E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0141(Multifunctional peptide)
DFBP ID DFBPMUFU0141
Peptide sequence AY
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 3
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0616 Corn Corn wet milling byproduct hydrolysates

N.D

DFBPACEI1229 Soybean and Wheat Soy sauce

N.D

DFBPACEI1594 Maize protein α-Zein

N.D

DFBPACEI1660 Buckwheat Buckwheat protein hydrolysates

N.D

DFBPACEI1853 Milk protein Multiple milk proteins

Many fragments

DFBPACEI1880 Amaranth seed proteins Amaranth glutelins

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0455 Corn Corn gluten meal

N.D

DFBPANHY0656 Corn, Corn oligopeptides Corn gluten meal

N.D

DFBPANHY0945 Buckwheat Buckwheat protein hydrolysates

N.D

Antioxidative peptides
DFBPID Organism Precursor protein Residue position
DFBPANOX0047 Soybean Okara protein Not measured
DFBPANOX0775 Milk protein Multiple milk proteins

Many fragments

Physical & computational properties
Three-letter amino acid Ala-Tyr
Single-letter amino acid AY
Peptide length 2
Theoretical mass 252.26 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
GRAVY 0.2500
Hydrophilic residue ratio 50%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0387 ---- Plant protein ---- Alpha purothionin
Source.3: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit
Source.4: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein
Source.5: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.6: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.7: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.8: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.9: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.10: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A
Source.11: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.12: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.13: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.14: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.15: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.16: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.17: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.18: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.19: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.20: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.21: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.22: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.23: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1
Source.24: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.25: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.26: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.27: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.28: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.29: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.30: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.31: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.32: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.33: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.34: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.35: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.36: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.37: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.38: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.39: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.40: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.41: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.42: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.43: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.44: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.45: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.46: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.47: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.48: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.49: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.50: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.51: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.52: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1
Source.53: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2
Source.54: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.55: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.56: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2
Source.57: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.58: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.59: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.60: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.61: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.62: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.63: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.64: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.65: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1
Source.66: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.67: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.68: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.69: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.70: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.71: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.72: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.73: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.74: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.75: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.76: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.77: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.78: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.79: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.80: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.81: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.82: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.83: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.84: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.85: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.86: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.87: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.88: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.89: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.90: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.91: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.92: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.93: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog
Source.94: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.95: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.96: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.97: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.98: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.99: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.100: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.101: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.102: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7
Source.103: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.104: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.105: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.106: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.107: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.108: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.109: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.110: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.111: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.112: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.113: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.114: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.115: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.116: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.117: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.118: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.119: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.120: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.121: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.122: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.123: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.124: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.125: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.126: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.127: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.128: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.129: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.130: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.131: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.132: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.133: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.134: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.135: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.136: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.137: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.138: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5
Source.139: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.140: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.141: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.142: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.143: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.144: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.145: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.146: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.147: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.148: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.149: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.150: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.151: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.152: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.153: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.154: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.155: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.156: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.157: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2
Source.158: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.159: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.160: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.161: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.162: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.163: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.164: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.165: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.166: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.167: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.168: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.169: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.170: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.171: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13
Source.172: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.173: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.174: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.175: DFBPPR1101 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 2
Source.176: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3
Source.177: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.178: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.179: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.180: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.181: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.182: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.183: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.184: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.185: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.186: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.187: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.188: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.189: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.190: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.191: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.192: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.193: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.194: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.195: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.196: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.197: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.198: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.199: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.200: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.201: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.202: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.203: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.204: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.205: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.206: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.207: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.208: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17
Source.209: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.210: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.211: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.212: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.213: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.214: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.215: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.216: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.217: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.218: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.219: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.220: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.221: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.222: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.223: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.224: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.225: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.226: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.227: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.228: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.229: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.230: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.231: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.232: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.233: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.234: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.235: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.236: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.237: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.238: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.239: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.240: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.241: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.242: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.243: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.244: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.245: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.246: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.247: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.248: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.249: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.250: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.251: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.252: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.253: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.254: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.255: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.256: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.257: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.258: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.259: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.260: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.261: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.262: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.263: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.264: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.265: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.266: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.267: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.268: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.269: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.270: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.271: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.272: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.273: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.274: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.275: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.276: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.277: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.278: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.279: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.280: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.281: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.282: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.283: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.284: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.285: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.286: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.287: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.288: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.289: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.290: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.291: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.292: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.293: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.294: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.295: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.296: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.297: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.298: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.299: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.300: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.301: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.302: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.303: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.304: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.305: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.306: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.307: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.308: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.309: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.310: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.311: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.312: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.313: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.314: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.315: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.316: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.317: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.318: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.319: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.320: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.321: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.322: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.323: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.324: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.325: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.326: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.327: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.328: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.329: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.330: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.331: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.332: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.333: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.334: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.335: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.336: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.337: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.338: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.339: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.340: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.341: DFBPPR1412 ---- Plant proteins ---- Histone H3.3
Source.342: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.343: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.344: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7
Source.345: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.346: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.347: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.348: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.349: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.350: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.351: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.352: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.353: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.354: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.355: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.356: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.357: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.358: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.359: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.360: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.361: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.362: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.363: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.364: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.365: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.366: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.367: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.368: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.369: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.370: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.371: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.372: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.373: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.374: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.375: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.376: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.377: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.378: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.379: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.380: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.381: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.382: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.383: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.384: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.385: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.386: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.387: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.388: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.389: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.390: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.391: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.392: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.393: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.394: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.395: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.396: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.397: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.398: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.399: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.400: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.401: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.402: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.403: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.404: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.405: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.406: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.407: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.408: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.409: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.410: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F
Source.411: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.412: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.413: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.414: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.415: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.416: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.417: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.418: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.419: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.420: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.421: DFBPPR1540 ---- Plant proteins ---- Protein DROOPING LEAF
Source.422: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.423: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.424: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.425: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.426: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.427: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.428: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.429: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.430: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.431: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.432: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.433: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.434: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.435: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A
Source.436: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.437: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.438: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.439: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.440: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.441: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.442: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.443: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.444: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.445: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.446: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.447: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.448: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.449: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.450: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.451: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.452: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.453: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.454: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.455: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5
Source.456: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.457: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.458: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.459: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.460: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.461: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.462: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29
Source.463: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.464: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.465: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.466: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.467: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.468: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.469: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.470: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.471: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.472: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.473: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.474: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.475: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2
Source.476: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.477: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.478: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.479: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.480: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.481: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.482: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.483: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.484: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.485: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.486: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.487: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.488: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.489: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.490: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.491: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.492: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.493: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.494: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.495: DFBPPR1676 ---- Plant proteins ---- MADS-box transcription factor 55
Source.496: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.497: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.498: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.499: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.500: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.501: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.502: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.503: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.504: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.505: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.506: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.507: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.508: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.509: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.510: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.511: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.512: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.513: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.514: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.515: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.516: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.517: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.518: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.519: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.520: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3
Source.521: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.522: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.523: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.524: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.525: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.526: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.527: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.528: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.529: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.530: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.531: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.532: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.533: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.534: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.535: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.536: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.537: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.538: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.539: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.540: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.541: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.542: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.543: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.544: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.545: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.546: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.547: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.548: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.549: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.550: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.551: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.552: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.553: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.554: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.555: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.556: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.557: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.558: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.559: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.560: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.561: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.562: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.563: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.564: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.565: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.566: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.567: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.568: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.569: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.570: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.571: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.572: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.573: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1
Source.574: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.575: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.576: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.577: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.578: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1
Source.579: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.580: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.581: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.582: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.583: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.584: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.585: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.586: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.587: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.588: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.589: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.590: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.591: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.592: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.593: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.594: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.595: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.596: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.597: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.598: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.599: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.600: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.601: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.602: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.603: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.604: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.605: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.606: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.607: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.608: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.609: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.610: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.611: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.612: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.613: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.614: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.615: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.616: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.617: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.618: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.619: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.620: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.621: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.622: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.623: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2
Source.624: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.625: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.626: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.627: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.628: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.629: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.630: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.631: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.632: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.633: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.634: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.635: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.636: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.637: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.638: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.639: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.640: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.641: DFBPPR1940 ---- Plant proteins ---- Histone H3.2
Source.642: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.643: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.644: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.645: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.646: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.647: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.648: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.649: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.650: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.651: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.652: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.653: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.654: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.655: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.656: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.657: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.658: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.659: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1
Source.660: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.661: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.662: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.663: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.664: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2
Source.665: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.666: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.667: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.668: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.669: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.670: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.671: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.672: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.673: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.674: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.675: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.676: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.677: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.678: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.679: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.680: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.681: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.682: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.683: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.684: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.685: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.686: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.687: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.688: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.689: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.690: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.691: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.692: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.693: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.694: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.695: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.696: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.697: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.698: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.699: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.700: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.701: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.702: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.703: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.704: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.705: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.706: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.707: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.708: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.709: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.710: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.711: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.712: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.713: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.714: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.715: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.716: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.717: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.718: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.719: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2
Source.720: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.721: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.722: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.723: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.724: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.725: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.726: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.727: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.728: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.729: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.730: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.731: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.732: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.733: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.734: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.735: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.736: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.737: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.738: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.739: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.740: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1
Source.741: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.742: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.743: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.744: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.745: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.746: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.747: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.748: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.749: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5
Source.750: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.751: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.752: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.753: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.754: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.755: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.756: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.757: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.758: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.759: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.760: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.761: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.762: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.763: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.764: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.765: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.766: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.767: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.768: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.769: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.770: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.771: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.772: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.773: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.774: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.775: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.776: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.777: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.778: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.779: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.780: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.781: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.782: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.783: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.784: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.785: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.786: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C
Source.787: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.788: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.789: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1
Source.790: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.791: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.792: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.793: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.794: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.795: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.796: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.797: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1
Source.798: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.799: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.800: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein
Source.801: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.802: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.803: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.804: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.805: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.806: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.807: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.808: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.809: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.810: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.811: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.812: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.813: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.814: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.815: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.816: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.817: DFBPPR2223 ---- Plant proteins ---- Urease
Source.818: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.819: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.820: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.821: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.822: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.823: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.824: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.825: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.826: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.827: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.828: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76
Source.829: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.830: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.831: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.832: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.833: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.834: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.835: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.836: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.837: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.838: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.839: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.840: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.841: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.842: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.843: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.844: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.845: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.846: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.847: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3
Source.848: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.849: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.850: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.851: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.852: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.853: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.854: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.855: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.856: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.857: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.858: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.859: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.860: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.861: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.862: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.863: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.864: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.865: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.866: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.867: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.868: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.869: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.870: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.871: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.872: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.873: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.874: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.875: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.876: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.877: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.878: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.879: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.880: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.881: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.882: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.883: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.884: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.885: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.886: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.887: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.888: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.889: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.890: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.891: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.892: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.893: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.894: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.895: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.896: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.897: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.898: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.899: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.900: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.901: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.902: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.903: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.904: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.905: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.906: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.907: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.908: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.909: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.910: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.911: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.912: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.913: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.914: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.915: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.916: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.917: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.918: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.919: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.920: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.921: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.922: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.923: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.924: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.925: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.926: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.927: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.928: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.929: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.930: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.931: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.932: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.933: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.934: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.935: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.936: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.937: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73
Source.938: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.939: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.940: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.941: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.942: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.943: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.944: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.945: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.946: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.947: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.948: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.949: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56
Source.950: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.951: DFBPPR2460 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.952: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.953: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.954: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34
Source.955: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.956: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.957: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.958: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.959: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.960: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.961: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.962: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.963: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.964: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.965: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.966: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.967: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.968: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.969: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic
Source.970: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.971: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.972: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B
Source.973: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.974: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.975: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.976: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.977: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.978: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.979: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.980: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.981: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.982: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.983: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.984: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.985: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.986: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.987: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.988: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.989: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.990: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.991: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.992: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.993: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.994: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.995: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.996: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.997: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.998: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.999: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.1000: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1001: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.1002: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.1003: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.1004: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.1005: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1006: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.1007: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.1008: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4
Source.1009: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.1010: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.1011: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.1012: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.1013: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.1014: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.1015: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.1016: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.1017: DFBPPR2582 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN1
Source.1018: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.1019: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.1020: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.1021: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.1022: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.1023: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.1024: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.1025: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.1026: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.1027: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.1028: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1029: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.1030: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.1031: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.1032: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.1033: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.1034: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.1035: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.1036: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1037: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.1038: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.1039: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1040: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.1041: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.1042: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.1043: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.1044: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.1045: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.1046: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.1047: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.1048: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.1049: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.1050: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.1051: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.1052: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.1053: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.1054: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.1055: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.1056: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.1057: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.1058: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.1059: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.1060: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.1061: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.1062: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.1063: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.1064: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.1065: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.1066: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.1067: DFBPPR2684 ---- Plant proteins ---- Arabinogalactan peptide 3
Source.1068: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.1069: DFBPPR2689 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.1070: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.1071: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.1072: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.1073: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.1074: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.1075: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.1076: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.1077: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1078: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.1079: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.1080: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.1081: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.1082: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.1083: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.1084: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.1085: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.1086: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.1087: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.1088: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.1089: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.1090: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.1091: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.1092: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.1093: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1094: DFBPPR2732 ---- Plant proteins ---- Small ubiquitin-related modifier 1
Source.1095: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.1096: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.1097: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.1098: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.1099: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.1100: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.1101: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.1102: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.1103: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.1104: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.1105: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.1106: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.1107: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.1108: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.1109: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.1110: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.1111: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.1112: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.1113: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1114: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.1115: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.1116: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.1117: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.1118: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.1119: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1120: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.1121: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1122: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.1123: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1124: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.1125: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.1126: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12
Source.1127: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.1128: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.1129: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.1130: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.1131: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.1132: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.1133: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1134: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.1135: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.1136: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.1137: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.1138: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.1139: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.1140: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.1141: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.1142: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.1143: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.1144: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.1145: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.1146: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.1147: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.1148: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.1149: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.1150: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.1151: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.1152: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.1153: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.1154: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.1155: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.1156: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.1157: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1158: DFBPPR2849 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 3
Source.1159: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.1160: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.1161: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.1162: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.1163: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1164: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.1165: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.1166: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3
Source.1167: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1168: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.1169: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.1170: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.1171: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.1172: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.1173: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.1174: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.1175: DFBPPR2880 ---- Plant proteins ---- Nuclear cap-binding protein subunit 2
Source.1176: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.1177: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.1178: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.1179: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.1180: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1181: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.1182: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.1183: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.1184: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.1185: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.1186: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.1187: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.1188: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.1189: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.1190: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.1191: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.1192: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.1193: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.1194: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.1195: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1
Source.1196: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.1197: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.1198: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.1199: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.1200: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.1201: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.1202: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.1203: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.1204: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.1205: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.1206: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.1207: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.1208: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.1209: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.1210: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1211: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.1212: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.1213: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.1214: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.1215: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.1216: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.1217: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1218: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.1219: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.1220: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.1221: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.1222: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.1223: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.1224: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.1225: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.1226: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.1227: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.1228: DFBPPR2987 ---- Plant proteins ---- 1-Cys peroxiredoxin B
Source.1229: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.1230: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.1231: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.1232: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.1233: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.1234: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.1235: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.1236: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.1237: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.1238: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.1239: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.1240: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.1241: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.1242: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.1243: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.1244: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.1245: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.1246: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.1247: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.1248: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.1249: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.1250: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.1251: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1252: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1253: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein
Source.1254: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.1255: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b
Source.1256: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.1257: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.1258: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1259: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.1260: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.1261: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1262: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.1263: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1264: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8
Source.1265: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.1266: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.1267: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.1268: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.1269: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.1270: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.1271: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1272: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.1273: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1274: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.1275: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.1276: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.1277: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1278: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.1279: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1280: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1281: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.1282: DFBPPR3079 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.1283: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1284: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1285: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1286: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.1287: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.1288: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.1289: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.1290: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.1291: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.1292: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1293: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.1294: DFBPPR3095 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 4
Source.1295: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1296: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1297: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.1298: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1299: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.1300: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.1301: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1302: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.1303: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.1304: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.1305: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.1306: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.1307: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.1308: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.1309: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.1310: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1311: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7
Source.1312: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1313: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.1314: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.1315: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1316: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1317: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1318: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1319: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.1320: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.1321: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.1322: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.1323: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.1324: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1325: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1326: DFBPPR3143 ---- Plant proteins ---- Protein OS-9 homolog
Source.1327: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.1328: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.1329: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1330: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.1331: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.1332: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1333: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1334: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.1335: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1336: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.1337: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1338: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1339: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1340: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1341: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.1342: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.1343: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.1344: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.1345: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1346: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.1347: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1348: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.1349: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1350: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1351: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1352: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1353: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1354: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1355: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1356: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1357: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1358: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1359: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.1360: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.1361: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1362: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1363: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1364: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1365: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.1366: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1367: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.1368: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1369: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1370: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.1371: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.1372: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.1373: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1374: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.1375: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1376: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1377: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.1378: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1379: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1380: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.1381: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1382: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.1383: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.1384: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.1385: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1386: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1387: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2
Source.1388: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.1389: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.1390: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1391: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1392: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.1393: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1394: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.1395: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1396: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.1397: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.1398: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1399: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1400: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.1401: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1402: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.1403: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.1404: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.1405: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.1406: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.1407: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1408: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E
Source.1409: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1410: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.1411: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.1412: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1413: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.1414: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.1415: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.1416: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1417: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.1418: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1419: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.1420: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.1421: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1422: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.1423: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.1424: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1425: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.1426: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.1427: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.1428: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1429: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1430: DFBPPR3336 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.1431: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.1432: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1433: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.1434: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.1435: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.1436: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.1437: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.1438: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1439: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.1440: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.1441: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1442: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.1443: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1444: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1445: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1446: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1447: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1448: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.1449: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1450: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.1451: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1452: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.1453: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1454: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.1455: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1456: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1457: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1458: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.1459: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.1460: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.1461: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1462: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1463: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1464: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1465: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.1466: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.1467: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1468: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1469: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.1470: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1471: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.1472: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1473: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1474: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.1475: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1476: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.1477: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.1478: DFBPPR3418 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 3
Source.1479: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1480: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1481: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1482: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1483: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1484: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.1485: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3
Source.1486: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1487: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.1488: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.1489: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.1490: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.1491: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1492: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.1493: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.1494: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1495: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1496: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1497: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.1498: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1499: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.1500: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1501: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.1502: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1503: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.1504: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.1505: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.1506: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.1507: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76
Source.1508: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1509: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.1510: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.1511: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1512: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1513: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1514: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.1515: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.1516: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1517: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1518: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.1519: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.1520: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1521: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1522: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.1523: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1524: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.1525: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1526: DFBPPR3510 ---- Plant proteins ---- Thioredoxin-like protein Clot
Source.1527: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1528: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1529: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.1530: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.1531: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.1532: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.1533: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1534: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1535: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1536: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.1537: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1538: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1539: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2
Source.1540: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1541: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1542: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1543: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.1544: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.1545: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.1546: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.1547: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.1548: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1549: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.1550: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.1551: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1552: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.1553: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1554: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.1555: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1556: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1557: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1558: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1559: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.1560: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1561: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1562: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1563: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.1564: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.1565: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.1566: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1567: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.1568: DFBPPR3596 ---- Plant proteins ---- Coatomer subunit epsilon-1
Source.1569: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.1570: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1571: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.1572: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1573: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1574: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.1575: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1576: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.1577: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1578: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1579: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1580: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.1581: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1582: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.1583: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1584: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.1585: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1586: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.1587: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1588: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.1589: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1590: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.1591: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.1592: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1593: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.1594: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.1595: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1596: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1597: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1598: DFBPPR3653 ---- Plant proteins ---- Protein YABBY 7
Source.1599: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1600: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1601: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1602: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1603: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.1604: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1605: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.1606: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.1607: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1608: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1609: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1610: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1611: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1612: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1613: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1614: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.1615: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.1616: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1617: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.1618: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.1619: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.1620: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.1621: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.1622: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3
Source.1623: DFBPPR3701 ---- Plant proteins ---- Non-specific lipid-transfer protein C4
Source.1624: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.1625: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.1626: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.1627: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.1628: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.1629: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.1630: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.1631: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.1632: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.1633: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1634: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.1635: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.1636: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1637: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.1638: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.1639: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.1640: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.1641: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.1642: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.1643: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.1644: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.1645: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1646: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1647: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.1648: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.1649: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.1650: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.1651: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.1652: DFBPPR3763 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.1653: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.1654: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1655: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.1656: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.1657: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1658: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.1659: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.1660: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.1661: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.1662: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1663: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.1664: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial
Source.1665: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1666: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.1667: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42
Source.1668: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.1669: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1670: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.1671: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.1672: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.1673: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.1674: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1675: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.1676: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.1677: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.1678: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.1679: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1680: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.1681: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.1682: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.1683: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.1684: DFBPPR3826 ---- Plant proteins ---- Profilin LP04
Source.1685: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.1686: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.1687: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.1688: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.1689: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.1690: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.1691: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.1692: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.1693: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.1694: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.1695: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.1696: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.1697: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.1698: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.1699: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.1700: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.1701: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.1702: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1703: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.1704: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.1705: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.1706: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.1707: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.1708: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.1709: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.1710: DFBPPR3884 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.1711: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.1712: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.1713: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1714: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.1715: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.1716: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.1717: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.1718: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1719: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.1720: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.1721: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.1722: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.1723: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.1724: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1725: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1726: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.1727: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.1728: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.1729: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.1730: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.1731: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.1732: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1733: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1734: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.1735: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1736: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1737: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.1738: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1739: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.1740: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.1741: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1742: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.1743: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.1744: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.1745: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.1746: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.1747: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.1748: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.1749: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.1750: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.1751: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial
Source.1752: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.1753: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1754: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1755: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.1756: DFBPPR3976 ---- Plant proteins ---- Double-stranded RNA-binding protein 4
Source.1757: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.1758: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1759: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.1760: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.1761: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.1762: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1763: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.1764: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.1765: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.1766: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.1767: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.1768: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1769: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1770: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.1771: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.1772: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.1773: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.1774: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1775: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.1776: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.1777: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.1778: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1779: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.1780: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.1781: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5
Source.1782: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.1783: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1784: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.1785: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.1786: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.1787: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.1788: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.1789: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.1790: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.1791: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1792: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.1793: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1794: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.1795: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1796: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.1797: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.1798: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.1799: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1800: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.1801: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.1802: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.1803: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.1804: DFBPPR4051 ---- Plant proteins ---- 40S ribosomal protein S3a
Source.1805: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.1806: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1807: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.1808: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.1809: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.1810: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.1811: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.1812: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1813: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.1814: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.1815: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.1816: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.1817: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.1818: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.1819: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.1820: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1821: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.1822: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1823: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.1824: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.1825: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.1826: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.1827: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.1828: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.1829: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.1830: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1831: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.1832: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1833: DFBPPR4101 ---- Plant proteins ---- Succinate dehydrogenase subunit 7, mitochondrial
Source.1834: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.1835: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.1836: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1837: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.1838: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.1839: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.1840: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.1841: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.1842: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1843: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.1844: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.1845: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1846: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.1847: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.1848: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.1849: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1850: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.1851: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.1852: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.1853: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.1854: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1855: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1856: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1857: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1858: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1859: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.1860: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.1861: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.1862: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1863: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6
Source.1864: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.1865: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1
Source.1866: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1867: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1868: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1869: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.1870: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4
Source.1871: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1872: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.1873: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1874: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.1875: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.1876: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1877: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1878: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.1879: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1880: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3
Source.1881: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1882: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1883: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.1884: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1885: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1886: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.1887: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1888: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.1889: DFBPPR4207 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4B
Source.1890: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1891: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.1892: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1893: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.1894: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1895: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.1896: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1897: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.1898: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1899: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1900: DFBPPR4223 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim13
Source.1901: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.1902: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.1903: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.1904: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.1905: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.1906: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.1907: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1908: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.1909: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1910: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1911: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.1912: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1913: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1914: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.1915: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.1916: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.1917: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.1918: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.1919: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.1920: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.1921: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1922: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1923: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1924: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1925: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1926: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1927: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.1928: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.1929: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.1930: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.1931: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.1932: DFBPPR4282 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.1933: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.1934: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1935: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.1936: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1937: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.1938: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1939: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.1940: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.1941: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.1942: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1943: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.1944: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.1945: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.1946: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1947: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1948: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1949: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1950: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.1951: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.1952: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.1953: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1954: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.1955: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.1956: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1957: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.1958: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.1959: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1960: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.1961: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.1962: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.1963: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.1964: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.1965: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.1966: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.1967: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.1968: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.1969: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1970: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.1971: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.1972: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.1973: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.1974: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1975: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.1976: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.1977: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1978: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1979: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.1980: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.1981: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1982: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1983: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14
Source.1984: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.1985: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.1986: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.1987: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.1988: DFBPPR4398 ---- Plant proteins ---- 40S ribosomal protein S16
Source.1989: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.1990: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.1991: DFBPPR4405 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4A
Source.1992: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D
Source.1993: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1994: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1995: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.1996: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1997: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1998: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.1999: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.2000: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.2001: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.2002: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.2003: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.2004: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.2005: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.2006: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.2007: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.2008: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2
Source.2009: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.2010: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.2011: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.2012: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.2013: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.2014: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.2015: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.2016: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.2017: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.2018: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.2019: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.2020: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.2021: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.2022: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.2023: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.2024: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.2025: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.2026: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.2027: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.2028: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.2029: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.2030: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.2031: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.2032: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.2033: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.2034: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.2035: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.2036: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.2037: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.2038: DFBPPR4509 ---- Plant proteins ---- Putative glycine-rich cell wall structural protein 1
Source.2039: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.2040: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.2041: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.2042: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.2043: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.2044: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.2045: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.2046: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.2047: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.2048: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.2049: DFBPPR4530 ---- Plant proteins ---- Water stress-inducible protein Rab21
Source.2050: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.2051: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2
Source.2052: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.2053: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.2054: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.2055: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.2056: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.2057: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.2058: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.2059: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.2060: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.2061: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.2062: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.2063: DFBPPR4558 ---- Plant proteins ---- 40S ribosomal protein S20
Source.2064: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.2065: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1
Source.2066: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.2067: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.2068: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.2069: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.2070: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.2071: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.2072: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.2073: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.2074: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.2075: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.2076: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.2077: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.2078: DFBPPR4599 ---- Plant proteins ---- 60S ribosomal protein L37a-1
Source.2079: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.2080: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.2081: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.2082: DFBPPR4612 ---- Plant proteins ---- 60S ribosomal protein L37a-2
Source.2083: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.2084: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.2085: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.2086: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.2087: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2088: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.2089: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19
Source.2090: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.2091: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.2092: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.2093: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.2094: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.2095: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.2096: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2097: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.2098: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.2099: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.2100: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.2101: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.2102: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.2103: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.2104: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.2105: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.2106: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.2107: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.2108: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.2109: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.2110: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.2111: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.2112: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1
Source.2113: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.2114: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.2115: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.2116: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.2117: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.2118: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.2119: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D
Source.2120: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.2121: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.2122: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.2123: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2
Source.2124: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.2125: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1
Source.2126: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6
Source.2127: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.2128: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.2129: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.2130: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.2131: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.2132: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.2133: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.2134: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.2135: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.2136: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.2137: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.2138: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.2139: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.2140: DFBPPR4738 ---- Plant proteins ---- Putative yippee-like protein Os10g0369500
Source.2141: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2
Source.2142: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.2143: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.2144: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.2145: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.2146: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.2147: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.2148: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.2149: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.2150: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.2151: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.2152: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.2153: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.2154: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.2155: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.2156: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.2157: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.2158: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A
Source.2159: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.2160: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G
Source.2161: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.2162: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H
Source.2163: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.2164: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.2165: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.2166: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.2167: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.2168: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2169: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.2170: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2
Source.2171: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100
Source.2172: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.2173: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.2174: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.2175: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.2176: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.2177: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.2178: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.2179: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.2180: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.2181: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000
Source.2182: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.2183: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.2184: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.2185: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.2186: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.2187: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.2188: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.2189: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.2190: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.2191: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400
Source.2192: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.2193: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.2194: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.2195: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.2196: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.2197: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.2198: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500
Source.2199: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.2200: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.2201: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.2202: DFBPPR4872 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0158600
Source.2203: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.2204: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.2205: DFBPPR4883 ---- Plant proteins ---- Uncharacterized protein Os02g0798400
Source.2206: DFBPPR4884 ---- Plant proteins ---- Uncharacterized protein Os02g0798501
Source.2207: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.2208: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.2209: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.2210: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.2211: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.2212: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1
Source.2213: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.2214: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.2215: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.2216: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.2217: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.2218: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.2219: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.2220: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.2221: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.2222: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.2223: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.2224: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.2225: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.2226: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.2227: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.2228: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.2229: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.2230: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.2231: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.2232: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.2233: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.2234: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.2235: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.2236: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.2237: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.2238: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.2239: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.2240: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.2241: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.2242: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.2243: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.2244: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2245: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.2246: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.2247: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.2248: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.2249: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.2250: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.2251: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.2252: DFBPPR4964 ---- Plant proteins ---- Soybean toxin 27 kDa chain
Source.2253: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.2254: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.2255: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.2256: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.2257: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.2258: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.2259: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.2260: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.2261: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.2262: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2263: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.2264: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.2265: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.2266: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1
Source.2267: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.2268: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2269: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.2270: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.2271: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.2272: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.2273: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.2274: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.2275: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2276: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.2277: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2278: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.2279: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2280: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2281: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.2282: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.2283: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.2284: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.2285: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.2286: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.2287: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2288: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2289: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2290: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.2291: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2292: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.2293: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.2294: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.2295: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.2296: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.2297: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.2298: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.2299: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2300: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2301: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.2302: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.2303: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A
Source.2304: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.2305: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2306: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.2307: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.2308: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.2309: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2
Source.2310: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.2311: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.2312: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.2313: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.2314: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2315: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic
Source.2316: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2317: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.2318: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.2319: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2320: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.2321: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.2322: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.2323: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2324: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1
Source.2325: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.2326: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.2327: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.2328: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.2329: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.2330: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.2331: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.2332: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.2333: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.2334: DFBPPR5087 ---- Plant proteins ---- Photosystem I iron-sulfur center
Source.2335: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.2336: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.2337: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.2338: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.2339: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2340: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.2341: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.2342: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2343: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.2344: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.2345: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22
Source.2346: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.2347: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.2348: DFBPPR5114 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.2349: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.2350: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2351: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.2352: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2353: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.2354: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.2355: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.2356: DFBPPR5134 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2357: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.2358: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.2359: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.2360: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.2361: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.2362: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2363: DFBPPR5146 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.2364: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.2365: DFBPPR5150 ---- Plant proteins ---- Profilin-2
Source.2366: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2367: DFBPPR5154 ---- Plant proteins ---- Profilin-1
Source.2368: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.2369: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2370: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2371: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2372: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2373: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2374: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.2375: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2376: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2377: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.2378: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.2379: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.2380: DFBPPR5191 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2381: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.2382: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.2383: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.2384: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2385: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.2386: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.2387: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.2388: DFBPPR5205 ---- Plant proteins ---- Urease
Source.2389: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.2390: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.2391: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.2392: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.2393: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.2394: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.2395: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.2396: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.2397: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.2398: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2399: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2400: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.2401: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.2402: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2403: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2404: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic
Source.2405: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.2406: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.2407: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.2408: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.2409: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.2410: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic
Source.2411: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2412: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.2413: DFBPPR5281 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2414: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.2415: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.2416: DFBPPR5290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.2417: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2418: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.2419: DFBPPR5301 ---- Plant proteins ---- DNA-binding protein DRP90
Source.2420: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.2421: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2422: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.2423: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.2424: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.2425: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.2426: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.2427: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.2428: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.2429: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.2430: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.2431: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.2432: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.2433: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.2434: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.2435: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2436: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein
Source.2437: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.2438: DFBPPR5344 ---- Plant proteins ---- Nodulin-16
Source.2439: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.2440: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.2441: DFBPPR5355 ---- Plant proteins ---- Early nodulin-93
Source.2442: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.2443: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D
Source.2444: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.2445: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.2446: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.2447: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.2448: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.2449: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.2450: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.2451: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.2452: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.2453: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.2454: DFBPPR5385 ---- Plant proteins ---- Profilin-5
Source.2455: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.2456: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2457: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.2458: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.2459: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2460: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.2461: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.2462: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.2463: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.2464: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.2465: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2466: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.2467: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2468: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.2469: DFBPPR5407 ---- Plant proteins ---- Profilin-2
Source.2470: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.2471: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.2472: DFBPPR5410 ---- Plant proteins ---- Profilin-4
Source.2473: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.2474: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.2475: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.2476: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.2477: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.2478: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.2479: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.2480: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.2481: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.2482: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.2483: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.2484: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2485: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.2486: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.2487: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.2488: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.2489: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.2490: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.2491: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.2492: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.2493: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.2494: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.2495: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.2496: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2497: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.2498: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial
Source.2499: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.2500: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.2501: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.2502: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.2503: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.2504: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.2505: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.2506: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.2507: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.2508: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2509: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.2510: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.2511: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.2512: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2513: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.2514: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.2515: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.2516: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.2517: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.2518: DFBPPR5489 ---- Plant proteins ---- Histone H3.2
Source.2519: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.2520: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.2521: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70
Source.2522: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.2523: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.2524: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66
Source.2525: DFBPPR5499 ---- Plant proteins ---- Dehydrin DHN1
Source.2526: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.2527: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2528: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.2529: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.2530: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.2531: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic
Source.2532: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.2533: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2534: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.2535: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.2536: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.2537: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2538: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.2539: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.2540: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic
Source.2541: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.2542: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.2543: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.2544: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.2545: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.2546: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.2547: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.2548: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2549: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.2550: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.2551: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.2552: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2553: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.2554: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.2555: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.2556: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.2557: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.2558: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.2559: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.2560: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.2561: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.2562: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.2563: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.2564: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.2565: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.2566: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.2567: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.2568: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.2569: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.2570: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.2571: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2572: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.2573: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.2574: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.2575: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.2576: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.2577: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.2578: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2579: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.2580: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2581: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.2582: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A
Source.2583: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.2584: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2585: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.2586: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.2587: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.2588: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.2589: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.2590: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.2591: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.2592: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.2593: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.2594: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.2595: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2596: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.2597: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.2598: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.2599: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.2600: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.2601: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.2602: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2603: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.2604: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.2605: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2606: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.2607: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2608: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.2609: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial
Source.2610: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.2611: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.2612: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2613: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.2614: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2615: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.2616: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2617: DFBPPR5648 ---- Plant proteins ---- AP-2 complex subunit sigma
Source.2618: DFBPPR5651 ---- Plant proteins ---- Cytochrome c
Source.2619: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.2620: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.2621: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.2622: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.2623: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.2624: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.2625: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2626: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.2627: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2628: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.2629: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial
Source.2630: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.2631: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial
Source.2632: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.2633: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.2634: DFBPPR5689 ---- Plant proteins ---- Profilin-9
Source.2635: DFBPPR5690 ---- Plant proteins ---- Profilin-7
Source.2636: DFBPPR5691 ---- Plant proteins ---- Profilin-10
Source.2637: DFBPPR5693 ---- Plant proteins ---- Profilin-11
Source.2638: DFBPPR5694 ---- Plant proteins ---- Profilin-8
Source.2639: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.2640: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2641: DFBPPR5697 ---- Plant proteins ---- Profilin-12
Source.2642: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.2643: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.2644: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.2645: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.2646: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2647: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2648: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.2649: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.2650: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.2651: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.2652: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.2653: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.2654: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2655: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.2656: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.2657: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.2658: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2659: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.2660: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2661: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.2662: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.2663: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.2664: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.2665: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.2666: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.2667: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.2668: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.2669: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.2670: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.2671: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.2672: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.2673: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.2674: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.2675: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2676: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2677: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic
Source.2678: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.2679: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.2680: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.2681: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.2682: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.2683: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2684: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.2685: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.2686: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2687: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2688: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.2689: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.2690: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.2691: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2692: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.2693: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2694: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.2695: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.2696: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2697: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.2698: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2699: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.2700: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.2701: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.2702: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.2703: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.2704: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.2705: DFBPPR5827 ---- Plant proteins ---- 60S acidic ribosomal protein P2B
Source.2706: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.2707: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.2708: DFBPPR5830 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.2709: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.2710: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.2711: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.2712: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.2713: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.2714: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.2715: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.2716: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12
Source.2717: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.2718: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.2719: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2720: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4
Source.2721: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.2722: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.2723: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6
Source.2724: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.2725: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2726: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.2727: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.2728: DFBPPR5865 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.2729: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.2730: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.2731: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2732: DFBPPR5877 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2733: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.2734: DFBPPR5884 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.2735: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.2736: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.2737: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B
Source.2738: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.2739: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.2740: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.2741: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B
Source.2742: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1
Source.2743: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.2744: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A
Source.2745: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.2746: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.2747: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.2748: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.2749: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.2750: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.2751: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.2752: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.2753: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.2754: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.2755: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.2756: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.2757: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.2758: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.2759: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2760: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.2761: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2762: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.2763: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.2764: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.2765: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.2766: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.2767: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.2768: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2769: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.2770: DFBPPR5953 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.2771: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.2772: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.2773: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein
Source.2774: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.2775: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.2776: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.2777: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.2778: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.2779: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.2780: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.2781: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.2782: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.2783: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.2784: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.2785: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.2786: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.2787: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.2788: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.2789: DFBPPR5997 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.2790: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.2791: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.2792: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.2793: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1
Source.2794: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.2795: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.2796: DFBPPR6007 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2797: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.2798: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.2799: DFBPPR6024 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.2800: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2801: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.2802: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.2803: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.2804: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.2805: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2
Source.2806: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.2807: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.2808: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.2809: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.2810: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.2811: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.2812: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.2813: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.2814: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.2815: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.2816: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2817: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.2818: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2819: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.2820: DFBPPR6074 ---- Plant proteins ---- Trypsin inhibitor
Source.2821: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.2822: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.2823: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.2824: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.2825: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.2826: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.2827: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99
Source.2828: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.2829: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1
Source.2830: DFBPPR6094 ---- Plant proteins ---- Zein-alpha PZ19.1
Source.2831: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20
Source.2832: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.2833: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.2834: DFBPPR6101 ---- Plant proteins ---- Zein-alpha M6
Source.2835: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.2836: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.2837: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.2838: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2839: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.2840: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.2841: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.2842: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.2843: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.2844: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.2845: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.2846: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.2847: DFBPPR6128 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.2848: DFBPPR6130 ---- Plant proteins ---- Cell number regulator 13
Source.2849: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.2850: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.2851: DFBPPR6151 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.2852: DFBPPR6159 ---- Plant proteins ---- MFS14 protein
Source.2853: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.2854: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.2855: DFBPPR6172 ---- Plant proteins ---- Unknown protein from spot 207 of 2D-PAGE of etiolated coleoptile
Source.2856: DFBPPR6176 ---- Plant proteins ---- Unknown protein from spot 146 of 2D-PAGE of etiolated coleoptile
Source.2857: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile
Source.2858: DFBPPR6181 ---- Plant proteins ---- Unknown protein from spot 154 of 2D-PAGE of etiolated coleoptile
Source.2859: DFBPPR6204 ---- Plant proteins ---- Unknown protein from spot 258 of 2D-PAGE of etiolated coleoptile
Source.2860: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.2861: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2862: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2863: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.2864: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34
Source.2865: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.2866: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.2867: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.2868: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.2869: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.2870: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.2871: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2872: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.2873: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.2874: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.2875: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2876: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2877: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.2878: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.2879: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.2880: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.2881: DFBPPR6254 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.2882: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.2883: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.2884: DFBPPR6258 ---- Plant proteins ---- Histone H3.2
Source.2885: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.2886: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.2887: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2888: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.2889: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.2890: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.2891: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.2892: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.2893: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1
Source.2894: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2895: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.2896: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.2897: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1
Source.2898: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.2899: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2900: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.2901: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2902: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.2903: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.2904: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.2905: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2906: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.2907: DFBPPR6299 ---- Plant proteins ---- Photosystem I iron-sulfur center
Source.2908: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.2909: DFBPPR6301 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2910: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.2911: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2912: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.2913: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.2914: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.2915: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.2916: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2917: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.2918: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2919: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.2920: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.2921: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2922: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2923: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1
Source.2924: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.2925: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.2926: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.2927: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1
Source.2928: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.2929: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.2930: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2931: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.2932: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.2933: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.2934: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.2935: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic
Source.2936: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.2937: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.2938: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.2939: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2940: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.2941: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.2942: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2943: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.2944: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.2945: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.2946: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.2947: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2948: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2949: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.2950: DFBPPR6381 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor IVB
Source.2951: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.2952: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2953: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.2954: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.2955: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.2956: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2
Source.2957: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.2958: DFBPPR6397 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.2959: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2960: DFBPPR6399 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor IVA
Source.2961: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.2962: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.2963: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.2964: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.2965: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.2966: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.2967: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2968: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.2969: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.2970: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.2971: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.2972: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.2973: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.2974: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2975: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2976: DFBPPR6427 ---- Plant proteins ---- MADS-box transcription factor 1
Source.2977: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.2978: DFBPPR6444 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.2979: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.2980: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.2981: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.2982: DFBPPR6461 ---- Plant proteins ---- Leghemoglobin Lb5-10
Source.2983: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.2984: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2985: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.2986: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.2987: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.2988: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.2989: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.2990: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic
Source.2991: DFBPPR6481 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.2992: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.2993: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.2994: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.2995: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.2996: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.2997: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34
Source.2998: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1
Source.2999: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8
Source.3000: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29
Source.3001: DFBPPR6502 ---- Plant proteins ---- Early light-induced protein, chloroplastic
Source.3002: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A
Source.3003: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.3004: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.3005: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.3006: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3007: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.3008: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.3009: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3010: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.3011: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49
Source.3012: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.3013: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.3014: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.3015: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3016: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3017: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.3018: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.3019: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.3020: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4
Source.3021: DFBPPR6584 ---- Plant proteins ---- Organ-specific protein S2
Source.3022: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34
Source.3023: DFBPPR6594 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.3024: DFBPPR6595 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.3025: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.3026: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176
Source.3027: DFBPPR6619 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.3028: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28
Source.3029: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3030: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.3031: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.3032: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.3033: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.3034: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.3035: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3036: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.3037: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1
Source.3038: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.3039: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3040: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3041: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.3042: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.3043: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.3044: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.3045: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3046: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.3047: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.3048: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.3049: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.3050: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.3051: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.3052: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.3053: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.3054: DFBPPR6667 ---- Plant proteins ---- Cytochrome c
Source.3055: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3056: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.3057: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.3058: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.3059: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3060: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.3061: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.3062: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.3063: DFBPPR6686 ---- Plant proteins ---- Histone H3.2
Source.3064: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.3065: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.3066: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.3067: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3068: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.3069: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.3070: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.3071: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.3072: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2
Source.3073: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.3074: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.3075: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3076: DFBPPR6718 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.3077: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.3078: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.3079: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.3080: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.3081: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3082: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.3083: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.3084: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3085: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.3086: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.3087: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.3088: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.3089: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.3090: DFBPPR6742 ---- Plant proteins ---- Alpha-1-purothionin
Source.3091: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3
Source.3092: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic
Source.3093: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.3094: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3095: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.3096: DFBPPR6766 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3097: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.3098: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3099: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3100: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.3101: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3102: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.3103: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3104: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3105: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.3106: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.3107: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.3108: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.3109: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.3110: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.3111: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3112: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.3113: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3114: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3115: DFBPPR6808 ---- Plant proteins ---- Profilin-2
Source.3116: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3117: DFBPPR6813 ---- Plant proteins ---- Profilin-3
Source.3118: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.3119: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3120: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3121: DFBPPR6819 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3122: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3123: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.3124: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.3125: DFBPPR6829 ---- Plant proteins ---- Cold-shock protein CS120
Source.3126: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3127: DFBPPR6832 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.3128: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512
Source.3129: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3130: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.3131: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.3132: DFBPPR6848 ---- Plant proteins ---- Cold shock protein CS66
Source.3133: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3134: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.3135: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1
Source.3136: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3137: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3138: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.3139: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.3140: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A
Source.3141: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3142: DFBPPR6869 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.3143: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3144: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3145: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.3146: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3147: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3148: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.3149: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor
Source.3150: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1
Source.3151: DFBPPR6892 ---- Plant proteins ---- 60S acidic ribosomal protein P2
Source.3152: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial
Source.3153: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.3154: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3155: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3156: DFBPPR6946 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3157: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.3158: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3159: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.3160: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.3161: DFBPPR6973 ---- Plant proteins ---- Avenin-like a6
Source.3162: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin
Source.3163: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3164: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2
Source.3165: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.3166: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.3167: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.3168: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.3169: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.3170: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3171: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3172: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.3173: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3174: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.3175: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3176: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.3177: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3178: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.3179: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.3180: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.3181: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.3182: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.3183: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.3184: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe
Source.3185: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.3186: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.3187: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3188: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.3189: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.3190: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.3191: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.3192: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.3193: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.3194: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3195: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.3196: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.3197: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3198: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.3199: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.3200: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.3201: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3202: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.3203: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3204: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.3205: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3206: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3207: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.3208: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.3209: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.3210: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.3211: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3212: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3213: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.3214: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.3215: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3216: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3217: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.3218: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3219: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3220: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3221: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3222: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.3223: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.3224: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3225: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.3226: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.3227: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.3228: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3229: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.3230: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.3231: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3232: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.3233: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3234: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.3235: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.3236: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3237: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.3238: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.3239: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3240: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.3241: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.3242: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.3243: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.3244: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.3245: DFBPPR7137 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3246: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.3247: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.3248: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.3249: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.3250: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.3251: DFBPPR7146 ---- Plant proteins ---- Non-specific lipid-transfer protein Cw18
Source.3252: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.3253: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3254: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3255: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.3256: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.3257: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.3258: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3259: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.3260: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.3261: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.3262: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3263: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.3264: DFBPPR7172 ---- Plant proteins ---- Barwin
Source.3265: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.3266: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.3267: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.3268: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3269: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.3270: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.3271: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.3272: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3273: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.3274: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3275: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.3276: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.3277: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.3278: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.3279: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.3280: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.3281: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.3282: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.3283: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.3284: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3285: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic
Source.3286: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.3287: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.3288: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.3289: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3290: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.3291: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.3292: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.3293: DFBPPR7217 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.3294: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3295: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.3296: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3297: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.3298: DFBPPR7223 ---- Plant proteins ---- Ferredoxin
Source.3299: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3300: DFBPPR7229 ---- Plant proteins ---- Histone H3.3
Source.3301: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.3302: DFBPPR7232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic
Source.3303: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3304: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2
Source.3305: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.3306: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.3307: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3308: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3309: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.3310: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.3311: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.3312: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.3313: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.3314: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.3315: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.3316: DFBPPR7281 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3317: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1
Source.3318: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.3319: DFBPPR7312 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3320: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3321: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3322: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.3323: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C
Source.3324: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B
Source.3325: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A
Source.3326: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B
Source.3327: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.3328: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.3329: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.3330: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.3331: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.3332: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.3333: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.3334: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.3335: DFBPPR7406 ---- Plant proteins ---- Cytochrome c
Source.3336: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.3337: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.3338: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.3339: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.3340: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.3341: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.3342: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.3343: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.3344: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.3345: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.3346: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.3347: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.3348: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.3349: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.3350: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3351: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3352: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.3353: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.3354: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.3355: DFBPPR7448 ---- Plant proteins ---- Histone H3.2
Source.3356: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3357: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.3358: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.3359: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.3360: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3361: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.3362: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.3363: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.3364: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.3365: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3366: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.3367: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.3368: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.3369: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.3370: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.3371: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25
Source.3372: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.3373: DFBPPR7481 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial
Source.3374: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.3375: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.3376: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.3377: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.3378: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.3379: DFBPPR7499 ---- Plant proteins ---- Ferredoxin
Source.3380: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.3381: DFBPPR7502 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3382: DFBPPR7508 ---- Plant proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5
Source.3383: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.3384: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.3385: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.3386: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3387: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.3388: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.3389: DFBPPR7547 ---- Plant proteins ---- 60S ribosomal protein L13-2
Source.3390: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.3391: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.3392: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.3393: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.3394: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.3395: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.3396: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2
Source.3397: DFBPPR7606 ---- Milk proteins ---- Osteopontin
Source.3398: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.3399: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.3400: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.3401: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.3402: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.3403: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.3404: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.3405: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.3406: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.3407: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.3408: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.3409: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.3410: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.3411: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.3412: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.3413: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.3414: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.3415: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.3416: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.3417: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3418: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.3419: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.3420: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.3421: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.3422: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.3423: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.3424: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein
Source.3425: DFBPPR7664 ---- Milk proteins ---- Alpha-S2-casein
Source.3426: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein
Source.3427: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.3428: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.3429: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein
Source.3430: DFBPPR7690 ---- Milk proteins ---- Lactadherin
Source.3431: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein
Source.3432: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.3433: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein
Source.3434: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.3435: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.3436: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.3437: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.3438: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.3439: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.3440: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.3441: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.3442: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.3443: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.3444: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3445: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.3446: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.3447: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.3448: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.3449: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.3450: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.3451: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.3452: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.3453: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.3454: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.3455: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.3456: DFBPPR8187 ---- Plant proteins ---- Cytochrome c
Source.3457: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3458: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.3459: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.3460: DFBPPR8192 ---- Plant proteins ---- 2S albumin
Source.3461: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.3462: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.3463: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.3464: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.3465: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.3466: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3467: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3468: DFBPPR8358 ---- Plant proteins ---- Cytochrome c
Source.3469: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.3470: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3471: DFBPPR8377 ---- Plant proteins ---- Profilin
Source.3472: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1
Source.3473: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2
Source.3474: DFBPPR8382 ---- Plant proteins ---- Cationic peroxidase 1
Source.3475: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.3476: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.3477: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.3478: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.3479: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.3480: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.3481: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.3482: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.3483: DFBPPR8423 ---- Plant proteins ---- Cytochrome c
Source.3484: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3485: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3486: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.3487: DFBPPR8436 ---- Plant proteins ---- Bowman-Birk type proteinase inhibitor
Source.3488: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.3489: DFBPPR8439 ---- Plant proteins ---- Albumin-2
Source.3490: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.3491: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.3492: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.3493: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.3494: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.3495: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.3496: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3497: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.3498: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3499: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.3500: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.3501: DFBPPR8465 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3502: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.3503: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.3504: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.3505: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3506: DFBPPR8482 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3507: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.3508: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.3509: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.3510: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.3511: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.3512: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.3513: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.3514: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.3515: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.3516: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.3517: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.3518: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.3519: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.3520: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2
Source.3521: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3522: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.3523: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.3524: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.3525: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.3526: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.3527: DFBPPR8525 ---- Milk proteins ---- Glycolactin
Source.3528: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.3529: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.3530: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.3531: DFBPPR15938 ---- Animal proteins ---- Apolipoprotein A-II
Source.3532: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.3533: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.3534: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.3535: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.3536: DFBPPR15944 ---- Animal proteins ---- Ras-related protein Rab-13
Source.3537: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3538: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.3539: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3540: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.3541: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.3542: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.3543: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.3544: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.3545: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.3546: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3547: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.3548: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.3549: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3550: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.3551: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.3552: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.3553: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.3554: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.3555: DFBPPR15977 ---- Animal proteins ---- Cytochrome c
Source.3556: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.3557: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.3558: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.3559: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.3560: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.3561: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.3562: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.3563: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.3564: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.3565: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3566: DFBPPR15998 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.3567: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.3568: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.3569: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3570: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.3571: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.3572: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.3573: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.3574: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3575: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3576: DFBPPR16013 ---- Animal proteins ---- Osteocalcin
Source.3577: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3578: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.3579: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3580: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.3581: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.3582: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.3583: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3584: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3585: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.3586: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.3587: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.3588: DFBPPR16036 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.3589: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.3590: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.3591: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.3592: DFBPPR16044 ---- Animal proteins ---- High mobility group protein B1
Source.3593: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.3594: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3595: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3596: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.3597: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3598: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.3599: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.3600: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.3601: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.3602: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.3603: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.3604: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.3605: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.3606: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.3607: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.3608: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.3609: DFBPPR16078 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.3610: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3611: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.3612: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.3613: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.3614: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.3615: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.3616: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.3617: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.3618: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.3619: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.3620: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.3621: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.3622: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3623: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.3624: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.3625: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.3626: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3627: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.3628: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.3629: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.3630: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.3631: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.3632: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.3633: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.3634: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.3635: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.3636: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.3637: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.3638: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3639: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.3640: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.3641: DFBPPR16139 ---- Animal proteins ---- Lipocalin Can f 6.0101
Source.3642: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.3643: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.3644: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.3645: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.3646: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.3647: DFBPPR16154 ---- Animal proteins ---- Apolipoprotein C-II
Source.3648: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.3649: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.3650: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.3651: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.3652: DFBPPR16166 ---- Animal proteins ---- Ras-related protein Rab-12
Source.3653: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.3654: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.3655: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.3656: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.3657: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.3658: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.3659: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.3660: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.3661: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.3662: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.3663: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.3664: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.3665: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.3666: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3667: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.3668: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.3669: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.3670: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.3671: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.3672: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.3673: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3674: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3675: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3676: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.3677: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.3678: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.3679: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3680: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.3681: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.3682: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3683: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.3684: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.3685: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.3686: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.3687: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.3688: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.3689: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.3690: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.3691: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.3692: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.3693: DFBPPR16235 ---- Animal proteins ---- Serum amyloid A protein
Source.3694: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.3695: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.3696: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.3697: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3698: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.3699: DFBPPR16247 ---- Animal proteins ---- Recoverin
Source.3700: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3701: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.3702: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.3703: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3704: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.3705: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.3706: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3707: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.3708: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.3709: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.3710: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3711: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.3712: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3713: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.3714: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.3715: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta
Source.3716: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.3717: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.3718: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3719: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.3720: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.3721: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.3722: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3723: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.3724: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.3725: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3726: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3727: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3728: DFBPPR16301 ---- Animal proteins ---- Major allergen Can f 1
Source.3729: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.3730: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.3731: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25
Source.3732: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.3733: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3734: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.3735: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.3736: DFBPPR16315 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3737: DFBPPR16316 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3738: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.3739: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.3740: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.3741: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.3742: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.3743: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.3744: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3745: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.3746: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.3747: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.3748: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.3749: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3750: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.3751: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.3752: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.3753: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.3754: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3755: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3756: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.3757: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.3758: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.3759: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.3760: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.3761: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.3762: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.3763: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.3764: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.3765: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.3766: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3767: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.3768: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.3769: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.3770: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.3771: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.3772: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.3773: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.3774: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.3775: DFBPPR16494 ---- Animal proteins ---- C-C motif chemokine 25
Source.3776: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.3777: DFBPPR16497 ---- Animal proteins ---- Interleukin-5
Source.3778: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.3779: DFBPPR16500 ---- Animal proteins ---- C-C motif chemokine 5
Source.3780: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3781: DFBPPR16505 ---- Animal proteins ---- Agouti-signaling protein
Source.3782: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.3783: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.3784: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.3785: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.3786: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.3787: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.3788: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.3789: DFBPPR16524 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.3790: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3791: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.3792: DFBPPR16528 ---- Animal proteins ---- Signal recognition particle 14 kDa protein
Source.3793: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.3794: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.3795: DFBPPR16531 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.3796: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.3797: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.3798: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.3799: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3800: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.3801: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.3802: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.3803: DFBPPR16549 ---- Animal proteins ---- Interleukin-1 alpha
Source.3804: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.3805: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3806: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3807: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.3808: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.3809: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.3810: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.3811: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.3812: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.3813: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3814: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3815: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3816: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.3817: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.3818: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.3819: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3820: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.3821: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.3822: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.3823: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.3824: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.3825: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.3826: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.3827: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.3828: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.3829: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.3830: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.3831: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.3832: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4
Source.3833: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.3834: DFBPPR16621 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3835: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.3836: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.3837: DFBPPR16627 ---- Animal proteins ---- 60S ribosomal protein L15
Source.3838: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.3839: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.3840: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.3841: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3842: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3843: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.3844: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.3845: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.3846: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.3847: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.3848: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1
Source.3849: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.3850: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.3851: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.3852: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.3853: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.3854: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3
Source.3855: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.3856: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.3857: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.3858: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3859: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.3860: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.3861: DFBPPR16723 ---- Animal proteins ---- Ig heavy chain V region GOM
Source.3862: DFBPPR16734 ---- Animal proteins ---- 40S ribosomal protein S11
Source.3863: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.3864: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3865: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3866: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.3867: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.3868: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3869: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3870: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.3871: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.3872: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.3873: DFBPPR16768 ---- Animal proteins ---- Cytochrome c
Source.3874: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.3875: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.3876: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.3877: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.3878: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.3879: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3880: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3881: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.3882: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.3883: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.3884: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3885: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.3886: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.3887: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.3888: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3889: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3890: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.3891: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.3892: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.3893: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.3894: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3895: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.3896: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.3897: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3898: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.3899: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3900: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.3901: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.3902: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3903: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.3904: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.3905: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.3906: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.3907: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial
Source.3908: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.3909: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E
Source.3910: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.3911: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.3912: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.3913: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.3914: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3915: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.3916: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3917: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.3918: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3919: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.3920: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.3921: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.3922: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.3923: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein
Source.3924: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3925: DFBPPR16906 ---- Animal proteins ---- High mobility group protein B1
Source.3926: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3927: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.3928: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.3929: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.3930: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.3931: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.3932: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.3933: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.3934: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.3935: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.3936: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3937: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.3938: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3939: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.3940: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.3941: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.3942: DFBPPR16937 ---- Animal proteins ---- GTP:AMP phosphotransferase AK3, mitochondrial
Source.3943: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3944: DFBPPR16939 ---- Animal proteins ---- Histone H3.3
Source.3945: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.3946: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3947: DFBPPR16946 ---- Animal proteins ---- Recoverin
Source.3948: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2
Source.3949: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.3950: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.3951: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.3952: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3953: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.3954: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3955: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.3956: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.3957: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.3958: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.3959: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.3960: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.3961: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.3962: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3963: DFBPPR16972 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-2
Source.3964: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.3965: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.3966: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3967: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.3968: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.3969: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.3970: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.3971: DFBPPR16988 ---- Animal proteins ---- Protachykinin-1
Source.3972: DFBPPR16989 ---- Animal proteins ---- Cytochrome c
Source.3973: DFBPPR16991 ---- Animal proteins ---- Osteocalcin
Source.3974: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.3975: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.3976: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3977: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.3978: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3979: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.3980: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.3981: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.3982: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.3983: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.3984: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3985: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.3986: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.3987: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.3988: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.3989: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.3990: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.3991: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3992: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.3993: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.3994: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.3995: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3996: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.3997: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3998: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.3999: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.4000: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.4001: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.4002: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.4003: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4004: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.4005: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.4006: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.4007: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.4008: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.4009: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.4010: DFBPPR17058 ---- Animal proteins ---- Ras-related protein Rab-13
Source.4011: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.4012: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.4013: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4014: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.4015: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.4016: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.4017: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.4018: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.4019: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4020: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.4021: DFBPPR17076 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.4022: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.4023: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.4024: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.4025: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.4026: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.4027: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.4028: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.4029: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.4030: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.4031: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.4032: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.4033: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4034: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4035: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.4036: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4037: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4038: DFBPPR17116 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.4039: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.4040: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.4041: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.4042: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.4043: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.4044: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.4045: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.4046: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4047: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.4048: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.4049: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4050: DFBPPR17132 ---- Animal proteins ---- Apolipoprotein A-II
Source.4051: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.4052: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.4053: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.4054: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.4055: DFBPPR17140 ---- Animal proteins ---- Adiponectin
Source.4056: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.4057: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4058: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.4059: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.4060: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.4061: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.4062: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.4063: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.4064: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4065: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.4066: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.4067: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.4068: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.4069: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.4070: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.4071: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.4072: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.4073: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.4074: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.4075: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4076: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4077: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.4078: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.4079: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4080: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4081: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.4082: DFBPPR17245 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.4083: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2
Source.4084: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.4085: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.4086: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.4087: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.4088: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.4089: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.4090: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.4091: DFBPPR17276 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.4092: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.4093: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.4094: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.4095: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.4096: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.4097: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.4098: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.4099: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.4100: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.4101: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.4102: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.4103: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.4104: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.4105: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.4106: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.4107: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.4108: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.4109: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.4110: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.4111: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.4112: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.4113: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.4114: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.4115: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.4116: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.4117: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.4118: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.4119: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.4120: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.4121: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.4122: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.4123: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.4124: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.4125: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.4126: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.4127: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.4128: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.4129: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.4130: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.4131: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.4132: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.4133: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.4134: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.4135: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.4136: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.4137: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.4138: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.4139: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.4140: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.4141: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.4142: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.4143: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.4144: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.4145: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.4146: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.4147: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.4148: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.4149: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.4150: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.4151: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.4152: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.4153: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.4154: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.4155: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.4156: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.4157: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.4158: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.4159: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.4160: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.4161: DFBPPR17402 ---- Animal proteins ---- High mobility group protein B2
Source.4162: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.4163: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.4164: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.4165: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.4166: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.4167: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.4168: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.4169: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.4170: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.4171: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1
Source.4172: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.4173: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.4174: DFBPPR17420 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.4175: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.4176: DFBPPR17423 ---- Animal proteins ---- Furin
Source.4177: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.4178: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.4179: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.4180: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.4181: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.4182: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4183: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.4184: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.4185: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.4186: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1
Source.4187: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.4188: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.4189: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.4190: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.4191: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.4192: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.4193: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.4194: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4195: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.4196: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4197: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.4198: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.4199: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.4200: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.4201: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.4202: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.4203: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.4204: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.4205: DFBPPR17466 ---- Animal proteins ---- N-alpha-acetyltransferase 50
Source.4206: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.4207: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.4208: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.4209: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.4210: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.4211: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.4212: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.4213: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.4214: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.4215: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.4216: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.4217: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.4218: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.4219: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.4220: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.4221: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.4222: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.4223: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase
Source.4224: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.4225: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.4226: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.4227: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.4228: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.4229: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.4230: DFBPPR17517 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.4231: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.4232: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.4233: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.4234: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.4235: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.4236: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.4237: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.4238: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.4239: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.4240: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.4241: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.4242: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3
Source.4243: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.4244: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.4245: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.4246: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.4247: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.4248: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.4249: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.4250: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.4251: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.4252: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.4253: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.4254: DFBPPR17577 ---- Animal proteins ---- Interleukin-1 alpha
Source.4255: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.4256: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.4257: DFBPPR17581 ---- Animal proteins ---- Histone H3.1
Source.4258: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.4259: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.4260: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.4261: DFBPPR17588 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.4262: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.4263: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.4264: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.4265: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.4266: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4267: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.4268: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.4269: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.4270: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.4271: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.4272: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.4273: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.4274: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.4275: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.4276: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.4277: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.4278: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.4279: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.4280: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.4281: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.4282: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial
Source.4283: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.4284: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.4285: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.4286: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.4287: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.4288: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.4289: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.4290: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.4291: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.4292: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.4293: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.4294: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.4295: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.4296: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.4297: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.4298: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.4299: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4300: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.4301: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.4302: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.4303: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.4304: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10
Source.4305: DFBPPR17752 ---- Animal proteins ---- Follistatin
Source.4306: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.4307: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1
Source.4308: DFBPPR17756 ---- Animal proteins ---- Ras-related protein Rab-3B
Source.4309: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.4310: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein
Source.4311: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.4312: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.4313: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.4314: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4
Source.4315: DFBPPR17765 ---- Animal proteins ---- Ras-related protein Rab-27B
Source.4316: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.4317: DFBPPR17769 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.4318: DFBPPR17770 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.4319: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.4320: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4321: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.4322: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.4323: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.4324: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.4325: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.4326: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.4327: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.4328: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.4329: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.4330: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.4331: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.4332: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.4333: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.4334: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.4335: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.4336: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1
Source.4337: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2
Source.4338: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.4339: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.4340: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.4341: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.4342: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.4343: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.4344: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.4345: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.4346: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.4347: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.4348: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.4349: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.4350: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4351: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.4352: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.4353: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.4354: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.4355: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.4356: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.4357: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.4358: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.4359: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.4360: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.4361: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.4362: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.4363: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase
Source.4364: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.4365: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.4366: DFBPPR17871 ---- Animal proteins ---- Ras-related protein Rab-11B
Source.4367: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.4368: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.4369: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.4370: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.4371: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.4372: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.4373: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.4374: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.4375: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.4376: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.4377: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.4378: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4379: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.4380: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.4381: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.4382: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.4383: DFBPPR17912 ---- Animal proteins ---- Histone H3.2
Source.4384: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.4385: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.4386: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.4387: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.4388: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.4389: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P
Source.4390: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.4391: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.4392: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.4393: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.4394: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.4395: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.4396: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.4397: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.4398: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.4399: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.4400: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9
Source.4401: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.4402: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.4403: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.4404: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.4405: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.4406: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.4407: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.4408: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.4409: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.4410: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.4411: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.4412: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.4413: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.4414: DFBPPR17970 ---- Animal proteins ---- Profilin-2
Source.4415: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.4416: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.4417: DFBPPR17974 ---- Animal proteins ---- Mimecan
Source.4418: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.4419: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.4420: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.4421: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.4422: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.4423: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.4424: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.4425: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.4426: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.4427: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.4428: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.4429: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.4430: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.4431: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.4432: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.4433: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.4434: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.4435: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.4436: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.4437: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.4438: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.4439: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.4440: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.4441: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.4442: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.4443: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.4444: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6
Source.4445: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.4446: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4447: DFBPPR18046 ---- Animal proteins ---- NHP2-like protein 1
Source.4448: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.4449: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.4450: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4451: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8
Source.4452: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.4453: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.4454: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.4455: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.4456: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.4457: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.4458: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.4459: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.4460: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.4461: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta
Source.4462: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.4463: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.4464: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.4465: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4466: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.4467: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.4468: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.4469: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.4470: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4471: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.4472: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.4473: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.4474: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.4475: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.4476: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.4477: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.4478: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.4479: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.4480: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.4481: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.4482: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a
Source.4483: DFBPPR18118 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 8
Source.4484: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.4485: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.4486: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1
Source.4487: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.4488: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.4489: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.4490: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.4491: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.4492: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.4493: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.4494: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.4495: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.4496: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.4497: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.4498: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.4499: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.4500: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.4501: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.4502: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.4503: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.4504: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.4505: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.4506: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.4507: DFBPPR18172 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.4508: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.4509: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.4510: DFBPPR18187 ---- Animal proteins ---- Lithostathine
Source.4511: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.4512: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.4513: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2
Source.4514: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4515: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.4516: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.4517: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.4518: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.4519: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.4520: DFBPPR18207 ---- Animal proteins ---- Interleukin-7
Source.4521: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4
Source.4522: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.4523: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.4524: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.4525: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.4526: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.4527: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B
Source.4528: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.4529: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.4530: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4531: DFBPPR18232 ---- Animal proteins ---- Ragulator complex protein LAMTOR1
Source.4532: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.4533: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.4534: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.4535: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.4536: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.4537: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.4538: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.4539: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a
Source.4540: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.4541: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.4542: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.4543: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.4544: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.4545: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.4546: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41
Source.4547: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.4548: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.4549: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.4550: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.4551: DFBPPR18274 ---- Animal proteins ---- Histone deacetylase 8
Source.4552: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.4553: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.4554: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.4555: DFBPPR18284 ---- Animal proteins ---- ATP synthase subunit epsilon, mitochondrial
Source.4556: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.4557: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.4558: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.4559: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.4560: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11
Source.4561: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.4562: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.4563: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.4564: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.4565: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.4566: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.4567: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.4568: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.4569: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.4570: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.4571: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.4572: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.4573: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1
Source.4574: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.4575: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.4576: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.4577: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.4578: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.4579: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.4580: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.4581: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.4582: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.4583: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.4584: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.4585: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.4586: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.4587: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.4588: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4589: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.4590: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.4591: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.4592: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.4593: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.4594: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.4595: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.4596: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4597: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.4598: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.4599: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.4600: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.4601: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.4602: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.4603: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.4604: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.4605: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4606: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4607: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.4608: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.4609: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.4610: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.4611: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.4612: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.4613: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.4614: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.4615: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.4616: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.4617: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.4618: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen
Source.4619: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein
Source.4620: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.4621: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.4622: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.4623: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.4624: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.4625: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.4626: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.4627: DFBPPR18427 ---- Animal proteins ---- Cystatin-C
Source.4628: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.4629: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.4630: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.4631: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.4632: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.4633: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.4634: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.4635: DFBPPR18441 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.4636: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.4637: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.4638: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.4639: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.4640: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.4641: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.4642: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.4643: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.4644: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.4645: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.4646: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.4647: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.4648: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.4649: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.4650: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.4651: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.4652: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.4653: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.4654: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.4655: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.4656: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.4657: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.4658: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.4659: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.4660: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.4661: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.4662: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.4663: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.4664: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.4665: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.4666: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.4667: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial
Source.4668: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.4669: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.4670: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.4671: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C
Source.4672: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.4673: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1
Source.4674: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.4675: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.4676: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.4677: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.4678: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma
Source.4679: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4680: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.4681: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.4682: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.4683: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.4684: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.4685: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.4686: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.4687: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.4688: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.4689: DFBPPR18544 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.4690: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.4691: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.4692: DFBPPR18549 ---- Animal proteins ---- Serum amyloid A protein
Source.4693: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.4694: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.4695: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.4696: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22
Source.4697: DFBPPR18563 ---- Animal proteins ---- Collectin-43
Source.4698: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal
Source.4699: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.4700: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.4701: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.4702: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.4703: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1
Source.4704: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.4705: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.4706: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.4707: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.4708: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.4709: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.4710: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.4711: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.4712: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.4713: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.4714: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.4715: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.4716: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4717: DFBPPR18623 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.4718: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.4719: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.4720: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.4721: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.4722: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.4723: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.4724: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.4725: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.4726: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.4727: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.4728: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.4729: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.4730: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.4731: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.4732: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.4733: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.4734: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.4735: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.4736: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.4737: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.4738: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5
Source.4739: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.4740: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.4741: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.4742: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.4743: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.4744: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5
Source.4745: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.4746: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.4747: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.4748: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.4749: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.4750: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.4751: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.4752: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.4753: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.4754: DFBPPR18753 ---- Animal proteins ---- Endosome-associated-trafficking regulator 1
Source.4755: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.4756: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.4757: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.4758: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.4759: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.4760: DFBPPR18769 ---- Animal proteins ---- Histone H3.3C
Source.4761: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.4762: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.4763: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A
Source.4764: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.4765: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.4766: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.4767: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone
Source.4768: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.4769: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.4770: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.4771: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.4772: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.4773: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.4774: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A
Source.4775: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.4776: DFBPPR18801 ---- Animal proteins ---- Mitochondrial pyruvate carrier 1
Source.4777: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.4778: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.4779: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.4780: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.4781: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.4782: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.4783: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.4784: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.4785: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.4786: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.4787: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.4788: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.4789: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.4790: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.4791: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.4792: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.4793: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2
Source.4794: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.4795: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.4796: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.4797: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.4798: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.4799: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.4800: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.4801: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.4802: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.4803: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.4804: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.4805: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.4806: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.4807: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.4808: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.4809: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.4810: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.4811: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.4812: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.4813: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.4814: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.4815: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.4816: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.4817: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.4818: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.4819: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.4820: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.4821: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.4822: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.4823: DFBPPR18889 ---- Animal proteins ---- Achaete-scute homolog 2
Source.4824: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.4825: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.4826: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.4827: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.4828: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.4829: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.4830: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.4831: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.4832: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.4833: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.4834: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.4835: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.4836: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.4837: DFBPPR18920 ---- Animal proteins ---- Profilin-1
Source.4838: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.4839: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.4840: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.4841: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.4842: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.4843: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.4844: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.4845: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.4846: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial
Source.4847: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.4848: DFBPPR18942 ---- Animal proteins ---- Four and a half LIM domains protein 2
Source.4849: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.4850: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.4851: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.4852: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.4853: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.4854: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.4855: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.4856: DFBPPR18958 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.4857: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.4858: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.4859: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.4860: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.4861: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.4862: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.4863: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.4864: DFBPPR18980 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.4865: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.4866: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.4867: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.4868: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.4869: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.4870: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.4871: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.4872: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.4873: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.4874: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.4875: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.4876: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.4877: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.4878: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.4879: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.4880: DFBPPR19014 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 1
Source.4881: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.4882: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4883: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.4884: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.4885: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.4886: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.4887: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.4888: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.4889: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.4890: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.4891: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.4892: DFBPPR19042 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 2
Source.4893: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.4894: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.4895: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.4896: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.4897: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.4898: DFBPPR19051 ---- Animal proteins ---- Pro-neuropeptide Y
Source.4899: DFBPPR19053 ---- Animal proteins ---- Transmembrane protein 100
Source.4900: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.4901: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.4902: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.4903: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.4904: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.4905: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.4906: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.4907: DFBPPR19066 ---- Animal proteins ---- Agouti-signaling protein
Source.4908: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.4909: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.4910: DFBPPR19071 ---- Animal proteins ---- Collectrin
Source.4911: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4912: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2
Source.4913: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.4914: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.4915: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.4916: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.4917: DFBPPR19096 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.4918: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.4919: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.4920: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.4921: DFBPPR19102 ---- Animal proteins ---- Cytoplasmic FMR1-interacting protein 1
Source.4922: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.4923: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.4924: DFBPPR19106 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.4925: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.4926: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.4927: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3
Source.4928: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.4929: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.4930: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.4931: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.4932: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.4933: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.4934: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.4935: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.4936: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.4937: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.4938: DFBPPR19131 ---- Animal proteins ---- Nectin-4
Source.4939: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease
Source.4940: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.4941: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.4942: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.4943: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2
Source.4944: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.4945: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.4946: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.4947: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.4948: DFBPPR19164 ---- Animal proteins ---- RNA-binding protein with serine-rich domain 1
Source.4949: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.4950: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.4951: DFBPPR19170 ---- Animal proteins ---- Isoaspartyl peptidase/L-asparaginase
Source.4952: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.4953: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.4954: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4955: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.4956: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.4957: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.4958: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.4959: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.4960: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.4961: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.4962: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.4963: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.4964: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.4965: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.4966: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.4967: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.4968: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.4969: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2
Source.4970: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.4971: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.4972: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.4973: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.4974: DFBPPR19219 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A2, mitochondrial
Source.4975: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.4976: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.4977: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.4978: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.4979: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.4980: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.4981: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.4982: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.4983: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.4984: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.4985: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.4986: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.4987: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.4988: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.4989: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.4990: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.4991: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.4992: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.4993: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.4994: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.4995: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.4996: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.4997: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.4998: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.4999: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.5000: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.5001: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.5002: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.5003: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.5004: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.5005: DFBPPR19280 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF183
Source.5006: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.5007: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.5008: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.5009: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.5010: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.5011: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.5012: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.5013: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.5014: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.5015: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.5016: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.5017: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.5018: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.5019: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.5020: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.5021: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.5022: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.5023: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.5024: DFBPPR19317 ---- Animal proteins ---- AP-1 complex subunit sigma-1A
Source.5025: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1
Source.5026: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.5027: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.5028: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.5029: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.5030: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.5031: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.5032: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.5033: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.5034: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.5035: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.5036: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.5037: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.5038: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.5039: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.5040: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.5041: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.5042: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.5043: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.5044: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.5045: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.5046: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3
Source.5047: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.5048: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.5049: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.5050: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.5051: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.5052: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.5053: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.5054: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.5055: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.5056: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.5057: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.5058: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.5059: DFBPPR19383 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 1
Source.5060: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.5061: DFBPPR19389 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.5062: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.5063: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.5064: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.5065: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.5066: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.5067: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.5068: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.5069: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.5070: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.5071: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.5072: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.5073: DFBPPR19417 ---- Animal proteins ---- L-xylulose reductase
Source.5074: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22
Source.5075: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.5076: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.5077: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.5078: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.5079: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.5080: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.5081: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial
Source.5082: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.5083: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.5084: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.5085: DFBPPR19443 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.5086: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.5087: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.5088: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.5089: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.5090: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.5091: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.5092: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.5093: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.5094: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.5095: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.5096: DFBPPR19456 ---- Animal proteins ---- Ly-6/neurotoxin-like protein 1
Source.5097: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.5098: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.5099: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.5100: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.5101: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.5102: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.5103: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.5104: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.5105: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.5106: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.5107: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.5108: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.5109: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.5110: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.5111: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.5112: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.5113: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.5114: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.5115: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.5116: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.5117: DFBPPR19496 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.5118: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2
Source.5119: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.5120: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.5121: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.5122: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.5123: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.5124: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.5125: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.5126: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.5127: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.5128: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.5129: DFBPPR19530 ---- Animal proteins ---- Tuftelin
Source.5130: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.5131: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.5132: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.5133: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.5134: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.5135: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.5136: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.5137: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein
Source.5138: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial
Source.5139: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.5140: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.5141: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.5142: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.5143: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.5144: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.5145: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.5146: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.5147: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.5148: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.5149: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4
Source.5150: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.5151: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.5152: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.5153: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.5154: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.5155: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.5156: DFBPPR19574 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit 2
Source.5157: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.5158: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.5159: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.5160: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.5161: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.5162: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.5163: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.5164: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.5165: DFBPPR19594 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.5166: DFBPPR19595 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.5167: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.5168: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.5169: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.5170: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.5171: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.5172: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.5173: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.5174: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.5175: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.5176: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.5177: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.5178: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.5179: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.5180: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.5181: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.5182: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.5183: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.5184: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.5185: DFBPPR19645 ---- Animal proteins ---- Barrier-to-autointegration factor
Source.5186: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.5187: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.5188: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.5189: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.5190: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.5191: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.5192: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.5193: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.5194: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.5195: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.5196: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2
Source.5197: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.5198: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.5199: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.5200: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.5201: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.5202: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.5203: DFBPPR19678 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 5
Source.5204: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.5205: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.5206: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.5207: DFBPPR19686 ---- Animal proteins ---- Spindle and kinetochore-associated protein 1
Source.5208: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.5209: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5
Source.5210: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.5211: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.5212: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.5213: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.5214: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.5215: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.5216: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.5217: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.5218: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.5219: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.5220: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.5221: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.5222: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.5223: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.5224: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.5225: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.5226: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.5227: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.5228: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.5229: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.5230: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.5231: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.5232: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.5233: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.5234: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.5235: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5
Source.5236: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.5237: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.5238: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.5239: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.5240: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein
Source.5241: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.5242: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.5243: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.5244: DFBPPR19758 ---- Animal proteins ---- MICOS complex subunit MIC25
Source.5245: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.5246: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.5247: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.5248: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.5249: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.5250: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH
Source.5251: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.5252: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog
Source.5253: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.5254: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit
Source.5255: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.5256: DFBPPR19783 ---- Animal proteins ---- Syndecan-1
Source.5257: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.5258: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.5259: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.5260: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.5261: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.5262: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.5263: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.5264: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.5265: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.5266: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.5267: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.5268: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.5269: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.5270: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.5271: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.5272: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.5273: DFBPPR19820 ---- Animal proteins ---- Septin-10
Source.5274: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.5275: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.5276: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.5277: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.5278: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.5279: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.5280: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.5281: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.5282: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.5283: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.5284: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.5285: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.5286: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.5287: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.5288: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.5289: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.5290: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.5291: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.5292: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.5293: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.5294: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.5295: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.5296: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.5297: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.5298: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.5299: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.5300: DFBPPR19877 ---- Animal proteins ---- Histone H3-like centromeric protein A
Source.5301: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.5302: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.5303: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.5304: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.5305: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.5306: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.5307: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.5308: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.5309: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.5310: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.5311: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.5312: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.5313: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.5314: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.5315: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.5316: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.5317: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.5318: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.5319: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.5320: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.5321: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.5322: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.5323: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.5324: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.5325: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.5326: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.5327: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.5328: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.5329: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.5330: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2
Source.5331: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.5332: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.5333: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.5334: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.5335: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.5336: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.5337: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.5338: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.5339: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.5340: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.5341: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.5342: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma
Source.5343: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.5344: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.5345: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.5346: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.5347: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.5348: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.5349: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.5350: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.5351: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.5352: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.5353: DFBPPR19992 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm3
Source.5354: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein
Source.5355: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.5356: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.5357: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.5358: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.5359: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.5360: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.5361: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.5362: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.5363: DFBPPR20019 ---- Animal proteins ---- 28S ribosomal protein S16, mitochondrial
Source.5364: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.5365: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.5366: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.5367: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.5368: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.5369: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.5370: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.5371: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.5372: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.5373: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.5374: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.5375: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.5376: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.5377: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.5378: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.5379: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.5380: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.5381: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.5382: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.5383: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.5384: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.5385: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.5386: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.5387: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.5388: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.5389: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.5390: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.5391: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.5392: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.5393: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.5394: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.5395: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.5396: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.5397: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.5398: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.5399: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.5400: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.5401: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.5402: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.5403: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.5404: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.5405: DFBPPR20102 ---- Animal proteins ---- Cylicin-2
Source.5406: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.5407: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.5408: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.5409: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.5410: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.5411: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.5412: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.5413: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B
Source.5414: DFBPPR20125 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 2
Source.5415: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.5416: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.5417: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.5418: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.5419: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.5420: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.5421: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma
Source.5422: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.5423: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.5424: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.5425: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.5426: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.5427: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.5428: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.5429: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.5430: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.5431: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.5432: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.5433: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.5434: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.5435: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein
Source.5436: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3
Source.5437: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.5438: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.5439: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.5440: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.5441: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.5442: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.5443: DFBPPR20203 ---- Animal proteins ---- Calcitonin
Source.5444: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.5445: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.5446: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.5447: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.5448: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.5449: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.5450: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.5451: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.5452: DFBPPR20225 ---- Animal proteins ---- Claudin-2
Source.5453: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.5454: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.5455: DFBPPR20231 ---- Animal proteins ---- Dynein light chain 2, cytoplasmic
Source.5456: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.5457: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.5458: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.5459: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.5460: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.5461: DFBPPR20241 ---- Animal proteins ---- Ras-related protein Rab-8B
Source.5462: DFBPPR20242 ---- Animal proteins ---- Coactosin-like protein
Source.5463: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.5464: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.5465: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.5466: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.5467: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.5468: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.5469: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.5470: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12
Source.5471: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.5472: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.5473: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4
Source.5474: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.5475: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.5476: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.5477: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.5478: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.5479: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.5480: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1
Source.5481: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.5482: DFBPPR20295 ---- Animal proteins ---- Protein dpy-30 homolog
Source.5483: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.5484: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.5485: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.5486: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3
Source.5487: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B
Source.5488: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.5489: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.5490: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.5491: DFBPPR20326 ---- Animal proteins ---- Survival of motor neuron-related-splicing factor 30
Source.5492: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.5493: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.5494: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.5495: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.5496: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.5497: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.5498: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial
Source.5499: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.5500: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.5501: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.5502: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.5503: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.5504: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.5505: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.5506: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.5507: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.5508: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.5509: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.5510: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.5511: DFBPPR20363 ---- Animal proteins ---- F-box/LRR-repeat protein 2
Source.5512: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.5513: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.5514: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.5515: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.5516: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.5517: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.5518: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.5519: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.5520: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.5521: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.5522: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2
Source.5523: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.5524: DFBPPR20404 ---- Animal proteins ---- Protein tilB homolog
Source.5525: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.5526: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.5527: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.5528: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.5529: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.5530: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.5531: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.5532: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.5533: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.5534: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.5535: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.5536: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.5537: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.5538: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.5539: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.5540: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.5541: DFBPPR20438 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.5542: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.5543: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5
Source.5544: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.5545: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.5546: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.5547: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.5548: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.5549: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.5550: DFBPPR20453 ---- Animal proteins ---- Cysteine dioxygenase type 1
Source.5551: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.5552: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.5553: DFBPPR20458 ---- Animal proteins ---- Putative transcription factor Ovo-like 1
Source.5554: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.5555: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.5556: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.5557: DFBPPR20467 ---- Animal proteins ---- Tetranectin
Source.5558: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.5559: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.5560: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.5561: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.5562: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.5563: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.5564: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.5565: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.5566: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.5567: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog
Source.5568: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.5569: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.5570: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial
Source.5571: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.5572: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.5573: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.5574: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.5575: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.5576: DFBPPR20518 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC5
Source.5577: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6
Source.5578: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.5579: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.5580: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.5581: DFBPPR20530 ---- Animal proteins ---- Protein HEXIM2
Source.5582: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.5583: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.5584: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.5585: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.5586: DFBPPR20553 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.5587: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.5588: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.5589: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.5590: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.5591: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.5592: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10
Source.5593: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.5594: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.5595: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a
Source.5596: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.5597: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.5598: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.5599: DFBPPR20585 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 3
Source.5600: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.5601: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.5602: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein
Source.5603: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.5604: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.5605: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.5606: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.5607: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.5608: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.5609: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.5610: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.5611: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.5612: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.5613: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.5614: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.5615: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.5616: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.5617: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.5618: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.5619: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.5620: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.5621: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.5622: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.5623: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.5624: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.5625: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.5626: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.5627: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.5628: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.5629: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.5630: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.5631: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.5632: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.5633: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial
Source.5634: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.5635: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.5636: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.5637: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.5638: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.5639: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2
Source.5640: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.5641: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.5642: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.5643: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.5644: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.5645: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.5646: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.5647: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.5648: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.5649: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.5650: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.5651: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog
Source.5652: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.5653: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.5654: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.5655: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.5656: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.5657: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.5658: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.5659: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B
Source.5660: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.5661: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.5662: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.5663: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.5664: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.5665: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.5666: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.5667: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.5668: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.5669: DFBPPR20768 ---- Animal proteins ---- Lysozyme-like protein 1
Source.5670: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.5671: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.5672: DFBPPR20775 ---- Animal proteins ---- Colipase
Source.5673: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.5674: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.5675: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.5676: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.5677: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.5678: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.5679: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.5680: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.5681: DFBPPR20799 ---- Animal proteins ---- F-box/LRR-repeat protein 20
Source.5682: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.5683: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.5684: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.5685: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.5686: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.5687: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.5688: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.5689: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.5690: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.5691: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.5692: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT
Source.5693: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.5694: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.5695: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.5696: DFBPPR20830 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.5697: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.5698: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.5699: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.5700: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.5701: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.5702: DFBPPR20841 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.5703: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.5704: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.5705: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.5706: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.5707: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.5708: DFBPPR20852 ---- Animal proteins ---- 28S ribosomal protein S21, mitochondrial
Source.5709: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2
Source.5710: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.5711: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.5712: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.5713: DFBPPR20877 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD5
Source.5714: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.5715: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.5716: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.5717: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.5718: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.5719: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2
Source.5720: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.5721: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.5722: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.5723: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.5724: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.5725: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.5726: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.5727: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.5728: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.5729: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.5730: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.5731: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.5732: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.5733: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.5734: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.5735: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.5736: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.5737: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.5738: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.5739: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.5740: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B
Source.5741: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.5742: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.5743: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial
Source.5744: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.5745: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.5746: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.5747: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.5748: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.5749: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.5750: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.5751: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.5752: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.5753: DFBPPR20978 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 B
Source.5754: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.5755: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.5756: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.5757: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.5758: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.5759: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.5760: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.5761: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.5762: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.5763: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.5764: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.5765: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.5766: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.5767: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.5768: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.5769: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.5770: DFBPPR21023 ---- Animal proteins ---- Ribosome biogenesis protein NSA2 homolog
Source.5771: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.5772: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.5773: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.5774: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.5775: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.5776: DFBPPR21040 ---- Animal proteins ---- Neuritin
Source.5777: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.5778: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.5779: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.5780: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.5781: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.5782: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.5783: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.5784: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.5785: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.5786: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.5787: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.5788: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.5789: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.5790: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.5791: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.5792: DFBPPR21092 ---- Animal proteins ---- Calponin-1
Source.5793: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.5794: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.5795: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.5796: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.5797: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.5798: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.5799: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.5800: DFBPPR21118 ---- Animal proteins ---- NADH-cytochrome b5 reductase 1
Source.5801: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog
Source.5802: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.5803: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.5804: DFBPPR21129 ---- Animal proteins ---- 60S ribosomal protein L15
Source.5805: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.5806: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.5807: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.5808: DFBPPR21145 ---- Animal proteins ---- Transcription elongation factor SPT4
Source.5809: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.5810: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.5811: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.5812: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.5813: DFBPPR21158 ---- Animal proteins ---- Stress-induced-phosphoprotein 1
Source.5814: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor
Source.5815: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.5816: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.5817: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.5818: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.5819: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52
Source.5820: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.5821: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H
Source.5822: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7
Source.5823: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.5824: DFBPPR21183 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.5825: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.5826: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.5827: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.5828: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.5829: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.5830: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.5831: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.5832: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.5833: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6
Source.5834: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.5835: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.5836: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.5837: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.5838: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.5839: DFBPPR21229 ---- Animal proteins ---- Neurexophilin-2
Source.5840: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.5841: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.5842: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2
Source.5843: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1
Source.5844: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.5845: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1
Source.5846: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.5847: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.5848: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.5849: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3
Source.5850: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.5851: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.5852: DFBPPR21267 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.5853: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.5854: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.5855: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.5856: DFBPPR21274 ---- Animal proteins ---- 39S ribosomal protein L48, mitochondrial
Source.5857: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.5858: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.5859: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.5860: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2
Source.5861: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.5862: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.5863: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.5864: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.5865: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58
Source.5866: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.5867: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.5868: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.5869: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.5870: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.5871: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.5872: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.5873: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.5874: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.5875: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner
Source.5876: DFBPPR21316 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit alpha
Source.5877: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.5878: DFBPPR21320 ---- Animal proteins ---- Sjoegren syndrome nuclear autoantigen 1 homolog
Source.5879: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.5880: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma
Source.5881: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.5882: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3
Source.5883: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.5884: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124
Source.5885: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.5886: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.5887: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.5888: DFBPPR21345 ---- Animal proteins ---- XIAP-associated factor 1
Source.5889: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.5890: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397
Source.5891: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.5892: DFBPPR21351 ---- Animal proteins ---- Protein kish-A
Source.5893: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.5894: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.5895: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.5896: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.5897: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.5898: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.5899: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.5900: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.5901: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.5902: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.5903: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.5904: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.5905: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.5906: DFBPPR21381 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A-related protein, mitochondrial
Source.5907: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.5908: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.5909: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.5910: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.5911: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.5912: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.5913: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.5914: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.5915: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.5916: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37
Source.5917: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.5918: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.5919: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.5920: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.5921: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.5922: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.5923: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.5924: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.5925: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.5926: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.5927: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.5928: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.5929: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.5930: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.5931: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207
Source.5932: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.5933: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.5934: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.5935: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.5936: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.5937: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.5938: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.5939: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.5940: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.5941: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.5942: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.5943: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.5944: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.5945: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial
Source.5946: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.5947: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.5948: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.5949: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.5950: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.5951: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.5952: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.5953: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.5954: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.5955: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2
Source.5956: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.5957: DFBPPR21499 ---- Animal proteins ---- Barrier-to-autointegration factor-like protein
Source.5958: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.5959: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.5960: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.5961: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.5962: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.5963: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.5964: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.5965: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.5966: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4
Source.5967: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.5968: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.5969: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.5970: DFBPPR21542 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6c
Source.5971: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.5972: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.5973: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.5974: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1
Source.5975: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.5976: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.5977: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.5978: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.5979: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B
Source.5980: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.5981: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.5982: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.5983: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.5984: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19
Source.5985: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.5986: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.5987: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.5988: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.5989: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.5990: DFBPPR21600 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit H
Source.5991: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.5992: DFBPPR21604 ---- Animal proteins ---- Zinc finger protein 345
Source.5993: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.5994: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.5995: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.5996: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.5997: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.5998: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.5999: DFBPPR21628 ---- Animal proteins ---- G patch domain-containing protein 11
Source.6000: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.6001: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.6002: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.6003: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.6004: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.6005: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.6006: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.6007: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26
Source.6008: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6
Source.6009: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.6010: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.6011: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.6012: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.6013: DFBPPR21664 ---- Animal proteins ---- Signal recognition particle 14 kDa protein
Source.6014: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.6015: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.6016: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.6017: DFBPPR21677 ---- Animal proteins ---- Dolichol phosphate-mannose biosynthesis regulatory protein
Source.6018: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A
Source.6019: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26
Source.6020: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.6021: DFBPPR21687 ---- Animal proteins ---- Ropporin-1-like protein
Source.6022: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.6023: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.6024: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.6025: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.6026: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.6027: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2
Source.6028: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.6029: DFBPPR21708 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.6030: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.6031: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.6032: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.6033: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.6034: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.6035: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.6036: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.6037: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.6038: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.6039: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.6040: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.6041: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.6042: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.6043: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.6044: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta
Source.6045: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.6046: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.6047: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.6048: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.6049: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.6050: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.6051: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.6052: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28
Source.6053: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.6054: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.6055: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.6056: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.6057: DFBPPR21771 ---- Animal proteins ---- RAD9, HUS1, RAD1-interacting nuclear orphan protein 1
Source.6058: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.6059: DFBPPR21774 ---- Animal proteins ---- Gem-associated protein 6
Source.6060: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.6061: DFBPPR21780 ---- Animal proteins ---- 40S ribosomal protein S11
Source.6062: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.6063: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.6064: DFBPPR21789 ---- Animal proteins ---- Protein kish-B
Source.6065: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.6066: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.6067: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.6068: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.6069: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.6070: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.6071: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.6072: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.6073: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.6074: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1
Source.6075: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6076: DFBPPR21811 ---- Animal proteins ---- Coiled-coil domain-containing protein 89
Source.6077: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog
Source.6078: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.6079: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.6080: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.6081: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.6082: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.6083: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.6084: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.6085: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.6086: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.6087: DFBPPR21840 ---- Animal proteins ---- Keratin-associated protein 3-1
Source.6088: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A
Source.6089: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.6090: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17
Source.6091: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.6092: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.6093: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.6094: DFBPPR21856 ---- Animal proteins ---- Protein FAM32A
Source.6095: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.6096: DFBPPR21861 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 3, mitochondrial
Source.6097: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.6098: DFBPPR21869 ---- Animal proteins ---- Centromere protein O
Source.6099: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.6100: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.6101: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.6102: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.6103: DFBPPR21878 ---- Animal proteins ---- Statherin
Source.6104: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.6105: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.6106: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.6107: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.6108: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.6109: DFBPPR21904 ---- Animal proteins ---- Protein TBATA
Source.6110: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.6111: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.6112: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.6113: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.6114: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.6115: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.6116: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.6117: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.6118: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.6119: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.6120: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.6121: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.6122: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.6123: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.6124: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.6125: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.6126: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.6127: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3
Source.6128: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.6129: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.6130: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.6131: DFBPPR21964 ---- Animal proteins ---- Protein yippee-like 3
Source.6132: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.6133: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.6134: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.6135: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5
Source.6136: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.6137: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.6138: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.6139: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6140: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.6141: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.6142: DFBPPR21986 ---- Animal proteins ---- Gem-associated protein 8
Source.6143: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.6144: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2
Source.6145: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1
Source.6146: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.6147: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.6148: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.6149: DFBPPR22004 ---- Animal proteins ---- 60S ribosomal protein L35a
Source.6150: DFBPPR22007 ---- Animal proteins ---- Protein C8orf37 homolog
Source.6151: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.6152: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.6153: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial
Source.6154: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.6155: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.6156: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.6157: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.6158: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.6159: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.6160: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.6161: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1
Source.6162: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.6163: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.6164: DFBPPR22063 ---- Animal proteins ---- 60S ribosomal protein L29
Source.6165: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.6166: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.6167: DFBPPR22071 ---- Animal proteins ---- Neuromedin-S
Source.6168: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.6169: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.6170: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.6171: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49
Source.6172: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.6173: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.6174: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.6175: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.6176: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.6177: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.6178: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.6179: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.6180: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.6181: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4
Source.6182: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.6183: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.6184: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.6185: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.6186: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.6187: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.6188: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.6189: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.6190: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.6191: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.6192: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.6193: DFBPPR22125 ---- Animal proteins ---- 40S ribosomal protein S16
Source.6194: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.6195: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.6196: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.6197: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.6198: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.6199: DFBPPR22138 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 7
Source.6200: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.6201: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.6202: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.6203: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.6204: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.6205: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.6206: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.6207: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.6208: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1
Source.6209: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.6210: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.6211: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.6212: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.6213: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.6214: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.6215: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256
Source.6216: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14
Source.6217: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.6218: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.6219: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.6220: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.6221: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.6222: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.6223: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.6224: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.6225: DFBPPR22194 ---- Animal proteins ---- Cystatin-9
Source.6226: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.6227: DFBPPR22202 ---- Animal proteins ---- Protein FMC1 homolog
Source.6228: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.6229: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.6230: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1
Source.6231: DFBPPR22208 ---- Animal proteins ---- Protein yippee-like 2
Source.6232: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.6233: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.6234: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.6235: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.6236: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.6237: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.6238: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.6239: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.6240: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.6241: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A
Source.6242: DFBPPR22234 ---- Animal proteins ---- COMM domain-containing protein 3
Source.6243: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.6244: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.6245: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.6246: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.6247: DFBPPR22250 ---- Animal proteins ---- Tetratricopeptide repeat protein 23-like
Source.6248: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1
Source.6249: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.6250: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.6251: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.6252: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.6253: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.6254: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog
Source.6255: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial
Source.6256: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.6257: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.6258: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.6259: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.6260: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.6261: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.6262: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.6263: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.6264: DFBPPR22297 ---- Animal proteins ---- Histatherin
Source.6265: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.6266: DFBPPR22303 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 4
Source.6267: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.6268: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1
Source.6269: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein
Source.6270: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2
Source.6271: DFBPPR22315 ---- Animal proteins ---- Probable cystatin-15
Source.6272: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.6273: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.6274: DFBPPR22323 ---- Animal proteins ---- Meiosis expressed gene 1 protein homolog
Source.6275: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.6276: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.6277: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.6278: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.6279: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16
Source.6280: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.6281: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.6282: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.6283: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.6284: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.6285: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.6286: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.6287: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.6288: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.6289: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.6290: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.6291: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.6292: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.6293: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.6294: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.6295: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.6296: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.6297: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.6298: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.6299: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.6300: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.6301: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.6302: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog
Source.6303: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.6304: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.6305: DFBPPR22425 ---- Animal proteins ---- Protein THEM6
Source.6306: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.6307: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.6308: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.6309: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.6310: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.6311: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.6312: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4
Source.6313: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.6314: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.6315: DFBPPR22471 ---- Animal proteins ---- Protein shisa-like-2B
Source.6316: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.6317: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.6318: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.6319: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.6320: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.6321: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.6322: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.6323: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.6324: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.6325: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.6326: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.6327: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.6328: DFBPPR22498 ---- Animal proteins ---- Protein NATD1
Source.6329: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1
Source.6330: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46
Source.6331: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.6332: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog
Source.6333: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.6334: DFBPPR22515 ---- Animal proteins ---- Small integral membrane protein 8
Source.6335: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.6336: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.6337: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.6338: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.6339: DFBPPR22530 ---- Animal proteins ---- Coiled-coil domain-containing protein 167
Source.6340: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.6341: DFBPPR22540 ---- Animal proteins ---- Coiled-coil domain-containing protein 25
Source.6342: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.6343: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.6344: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23
Source.6345: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.6346: DFBPPR22554 ---- Animal proteins ---- ELMO domain-containing protein 1
Source.6347: DFBPPR22555 ---- Animal proteins ---- Bcl-2-like protein 15
Source.6348: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.6349: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.6350: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.6351: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.6352: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.6353: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.6354: DFBPPR22581 ---- Animal proteins ---- UPF0690 protein C1orf52 homolog
Source.6355: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.6356: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.6357: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.6358: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26
Source.6359: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.6360: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.6361: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254
Source.6362: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.6363: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36
Source.6364: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105
Source.6365: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.6366: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.6367: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.6368: DFBPPR22620 ---- Animal proteins ---- Cysteine-rich tail protein 1
Source.6369: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.6370: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253
Source.6371: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.6372: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270
Source.6373: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30
Source.6374: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.6375: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.6376: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.6377: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.6378: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.6379: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog
Source.6380: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.6381: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.6382: DFBPPR22675 ---- Animal proteins ---- UPF0711 protein C18orf21 homolog
Source.6383: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.6384: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A
Source.6385: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.6386: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.6387: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2
Source.6388: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D
Source.6389: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog
Source.6390: DFBPPR22715 ---- Animal proteins ---- Spermatogenesis-associated protein 45
Source.6391: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.6392: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.6393: DFBPPR22730 ---- Animal proteins ---- UPF0545 protein C22orf39 homolog
Source.6394: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.6395: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1
Source.6396: DFBPPR22739 ---- Animal proteins ---- Testis, prostate and placenta-expressed protein
Source.6397: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog
Source.6398: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.6399: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.6400: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog
Source.6401: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.6402: DFBPPR22757 ---- Animal proteins ---- Uncharacterized protein CXorf65 homolog
Source.6403: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog
Source.6404: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog
Source.6405: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.6406: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.6407: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.6408: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.6409: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.6410: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.6411: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.6412: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.6413: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.6414: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.6415: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.6416: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.6417: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.6418: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.6419: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.6420: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.6421: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6422: DFBPPR8553 ---- Animal proteins ---- Protein AMBP
Source.6423: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.6424: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.6425: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6426: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.6427: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.6428: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.6429: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.6430: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.6431: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.6432: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.6433: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.6434: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.6435: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.6436: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.6437: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.6438: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.6439: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.6440: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.6441: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.6442: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.6443: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.6444: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.6445: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.6446: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.6447: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein
Source.6448: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.6449: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.6450: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.6451: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.6452: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.6453: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6454: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.6455: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.6456: DFBPPR8623 ---- Animal proteins ---- High mobility group protein B1
Source.6457: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.6458: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.6459: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.6460: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.6461: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.6462: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.6463: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.6464: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.6465: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.6466: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.6467: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.6468: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.6469: DFBPPR8655 ---- Animal proteins ---- Azurocidin
Source.6470: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.6471: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.6472: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.6473: DFBPPR8666 ---- Animal proteins ---- Histone H3.3
Source.6474: DFBPPR8667 ---- Animal proteins ---- High mobility group protein B2
Source.6475: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.6476: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.6477: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.6478: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.6479: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.6480: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.6481: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.6482: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.6483: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.6484: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.6485: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.6486: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.6487: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.6488: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.6489: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.6490: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.6491: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.6492: DFBPPR8697 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.6493: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.6494: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.6495: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.6496: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.6497: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.6498: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.6499: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.6500: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.6501: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.6502: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.6503: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.6504: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.6505: DFBPPR8718 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.6506: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.6507: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.6508: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.6509: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.6510: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.6511: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.6512: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase
Source.6513: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.6514: DFBPPR8733 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.6515: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.6516: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.6517: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.6518: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.6519: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.6520: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.6521: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.6522: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.6523: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.6524: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.6525: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.6526: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.6527: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.6528: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.6529: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.6530: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.6531: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.6532: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.6533: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.6534: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.6535: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.6536: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.6537: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.6538: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.6539: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.6540: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.6541: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.6542: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.6543: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.6544: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.6545: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.6546: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.6547: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.6548: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.6549: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.6550: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II
Source.6551: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.6552: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.6553: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.6554: DFBPPR8810 ---- Animal proteins ---- Follistatin
Source.6555: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.6556: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.6557: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.6558: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.6559: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase
Source.6560: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.6561: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.6562: DFBPPR8832 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.6563: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.6564: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.6565: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.6566: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.6567: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.6568: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.6569: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.6570: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.6571: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.6572: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.6573: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.6574: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.6575: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.6576: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.6577: DFBPPR8859 ---- Animal proteins ---- Interleukin-1 alpha
Source.6578: DFBPPR8861 ---- Animal proteins ---- Colipase
Source.6579: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.6580: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.6581: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.6582: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.6583: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.6584: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.6585: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.6586: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.6587: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.6588: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.6589: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.6590: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.6591: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.6592: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.6593: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.6594: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.6595: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.6596: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.6597: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.6598: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.6599: DFBPPR8926 ---- Animal proteins ---- Osteocalcin
Source.6600: DFBPPR8927 ---- Animal proteins ---- Pro-neuropeptide Y
Source.6601: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.6602: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.6603: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.6604: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.6605: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.6606: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.6607: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.6608: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.6609: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.6610: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6611: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.6612: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.6613: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.6614: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.6615: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.6616: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.6617: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.6618: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.6619: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic
Source.6620: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.6621: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.6622: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.6623: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.6624: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.6625: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.6626: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.6627: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.6628: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.6629: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.6630: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.6631: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.6632: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.6633: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.6634: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.6635: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.6636: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.6637: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B
Source.6638: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.6639: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.6640: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.6641: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.6642: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.6643: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.6644: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.6645: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.6646: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.6647: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.6648: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.6649: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.6650: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.6651: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.6652: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.6653: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.6654: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.6655: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.6656: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.6657: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.6658: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.6659: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.6660: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.6661: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.6662: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.6663: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.6664: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.6665: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.6666: DFBPPR9123 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.6667: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.6668: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.6669: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.6670: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.6671: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.6672: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.6673: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.6674: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.6675: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.6676: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.6677: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.6678: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.6679: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.6680: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.6681: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.6682: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.6683: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.6684: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.6685: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3
Source.6686: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.6687: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.6688: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.6689: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.6690: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.6691: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.6692: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.6693: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.6694: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2
Source.6695: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.6696: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.6697: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.6698: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.6699: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.6700: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.6701: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.6702: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.6703: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.6704: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.6705: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.6706: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.6707: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6708: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.6709: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.6710: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.6711: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C
Source.6712: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.6713: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.6714: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.6715: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.6716: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.6717: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9
Source.6718: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.6719: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.6720: DFBPPR9249 ---- Animal proteins ---- 5-hydroxytryptamine receptor 4
Source.6721: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.6722: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.6723: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4
Source.6724: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.6725: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.6726: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.6727: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.6728: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.6729: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.6730: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.6731: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.6732: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.6733: DFBPPR9272 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.6734: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.6735: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.6736: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.6737: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.6738: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.6739: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.6740: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6741: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.6742: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.6743: DFBPPR9304 ---- Animal proteins ---- Peroxiredoxin-2
Source.6744: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.6745: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.6746: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.6747: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.6748: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.6749: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.6750: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.6751: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.6752: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.6753: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6754: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.6755: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.6756: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.6757: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.6758: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.6759: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.6760: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.6761: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.6762: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.6763: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.6764: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.6765: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta
Source.6766: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.6767: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.6768: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.6769: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.6770: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.6771: DFBPPR9402 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.6772: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.6773: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.6774: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6775: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6776: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.6777: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.6778: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.6779: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.6780: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.6781: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.6782: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.6783: DFBPPR9422 ---- Animal proteins ---- C-C motif chemokine 25
Source.6784: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.6785: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.6786: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.6787: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.6788: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.6789: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.6790: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.6791: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.6792: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.6793: DFBPPR9448 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.6794: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.6795: DFBPPR9456 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.6796: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.6797: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.6798: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.6799: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.6800: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.6801: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.6802: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.6803: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.6804: DFBPPR9518 ---- Animal proteins ---- Interleukin-5
Source.6805: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.6806: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.6807: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.6808: DFBPPR9523 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.6809: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.6810: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.6811: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.6812: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.6813: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.6814: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.6815: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.6816: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.6817: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.6818: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.6819: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.6820: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.6821: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.6822: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.6823: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.6824: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.6825: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog
Source.6826: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.6827: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.6828: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.6829: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.6830: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.6831: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26
Source.6832: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.6833: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.6834: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.6835: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.6836: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.6837: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.6838: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.6839: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.6840: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.6841: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.6842: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.6843: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6844: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.6845: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.6846: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.6847: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.6848: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.6849: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.6850: DFBPPR9621 ---- Animal proteins ---- PDZ domain-containing protein 11
Source.6851: DFBPPR9622 ---- Animal proteins ---- Calcitonin
Source.6852: DFBPPR9624 ---- Animal proteins ---- Cadherin-3
Source.6853: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.6854: DFBPPR9630 ---- Animal proteins ---- Calponin-1
Source.6855: DFBPPR9631 ---- Animal proteins ---- Lithostathine
Source.6856: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.6857: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.6858: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.6859: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561
Source.6860: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.6861: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.6862: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.6863: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1
Source.6864: DFBPPR9647 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.6865: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.6866: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.6867: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.6868: DFBPPR9656 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.6869: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.6870: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.6871: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.6872: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.6873: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.6874: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.6875: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.6876: DFBPPR9681 ---- Animal proteins ---- Complement C5a anaphylatoxin
Source.6877: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.6878: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2
Source.6879: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.6880: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.6881: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.6882: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.6883: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.6884: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.6885: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.6886: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.6887: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.6888: DFBPPR9710 ---- Animal proteins ---- Gastricsin
Source.6889: DFBPPR9711 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.6890: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.6891: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.6892: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.6893: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2
Source.6894: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.6895: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.6896: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.6897: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.6898: DFBPPR9749 ---- Animal proteins ---- Guanylin
Source.6899: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.6900: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6901: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.6902: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.6903: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.6904: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.6905: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A
Source.6906: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.6907: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.6908: DFBPPR9780 ---- Animal proteins ---- Small ubiquitin-related modifier 4
Source.6909: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.6910: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.6911: DFBPPR9800 ---- Animal proteins ---- Glycophorin-A
Source.6912: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.6913: DFBPPR9810 ---- Animal proteins ---- 40S ribosomal protein S16
Source.6914: DFBPPR9812 ---- Animal proteins ---- 60S ribosomal protein L29
Source.6915: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.6916: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.6917: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.6918: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.6919: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.6920: DFBPPR9826 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.6921: DFBPPR9829 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.6922: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.6923: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.6924: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.6925: DFBPPR9841 ---- Animal proteins ---- Interleukin-10
Source.6926: DFBPPR9843 ---- Animal proteins ---- P protein
Source.6927: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.6928: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.6929: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.6930: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.6931: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.6932: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A
Source.6933: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.6934: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.6935: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.6936: DFBPPR9896 ---- Animal proteins ---- Pepsin B
Source.6937: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.6938: DFBPPR9910 ---- Animal proteins ---- Serum amyloid A-2 protein
Source.6939: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.6940: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.6941: DFBPPR9929 ---- Animal proteins ---- Tuftelin
Source.6942: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.6943: DFBPPR9936 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.6944: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.6945: DFBPPR9940 ---- Animal proteins ---- Neuronatin
Source.6946: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1
Source.6947: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.6948: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.6949: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.6950: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.6951: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.6952: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.6953: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.6954: DFBPPR9960 ---- Animal proteins ---- Histone H3.2
Source.6955: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.6956: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.6957: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.6958: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1
Source.6959: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.6960: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.6961: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.6962: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.6963: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.6964: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.6965: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.6966: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.6967: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.6968: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.6969: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.6970: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.6971: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.6972: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.6973: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.6974: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.6975: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.6976: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.6977: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.6978: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.6979: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2
Source.6980: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.6981: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.6982: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.6983: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.6984: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.6985: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.6986: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.6987: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.6988: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.6989: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.6990: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.6991: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.6992: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.6993: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.6994: DFBPPR10053 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.6995: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.6996: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.6997: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.6998: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.6999: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.7000: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6
Source.7001: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.7002: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.7003: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.7004: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.7005: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7006: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.7007: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.7008: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.7009: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.7010: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.7011: DFBPPR10088 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.7012: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.7013: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.7014: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.7015: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4
Source.7016: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.7017: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.7018: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.7019: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.7020: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.7021: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.7022: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.7023: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.7024: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.7025: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.7026: DFBPPR10115 ---- Animal proteins ---- Annexin A1
Source.7027: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.7028: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.7029: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.7030: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.7031: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.7032: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.7033: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.7034: DFBPPR10130 ---- Animal proteins ---- Histone H3.3
Source.7035: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.7036: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.7037: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.7038: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.7039: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.7040: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.7041: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.7042: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.7043: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.7044: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.7045: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.7046: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.7047: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.7048: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.7049: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2
Source.7050: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.7051: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.7052: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.7053: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.7054: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.7055: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.7056: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.7057: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.7058: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.7059: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.7060: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.7061: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.7062: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.7063: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.7064: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.7065: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.7066: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.7067: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.7068: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.7069: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.7070: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.7071: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.7072: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.7073: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.7074: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.7075: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.7076: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.7077: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.7078: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.7079: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9
Source.7080: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.7081: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.7082: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.7083: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.7084: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.7085: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.7086: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.7087: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.7088: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.7089: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.7090: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.7091: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.7092: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.7093: DFBPPR10217 ---- Animal proteins ---- Follistatin
Source.7094: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.7095: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.7096: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.7097: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.7098: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.7099: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.7100: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.7101: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.7102: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.7103: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.7104: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.7105: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.7106: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.7107: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.7108: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.7109: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.7110: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.7111: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein
Source.7112: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.7113: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.7114: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.7115: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.7116: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.7117: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.7118: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.7119: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.7120: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.7121: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.7122: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.7123: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.7124: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.7125: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.7126: DFBPPR10276 ---- Animal proteins ---- Adapter molecule crk
Source.7127: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.7128: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.7129: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.7130: DFBPPR10280 ---- Animal proteins ---- Cytochrome c
Source.7131: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.7132: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.7133: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.7134: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.7135: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.7136: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.7137: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.7138: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.7139: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.7140: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.7141: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.7142: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.7143: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.7144: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.7145: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.7146: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.7147: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.7148: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.7149: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.7150: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.7151: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.7152: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.7153: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.7154: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.7155: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.7156: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.7157: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.7158: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.7159: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.7160: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.7161: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.7162: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.7163: DFBPPR10339 ---- Animal proteins ---- Osteocalcin
Source.7164: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.7165: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.7166: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.7167: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.7168: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.7169: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.7170: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.7171: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.7172: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.7173: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.7174: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.7175: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.7176: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.7177: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.7178: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.7179: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.7180: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.7181: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.7182: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.7183: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.7184: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.7185: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.7186: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.7187: DFBPPR10405 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.7188: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.7189: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.7190: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.7191: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.7192: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.7193: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.7194: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.7195: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.7196: DFBPPR10428 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.7197: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.7198: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.7199: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone
Source.7200: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.7201: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.7202: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.7203: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.7204: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.7205: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.7206: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.7207: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.7208: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.7209: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.7210: DFBPPR10453 ---- Animal proteins ---- Neurotrophin-3
Source.7211: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.7212: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.7213: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.7214: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.7215: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.7216: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.7217: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.7218: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.7219: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.7220: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.7221: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.7222: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.7223: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.7224: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.7225: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.7226: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.7227: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.7228: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.7229: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.7230: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.7231: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.7232: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.7233: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.7234: DFBPPR10509 ---- Animal proteins ---- Calponin-1
Source.7235: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.7236: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.7237: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.7238: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.7239: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.7240: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.7241: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.7242: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.7243: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.7244: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.7245: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.7246: DFBPPR10530 ---- Animal proteins ---- Osteopontin
Source.7247: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.7248: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.7249: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.7250: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.7251: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.7252: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.7253: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.7254: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.7255: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.7256: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.7257: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.7258: DFBPPR10563 ---- Animal proteins ---- Optineurin
Source.7259: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.7260: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.7261: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.7262: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.7263: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.7264: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.7265: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.7266: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.7267: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.7268: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.7269: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.7270: DFBPPR10583 ---- Animal proteins ---- Gallinacin-9
Source.7271: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.7272: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.7273: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.7274: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.7275: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.7276: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.7277: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.7278: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.7279: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.7280: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.7281: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.7282: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.7283: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.7284: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.7285: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.7286: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.7287: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.7288: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.7289: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.7290: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b
Source.7291: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.7292: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.7293: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.7294: DFBPPR10627 ---- Animal proteins ---- Apovitellenin-1
Source.7295: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.7296: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.7297: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.7298: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.7299: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.7300: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.7301: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.7302: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.7303: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.7304: DFBPPR10647 ---- Animal proteins ---- Gallinacin-4
Source.7305: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.7306: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.7307: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.7308: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.7309: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.7310: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.7311: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.7312: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.7313: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.7314: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.7315: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.7316: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.7317: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.7318: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.7319: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.7320: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.7321: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.7322: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.7323: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.7324: DFBPPR10680 ---- Animal proteins ---- Hemoglobin subunit pi
Source.7325: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.7326: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.7327: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.7328: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.7329: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.7330: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.7331: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.7332: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.7333: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.7334: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.7335: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.7336: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.7337: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.7338: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.7339: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.7340: DFBPPR10710 ---- Animal proteins ---- Linker for activation of T-cells family member 2
Source.7341: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.7342: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7343: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.7344: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.7345: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.7346: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.7347: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.7348: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.7349: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.7350: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor
Source.7351: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.7352: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.7353: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.7354: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.7355: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.7356: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.7357: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.7358: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.7359: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.7360: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.7361: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.7362: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.7363: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.7364: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.7365: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.7366: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.7367: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.7368: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.7369: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.7370: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.7371: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.7372: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7373: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.7374: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.7375: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein
Source.7376: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1
Source.7377: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.7378: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b
Source.7379: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C
Source.7380: DFBPPR10787 ---- Animal proteins ---- Angiogenin
Source.7381: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.7382: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.7383: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.7384: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.7385: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.7386: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.7387: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.7388: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.7389: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.7390: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.7391: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.7392: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.7393: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.7394: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.7395: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.7396: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.7397: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.7398: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.7399: DFBPPR10831 ---- Animal proteins ---- Early growth response protein 1
Source.7400: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.7401: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.7402: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.7403: DFBPPR10838 ---- Animal proteins ---- Protein lin-28 homolog A
Source.7404: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.7405: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.7406: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.7407: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.7408: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.7409: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.7410: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.7411: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.7412: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.7413: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.7414: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.7415: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.7416: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.7417: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.7418: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.7419: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.7420: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.7421: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.7422: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.7423: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.7424: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.7425: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.7426: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.7427: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.7428: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.7429: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.7430: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.7431: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.7432: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.7433: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.7434: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.7435: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.7436: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.7437: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.7438: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2
Source.7439: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.7440: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.7441: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.7442: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.7443: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.7444: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.7445: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.7446: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.7447: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.7448: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B
Source.7449: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.7450: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.7451: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.7452: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.7453: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.7454: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.7455: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.7456: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.7457: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.7458: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.7459: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.7460: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.7461: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.7462: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.7463: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.7464: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.7465: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.7466: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.7467: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2
Source.7468: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.7469: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.7470: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.7471: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.7472: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.7473: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.7474: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.7475: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.7476: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.7477: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.7478: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.7479: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.7480: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.7481: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.7482: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.7483: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.7484: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.7485: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.7486: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.7487: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.7488: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.7489: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.7490: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.7491: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.7492: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.7493: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.7494: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.7495: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.7496: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.7497: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.7498: DFBPPR11011 ---- Animal proteins ---- Epigen
Source.7499: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.7500: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.7501: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.7502: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.7503: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.7504: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.7505: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.7506: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog
Source.7507: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.7508: DFBPPR11034 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.7509: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.7510: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.7511: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.7512: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.7513: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.7514: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.7515: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.7516: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.7517: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.7518: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.7519: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.7520: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.7521: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.7522: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.7523: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.7524: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.7525: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.7526: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.7527: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.7528: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.7529: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.7530: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.7531: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.7532: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.7533: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.7534: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.7535: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.7536: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.7537: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.7538: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.7539: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.7540: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.7541: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.7542: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.7543: DFBPPR11091 ---- Animal proteins ---- Pro-neuropeptide Y
Source.7544: DFBPPR11092 ---- Animal proteins ---- Ataxin-3
Source.7545: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.7546: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.7547: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.7548: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.7549: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.7550: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.7551: DFBPPR11113 ---- Animal proteins ---- POU domain, class 4, transcription factor 1
Source.7552: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.7553: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7554: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.7555: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.7556: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.7557: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.7558: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.7559: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.7560: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.7561: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.7562: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.7563: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.7564: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.7565: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.7566: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3
Source.7567: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.7568: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.7569: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.7570: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.7571: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.7572: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.7573: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.7574: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.7575: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.7576: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.7577: DFBPPR11169 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.7578: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.7579: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.7580: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3
Source.7581: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.7582: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.7583: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.7584: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.7585: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.7586: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.7587: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.7588: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.7589: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.7590: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.7591: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.7592: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.7593: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.7594: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.7595: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.7596: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.7597: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF
Source.7598: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.7599: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.7600: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.7601: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.7602: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.7603: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.7604: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.7605: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.7606: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.7607: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.7608: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.7609: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.7610: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.7611: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.7612: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.7613: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.7614: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.7615: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.7616: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.7617: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.7618: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.7619: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.7620: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.7621: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.7622: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.7623: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.7624: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.7625: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B
Source.7626: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.7627: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.7628: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.7629: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.7630: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.7631: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES
Source.7632: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.7633: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.7634: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.7635: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein
Source.7636: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.7637: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.7638: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.7639: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.7640: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.7641: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.7642: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.7643: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.7644: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta
Source.7645: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.7646: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.7647: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.7648: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.7649: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.7650: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.7651: DFBPPR11322 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.7652: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.7653: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.7654: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.7655: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.7656: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.7657: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.7658: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.7659: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.7660: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.7661: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.7662: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.7663: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.7664: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.7665: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.7666: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13
Source.7667: DFBPPR11351 ---- Animal proteins ---- Small ubiquitin-related modifier 3
Source.7668: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.7669: DFBPPR11354 ---- Animal proteins ---- Centromere protein O
Source.7670: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR
Source.7671: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.7672: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.7673: DFBPPR11359 ---- Animal proteins ---- Mesogenin-1
Source.7674: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.7675: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.7676: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.7677: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.7678: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.7679: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.7680: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.7681: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.7682: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.7683: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.7684: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.7685: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.7686: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.7687: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.7688: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.7689: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.7690: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.7691: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.7692: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.7693: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.7694: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.7695: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.7696: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.7697: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3
Source.7698: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.7699: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.7700: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.7701: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.7702: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.7703: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.7704: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.7705: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.7706: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.7707: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.7708: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.7709: DFBPPR11426 ---- Animal proteins ---- Glutathione S-transferase 5
Source.7710: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.7711: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.7712: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.7713: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.7714: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.7715: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.7716: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.7717: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.7718: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.7719: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.7720: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.7721: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.7722: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.7723: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.7724: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.7725: DFBPPR11475 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-B
Source.7726: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.7727: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.7728: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.7729: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.7730: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.7731: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.7732: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.7733: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.7734: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.7735: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.7736: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.7737: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.7738: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.7739: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.7740: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.7741: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.7742: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.7743: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.7744: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.7745: DFBPPR11525 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.7746: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform
Source.7747: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.7748: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.7749: DFBPPR11533 ---- Animal proteins ---- Mimecan
Source.7750: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.7751: DFBPPR11543 ---- Animal proteins ---- Small ubiquitin-related modifier 2
Source.7752: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.7753: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.7754: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.7755: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.7756: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.7757: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.7758: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.7759: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.7760: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.7761: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.7762: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.7763: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.7764: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.7765: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.7766: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.7767: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.7768: DFBPPR11580 ---- Animal proteins ---- Cilia- and flagella-associated protein 20
Source.7769: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.7770: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.7771: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.7772: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.7773: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.7774: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.7775: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.7776: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.7777: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.7778: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230
Source.7779: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.7780: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.7781: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.7782: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.7783: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.7784: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.7785: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein
Source.7786: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.7787: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.7788: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.7789: DFBPPR11618 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.7790: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.7791: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.7792: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.7793: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.7794: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.7795: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.7796: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.7797: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.7798: DFBPPR11630 ---- Animal proteins ---- Protein kish-A
Source.7799: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.7800: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.7801: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.7802: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.7803: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.7804: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.7805: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.7806: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.7807: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.7808: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.7809: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.7810: DFBPPR11652 ---- Animal proteins ---- Stathmin-3
Source.7811: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.7812: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.7813: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.7814: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.7815: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1
Source.7816: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.7817: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.7818: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.7819: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.7820: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.7821: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.7822: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.7823: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.7824: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.7825: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta
Source.7826: DFBPPR11685 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.7827: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4
Source.7828: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.7829: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.7830: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.7831: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.7832: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.7833: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.7834: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.7835: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.7836: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.7837: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.7838: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.7839: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.7840: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.7841: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.7842: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.7843: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.7844: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.7845: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.7846: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.7847: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.7848: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.7849: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.7850: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.7851: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.7852: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.7853: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.7854: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.7855: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.7856: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.7857: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.7858: DFBPPR11765 ---- Animal proteins ---- Peptide YY-like
Source.7859: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.7860: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.7861: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.7862: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.7863: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.7864: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.7865: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.7866: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.7867: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.7868: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.7869: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.7870: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.7871: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.7872: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.7873: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.7874: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.7875: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.7876: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.7877: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.7878: DFBPPR11799 ---- Animal proteins ---- Homeobox protein Hox-B5
Source.7879: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.7880: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.7881: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.7882: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.7883: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.7884: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.7885: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.7886: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.7887: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.7888: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.7889: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.7890: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.7891: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog
Source.7892: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.7893: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.7894: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.7895: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.7896: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.7897: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.7898: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.7899: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.7900: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7
Source.7901: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.7902: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.7903: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.7904: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.7905: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.7906: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.7907: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.7908: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.7909: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.7910: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.7911: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.7912: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.7913: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.7914: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.7915: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.7916: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.7917: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.7918: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.7919: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.7920: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.7921: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.7922: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.7923: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.7924: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.7925: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.7926: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.7927: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.7928: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.7929: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.7930: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.7931: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.7932: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.7933: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.7934: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.7935: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.7936: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.7937: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.7938: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.7939: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein
Source.7940: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.7941: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.7942: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.7943: DFBPPR11936 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.7944: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.7945: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.7946: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.7947: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog
Source.7948: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.7949: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.7950: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.7951: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.7952: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.7953: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.7954: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.7955: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.7956: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.7957: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.7958: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.7959: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.7960: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.7961: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.7962: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.7963: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.7964: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.7965: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.7966: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.7967: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.7968: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.7969: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.7970: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.7971: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.7972: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.7973: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.7974: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.7975: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.7976: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.7977: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.7978: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.7979: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.7980: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.7981: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.7982: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.7983: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.7984: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.7985: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.7986: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.7987: DFBPPR12063 ---- Animal proteins ---- Centromere protein M
Source.7988: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.7989: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.7990: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.7991: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.7992: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.7993: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.7994: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma
Source.7995: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.7996: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.7997: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.7998: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.7999: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.8000: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.8001: DFBPPR12089 ---- Animal proteins ---- Cysteine-rich PDZ-binding protein
Source.8002: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.8003: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.8004: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.8005: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.8006: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.8007: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.8008: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.8009: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.8010: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.8011: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.8012: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.8013: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.8014: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.8015: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.8016: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.8017: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.8018: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.8019: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.8020: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.8021: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.8022: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.8023: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.8024: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.8025: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.8026: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.8027: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.8028: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.8029: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.8030: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.8031: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.8032: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.8033: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.8034: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.8035: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.8036: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.8037: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.8038: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.8039: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme
Source.8040: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.8041: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.8042: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1
Source.8043: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.8044: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.8045: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.8046: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog
Source.8047: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.8048: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.8049: DFBPPR12210 ---- Animal proteins ---- Protein NATD1
Source.8050: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.8051: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.8052: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.8053: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.8054: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.8055: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.8056: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.8057: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.8058: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.8059: DFBPPR12236 ---- Animal proteins ---- Protein FAM133
Source.8060: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.8061: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.8062: DFBPPR12240 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.8063: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.8064: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.8065: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog
Source.8066: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.8067: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.8068: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.8069: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.8070: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.8071: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.8072: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.8073: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.8074: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.8075: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.8076: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.8077: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.8078: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.8079: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.8080: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.8081: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.8082: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.8083: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.8084: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.8085: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.8086: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.8087: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.8088: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.8089: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.8090: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.8091: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.8092: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.8093: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8094: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.8095: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.8096: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.8097: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.8098: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.8099: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.8100: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8101: DFBPPR12308 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.8102: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.8103: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8104: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.8105: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.8106: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.8107: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.8108: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.8109: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.8110: DFBPPR12322 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1A
Source.8111: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.8112: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.8113: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.8114: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.8115: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.8116: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.8117: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.8118: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.8119: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.8120: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.8121: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.8122: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.8123: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.8124: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.8125: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.8126: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.8127: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.8128: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.8129: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.8130: DFBPPR12361 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.8131: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.8132: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.8133: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.8134: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.8135: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.8136: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.8137: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.8138: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.8139: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.8140: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8141: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.8142: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.8143: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.8144: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.8145: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.8146: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.8147: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.8148: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.8149: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.8150: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.8151: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.8152: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.8153: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.8154: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.8155: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.8156: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.8157: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8158: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.8159: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.8160: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.8161: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.8162: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.8163: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.8164: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.8165: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.8166: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8167: DFBPPR12424 ---- Animal proteins ---- Protein phosphatase inhibitor 2
Source.8168: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.8169: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.8170: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.8171: DFBPPR12435 ---- Animal proteins ---- Cytochrome c
Source.8172: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.8173: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.8174: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.8175: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.8176: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8177: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.8178: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.8179: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.8180: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.8181: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.8182: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.8183: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.8184: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.8185: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8186: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.8187: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.8188: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.8189: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.8190: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.8191: DFBPPR12471 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.8192: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.8193: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.8194: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.8195: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.8196: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.8197: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8198: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.8199: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.8200: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.8201: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.8202: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.8203: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.8204: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.8205: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.8206: DFBPPR12496 ---- Animal proteins ---- Protachykinin-1
Source.8207: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.8208: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.8209: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.8210: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.8211: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.8212: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.8213: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.8214: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.8215: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.8216: DFBPPR12510 ---- Animal proteins ---- Phospholemman
Source.8217: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.8218: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase
Source.8219: DFBPPR12518 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.8220: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.8221: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8222: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.8223: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.8224: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.8225: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.8226: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.8227: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.8228: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.8229: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.8230: DFBPPR12543 ---- Animal proteins ---- Serine/threonine-protein phosphatase 5
Source.8231: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.8232: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.8233: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.8234: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.8235: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.8236: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8237: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.8238: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.8239: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.8240: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.8241: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.8242: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.8243: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.8244: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.8245: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.8246: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.8247: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.8248: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.8249: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.8250: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.8251: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.8252: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.8253: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.8254: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.8255: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.8256: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.8257: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.8258: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.8259: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.8260: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.8261: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.8262: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.8263: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.8264: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.8265: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.8266: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.8267: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.8268: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.8269: DFBPPR12621 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8270: DFBPPR12622 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8271: DFBPPR12623 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.8272: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.8273: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.8274: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.8275: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.8276: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.8277: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.8278: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.8279: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.8280: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8281: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.8282: DFBPPR12662 ---- Animal proteins ---- Interferon gamma
Source.8283: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.8284: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.8285: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.8286: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8287: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.8288: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.8289: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8290: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.8291: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.8292: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.8293: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.8294: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.8295: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.8296: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.8297: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.8298: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.8299: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.8300: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.8301: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8302: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.8303: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.8304: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.8305: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.8306: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.8307: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25
Source.8308: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.8309: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.8310: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.8311: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.8312: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.8313: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.8314: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.8315: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.8316: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.8317: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.8318: DFBPPR12761 ---- Animal proteins ---- Trichohyalin
Source.8319: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.8320: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.8321: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.8322: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.8323: DFBPPR12770 ---- Animal proteins ---- Filamin-B
Source.8324: DFBPPR12772 ---- Animal proteins ---- Colipase
Source.8325: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.8326: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8327: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.8328: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.8329: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.8330: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.8331: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.8332: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.8333: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.8334: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.8335: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.8336: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.8337: DFBPPR12797 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 1
Source.8338: DFBPPR12799 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein
Source.8339: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.8340: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.8341: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.8342: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.8343: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.8344: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.8345: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.8346: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.8347: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.8348: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.8349: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.8350: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.8351: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.8352: DFBPPR12827 ---- Animal proteins ---- Matrix Gla protein
Source.8353: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.8354: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.8355: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.8356: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.8357: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8358: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.8359: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.8360: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.8361: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.8362: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.8363: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.8364: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.8365: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.8366: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.8367: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.8368: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.8369: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.8370: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta
Source.8371: DFBPPR12865 ---- Animal proteins ---- Sperm surface protein Sp17
Source.8372: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.8373: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.8374: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.8375: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.8376: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.8377: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8378: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.8379: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.8380: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.8381: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.8382: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.8383: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.8384: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.8385: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.8386: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.8387: DFBPPR12929 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.8388: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.8389: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.8390: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.8391: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.8392: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.8393: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.8394: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.8395: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8396: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.8397: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein
Source.8398: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.8399: DFBPPR12954 ---- Animal proteins ---- Apolipoprotein B
Source.8400: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.8401: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.8402: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.8403: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.8404: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.8405: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.8406: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.8407: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.8408: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.8409: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.8410: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.8411: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.8412: DFBPPR12974 ---- Animal proteins ---- Serum amyloid A-3 protein
Source.8413: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.8414: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.8415: DFBPPR12984 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.8416: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.8417: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.8418: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.8419: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.8420: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A
Source.8421: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.8422: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.8423: DFBPPR12992 ---- Animal proteins ---- Mimecan
Source.8424: DFBPPR12993 ---- Animal proteins ---- Tumor protein D52
Source.8425: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.8426: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8427: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.8428: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.8429: DFBPPR13014 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.8430: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.8431: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.8432: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.8433: DFBPPR13025 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.8434: DFBPPR13028 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.8435: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.8436: DFBPPR13034 ---- Animal proteins ---- Sarcospan
Source.8437: DFBPPR13035 ---- Animal proteins ---- Chymase
Source.8438: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.8439: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.8440: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein
Source.8441: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.8442: DFBPPR13055 ---- Animal proteins ---- Serum amyloid A-2 protein
Source.8443: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.8444: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.8445: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.8446: DFBPPR13068 ---- Animal proteins ---- Biglycan
Source.8447: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.8448: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.8449: DFBPPR13075 ---- Animal proteins ---- 60S ribosomal protein L5
Source.8450: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.8451: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.8452: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.8453: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta
Source.8454: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.8455: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.8456: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2
Source.8457: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.8458: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8459: DFBPPR13125 ---- Animal proteins ---- Ig kappa chain V region 3547
Source.8460: DFBPPR13141 ---- Animal proteins ---- Cytochrome c
Source.8461: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8462: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.8463: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.8464: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.8465: DFBPPR13155 ---- Animal proteins ---- C-C motif chemokine 5
Source.8466: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.8467: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.8468: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8469: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.8470: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.8471: DFBPPR13169 ---- Animal proteins ---- High mobility group protein B1
Source.8472: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8473: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.8474: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.8475: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.8476: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8477: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8478: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.8479: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.8480: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.8481: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.8482: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.8483: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8484: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.8485: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.8486: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.8487: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.8488: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.8489: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.8490: DFBPPR13203 ---- Animal proteins ---- Follistatin
Source.8491: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.8492: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8493: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.8494: DFBPPR13211 ---- Animal proteins ---- Colipase B
Source.8495: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.8496: DFBPPR13216 ---- Animal proteins ---- Colipase A
Source.8497: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.8498: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.8499: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.8500: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.8501: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8502: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.8503: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.8504: DFBPPR13232 ---- Animal proteins ---- Osteocalcin
Source.8505: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.8506: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2
Source.8507: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8508: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.8509: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.8510: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.8511: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.8512: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.8513: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.8514: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.8515: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.8516: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.8517: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8518: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.8519: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.8520: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.8521: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8522: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.8523: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.8524: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8525: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.8526: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.8527: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.8528: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.8529: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.8530: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.8531: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha
Source.8532: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8533: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.8534: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.8535: DFBPPR13308 ---- Animal proteins ---- Interleukin-10
Source.8536: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8537: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.8538: DFBPPR13311 ---- Animal proteins ---- Agouti-signaling protein
Source.8539: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.8540: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.8541: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.8542: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8543: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.8544: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8545: DFBPPR13325 ---- Animal proteins ---- Serum amyloid A protein
Source.8546: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.8547: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.8548: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.8549: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.8550: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.8551: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.8552: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.8553: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.8554: DFBPPR13348 ---- Animal proteins ---- Calcitonin
Source.8555: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3
Source.8556: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8557: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.8558: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.8559: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A
Source.8560: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8561: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.8562: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2
Source.8563: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.8564: DFBPPR13376 ---- Animal proteins ---- Interleukin-5
Source.8565: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.8566: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.8567: DFBPPR13387 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.8568: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8569: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.8570: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.8571: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22
Source.8572: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.8573: DFBPPR13408 ---- Animal proteins ---- Fin bud initiation factor homolog
Source.8574: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8575: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.8576: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.8577: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.8578: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8579: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.8580: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.8581: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.8582: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.8583: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.8584: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.8585: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.8586: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8587: DFBPPR13445 ---- Animal proteins ---- Interleukin-1 alpha
Source.8588: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.8589: DFBPPR13448 ---- Animal proteins ---- Osteocalcin
Source.8590: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8591: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P
Source.8592: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.8593: DFBPPR13462 ---- Animal proteins ---- Fatty acid synthase
Source.8594: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8595: DFBPPR13468 ---- Animal proteins ---- Hemoglobin subunit alpha-1
Source.8596: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.8597: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8598: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.8599: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8600: DFBPPR13476 ---- Animal proteins ---- Hemoglobin subunit alpha-2
Source.8601: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta
Source.8602: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.8603: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.8604: DFBPPR13485 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.8605: DFBPPR13491 ---- Animal proteins ---- Gastrin
Source.8606: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a
Source.8607: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.8608: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8609: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.8610: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.8611: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.8612: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.8613: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.8614: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8615: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.8616: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E
Source.8617: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.8618: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.8619: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.8620: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8621: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.8622: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.8623: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.8624: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8625: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.8626: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.8627: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.8628: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.8629: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.8630: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.8631: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.8632: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.8633: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8634: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8635: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.8636: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8637: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.8638: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.8639: DFBPPR13606 ---- Animal proteins ---- Estrogen receptor
Source.8640: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.8641: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8642: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.8643: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.8644: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.8645: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.8646: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.8647: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.8648: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8649: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.8650: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.8651: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.8652: DFBPPR13631 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8653: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.8654: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.8655: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.8656: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.8657: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.8658: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.8659: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8660: DFBPPR13661 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2
Source.8661: DFBPPR13663 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.8662: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.8663: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.8664: DFBPPR13671 ---- Animal proteins ---- Interleukin-7
Source.8665: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.8666: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.8667: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8668: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.8669: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.8670: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.8671: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.8672: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma
Source.8673: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.8674: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.8675: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8676: DFBPPR13692 ---- Animal proteins ---- Pro-neuropeptide Y
Source.8677: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.8678: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.8679: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.8680: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.8681: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.8682: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.8683: DFBPPR13708 ---- Animal proteins ---- Renin
Source.8684: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta
Source.8685: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.8686: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.8687: DFBPPR13723 ---- Animal proteins ---- Cytochrome c
Source.8688: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.8689: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.8690: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8691: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.8692: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.8693: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.8694: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.8695: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.8696: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.8697: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.8698: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8699: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.8700: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.8701: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.8702: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.8703: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.8704: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.8705: DFBPPR13773 ---- Animal proteins ---- Interleukin-1 alpha
Source.8706: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.8707: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.8708: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.8709: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.8710: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15
Source.8711: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.8712: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.8713: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.8714: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.8715: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.8716: DFBPPR13805 ---- Animal proteins ---- Serum amyloid A protein
Source.8717: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8718: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma
Source.8719: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.8720: DFBPPR13821 ---- Animal proteins ---- Calcitonin
Source.8721: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.8722: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin
Source.8723: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.8724: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.8725: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.8726: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.8727: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.8728: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.8729: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.8730: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.8731: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8732: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.8733: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.8734: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.8735: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.8736: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.8737: DFBPPR13864 ---- Animal proteins ---- Interleukin-5
Source.8738: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9
Source.8739: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.8740: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.8741: DFBPPR13876 ---- Animal proteins ---- Follistatin
Source.8742: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8743: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.8744: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.8745: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8746: DFBPPR13893 ---- Animal proteins ---- Calponin-1
Source.8747: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.8748: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.8749: DFBPPR13901 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.8750: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.8751: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.8752: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.8753: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.8754: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease
Source.8755: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.8756: DFBPPR13928 ---- Animal proteins ---- Keratin, type II microfibrillar
Source.8757: DFBPPR13929 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.8758: DFBPPR13931 ---- Animal proteins ---- Homeobox protein Hox-B5
Source.8759: DFBPPR13935 ---- Animal proteins ---- Major centromere autoantigen B
Source.8760: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.8761: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.8762: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.8763: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26
Source.8764: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2
Source.8765: DFBPPR13958 ---- Animal proteins ---- Homeobox protein Hox-D3
Source.8766: DFBPPR13960 ---- Animal proteins ---- Homeobox protein Hox-D4
Source.8767: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8768: DFBPPR13980 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.8769: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.8770: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.8771: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2
Source.8772: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8773: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.8774: DFBPPR13991 ---- Animal proteins ---- Osteocalcin
Source.8775: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.8776: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.8777: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog
Source.8778: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.8779: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.8780: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.8781: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1
Source.8782: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.8783: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.8784: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8785: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.8786: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2
Source.8787: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8788: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.8789: DFBPPR14020 ---- Animal proteins ---- Parvalbumin alpha
Source.8790: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.8791: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.8792: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.8793: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.8794: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.8795: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8796: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.8797: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.8798: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.8799: DFBPPR14050 ---- Animal proteins ---- Somatoliberin
Source.8800: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.8801: DFBPPR14065 ---- Animal proteins ---- Lysozyme g
Source.8802: DFBPPR14070 ---- Animal proteins ---- 60S ribosomal protein L15
Source.8803: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.8804: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.8805: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.8806: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.8807: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.8808: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.8809: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.8810: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta
Source.8811: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha
Source.8812: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.8813: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.8814: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.8815: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.8816: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.8817: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.8818: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.8819: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.8820: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.8821: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9
Source.8822: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.8823: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.8824: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial
Source.8825: DFBPPR14116 ---- Marine protein ---- Ferritin, heavy subunit
Source.8826: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.8827: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.8828: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.8829: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.8830: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.8831: DFBPPR14134 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B
Source.8832: DFBPPR14135 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2A
Source.8833: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.8834: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.8835: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H
Source.8836: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.8837: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.8838: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.8839: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.8840: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.8841: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.8842: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog
Source.8843: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.8844: DFBPPR14172 ---- Marine protein ---- Homeobox protein Hox-B2
Source.8845: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.8846: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.8847: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.8848: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1
Source.8849: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.8850: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.8851: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.8852: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.8853: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.8854: DFBPPR14211 ---- Marine protein ---- WASH complex subunit 3
Source.8855: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.8856: DFBPPR14228 ---- Marine protein ---- UPF0691 protein C9orf116 homolog
Source.8857: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.8858: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.8859: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.8860: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.8861: DFBPPR14243 ---- Marine protein ---- Glycoprotein hormones alpha chain 2
Source.8862: DFBPPR14246 ---- Marine protein ---- Glycoprotein hormones alpha chain 1
Source.8863: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3
Source.8864: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1
Source.8865: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2
Source.8866: DFBPPR14268 ---- Marine protein ---- Cytochrome c oxidase subunit 6C-1
Source.8867: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.8868: DFBPPR14271 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.8869: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain
Source.8870: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.8871: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain
Source.8872: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.8873: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.8874: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase
Source.8875: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.8876: DFBPPR14295 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain
Source.8877: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.8878: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.8879: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.8880: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.8881: DFBPPR14310 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.8882: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.8883: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.8884: DFBPPR14315 ---- Marine protein ---- Protein CfxQ homolog
Source.8885: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.8886: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain
Source.8887: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.8888: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.8889: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.8890: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.8891: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.8892: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.8893: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.8894: DFBPPR14337 ---- Marine protein ---- Photosystem I iron-sulfur center
Source.8895: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.8896: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.8897: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.8898: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.8899: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.8900: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.8901: DFBPPR14346 ---- Marine protein ---- R-phycoerythrin alpha chain
Source.8902: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.8903: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.8904: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.8905: DFBPPR14357 ---- Marine protein ---- Ferredoxin
Source.8906: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.8907: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit
Source.8908: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.8909: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42
Source.8910: DFBPPR14364 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain
Source.8911: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.8912: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.8913: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.8914: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.8915: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha
Source.8916: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha
Source.8917: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.8918: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase
Source.8919: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha
Source.8920: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.8921: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.8922: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain
Source.8923: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.8924: DFBPPR14391 ---- Marine protein ---- Cytochrome b6-f complex subunit 5
Source.8925: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.8926: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.8927: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.8928: DFBPPR14400 ---- Marine protein ---- Heme oxygenase
Source.8929: DFBPPR14403 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.8930: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.8931: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K
Source.8932: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.8933: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.8934: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.8935: DFBPPR14423 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.8936: DFBPPR14430 ---- Marine protein ---- 30S ribosomal protein S12, chloroplastic
Source.8937: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.8938: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.8939: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.8940: DFBPPR14455 ---- Marine protein ---- 30S ribosomal protein S10, chloroplastic
Source.8941: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.8942: DFBPPR14472 ---- Marine protein ---- Photosystem I reaction center subunit XI
Source.8943: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.8944: DFBPPR14475 ---- Marine protein ---- Photosystem I reaction center subunit VIII
Source.8945: DFBPPR14476 ---- Marine protein ---- Protein CfxQ homolog
Source.8946: DFBPPR14477 ---- Marine protein ---- 30S ribosomal protein S1, chloroplastic
Source.8947: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.8948: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28
Source.8949: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.8950: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.8951: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.8952: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.8953: DFBPPR14522 ---- Marine protein ---- Uncharacterized protein ycf20
Source.8954: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35
Source.8955: DFBPPR14529 ---- Marine protein ---- Uncharacterized protein ycf22
Source.8956: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.8957: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.8958: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.8959: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.8960: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.8961: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.8962: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8963: DFBPPR14560 ---- Marine protein ---- Histone H3.2
Source.8964: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.8965: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.8966: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.8967: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.8968: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.8969: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.8970: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.8971: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1
Source.8972: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.8973: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.8974: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.8975: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4
Source.8976: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.8977: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.8978: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.8979: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.8980: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein
Source.8981: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.8982: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9
Source.8983: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.8984: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a
Source.8985: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.8986: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.8987: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1
Source.8988: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.8989: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.8990: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.8991: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.8992: DFBPPR14643 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B
Source.8993: DFBPPR14644 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2A
Source.8994: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B
Source.8995: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.8996: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.8997: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.8998: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein
Source.8999: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.9000: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.9001: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.9002: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.9003: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.9004: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.9005: DFBPPR14686 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.9006: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.9007: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.9008: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.9009: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1
Source.9010: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.9011: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog
Source.9012: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.9013: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2
Source.9014: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1
Source.9015: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2
Source.9016: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.9017: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B
Source.9018: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.9019: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.9020: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.9021: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.9022: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.9023: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.9024: DFBPPR14759 ---- Marine protein ---- Tachystatin-A2
Source.9025: DFBPPR14760 ---- Marine protein ---- Big defensin
Source.9026: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.9027: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.9028: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.9029: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.9030: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.9031: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.9032: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.9033: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.9034: DFBPPR14791 ---- Marine protein ---- Guanine nucleotide-binding protein G(i) subunit alpha
Source.9035: DFBPPR14793 ---- Marine protein ---- Panulirin
Source.9036: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.9037: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.9038: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.9039: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.9040: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.9041: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.9042: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.9043: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.9044: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.9045: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.9046: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial
Source.9047: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.9048: DFBPPR14818 ---- Marine protein ---- Tropomyosin
Source.9049: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.9050: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1
Source.9051: DFBPPR14828 ---- Marine protein ---- Tropomyosin
Source.9052: DFBPPR14838 ---- Marine protein ---- Hemocyanin subunit 4
Source.9053: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.9054: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.9055: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.9056: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha
Source.9057: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.9058: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.9059: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.9060: DFBPPR14864 ---- Marine protein ---- Hemoglobin anodic subunit beta
Source.9061: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.9062: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.9063: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.9064: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.9065: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.9066: DFBPPR14881 ---- Microorganism protein ---- Decapping and exoribonuclease protein 1
Source.9067: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.9068: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.9069: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.9070: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.9071: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.9072: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.9073: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.9074: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.9075: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.9076: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.9077: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.9078: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.9079: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.9080: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.9081: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.9082: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.9083: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.9084: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.9085: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.9086: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.9087: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.9088: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.9089: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.9090: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.9091: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.9092: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.9093: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.9094: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.9095: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.9096: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1
Source.9097: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.9098: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.9099: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.9100: DFBPPR14936 ---- Microorganism protein ---- Inner kinetochore subunit MCM21
Source.9101: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase
Source.9102: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.9103: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.9104: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.9105: DFBPPR14944 ---- Microorganism protein ---- Histone H3
Source.9106: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.9107: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.9108: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.9109: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.9110: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.9111: DFBPPR14952 ---- Microorganism protein ---- Histone H2B.1
Source.9112: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.9113: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.9114: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.9115: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.9116: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.9117: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.9118: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.9119: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.9120: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.9121: DFBPPR14967 ---- Microorganism protein ---- Histone H2B.2
Source.9122: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.9123: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.9124: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.9125: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.9126: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.9127: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.9128: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.9129: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.9130: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.9131: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1
Source.9132: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.9133: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.9134: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.9135: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.9136: DFBPPR14999 ---- Microorganism protein ---- Histone H3-like centromeric protein CSE4
Source.9137: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.9138: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.9139: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.9140: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.9141: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.9142: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.9143: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.9144: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.9145: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.9146: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.9147: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.9148: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.9149: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.9150: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.9151: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.9152: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.9153: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.9154: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.9155: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.9156: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.9157: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.9158: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.9159: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.9160: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.9161: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.9162: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.9163: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial
Source.9164: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.9165: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.9166: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.9167: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.9168: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.9169: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.9170: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.9171: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.9172: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.9173: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.9174: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.9175: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.9176: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.9177: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.9178: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.9179: DFBPPR15072 ---- Microorganism protein ---- ER lumen protein-retaining receptor
Source.9180: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12
Source.9181: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.9182: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.9183: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.9184: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase
Source.9185: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.9186: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.9187: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.9188: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial
Source.9189: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.9190: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.9191: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.9192: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.9193: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6
Source.9194: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.9195: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.9196: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.9197: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.9198: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.9199: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.9200: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.9201: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.9202: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.9203: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.9204: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.9205: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G
Source.9206: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.9207: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.9208: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase
Source.9209: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.9210: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.9211: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.9212: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.9213: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.9214: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.9215: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.9216: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.9217: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.9218: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic
Source.9219: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.9220: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.9221: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.9222: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.9223: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.9224: DFBPPR15159 ---- Microorganism protein ---- Centromere-binding protein 1
Source.9225: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.9226: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.9227: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.9228: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2
Source.9229: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.9230: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.9231: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.9232: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.9233: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.9234: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.9235: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.9236: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.9237: DFBPPR15185 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 8
Source.9238: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.9239: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.9240: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.9241: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I
Source.9242: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.9243: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.9244: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.9245: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.9246: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.9247: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1
Source.9248: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.9249: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.9250: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.9251: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.9252: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.9253: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.9254: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.9255: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.9256: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.9257: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.9258: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.9259: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4
Source.9260: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.9261: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.9262: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.9263: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.9264: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.9265: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.9266: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.9267: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.9268: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.9269: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.9270: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.9271: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.9272: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.9273: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.9274: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.9275: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1
Source.9276: DFBPPR15265 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.9277: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.9278: DFBPPR15267 ---- Microorganism protein ---- Cofilin
Source.9279: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.9280: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.9281: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.9282: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.9283: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.9284: DFBPPR15281 ---- Microorganism protein ---- Cytochrome c oxidase subunit 9, mitochondrial
Source.9285: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.9286: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.9287: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.9288: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D
Source.9289: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.9290: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.9291: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.9292: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.9293: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.9294: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.9295: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1
Source.9296: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.9297: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.9298: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.9299: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.9300: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.9301: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.9302: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.9303: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.9304: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.9305: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.9306: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.9307: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.9308: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.9309: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.9310: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.9311: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.9312: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.9313: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.9314: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.9315: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.9316: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.9317: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.9318: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.9319: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.9320: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.9321: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.9322: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.9323: DFBPPR15365 ---- Microorganism protein ---- Inositol-pentakisphosphate 2-kinase
Source.9324: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.9325: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.9326: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.9327: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.9328: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.9329: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.9330: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.9331: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial
Source.9332: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.9333: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.9334: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.9335: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.9336: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.9337: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.9338: DFBPPR15403 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM13
Source.9339: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.9340: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3
Source.9341: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.9342: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.9343: DFBPPR15424 ---- Microorganism protein ---- Diphthamide biosynthesis protein 4
Source.9344: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.9345: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.9346: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.9347: DFBPPR15442 ---- Microorganism protein ---- Type 1 phosphatases regulator YPI1
Source.9348: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.9349: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.9350: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.9351: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.9352: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.9353: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.9354: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.9355: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121
Source.9356: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.9357: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.9358: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.9359: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.9360: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.9361: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.9362: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.9363: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.9364: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.9365: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.9366: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.9367: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.9368: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.9369: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.9370: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.9371: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.9372: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.9373: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.9374: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.9375: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.9376: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.9377: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.9378: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23
Source.9379: DFBPPR15530 ---- Microorganism protein ---- Translationally-controlled tumor protein homolog
Source.9380: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6
Source.9381: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.9382: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.9383: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.9384: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.9385: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.9386: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.9387: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.9388: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.9389: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.9390: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.9391: DFBPPR15561 ---- Microorganism protein ---- Ribosome biogenesis protein SLX9
Source.9392: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2
Source.9393: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.9394: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein
Source.9395: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.9396: DFBPPR15571 ---- Microorganism protein ---- Mating-type protein ALPHA2
Source.9397: DFBPPR15572 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 2, mitochondrial
Source.9398: DFBPPR15575 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP381
Source.9399: DFBPPR15576 ---- Microorganism protein ---- Cytochrome c oxidase-assembly factor COX23, mitochondrial
Source.9400: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.9401: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.9402: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.9403: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.9404: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.9405: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.9406: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.9407: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.9408: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4
Source.9409: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.9410: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.9411: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial
Source.9412: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.9413: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13
Source.9414: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.9415: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.9416: DFBPPR15614 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX16, mitochondrial
Source.9417: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.9418: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.9419: DFBPPR15620 ---- Microorganism protein ---- Autophagy-related protein 23
Source.9420: DFBPPR15622 ---- Microorganism protein ---- Mitochondrial zinc maintenance protein 1, mitochondrial
Source.9421: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.9422: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.9423: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.9424: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.9425: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.9426: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.9427: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.9428: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1
Source.9429: DFBPPR15634 ---- Microorganism protein ---- Hsp70 nucleotide exchange factor FES1
Source.9430: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.9431: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16
Source.9432: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3
Source.9433: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.9434: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.9435: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.9436: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22
Source.9437: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.9438: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.9439: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.9440: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25
Source.9441: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.9442: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial
Source.9443: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.9444: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.9445: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.9446: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.9447: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.9448: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.9449: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.9450: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.9451: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.9452: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1
Source.9453: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.9454: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45
Source.9455: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.9456: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.9457: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.9458: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.9459: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.9460: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.9461: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.9462: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.9463: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.9464: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1
Source.9465: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.9466: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.9467: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.9468: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.9469: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.9470: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.9471: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19
Source.9472: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.9473: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.9474: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.9475: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.9476: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.9477: DFBPPR15760 ---- Microorganism protein ---- 40S ribosomal protein S16
Source.9478: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.9479: DFBPPR15763 ---- Microorganism protein ---- ATPase expression protein 3
Source.9480: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.9481: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.9482: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.9483: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.9484: DFBPPR15776 ---- Microorganism protein ---- Nonsense-mediated decay protein 4
Source.9485: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.9486: DFBPPR15781 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 5
Source.9487: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1
Source.9488: DFBPPR15785 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 7
Source.9489: DFBPPR15786 ---- Microorganism protein ---- Stationary phase protein 4
Source.9490: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.9491: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.9492: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.9493: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.9494: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase
Source.9495: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.9496: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component
Source.9497: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.9498: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.9499: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.9500: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.9501: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.9502: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD
Source.9503: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.9504: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.9505: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.9506: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.9507: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.9508: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR
Source.9509: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.9510: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.9511: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.9512: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.9513: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.9514: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.9515: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.9516: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.9517: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.9518: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.9519: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.9520: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.9521: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.9522: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.9523: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.9524: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.9525: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.9526: DFBPPR15867 ---- Microorganism protein ---- Superoxide dismutase [Mn], mitochondrial
Source.9527: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase
Source.9528: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.9529: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.9530: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.9531: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.9532: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.9533: DFBPPR15889 ---- Marine protein ---- Ferredoxin
Source.9534: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.9535: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.9536: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.9537: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9538: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.9539: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.9540: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.9541: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.9542: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.9543: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.9544: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9545: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.9546: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.9547: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.9548: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.9549: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.9550: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.9551: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.9552: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.9553: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.9554: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9555: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.9556: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.9557: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.9558: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9559: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.9560: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.9561: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.9562: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.9563: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.9564: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.9565: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.9566: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9567: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9568: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.9569: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.9570: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.9571: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9572: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.9573: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9574: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.9575: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9576: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.9577: DFBPPR7812 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9578: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.9579: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9580: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9581: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9582: DFBPPR7824 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.9583: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.9584: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.9585: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9586: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.9587: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.9588: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.9589: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.9590: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.9591: DFBPPR7843 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9592: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.9593: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.9594: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.9595: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.9596: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9597: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.9598: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.9599: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.9600: DFBPPR7866 ---- Plant protein ---- Photosystem II reaction center protein K
Source.9601: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.9602: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3
Source.9603: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1
Source.9604: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.9605: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.9606: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.9607: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2
Source.9608: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.9609: DFBPPR7897 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic
Source.9610: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.9611: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.9612: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.9613: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1
Source.9614: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.9615: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.9616: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.9617: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.9618: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.9619: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2
Source.9620: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.9621: DFBPPR7926 ---- Plant protein ---- Kafirin PSK8
Source.9622: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.9623: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.9624: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.9625: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.9626: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.9627: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.9628: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.9629: DFBPPR7939 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase FKBP12
Source.9630: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1
Source.9631: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.9632: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9633: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.9634: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.9635: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.9636: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.9637: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49
Source.9638: DFBPPR7963 ---- Plant protein ---- Leghemoglobin 29
Source.9639: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.9640: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.9641: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.9642: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.9643: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein
Source.9644: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.9645: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.9646: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.9647: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2
Source.9648: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.9649: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9650: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9651: DFBPPR7996 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.9652: DFBPPR8000 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9653: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.9654: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.9655: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.9656: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.9657: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.9658: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.9659: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.9660: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.9661: DFBPPR8033 ---- Plant protein ---- Uricase-2
Source.9662: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.9663: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.9664: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.9665: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.9666: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9667: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.9668: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.9669: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.9670: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.9671: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9672: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.9673: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.9674: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.9675: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.9676: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.9677: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.9678: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9679: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.9680: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.9681: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9682: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.9683: DFBPPR8061 ---- Plant protein ---- Photosystem I iron-sulfur center
Source.9684: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.9685: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A
Source.9686: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9687: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.9688: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9689: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9690: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.9691: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.9692: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.9693: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.9694: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.9695: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.9696: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9697: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.9698: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9699: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.9700: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.9701: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.9702: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.9703: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9704: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.9705: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.9706: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9707: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9708: DFBPPR8107 ---- Plant protein ---- Stress-related protein
Source.9709: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1
Source.9710: DFBPPR8110 ---- Plant protein ---- Leghemoglobin
Source.9711: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.9712: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.9713: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9714: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.9715: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.9716: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8
Source.9717: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.9718: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.9719: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9720: DFBPPR8127 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9721: DFBPPR8128 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.9722: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.9723: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.9724: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.9725: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2
Source.9726: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.9727: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.9728: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.9729: DFBPPR8174 ---- Plant protein ---- 60 kDa cell wall protein
Source.9730: DFBPPR8181 ---- Plant protein ---- 33 kDa cell wall protein
Source.9731: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.9732: DFBPPR8214 ---- Plant protein ---- Cytochrome c
Source.9733: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.9734: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.9735: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.9736: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.9737: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.9738: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.9739: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.9740: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.9741: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.9742: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.9743: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.9744: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.9745: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.9746: DFBPPR8233 ---- Plant protein ---- Photosystem I iron-sulfur center
Source.9747: DFBPPR8235 ---- Plant protein ---- Catalase
Source.9748: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.9749: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.9750: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.9751: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.9752: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3
Source.9753: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.9754: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.9755: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.9756: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.9757: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.9758: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.9759: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.9760: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.9761: DFBPPR8258 ---- Plant protein ---- Ribosomal protein S12, mitochondrial
Source.9762: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.9763: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.9764: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.9765: DFBPPR8267 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.9766: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.9767: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.9768: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.9769: DFBPPR8277 ---- Plant protein ---- Profilin
Source.9770: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase
Source.9771: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.9772: DFBPPR8282 ---- Plant protein ---- Isocitrate lyase
Source.9773: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.9774: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.9775: DFBPPR8292 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic
Source.9776: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.9777: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.9778: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Source.9779: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.9780: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.9781: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.9782: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.9783: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.9784: DFBPPR8337 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic
Source.9785: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3
Source.9786: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein
Source.9787: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Source.9788: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Source.9789: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 3563, 7866, 8765
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214