E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0234(Multifunctional peptide)
DFBP ID DFBPMUFU0234
Peptide sequence IAE
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 3
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1177 Pearl oyster (Pinctada fucata martensii) Pearl oyster powder hydrolysates

N.D

DFBPACEI1183 Short-necked clam (Tapes philippinarum) Short-necked clam powder hydrolysates

N.D

DFBPACEI1516 Spirulina platensis Spirulina platensis powder hydrolysates

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0842 Pearl oyster (Pinctada fucata martensii) Pearl oyster powder hydrolysates

N.D

DFBPANHY0448 Spirulina platensis Spirulina platensis powder hydrolysates

N.D

DFBPANHY0848 Short-necked clam (Tapes philippinarum) Short-necked clam powder hydrolysates

N.D

Antioxidative peptides
DFBPID Organism Precursor protein Residue position
DFBPANOX0890 Bovine whey protein β-Lactoglobulin

N.D

Physical & computational properties
Three-letter amino acid Ile-Ala-Glu
Single-letter amino acid IAE
Peptide length 3
Theoretical mass 331.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
GRAVY 0.9333
Hydrophilic residue ratio 66.67%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.2: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.3: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.4: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.5: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.6: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.7: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.8: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.9: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.10: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.11: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.12: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.13: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.14: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.15: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.16: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.17: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.18: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.19: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.20: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.21: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.22: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.23: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.24: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.25: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.26: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.27: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.28: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.29: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.30: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.31: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13
Source.32: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.33: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.34: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.35: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.36: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.37: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.38: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.39: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.40: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.41: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.42: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.43: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.44: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.45: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.46: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.47: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.48: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.49: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.50: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.51: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.52: DFBPPR1301 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.53: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.54: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.55: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.56: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.57: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.58: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.59: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.60: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.61: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.62: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.63: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.64: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.65: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.66: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.67: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.68: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.69: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.70: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.71: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.72: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.73: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1
Source.74: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.75: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.76: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.77: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.78: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.79: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.80: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.81: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.82: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F
Source.83: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.84: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.85: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.86: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.87: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.88: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.89: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.90: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.91: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.92: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.93: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.94: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.95: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.96: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.97: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.98: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog
Source.99: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.100: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.101: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1
Source.102: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.103: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.104: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.105: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.106: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.107: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.108: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.109: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.110: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.111: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.112: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.113: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.114: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.115: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.116: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.117: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.118: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.119: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.120: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.121: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.122: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.123: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.124: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.125: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.126: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.127: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.128: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.129: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.130: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.131: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.132: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.133: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.134: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.135: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.136: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.137: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.138: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.139: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.140: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.141: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.142: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.143: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.144: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.145: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.146: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.147: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.148: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.149: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.150: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.151: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.152: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.153: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.154: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.155: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.156: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.157: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.158: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.159: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.160: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.161: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.162: DFBPPR2245 ---- Plant proteins ---- Expansin-A26
Source.163: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.164: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.165: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.166: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.167: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.168: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.169: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.170: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.171: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.172: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.173: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.174: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.175: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.176: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.177: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.178: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.179: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.180: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.181: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.182: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.183: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.184: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.185: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.186: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.187: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.188: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.189: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.190: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.191: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.192: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.193: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.194: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.195: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.196: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.197: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.198: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.199: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.200: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.201: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.202: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.203: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.204: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.205: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.206: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.207: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.208: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.209: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.210: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.211: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.212: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.213: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.214: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.215: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.216: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.217: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic
Source.218: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.219: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.220: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.221: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.222: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.223: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.224: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.225: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.226: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.227: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.228: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.229: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.230: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.231: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2
Source.232: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.233: DFBPPR2818 ---- Plant proteins ---- Replication protein A 14 kDa subunit
Source.234: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.235: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.236: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.237: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.238: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.239: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.240: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.241: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.242: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.243: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.244: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.245: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.246: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.247: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.248: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.249: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.250: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.251: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.252: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.253: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.254: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.255: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.256: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.257: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.258: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.259: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.260: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.261: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.262: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.263: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.264: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.265: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.266: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.267: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.268: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1
Source.269: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.270: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.271: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.272: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.273: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.274: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.275: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.276: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.277: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.278: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.279: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.280: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.281: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.282: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.283: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4
Source.284: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.285: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.286: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.287: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.288: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.289: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.290: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.291: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.292: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.293: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.294: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.295: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.296: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.297: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.298: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.299: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.300: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9
Source.301: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.302: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.303: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.304: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.305: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.306: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.307: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.308: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.309: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.310: DFBPPR3397 ---- Plant proteins ---- Probable membrane-associated 30 kDa protein, chloroplastic
Source.311: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.312: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.313: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.314: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.315: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.316: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.317: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.318: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.319: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.320: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.321: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.322: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.323: DFBPPR3525 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.324: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.325: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.326: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.327: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.328: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.329: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.330: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.331: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.332: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.333: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.334: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.335: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.336: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.337: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.338: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.339: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.340: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.341: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.342: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.343: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.344: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.345: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.346: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.347: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.348: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.349: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.350: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.351: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.352: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1
Source.353: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.354: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.355: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.356: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.357: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.358: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.359: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.360: DFBPPR3882 ---- Plant proteins ---- Squamosa promoter-binding-like protein 7
Source.361: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.362: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.363: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.364: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.365: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.366: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.367: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.368: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.369: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.370: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.371: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.372: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.373: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.374: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.375: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.376: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.377: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.378: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.379: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.380: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.381: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.382: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.383: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.384: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.385: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.386: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.387: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.388: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.389: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.390: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.391: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.392: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial
Source.393: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.394: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.395: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.396: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.397: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.398: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.399: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.400: DFBPPR4320 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.401: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.402: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.403: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.404: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.405: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.406: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.407: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.408: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.409: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.410: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.411: DFBPPR4634 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 9
Source.412: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.413: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.414: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.415: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.416: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.417: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.418: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.419: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.420: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.421: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.422: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.423: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.424: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.425: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.426: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.427: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.428: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.429: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.430: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.431: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.432: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.433: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.434: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.435: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.436: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.437: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.438: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.439: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.440: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.441: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.442: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.443: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.444: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.445: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.446: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.447: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A
Source.448: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.449: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.450: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.451: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.452: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.453: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.454: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.455: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.456: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.457: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.458: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.459: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.460: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.461: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.462: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.463: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.464: DFBPPR5187 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.465: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.466: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.467: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.468: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.469: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.470: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.471: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.472: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B
Source.473: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.474: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2
Source.475: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.476: DFBPPR5276 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.477: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.478: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.479: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.480: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.481: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.482: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.483: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.484: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.485: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.486: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.487: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.488: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.489: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.490: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.491: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.492: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1
Source.493: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.494: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.495: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.496: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.497: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.498: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.499: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.500: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.501: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.502: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.503: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.504: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.505: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.506: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.507: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.508: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.509: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.510: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.511: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.512: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.513: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.514: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.515: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.516: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.517: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.518: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.519: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.520: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.521: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.522: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.523: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.524: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.525: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.526: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.527: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.528: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.529: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.530: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.531: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.532: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.533: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.534: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.535: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.536: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.537: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.538: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.539: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.540: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.541: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.542: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.543: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.544: DFBPPR5944 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.545: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.546: DFBPPR5954 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.547: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.548: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.549: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.550: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.551: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.552: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.553: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.554: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.555: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.556: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.557: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.558: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.559: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.560: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.561: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.562: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.563: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.564: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.565: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.566: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.567: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.568: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.569: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.570: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.571: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.572: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.573: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.574: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.575: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.576: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.577: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.578: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.579: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.580: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.581: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.582: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.583: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.584: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.585: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.586: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.587: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.588: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.589: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.590: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.591: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.592: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.593: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.594: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.595: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.596: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.597: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.598: DFBPPR6483 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.599: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.600: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.601: DFBPPR6494 ---- Plant proteins ---- 50S ribosomal protein L1, chloroplastic
Source.602: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.603: DFBPPR6520 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.604: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.605: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.606: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.607: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.608: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.609: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.610: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.611: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.612: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.613: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.614: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.615: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.616: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.617: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.618: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.619: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.620: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.621: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.622: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.623: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.624: DFBPPR6783 ---- Plant proteins ---- Thioredoxin H-type
Source.625: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.626: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.627: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.628: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.629: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.630: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.631: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.632: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.633: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.634: DFBPPR6958 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.635: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.636: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.637: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase
Source.638: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.639: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.640: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.641: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.642: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.643: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.644: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.645: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.646: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.647: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.648: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.649: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.650: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.651: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.652: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.653: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.654: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.655: DFBPPR7327 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.656: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A
Source.657: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.658: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.659: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.660: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.661: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.662: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.663: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.664: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.665: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.666: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.667: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.668: DFBPPR7499 ---- Plant proteins ---- Ferredoxin
Source.669: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.670: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.671: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.672: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.673: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.674: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.675: DFBPPR7663 ---- Milk proteins ---- Kappa-casein
Source.676: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.677: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.678: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.679: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.680: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.681: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase
Source.682: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.683: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.684: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.685: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.686: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.687: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.688: DFBPPR8468 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.689: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.690: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.691: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.692: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.693: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.694: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.695: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.696: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.697: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.698: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.699: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.700: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.701: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.702: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.703: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.704: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.705: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.706: DFBPPR16037 ---- Animal proteins ---- Caveolin-1
Source.707: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.708: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.709: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.710: DFBPPR16072 ---- Animal proteins ---- Clusterin
Source.711: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.712: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.713: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.714: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.715: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.716: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.717: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.718: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.719: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.720: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.721: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.722: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.723: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.724: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.725: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.726: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.727: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.728: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.729: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.730: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.731: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.732: DFBPPR16474 ---- Animal proteins ---- Pinin
Source.733: DFBPPR16492 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.734: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.735: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.736: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.737: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.738: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.739: DFBPPR16580 ---- Animal proteins ---- Fibrinogen alpha chain
Source.740: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.741: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.742: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.743: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.744: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.745: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.746: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.747: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.748: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.749: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.750: DFBPPR16823 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.751: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.752: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.753: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.754: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.755: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.756: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.757: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.758: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.759: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.760: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.761: DFBPPR16927 ---- Animal proteins ---- Caveolin-1
Source.762: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.763: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.764: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.765: DFBPPR16955 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.766: DFBPPR16984 ---- Animal proteins ---- Caveolin-2
Source.767: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.768: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.769: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.770: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.771: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.772: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.773: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.774: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.775: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.776: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.777: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.778: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.779: DFBPPR17128 ---- Animal proteins ---- Intraflagellar transport protein 20 homolog
Source.780: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.781: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.782: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.783: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.784: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.785: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.786: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.787: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.788: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.789: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.790: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.791: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.792: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.793: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.794: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.795: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.796: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.797: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.798: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.799: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.800: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.801: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.802: DFBPPR17433 ---- Animal proteins ---- Caveolin-3
Source.803: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.804: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.805: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.806: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.807: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.808: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.809: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.810: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.811: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.812: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.813: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.814: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.815: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.816: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.817: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.818: DFBPPR17612 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.819: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.820: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.821: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.822: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.823: DFBPPR17750 ---- Animal proteins ---- N-alpha-acetyltransferase 10
Source.824: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.825: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.826: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.827: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.828: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.829: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.830: DFBPPR17823 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 1
Source.831: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.832: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.833: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.834: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.835: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.836: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.837: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.838: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.839: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.840: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.841: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.842: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.843: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.844: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.845: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.846: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.847: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.848: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.849: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.850: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.851: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.852: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase
Source.853: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.854: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.855: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.856: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.857: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.858: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.859: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1
Source.860: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.861: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta
Source.862: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta
Source.863: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.864: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.865: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.866: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.867: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.868: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.869: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.870: DFBPPR18139 ---- Animal proteins ---- Polyglutamine-binding protein 1
Source.871: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.872: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.873: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.874: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.875: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.876: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.877: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.878: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.879: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.880: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.881: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.882: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.883: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.884: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.885: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.886: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.887: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.888: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial
Source.889: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.890: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.891: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.892: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.893: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.894: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.895: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.896: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6
Source.897: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.898: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.899: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.900: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.901: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.902: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.903: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.904: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.905: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.906: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.907: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.908: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.909: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.910: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.911: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.912: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.913: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.914: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.915: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.916: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.917: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.918: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.919: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor
Source.920: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.921: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.922: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.923: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase
Source.924: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.925: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.926: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.927: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1
Source.928: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.929: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.930: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.931: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.932: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.933: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.934: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.935: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.936: DFBPPR19055 ---- Animal proteins ---- Complement factor D
Source.937: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.938: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.939: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1
Source.940: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.941: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.942: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.943: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.944: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain
Source.945: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.946: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.947: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.948: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein
Source.949: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.950: DFBPPR19206 ---- Animal proteins ---- Protein chibby homolog 1
Source.951: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2
Source.952: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.953: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.954: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.955: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.956: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.957: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.958: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.959: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.960: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.961: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.962: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.963: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.964: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.965: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.966: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.967: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.968: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.969: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.970: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.971: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.972: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.973: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.974: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.975: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.976: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.977: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.978: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.979: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.980: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.981: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.982: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.983: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.984: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.985: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.986: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.987: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.988: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.989: DFBPPR19728 ---- Animal proteins ---- THO complex subunit 7 homolog
Source.990: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.991: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.992: DFBPPR19734 ---- Animal proteins ---- CDC42 small effector protein 2
Source.993: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.994: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.995: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.996: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.997: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.998: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.999: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.1000: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.1001: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.1002: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1003: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.1004: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8
Source.1005: DFBPPR19888 ---- Animal proteins ---- Splicing factor 3B subunit 5
Source.1006: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30
Source.1007: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.1008: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.1009: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.1010: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1011: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1
Source.1012: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.1013: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma
Source.1014: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1015: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.1016: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.1017: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.1018: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.1019: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.1020: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.1021: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.1022: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.1023: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1024: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.1025: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.1026: DFBPPR20144 ---- Animal proteins ---- Destrin
Source.1027: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.1028: DFBPPR20154 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 6, mitochondrial
Source.1029: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.1030: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.1031: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.1032: DFBPPR20175 ---- Animal proteins ---- Selenoprotein K
Source.1033: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1034: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.1035: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.1036: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1037: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.1038: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.1039: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.1040: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.1041: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.1042: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.1043: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial
Source.1044: DFBPPR20342 ---- Animal proteins ---- Nucleosome assembly protein 1-like 4
Source.1045: DFBPPR20348 ---- Animal proteins ---- V-type proton ATPase subunit F
Source.1046: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.1047: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.1048: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.1049: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.1050: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1051: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.1052: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.1053: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.1054: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.1055: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.1056: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.1057: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.1058: DFBPPR20481 ---- Animal proteins ---- Ropporin-1
Source.1059: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.1060: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.1061: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.1062: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.1063: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.1064: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.1065: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.1066: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.1067: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.1068: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.1069: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.1070: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.1071: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.1072: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.1073: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1074: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.1075: DFBPPR20640 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 8
Source.1076: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1077: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.1078: DFBPPR20683 ---- Animal proteins ---- Kinetochore protein Spc25
Source.1079: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.1080: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1081: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.1082: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.1083: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.1084: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4
Source.1085: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1086: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.1087: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.1088: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.1089: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1090: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1091: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.1092: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor
Source.1093: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1094: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.1095: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.1096: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.1097: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.1098: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B
Source.1099: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.1100: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.1101: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.1102: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.1103: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.1104: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H
Source.1105: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.1106: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6
Source.1107: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.1108: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.1109: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.1110: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.1111: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.1112: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.1113: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.1114: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.1115: DFBPPR21320 ---- Animal proteins ---- Sjoegren syndrome nuclear autoantigen 1 homolog
Source.1116: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.1117: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.1118: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4
Source.1119: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.1120: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.1121: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.1122: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.1123: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.1124: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.1125: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.1126: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1
Source.1127: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.1128: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.1129: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.1130: DFBPPR21578 ---- Animal proteins ---- Calcium-binding protein 5
Source.1131: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.1132: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.1133: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6
Source.1134: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.1135: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.1136: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.1137: DFBPPR21701 ---- Animal proteins ---- Prefoldin subunit 1
Source.1138: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1139: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.1140: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.1141: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta
Source.1142: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.1143: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.1144: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.1145: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.1146: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.1147: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.1148: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.1149: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.1150: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.1151: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.1152: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11
Source.1153: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1154: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.1155: DFBPPR21948 ---- Animal proteins ---- Selenoprotein F
Source.1156: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.1157: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.1158: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1159: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.1160: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.1161: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.1162: DFBPPR22036 ---- Animal proteins ---- Anaphase-promoting complex subunit 15
Source.1163: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.1164: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.1165: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.1166: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.1167: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog
Source.1168: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.1169: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106
Source.1170: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1171: DFBPPR22188 ---- Animal proteins ---- ER membrane protein complex subunit 8
Source.1172: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.1173: DFBPPR22310 ---- Animal proteins ---- B-cell CLL/lymphoma 7 protein family member B
Source.1174: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.1175: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.1176: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.1177: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.1178: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.1179: DFBPPR22446 ---- Animal proteins ---- Tektin-5
Source.1180: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.1181: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.1182: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.1183: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.1184: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.1185: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.1186: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.1187: DFBPPR22555 ---- Animal proteins ---- Bcl-2-like protein 15
Source.1188: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B
Source.1189: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.1190: DFBPPR22655 ---- Animal proteins ---- Coiled-coil domain-containing protein 190
Source.1191: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.1192: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.1193: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.1194: DFBPPR22740 ---- Animal proteins ---- Glutamate-rich protein 2
Source.1195: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.1196: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.1197: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.1198: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.1199: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.1200: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1201: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.1202: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.1203: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.1204: DFBPPR8593 ---- Animal proteins ---- Caveolin-1
Source.1205: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.1206: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1207: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1208: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1209: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.1210: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.1211: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.1212: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1213: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1214: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.1215: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1216: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.1217: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1218: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.1219: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1220: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.1221: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.1222: DFBPPR8758 ---- Animal proteins ---- Caveolin-2
Source.1223: DFBPPR8759 ---- Animal proteins ---- Caveolin-3
Source.1224: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.1225: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1226: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.1227: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.1228: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.1229: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.1230: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.1231: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.1232: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.1233: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6
Source.1234: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.1235: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.1236: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.1237: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1238: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.1239: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1240: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.1241: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.1242: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1243: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1244: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.1245: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.1246: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.1247: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.1248: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.1249: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.1250: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.1251: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.1252: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.1253: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1254: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.1255: DFBPPR9123 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.1256: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1257: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1258: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.1259: DFBPPR9192 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.1260: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.1261: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.1262: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.1263: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.1264: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.1265: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.1266: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.1267: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.1268: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1269: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.1270: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.1271: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.1272: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.1273: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1274: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1275: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.1276: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.1277: DFBPPR9485 ---- Animal proteins ---- Destrin
Source.1278: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor
Source.1279: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.1280: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.1281: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1
Source.1282: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1283: DFBPPR9593 ---- Animal proteins ---- Selenoprotein K
Source.1284: DFBPPR9711 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B
Source.1285: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.1286: DFBPPR9722 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.1287: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.1288: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.1289: DFBPPR9843 ---- Animal proteins ---- P protein
Source.1290: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.1291: DFBPPR9878 ---- Animal proteins ---- Selenoprotein F
Source.1292: DFBPPR9879 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1293: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1294: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1295: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1296: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.1297: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.1298: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.1299: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.1300: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.1301: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1302: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.1303: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1304: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.1305: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.1306: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.1307: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1308: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1309: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.1310: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.1311: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.1312: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.1313: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.1314: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.1315: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.1316: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.1317: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.1318: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.1319: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.1320: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1321: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1322: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.1323: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.1324: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.1325: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1326: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.1327: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.1328: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.1329: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.1330: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.1331: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.1332: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.1333: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1334: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.1335: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.1336: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1337: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1338: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.1339: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.1340: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.1341: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3
Source.1342: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.1343: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.1344: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.1345: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.1346: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.1347: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.1348: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.1349: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1350: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1351: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.1352: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1353: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.1354: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1355: DFBPPR10424 ---- Animal proteins ---- Charged multivesicular body protein 4b
Source.1356: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.1357: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.1358: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.1359: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.1360: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.1361: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.1362: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1363: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.1364: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.1365: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.1366: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1367: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.1368: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.1369: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1370: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.1371: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1
Source.1372: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.1373: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1374: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1375: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1376: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.1377: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.1378: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.1379: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1380: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6
Source.1381: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.1382: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1383: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.1384: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.1385: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1386: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.1387: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1388: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1389: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.1390: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1391: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.1392: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.1393: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1394: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.1395: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.1396: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1397: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1398: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.1399: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.1400: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1401: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1402: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1403: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.1404: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1405: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.1406: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.1407: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.1408: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.1409: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.1410: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.1411: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.1412: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.1413: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.1414: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1415: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.1416: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.1417: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.1418: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.1419: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1420: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.1421: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1422: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.1423: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.1424: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.1425: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.1426: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1427: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1428: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain
Source.1429: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.1430: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.1431: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1432: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.1433: DFBPPR11043 ---- Animal proteins ---- Centromere protein H
Source.1434: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1435: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.1436: DFBPPR11076 ---- Animal proteins ---- Myoglobin
Source.1437: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1438: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.1439: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.1440: DFBPPR11113 ---- Animal proteins ---- POU domain, class 4, transcription factor 1
Source.1441: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.1442: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.1443: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1444: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3
Source.1445: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.1446: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.1447: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1448: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.1449: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.1450: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.1451: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.1452: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1453: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1454: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1455: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.1456: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.1457: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1458: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1459: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1460: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.1461: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.1462: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.1463: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.1464: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.1465: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.1466: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.1467: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.1468: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.1469: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.1470: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.1471: DFBPPR11403 ---- Animal proteins ---- Destrin
Source.1472: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.1473: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.1474: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.1475: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.1476: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.1477: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.1478: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.1479: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1
Source.1480: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1481: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.1482: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.1483: DFBPPR11581 ---- Animal proteins ---- PRKR-interacting protein 1 homolog
Source.1484: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.1485: DFBPPR11584 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.1486: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.1487: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.1488: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.1489: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.1490: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.1491: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.1492: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.1493: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta
Source.1494: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1495: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.1496: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.1497: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.1498: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.1499: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.1500: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.1501: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.1502: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.1503: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.1504: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.1505: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.1506: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.1507: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.1508: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.1509: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.1510: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.1511: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.1512: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.1513: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1514: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.1515: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.1516: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.1517: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.1518: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.1519: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.1520: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.1521: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4
Source.1522: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.1523: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma
Source.1524: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.1525: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.1526: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.1527: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.1528: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.1529: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.1530: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.1531: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1532: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.1533: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.1534: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1535: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.1536: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1537: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1538: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.1539: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1540: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1541: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1542: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.1543: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.1544: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.1545: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.1546: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.1547: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.1548: DFBPPR12391 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1
Source.1549: DFBPPR12397 ---- Animal proteins ---- Caveolin-1
Source.1550: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.1551: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.1552: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1553: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.1554: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.1555: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.1556: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.1557: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1558: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1559: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1560: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.1561: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.1562: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.1563: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1564: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.1565: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.1566: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.1567: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.1568: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.1569: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.1570: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.1571: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.1572: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.1573: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.1574: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.1575: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.1576: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.1577: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.1578: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.1579: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.1580: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1581: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.1582: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1583: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain
Source.1584: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.1585: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.1586: DFBPPR12915 ---- Animal proteins ---- Small proline-rich protein 3
Source.1587: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.1588: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.1589: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.1590: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.1591: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta
Source.1592: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1593: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.1594: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1595: DFBPPR13173 ---- Animal proteins ---- Caveolin-1
Source.1596: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.1597: DFBPPR13197 ---- Animal proteins ---- Caveolin-2
Source.1598: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.1599: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.1600: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1601: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1602: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.1603: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.1604: DFBPPR13306 ---- Animal proteins ---- Tropomyosin alpha-4 chain
Source.1605: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.1606: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.1607: DFBPPR13357 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.1608: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1609: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1610: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.1611: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1612: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.1613: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1614: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.1615: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.1616: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.1617: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.1618: DFBPPR13583 ---- Animal proteins ---- Caveolin-2
Source.1619: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1620: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1621: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.1622: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.1623: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1624: DFBPPR13689 ---- Animal proteins ---- Caveolin-1
Source.1625: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1626: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.1627: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1628: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.1629: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1630: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1631: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.1632: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.1633: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma
Source.1634: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.1635: DFBPPR13871 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.1636: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1637: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1638: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1639: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.1640: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.1641: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.1642: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.1643: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.1644: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.1645: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9
Source.1646: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.1647: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.1648: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.1649: DFBPPR14125 ---- Marine protein ---- Partner of Y14 and mago B
Source.1650: DFBPPR14137 ---- Marine protein ---- Partner of Y14 and mago A
Source.1651: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.1652: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.1653: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.1654: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1655: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.1656: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1657: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.1658: DFBPPR14354 ---- Marine protein ---- Cytochrome c-550
Source.1659: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.1660: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit
Source.1661: DFBPPR14366 ---- Marine protein ---- Thioredoxin
Source.1662: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.1663: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1664: DFBPPR14376 ---- Marine protein ---- ATP synthase subunit b', chloroplastic
Source.1665: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.1666: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.1667: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1668: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.1669: DFBPPR14399 ---- Marine protein ---- Allophycocyanin subunit beta-18
Source.1670: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.1671: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.1672: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.1673: DFBPPR14436 ---- Marine protein ---- 50S ribosomal protein L11, chloroplastic
Source.1674: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic
Source.1675: DFBPPR14484 ---- Marine protein ---- Translation initiation factor IF-3, chloroplastic
Source.1676: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.1677: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.1678: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1679: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9
Source.1680: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.1681: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.1682: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.1683: DFBPPR14695 ---- Marine protein ---- C-type natriuretic peptide 2
Source.1684: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.1685: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.1686: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1
Source.1687: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.1688: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2
Source.1689: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1
Source.1690: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.1691: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.1692: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.1693: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.1694: DFBPPR14775 ---- Marine protein ---- Troponin C
Source.1695: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.1696: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.1697: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.1698: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.1699: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.1700: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A
Source.1701: DFBPPR14847 ---- Marine protein ---- Cuticle protein AMP2
Source.1702: DFBPPR14848 ---- Marine protein ---- Cuticle protein AMP3
Source.1703: DFBPPR14849 ---- Marine protein ---- Cuticle protein AMP4
Source.1704: DFBPPR14850 ---- Marine protein ---- Cuticle protein AMP1B
Source.1705: DFBPPR14851 ---- Marine protein ---- Cuticle protein AMP1A
Source.1706: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.1707: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1708: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.1709: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.1710: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.1711: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.1712: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.1713: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.1714: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.1715: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.1716: DFBPPR14897 ---- Microorganism protein ---- Calmodulin
Source.1717: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.1718: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.1719: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.1720: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.1721: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.1722: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.1723: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.1724: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.1725: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.1726: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.1727: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.1728: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.1729: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.1730: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial
Source.1731: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.1732: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.1733: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.1734: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.1735: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.1736: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.1737: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.1738: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.1739: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.1740: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.1741: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.1742: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2
Source.1743: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.1744: DFBPPR15089 ---- Microorganism protein ---- F-actin-capping protein subunit beta
Source.1745: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.1746: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.1747: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.1748: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.1749: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.1750: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.1751: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.1752: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.1753: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.1754: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.1755: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.1756: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.1757: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.1758: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.1759: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.1760: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.1761: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.1762: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1
Source.1763: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.1764: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.1765: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.1766: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.1767: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.1768: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.1769: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.1770: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.1771: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.1772: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.1773: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.1774: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.1775: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.1776: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.1777: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.1778: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.1779: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.1780: DFBPPR15456 ---- Microorganism protein ---- RNA polymerase II holoenzyme cyclin-like subunit
Source.1781: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.1782: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.1783: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4
Source.1784: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.1785: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.1786: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.1787: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1
Source.1788: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.1789: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.1790: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.1791: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.1792: DFBPPR15547 ---- Microorganism protein ---- SWR1-complex protein 5
Source.1793: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.1794: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.1795: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.1796: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26
Source.1797: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.1798: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.1799: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.1800: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial
Source.1801: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.1802: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.1803: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.1804: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.1805: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.1806: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16
Source.1807: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.1808: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.1809: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.1810: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.1811: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.1812: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial
Source.1813: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.1814: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.1815: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.1816: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.1817: DFBPPR15819 ---- Microorganism protein ---- Phosphocarrier protein HPr
Source.1818: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.1819: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.1820: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.1821: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.1822: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.1823: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.1824: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.1825: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.1826: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.1827: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.1828: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1829: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.1830: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.1831: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.1832: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.1833: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.1834: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.1835: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1836: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1837: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.1838: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.1839: DFBPPR7920 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.1840: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.1841: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.1842: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.1843: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.1844: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.1845: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.1846: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.1847: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.1848: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.1849: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.1850: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.1851: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1
Source.1852: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.1853: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.1854: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.1855: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.1856: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.1857: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.1858: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1859: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.1860: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1861: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.1862: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.1863: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.1864: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.1865: DFBPPR8176 ---- Plant protein ---- 53 kDa cell wall protein
Source.1866: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1867: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1868: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1869: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.1870: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.1871: DFBPPR8307 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.1872: DFBPPR8349 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.1873: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Source.1874: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 7824
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214