E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0120(Multifunctional peptide)
DFBP ID DFBPMUFU0120
Peptide sequence IVVE
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0431 Chlorella vulgaris Chlorella vulgaris powder hydrolysates

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0443 Chlorella vulgaris Chlorella vulgaris powder hydrolysates

N.D

Physical & computational properties
Three-letter amino acid Ile-Val-Val-Glu
Single-letter amino acid IVVE
Peptide length 4
Theoretical mass 458.55 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
GRAVY 2.3500
Hydrophilic residue ratio 75%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.2: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.3: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.4: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.5: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.6: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.7: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.8: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.9: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.10: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.11: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.12: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.13: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.14: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.15: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.16: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.17: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.18: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.19: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.20: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.21: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.22: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.23: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300
Source.24: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.25: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.26: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.27: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.28: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.29: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.30: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.31: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.32: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.33: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.34: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.35: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.36: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.37: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.38: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.39: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.40: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.41: DFBPPR4422 ---- Plant proteins ---- Thioredoxin-like protein CXXS1
Source.42: DFBPPR4514 ---- Plant proteins ---- Actin-depolymerizing factor 10
Source.43: DFBPPR4636 ---- Plant proteins ---- Putative actin-depolymerizing factor 8
Source.44: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.45: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.46: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.47: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.48: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.49: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.50: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.51: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.52: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.53: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1
Source.54: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.55: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.56: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.57: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.58: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.59: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.60: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.61: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.62: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.63: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.64: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.65: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.66: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.67: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.68: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.69: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.70: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.71: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.72: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.73: DFBPPR7520 ---- Plant proteins ---- 40S ribosomal protein S15a
Source.74: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.75: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.76: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.77: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.78: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.79: DFBPPR16258 ---- Animal proteins ---- Decorin
Source.80: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.81: DFBPPR16816 ---- Animal proteins ---- Decorin
Source.82: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.83: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.84: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.85: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.86: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.87: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.88: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.89: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.90: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26
Source.91: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5
Source.92: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.93: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.94: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.95: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.96: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.97: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.98: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.99: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.100: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.101: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.102: DFBPPR21428 ---- Animal proteins ---- Protein LBH
Source.103: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.104: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.105: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.106: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.107: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.108: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.109: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.110: DFBPPR9366 ---- Animal proteins ---- Decorin
Source.111: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.112: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.113: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.114: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.115: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.116: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.117: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.118: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.119: DFBPPR12112 ---- Animal proteins ---- Protein LBH
Source.120: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.121: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.122: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.123: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.124: DFBPPR13240 ---- Animal proteins ---- Decorin
Source.125: DFBPPR13793 ---- Animal proteins ---- Decorin
Source.126: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.127: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.128: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.129: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.130: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.131: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.132: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.133: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.134: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.135: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region
Source.136: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.137: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic
Source.138: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.139: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.140: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.141: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 3260
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214