E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0115(Multifunctional peptide)
DFBP ID DFBPMUFU0115
Peptide sequence VMP
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0373 Human milk protein β-Casein

f(99-101)

PEP-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPPEPI0080 Human milk protein β-Casein

f(99-101)

Physical & computational properties
Three-letter amino acid Val-Met-Pro
Single-letter amino acid VMP
Peptide length 3
Theoretical mass 345.46 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
GRAVY 1.5000
Hydrophilic residue ratio 100%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.2: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.3: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.4: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.5: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.6: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.7: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.8: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.9: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.10: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.11: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.12: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.13: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.14: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.15: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.16: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.17: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.18: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.19: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.20: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.21: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.22: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.23: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.24: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.25: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.26: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.27: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.28: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.29: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.30: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.31: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.32: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.33: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.34: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.35: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.36: DFBPPR2096 ---- Plant proteins ---- Peroxiredoxin-2E-1, chloroplastic
Source.37: DFBPPR2148 ---- Plant proteins ---- Auxin-responsive protein SAUR36
Source.38: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.39: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.40: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.41: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.42: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.43: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.44: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.45: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.46: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.47: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.48: DFBPPR2491 ---- Plant proteins ---- Expansin-A10
Source.49: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.50: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.51: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.52: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.53: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.54: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.55: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.56: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.57: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.58: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.59: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.60: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.61: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.62: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.63: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.64: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.65: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.66: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.67: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.68: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.69: DFBPPR3170 ---- Plant proteins ---- Probable histone H2A.2
Source.70: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.71: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7
Source.72: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1
Source.73: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.74: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3
Source.75: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.76: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.77: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.78: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.79: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.80: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.81: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.82: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.83: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.84: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.85: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.86: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase
Source.87: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.88: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.89: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.90: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7
Source.91: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.92: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.93: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.94: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g
Source.95: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.96: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.97: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.98: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.99: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.100: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.101: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.102: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.103: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.104: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.105: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.106: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.107: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.108: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.109: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.110: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.111: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.112: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.113: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.114: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.115: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.116: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.117: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.118: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.119: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.120: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.121: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.122: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.123: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.124: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.125: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.126: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.127: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.128: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.129: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic
Source.130: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.131: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.132: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.133: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.134: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.135: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.136: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2
Source.137: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.138: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.139: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.140: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.141: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.142: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.143: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.144: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.145: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.146: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.147: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.148: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.149: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.150: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.151: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.152: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.153: DFBPPR5896 ---- Plant proteins ---- 50 kDa gamma-zein
Source.154: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.155: DFBPPR6007 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.156: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.157: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.158: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.159: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.160: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.161: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.162: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.163: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.164: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.165: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.166: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.167: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.168: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7
Source.169: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4
Source.170: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.171: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.172: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.173: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.174: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.175: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.176: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.177: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.178: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.179: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.180: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.181: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.182: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.183: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.184: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.185: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.186: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.187: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.188: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.189: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.190: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.191: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.192: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.193: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.194: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.195: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.196: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.197: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.198: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.199: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.200: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.201: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.202: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.203: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.204: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.205: DFBPPR16345 ---- Animal proteins ---- Interleukin-10
Source.206: DFBPPR16378 ---- Animal proteins ---- Arginine esterase
Source.207: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.208: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.209: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.210: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.211: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.212: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.213: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.214: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.215: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.216: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.217: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.218: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.219: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.220: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.221: DFBPPR16981 ---- Animal proteins ---- Clusterin
Source.222: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.223: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.224: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.225: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.226: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.227: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.228: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.229: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.230: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.231: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.232: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.233: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.234: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.235: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.236: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.237: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.238: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.239: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.240: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA
Source.241: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.242: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.243: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.244: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.245: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.246: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38
Source.247: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.248: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.249: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.250: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.251: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.252: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B
Source.253: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.254: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.255: DFBPPR18312 ---- Animal proteins ---- Interleukin-10
Source.256: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.257: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.258: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.259: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22
Source.260: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.261: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.262: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.263: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.264: DFBPPR18769 ---- Animal proteins ---- Histone H3.3C
Source.265: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.266: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.267: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1
Source.268: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.269: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.270: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.271: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.272: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.273: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.274: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.275: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.276: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.277: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.278: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.279: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.280: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.281: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.282: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.283: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit
Source.284: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.285: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.286: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.287: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.288: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.289: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.290: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.291: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.292: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.293: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.294: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.295: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.296: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.297: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.298: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.299: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.300: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.301: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.302: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.303: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.304: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.305: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.306: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.307: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.308: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.309: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.310: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.311: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.312: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.313: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.314: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.315: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.316: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3
Source.317: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.318: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.319: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.320: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.321: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.322: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.323: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.324: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.325: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.326: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.327: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.328: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.329: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.330: DFBPPR21531 ---- Animal proteins ---- 60S ribosomal protein L13
Source.331: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.332: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.333: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.334: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.335: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.336: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.337: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.338: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19
Source.339: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.340: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2
Source.341: DFBPPR22030 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 25 kDa protein
Source.342: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.343: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.344: DFBPPR22200 ---- Animal proteins ---- Profilin-4
Source.345: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.346: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.347: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.348: DFBPPR22533 ---- Animal proteins ---- Coiled-coil domain-containing protein 160
Source.349: DFBPPR22575 ---- Animal proteins ---- UPF0687 protein C20orf27 homolog
Source.350: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.351: DFBPPR22723 ---- Animal proteins ---- Testis-expressed protein 43
Source.352: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.353: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.354: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.355: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.356: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.357: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.358: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.359: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.360: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.361: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA
Source.362: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.363: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.364: DFBPPR8865 ---- Animal proteins ---- Haptoglobin
Source.365: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.366: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.367: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.368: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.369: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B
Source.370: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.371: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.372: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.373: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.374: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.375: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.376: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.377: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.378: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.379: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.380: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.381: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.382: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.383: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.384: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.385: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E
Source.386: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.387: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.388: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.389: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.390: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.391: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.392: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.393: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.394: DFBPPR9841 ---- Animal proteins ---- Interleukin-10
Source.395: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.396: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.397: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19
Source.398: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.399: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.400: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.401: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.402: DFBPPR10082 ---- Animal proteins ---- Pinopsin
Source.403: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.404: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.405: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.406: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.407: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.408: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.409: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.410: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.411: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.412: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.413: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.414: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.415: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.416: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.417: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.418: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.419: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.420: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.421: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA
Source.422: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.423: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.424: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.425: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.426: DFBPPR10755 ---- Animal proteins ---- Draxin
Source.427: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.428: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.429: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.430: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.431: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.432: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.433: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.434: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.435: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.436: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.437: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.438: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.439: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.440: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.441: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.442: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B
Source.443: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.444: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.445: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.446: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.447: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.448: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.449: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.450: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13
Source.451: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.452: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.453: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.454: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.455: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.456: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.457: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.458: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.459: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.460: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.461: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.462: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.463: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.464: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.465: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.466: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.467: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.468: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.469: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.470: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.471: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.472: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.473: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.474: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.475: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.476: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.477: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.478: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.479: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.480: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.481: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.482: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.483: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.484: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.485: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.486: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.487: DFBPPR12642 ---- Animal proteins ---- Haptoglobin
Source.488: DFBPPR12643 ---- Animal proteins ---- Haptoglobin
Source.489: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.490: DFBPPR12797 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 1
Source.491: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.492: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor
Source.493: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.494: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.495: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.496: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.497: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.498: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.499: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.500: DFBPPR13167 ---- Animal proteins ---- Natriuretic peptides A
Source.501: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.502: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.503: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.504: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta
Source.505: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.506: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.507: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.508: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.509: DFBPPR13308 ---- Animal proteins ---- Interleukin-10
Source.510: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.511: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.512: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.513: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.514: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.515: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.516: DFBPPR13651 ---- Animal proteins ---- Clusterin
Source.517: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA
Source.518: DFBPPR13664 ---- Animal proteins ---- Interleukin-10
Source.519: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.520: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.521: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.522: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.523: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.524: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.525: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA
Source.526: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.527: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.528: DFBPPR14175 ---- Marine protein ---- Draxin-B
Source.529: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.530: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.531: DFBPPR14358 ---- Marine protein ---- Thiazole synthase
Source.532: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.533: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.534: DFBPPR14438 ---- Marine protein ---- 50S ribosomal protein L1, chloroplastic
Source.535: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY
Source.536: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.537: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin
Source.538: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.539: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.540: DFBPPR14812 ---- Marine protein ---- Alpha-2-macroglobulin homolog
Source.541: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.542: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.543: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.544: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.545: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.546: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.547: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.548: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.549: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.550: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase
Source.551: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.552: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.553: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase
Source.554: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.555: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.556: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.557: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.558: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.559: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.560: DFBPPR15737 ---- Microorganism protein ---- Required for respiratory growth protein 9, mitochondrial
Source.561: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.562: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.563: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.564: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.565: DFBPPR7866 ---- Plant protein ---- Photosystem II reaction center protein K
Source.566: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.567: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.568: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.569: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.570: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.571: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.572: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.573: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 2617
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214