13167 ---- Animal proteins ---- Natriuretic peptides A
Source.8584: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.8585: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1
Source.8586: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8587: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.8588: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8589: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8590: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.8591: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.8592: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.8593: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8594: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.8595: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.8596: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.8597: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.8598: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.8599: DFBPPR13199 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.8600: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.8601: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8602: DFBPPR13210 ---- Animal proteins ---- Angiogenin
Source.8603: DFBPPR13211 ---- Animal proteins ---- Colipase B
Source.8604: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.8605: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.8606: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.8607: DFBPPR13216 ---- Animal proteins ---- Colipase A
Source.8608: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.8609: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.8610: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.8611: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.8612: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.8613: DFBPPR13232 ---- Animal proteins ---- Osteocalcin
Source.8614: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.8615: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.8616: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.8617: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8618: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.8619: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.8620: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.8621: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.8622: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.8623: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.8624: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.8625: DFBPPR13264 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.8626: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8627: DFBPPR13267 ---- Animal proteins ---- Interferon beta
Source.8628: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.8629: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.8630: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.8631: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.8632: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8633: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.8634: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8635: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.8636: DFBPPR13286 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.8637: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.8638: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.8639: DFBPPR13290 ---- Animal proteins ---- Myelin basic protein
Source.8640: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.8641: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.8642: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.8643: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.8644: DFBPPR13302 ---- Animal proteins ---- Endothelin-2
Source.8645: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8646: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.8647: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I
Source.8648: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.8649: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.8650: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0
Source.8651: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.8652: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8653: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.8654: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.8655: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.8656: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.8657: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.8658: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.8659: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3
Source.8660: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8661: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.8662: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.8663: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.8664: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.8665: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4
Source.8666: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.8667: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.8668: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8669: DFBPPR13389 ---- Animal proteins ---- Phosducin
Source.8670: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8671: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.8672: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22
Source.8673: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.8674: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.8675: DFBPPR13412 ---- Animal proteins ---- Dander allergen Equ c 2.0101
Source.8676: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8677: DFBPPR13422 ---- Animal proteins ---- Interferon gamma
Source.8678: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.8679: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8680: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.8681: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.8682: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.8683: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.8684: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.8685: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.8686: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.8687: DFBPPR13445 ---- Animal proteins ---- Interleukin-1 alpha
Source.8688: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.8689: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I
Source.8690: DFBPPR13448 ---- Animal proteins ---- Osteocalcin
Source.8691: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8692: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.8693: DFBPPR13454 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.8694: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P
Source.8695: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.8696: DFBPPR13464 ---- Animal proteins ---- Interferon tau
Source.8697: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.8698: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8699: DFBPPR13468 ---- Animal proteins ---- Hemoglobin subunit alpha-1
Source.8700: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.8701: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8702: DFBPPR13476 ---- Animal proteins ---- Hemoglobin subunit alpha-2
Source.8703: DFBPPR13478 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.8704: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.8705: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.8706: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.8707: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.8708: DFBPPR13488 ---- Animal proteins ---- Lysozyme C-2
Source.8709: DFBPPR13489 ---- Animal proteins ---- Lysozyme C-1
Source.8710: DFBPPR13491 ---- Animal proteins ---- Gastrin
Source.8711: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.8712: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.8713: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.8714: DFBPPR13505 ---- Animal proteins ---- Spectrin beta chain, non-erythrocytic 1
Source.8715: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.8716: DFBPPR13524 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.8717: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.8718: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.8719: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8720: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8721: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.8722: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.8723: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.8724: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.8725: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.8726: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.8727: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8728: DFBPPR13557 ---- Animal proteins ---- Interferon gamma
Source.8729: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.8730: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.8731: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8732: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.8733: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.8734: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.8735: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.8736: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.8737: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.8738: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.8739: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.8740: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.8741: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.8742: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.8743: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8744: DFBPPR13586 ---- Animal proteins ---- Fibroblast growth factor 1
Source.8745: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.8746: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8747: DFBPPR13592 ---- Animal proteins ---- Natriuretic peptides A
Source.8748: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.8749: DFBPPR13599 ---- Animal proteins ---- Beta-2-microglobulin
Source.8750: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor
Source.8751: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.8752: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.8753: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.8754: DFBPPR13606 ---- Animal proteins ---- Estrogen receptor
Source.8755: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.8756: DFBPPR13613 ---- Animal proteins ---- Phospholipase A2
Source.8757: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.8758: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.8759: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.8760: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.8761: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.8762: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8763: DFBPPR13625 ---- Animal proteins ---- Lysozyme C-1
Source.8764: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8765: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.8766: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.8767: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2
Source.8768: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.8769: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.8770: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.8771: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.8772: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.8773: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6
Source.8774: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.8775: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.8776: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11
Source.8777: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8778: DFBPPR13661 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2
Source.8779: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.8780: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.8781: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I
Source.8782: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.8783: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8784: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.8785: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.8786: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.8787: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.8788: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.8789: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8790: DFBPPR13692 ---- Animal proteins ---- Pro-neuropeptide Y
Source.8791: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.8792: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1
Source.8793: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.8794: DFBPPR13698 ---- Animal proteins ---- Progonadoliberin-1
Source.8795: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.8796: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.8797: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.8798: DFBPPR13707 ---- Animal proteins ---- Lysozyme C-3
Source.8799: DFBPPR13708 ---- Animal proteins ---- Renin
Source.8800: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.8801: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.8802: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.8803: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.8804: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.8805: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10
Source.8806: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.8807: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.8808: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8809: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1
Source.8810: DFBPPR13736 ---- Animal proteins ---- Cathelin-related peptide SC5
Source.8811: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.8812: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme
Source.8813: DFBPPR13741 ---- Animal proteins ---- Cathelin-related peptide SC5
Source.8814: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5
Source.8815: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9
Source.8816: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8
Source.8817: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7
Source.8818: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4
Source.8819: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic
Source.8820: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.8821: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.8822: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.8823: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8824: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.8825: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.8826: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.8827: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.8828: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8829: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.8830: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.8831: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.8832: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.8833: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.8834: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.8835: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.8836: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.8837: DFBPPR13791 ---- Animal proteins ---- Cholinesterase
Source.8838: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.8839: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.8840: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.8841: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone
Source.8842: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.8843: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.8844: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1
Source.8845: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.8846: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.8847: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin
Source.8848: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.8849: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.8850: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.8851: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.8852: DFBPPR13838 ---- Animal proteins ---- Endothelin-1
Source.8853: DFBPPR13841 ---- Animal proteins ---- Keratin-associated protein 6-1
Source.8854: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.8855: DFBPPR13851 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2A
Source.8856: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.8857: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.8858: DFBPPR13855 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.8859: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.8860: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.8861: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.8862: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9
Source.8863: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.8864: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.8865: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.8866: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.8867: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8868: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.8869: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.8870: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8871: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.8872: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8873: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.8874: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.8875: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.8876: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.8877: DFBPPR13902 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.8878: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.8879: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.8880: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.8881: DFBPPR13911 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2C
Source.8882: DFBPPR13914 ---- Animal proteins ---- Homeobox protein Hox-C6
Source.8883: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.8884: DFBPPR13935 ---- Animal proteins ---- Major centromere autoantigen B
Source.8885: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.8886: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.8887: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.8888: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.8889: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.8890: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.8891: DFBPPR13966 ---- Animal proteins ---- Promotilin
Source.8892: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8893: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.8894: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.8895: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.8896: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.8897: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.8898: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B
Source.8899: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.8900: DFBPPR13991 ---- Animal proteins ---- Osteocalcin
Source.8901: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.8902: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.8903: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.8904: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.8905: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.8906: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.8907: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.8908: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8909: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8910: DFBPPR14010 ---- Animal proteins ---- GTPase KRas
Source.8911: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8912: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.8913: DFBPPR14020 ---- Animal proteins ---- Parvalbumin alpha
Source.8914: DFBPPR14025 ---- Animal proteins ---- Granulin-1
Source.8915: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.8916: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.8917: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form
Source.8918: DFBPPR14054 ---- Animal proteins ---- Pro-neuropeptide Y
Source.8919: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form
Source.8920: DFBPPR14059 ---- Animal proteins ---- Beta-2-microglobulin
Source.8921: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.8922: DFBPPR14065 ---- Animal proteins ---- Lysozyme g
Source.8923: DFBPPR14070 ---- Animal proteins ---- 60S ribosomal protein L15
Source.8924: DFBPPR14071 ---- Marine protein ---- Somatotropin
Source.8925: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.8926: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.8927: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.8928: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.8929: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.8930: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.8931: DFBPPR14083 ---- Marine protein ---- RING-box protein 1
Source.8932: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.8933: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.8934: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.8935: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.8936: DFBPPR14098 ---- Marine protein ---- Nuclear cap-binding protein subunit 2
Source.8937: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.8938: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.8939: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9
Source.8940: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.8941: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.8942: DFBPPR14112 ---- Marine protein ---- Proteasome subunit beta type-6-A like protein
Source.8943: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.8944: DFBPPR14114 ---- Marine protein ---- Proteasome subunit beta type-6-B like protein
Source.8945: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.8946: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.8947: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.8948: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.8949: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.8950: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.8951: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.8952: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.8953: DFBPPR14132 ---- Marine protein ---- Calumenin-A
Source.8954: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.8955: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.8956: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.8957: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H
Source.8958: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.8959: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.8960: DFBPPR14151 ---- Marine protein ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.8961: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3
Source.8962: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.8963: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.8964: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.8965: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.8966: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.8967: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.8968: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.8969: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.8970: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.8971: DFBPPR14188 ---- Marine protein ---- DNA repair protein SWI5 homolog
Source.8972: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.8973: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1
Source.8974: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.8975: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.8976: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.8977: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.8978: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.8979: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.8980: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.8981: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial
Source.8982: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.8983: DFBPPR14228 ---- Marine protein ---- UPF0691 protein C9orf116 homolog
Source.8984: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin
Source.8985: DFBPPR14231 ---- Marine protein ---- Somatotropin
Source.8986: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.8987: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.8988: DFBPPR14239 ---- Marine protein ---- Gonadotropin subunit beta-1
Source.8989: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.8990: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.8991: DFBPPR14248 ---- Marine protein ---- Gonadoliberin-3
Source.8992: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3
Source.8993: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1
Source.8994: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.8995: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2
Source.8996: DFBPPR14261 ---- Marine protein ---- Beta-endorphin-2
Source.8997: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.8998: DFBPPR14266 ---- Marine protein ---- Gonadotropin subunit beta-1
Source.8999: DFBPPR14268 ---- Marine protein ---- Cytochrome c oxidase subunit 6C-1
Source.9000: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.9001: DFBPPR14271 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.9002: DFBPPR14274 ---- Marine protein ---- Cytochrome c oxidase subunit 7B-heart, mitochondrial
Source.9003: DFBPPR14275 ---- Marine protein ---- Cytochrome c oxidase subunit 7B-liver, mitochondrial
Source.9004: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.9005: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain
Source.9006: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.9007: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.9008: DFBPPR14294 ---- Marine protein ---- ATP synthase subunit c, chloroplastic
Source.9009: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.9010: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.9011: DFBPPR14298 ---- Marine protein ---- Acetolactate synthase small subunit
Source.9012: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.9013: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.9014: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.9015: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.9016: DFBPPR14307 ---- Marine protein ---- Uncharacterized protein ycf83
Source.9017: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.9018: DFBPPR14315 ---- Marine protein ---- Protein CfxQ homolog
Source.9019: DFBPPR14319 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic
Source.9020: DFBPPR14325 ---- Marine protein ---- Uncharacterized protein ycf20
Source.9021: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain
Source.9022: DFBPPR14327 ---- Marine protein ---- Allophycocyanin beta chain
Source.9023: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.9024: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.9025: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.9026: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9027: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.9028: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.9029: DFBPPR14334 ---- Marine protein ---- Ferredoxin-thioredoxin reductase, catalytic chain
Source.9030: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.9031: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9032: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.9033: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.9034: DFBPPR14343 ---- Marine protein ---- Anthranilate synthase component 2
Source.9035: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase
Source.9036: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.9037: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.9038: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.9039: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3
Source.9040: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.9041: DFBPPR14355 ---- Marine protein ---- ATP synthase subunit c, chloroplastic
Source.9042: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.9043: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit
Source.9044: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.9045: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.9046: DFBPPR14366 ---- Marine protein ---- Thioredoxin
Source.9047: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.9048: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.9049: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha
Source.9050: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.9051: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.9052: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.9053: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.9054: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.9055: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.9056: DFBPPR14395 ---- Marine protein ---- 30S ribosomal protein S13-2, chloroplastic
Source.9057: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain
Source.9058: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.9059: DFBPPR14400 ---- Marine protein ---- Heme oxygenase
Source.9060: DFBPPR14403 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.9061: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain
Source.9062: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4
Source.9063: DFBPPR14415 ---- Marine protein ---- Photosystem II reaction center protein H
Source.9064: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.9065: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.9066: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator
Source.9067: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.9068: DFBPPR14430 ---- Marine protein ---- 30S ribosomal protein S12, chloroplastic
Source.9069: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.9070: DFBPPR14449 ---- Marine protein ---- Photosystem II reaction center protein J
Source.9071: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.9072: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1
Source.9073: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.9074: DFBPPR14462 ---- Marine protein ---- Chromophore lyase CpcS/CpeS homolog
Source.9075: DFBPPR14471 ---- Marine protein ---- Uncharacterized protein ycf83
Source.9076: DFBPPR14472 ---- Marine protein ---- Photosystem I reaction center subunit XI
Source.9077: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.9078: DFBPPR14479 ---- Marine protein ---- Photosystem I assembly protein Ycf4
Source.9079: DFBPPR14484 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic
Source.9080: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.9081: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.9082: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.9083: DFBPPR14498 ---- Marine protein ---- 30S ribosomal protein S16, chloroplastic
Source.9084: DFBPPR14500 ---- Marine protein ---- 50S ribosomal protein L27, chloroplastic
Source.9085: DFBPPR14502 ---- Marine protein ---- 30S ribosomal protein S9, chloroplastic
Source.9086: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.9087: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.9088: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.9089: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23
Source.9090: DFBPPR14522 ---- Marine protein ---- Uncharacterized protein ycf20
Source.9091: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56
Source.9092: DFBPPR14528 ---- Marine protein ---- Uracil phosphoribosyltransferase homolog
Source.9093: DFBPPR14529 ---- Marine protein ---- Uncharacterized protein ycf22
Source.9094: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.9095: DFBPPR14534 ---- Marine protein ---- Uncharacterized protein ORF62
Source.9096: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.9097: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.9098: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.9099: DFBPPR14541 ---- Marine protein ---- Somatotropin-1
Source.9100: DFBPPR14542 ---- Marine protein ---- Somatotropin-2
Source.9101: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.9102: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.9103: DFBPPR14545 ---- Marine protein ---- Ghrelin
Source.9104: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.9105: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.9106: DFBPPR14551 ---- Marine protein ---- Histone H4
Source.9107: DFBPPR14552 ---- Marine protein ---- Lysozyme C II
Source.9108: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.9109: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.9110: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.9111: DFBPPR14557 ---- Marine protein ---- Interferon a3
Source.9112: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.9113: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.9114: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.9115: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.9116: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.9117: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.9118: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.9119: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.9120: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.9121: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.9122: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I
Source.9123: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.9124: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.9125: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.9126: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.9127: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.9128: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.9129: DFBPPR14602 ---- Marine protein ---- Proteasome subunit beta type-3
Source.9130: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.9131: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9
Source.9132: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.9133: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a
Source.9134: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.9135: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.9136: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.9137: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.9138: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.9139: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.9140: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.9141: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.9142: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18
Source.9143: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.9144: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.9145: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.9146: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin
Source.9147: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.9148: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.9149: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.9150: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.9151: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.9152: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.9153: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.9154: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.9155: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.9156: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.9157: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.9158: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.9159: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.9160: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3
Source.9161: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.9162: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.9163: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.9164: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.9165: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.9166: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.9167: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.9168: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.9169: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.9170: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.9171: DFBPPR14755 ---- Marine protein ---- Techylectin-5A
Source.9172: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.9173: DFBPPR14759 ---- Marine protein ---- Tachystatin-A2
Source.9174: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.9175: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.9176: DFBPPR14768 ---- Marine protein ---- Tachylectin-2
Source.9177: DFBPPR14769 ---- Marine protein ---- Tachystatin-A1
Source.9178: DFBPPR14770 ---- Marine protein ---- Lectin L6
Source.9179: DFBPPR14776 ---- Marine protein ---- Proteinase inhibitor
Source.9180: DFBPPR14777 ---- Marine protein ---- Tachystatin-C
Source.9181: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.9182: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.9183: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.9184: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.9185: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.9186: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.9187: DFBPPR14793 ---- Marine protein ---- Panulirin
Source.9188: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.9189: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.9190: DFBPPR14798 ---- Marine protein ---- Panusin
Source.9191: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.9192: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.9193: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.9194: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.9195: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.9196: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.9197: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.9198: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.9199: DFBPPR14811 ---- Marine protein ---- Crustacean hyperglycemic hormone
Source.9200: DFBPPR14812 ---- Marine protein ---- Alpha-2-macroglobulin homolog
Source.9201: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.9202: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.9203: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.9204: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.9205: DFBPPR14838 ---- Marine protein ---- Hemocyanin subunit 4
Source.9206: DFBPPR14843 ---- Marine protein ---- Cuticle protein AMP5
Source.9207: DFBPPR14847 ---- Marine protein ---- Cuticle protein AMP2
Source.9208: DFBPPR14848 ---- Marine protein ---- Cuticle protein AMP3
Source.9209: DFBPPR14850 ---- Marine protein ---- Cuticle protein AMP1B
Source.9210: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.9211: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.9212: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.9213: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.9214: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.9215: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.9216: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.9217: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.9218: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.9219: DFBPPR14880 ---- Microorganism protein ---- Spindle assembly checkpoint kinase
Source.9220: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.9221: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.9222: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.9223: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.9224: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.9225: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.9226: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.9227: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.9228: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.9229: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.9230: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.9231: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.9232: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.9233: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.9234: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.9235: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.9236: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.9237: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.9238: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.9239: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.9240: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.9241: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.9242: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.9243: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.9244: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.9245: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.9246: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.9247: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.9248: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.9249: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.9250: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.9251: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.9252: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.9253: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.9254: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.9255: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.9256: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.9257: DFBPPR14936 ---- Microorganism protein ---- Inner kinetochore subunit MCM21
Source.9258: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.9259: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.9260: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5
Source.9261: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.9262: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.9263: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.9264: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.9265: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.9266: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.9267: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.9268: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.9269: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.9270: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.9271: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.9272: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.9273: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial
Source.9274: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.9275: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.9276: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.9277: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.9278: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.9279: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.9280: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.9281: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.9282: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.9283: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.9284: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.9285: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.9286: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.9287: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.9288: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit
Source.9289: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.9290: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.9291: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.9292: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.9293: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.9294: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.9295: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.9296: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.9297: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.9298: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.9299: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.9300: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1
Source.9301: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.9302: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.9303: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.9304: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.9305: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.9306: DFBPPR15018 ---- Microorganism protein ---- Sorting nexin-4
Source.9307: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.9308: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.9309: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.9310: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.9311: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.9312: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.9313: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.9314: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.9315: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.9316: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.9317: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.9318: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.9319: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.9320: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.9321: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.9322: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.9323: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.9324: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.9325: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.9326: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1
Source.9327: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.9328: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13
Source.9329: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.9330: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.9331: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.9332: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.9333: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.9334: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.9335: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.9336: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.9337: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.9338: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.9339: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.9340: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.9341: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2
Source.9342: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.9343: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.9344: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.9345: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase
Source.9346: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.9347: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.9348: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.9349: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial
Source.9350: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.9351: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.9352: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.9353: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.9354: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.9355: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.9356: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.9357: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.9358: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.9359: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.9360: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1
Source.9361: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.9362: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.9363: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.9364: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.9365: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G
Source.9366: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase
Source.9367: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.9368: DFBPPR15128 ---- Microorganism protein ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.9369: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.9370: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.9371: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.9372: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.9373: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.9374: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A
Source.9375: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.9376: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.9377: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.9378: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.9379: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase
Source.9380: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.9381: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.9382: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.9383: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.9384: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.9385: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.9386: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1
Source.9387: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.9388: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.9389: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.9390: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.9391: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2
Source.9392: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.9393: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.9394: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.9395: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.9396: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.9397: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.9398: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.9399: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.9400: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.9401: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.9402: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.9403: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.9404: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.9405: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.9406: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I
Source.9407: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase
Source.9408: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.9409: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.9410: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1
Source.9411: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.9412: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1
Source.9413: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.9414: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.9415: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.9416: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.9417: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.9418: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.9419: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.9420: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.9421: DFBPPR15222 ---- Microorganism protein ---- DASH complex subunit ASK1
Source.9422: DFBPPR15223 ---- Microorganism protein ---- FK506-binding protein 2
Source.9423: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.9424: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.9425: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.9426: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.9427: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.9428: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.9429: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2
Source.9430: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.9431: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.9432: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.9433: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.9434: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2
Source.9435: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38
Source.9436: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.9437: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.9438: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.9439: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.9440: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.9441: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.9442: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.9443: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.9444: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1
Source.9445: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.9446: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.9447: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.9448: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.9449: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.9450: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20
Source.9451: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.9452: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.9453: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.9454: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.9455: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D
Source.9456: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta
Source.9457: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.9458: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.9459: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.9460: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80
Source.9461: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.9462: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.9463: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.9464: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.9465: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1
Source.9466: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14
Source.9467: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.9468: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial
Source.9469: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.9470: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.9471: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.9472: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.9473: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.9474: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.9475: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.9476: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.9477: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.9478: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.9479: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.9480: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.9481: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.9482: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.9483: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.9484: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.9485: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.9486: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.9487: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.9488: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.9489: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.9490: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.9491: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.9492: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.9493: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.9494: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.9495: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.9496: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.9497: DFBPPR15372 ---- Microorganism protein ---- Protein AF-9 homolog
Source.9498: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.9499: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.9500: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.9501: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.9502: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.9503: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.9504: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17
Source.9505: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.9506: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.9507: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.9508: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.9509: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.9510: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.9511: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.9512: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.9513: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.9514: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.9515: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.9516: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.9517: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59
Source.9518: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.9519: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16
Source.9520: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.9521: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.9522: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.9523: DFBPPR15427 ---- Microorganism protein ---- RNA exonuclease 4
Source.9524: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24
Source.9525: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.9526: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.9527: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.9528: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.9529: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.9530: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.9531: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0
Source.9532: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.9533: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.9534: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.9535: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.9536: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.9537: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1
Source.9538: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.9539: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.9540: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.9541: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.9542: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4
Source.9543: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.9544: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.9545: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1
Source.9546: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.9547: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1
Source.9548: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.9549: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.9550: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.9551: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.9552: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.9553: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.9554: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.9555: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.9556: DFBPPR15520 ---- Microorganism protein ---- Protein YAE1
Source.9557: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.9558: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23
Source.9559: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.9560: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta
Source.9561: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.9562: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.9563: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.9564: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.9565: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4
Source.9566: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial
Source.9567: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.9568: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.9569: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26
Source.9570: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.9571: DFBPPR15561 ---- Microorganism protein ---- Ribosome biogenesis protein SLX9
Source.9572: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2
Source.9573: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.9574: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.9575: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381
Source.9576: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.9577: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.9578: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.9579: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.9580: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.9581: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.9582: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4
Source.9583: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.9584: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.9585: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.9586: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.9587: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial
Source.9588: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.9589: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13
Source.9590: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.9591: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.9592: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.9593: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.9594: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.9595: DFBPPR15618 ---- Microorganism protein ---- Ribosome assembly protein 3
Source.9596: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.9597: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.9598: DFBPPR15624 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit VAB2
Source.9599: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.9600: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.9601: DFBPPR15627 ---- Microorganism protein ---- Multiprotein-bridging factor 1
Source.9602: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.9603: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1
Source.9604: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.9605: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16
Source.9606: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3
Source.9607: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3
Source.9608: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.9609: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22
Source.9610: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.9611: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18
Source.9612: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1
Source.9613: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.9614: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.9615: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.9616: DFBPPR15672 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLI1
Source.9617: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.9618: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.9619: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.9620: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.9621: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.9622: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.9623: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.9624: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.9625: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.9626: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4
Source.9627: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.9628: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.9629: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.9630: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.9631: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45
Source.9632: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.9633: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.9634: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.9635: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.9636: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.9637: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.9638: DFBPPR15722 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 18, mitochondrial
Source.9639: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.9640: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.9641: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.9642: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.9643: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.9644: DFBPPR15734 ---- Microorganism protein ---- 40S ribosomal protein S29
Source.9645: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.9646: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.9647: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.9648: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.9649: DFBPPR15746 ---- Microorganism protein ---- Topoisomerase I damage affected protein 11
Source.9650: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.9651: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial
Source.9652: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.9653: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.9654: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.9655: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.9656: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3
Source.9657: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.9658: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial
Source.9659: DFBPPR15766 ---- Microorganism protein ---- Protein ATC1/LIC4
Source.9660: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.9661: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.9662: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.9663: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.9664: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial
Source.9665: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.9666: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.9667: DFBPPR15777 ---- Microorganism protein ---- FAS1 domain-containing protein KLLA0E16841g
Source.9668: DFBPPR15781 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 5
Source.9669: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.9670: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2
Source.9671: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.9672: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.9673: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.9674: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.9675: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.9676: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.9677: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase
Source.9678: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.9679: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component
Source.9680: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.9681: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.9682: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.9683: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.9684: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.9685: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.9686: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.9687: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.9688: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.9689: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.9690: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.9691: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.9692: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.9693: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.9694: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.9695: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.9696: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin
Source.9697: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.9698: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.9699: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.9700: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.9701: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.9702: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.9703: DFBPPR15859 ---- Microorganism protein ---- Histone H4
Source.9704: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.9705: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.9706: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.9707: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.9708: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.9709: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.9710: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.9711: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.9712: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.9713: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.9714: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.9715: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.9716: DFBPPR15886 ---- Microorganism protein ---- Capsid protein
Source.9717: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.9718: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.9719: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.9720: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.9721: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.9722: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9723: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.9724: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.9725: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.9726: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.9727: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.9728: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.9729: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.9730: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.9731: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.9732: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.9733: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.9734: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.9735: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.9736: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.9737: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9738: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.9739: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.9740: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.9741: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9742: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic
Source.9743: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.9744: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic
Source.9745: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9746: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.9747: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.9748: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.9749: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.9750: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.9751: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.9752: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.9753: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9754: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.9755: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9756: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.9757: DFBPPR7798 ---- Plant protein ---- ATP synthase subunit c, chloroplastic
Source.9758: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.9759: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.9760: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.9761: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9762: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.9763: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9764: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.9765: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.9766: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9767: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.9768: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.9769: DFBPPR7815 ---- Plant protein ---- Photosystem II reaction center protein H
Source.9770: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.9771: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.9772: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9773: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9774: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9775: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.9776: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.9777: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.9778: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9779: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.9780: DFBPPR7832 ---- Plant protein ---- Extensin
Source.9781: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.9782: DFBPPR7837 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.9783: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.9784: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.9785: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.9786: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.9787: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.9788: DFBPPR7843 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9789: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.9790: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.9791: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.9792: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9793: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.9794: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.9795: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.9796: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.9797: DFBPPR7859 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.9798: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.9799: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4
Source.9800: DFBPPR7872 ---- Plant protein ---- Photosystem II reaction center protein J
Source.9801: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1
Source.9802: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.9803: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.9804: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.9805: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.9806: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.9807: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.9808: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.9809: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.9810: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.9811: DFBPPR7910 ---- Plant protein ---- Glycine-rich RNA-binding protein 2
Source.9812: DFBPPR7911 ---- Plant protein ---- Glycine-rich RNA-binding protein 1
Source.9813: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4
Source.9814: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.9815: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.9816: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.9817: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.9818: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.9819: DFBPPR7933 ---- Plant protein ---- FK506-binding protein 2
Source.9820: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.9821: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.9822: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.9823: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.9824: DFBPPR7939 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase FKBP12
Source.9825: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.9826: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.9827: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.9828: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.9829: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.9830: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.9831: DFBPPR7986 ---- Plant protein ---- Uncharacterized mitochondrial protein ORF154
Source.9832: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2
Source.9833: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.9834: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9835: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9836: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.9837: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.9838: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.9839: DFBPPR8004 ---- Plant protein ---- Photosystem II reaction center protein J
Source.9840: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.9841: DFBPPR8011 ---- Plant protein ---- Endochitinase 1
Source.9842: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.9843: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.9844: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.9845: DFBPPR8029 ---- Plant protein ---- Vignain
Source.9846: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.9847: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.9848: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.9849: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.9850: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.9851: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.9852: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9853: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.9854: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.9855: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.9856: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.9857: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9858: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.9859: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.9860: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.9861: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.9862: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.9863: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9864: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.9865: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.9866: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.9867: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9868: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.9869: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.9870: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.9871: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9872: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.9873: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9874: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.9875: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.9876: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9877: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.9878: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.9879: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.9880: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.9881: DFBPPR8077 ---- Plant protein ---- ATP synthase subunit c, chloroplastic
Source.9882: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.9883: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.9884: DFBPPR8080 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.9885: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.9886: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9887: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.9888: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.9889: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.9890: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.9891: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.9892: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.9893: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9894: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.9895: DFBPPR8101 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.9896: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.9897: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9898: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.9899: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9900: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.9901: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.9902: DFBPPR8115 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.9903: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9904: DFBPPR8119 ---- Plant protein ---- Chalcone--flavonone isomerase
Source.9905: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.9906: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8
Source.9907: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.9908: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.9909: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9910: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.9911: DFBPPR8130 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.9912: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.9913: DFBPPR8140 ---- Plant protein ---- Photosystem II reaction center protein J
Source.9914: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.9915: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.9916: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.9917: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.9918: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0
Source.9919: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.9920: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.9921: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.9922: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.9923: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.9924: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.9925: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.9926: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9927: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.9928: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.9929: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.9930: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9931: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9932: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.9933: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.9934: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.9935: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.9936: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.9937: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9938: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.9939: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9940: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.9941: DFBPPR8244 ---- Plant protein ---- ATP synthase subunit c, chloroplastic
Source.9942: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.9943: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9944: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9945: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9946: DFBPPR8253 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.9947: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.9948: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.9949: DFBPPR8258 ---- Plant protein ---- Ribosomal protein S12, mitochondrial
Source.9950: DFBPPR8261 ---- Plant protein ---- Photosystem II reaction center protein H
Source.9951: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9952: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.9953: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.9954: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.9955: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.9956: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9957: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.9958: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.9959: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9960: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9961: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.9962: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.9963: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9964: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4
Source.9965: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.9966: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.9967: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.9968: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.9969: DFBPPR8308 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.9970: DFBPPR8310 ---- Plant protein ---- 30S ribosomal protein S14, chloroplastic
Source.9971: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.9972: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.9973: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.9974: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.9975: DFBPPR8322 ---- Plant protein ---- Photosystem II reaction center protein J
Source.9976: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1
Source.9977: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.9978: DFBPPR8350 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic
Source.9979: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)NCC(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 2882, 3553, 8936, 9508
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214