E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0072(Multifunctional peptide)
DFBP ID DFBPMUFU0072
Peptide sequence YAN
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0181 Tenebrio molitor (L.) larva Tenebrio molitor larva protein hydrolysates

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0905 Tenebrio molitor (L.) larva Tenebrio molitor larva protein hydrolysates

N.D

Physical & computational properties
Three-letter amino acid Tyr-Ala-Asn
Single-letter amino acid YAN
Peptide length 3
Theoretical mass 366.37 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
GRAVY -1.0000
Hydrophilic residue ratio 33.33%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.2: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.3: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.4: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.5: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.6: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.7: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.8: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.9: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.10: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.11: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.12: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.13: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.14: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.15: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.16: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.17: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.18: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.19: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.20: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.21: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.22: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic
Source.23: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.24: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.25: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.26: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.27: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.28: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.29: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.30: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.31: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.32: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.33: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.34: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.35: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.36: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.37: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.38: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.39: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.40: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.41: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.42: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.43: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.44: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.45: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.46: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.47: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.48: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1
Source.49: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2
Source.50: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.51: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.52: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.53: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.54: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.55: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.56: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.57: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.58: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.59: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.60: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.61: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.62: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.63: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.64: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.65: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.66: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.67: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.68: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.69: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.70: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.71: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.72: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.73: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.74: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.75: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.76: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.77: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.78: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.79: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.80: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.81: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.82: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.83: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.84: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.85: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.86: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.87: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.88: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.89: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.90: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.91: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.92: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.93: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.94: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.95: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.96: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.97: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.98: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.99: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.100: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.101: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.102: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.103: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.104: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.105: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.106: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.107: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.108: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta
Source.109: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.110: DFBPPR3397 ---- Plant proteins ---- Probable membrane-associated 30 kDa protein, chloroplastic
Source.111: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.112: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.113: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.114: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.115: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.116: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.117: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.118: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.119: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.120: DFBPPR3750 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic
Source.121: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.122: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.123: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.124: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.125: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.126: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.127: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.128: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.129: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.130: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11
Source.131: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.132: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.133: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.134: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.135: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.136: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.137: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.138: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.139: DFBPPR4451 ---- Plant proteins ---- Mini zinc finger protein 2
Source.140: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.141: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.142: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.143: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.144: DFBPPR4564 ---- Plant proteins ---- Mini zinc finger protein 1
Source.145: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.146: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.147: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.148: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.149: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.150: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.151: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.152: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.153: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.154: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.155: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.156: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.157: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.158: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.159: DFBPPR5205 ---- Plant proteins ---- Urease
Source.160: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.161: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.162: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.163: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.164: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.165: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.166: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.167: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.168: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.169: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.170: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.171: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.172: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.173: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1
Source.174: DFBPPR5919 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic
Source.175: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.176: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.177: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.178: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.179: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.180: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.181: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.182: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.183: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.184: DFBPPR6458 ---- Plant proteins ---- Convicilin
Source.185: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.186: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin
Source.187: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.188: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.189: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.190: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.191: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.192: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin
Source.193: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.194: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.195: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.196: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.197: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.198: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.199: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.200: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.201: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.202: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.203: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3
Source.204: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.205: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.206: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.207: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.208: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.209: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.210: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.211: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.212: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.213: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.214: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.215: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.216: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.217: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.218: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1
Source.219: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.220: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.221: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.222: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.223: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.224: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.225: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.226: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.227: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.228: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.229: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.230: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.231: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.232: DFBPPR16654 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 1
Source.233: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.234: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.235: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.236: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.237: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.238: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.239: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.240: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.241: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.242: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.243: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.244: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.245: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.246: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.247: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.248: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.249: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.250: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.251: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.252: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.253: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.254: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.255: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.256: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.257: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.258: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.259: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.260: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.261: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.262: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.263: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.264: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.265: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.266: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.267: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.268: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.269: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.270: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.271: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.272: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.273: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.274: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.275: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.276: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.277: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.278: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.279: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.280: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.281: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.282: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.283: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain
Source.284: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.285: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.286: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.287: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.288: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.289: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.290: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.291: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.292: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.293: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.294: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.295: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.296: DFBPPR19756 ---- Animal proteins ---- Ras-related protein Rab-1B
Source.297: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.298: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.299: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.300: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.301: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.302: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.303: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.304: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.305: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.306: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.307: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.308: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4
Source.309: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.310: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.311: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog
Source.312: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.313: DFBPPR20771 ---- Animal proteins ---- Dynein light chain roadblock-type 1
Source.314: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.315: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.316: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.317: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.318: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.319: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.320: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.321: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.322: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.323: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner
Source.324: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.325: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.326: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.327: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.328: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.329: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.330: DFBPPR21824 ---- Animal proteins ---- Transcription factor Spi-C
Source.331: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.332: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.333: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.334: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.335: DFBPPR22407 ---- Animal proteins ---- TSSK6-activating co-chaperone protein
Source.336: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.337: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.338: DFBPPR22576 ---- Animal proteins ---- UPF0547 protein C16orf87 homolog
Source.339: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.340: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.341: DFBPPR22757 ---- Animal proteins ---- Uncharacterized protein CXorf65 homolog
Source.342: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.343: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.344: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.345: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.346: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor
Source.347: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.348: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.349: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase
Source.350: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.351: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.352: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.353: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.354: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.355: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.356: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.357: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.358: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.359: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D
Source.360: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.361: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.362: DFBPPR9334 ---- Animal proteins ---- Seminal plasma acrosin inhibitor A1
Source.363: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.364: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.365: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.366: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.367: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.368: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.369: DFBPPR9547 ---- Animal proteins ---- Ras-related protein Rab-1B
Source.370: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.371: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1
Source.372: DFBPPR9652 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.373: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.374: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.375: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.376: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.377: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.378: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.379: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.380: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.381: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.382: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.383: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.384: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.385: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.386: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.387: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.388: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.389: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.390: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.391: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.392: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.393: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.394: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.395: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.396: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.397: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.398: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.399: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.400: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1
Source.401: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.402: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.403: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.404: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.405: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.406: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.407: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.408: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.409: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.410: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.411: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.412: DFBPPR11048 ---- Animal proteins ---- Calcitonin
Source.413: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.414: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.415: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.416: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.417: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.418: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.419: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.420: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.421: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.422: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42
Source.423: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.424: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.425: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.426: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.427: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.428: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.429: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.430: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.431: DFBPPR11651 ---- Animal proteins ---- Vitelline membrane outer layer protein 1
Source.432: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.433: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.434: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.435: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.436: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.437: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog
Source.438: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.439: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.440: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.441: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.442: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.443: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.444: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.445: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.446: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.447: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.448: DFBPPR12543 ---- Animal proteins ---- Serine/threonine-protein phosphatase 5
Source.449: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.450: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.451: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.452: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.453: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.454: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1
Source.455: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.456: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.457: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.458: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.459: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.460: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.461: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.462: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.463: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.464: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.465: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.466: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.467: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.468: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.469: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.470: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.471: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.472: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.473: DFBPPR13946 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 1
Source.474: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.475: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.476: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.477: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.478: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.479: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.480: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.481: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.482: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.483: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog
Source.484: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.485: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.486: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.487: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.488: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.489: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.490: DFBPPR14441 ---- Marine protein ---- 30S ribosomal protein S8, chloroplastic
Source.491: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.492: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.493: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.494: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.495: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.496: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.497: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.498: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.499: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.500: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.501: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.502: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.503: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.504: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.505: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.506: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.507: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.508: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.509: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.510: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.511: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.512: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.513: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.514: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.515: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.516: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.517: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.518: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.519: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.520: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.521: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4
Source.522: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.523: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.524: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein
Source.525: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.526: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.527: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.528: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.529: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.530: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.531: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.532: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.533: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.534: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin
Source.535: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.536: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.537: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.538: DFBPPR7878 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic
Source.539: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.540: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.541: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.542: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.543: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.544: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.545: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Taste proterties & Structure
Bitterness
Non-bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP -
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214